summaryrefslogtreecommitdiffstats
path: root/samples/OpenIdRelyingPartyMvc/Content/scripts
diff options
context:
space:
mode:
Diffstat (limited to 'samples/OpenIdRelyingPartyMvc/Content/scripts')
-rw-r--r--samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-1.3.1.js4241
-rw-r--r--samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.js4126
-rw-r--r--samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.min.js184
3 files changed, 8551 insertions, 0 deletions
diff --git a/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-1.3.1.js b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-1.3.1.js
new file mode 100644
index 0000000..3a4badd
--- /dev/null
+++ b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-1.3.1.js
@@ -0,0 +1,4241 @@
+/*!
+ * jQuery JavaScript Library v1.3.1
+ * http://jquery.com/
+ *
+ * Copyright (c) 2009 John Resig
+ * Dual licensed under the MIT and GPL licenses.
+ * http://docs.jquery.com/License
+ *
+ * Date: 2009-01-21 20:42:16 -0500 (Wed, 21 Jan 2009)
+ * Revision: 6158
+ */
+(function(){
+
+var
+ // Will speed up references to window, and allows munging its name.
+ window = this,
+ // Will speed up references to undefined, and allows munging its name.
+ undefined,
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ jQuery = window.jQuery = window.$ = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context );
+ },
+
+ // A simple way to check for HTML strings or ID strings
+ // (both of which we optimize for)
+ quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,
+ // Is it a simple selector
+ isSimple = /^.[^:#\[\.,]*$/;
+
+jQuery.fn = jQuery.prototype = {
+ init: function( selector, context ) {
+ // Make sure that a selection was provided
+ selector = selector || document;
+
+ // Handle $(DOMElement)
+ if ( selector.nodeType ) {
+ this[0] = selector;
+ this.length = 1;
+ this.context = selector;
+ return this;
+ }
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ // Are we dealing with HTML string or an ID?
+ var match = quickExpr.exec( selector );
+
+ // Verify a match, and that no context was specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] )
+ selector = jQuery.clean( [ match[1] ], context );
+
+ // HANDLE: $("#id")
+ else {
+ var elem = document.getElementById( match[3] );
+
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem && elem.id != match[3] )
+ return jQuery().find( selector );
+
+ // Otherwise, we inject the element directly into the jQuery object
+ var ret = jQuery( elem || [] );
+ ret.context = document;
+ ret.selector = selector;
+ return ret;
+ }
+
+ // HANDLE: $(expr, [context])
+ // (which is just equivalent to: $(content).find(expr)
+ } else
+ return jQuery( context ).find( selector );
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) )
+ return jQuery( document ).ready( selector );
+
+ // Make sure that old selector state is passed along
+ if ( selector.selector && selector.context ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return this.setArray(jQuery.makeArray(selector));
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The current version of jQuery being used
+ jquery: "1.3.1",
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num === undefined ?
+
+ // Return a 'clean' array
+ jQuery.makeArray( this ) :
+
+ // Return just the object
+ this[ num ];
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems, name, selector ) {
+ // Build a new jQuery matched element set
+ var ret = jQuery( elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ ret.context = this.context;
+
+ if ( name === "find" )
+ ret.selector = this.selector + (this.selector ? " " : "") + selector;
+ else if ( name )
+ ret.selector = this.selector + "." + name + "(" + selector + ")";
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Force the current matched set of elements to become
+ // the specified array of elements (destroying the stack in the process)
+ // You should use pushStack() in order to do this, but maintain the stack
+ setArray: function( elems ) {
+ // Resetting the length to 0, then using the native Array push
+ // is a super-fast way to populate an object with array-like properties
+ this.length = 0;
+ Array.prototype.push.apply( this, elems );
+
+ return this;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem && elem.jquery ? elem[0] : elem
+ , this );
+ },
+
+ attr: function( name, value, type ) {
+ var options = name;
+
+ // Look for the case where we're accessing a style value
+ if ( typeof name === "string" )
+ if ( value === undefined )
+ return this[0] && jQuery[ type || "attr" ]( this[0], name );
+
+ else {
+ options = {};
+ options[ name ] = value;
+ }
+
+ // Check to see if we're setting style values
+ return this.each(function(i){
+ // Set all the styles
+ for ( name in options )
+ jQuery.attr(
+ type ?
+ this.style :
+ this,
+ name, jQuery.prop( this, options[ name ], type, i, name )
+ );
+ });
+ },
+
+ css: function( key, value ) {
+ // ignore negative width and height values
+ if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 )
+ value = undefined;
+ return this.attr( key, value, "curCSS" );
+ },
+
+ text: function( text ) {
+ if ( typeof text !== "object" && text != null )
+ return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+
+ var ret = "";
+
+ jQuery.each( text || this, function(){
+ jQuery.each( this.childNodes, function(){
+ if ( this.nodeType != 8 )
+ ret += this.nodeType != 1 ?
+ this.nodeValue :
+ jQuery.fn.text( [ this ] );
+ });
+ });
+
+ return ret;
+ },
+
+ wrapAll: function( html ) {
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).clone();
+
+ if ( this[0].parentNode )
+ wrap.insertBefore( this[0] );
+
+ wrap.map(function(){
+ var elem = this;
+
+ while ( elem.firstChild )
+ elem = elem.firstChild;
+
+ return elem;
+ }).append(this);
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ return this.each(function(){
+ jQuery( this ).contents().wrapAll( html );
+ });
+ },
+
+ wrap: function( html ) {
+ return this.each(function(){
+ jQuery( this ).wrapAll( html );
+ });
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function(elem){
+ if (this.nodeType == 1)
+ this.appendChild( elem );
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function(elem){
+ if (this.nodeType == 1)
+ this.insertBefore( elem, this.firstChild );
+ });
+ },
+
+ before: function() {
+ return this.domManip(arguments, false, function(elem){
+ this.parentNode.insertBefore( elem, this );
+ });
+ },
+
+ after: function() {
+ return this.domManip(arguments, false, function(elem){
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ },
+
+ end: function() {
+ return this.prevObject || jQuery( [] );
+ },
+
+ // For internal use only.
+ // Behaves like an Array's .push method, not like a jQuery method.
+ push: [].push,
+
+ find: function( selector ) {
+ if ( this.length === 1 && !/,/.test(selector) ) {
+ var ret = this.pushStack( [], "find", selector );
+ ret.length = 0;
+ jQuery.find( selector, this[0], ret );
+ return ret;
+ } else {
+ var elems = jQuery.map(this, function(elem){
+ return jQuery.find( selector, elem );
+ });
+
+ return this.pushStack( /[^+>] [^+>]/.test( selector ) ?
+ jQuery.unique( elems ) :
+ elems, "find", selector );
+ }
+ },
+
+ clone: function( events ) {
+ // Do the clone
+ var ret = this.map(function(){
+ if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
+ // IE copies events bound via attachEvent when
+ // using cloneNode. Calling detachEvent on the
+ // clone will also remove the events from the orignal
+ // In order to get around this, we use innerHTML.
+ // Unfortunately, this means some modifications to
+ // attributes in IE that are actually only stored
+ // as properties will not be copied (such as the
+ // the name attribute on an input).
+ var clone = this.cloneNode(true),
+ container = document.createElement("div");
+ container.appendChild(clone);
+ return jQuery.clean([container.innerHTML])[0];
+ } else
+ return this.cloneNode(true);
+ });
+
+ // Need to set the expando to null on the cloned set if it exists
+ // removeData doesn't work here, IE removes it from the original as well
+ // this is primarily for IE but the data expando shouldn't be copied over in any browser
+ var clone = ret.find("*").andSelf().each(function(){
+ if ( this[ expando ] !== undefined )
+ this[ expando ] = null;
+ });
+
+ // Copy the events from the original to the clone
+ if ( events === true )
+ this.find("*").andSelf().each(function(i){
+ if (this.nodeType == 3)
+ return;
+ var events = jQuery.data( this, "events" );
+
+ for ( var type in events )
+ for ( var handler in events[ type ] )
+ jQuery.event.add( clone[ i ], type, events[ type ][ handler ], events[ type ][ handler ].data );
+ });
+
+ // Return the cloned set
+ return ret;
+ },
+
+ filter: function( selector ) {
+ return this.pushStack(
+ jQuery.isFunction( selector ) &&
+ jQuery.grep(this, function(elem, i){
+ return selector.call( elem, i );
+ }) ||
+
+ jQuery.multiFilter( selector, jQuery.grep(this, function(elem){
+ return elem.nodeType === 1;
+ }) ), "filter", selector );
+ },
+
+ closest: function( selector ) {
+ var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null;
+
+ return this.map(function(){
+ var cur = this;
+ while ( cur && cur.ownerDocument ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) )
+ return cur;
+ cur = cur.parentNode;
+ }
+ });
+ },
+
+ not: function( selector ) {
+ if ( typeof selector === "string" )
+ // test special case where just one selector is passed in
+ if ( isSimple.test( selector ) )
+ return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector );
+ else
+ selector = jQuery.multiFilter( selector, this );
+
+ var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType;
+ return this.filter(function() {
+ return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector;
+ });
+ },
+
+ add: function( selector ) {
+ return this.pushStack( jQuery.unique( jQuery.merge(
+ this.get(),
+ typeof selector === "string" ?
+ jQuery( selector ) :
+ jQuery.makeArray( selector )
+ )));
+ },
+
+ is: function( selector ) {
+ return !!selector && jQuery.multiFilter( selector, this ).length > 0;
+ },
+
+ hasClass: function( selector ) {
+ return !!selector && this.is( "." + selector );
+ },
+
+ val: function( value ) {
+ if ( value === undefined ) {
+ var elem = this[0];
+
+ if ( elem ) {
+ if( jQuery.nodeName( elem, 'option' ) )
+ return (elem.attributes.value || {}).specified ? elem.value : elem.text;
+
+ // We need to handle select boxes special
+ if ( jQuery.nodeName( elem, "select" ) ) {
+ var index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type == "select-one";
+
+ // Nothing was selected
+ if ( index < 0 )
+ return null;
+
+ // Loop through all the selected options
+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+ var option = options[ i ];
+
+ if ( option.selected ) {
+ // Get the specifc value for the option
+ value = jQuery(option).val();
+
+ // We don't need an array for one selects
+ if ( one )
+ return value;
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ return values;
+ }
+
+ // Everything else, we just grab the value
+ return (elem.value || "").replace(/\r/g, "");
+
+ }
+
+ return undefined;
+ }
+
+ if ( typeof value === "number" )
+ value += '';
+
+ return this.each(function(){
+ if ( this.nodeType != 1 )
+ return;
+
+ if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) )
+ this.checked = (jQuery.inArray(this.value, value) >= 0 ||
+ jQuery.inArray(this.name, value) >= 0);
+
+ else if ( jQuery.nodeName( this, "select" ) ) {
+ var values = jQuery.makeArray(value);
+
+ jQuery( "option", this ).each(function(){
+ this.selected = (jQuery.inArray( this.value, values ) >= 0 ||
+ jQuery.inArray( this.text, values ) >= 0);
+ });
+
+ if ( !values.length )
+ this.selectedIndex = -1;
+
+ } else
+ this.value = value;
+ });
+ },
+
+ html: function( value ) {
+ return value === undefined ?
+ (this[0] ?
+ this[0].innerHTML :
+ null) :
+ this.empty().append( value );
+ },
+
+ replaceWith: function( value ) {
+ return this.after( value ).remove();
+ },
+
+ eq: function( i ) {
+ return this.slice( i, +i + 1 );
+ },
+
+ slice: function() {
+ return this.pushStack( Array.prototype.slice.apply( this, arguments ),
+ "slice", Array.prototype.slice.call(arguments).join(",") );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function(elem, i){
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ andSelf: function() {
+ return this.add( this.prevObject );
+ },
+
+ domManip: function( args, table, callback ) {
+ if ( this[0] ) {
+ var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(),
+ scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ),
+ first = fragment.firstChild,
+ extra = this.length > 1 ? fragment.cloneNode(true) : fragment;
+
+ if ( first )
+ for ( var i = 0, l = this.length; i < l; i++ )
+ callback.call( root(this[i], first), i > 0 ? extra.cloneNode(true) : fragment );
+
+ if ( scripts )
+ jQuery.each( scripts, evalScript );
+ }
+
+ return this;
+
+ function root( elem, cur ) {
+ return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
+ }
+ }
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+function evalScript( i, elem ) {
+ if ( elem.src )
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+
+ else
+ jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+
+ if ( elem.parentNode )
+ elem.parentNode.removeChild( elem );
+}
+
+function now(){
+ return +new Date;
+}
+
+jQuery.extend = jQuery.fn.extend = function() {
+ // copy reference to target object
+ var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) )
+ target = {};
+
+ // extend jQuery itself if only one argument is passed
+ if ( length == i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ )
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null )
+ // Extend the base object
+ for ( var name in options ) {
+ var src = target[ name ], copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy )
+ continue;
+
+ // Recurse if we're merging object values
+ if ( deep && copy && typeof copy === "object" && !copy.nodeType )
+ target[ name ] = jQuery.extend( deep,
+ // Never move original objects, clone them
+ src || ( copy.length != null ? [ ] : { } )
+ , copy );
+
+ // Don't bring in undefined values
+ else if ( copy !== undefined )
+ target[ name ] = copy;
+
+ }
+
+ // Return the modified object
+ return target;
+};
+
+// exclude the following css properties to add px
+var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+ // cache defaultView
+ defaultView = document.defaultView || {},
+ toString = Object.prototype.toString;
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ window.$ = _$;
+
+ if ( deep )
+ window.jQuery = _jQuery;
+
+ return jQuery;
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return toString.call(obj) === "[object Function]";
+ },
+
+ isArray: function( obj ) {
+ return toString.call(obj) === "[object Array]";
+ },
+
+ // check if an element is in a (or is an) XML document
+ isXMLDoc: function( elem ) {
+ return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
+ !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument );
+ },
+
+ // Evalulates a script in a global context
+ globalEval: function( data ) {
+ data = jQuery.trim( data );
+
+ if ( data ) {
+ // Inspired by code by Andrea Giammarchi
+ // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+ var head = document.getElementsByTagName("head")[0] || document.documentElement,
+ script = document.createElement("script");
+
+ script.type = "text/javascript";
+ if ( jQuery.support.scriptEval )
+ script.appendChild( document.createTextNode( data ) );
+ else
+ script.text = data;
+
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709).
+ head.insertBefore( script, head.firstChild );
+ head.removeChild( script );
+ }
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase();
+ },
+
+ // args is for internal usage only
+ each: function( object, callback, args ) {
+ var name, i = 0, length = object.length;
+
+ if ( args ) {
+ if ( length === undefined ) {
+ for ( name in object )
+ if ( callback.apply( object[ name ], args ) === false )
+ break;
+ } else
+ for ( ; i < length; )
+ if ( callback.apply( object[ i++ ], args ) === false )
+ break;
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( length === undefined ) {
+ for ( name in object )
+ if ( callback.call( object[ name ], name, object[ name ] ) === false )
+ break;
+ } else
+ for ( var value = object[0];
+ i < length && callback.call( value, i, value ) !== false; value = object[++i] ){}
+ }
+
+ return object;
+ },
+
+ prop: function( elem, value, type, i, name ) {
+ // Handle executable functions
+ if ( jQuery.isFunction( value ) )
+ value = value.call( elem, i );
+
+ // Handle passing in a number to a CSS property
+ return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ?
+ value + "px" :
+ value;
+ },
+
+ className: {
+ // internal only, use addClass("class")
+ add: function( elem, classNames ) {
+ jQuery.each((classNames || "").split(/\s+/), function(i, className){
+ if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) )
+ elem.className += (elem.className ? " " : "") + className;
+ });
+ },
+
+ // internal only, use removeClass("class")
+ remove: function( elem, classNames ) {
+ if (elem.nodeType == 1)
+ elem.className = classNames !== undefined ?
+ jQuery.grep(elem.className.split(/\s+/), function(className){
+ return !jQuery.className.has( classNames, className );
+ }).join(" ") :
+ "";
+ },
+
+ // internal only, use hasClass("class")
+ has: function( elem, className ) {
+ return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1;
+ }
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( var name in options )
+ elem.style[ name ] = old[ name ];
+ },
+
+ css: function( elem, name, force ) {
+ if ( name == "width" || name == "height" ) {
+ var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ];
+
+ function getWH() {
+ val = name == "width" ? elem.offsetWidth : elem.offsetHeight;
+ var padding = 0, border = 0;
+ jQuery.each( which, function() {
+ padding += parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+ border += parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+ });
+ val -= Math.round(padding + border);
+ }
+
+ if ( jQuery(elem).is(":visible") )
+ getWH();
+ else
+ jQuery.swap( elem, props, getWH );
+
+ return Math.max(0, val);
+ }
+
+ return jQuery.curCSS( elem, name, force );
+ },
+
+ curCSS: function( elem, name, force ) {
+ var ret, style = elem.style;
+
+ // We need to handle opacity special in IE
+ if ( name == "opacity" && !jQuery.support.opacity ) {
+ ret = jQuery.attr( style, "opacity" );
+
+ return ret == "" ?
+ "1" :
+ ret;
+ }
+
+ // Make sure we're using the right name for getting the float value
+ if ( name.match( /float/i ) )
+ name = styleFloat;
+
+ if ( !force && style && style[ name ] )
+ ret = style[ name ];
+
+ else if ( defaultView.getComputedStyle ) {
+
+ // Only "float" is needed here
+ if ( name.match( /float/i ) )
+ name = "float";
+
+ name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase();
+
+ var computedStyle = defaultView.getComputedStyle( elem, null );
+
+ if ( computedStyle )
+ ret = computedStyle.getPropertyValue( name );
+
+ // We should always get a number back from opacity
+ if ( name == "opacity" && ret == "" )
+ ret = "1";
+
+ } else if ( elem.currentStyle ) {
+ var camelCase = name.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+
+ ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) {
+ // Remember the original values
+ var left = style.left, rsLeft = elem.runtimeStyle.left;
+
+ // Put in the new values to get a computed value out
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ style.left = ret || 0;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
+
+ return ret;
+ },
+
+ clean: function( elems, context, fragment ) {
+ context = context || document;
+
+ // !context.createElement fails in IE with an error but returns typeof 'object'
+ if ( typeof context.createElement === "undefined" )
+ context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+
+ // If a single string is passed in and it's a single tag
+ // just do a createElement and skip the rest
+ if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) {
+ var match = /^<(\w+)\s*\/?>$/.exec(elems[0]);
+ if ( match )
+ return [ context.createElement( match[1] ) ];
+ }
+
+ var ret = [], scripts = [], div = context.createElement("div");
+
+ jQuery.each(elems, function(i, elem){
+ if ( typeof elem === "number" )
+ elem += '';
+
+ if ( !elem )
+ return;
+
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" ) {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){
+ return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ?
+ all :
+ front + "></" + tag + ">";
+ });
+
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tags = jQuery.trim( elem ).toLowerCase();
+
+ var wrap =
+ // option or optgroup
+ !tags.indexOf("<opt") &&
+ [ 1, "<select multiple='multiple'>", "</select>" ] ||
+
+ !tags.indexOf("<leg") &&
+ [ 1, "<fieldset>", "</fieldset>" ] ||
+
+ tags.match(/^<(thead|tbody|tfoot|colg|cap)/) &&
+ [ 1, "<table>", "</table>" ] ||
+
+ !tags.indexOf("<tr") &&
+ [ 2, "<table><tbody>", "</tbody></table>" ] ||
+
+ // <thead> matched above
+ (!tags.indexOf("<td") || !tags.indexOf("<th")) &&
+ [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] ||
+
+ !tags.indexOf("<col") &&
+ [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] ||
+
+ // IE can't serialize <link> and <script> tags normally
+ !jQuery.support.htmlSerialize &&
+ [ 1, "div<div>", "</div>" ] ||
+
+ [ 0, "", "" ];
+
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
+
+ // Move to the right depth
+ while ( wrap[0]-- )
+ div = div.lastChild;
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ var tbody = !tags.indexOf("<table") && tags.indexOf("<tbody") < 0 ?
+ div.firstChild && div.firstChild.childNodes :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] == "<table>" && tags.indexOf("<tbody") < 0 ?
+ div.childNodes :
+ [];
+
+ for ( var j = tbody.length - 1; j >= 0 ; --j )
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length )
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+
+ }
+
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) )
+ div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild );
+
+ elem = jQuery.makeArray( div.childNodes );
+ }
+
+ if ( elem.nodeType )
+ ret.push( elem );
+ else
+ ret = jQuery.merge( ret, elem );
+
+ });
+
+ if ( fragment ) {
+ for ( var i = 0; ret[i]; i++ ) {
+ if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+ } else {
+ if ( ret[i].nodeType === 1 )
+ ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+ fragment.appendChild( ret[i] );
+ }
+ }
+
+ return scripts;
+ }
+
+ return ret;
+ },
+
+ attr: function( elem, name, value ) {
+ // don't set attributes on text and comment nodes
+ if (!elem || elem.nodeType == 3 || elem.nodeType == 8)
+ return undefined;
+
+ var notxml = !jQuery.isXMLDoc( elem ),
+ // Whether we are setting (or getting)
+ set = value !== undefined;
+
+ // Try to normalize/fix the name
+ name = notxml && jQuery.props[ name ] || name;
+
+ // Only do all the following if this is a node (faster for style)
+ // IE elem.getAttribute passes even for style
+ if ( elem.tagName ) {
+
+ // These attributes require special treatment
+ var special = /href|src|style/.test( name );
+
+ // Safari mis-reports the default selected property of a hidden option
+ // Accessing the parent's selectedIndex property fixes it
+ if ( name == "selected" && elem.parentNode )
+ elem.parentNode.selectedIndex;
+
+ // If applicable, access the attribute via the DOM 0 way
+ if ( name in elem && notxml && !special ) {
+ if ( set ){
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode )
+ throw "type property can't be changed";
+
+ elem[ name ] = value;
+ }
+
+ // browsers index elements by id/name on forms, give priority to attributes.
+ if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) )
+ return elem.getAttributeNode( name ).nodeValue;
+
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ if ( name == "tabIndex" ) {
+ var attributeNode = elem.getAttributeNode( "tabIndex" );
+ return attributeNode && attributeNode.specified
+ ? attributeNode.value
+ : elem.nodeName.match(/(button|input|object|select|textarea)/i)
+ ? 0
+ : elem.nodeName.match(/^(a|area)$/i) && elem.href
+ ? 0
+ : undefined;
+ }
+
+ return elem[ name ];
+ }
+
+ if ( !jQuery.support.style && notxml && name == "style" )
+ return jQuery.attr( elem.style, "cssText", value );
+
+ if ( set )
+ // convert the value to a string (all browsers do this but IE) see #1070
+ elem.setAttribute( name, "" + value );
+
+ var attr = !jQuery.support.hrefNormalized && notxml && special
+ // Some attributes require a special call on IE
+ ? elem.getAttribute( name, 2 )
+ : elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return attr === null ? undefined : attr;
+ }
+
+ // elem is actually elem.style ... set the style
+
+ // IE uses filters for opacity
+ if ( !jQuery.support.opacity && name == "opacity" ) {
+ if ( set ) {
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ elem.zoom = 1;
+
+ // Set the alpha filter to set the opacity
+ elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) +
+ (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")");
+ }
+
+ return elem.filter && elem.filter.indexOf("opacity=") >= 0 ?
+ (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '':
+ "";
+ }
+
+ name = name.replace(/-([a-z])/ig, function(all, letter){
+ return letter.toUpperCase();
+ });
+
+ if ( set )
+ elem[ name ] = value;
+
+ return elem[ name ];
+ },
+
+ trim: function( text ) {
+ return (text || "").replace( /^\s+|\s+$/g, "" );
+ },
+
+ makeArray: function( array ) {
+ var ret = [];
+
+ if( array != null ){
+ var i = array.length;
+ // The window, strings (and functions) also have 'length'
+ if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval )
+ ret[0] = array;
+ else
+ while( i )
+ ret[--i] = array[i];
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, array ) {
+ for ( var i = 0, length = array.length; i < length; i++ )
+ // Use === because on IE, window == document
+ if ( array[ i ] === elem )
+ return i;
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ // We have to loop this way because IE & Opera overwrite the length
+ // expando of getElementsByTagName
+ var i = 0, elem, pos = first.length;
+ // Also, we need to make sure that the correct elements are being returned
+ // (IE returns comment nodes in a '*' query)
+ if ( !jQuery.support.getAll ) {
+ while ( (elem = second[ i++ ]) != null )
+ if ( elem.nodeType != 8 )
+ first[ pos++ ] = elem;
+
+ } else
+ while ( (elem = second[ i++ ]) != null )
+ first[ pos++ ] = elem;
+
+ return first;
+ },
+
+ unique: function( array ) {
+ var ret = [], done = {};
+
+ try {
+
+ for ( var i = 0, length = array.length; i < length; i++ ) {
+ var id = jQuery.data( array[ i ] );
+
+ if ( !done[ id ] ) {
+ done[ id ] = true;
+ ret.push( array[ i ] );
+ }
+ }
+
+ } catch( e ) {
+ ret = array;
+ }
+
+ return ret;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var ret = [];
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( var i = 0, length = elems.length; i < length; i++ )
+ if ( !inv != !callback( elems[ i ], i ) )
+ ret.push( elems[ i ] );
+
+ return ret;
+ },
+
+ map: function( elems, callback ) {
+ var ret = [];
+
+ // Go through the array, translating each of the items to their
+ // new value (or values).
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ var value = callback( elems[ i ], i );
+
+ if ( value != null )
+ ret[ ret.length ] = value;
+ }
+
+ return ret.concat.apply( [], ret );
+ }
+});
+
+// Use of jQuery.browser is deprecated.
+// It's included for backwards compatibility and plugins,
+// although they should work to migrate away.
+
+var userAgent = navigator.userAgent.toLowerCase();
+
+// Figure out what browser is being used
+jQuery.browser = {
+ version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1],
+ safari: /webkit/.test( userAgent ),
+ opera: /opera/.test( userAgent ),
+ msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ),
+ mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent )
+};
+
+jQuery.each({
+ parent: function(elem){return elem.parentNode;},
+ parents: function(elem){return jQuery.dir(elem,"parentNode");},
+ next: function(elem){return jQuery.nth(elem,2,"nextSibling");},
+ prev: function(elem){return jQuery.nth(elem,2,"previousSibling");},
+ nextAll: function(elem){return jQuery.dir(elem,"nextSibling");},
+ prevAll: function(elem){return jQuery.dir(elem,"previousSibling");},
+ siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);},
+ children: function(elem){return jQuery.sibling(elem.firstChild);},
+ contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);}
+}, function(name, fn){
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = jQuery.map( this, fn );
+
+ if ( selector && typeof selector == "string" )
+ ret = jQuery.multiFilter( selector, ret );
+
+ return this.pushStack( jQuery.unique( ret ), name, selector );
+ };
+});
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function(name, original){
+ jQuery.fn[ name ] = function() {
+ var args = arguments;
+
+ return this.each(function(){
+ for ( var i = 0, length = args.length; i < length; i++ )
+ jQuery( args[ i ] )[ original ]( this );
+ });
+ };
+});
+
+jQuery.each({
+ removeAttr: function( name ) {
+ jQuery.attr( this, name, "" );
+ if (this.nodeType == 1)
+ this.removeAttribute( name );
+ },
+
+ addClass: function( classNames ) {
+ jQuery.className.add( this, classNames );
+ },
+
+ removeClass: function( classNames ) {
+ jQuery.className.remove( this, classNames );
+ },
+
+ toggleClass: function( classNames, state ) {
+ if( typeof state !== "boolean" )
+ state = !jQuery.className.has( this, classNames );
+ jQuery.className[ state ? "add" : "remove" ]( this, classNames );
+ },
+
+ remove: function( selector ) {
+ if ( !selector || jQuery.filter( selector, [ this ] ).length ) {
+ // Prevent memory leaks
+ jQuery( "*", this ).add([this]).each(function(){
+ jQuery.event.remove(this);
+ jQuery.removeData(this);
+ });
+ if (this.parentNode)
+ this.parentNode.removeChild( this );
+ }
+ },
+
+ empty: function() {
+ // Remove element nodes and prevent memory leaks
+ jQuery( ">*", this ).remove();
+
+ // Remove any remaining nodes
+ while ( this.firstChild )
+ this.removeChild( this.firstChild );
+ }
+}, function(name, fn){
+ jQuery.fn[ name ] = function(){
+ return this.each( fn, arguments );
+ };
+});
+
+// Helper function used by the dimensions and offset modules
+function num(elem, prop) {
+ return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0;
+}
+var expando = "jQuery" + now(), uuid = 0, windowData = {};
+
+jQuery.extend({
+ cache: {},
+
+ data: function( elem, name, data ) {
+ elem = elem == window ?
+ windowData :
+ elem;
+
+ var id = elem[ expando ];
+
+ // Compute a unique ID for the element
+ if ( !id )
+ id = elem[ expando ] = ++uuid;
+
+ // Only generate the data cache if we're
+ // trying to access or manipulate it
+ if ( name && !jQuery.cache[ id ] )
+ jQuery.cache[ id ] = {};
+
+ // Prevent overriding the named cache with undefined values
+ if ( data !== undefined )
+ jQuery.cache[ id ][ name ] = data;
+
+ // Return the named cache data, or the ID for the element
+ return name ?
+ jQuery.cache[ id ][ name ] :
+ id;
+ },
+
+ removeData: function( elem, name ) {
+ elem = elem == window ?
+ windowData :
+ elem;
+
+ var id = elem[ expando ];
+
+ // If we want to remove a specific section of the element's data
+ if ( name ) {
+ if ( jQuery.cache[ id ] ) {
+ // Remove the section of cache data
+ delete jQuery.cache[ id ][ name ];
+
+ // If we've removed all the data, remove the element's cache
+ name = "";
+
+ for ( name in jQuery.cache[ id ] )
+ break;
+
+ if ( !name )
+ jQuery.removeData( elem );
+ }
+
+ // Otherwise, we want to remove all of the element's data
+ } else {
+ // Clean up the element expando
+ try {
+ delete elem[ expando ];
+ } catch(e){
+ // IE has trouble directly removing the expando
+ // but it's ok with using removeAttribute
+ if ( elem.removeAttribute )
+ elem.removeAttribute( expando );
+ }
+
+ // Completely remove the data cache
+ delete jQuery.cache[ id ];
+ }
+ },
+ queue: function( elem, type, data ) {
+ if ( elem ){
+
+ type = (type || "fx") + "queue";
+
+ var q = jQuery.data( elem, type );
+
+ if ( !q || jQuery.isArray(data) )
+ q = jQuery.data( elem, type, jQuery.makeArray(data) );
+ else if( data )
+ q.push( data );
+
+ }
+ return q;
+ },
+
+ dequeue: function( elem, type ){
+ var queue = jQuery.queue( elem, type ),
+ fn = queue.shift();
+
+ if( !type || type === "fx" )
+ fn = queue[0];
+
+ if( fn !== undefined )
+ fn.call(elem);
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ){
+ var parts = key.split(".");
+ parts[1] = parts[1] ? "." + parts[1] : "";
+
+ if ( value === undefined ) {
+ var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+ if ( data === undefined && this.length )
+ data = jQuery.data( this[0], key );
+
+ return data === undefined && parts[1] ?
+ this.data( parts[0] ) :
+ data;
+ } else
+ return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){
+ jQuery.data( this, key, value );
+ });
+ },
+
+ removeData: function( key ){
+ return this.each(function(){
+ jQuery.removeData( this, key );
+ });
+ },
+ queue: function(type, data){
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ }
+
+ if ( data === undefined )
+ return jQuery.queue( this[0], type );
+
+ return this.each(function(){
+ var queue = jQuery.queue( this, type, data );
+
+ if( type == "fx" && queue.length == 1 )
+ queue[0].call(this);
+ });
+ },
+ dequeue: function(type){
+ return this.each(function(){
+ jQuery.dequeue( this, type );
+ });
+ }
+});/*!
+ * Sizzle CSS Selector Engine - v0.9.3
+ * Copyright 2009, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]+['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[]+)+|[>+~])(\s*,\s*)?/g,
+ done = 0,
+ toString = Object.prototype.toString;
+
+var Sizzle = function(selector, context, results, seed) {
+ results = results || [];
+ context = context || document;
+
+ if ( context.nodeType !== 1 && context.nodeType !== 9 )
+ return [];
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ var parts = [], m, set, checkSet, check, mode, extra, prune = true;
+
+ // Reset the position of the chunker regexp (start from head)
+ chunker.lastIndex = 0;
+
+ while ( (m = chunker.exec(selector)) !== null ) {
+ parts.push( m[1] );
+
+ if ( m[2] ) {
+ extra = RegExp.rightContext;
+ break;
+ }
+ }
+
+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+ set = posProcess( parts[0] + parts[1], context );
+ } else {
+ set = Expr.relative[ parts[0] ] ?
+ [ context ] :
+ Sizzle( parts.shift(), context );
+
+ while ( parts.length ) {
+ selector = parts.shift();
+
+ if ( Expr.relative[ selector ] )
+ selector += parts.shift();
+
+ set = posProcess( selector, set );
+ }
+ }
+ } else {
+ var ret = seed ?
+ { expr: parts.pop(), set: makeArray(seed) } :
+ Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) );
+ set = Sizzle.filter( ret.expr, ret.set );
+
+ if ( parts.length > 0 ) {
+ checkSet = makeArray(set);
+ } else {
+ prune = false;
+ }
+
+ while ( parts.length ) {
+ var cur = parts.pop(), pop = cur;
+
+ if ( !Expr.relative[ cur ] ) {
+ cur = "";
+ } else {
+ pop = parts.pop();
+ }
+
+ if ( pop == null ) {
+ pop = context;
+ }
+
+ Expr.relative[ cur ]( checkSet, pop, isXML(context) );
+ }
+ }
+
+ if ( !checkSet ) {
+ checkSet = set;
+ }
+
+ if ( !checkSet ) {
+ throw "Syntax error, unrecognized expression: " + (cur || selector);
+ }
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+ } else if ( context.nodeType === 1 ) {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+ results.push( set[i] );
+ }
+ }
+ } else {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] );
+ }
+ }
+ }
+ } else {
+ makeArray( checkSet, results );
+ }
+
+ if ( extra ) {
+ Sizzle( extra, context, results, seed );
+ }
+
+ return results;
+};
+
+Sizzle.matches = function(expr, set){
+ return Sizzle(expr, null, null, set);
+};
+
+Sizzle.find = function(expr, context, isXML){
+ var set, match;
+
+ if ( !expr ) {
+ return [];
+ }
+
+ for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+ var type = Expr.order[i], match;
+
+ if ( (match = Expr.match[ type ].exec( expr )) ) {
+ var left = RegExp.leftContext;
+
+ if ( left.substr( left.length - 1 ) !== "\\" ) {
+ match[1] = (match[1] || "").replace(/\\/g, "");
+ set = Expr.find[ type ]( match, context, isXML );
+ if ( set != null ) {
+ expr = expr.replace( Expr.match[ type ], "" );
+ break;
+ }
+ }
+ }
+ }
+
+ if ( !set ) {
+ set = context.getElementsByTagName("*");
+ }
+
+ return {set: set, expr: expr};
+};
+
+Sizzle.filter = function(expr, set, inplace, not){
+ var old = expr, result = [], curLoop = set, match, anyFound;
+
+ while ( expr && set.length ) {
+ for ( var type in Expr.filter ) {
+ if ( (match = Expr.match[ type ].exec( expr )) != null ) {
+ var filter = Expr.filter[ type ], found, item;
+ anyFound = false;
+
+ if ( curLoop == result ) {
+ result = [];
+ }
+
+ if ( Expr.preFilter[ type ] ) {
+ match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not );
+
+ if ( !match ) {
+ anyFound = found = true;
+ } else if ( match === true ) {
+ continue;
+ }
+ }
+
+ if ( match ) {
+ for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+ if ( item ) {
+ found = filter( item, match, i, curLoop );
+ var pass = not ^ !!found;
+
+ if ( inplace && found != null ) {
+ if ( pass ) {
+ anyFound = true;
+ } else {
+ curLoop[i] = false;
+ }
+ } else if ( pass ) {
+ result.push( item );
+ anyFound = true;
+ }
+ }
+ }
+ }
+
+ if ( found !== undefined ) {
+ if ( !inplace ) {
+ curLoop = result;
+ }
+
+ expr = expr.replace( Expr.match[ type ], "" );
+
+ if ( !anyFound ) {
+ return [];
+ }
+
+ break;
+ }
+ }
+ }
+
+ expr = expr.replace(/\s*,\s*/, "");
+
+ // Improper expression
+ if ( expr == old ) {
+ if ( anyFound == null ) {
+ throw "Syntax error, unrecognized expression: " + expr;
+ } else {
+ break;
+ }
+ }
+
+ old = expr;
+ }
+
+ return curLoop;
+};
+
+var Expr = Sizzle.selectors = {
+ order: [ "ID", "NAME", "TAG" ],
+ match: {
+ ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,
+ CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
+ POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/
+ },
+ attrMap: {
+ "class": "className",
+ "for": "htmlFor"
+ },
+ attrHandle: {
+ href: function(elem){
+ return elem.getAttribute("href");
+ }
+ },
+ relative: {
+ "+": function(checkSet, part){
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ var cur = elem.previousSibling;
+ while ( cur && cur.nodeType !== 1 ) {
+ cur = cur.previousSibling;
+ }
+ checkSet[i] = typeof part === "string" ?
+ cur || false :
+ cur === part;
+ }
+ }
+
+ if ( typeof part === "string" ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ },
+ ">": function(checkSet, part, isXML){
+ if ( typeof part === "string" && !/\W/.test(part) ) {
+ part = isXML ? part : part.toUpperCase();
+
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ var parent = elem.parentNode;
+ checkSet[i] = parent.nodeName === part ? parent : false;
+ }
+ }
+ } else {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ checkSet[i] = typeof part === "string" ?
+ elem.parentNode :
+ elem.parentNode === part;
+ }
+ }
+
+ if ( typeof part === "string" ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ }
+ },
+ "": function(checkSet, part, isXML){
+ var doneName = "done" + (done++), checkFn = dirCheck;
+
+ if ( !part.match(/\W/) ) {
+ var nodeCheck = part = isXML ? part : part.toUpperCase();
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+ },
+ "~": function(checkSet, part, isXML){
+ var doneName = "done" + (done++), checkFn = dirCheck;
+
+ if ( typeof part === "string" && !part.match(/\W/) ) {
+ var nodeCheck = part = isXML ? part : part.toUpperCase();
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+ }
+ },
+ find: {
+ ID: function(match, context, isXML){
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ return m ? [m] : [];
+ }
+ },
+ NAME: function(match, context, isXML){
+ if ( typeof context.getElementsByName !== "undefined" && !isXML ) {
+ return context.getElementsByName(match[1]);
+ }
+ },
+ TAG: function(match, context){
+ return context.getElementsByTagName(match[1]);
+ }
+ },
+ preFilter: {
+ CLASS: function(match, curLoop, inplace, result, not){
+ match = " " + match[1].replace(/\\/g, "") + " ";
+
+ var elem;
+ for ( var i = 0; (elem = curLoop[i]) != null; i++ ) {
+ if ( elem ) {
+ if ( not ^ (" " + elem.className + " ").indexOf(match) >= 0 ) {
+ if ( !inplace )
+ result.push( elem );
+ } else if ( inplace ) {
+ curLoop[i] = false;
+ }
+ }
+ }
+
+ return false;
+ },
+ ID: function(match){
+ return match[1].replace(/\\/g, "");
+ },
+ TAG: function(match, curLoop){
+ for ( var i = 0; curLoop[i] === false; i++ ){}
+ return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase();
+ },
+ CHILD: function(match){
+ if ( match[1] == "nth" ) {
+ // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+ var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+ match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" ||
+ !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+ // calculate the numbers (first)n+(last) including if they are negative
+ match[2] = (test[1] + (test[2] || 1)) - 0;
+ match[3] = test[3] - 0;
+ }
+
+ // TODO: Move to normal caching system
+ match[0] = "done" + (done++);
+
+ return match;
+ },
+ ATTR: function(match){
+ var name = match[1].replace(/\\/g, "");
+
+ if ( Expr.attrMap[name] ) {
+ match[1] = Expr.attrMap[name];
+ }
+
+ if ( match[2] === "~=" ) {
+ match[4] = " " + match[4] + " ";
+ }
+
+ return match;
+ },
+ PSEUDO: function(match, curLoop, inplace, result, not){
+ if ( match[1] === "not" ) {
+ // If we're dealing with a complex expression, or a simple one
+ if ( match[3].match(chunker).length > 1 ) {
+ match[3] = Sizzle(match[3], null, null, curLoop);
+ } else {
+ var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+ if ( !inplace ) {
+ result.push.apply( result, ret );
+ }
+ return false;
+ }
+ } else if ( Expr.match.POS.test( match[0] ) ) {
+ return true;
+ }
+
+ return match;
+ },
+ POS: function(match){
+ match.unshift( true );
+ return match;
+ }
+ },
+ filters: {
+ enabled: function(elem){
+ return elem.disabled === false && elem.type !== "hidden";
+ },
+ disabled: function(elem){
+ return elem.disabled === true;
+ },
+ checked: function(elem){
+ return elem.checked === true;
+ },
+ selected: function(elem){
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ elem.parentNode.selectedIndex;
+ return elem.selected === true;
+ },
+ parent: function(elem){
+ return !!elem.firstChild;
+ },
+ empty: function(elem){
+ return !elem.firstChild;
+ },
+ has: function(elem, i, match){
+ return !!Sizzle( match[3], elem ).length;
+ },
+ header: function(elem){
+ return /h\d/i.test( elem.nodeName );
+ },
+ text: function(elem){
+ return "text" === elem.type;
+ },
+ radio: function(elem){
+ return "radio" === elem.type;
+ },
+ checkbox: function(elem){
+ return "checkbox" === elem.type;
+ },
+ file: function(elem){
+ return "file" === elem.type;
+ },
+ password: function(elem){
+ return "password" === elem.type;
+ },
+ submit: function(elem){
+ return "submit" === elem.type;
+ },
+ image: function(elem){
+ return "image" === elem.type;
+ },
+ reset: function(elem){
+ return "reset" === elem.type;
+ },
+ button: function(elem){
+ return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON";
+ },
+ input: function(elem){
+ return /input|select|textarea|button/i.test(elem.nodeName);
+ }
+ },
+ setFilters: {
+ first: function(elem, i){
+ return i === 0;
+ },
+ last: function(elem, i, match, array){
+ return i === array.length - 1;
+ },
+ even: function(elem, i){
+ return i % 2 === 0;
+ },
+ odd: function(elem, i){
+ return i % 2 === 1;
+ },
+ lt: function(elem, i, match){
+ return i < match[3] - 0;
+ },
+ gt: function(elem, i, match){
+ return i > match[3] - 0;
+ },
+ nth: function(elem, i, match){
+ return match[3] - 0 == i;
+ },
+ eq: function(elem, i, match){
+ return match[3] - 0 == i;
+ }
+ },
+ filter: {
+ CHILD: function(elem, match){
+ var type = match[1], parent = elem.parentNode;
+
+ var doneName = match[0];
+
+ if ( parent && (!parent[ doneName ] || !elem.nodeIndex) ) {
+ var count = 1;
+
+ for ( var node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType == 1 ) {
+ node.nodeIndex = count++;
+ }
+ }
+
+ parent[ doneName ] = count - 1;
+ }
+
+ if ( type == "first" ) {
+ return elem.nodeIndex == 1;
+ } else if ( type == "last" ) {
+ return elem.nodeIndex == parent[ doneName ];
+ } else if ( type == "only" ) {
+ return parent[ doneName ] == 1;
+ } else if ( type == "nth" ) {
+ var add = false, first = match[2], last = match[3];
+
+ if ( first == 1 && last == 0 ) {
+ return true;
+ }
+
+ if ( first == 0 ) {
+ if ( elem.nodeIndex == last ) {
+ add = true;
+ }
+ } else if ( (elem.nodeIndex - last) % first == 0 && (elem.nodeIndex - last) / first >= 0 ) {
+ add = true;
+ }
+
+ return add;
+ }
+ },
+ PSEUDO: function(elem, match, i, array){
+ var name = match[1], filter = Expr.filters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ } else if ( name === "contains" ) {
+ return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0;
+ } else if ( name === "not" ) {
+ var not = match[3];
+
+ for ( var i = 0, l = not.length; i < l; i++ ) {
+ if ( not[i] === elem ) {
+ return false;
+ }
+ }
+
+ return true;
+ }
+ },
+ ID: function(elem, match){
+ return elem.nodeType === 1 && elem.getAttribute("id") === match;
+ },
+ TAG: function(elem, match){
+ return (match === "*" && elem.nodeType === 1) || elem.nodeName === match;
+ },
+ CLASS: function(elem, match){
+ return match.test( elem.className );
+ },
+ ATTR: function(elem, match){
+ var result = Expr.attrHandle[ match[1] ] ? Expr.attrHandle[ match[1] ]( elem ) : elem[ match[1] ] || elem.getAttribute( match[1] ), value = result + "", type = match[2], check = match[4];
+ return result == null ?
+ type === "!=" :
+ type === "=" ?
+ value === check :
+ type === "*=" ?
+ value.indexOf(check) >= 0 :
+ type === "~=" ?
+ (" " + value + " ").indexOf(check) >= 0 :
+ !match[4] ?
+ result :
+ type === "!=" ?
+ value != check :
+ type === "^=" ?
+ value.indexOf(check) === 0 :
+ type === "$=" ?
+ value.substr(value.length - check.length) === check :
+ type === "|=" ?
+ value === check || value.substr(0, check.length + 1) === check + "-" :
+ false;
+ },
+ POS: function(elem, match, i, array){
+ var name = match[2], filter = Expr.setFilters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ }
+ }
+ }
+};
+
+var origPOS = Expr.match.POS;
+
+for ( var type in Expr.match ) {
+ Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+}
+
+var makeArray = function(array, results) {
+ array = Array.prototype.slice.call( array );
+
+ if ( results ) {
+ results.push.apply( results, array );
+ return results;
+ }
+
+ return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+try {
+ Array.prototype.slice.call( document.documentElement.childNodes );
+
+// Provide a fallback method if it does not work
+} catch(e){
+ makeArray = function(array, results) {
+ var ret = results || [];
+
+ if ( toString.call(array) === "[object Array]" ) {
+ Array.prototype.push.apply( ret, array );
+ } else {
+ if ( typeof array.length === "number" ) {
+ for ( var i = 0, l = array.length; i < l; i++ ) {
+ ret.push( array[i] );
+ }
+ } else {
+ for ( var i = 0; array[i]; i++ ) {
+ ret.push( array[i] );
+ }
+ }
+ }
+
+ return ret;
+ };
+}
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+ // We're going to inject a fake input element with a specified name
+ var form = document.createElement("form"),
+ id = "script" + (new Date).getTime();
+ form.innerHTML = "<input name='" + id + "'/>";
+
+ // Inject it into the root element, check its status, and remove it quickly
+ var root = document.documentElement;
+ root.insertBefore( form, root.firstChild );
+
+ // The workaround has to do additional checks after a getElementById
+ // Which slows things down for other browsers (hence the branching)
+ if ( !!document.getElementById( id ) ) {
+ Expr.find.ID = function(match, context, isXML){
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+ }
+ };
+
+ Expr.filter.ID = function(elem, match){
+ var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+ return elem.nodeType === 1 && node && node.nodeValue === match;
+ };
+ }
+
+ root.removeChild( form );
+})();
+
+(function(){
+ // Check to see if the browser returns only elements
+ // when doing getElementsByTagName("*")
+
+ // Create a fake element
+ var div = document.createElement("div");
+ div.appendChild( document.createComment("") );
+
+ // Make sure no comments are found
+ if ( div.getElementsByTagName("*").length > 0 ) {
+ Expr.find.TAG = function(match, context){
+ var results = context.getElementsByTagName(match[1]);
+
+ // Filter out possible comments
+ if ( match[1] === "*" ) {
+ var tmp = [];
+
+ for ( var i = 0; results[i]; i++ ) {
+ if ( results[i].nodeType === 1 ) {
+ tmp.push( results[i] );
+ }
+ }
+
+ results = tmp;
+ }
+
+ return results;
+ };
+ }
+
+ // Check to see if an attribute returns normalized href attributes
+ div.innerHTML = "<a href='#'></a>";
+ if ( div.firstChild && div.firstChild.getAttribute("href") !== "#" ) {
+ Expr.attrHandle.href = function(elem){
+ return elem.getAttribute("href", 2);
+ };
+ }
+})();
+
+if ( document.querySelectorAll ) (function(){
+ var oldSizzle = Sizzle, div = document.createElement("div");
+ div.innerHTML = "<p class='TEST'></p>";
+
+ // Safari can't handle uppercase or unicode characters when
+ // in quirks mode.
+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+ return;
+ }
+
+ Sizzle = function(query, context, extra, seed){
+ context = context || document;
+
+ // Only use querySelectorAll on non-XML documents
+ // (ID selectors don't work in non-HTML documents)
+ if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(e){}
+ }
+
+ return oldSizzle(query, context, extra, seed);
+ };
+
+ Sizzle.find = oldSizzle.find;
+ Sizzle.filter = oldSizzle.filter;
+ Sizzle.selectors = oldSizzle.selectors;
+ Sizzle.matches = oldSizzle.matches;
+})();
+
+if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) {
+ Expr.order.splice(1, 0, "CLASS");
+ Expr.find.CLASS = function(match, context) {
+ return context.getElementsByClassName(match[1]);
+ };
+}
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ elem = elem[dir];
+ var match = false;
+
+ while ( elem && elem.nodeType ) {
+ var done = elem[doneName];
+ if ( done ) {
+ match = checkSet[ done ];
+ break;
+ }
+
+ if ( elem.nodeType === 1 && !isXML )
+ elem[doneName] = i;
+
+ if ( elem.nodeName === cur ) {
+ match = elem;
+ break;
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ elem = elem[dir];
+ var match = false;
+
+ while ( elem && elem.nodeType ) {
+ if ( elem[doneName] ) {
+ match = checkSet[ elem[doneName] ];
+ break;
+ }
+
+ if ( elem.nodeType === 1 ) {
+ if ( !isXML )
+ elem[doneName] = i;
+
+ if ( typeof cur !== "string" ) {
+ if ( elem === cur ) {
+ match = true;
+ break;
+ }
+
+ } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+ match = elem;
+ break;
+ }
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+var contains = document.compareDocumentPosition ? function(a, b){
+ return a.compareDocumentPosition(b) & 16;
+} : function(a, b){
+ return a !== b && (a.contains ? a.contains(b) : true);
+};
+
+var isXML = function(elem){
+ return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
+ !!elem.ownerDocument && isXML( elem.ownerDocument );
+};
+
+var posProcess = function(selector, context){
+ var tmpSet = [], later = "", match,
+ root = context.nodeType ? [context] : context;
+
+ // Position selectors must be done after the filter
+ // And so must :not(positional) so we move all PSEUDOs to the end
+ while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+ later += match[0];
+ selector = selector.replace( Expr.match.PSEUDO, "" );
+ }
+
+ selector = Expr.relative[selector] ? selector + "*" : selector;
+
+ for ( var i = 0, l = root.length; i < l; i++ ) {
+ Sizzle( selector, root[i], tmpSet );
+ }
+
+ return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.filter = Sizzle.filter;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+
+Sizzle.selectors.filters.hidden = function(elem){
+ return "hidden" === elem.type ||
+ jQuery.css(elem, "display") === "none" ||
+ jQuery.css(elem, "visibility") === "hidden";
+};
+
+Sizzle.selectors.filters.visible = function(elem){
+ return "hidden" !== elem.type &&
+ jQuery.css(elem, "display") !== "none" &&
+ jQuery.css(elem, "visibility") !== "hidden";
+};
+
+Sizzle.selectors.filters.animated = function(elem){
+ return jQuery.grep(jQuery.timers, function(fn){
+ return elem === fn.elem;
+ }).length;
+};
+
+jQuery.multiFilter = function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return Sizzle.matches(expr, elems);
+};
+
+jQuery.dir = function( elem, dir ){
+ var matched = [], cur = elem[dir];
+ while ( cur && cur != document ) {
+ if ( cur.nodeType == 1 )
+ matched.push( cur );
+ cur = cur[dir];
+ }
+ return matched;
+};
+
+jQuery.nth = function(cur, result, dir, elem){
+ result = result || 1;
+ var num = 0;
+
+ for ( ; cur; cur = cur[dir] )
+ if ( cur.nodeType == 1 && ++num == result )
+ break;
+
+ return cur;
+};
+
+jQuery.sibling = function(n, elem){
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType == 1 && n != elem )
+ r.push( n );
+ }
+
+ return r;
+};
+
+return;
+
+window.Sizzle = Sizzle;
+
+})();
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+ // Bind an event to an element
+ // Original by Dean Edwards
+ add: function(elem, types, handler, data) {
+ if ( elem.nodeType == 3 || elem.nodeType == 8 )
+ return;
+
+ // For whatever reason, IE has trouble passing the window object
+ // around, causing it to be cloned in the process
+ if ( elem.setInterval && elem != window )
+ elem = window;
+
+ // Make sure that the function being executed has a unique ID
+ if ( !handler.guid )
+ handler.guid = this.guid++;
+
+ // if data is passed, bind to handler
+ if ( data !== undefined ) {
+ // Create temporary function pointer to original handler
+ var fn = handler;
+
+ // Create unique handler function, wrapped around original handler
+ handler = this.proxy( fn );
+
+ // Store data in unique handler
+ handler.data = data;
+ }
+
+ // Init the element's event structure
+ var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}),
+ handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){
+ // Handle the second event of a trigger and when
+ // an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+ jQuery.event.handle.apply(arguments.callee.elem, arguments) :
+ undefined;
+ });
+ // Add elem as a property of the handle function
+ // This is to prevent a memory leak with non-native
+ // event in IE.
+ handle.elem = elem;
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ jQuery.each(types.split(/\s+/), function(index, type) {
+ // Namespaced event handlers
+ var namespaces = type.split(".");
+ type = namespaces.shift();
+ handler.type = namespaces.slice().sort().join(".");
+
+ // Get the current list of functions bound to this event
+ var handlers = events[type];
+
+ if ( jQuery.event.specialAll[type] )
+ jQuery.event.specialAll[type].setup.call(elem, data, namespaces);
+
+ // Init the event handler queue
+ if (!handlers) {
+ handlers = events[type] = {};
+
+ // Check for a special event handler
+ // Only use addEventListener/attachEvent if the special
+ // events handler returns false
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) {
+ // Bind the global event handler to the element
+ if (elem.addEventListener)
+ elem.addEventListener(type, handle, false);
+ else if (elem.attachEvent)
+ elem.attachEvent("on" + type, handle);
+ }
+ }
+
+ // Add the function to the element's handler list
+ handlers[handler.guid] = handler;
+
+ // Keep track of which events have been used, for global triggering
+ jQuery.event.global[type] = true;
+ });
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ guid: 1,
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function(elem, types, handler) {
+ // don't do events on text and comment nodes
+ if ( elem.nodeType == 3 || elem.nodeType == 8 )
+ return;
+
+ var events = jQuery.data(elem, "events"), ret, index;
+
+ if ( events ) {
+ // Unbind all events for the element
+ if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") )
+ for ( var type in events )
+ this.remove( elem, type + (types || "") );
+ else {
+ // types is actually an event object here
+ if ( types.type ) {
+ handler = types.handler;
+ types = types.type;
+ }
+
+ // Handle multiple events seperated by a space
+ // jQuery(...).unbind("mouseover mouseout", fn);
+ jQuery.each(types.split(/\s+/), function(index, type){
+ // Namespaced event handlers
+ var namespaces = type.split(".");
+ type = namespaces.shift();
+ var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
+
+ if ( events[type] ) {
+ // remove the given handler for the given type
+ if ( handler )
+ delete events[type][handler.guid];
+
+ // remove all handlers for the given type
+ else
+ for ( var handle in events[type] )
+ // Handle the removal of namespaced events
+ if ( namespace.test(events[type][handle].type) )
+ delete events[type][handle];
+
+ if ( jQuery.event.specialAll[type] )
+ jQuery.event.specialAll[type].teardown.call(elem, namespaces);
+
+ // remove generic event handler if no more handlers exist
+ for ( ret in events[type] ) break;
+ if ( !ret ) {
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) {
+ if (elem.removeEventListener)
+ elem.removeEventListener(type, jQuery.data(elem, "handle"), false);
+ else if (elem.detachEvent)
+ elem.detachEvent("on" + type, jQuery.data(elem, "handle"));
+ }
+ ret = null;
+ delete events[type];
+ }
+ }
+ });
+ }
+
+ // Remove the expando if it's no longer used
+ for ( ret in events ) break;
+ if ( !ret ) {
+ var handle = jQuery.data( elem, "handle" );
+ if ( handle ) handle.elem = null;
+ jQuery.removeData( elem, "events" );
+ jQuery.removeData( elem, "handle" );
+ }
+ }
+ },
+
+ // bubbling is internal
+ trigger: function( event, data, elem, bubbling ) {
+ // Event object or event type
+ var type = event.type || event;
+
+ if( !bubbling ){
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[expando] ? event :
+ // Object literal
+ jQuery.extend( jQuery.Event(type), event ) :
+ // Just the event type (string)
+ jQuery.Event(type);
+
+ if ( type.indexOf("!") >= 0 ) {
+ event.type = type = type.slice(0, -1);
+ event.exclusive = true;
+ }
+
+ // Handle a global trigger
+ if ( !elem ) {
+ // Don't bubble custom events when global (to avoid too much overhead)
+ event.stopPropagation();
+ // Only trigger if we've ever bound an event for it
+ if ( this.global[type] )
+ jQuery.each( jQuery.cache, function(){
+ if ( this.events && this.events[type] )
+ jQuery.event.trigger( event, data, this.handle.elem );
+ });
+ }
+
+ // Handle triggering a single element
+
+ // don't do events on text and comment nodes
+ if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 )
+ return undefined;
+
+ // Clean up in case it is reused
+ event.result = undefined;
+ event.target = elem;
+
+ // Clone the incoming data, if any
+ data = jQuery.makeArray(data);
+ data.unshift( event );
+ }
+
+ event.currentTarget = elem;
+
+ // Trigger the event, it is assumed that "handle" is a function
+ var handle = jQuery.data(elem, "handle");
+ if ( handle )
+ handle.apply( elem, data );
+
+ // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links)
+ if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false )
+ event.result = false;
+
+ // Trigger the native events (except for clicks on links)
+ if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) {
+ this.triggered = true;
+ try {
+ elem[ type ]();
+ // prevent IE from throwing an error for some hidden elements
+ } catch (e) {}
+ }
+
+ this.triggered = false;
+
+ if ( !event.isPropagationStopped() ) {
+ var parent = elem.parentNode || elem.ownerDocument;
+ if ( parent )
+ jQuery.event.trigger(event, data, parent, true);
+ }
+ },
+
+ handle: function(event) {
+ // returned undefined or false
+ var all, handlers;
+
+ event = arguments[0] = jQuery.event.fix( event || window.event );
+
+ // Namespaced event handlers
+ var namespaces = event.type.split(".");
+ event.type = namespaces.shift();
+
+ // Cache this now, all = true means, any handler
+ all = !namespaces.length && !event.exclusive;
+
+ var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
+
+ handlers = ( jQuery.data(this, "events") || {} )[event.type];
+
+ for ( var j in handlers ) {
+ var handler = handlers[j];
+
+ // Filter the functions by class
+ if ( all || namespace.test(handler.type) ) {
+ // Pass in a reference to the handler function itself
+ // So that we can later remove it
+ event.handler = handler;
+ event.data = handler.data;
+
+ var ret = handler.apply(this, arguments);
+
+ if( ret !== undefined ){
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+
+ if( event.isImmediatePropagationStopped() )
+ break;
+
+ }
+ }
+ },
+
+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+ fix: function(event) {
+ if ( event[expando] )
+ return event;
+
+ // store a copy of the original event object
+ // and "clone" to set read-only properties
+ var originalEvent = event;
+ event = jQuery.Event( originalEvent );
+
+ for ( var i = this.props.length, prop; i; ){
+ prop = this.props[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary
+ if ( !event.target )
+ event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+
+ // check if target is a textnode (safari)
+ if ( event.target.nodeType == 3 )
+ event.target = event.target.parentNode;
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && event.fromElement )
+ event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && event.clientX != null ) {
+ var doc = document.documentElement, body = document.body;
+ event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0);
+ event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0);
+ }
+
+ // Add which for key events
+ if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) )
+ event.which = event.charCode || event.keyCode;
+
+ // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+ if ( !event.metaKey && event.ctrlKey )
+ event.metaKey = event.ctrlKey;
+
+ // Add which for click: 1 == left; 2 == middle; 3 == right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && event.button )
+ event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+
+ return event;
+ },
+
+ proxy: function( fn, proxy ){
+ proxy = proxy || function(){ return fn.apply(this, arguments); };
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++;
+ // So proxy can be declared as an argument
+ return proxy;
+ },
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: bindReady,
+ teardown: function() {}
+ }
+ },
+
+ specialAll: {
+ live: {
+ setup: function( selector, namespaces ){
+ jQuery.event.add( this, namespaces[0], liveHandler );
+ },
+ teardown: function( namespaces ){
+ if ( namespaces.length ) {
+ var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)");
+
+ jQuery.each( (jQuery.data(this, "events").live || {}), function(){
+ if ( name.test(this.type) )
+ remove++;
+ });
+
+ if ( remove < 1 )
+ jQuery.event.remove( this, namespaces[0], liveHandler );
+ }
+ }
+ }
+ }
+};
+
+jQuery.Event = function( src ){
+ // Allow instantiation without the 'new' keyword
+ if( !this.preventDefault )
+ return new jQuery.Event(src);
+
+ // Event object
+ if( src && src.type ){
+ this.originalEvent = src;
+ this.type = src.type;
+ // Event type
+ }else
+ this.type = src;
+
+ // timeStamp is buggy for some events on Firefox(#3843)
+ // So we won't rely on the native value
+ this.timeStamp = now();
+
+ // Mark it as fixed
+ this[expando] = true;
+};
+
+function returnFalse(){
+ return false;
+}
+function returnTrue(){
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if( !e )
+ return;
+ // if preventDefault exists run it on the original event
+ if (e.preventDefault)
+ e.preventDefault();
+ // otherwise set the returnValue property of the original event to false (IE)
+ e.returnValue = false;
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if( !e )
+ return;
+ // if stopPropagation exists run it on the original event
+ if (e.stopPropagation)
+ e.stopPropagation();
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation:function(){
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function(event) {
+ // Check if mouse(over|out) are still within the same parent element
+ var parent = event.relatedTarget;
+ // Traverse up the tree
+ while ( parent && parent != this )
+ try { parent = parent.parentNode; }
+ catch(e) { parent = this; }
+
+ if( parent != this ){
+ // set the correct event type
+ event.type = event.data;
+ // handle event if we actually just moused on to a non sub-element
+ jQuery.event.handle.apply( this, arguments );
+ }
+};
+
+jQuery.each({
+ mouseover: 'mouseenter',
+ mouseout: 'mouseleave'
+}, function( orig, fix ){
+ jQuery.event.special[ fix ] = {
+ setup: function(){
+ jQuery.event.add( this, orig, withinElement, fix );
+ },
+ teardown: function(){
+ jQuery.event.remove( this, orig, withinElement );
+ }
+ };
+});
+
+jQuery.fn.extend({
+ bind: function( type, data, fn ) {
+ return type == "unload" ? this.one(type, data, fn) : this.each(function(){
+ jQuery.event.add( this, type, fn || data, fn && data );
+ });
+ },
+
+ one: function( type, data, fn ) {
+ var one = jQuery.event.proxy( fn || data, function(event) {
+ jQuery(this).unbind(event, one);
+ return (fn || data).apply( this, arguments );
+ });
+ return this.each(function(){
+ jQuery.event.add( this, type, one, fn && data);
+ });
+ },
+
+ unbind: function( type, fn ) {
+ return this.each(function(){
+ jQuery.event.remove( this, type, fn );
+ });
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function(){
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+
+ triggerHandler: function( type, data ) {
+ if( this[0] ){
+ var event = jQuery.Event(type);
+ event.preventDefault();
+ event.stopPropagation();
+ jQuery.event.trigger( event, data, this[0] );
+ return event.result;
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments, i = 1;
+
+ // link all the functions, so any of them can unbind this click handler
+ while( i < args.length )
+ jQuery.event.proxy( fn, args[i++] );
+
+ return this.click( jQuery.event.proxy( fn, function(event) {
+ // Figure out which function to execute
+ this.lastToggle = ( this.lastToggle || 0 ) % i;
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ this.lastToggle++ ].apply( this, arguments ) || false;
+ }));
+ },
+
+ hover: function(fnOver, fnOut) {
+ return this.mouseenter(fnOver).mouseleave(fnOut);
+ },
+
+ ready: function(fn) {
+ // Attach the listeners
+ bindReady();
+
+ // If the DOM is already ready
+ if ( jQuery.isReady )
+ // Execute the function immediately
+ fn.call( document, jQuery );
+
+ // Otherwise, remember the function for later
+ else
+ // Add the function to the wait list
+ jQuery.readyList.push( fn );
+
+ return this;
+ },
+
+ live: function( type, fn ){
+ var proxy = jQuery.event.proxy( fn );
+ proxy.guid += this.selector + type;
+
+ jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy );
+
+ return this;
+ },
+
+ die: function( type, fn ){
+ jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null );
+ return this;
+ }
+});
+
+function liveHandler( event ){
+ var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"),
+ stop = true,
+ elems = [];
+
+ jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){
+ if ( check.test(fn.type) ) {
+ var elem = jQuery(event.target).closest(fn.data)[0];
+ if ( elem )
+ elems.push({ elem: elem, fn: fn });
+ }
+ });
+
+ jQuery.each(elems, function(){
+ if ( this.fn.call(this.elem, event, this.fn.data) === false )
+ stop = false;
+ });
+
+ return stop;
+}
+
+function liveConvert(type, selector){
+ return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join(".");
+}
+
+jQuery.extend({
+ isReady: false,
+ readyList: [],
+ // Handle when the DOM is ready
+ ready: function() {
+ // Make sure that the DOM is not already loaded
+ if ( !jQuery.isReady ) {
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If there are functions bound, to execute
+ if ( jQuery.readyList ) {
+ // Execute all of them
+ jQuery.each( jQuery.readyList, function(){
+ this.call( document, jQuery );
+ });
+
+ // Reset the list of functions
+ jQuery.readyList = null;
+ }
+
+ // Trigger any bound ready events
+ jQuery(document).triggerHandler("ready");
+ }
+ }
+});
+
+var readyBound = false;
+
+function bindReady(){
+ if ( readyBound ) return;
+ readyBound = true;
+
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", function(){
+ document.removeEventListener( "DOMContentLoaded", arguments.callee, false );
+ jQuery.ready();
+ }, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent("onreadystatechange", function(){
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", arguments.callee );
+ jQuery.ready();
+ }
+ });
+
+ // If IE and not an iframe
+ // continually check to see if the document is ready
+ if ( document.documentElement.doScroll && typeof window.frameElement === "undefined" ) (function(){
+ if ( jQuery.isReady ) return;
+
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch( error ) {
+ setTimeout( arguments.callee, 0 );
+ return;
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+ })();
+ }
+
+ // A fallback to window.onload, that will always work
+ jQuery.event.add( window, "load", jQuery.ready );
+}
+
+jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," +
+ "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," +
+ "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){
+
+ // Handle event binding
+ jQuery.fn[name] = function(fn){
+ return fn ? this.bind(name, fn) : this.trigger(name);
+ };
+});
+
+// Prevent memory leaks in IE
+// And prevent errors on refresh with events like mouseover in other browsers
+// Window isn't included so as not to unbind existing unload events
+jQuery( window ).bind( 'unload', function(){
+ for ( var id in jQuery.cache )
+ // Skip the window
+ if ( id != 1 && jQuery.cache[ id ].handle )
+ jQuery.event.remove( jQuery.cache[ id ].handle.elem );
+});
+(function(){
+
+ jQuery.support = {};
+
+ var root = document.documentElement,
+ script = document.createElement("script"),
+ div = document.createElement("div"),
+ id = "script" + (new Date).getTime();
+
+ div.style.display = "none";
+ div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';
+
+ var all = div.getElementsByTagName("*"),
+ a = div.getElementsByTagName("a")[0];
+
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return;
+ }
+
+ jQuery.support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: div.firstChild.nodeType == 3,
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
+
+ // Make sure that you can get all elements in an <object> element
+ // IE 7 always returns no results
+ objectAll: !!div.getElementsByTagName("object")[0]
+ .getElementsByTagName("*").length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText insted)
+ style: /red/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: a.getAttribute("href") === "/a",
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ opacity: a.style.opacity === "0.5",
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Will be defined later
+ scriptEval: false,
+ noCloneEvent: true,
+ boxModel: null
+ };
+
+ script.type = "text/javascript";
+ try {
+ script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+ } catch(e){}
+
+ root.insertBefore( script, root.firstChild );
+
+ // Make sure that the execution of code works by injecting a script
+ // tag with appendChild/createTextNode
+ // (IE doesn't support this, fails, and uses .text instead)
+ if ( window[ id ] ) {
+ jQuery.support.scriptEval = true;
+ delete window[ id ];
+ }
+
+ root.removeChild( script );
+
+ if ( div.attachEvent && div.fireEvent ) {
+ div.attachEvent("onclick", function(){
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ jQuery.support.noCloneEvent = false;
+ div.detachEvent("onclick", arguments.callee);
+ });
+ div.cloneNode(true).fireEvent("onclick");
+ }
+
+ // Figure out if the W3C box model works as expected
+ // document.body must exist before we can do this
+ jQuery(function(){
+ var div = document.createElement("div");
+ div.style.width = "1px";
+ div.style.paddingLeft = "1px";
+
+ document.body.appendChild( div );
+ jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+ document.body.removeChild( div );
+ });
+})();
+
+var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat";
+
+jQuery.props = {
+ "for": "htmlFor",
+ "class": "className",
+ "float": styleFloat,
+ cssFloat: styleFloat,
+ styleFloat: styleFloat,
+ readonly: "readOnly",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ rowspan: "rowSpan",
+ tabindex: "tabIndex"
+};
+jQuery.fn.extend({
+ // Keep a copy of the old load
+ _load: jQuery.fn.load,
+
+ load: function( url, params, callback ) {
+ if ( typeof url !== "string" )
+ return this._load( url );
+
+ var off = url.indexOf(" ");
+ if ( off >= 0 ) {
+ var selector = url.slice(off, url.length);
+ url = url.slice(0, off);
+ }
+
+ // Default to a GET request
+ var type = "GET";
+
+ // If the second parameter was provided
+ if ( params )
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+ // We assume that it's the callback
+ callback = params;
+ params = null;
+
+ // Otherwise, build a param string
+ } else if( typeof params === "object" ) {
+ params = jQuery.param( params );
+ type = "POST";
+ }
+
+ var self = this;
+
+ // Request the remote document
+ jQuery.ajax({
+ url: url,
+ type: type,
+ dataType: "html",
+ data: params,
+ complete: function(res, status){
+ // If successful, inject the HTML into all the matched elements
+ if ( status == "success" || status == "notmodified" )
+ // See if a selector was specified
+ self.html( selector ?
+ // Create a dummy div to hold the results
+ jQuery("<div/>")
+ // inject the contents of the document in, removing the scripts
+ // to avoid any 'Permission Denied' errors in IE
+ .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, ""))
+
+ // Locate the specified elements
+ .find(selector) :
+
+ // If not, just inject the full result
+ res.responseText );
+
+ if( callback )
+ self.each( callback, [res.responseText, status, res] );
+ }
+ });
+ return this;
+ },
+
+ serialize: function() {
+ return jQuery.param(this.serializeArray());
+ },
+ serializeArray: function() {
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray(this.elements) : this;
+ })
+ .filter(function(){
+ return this.name && !this.disabled &&
+ (this.checked || /select|textarea/i.test(this.nodeName) ||
+ /text|hidden|password/i.test(this.type));
+ })
+ .map(function(i, elem){
+ var val = jQuery(this).val();
+ return val == null ? null :
+ jQuery.isArray(val) ?
+ jQuery.map( val, function(val, i){
+ return {name: elem.name, value: val};
+ }) :
+ {name: elem.name, value: val};
+ }).get();
+ }
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){
+ jQuery.fn[o] = function(f){
+ return this.bind(o, f);
+ };
+});
+
+var jsc = now();
+
+jQuery.extend({
+
+ get: function( url, data, callback, type ) {
+ // shift arguments if data argument was ommited
+ if ( jQuery.isFunction( data ) ) {
+ callback = data;
+ data = null;
+ }
+
+ return jQuery.ajax({
+ type: "GET",
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ },
+
+ getScript: function( url, callback ) {
+ return jQuery.get(url, null, callback, "script");
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get(url, data, callback, "json");
+ },
+
+ post: function( url, data, callback, type ) {
+ if ( jQuery.isFunction( data ) ) {
+ callback = data;
+ data = {};
+ }
+
+ return jQuery.ajax({
+ type: "POST",
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ },
+
+ ajaxSetup: function( settings ) {
+ jQuery.extend( jQuery.ajaxSettings, settings );
+ },
+
+ ajaxSettings: {
+ url: location.href,
+ global: true,
+ type: "GET",
+ contentType: "application/x-www-form-urlencoded",
+ processData: true,
+ async: true,
+ /*
+ timeout: 0,
+ data: null,
+ username: null,
+ password: null,
+ */
+ // Create the request object; Microsoft failed to properly
+ // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available
+ // This function can be overriden by calling jQuery.ajaxSetup
+ xhr:function(){
+ return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest();
+ },
+ accepts: {
+ xml: "application/xml, text/xml",
+ html: "text/html",
+ script: "text/javascript, application/javascript",
+ json: "application/json, text/javascript",
+ text: "text/plain",
+ _default: "*/*"
+ }
+ },
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+
+ ajax: function( s ) {
+ // Extend the settings, but re-extend 's' so that it can be
+ // checked again later (in the test suite, specifically)
+ s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s));
+
+ var jsonp, jsre = /=\?(&|$)/g, status, data,
+ type = s.type.toUpperCase();
+
+ // convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" )
+ s.data = jQuery.param(s.data);
+
+ // Handle JSONP Parameter Callbacks
+ if ( s.dataType == "jsonp" ) {
+ if ( type == "GET" ) {
+ if ( !s.url.match(jsre) )
+ s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+ } else if ( !s.data || !s.data.match(jsre) )
+ s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+ s.dataType = "json";
+ }
+
+ // Build temporary JSONP function
+ if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) {
+ jsonp = "jsonp" + jsc++;
+
+ // Replace the =? sequence both in the query string and the data
+ if ( s.data )
+ s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+ s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+
+ // We need to make sure
+ // that a JSONP style response is executed properly
+ s.dataType = "script";
+
+ // Handle JSONP-style loading
+ window[ jsonp ] = function(tmp){
+ data = tmp;
+ success();
+ complete();
+ // Garbage collect
+ window[ jsonp ] = undefined;
+ try{ delete window[ jsonp ]; } catch(e){}
+ if ( head )
+ head.removeChild( script );
+ };
+ }
+
+ if ( s.dataType == "script" && s.cache == null )
+ s.cache = false;
+
+ if ( s.cache === false && type == "GET" ) {
+ var ts = now();
+ // try replacing _= if it is there
+ var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2");
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : "");
+ }
+
+ // If data is available, append data to url for get requests
+ if ( s.data && type == "GET" ) {
+ s.url += (s.url.match(/\?/) ? "&" : "?") + s.data;
+
+ // IE likes to send both get and post data, prevent this
+ s.data = null;
+ }
+
+ // Watch for a new set of requests
+ if ( s.global && ! jQuery.active++ )
+ jQuery.event.trigger( "ajaxStart" );
+
+ // Matches an absolute URL, and saves the domain
+ var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url );
+
+ // If we're requesting a remote document
+ // and trying to load JSON or Script with a GET
+ if ( s.dataType == "script" && type == "GET" && parts
+ && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){
+
+ var head = document.getElementsByTagName("head")[0];
+ var script = document.createElement("script");
+ script.src = s.url;
+ if (s.scriptCharset)
+ script.charset = s.scriptCharset;
+
+ // Handle Script loading
+ if ( !jsonp ) {
+ var done = false;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function(){
+ if ( !done && (!this.readyState ||
+ this.readyState == "loaded" || this.readyState == "complete") ) {
+ done = true;
+ success();
+ complete();
+ head.removeChild( script );
+ }
+ };
+ }
+
+ head.appendChild(script);
+
+ // We handle everything using the script element injection
+ return undefined;
+ }
+
+ var requestDone = false;
+
+ // Create the request object
+ var xhr = s.xhr();
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if( s.username )
+ xhr.open(type, s.url, s.async, s.username, s.password);
+ else
+ xhr.open(type, s.url, s.async);
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ // Set the correct header, if data is being sent
+ if ( s.data )
+ xhr.setRequestHeader("Content-Type", s.contentType);
+
+ // Set the If-Modified-Since header, if ifModified mode.
+ if ( s.ifModified )
+ xhr.setRequestHeader("If-Modified-Since",
+ jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" );
+
+ // Set header so the called script knows that it's an XMLHttpRequest
+ xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+
+ // Set the Accepts header for the server, depending on the dataType
+ xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
+ s.accepts[ s.dataType ] + ", */*" :
+ s.accepts._default );
+ } catch(e){}
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && s.beforeSend(xhr, s) === false ) {
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ // close opended socket
+ xhr.abort();
+ return false;
+ }
+
+ if ( s.global )
+ jQuery.event.trigger("ajaxSend", [xhr, s]);
+
+ // Wait for a response to come back
+ var onreadystatechange = function(isTimeout){
+ // The request was aborted, clear the interval and decrement jQuery.active
+ if (xhr.readyState == 0) {
+ if (ival) {
+ // clear poll interval
+ clearInterval(ival);
+ ival = null;
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ // The transfer is complete and the data is available, or the request timed out
+ } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) {
+ requestDone = true;
+
+ // clear poll interval
+ if (ival) {
+ clearInterval(ival);
+ ival = null;
+ }
+
+ status = isTimeout == "timeout" ? "timeout" :
+ !jQuery.httpSuccess( xhr ) ? "error" :
+ s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" :
+ "success";
+
+ if ( status == "success" ) {
+ // Watch for, and catch, XML document parse errors
+ try {
+ // process the data (runs the xml through httpData regardless of callback)
+ data = jQuery.httpData( xhr, s.dataType, s );
+ } catch(e) {
+ status = "parsererror";
+ }
+ }
+
+ // Make sure that the request was successful or notmodified
+ if ( status == "success" ) {
+ // Cache Last-Modified header, if ifModified mode.
+ var modRes;
+ try {
+ modRes = xhr.getResponseHeader("Last-Modified");
+ } catch(e) {} // swallow exception thrown by FF if header is not available
+
+ if ( s.ifModified && modRes )
+ jQuery.lastModified[s.url] = modRes;
+
+ // JSONP handles its own success callback
+ if ( !jsonp )
+ success();
+ } else
+ jQuery.handleError(s, xhr, status);
+
+ // Fire the complete handlers
+ complete();
+
+ if ( isTimeout )
+ xhr.abort();
+
+ // Stop memory leaks
+ if ( s.async )
+ xhr = null;
+ }
+ };
+
+ if ( s.async ) {
+ // don't attach the handler to the request, just poll it instead
+ var ival = setInterval(onreadystatechange, 13);
+
+ // Timeout checker
+ if ( s.timeout > 0 )
+ setTimeout(function(){
+ // Check to see if the request is still happening
+ if ( xhr && !requestDone )
+ onreadystatechange( "timeout" );
+ }, s.timeout);
+ }
+
+ // Send the data
+ try {
+ xhr.send(s.data);
+ } catch(e) {
+ jQuery.handleError(s, xhr, null, e);
+ }
+
+ // firefox 1.5 doesn't fire statechange for sync requests
+ if ( !s.async )
+ onreadystatechange();
+
+ function success(){
+ // If a local callback was specified, fire it and pass it the data
+ if ( s.success )
+ s.success( data, status );
+
+ // Fire the global callback
+ if ( s.global )
+ jQuery.event.trigger( "ajaxSuccess", [xhr, s] );
+ }
+
+ function complete(){
+ // Process result
+ if ( s.complete )
+ s.complete(xhr, status);
+
+ // The request was completed
+ if ( s.global )
+ jQuery.event.trigger( "ajaxComplete", [xhr, s] );
+
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ }
+
+ // return XMLHttpRequest to allow aborting the request etc.
+ return xhr;
+ },
+
+ handleError: function( s, xhr, status, e ) {
+ // If a local callback was specified, fire it
+ if ( s.error ) s.error( xhr, status, e );
+
+ // Fire the global callback
+ if ( s.global )
+ jQuery.event.trigger( "ajaxError", [xhr, s, e] );
+ },
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Determines if an XMLHttpRequest was successful or not
+ httpSuccess: function( xhr ) {
+ try {
+ // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
+ return !xhr.status && location.protocol == "file:" ||
+ ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223;
+ } catch(e){}
+ return false;
+ },
+
+ // Determines if an XMLHttpRequest returns NotModified
+ httpNotModified: function( xhr, url ) {
+ try {
+ var xhrRes = xhr.getResponseHeader("Last-Modified");
+
+ // Firefox always returns 200. check Last-Modified date
+ return xhr.status == 304 || xhrRes == jQuery.lastModified[url];
+ } catch(e){}
+ return false;
+ },
+
+ httpData: function( xhr, type, s ) {
+ var ct = xhr.getResponseHeader("content-type"),
+ xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0,
+ data = xml ? xhr.responseXML : xhr.responseText;
+
+ if ( xml && data.documentElement.tagName == "parsererror" )
+ throw "parsererror";
+
+ // Allow a pre-filtering function to sanitize the response
+ // s != null is checked to keep backwards compatibility
+ if( s && s.dataFilter )
+ data = s.dataFilter( data, type );
+
+ // The filter can actually parse the response
+ if( typeof data === "string" ){
+
+ // If the type is "script", eval it in global context
+ if ( type == "script" )
+ jQuery.globalEval( data );
+
+ // Get the JavaScript object, if JSON is used.
+ if ( type == "json" )
+ data = window["eval"]("(" + data + ")");
+ }
+
+ return data;
+ },
+
+ // Serialize an array of form elements or a set of
+ // key/values into a query string
+ param: function( a ) {
+ var s = [ ];
+
+ function add( key, value ){
+ s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value);
+ };
+
+ // If an array was passed in, assume that it is an array
+ // of form elements
+ if ( jQuery.isArray(a) || a.jquery )
+ // Serialize the form elements
+ jQuery.each( a, function(){
+ add( this.name, this.value );
+ });
+
+ // Otherwise, assume that it's an object of key/value pairs
+ else
+ // Serialize the key/values
+ for ( var j in a )
+ // If the value is an array then the key names need to be repeated
+ if ( jQuery.isArray(a[j]) )
+ jQuery.each( a[j], function(){
+ add( j, this );
+ });
+ else
+ add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] );
+
+ // Return the resulting serialization
+ return s.join("&").replace(/%20/g, "+");
+ }
+
+});
+var elemdisplay = {},
+ timerId,
+ fxAttrs = [
+ // height animations
+ [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+ // width animations
+ [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+ // opacity animations
+ [ "opacity" ]
+ ];
+
+function genFx( type, num ){
+ var obj = {};
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){
+ obj[ this ] = type;
+ });
+ return obj;
+}
+
+jQuery.fn.extend({
+ show: function(speed,callback){
+ if ( speed ) {
+ return this.animate( genFx("show", 3), speed, callback);
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ var old = jQuery.data(this[i], "olddisplay");
+
+ this[i].style.display = old || "";
+
+ if ( jQuery.css(this[i], "display") === "none" ) {
+ var tagName = this[i].tagName, display;
+
+ if ( elemdisplay[ tagName ] ) {
+ display = elemdisplay[ tagName ];
+ } else {
+ var elem = jQuery("<" + tagName + " />").appendTo("body");
+
+ display = elem.css("display");
+ if ( display === "none" )
+ display = "block";
+
+ elem.remove();
+
+ elemdisplay[ tagName ] = display;
+ }
+
+ this[i].style.display = jQuery.data(this[i], "olddisplay", display);
+ }
+ }
+
+ return this;
+ }
+ },
+
+ hide: function(speed,callback){
+ if ( speed ) {
+ return this.animate( genFx("hide", 3), speed, callback);
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ var old = jQuery.data(this[i], "olddisplay");
+ if ( !old && old !== "none" )
+ jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+ this[i].style.display = "none";
+ }
+ return this;
+ }
+ },
+
+ // Save the old toggle function
+ _toggle: jQuery.fn.toggle,
+
+ toggle: function( fn, fn2 ){
+ var bool = typeof fn === "boolean";
+
+ return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ?
+ this._toggle.apply( this, arguments ) :
+ fn == null || bool ?
+ this.each(function(){
+ var state = bool ? fn : jQuery(this).is(":hidden");
+ jQuery(this)[ state ? "show" : "hide" ]();
+ }) :
+ this.animate(genFx("toggle", 3), fn, fn2);
+ },
+
+ fadeTo: function(speed,to,callback){
+ return this.animate({opacity: to}, speed, callback);
+ },
+
+ animate: function( prop, speed, easing, callback ) {
+ var optall = jQuery.speed(speed, easing, callback);
+
+ return this[ optall.queue === false ? "each" : "queue" ](function(){
+
+ var opt = jQuery.extend({}, optall), p,
+ hidden = this.nodeType == 1 && jQuery(this).is(":hidden"),
+ self = this;
+
+ for ( p in prop ) {
+ if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden )
+ return opt.complete.call(this);
+
+ if ( ( p == "height" || p == "width" ) && this.style ) {
+ // Store display property
+ opt.display = jQuery.css(this, "display");
+
+ // Make sure that nothing sneaks out
+ opt.overflow = this.style.overflow;
+ }
+ }
+
+ if ( opt.overflow != null )
+ this.style.overflow = "hidden";
+
+ opt.curAnim = jQuery.extend({}, prop);
+
+ jQuery.each( prop, function(name, val){
+ var e = new jQuery.fx( self, opt, name );
+
+ if ( /toggle|show|hide/.test(val) )
+ e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+ else {
+ var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),
+ start = e.cur(true) || 0;
+
+ if ( parts ) {
+ var end = parseFloat(parts[2]),
+ unit = parts[3] || "px";
+
+ // We need to compute starting value
+ if ( unit != "px" ) {
+ self.style[ name ] = (end || 1) + unit;
+ start = ((end || 1) / e.cur(true)) * start;
+ self.style[ name ] = start + unit;
+ }
+
+ // If a +=/-= token was provided, we're doing a relative animation
+ if ( parts[1] )
+ end = ((parts[1] == "-=" ? -1 : 1) * end) + start;
+
+ e.custom( start, end, unit );
+ } else
+ e.custom( start, val, "" );
+ }
+ });
+
+ // For JS strict compliance
+ return true;
+ });
+ },
+
+ stop: function(clearQueue, gotoEnd){
+ var timers = jQuery.timers;
+
+ if (clearQueue)
+ this.queue([]);
+
+ this.each(function(){
+ // go in reverse order so anything added to the queue during the loop is ignored
+ for ( var i = timers.length - 1; i >= 0; i-- )
+ if ( timers[i].elem == this ) {
+ if (gotoEnd)
+ // force the next step to be the last
+ timers[i](true);
+ timers.splice(i, 1);
+ }
+ });
+
+ // start the next in the queue if the last step wasn't forced
+ if (!gotoEnd)
+ this.dequeue();
+
+ return this;
+ }
+
+});
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show", 1),
+ slideUp: genFx("hide", 1),
+ slideToggle: genFx("toggle", 1),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" }
+}, function( name, props ){
+ jQuery.fn[ name ] = function( speed, callback ){
+ return this.animate( props, speed, callback );
+ };
+});
+
+jQuery.extend({
+
+ speed: function(speed, easing, fn) {
+ var opt = typeof speed === "object" ? speed : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default;
+
+ // Queueing
+ opt.old = opt.complete;
+ opt.complete = function(){
+ if ( opt.queue !== false )
+ jQuery(this).dequeue();
+ if ( jQuery.isFunction( opt.old ) )
+ opt.old.call( this );
+ };
+
+ return opt;
+ },
+
+ easing: {
+ linear: function( p, n, firstNum, diff ) {
+ return firstNum + diff * p;
+ },
+ swing: function( p, n, firstNum, diff ) {
+ return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+ }
+ },
+
+ timers: [],
+
+ fx: function( elem, options, prop ){
+ this.options = options;
+ this.elem = elem;
+ this.prop = prop;
+
+ if ( !options.orig )
+ options.orig = {};
+ }
+
+});
+
+jQuery.fx.prototype = {
+
+ // Simple function for setting a style value
+ update: function(){
+ if ( this.options.step )
+ this.options.step.call( this.elem, this.now, this );
+
+ (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+
+ // Set display property to block for height/width animations
+ if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style )
+ this.elem.style.display = "block";
+ },
+
+ // Get the current size
+ cur: function(force){
+ if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) )
+ return this.elem[ this.prop ];
+
+ var r = parseFloat(jQuery.css(this.elem, this.prop, force));
+ return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+ },
+
+ // Start an animation from one number to another
+ custom: function(from, to, unit){
+ this.startTime = now();
+ this.start = from;
+ this.end = to;
+ this.unit = unit || this.unit || "px";
+ this.now = this.start;
+ this.pos = this.state = 0;
+
+ var self = this;
+ function t(gotoEnd){
+ return self.step(gotoEnd);
+ }
+
+ t.elem = this.elem;
+
+ if ( t() && jQuery.timers.push(t) == 1 ) {
+ timerId = setInterval(function(){
+ var timers = jQuery.timers;
+
+ for ( var i = 0; i < timers.length; i++ )
+ if ( !timers[i]() )
+ timers.splice(i--, 1);
+
+ if ( !timers.length ) {
+ clearInterval( timerId );
+ }
+ }, 13);
+ }
+ },
+
+ // Simple 'show' function
+ show: function(){
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.show = true;
+
+ // Begin the animation
+ // Make sure that we start at a small width/height to avoid any
+ // flash of content
+ this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur());
+
+ // Start by showing the element
+ jQuery(this.elem).show();
+ },
+
+ // Simple 'hide' function
+ hide: function(){
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.hide = true;
+
+ // Begin the animation
+ this.custom(this.cur(), 0);
+ },
+
+ // Each step of an animation
+ step: function(gotoEnd){
+ var t = now();
+
+ if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+ this.now = this.end;
+ this.pos = this.state = 1;
+ this.update();
+
+ this.options.curAnim[ this.prop ] = true;
+
+ var done = true;
+ for ( var i in this.options.curAnim )
+ if ( this.options.curAnim[i] !== true )
+ done = false;
+
+ if ( done ) {
+ if ( this.options.display != null ) {
+ // Reset the overflow
+ this.elem.style.overflow = this.options.overflow;
+
+ // Reset the display
+ this.elem.style.display = this.options.display;
+ if ( jQuery.css(this.elem, "display") == "none" )
+ this.elem.style.display = "block";
+ }
+
+ // Hide the element if the "hide" operation was done
+ if ( this.options.hide )
+ jQuery(this.elem).hide();
+
+ // Reset the properties, if the item has been hidden or shown
+ if ( this.options.hide || this.options.show )
+ for ( var p in this.options.curAnim )
+ jQuery.attr(this.elem.style, p, this.options.orig[p]);
+
+ // Execute the complete function
+ this.options.complete.call( this.elem );
+ }
+
+ return false;
+ } else {
+ var n = t - this.startTime;
+ this.state = n / this.options.duration;
+
+ // Perform the easing function, defaults to swing
+ this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration);
+ this.now = this.start + ((this.end - this.start) * this.pos);
+
+ // Perform the next step of the animation
+ this.update();
+ }
+
+ return true;
+ }
+
+};
+
+jQuery.extend( jQuery.fx, {
+ speeds:{
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+ },
+ step: {
+
+ opacity: function(fx){
+ jQuery.attr(fx.elem.style, "opacity", fx.now);
+ },
+
+ _default: function(fx){
+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null )
+ fx.elem.style[ fx.prop ] = fx.now + fx.unit;
+ else
+ fx.elem[ fx.prop ] = fx.now;
+ }
+ }
+});
+if ( document.documentElement["getBoundingClientRect"] )
+ jQuery.fn.offset = function() {
+ if ( !this[0] ) return { top: 0, left: 0 };
+ if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
+ var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement,
+ clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
+ top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop,
+ left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+ return { top: top, left: left };
+ };
+else
+ jQuery.fn.offset = function() {
+ if ( !this[0] ) return { top: 0, left: 0 };
+ if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
+ jQuery.offset.initialized || jQuery.offset.initialize();
+
+ var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem,
+ doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
+ body = doc.body, defaultView = doc.defaultView,
+ prevComputedStyle = defaultView.getComputedStyle(elem, null),
+ top = elem.offsetTop, left = elem.offsetLeft;
+
+ while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+ computedStyle = defaultView.getComputedStyle(elem, null);
+ top -= elem.scrollTop, left -= elem.scrollLeft;
+ if ( elem === offsetParent ) {
+ top += elem.offsetTop, left += elem.offsetLeft;
+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) )
+ top += parseInt( computedStyle.borderTopWidth, 10) || 0,
+ left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+ prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
+ }
+ if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" )
+ top += parseInt( computedStyle.borderTopWidth, 10) || 0,
+ left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+ prevComputedStyle = computedStyle;
+ }
+
+ if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" )
+ top += body.offsetTop,
+ left += body.offsetLeft;
+
+ if ( prevComputedStyle.position === "fixed" )
+ top += Math.max(docElem.scrollTop, body.scrollTop),
+ left += Math.max(docElem.scrollLeft, body.scrollLeft);
+
+ return { top: top, left: left };
+ };
+
+jQuery.offset = {
+ initialize: function() {
+ if ( this.initialized ) return;
+ var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop,
+ html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';
+
+ rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' };
+ for ( prop in rules ) container.style[prop] = rules[prop];
+
+ container.innerHTML = html;
+ body.insertBefore(container, body.firstChild);
+ innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild;
+
+ this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+ this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+ innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative';
+ this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+ body.style.marginTop = '1px';
+ this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0);
+ body.style.marginTop = bodyMarginTop;
+
+ body.removeChild(container);
+ this.initialized = true;
+ },
+
+ bodyOffset: function(body) {
+ jQuery.offset.initialized || jQuery.offset.initialize();
+ var top = body.offsetTop, left = body.offsetLeft;
+ if ( jQuery.offset.doesNotIncludeMarginInBodyOffset )
+ top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0,
+ left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0;
+ return { top: top, left: left };
+ }
+};
+
+
+jQuery.fn.extend({
+ position: function() {
+ var left = 0, top = 0, results;
+
+ if ( this[0] ) {
+ // Get *real* offsetParent
+ var offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= num( this, 'marginTop' );
+ offset.left -= num( this, 'marginLeft' );
+
+ // Add offsetParent borders
+ parentOffset.top += num( offsetParent, 'borderTopWidth' );
+ parentOffset.left += num( offsetParent, 'borderLeftWidth' );
+
+ // Subtract the two offsets
+ results = {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
+ }
+
+ return results;
+ },
+
+ offsetParent: function() {
+ var offsetParent = this[0].offsetParent || document.body;
+ while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') )
+ offsetParent = offsetParent.offsetParent;
+ return jQuery(offsetParent);
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ['Left', 'Top'], function(i, name) {
+ var method = 'scroll' + name;
+
+ jQuery.fn[ method ] = function(val) {
+ if (!this[0]) return null;
+
+ return val !== undefined ?
+
+ // Set the scroll offset
+ this.each(function() {
+ this == window || this == document ?
+ window.scrollTo(
+ !i ? val : jQuery(window).scrollLeft(),
+ i ? val : jQuery(window).scrollTop()
+ ) :
+ this[ method ] = val;
+ }) :
+
+ // Return the scroll offset
+ this[0] == window || this[0] == document ?
+ self[ i ? 'pageYOffset' : 'pageXOffset' ] ||
+ jQuery.boxModel && document.documentElement[ method ] ||
+ document.body[ method ] :
+ this[0][ method ];
+ };
+});
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function(i, name){
+
+ var tl = i ? "Left" : "Top", // top or left
+ br = i ? "Right" : "Bottom"; // bottom or right
+
+ // innerHeight and innerWidth
+ jQuery.fn["inner" + name] = function(){
+ return this[ name.toLowerCase() ]() +
+ num(this, "padding" + tl) +
+ num(this, "padding" + br);
+ };
+
+ // outerHeight and outerWidth
+ jQuery.fn["outer" + name] = function(margin) {
+ return this["inner" + name]() +
+ num(this, "border" + tl + "Width") +
+ num(this, "border" + br + "Width") +
+ (margin ?
+ num(this, "margin" + tl) + num(this, "margin" + br) : 0);
+ };
+
+ var type = name.toLowerCase();
+
+ jQuery.fn[ type ] = function( size ) {
+ // Get window width or height
+ return this[0] == window ?
+ // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+ document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] ||
+ document.body[ "client" + name ] :
+
+ // Get document width or height
+ this[0] == document ?
+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+ Math.max(
+ document.documentElement["client" + name],
+ document.body["scroll" + name], document.documentElement["scroll" + name],
+ document.body["offset" + name], document.documentElement["offset" + name]
+ ) :
+
+ // Get or set width or height on the element
+ size === undefined ?
+ // Get width or height on the element
+ (this.length ? jQuery.css( this[0], type ) : null) :
+
+ // Set the width or height on the element (default to pixels if value is unitless)
+ this.css( type, typeof size === "string" ? size : size + "px" );
+ };
+
+});})();
diff --git a/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.js b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.js
new file mode 100644
index 0000000..71bea46
--- /dev/null
+++ b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.js
@@ -0,0 +1,4126 @@
+/*
+ * jQuery UI 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;(function($) {
+
+var _remove = $.fn.remove,
+ isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.6rc6",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ cssCache: {},
+ css: function(name) {
+ if ($.ui.cssCache[name]) { return $.ui.cssCache[name]; }
+ var tmp = $('<div class="ui-gen"></div>').addClass(name).css({position:'absolute', top:'-5000px', left:'-5000px', display:'block'}).appendTo('body');
+
+ //if (!$.browser.safari)
+ //tmp.appendTo('body');
+
+ //Opera and Safari set width and height to 0px instead of auto
+ //Safari returns rgba(0,0,0,0) when bgcolor is not set
+ $.ui.cssCache[name] = !!(
+ (!(/auto|default/).test(tmp.css('cursor')) || (/^[1-9]/).test(tmp.css('height')) || (/^[1-9]/).test(tmp.css('width')) ||
+ !(/none/).test(tmp.css('backgroundImage')) || !(/transparent|rgba\(0, 0, 0, 0\)/).test(tmp.css('backgroundColor')))
+ );
+ try { $('body').get(0).removeChild(tmp.get(0)); } catch(e){}
+ return $.ui.cssCache[name];
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+ var attr = $.attr,
+ removeAttr = $.fn.removeAttr,
+ ariaNS = "http://www.w3.org/2005/07/aaa",
+ ariaState = /^aria-/,
+ ariaRole = /^wairole:/;
+
+ $.attr = function(elem, name, value) {
+ var set = value !== undefined;
+
+ return (name == 'role'
+ ? (set
+ ? attr.call(this, elem, name, "wairole:" + value)
+ : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+ : (ariaState.test(name)
+ ? (set
+ ? elem.setAttributeNS(ariaNS,
+ name.replace(ariaState, "aaa:"), value)
+ : attr.call(this, elem, name.replace(ariaState, "aaa:")))
+ : attr.apply(this, arguments)));
+ };
+
+ $.fn.removeAttr = function(name) {
+ return (ariaState.test(name)
+ ? this.each(function() {
+ this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+ }) : removeAttr.call(this, name));
+ };
+}
+
+//jQuery plugins
+$.fn.extend({
+ remove: function() {
+ // Safari has a native remove event which actually removes DOM elements,
+ // so we have to use triggerHandler instead of trigger (#3037).
+ $("*", this).add(this).each(function() {
+ $(this).triggerHandler("remove");
+ });
+ return _remove.apply(this, arguments );
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+function getter(namespace, plugin, method, args) {
+ function getMethods(type) {
+ var methods = $[namespace][plugin][type] || [];
+ return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
+ }
+
+ var methods = getMethods('getter');
+ if (args.length == 1 && typeof args[0] == 'string') {
+ methods = methods.concat(getMethods('getterSetter'));
+ }
+ return ($.inArray(method, methods) != -1);
+}
+
+$.widget = function(name, prototype) {
+ var namespace = name.split(".")[0];
+ name = name.split(".")[1];
+
+ // create plugin method
+ $.fn[name] = function(options) {
+ var isMethodCall = (typeof options == 'string'),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ // prevent calls to internal methods
+ if (isMethodCall && options.substring(0, 1) == '_') {
+ return this;
+ }
+
+ // handle getter methods
+ if (isMethodCall && getter(namespace, name, options, args)) {
+ var instance = $.data(this[0], name);
+ return (instance ? instance[options].apply(instance, args)
+ : undefined);
+ }
+
+ // handle initialization and non-getter methods
+ return this.each(function() {
+ var instance = $.data(this, name);
+
+ // constructor
+ (!instance && !isMethodCall &&
+ $.data(this, name, new $[namespace][name](this, options))._init());
+
+ // method call
+ (instance && isMethodCall && $.isFunction(instance[options]) &&
+ instance[options].apply(instance, args));
+ });
+ };
+
+ // create widget constructor
+ $[namespace] = $[namespace] || {};
+ $[namespace][name] = function(element, options) {
+ var self = this;
+
+ this.namespace = namespace;
+ this.widgetName = name;
+ this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+ this.widgetBaseClass = namespace + '-' + name;
+
+ this.options = $.extend({},
+ $.widget.defaults,
+ $[namespace][name].defaults,
+ $.metadata && $.metadata.get(element)[name],
+ options);
+
+ this.element = $(element)
+ .bind('setData.' + name, function(event, key, value) {
+ if (event.target == element) {
+ return self._setData(key, value);
+ }
+ })
+ .bind('getData.' + name, function(event, key) {
+ if (event.target == element) {
+ return self._getData(key);
+ }
+ })
+ .bind('remove', function() {
+ return self.destroy();
+ });
+ };
+
+ // add widget prototype
+ $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+
+ // TODO: merge getter and getterSetter properties from widget prototype
+ // and plugin prototype
+ $[namespace][name].getterSetter = 'option';
+};
+
+$.widget.prototype = {
+ _init: function() {},
+ destroy: function() {
+ this.element.removeData(this.widgetName)
+ .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+ .removeAttr('aria-disabled');
+ },
+
+ option: function(key, value) {
+ var options = key,
+ self = this;
+
+ if (typeof key == "string") {
+ if (value === undefined) {
+ return this._getData(key);
+ }
+ options = {};
+ options[key] = value;
+ }
+
+ $.each(options, function(key, value) {
+ self._setData(key, value);
+ });
+ },
+ _getData: function(key) {
+ return this.options[key];
+ },
+ _setData: function(key, value) {
+ this.options[key] = value;
+
+ if (key == 'disabled') {
+ this.element
+ [value ? 'addClass' : 'removeClass'](
+ this.widgetBaseClass + '-disabled' + ' ' +
+ this.namespace + '-state-disabled')
+ .attr("aria-disabled", value);
+ }
+ },
+
+ enable: function() {
+ this._setData('disabled', false);
+ },
+ disable: function() {
+ this._setData('disabled', true);
+ },
+
+ _trigger: function(type, event, data) {
+ var callback = this.options[type],
+ eventName = (type == this.widgetEventPrefix
+ ? type : this.widgetEventPrefix + type);
+
+ event = $.Event(event);
+ event.type = eventName;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (event.originalEvent) {
+ for (var i = $.event.props.length, prop; i;) {
+ prop = $.event.props[--i];
+ event[prop] = event.originalEvent[prop];
+ }
+ }
+
+ this.element.trigger(event, data);
+
+ return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+ || event.isDefaultPrevented());
+ }
+};
+
+$.widget.defaults = {
+ disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ return false;
+ }
+ });
+
+ // Prevent text selection in IE
+ if ($.browser.msie) {
+ this._mouseUnselectable = this.element.attr('unselectable');
+ this.element.attr('unselectable', 'on');
+ }
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+
+ // Restore text selection in IE
+ ($.browser.msie
+ && this.element.attr('unselectable', this._mouseUnselectable));
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = true;
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+ cancel: null,
+ distance: 1,
+ delay: 0
+};
+
+})(jQuery);
+/*
+ * jQuery UI Draggable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-draggable"));
+ (this.options.disabled && this.element.addClass(this.options.cssNamespace+'-draggable-disabled'));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+'-draggable '+this.options.cssNamespace+'-draggable-dragging '+this.options.cssNamespace+'-draggable-disabled');
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (this.helper || o.disabled || $(event.target).is('.'+this.options.cssNamespace+'-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Call plugins and callbacks
+ this._trigger("start", event);
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass(o.cssNamespace+"-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ this._trigger('drag', event, ui);
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ self._trigger("stop", event);
+ self._clear();
+ });
+ } else {
+ this._trigger("stop", event);
+ this._clear();
+ }
+
+ return false;
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body && $.browser.mozilla) //Ugly FF3 fix
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ absolutePosition: this.positionAbs, //deprecated
+ offset: this.positionAbs
+ };
+ }
+
+}));
+
+$.extend($.ui.draggable, {
+ version: "1.6rc6",
+ eventPrefix: "drag",
+ defaults: {
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectToSortable: false,
+ containment: false,
+ cssNamespace: "ui",
+ cursor: "default",
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ }
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ // 'this' points to a string, and should therefore resolved as query, but instead, if the string is assigned to a variable, it loops through the strings properties,
+ // so we have to append '' to make it anonymous again
+ $(typeof this == 'string' ? this+'': this).each(function() {
+ if($.data(this, 'sortable')) {
+ var sortable = $.data(this, 'sortable');
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, inst);
+ }
+ });
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable");
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, inst);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ if(checkPos.call(inst, this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ this.instance.fromOutside = inst; //Little hack so receive/update callbacks work
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+ this.instance.options.revert = false; //No revert here
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.absolutePosition.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.absolutePosition.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ });
+
+ $(group).each(function(i) {
+ this.style.zIndex = o.stack.min + i;
+ });
+
+ this[0].style.zIndex = o.stack.min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ proportionallyResize: o.proportionallyResize ? [o.proportionallyResize] : [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent();
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ if ($.browser.safari && o.preventDefault) this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this.proportionallyResize.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ if (o.transparent)
+ this.handles[i].css({ opacity: 0 });
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ if (!o.transparent)
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element);
+
+ if (o.disableSelection)
+ this._handles.disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ this.wrapper.parent().append(
+ this.originalElement.css({
+ position: this.wrapper.css('position'),
+ width: this.wrapper.outerWidth(),
+ height: this.wrapper.outerHeight(),
+ top: this.wrapper.css('top'),
+ left: this.wrapper.css('left')
+ })
+ ).end().remove();
+ }
+
+ _destroy(this.originalElement);
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var handle = false;
+ for(var i in this.handles) {
+ if($(this.handles[i])[0] == event.target) handle = true;
+ }
+
+ return this.options.disabled || !!handle;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ if (o.preserveCursor) {
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+ }
+
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this.proportionallyResize.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this.proportionallyResize, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ if (o.preserveCursor)
+ $('body').css('cursor', 'auto');
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (data.left) this.position.left = data.left;
+ if (data.top) this.position.top = data.top;
+ if (data.height) this.size.height = data.height;
+ if (data.width) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10))
+ };
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this.proportionallyResize.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this.proportionallyResize.length; i++) {
+
+ var prel = this.proportionallyResize[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper.appendTo("body");
+
+ if (o.disableSelection)
+ this.helper.disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+}));
+
+$.extend($.ui.resizable, {
+ version: "1.6rc6",
+ eventPrefix: "resize",
+ defaults: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ cancel: ":input,option",
+ containment: false,
+ delay: 0,
+ disableSelection: true,
+ distance: 1,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ preserveCursor: true,
+ preventDefault: true,
+ proportionallyResize: false,
+ transparent: false,
+ zIndex: 1000
+ }
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = o.proportionallyResize, ista = pr && (/textarea/i).test(pr.get(0).nodeName),
+ soffseth = ista && $.ui.hasScroll(pr.get(0), 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr) pr.css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = o._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, pr = o.proportionallyResize, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+})(jQuery);
+/*
+ * jQuery UI Dialog 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+ dragStart: "start.draggable",
+ drag: "drag.draggable",
+ dragStop: "stop.draggable",
+ maxHeight: "maxHeight.resizable",
+ minHeight: "minHeight.resizable",
+ maxWidth: "maxWidth.resizable",
+ minWidth: "minWidth.resizable",
+ resizeStart: "start.resizable",
+ resize: "drag.resizable",
+ resizeStop: "stop.resizable"
+};
+
+$.widget("ui.dialog", {
+
+ _init: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = this.options,
+
+ title = options.title || this.originalTitle || '&nbsp;',
+ titleId = $.ui.dialog.getTitleId(this.element),
+
+ uiDialog = (this.uiDialog = $('<div/>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ' +
+ options.dialogClass
+ )
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ (options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(event);
+ }),
+
+ uiDialogContent = this.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"/>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .mousedown(function(ev) {
+ ev.stopPropagation();
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span/>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ (options.draggable && $.fn.draggable && this._makeDraggable());
+ (options.resizable && $.fn.resizable && this._makeResizable());
+
+ this._createButtons(options.buttons);
+ this._isOpen = false;
+
+ (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
+ (options.autoOpen && this.open());
+
+ },
+
+ destroy: function() {
+ (this.overlay && this.overlay.destroy());
+ (this.shadow && this._destroyShadow());
+ this.uiDialog.hide();
+ this.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ this.uiDialog.remove();
+
+ (this.originalTitle && this.element.attr('title', this.originalTitle));
+ },
+
+ close: function(event) {
+ if (false === this._trigger('beforeclose', event)) {
+ return;
+ }
+
+ (this.overlay && this.overlay.destroy());
+ (this.shadow && this._destroyShadow());
+ this.uiDialog
+ .hide(this.options.hide)
+ .unbind('keypress.ui-dialog');
+
+ this._trigger('close', event);
+ $.ui.dialog.overlay.resize();
+
+ this._isOpen = false;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+
+ if ((this.options.modal && !force)
+ || (!this.options.stack && !this.options.modal)) {
+ return this._trigger('focus', event);
+ }
+
+ var maxZ = this.options.zIndex, options = this.options;
+ $('.ui-dialog:visible').each(function() {
+ maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10) || options.zIndex);
+ });
+ (this.overlay && this.overlay.$el.css('z-index', ++maxZ));
+ (this.shadow && this.shadow.css('z-index', ++maxZ));
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
+ this.uiDialog.css('z-index', ++maxZ);
+ this.element.attr(saveScroll);
+ this._trigger('focus', event);
+ },
+
+ open: function(event) {
+ if (this._isOpen) { return; }
+
+ var options = this.options,
+ uiDialog = this.uiDialog;
+
+ this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
+ (uiDialog.next().length && uiDialog.appendTo('body'));
+ this._size();
+ this._position(options.position);
+ uiDialog.show(options.show);
+ this.moveToTop(true, event);
+
+ // prevent tabbing out of modal dialogs
+ (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode != $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first')[0],
+ last = tabbables.filter(':last')[0];
+
+ if (event.target == last && !event.shiftKey) {
+ setTimeout(function() {
+ first.focus();
+ }, 1);
+ } else if (event.target == first && event.shiftKey) {
+ setTimeout(function() {
+ last.focus();
+ }, 1);
+ }
+ }));
+
+ // set focus to the first tabbable element in:
+ // - content area
+ // - button pane
+ // - title bar
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-titlebar :tabbable:first'))
+ .filter(':first')
+ .focus();
+
+ if(options.shadow)
+ this._createShadow();
+
+ this._trigger('open', event);
+ this._isOpen = true;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ this.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ (typeof buttons == 'object' && buttons !== null &&
+ $.each(buttons, function() { return !(hasButtons = true); }));
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ $('<button type="button"></button>')
+ .addClass(
+ 'ui-state-default ' +
+ 'ui-corner-all'
+ )
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .hover(
+ function() {
+ $(this).addClass('ui-state-hover');
+ },
+ function() {
+ $(this).removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ $(this).addClass('ui-state-focus');
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ })
+ .appendTo(uiDialogButtonPane);
+ });
+ uiDialogButtonPane.appendTo(this.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = this.options;
+
+ this.uiDialog.draggable({
+ cancel: '.ui-dialog-content',
+ helper: options.dragHelper,
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function() {
+ (options.dragStart && options.dragStart.apply(self.element[0], arguments));
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide();
+ },
+ drag: function() {
+ (options.drag && options.drag.apply(self.element[0], arguments));
+ self._refreshShadow(1);
+ },
+ stop: function() {
+ (options.dragStop && options.dragStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show();
+ self._refreshShadow();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = this.options,
+ resizeHandles = typeof handles == 'string'
+ ? handles
+ : 'n,e,s,w,se,sw,ne,nw';
+
+ this.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ alsoResize: this.element,
+ helper: options.resizeHelper,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: options.minHeight,
+ start: function() {
+ (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide();
+ },
+ resize: function() {
+ (options.resize && options.resize.apply(self.element[0], arguments));
+ self._refreshShadow(1);
+ },
+ handles: resizeHandles,
+ stop: function() {
+ (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show();
+ self._refreshShadow();
+ }
+ })
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _position: function(pos) {
+ var wnd = $(window), doc = $(document),
+ pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
+ minTop = pTop;
+
+ if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
+ pos = [
+ pos == 'right' || pos == 'left' ? pos : 'center',
+ pos == 'top' || pos == 'bottom' ? pos : 'middle'
+ ];
+ }
+ if (pos.constructor != Array) {
+ pos = ['center', 'middle'];
+ }
+ if (pos[0].constructor == Number) {
+ pLeft += pos[0];
+ } else {
+ switch (pos[0]) {
+ case 'left':
+ pLeft += 0;
+ break;
+ case 'right':
+ pLeft += wnd.width() - this.uiDialog.outerWidth();
+ break;
+ default:
+ case 'center':
+ pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ }
+ }
+ if (pos[1].constructor == Number) {
+ pTop += pos[1];
+ } else {
+ switch (pos[1]) {
+ case 'top':
+ pTop += 0;
+ break;
+ case 'bottom':
+ pTop += wnd.height() - this.uiDialog.outerHeight();
+ break;
+ default:
+ case 'middle':
+ pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ }
+ }
+
+ // prevent the dialog from being too high (make sure the titlebar
+ // is accessible)
+ pTop = Math.max(pTop, minTop);
+ this.uiDialog.css({top: pTop, left: pLeft});
+ },
+
+ _setData: function(key, value){
+ (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
+ switch (key) {
+ case "buttons":
+ this._createButtons(value);
+ break;
+ case "closeText":
+ this.uiDialogTitlebarCloseText.text(value);
+ break;
+ case "draggable":
+ (value
+ ? this._makeDraggable()
+ : this.uiDialog.draggable('destroy'));
+ break;
+ case "height":
+ this.uiDialog.height(value);
+ break;
+ case "position":
+ this._position(value);
+ break;
+ case "resizable":
+ var uiDialog = this.uiDialog,
+ isResizable = this.uiDialog.is(':data(resizable)');
+
+ // currently resizable, becoming non-resizable
+ (isResizable && !value && uiDialog.resizable('destroy'));
+
+ // currently resizable, changing handles
+ (isResizable && typeof value == 'string' &&
+ uiDialog.resizable('option', 'handles', value));
+
+ // currently non-resizable, becoming resizable
+ (isResizable || this._makeResizable(value));
+
+ break;
+ case "title":
+ $(".ui-dialog-title", this.uiDialogTitlebar).html(value || '&nbsp;');
+ break;
+ case "width":
+ this.uiDialog.width(value);
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options;
+
+ // reset content sizing
+ this.element.css({
+ height: 0,
+ minHeight: 0,
+ width: 'auto'
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ var nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css({
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: options.height == 'auto'
+ ? 'auto'
+ : options.height - nonContentHeight
+ });
+ },
+
+ _createShadow: function() {
+ this.shadow = $('<div class="ui-widget-shadow"></div>').css('position', 'absolute').appendTo(document.body);
+ this._refreshShadow();
+ return this.shadow;
+ },
+
+ _refreshShadow: function(dragging) {
+ // IE6 is simply to slow to handle the reflow in a good way, so
+ // resizing only happens on stop, and the shadow is hidden during drag/resize
+ if(dragging && $.browser.msie && $.browser.version < 7) return;
+
+ var offset = this.uiDialog.offset();
+ this.shadow.css({
+ left: offset.left,
+ top: offset.top,
+ width: this.uiDialog.outerWidth(),
+ height: this.uiDialog.outerHeight()
+ });
+ },
+
+ _destroyShadow: function() {
+ this.shadow.remove();
+ this.shadow = null;
+ }
+
+});
+
+$.extend($.ui.dialog, {
+ version: "1.6rc6",
+ defaults: {
+ autoOpen: true,
+ bgiframe: false,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ draggable: true,
+ height: 'auto',
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ shadow: true,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ getter: 'isOpen',
+
+ uuid: 0,
+
+ getTitleId: function($el) {
+ return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ $('a, :input').bind($.ui.dialog.overlay.events, function() {
+ // allow use of the element if inside a dialog and
+ // - there are no modal dialogs
+ // - there are modal dialogs, but we are in front of the topmost modal
+ var allow = false;
+ var $dialog = $(this).parents('.ui-dialog');
+ if ($dialog.length) {
+ var $overlays = $('.ui-dialog-overlay');
+ if ($overlays.length) {
+ var maxZ = parseInt($overlays.css('z-index'), 10);
+ $overlays.each(function() {
+ maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10));
+ });
+ allow = parseInt($dialog.css('z-index'), 10) > maxZ;
+ } else {
+ allow = true;
+ }
+ }
+ return allow;
+ });
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ (dialog.options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = $('<div></div>').appendTo(document.body)
+ .addClass('ui-widget-overlay').css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.instances.splice($.inArray(this.instances, $el), 1);
+
+ if (this.instances.length === 0) {
+ $('a, :input').add([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+ },
+
+ height: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ var offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ var offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Effects 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;(function($) {
+
+$.effects = $.effects || {}; //Add the 'effects' scope
+
+$.extend($.effects, {
+ version: "1.6rc6",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ //if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent();
+
+ //Cache width,height and float properties of the element, and create a wrapper around it
+ var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
+ element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
+ var wrapper = element.parent();
+
+ //Transfer the positioning of the element to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative'} );
+ } else {
+ var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
+ var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
+ wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ wrapper.css(props);
+ return wrapper;
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ },
+
+ //Base function to animate from one class to another in a seamless transition
+ animateClass: function(value, duration, easing, callback) {
+
+ var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
+ var ea = (typeof easing == "string" ? easing : null);
+
+ return this.each(function() {
+
+ var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
+ if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
+ if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+
+ //Let's get a style offset
+ var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
+ var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+
+ // The main function to form the object for animation
+ for(var n in newStyle) {
+ if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
+ && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
+ && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
+ && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
+ && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
+ ) offset[n] = newStyle[n];
+ }
+
+ that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
+ // Change style attribute back to original. For stupid IE, we need to clear the damn object.
+ if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
+ if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
+ if(cb) cb.apply(this, arguments);
+ });
+
+ });
+ }
+});
+
+
+function _normalizeArguments(a, m) {
+
+ var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
+ var speed = a[1] && a[1].constructor != Object ? a[1] : o.duration; //either comes from options.duration or the second argument
+ speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+ var callback = o.callback || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
+
+ return [a[0], o, speed, callback];
+
+}
+
+//Extend the methods of jQuery
+$.fn.extend({
+
+ //Save old methods
+ _show: $.fn.show,
+ _hide: $.fn.hide,
+ __toggle: $.fn.toggle,
+ _addClass: $.fn.addClass,
+ _removeClass: $.fn.removeClass,
+ _toggleClass: $.fn.toggleClass,
+
+ // New effect methods
+ effect: function(fx, options, speed, callback) {
+ return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
+ },
+
+ show: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._show.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
+ }
+ },
+
+ hide: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._hide.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
+ }
+ },
+
+ toggle: function(){
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
+ return this.__toggle.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
+ }
+ },
+
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+ toggleClass: function(classNames,speed,easing,callback) {
+ return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
+ },
+ morph: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ },
+ switchClass: function() {
+ return this.morph.apply(this, arguments);
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+/*
+ * jQuery Color Animations
+ * Copyright 2007 John Resig
+ * Released under the MIT and GPL licenses.
+ */
+
+// We override the animation for all of these color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
+ $.fx.step[attr] = function(fx) {
+ if ( fx.state == 0 ) {
+ fx.start = getColor( fx.elem, attr );
+ fx.end = getRGB( fx.end );
+ }
+
+ fx.elem.style[attr] = "rgb(" + [
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
+ ].join(",") + ")";
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop")) || 0;
+ offset.left -= parseInt(el.css("marginLeft")) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1]) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var color = o.options.color || "#ffff99"; // Default highlight color
+ var oldColor = el.css("backgroundColor");
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
+
+ // Animation
+ var animation = {backgroundColor: oldColor };
+ if (mode == "hide") animation['opacity'] = 0;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == "hide") el.hide();
+ $.effects.restore(el, props);
+ if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
+ if(o.callback) o.callback.apply(this, arguments);
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var times = o.options.times || 5; // Default # of times
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ if (mode == 'hide') times--;
+ if (el.is(':hidden')) { // Show fadeIn
+ el.css('opacity', 0);
+ el.show(); // Show
+ el.animate({opacity: 1}, duration, o.options.easing);
+ times = times-2;
+ }
+
+ // Animate
+ for (var i = 0; i < times; i++) { // Pulsate
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
+ };
+ if (mode == 'hide') { // Last Pulse
+ el.animate({opacity: 0}, duration, o.options.easing, function(){
+ el.hide(); // Hide
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var percent = parseInt(o.options.percent) || 150; // Set default puff percent
+ options.fade = true; // It's not a puff if it doesn't fade! :)
+ var original = {height: el.height(), width: el.width()}; // Save original
+
+ // Adjust
+ var factor = percent / 100;
+ el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
+
+ // Animation
+ options.from = el.from;
+ options.percent = (mode == 'hide') ? percent : 100;
+ options.mode = mode;
+
+ // Animate
+ el.effect('scale', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent) || (parseInt(o.options.percent) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var target = $(o.options.to); // Find Target
+ var position = el.offset();
+ var transfer = $('<div class="ui-effects-transfer"></div>').appendTo(document.body);
+ if(o.options.className) transfer.addClass(o.options.className);
+
+ // Set target css
+ transfer.addClass(o.options.className);
+ transfer.css({
+ top: position.top,
+ left: position.left,
+ height: el.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')),
+ width: el.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')),
+ position: 'absolute'
+ });
+
+ // Animation
+ position = target.offset();
+ animation = {
+ top: position.top,
+ left: position.left,
+ height: target.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')),
+ width: target.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth'))
+ };
+
+ // Animate
+ transfer.animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove(); // Remove div
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
diff --git a/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.min.js b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.min.js
new file mode 100644
index 0000000..2d97bb8
--- /dev/null
+++ b/samples/OpenIdRelyingPartyMvc/Content/scripts/jquery-ui-personalized-1.6rc6.min.js
@@ -0,0 +1,184 @@
+/*
+ * jQuery UI 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */ (function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.6rc6",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n){return}for(var m=0;m<n.length;m++){if(j.options[n[m][0]]){n[m][1].apply(j.element,k)}}}},contains:function(k,j){return document.compareDocumentPosition?k.compareDocumentPosition(j)&16:k!==j&&k.contains(j)},cssCache:{},css:function(j){if(c.ui.cssCache[j]){return c.ui.cssCache[j]}var k=c('<div class="ui-gen"></div>').addClass(j).css({position:"absolute",top:"-5000px",left:"-5000px",display:"block"}).appendTo("body");c.ui.cssCache[j]=!!((!(/auto|default/).test(k.css("cursor"))||(/^[1-9]/).test(k.css("height"))||(/^[1-9]/).test(k.css("width"))||!(/none/).test(k.css("backgroundImage"))||!(/transparent|rgba\(0, 0, 0, 0\)/).test(k.css("backgroundColor"))));try{c("body").get(0).removeChild(k.get(0))}catch(l){}return c.ui.cssCache[j]},hasScroll:function(m,k){if(c(m).css("overflow")=="hidden"){return false}var j=(k&&k=="left")?"scrollLeft":"scrollTop",l=false;if(m[j]>0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=true;this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);;/*
+ * jQuery UI Draggable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */ (function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.cssNamespace&&this.element.addClass(this.options.cssNamespace+"-draggable"));(this.options.disabled&&this.element.addClass(this.options.cssNamespace+"-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+"-draggable "+this.options.cssNamespace+"-draggable-dragging "+this.options.cssNamespace+"-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is("."+this.options.cssNamespace+"-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass(c.cssNamespace+"-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body&&a.browser.mozilla)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c)}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop()))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft()))}},_clear:function(){this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(b,c,d){d=d||this._uiHash();a.ui.plugin.call(this,b,[c,d]);if(b=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(b){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs}}}));a.extend(a.ui.draggable,{version:"1.6rc6",eventPrefix:"drag",defaults:{appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cssNamespace:"ui",cursor:"default",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});a.ui.plugin.add("draggable","connectToSortable",{start:function(b,d){var c=a(this).data("draggable"),e=c.options;c.sortables=[];a(e.connectToSortable).each(function(){a(typeof this=="string"?this+"":this).each(function(){if(a.data(this,"sortable")){var f=a.data(this,"sortable");c.sortables.push({instance:f,shouldRevert:f.options.revert});f._refreshItems();f._trigger("activate",b,c)}})})},stop:function(b,d){var c=a(this).data("draggable");a.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(b);this.instance.options.helper=this.instance.options._helper;if(c.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",b,c)}})},drag:function(c,f){var e=a(this).data("draggable"),b=this;var d=function(i){var n=this.offset.click.top,m=this.offset.click.left;var g=this.positionAbs.top,k=this.positionAbs.left;var j=i.height,l=i.width;var p=i.top,h=i.left;return a.ui.isOver(g+n,k+m,p,h,j,l)};a.each(e.sortables,function(g){if(d.call(e,this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(b).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c,true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=e.offset.click.top;this.instance.offset.click.left=e.offset.click.left;this.instance.offset.parent.left-=e.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=e.offset.parent.top-this.instance.offset.parent.top;e._trigger("toSortable",c);e.dropped=this.instance.element;this.instance.fromOutside=e}if(this.instance.currentItem){this.instance._mouseDrag(c)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}e._trigger("fromSortable",c);e.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(c,d){var b=a("body"),e=a(this).data("draggable").options;if(b.css("cursor")){e._cursor=b.css("cursor")}b.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._cursor){a("body").css("cursor",d._cursor)}}});a.ui.plugin.add("draggable","iframeFix",{start:function(b,c){var d=a(this).data("draggable").options;a(d.iframeFix===true?"iframe":d.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop+f.scrollSpeed}else{if(d.pageY-c.overflowOffset.top<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop-f.scrollSpeed}}}if(!f.axis||f.axis!="y"){if((c.overflowOffset.left+c.scrollParent[0].offsetWidth)-d.pageX<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft+f.scrollSpeed}else{if(d.pageX-c.overflowOffset.left<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft-f.scrollSpeed}}}}else{if(!f.axis||f.axis!="x"){if(d.pageY-a(document).scrollTop()<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-f.scrollSpeed)}else{if(a(window).height()-(d.pageY-a(document).scrollTop())<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+f.scrollSpeed)}}}if(!f.axis||f.axis!="y"){if(d.pageX-a(document).scrollLeft()<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-f.scrollSpeed)}else{if(a(window).width()-(d.pageX-a(document).scrollLeft())<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+f.scrollSpeed)}}}}if(b!==false&&a.ui.ddmanager&&!f.dropBehaviour){a.ui.ddmanager.prepareOffsets(c,d)}}});a.ui.plugin.add("draggable","snap",{start:function(c,d){var b=a(this).data("draggable"),e=b.options;b.snapElements=[];a(e.snap.constructor!=String?(e.snap.items||":data(draggable)"):e.snap).each(function(){var g=a(this);var f=g.offset();if(this!=b.element[0]){b.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:f.top,left:f.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.absolutePosition.left,w=x+g.helperProportions.width,f=p.absolutePosition.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(b,c){var e=a(this).data("draggable").options;var d=a.makeArray(a(e.stack.group)).sort(function(g,f){return(parseInt(a(g).css("zIndex"),10)||e.stack.min)-(parseInt(a(f).css("zIndex"),10)||e.stack.min)});a(d).each(function(f){this.style.zIndex=e.stack.min+f});this[0].style.zIndex=e.stack.min+d.length}});a.ui.plugin.add("draggable","zIndex",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("zIndex")){e._zIndex=b.css("zIndex")}b.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._zIndex){a(c.helper).css("zIndex",d._zIndex)}}})})(jQuery);;/*
+ * jQuery UI Resizable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */ (function(b){b.widget("ui.resizable",b.extend({},b.ui.mouse,{_init:function(){var d=this,h=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!(h.aspectRatio),aspectRatio:h.aspectRatio,originalElement:this.element,proportionallyResize:h.proportionallyResize?[h.proportionallyResize]:[],_helper:h.helper||h.ghost||h.animate?h.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&b.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent();this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});if(b.browser.safari&&h.preventDefault){this.originalElement.css("resize","none")}this.proportionallyResize.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var j=this.handles.split(",");this.handles={};for(var e=0;e<j.length;e++){var g=b.trim(j[e]),c="ui-resizable-"+g;var f=b('<div class="ui-resizable-handle '+c+'"></div>');if(/sw|se|ne|nw/.test(g)){f.css({zIndex:++h.zIndex})}if("se"==g){f.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[g]=".ui-resizable-"+g;this.element.append(f)}}this._renderAxis=function(o){o=o||this.element;for(var l in this.handles){if(this.handles[l].constructor==String){this.handles[l]=b(this.handles[l],this.element).show()}if(h.transparent){this.handles[l].css({opacity:0})}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var m=b(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?m.outerHeight():m.outerWidth();var k=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");if(!h.transparent){o.css(k,n)}this._proportionallyResize()}if(!b(this.handles[l]).length){continue}}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element);if(h.disableSelection){this._handles.disableSelection()}this._handles.mouseover(function(){if(!d.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}d.axis=i&&i[1]?i[1]:"se"}});if(h.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");d._handles.show()},function(){if(!d.resizing){b(this).addClass("ui-resizable-autohide");d._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var c=function(d){b(d).removeClass("ui-resizable ui-resizable-disabled").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){c(this.element);this.wrapper.parent().append(this.originalElement.css({position:this.wrapper.css("position"),width:this.wrapper.outerWidth(),height:this.wrapper.outerHeight(),top:this.wrapper.css("top"),left:this.wrapper.css("left")})).end().remove()}c(this.originalElement)},_mouseCapture:function(d){var e=false;for(var c in this.handles){if(b(this.handles[c])[0]==d.target){e=true}}return this.options.disabled||!!e},_mouseStart:function(e){var h=this.options,d=this.element.position(),c=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(c.is(".ui-draggable")||(/absolute/).test(c.css("position"))){c.css({position:"absolute",top:d.top,left:d.left})}if(b.browser.opera&&(/relative/).test(c.css("position"))){c.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var i=a(this.helper.css("left")),f=a(this.helper.css("top"));if(h.containment){i+=b(h.containment).scrollLeft()||0;f+=b(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:i,top:f};this.size=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalSize=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalPosition={left:i,top:f};this.sizeDiff={width:c.outerWidth()-c.width(),height:c.outerHeight()-c.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=(typeof h.aspectRatio=="number")?h.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);if(h.preserveCursor){var g=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",g=="auto"?this.axis+"-resize":g)}this._propagate("start",e);return true},_mouseDrag:function(c){var f=this.helper,e=this.options,k={},n=this,h=this.originalMousePosition,l=this.axis;var p=(c.pageX-h.left)||0,m=(c.pageY-h.top)||0;var g=this._change[l];if(!g){return false}var j=g.apply(this,[c,p,m]),i=b.browser.msie&&b.browser.version<7,d=this.sizeDiff;if(this._aspectRatio||c.shiftKey){j=this._updateRatio(j,c)}j=this._respectSize(j,c);this._propagate("resize",c);f.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this.proportionallyResize.length){this._proportionallyResize()}this._updateCache(j);this._trigger("resize",c,this.ui());return false},_mouseStop:function(f){this.resizing=false;var g=this.options,k=this;if(this._helper){var e=this.proportionallyResize,c=e.length&&(/textarea/i).test(e[0].nodeName),d=c&&b.ui.hasScroll(e[0],"left")?0:k.sizeDiff.height,i=c?0:k.sizeDiff.width;var l={width:(k.size.width-i),height:(k.size.height-d)},h=(parseInt(k.element.css("left"),10)+(k.position.left-k.originalPosition.left))||null,j=(parseInt(k.element.css("top"),10)+(k.position.top-k.originalPosition.top))||null;if(!g.animate){this.element.css(b.extend(l,{top:j,left:h}))}if(this._helper&&!g.animate){this._proportionallyResize()}}if(g.preserveCursor){b("body").css("cursor","auto")}this._propagate("stop",f);if(this._helper){this.helper.remove()}return false},_updateCache:function(c){var d=this.options;this.offset=this.helper.offset();if(c.left){this.position.left=c.left}if(c.top){this.position.top=c.top}if(c.height){this.size.height=c.height}if(c.width){this.size.width=c.width}},_updateRatio:function(f,e){var g=this.options,h=this.position,d=this.size,c=this.axis;if(f.height){f.width=(d.height*this.aspectRatio)}else{if(f.width){f.height=(d.width/this.aspectRatio)}}if(c=="sw"){f.left=h.left+(d.width-f.width);f.top=null}if(c=="nw"){f.top=h.top+(d.height-f.height);f.left=h.left+(d.width-f.width)}return f},_respectSize:function(j,e){var r=function(o){return !isNaN(parseInt(o,10))};var h=this.helper,g=this.options,p=this._aspectRatio||e.shiftKey,n=this.axis,s=r(j.width)&&g.maxWidth&&(g.maxWidth<j.width),k=r(j.height)&&g.maxHeight&&(g.maxHeight<j.height),f=r(j.width)&&g.minWidth&&(g.minWidth>j.width),q=r(j.height)&&g.minHeight&&(g.minHeight>j.height);if(f){j.width=g.minWidth}if(q){j.height=g.minHeight}if(s){j.width=g.maxWidth}if(k){j.height=g.maxHeight}var d=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height;var i=/sw|nw|w/.test(n),c=/nw|ne|n/.test(n);if(f&&i){j.left=d-g.minWidth}if(s&&i){j.left=d-g.maxWidth}if(q&&c){j.top=m-g.minHeight}if(k&&c){j.top=m-g.maxHeight}var l=!j.width&&!j.height;if(l&&!j.left&&j.top){j.top=null}else{if(l&&!j.top&&j.left){j.left=null}}return j},_proportionallyResize:function(){var h=this.options;if(!this.proportionallyResize.length){return}var e=this.helper||this.element;for(var d=0;d<this.proportionallyResize.length;d++){var f=this.proportionallyResize[d];if(!this.borderDif){var c=[f.css("borderTopWidth"),f.css("borderRightWidth"),f.css("borderBottomWidth"),f.css("borderLeftWidth")],g=[f.css("paddingTop"),f.css("paddingRight"),f.css("paddingBottom"),f.css("paddingLeft")];this.borderDif=b.map(c,function(j,l){var k=parseInt(j,10)||0,m=parseInt(g[l],10)||0;return k+m})}if(b.browser.msie&&!(!(b(e).is(":hidden")||b(e).parents(":hidden").length))){continue}f.css({height:(e.height()-this.borderDif[0]-this.borderDif[2])||0,width:(e.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var d=this.element,g=this.options;this.elementOffset=d.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var c=b.browser.msie&&b.browser.version<7,e=(c?1:0),f=(c?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++g.zIndex});this.helper.appendTo("body");if(g.disableSelection){this.helper.disableSelection()}}else{this.helper=this.element}},_change:{e:function(e,d,c){return{width:this.originalSize.width+d}},w:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{left:g.left+d,width:e.width-d}},n:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{top:g.top+c,height:e.height-c}},s:function(e,d,c){return{height:this.originalSize.height+c}},se:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},sw:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,d,c]))},ne:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},nw:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,d,c]))}},_propagate:function(d,c){b.ui.plugin.call(this,d,[c,this.ui()]);(d!="resize"&&this._trigger(d,c,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));b.extend(b.ui.resizable,{version:"1.6rc6",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,disableSelection:true,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,preserveCursor:true,preventDefault:true,proportionallyResize:false,transparent:false,zIndex:1000}});b.ui.plugin.add("resizable","alsoResize",{start:function(d,e){var c=b(this).data("resizable"),f=c.options;_store=function(g){b(g).each(function(){b(this).data("resizable-alsoresize",{width:parseInt(b(this).width(),10),height:parseInt(b(this).height(),10),left:parseInt(b(this).css("left"),10),top:parseInt(b(this).css("top"),10)})})};if(typeof(f.alsoResize)=="object"&&!f.alsoResize.parentNode){if(f.alsoResize.length){f.alsoResize=f.alsoResize[0];_store(f.alsoResize)}else{b.each(f.alsoResize,function(g,h){_store(g)})}}else{_store(f.alsoResize)}},resize:function(e,g){var d=b(this).data("resizable"),h=d.options,f=d.originalSize,j=d.originalPosition;var i={height:(d.size.height-f.height)||0,width:(d.size.width-f.width)||0,top:(d.position.top-j.top)||0,left:(d.position.left-j.left)||0},c=function(k,l){b(k).each(function(){var o=b(this),p=b(this).data("resizable-alsoresize"),n={},m=l&&l.length?l:["width","height","top","left"];b.each(m||["width","height","top","left"],function(q,s){var r=(p[s]||0)+(i[s]||0);if(r&&r>=0){n[s]=r||null}});if(/relative/.test(o.css("position"))&&b.browser.opera){d._revertToRelativePosition=true;o.css({position:"absolute",top:"auto",left:"auto"})}o.css(n)})};if(typeof(h.alsoResize)=="object"&&!h.alsoResize.nodeType){b.each(h.alsoResize,function(k,l){c(k,l)})}else{c(h.alsoResize)}},stop:function(d,e){var c=b(this).data("resizable");if(c._revertToRelativePosition&&b.browser.opera){c._revertToRelativePosition=false;el.css({position:"relative"})}b(this).removeData("resizable-alsoresize-start")}});b.ui.plugin.add("resizable","animate",{stop:function(g,l){var m=b(this).data("resizable"),h=m.options;var f=h.proportionallyResize,c=f&&(/textarea/i).test(f.get(0).nodeName),d=c&&b.ui.hasScroll(f.get(0),"left")?0:m.sizeDiff.height,j=c?0:m.sizeDiff.width;var e={width:(m.size.width-j),height:(m.size.height-d)},i=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,k=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;m.element.animate(b.extend(e,k&&i?{top:k,left:i}:{}),{duration:h.animateDuration,easing:h.animateEasing,step:function(){var n={width:parseInt(m.element.css("width"),10),height:parseInt(m.element.css("height"),10),top:parseInt(m.element.css("top"),10),left:parseInt(m.element.css("left"),10)};if(f){f.css({width:n.width,height:n.height})}m._updateCache(n);m._propagate("resize",g)}})}});b.ui.plugin.add("resizable","containment",{start:function(d,n){var r=b(this).data("resizable"),h=r.options,j=r.element;var e=h.containment,i=(e instanceof b)?e.get(0):(/parent/.test(e))?j.parent().get(0):e;if(!i){return}r.containerElement=b(i);if(/document/.test(e)||e==document){r.containerOffset={left:0,top:0};r.containerPosition={left:0,top:0};r.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var l=b(i),g=[];b(["Top","Right","Left","Bottom"]).each(function(p,o){g[p]=a(l.css("padding"+o))});r.containerOffset=l.offset();r.containerPosition=l.position();r.containerSize={height:(l.innerHeight()-g[3]),width:(l.innerWidth()-g[1])};var m=r.containerOffset,c=r.containerSize.height,k=r.containerSize.width,f=(b.ui.hasScroll(i,"left")?i.scrollWidth:k),q=(b.ui.hasScroll(i)?i.scrollHeight:c);r.parentData={element:i,left:m.left,top:m.top,width:f,height:q}}},resize:function(e,l){var p=b(this).data("resizable"),g=p.options,d=p.containerSize,k=p.containerOffset,i=p.size,j=p.position,m=g._aspectRatio||e.shiftKey,c={top:0,left:0},f=p.containerElement;if(f[0]!=document&&(/static/).test(f.css("position"))){c=k}if(j.left<(p._helper?k.left:0)){p.size.width=p.size.width+(p._helper?(p.position.left-k.left):(p.position.left-c.left));if(m){p.size.height=p.size.width/g.aspectRatio}p.position.left=g.helper?k.left:0}if(j.top<(p._helper?k.top:0)){p.size.height=p.size.height+(p._helper?(p.position.top-k.top):p.position.top);if(m){p.size.width=p.size.height*g.aspectRatio}p.position.top=p._helper?k.top:0}var h=Math.abs((p._helper?p.offset.left-c.left:(p.offset.left-c.left))+p.sizeDiff.width),n=Math.abs((p._helper?p.offset.top-c.top:(p.offset.top-k.top))+p.sizeDiff.height);if(h+p.size.width>=p.parentData.width){p.size.width=p.parentData.width-h;if(m){p.size.height=p.size.width/g.aspectRatio}}if(n+p.size.height>=p.parentData.height){p.size.height=p.parentData.height-n;if(m){p.size.width=p.size.height*g.aspectRatio}}},stop:function(d,l){var n=b(this).data("resizable"),e=n.options,j=n.position,k=n.containerOffset,c=n.containerPosition,f=n.containerElement;var g=b(n.helper),p=g.offset(),m=g.outerWidth()-n.sizeDiff.width,i=g.outerHeight()-n.sizeDiff.height;if(n._helper&&!e.animate&&(/relative/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}if(n._helper&&!e.animate&&(/static/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}}});b.ui.plugin.add("resizable","ghost",{start:function(e,f){var c=b(this).data("resizable"),g=c.options,h=g.proportionallyResize,d=c.size;c.ghost=c.originalElement.clone();c.ghost.css({opacity:0.25,display:"block",position:"relative",height:d.height,width:d.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof g.ghost=="string"?g.ghost:"");c.ghost.appendTo(c.helper)},resize:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost){c.ghost.css({position:"relative",height:c.size.height,width:c.size.width})}},stop:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost&&c.helper){c.helper.get(0).removeChild(c.ghost.get(0))}}});b.ui.plugin.add("resizable","grid",{resize:function(c,k){var m=b(this).data("resizable"),f=m.options,i=m.size,g=m.originalSize,h=m.originalPosition,l=m.axis,j=f._aspectRatio||c.shiftKey;f.grid=typeof f.grid=="number"?[f.grid,f.grid]:f.grid;var e=Math.round((i.width-g.width)/(f.grid[0]||1))*(f.grid[0]||1),d=Math.round((i.height-g.height)/(f.grid[1]||1))*(f.grid[1]||1);if(/^(se|s|e)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d}else{if(/^(ne)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d}else{if(/^(sw)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.left=h.left-e}else{m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d;m.position.left=h.left-e}}}}});var a=function(c){return parseInt(c,10)||0}})(jQuery);;/*
+ * jQuery UI Dialog 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */ (function(b){var a={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"};b.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");var k=this,l=this.options,i=l.title||this.originalTitle||"&nbsp;",d=b.ui.dialog.getTitleId(this.element),j=(this.uiDialog=b("<div/>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+l.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:l.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(m){(l.closeOnEscape&&m.keyCode&&m.keyCode==b.ui.keyCode.ESCAPE&&k.close(m))}).attr({role:"dialog","aria-labelledby":d}).mousedown(function(m){k.moveToTop(m)}),f=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j),e=(this.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j),h=b('<a href="#"/>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).mousedown(function(m){m.stopPropagation()}).click(function(m){k.close(m);return false}).appendTo(e),g=(this.uiDialogTitlebarCloseText=b("<span/>")).addClass("ui-icon ui-icon-closethick").text(l.closeText).appendTo(h),c=b("<span/>").addClass("ui-dialog-title").attr("id",d).html(i).prependTo(e);e.find("*").add(e).disableSelection();(l.draggable&&b.fn.draggable&&this._makeDraggable());(l.resizable&&b.fn.resizable&&this._makeResizable());this._createButtons(l.buttons);this._isOpen=false;(l.bgiframe&&b.fn.bgiframe&&j.bgiframe());(l.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(c){if(false===this._trigger("beforeclose",c)){return}(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide(this.options.hide).unbind("keypress.ui-dialog");this._trigger("close",c);b.ui.dialog.overlay.resize();this._isOpen=false},isOpen:function(){return this._isOpen},moveToTop:function(g,f){if((this.options.modal&&!g)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",f)}var e=this.options.zIndex,d=this.options;b(".ui-dialog:visible").each(function(){e=Math.max(e,parseInt(b(this).css("z-index"),10)||d.zIndex)});(this.overlay&&this.overlay.$el.css("z-index",++e));(this.shadow&&this.shadow.css("z-index",++e));var c={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++e);this.element.attr(c);this._trigger("focus",f)},open:function(e){if(this._isOpen){return}var d=this.options,c=this.uiDialog;this.overlay=d.modal?new b.ui.dialog.overlay(this):null;(c.next().length&&c.appendTo("body"));this._size();this._position(d.position);c.show(d.show);this.moveToTop(true,e);(d.modal&&c.bind("keypress.ui-dialog",function(h){if(h.keyCode!=b.ui.keyCode.TAB){return}var g=b(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));b([]).add(c.find(".ui-dialog-content :tabbable:first")).add(c.find(".ui-dialog-buttonpane :tabbable:first")).add(c.find(".ui-dialog-titlebar :tabbable:first")).filter(":first").focus();if(d.shadow){this._createShadow()}this._trigger("open",e);this._isOpen=true},_createButtons:function(f){var e=this,c=false,d=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof f=="object"&&f!==null&&b.each(f,function(){return !(c=true)}));if(c){b.each(f,function(g,h){b('<button type="button"></button>').addClass("ui-state-default ui-corner-all").text(g).click(function(){h.apply(e.element[0],arguments)}).hover(function(){b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){b(this).addClass("ui-state-focus")}).blur(function(){b(this).removeClass("ui-state-focus")}).appendTo(d)});d.appendTo(this.uiDialog)}},_makeDraggable:function(){var c=this,d=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content",helper:d.dragHelper,handle:".ui-dialog-titlebar",containment:"document",start:function(){(d.dragStart&&d.dragStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},drag:function(){(d.drag&&d.drag.apply(c.element[0],arguments));c._refreshShadow(1)},stop:function(){(d.dragStop&&d.dragStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}})},_makeResizable:function(f){f=(f===undefined?this.options.resizable:f);var c=this,e=this.options,d=typeof f=="string"?f:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,helper:e.resizeHelper,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:e.minHeight,start:function(){(e.resizeStart&&e.resizeStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},resize:function(){(e.resize&&e.resize.apply(c.element[0],arguments));c._refreshShadow(1)},handles:d,stop:function(){(e.resizeStop&&e.resizeStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(h){var d=b(window),e=b(document),f=e.scrollTop(),c=e.scrollLeft(),g=f;if(b.inArray(h,["center","top","right","bottom","left"])>=0){h=[h=="right"||h=="left"?h:"center",h=="top"||h=="bottom"?h:"middle"]}if(h.constructor!=Array){h=["center","middle"]}if(h[0].constructor==Number){c+=h[0]}else{switch(h[0]){case"left":c+=0;break;case"right":c+=d.width()-this.uiDialog.outerWidth();break;default:case"center":c+=(d.width()-this.uiDialog.outerWidth())/2}}if(h[1].constructor==Number){f+=h[1]}else{switch(h[1]){case"top":f+=0;break;case"bottom":f+=d.height()-this.uiDialog.outerHeight();break;default:case"middle":f+=(d.height()-this.uiDialog.outerHeight())/2}}f=Math.max(f,g);this.uiDialog.css({top:f,left:c})},_setData:function(d,e){(a[d]&&this.uiDialog.data(a[d],e));switch(d){case"buttons":this._createButtons(e);break;case"closeText":this.uiDialogTitlebarCloseText.text(e);break;case"draggable":(e?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(e);break;case"position":this._position(e);break;case"resizable":var c=this.uiDialog,f=this.uiDialog.is(":data(resizable)");(f&&!e&&c.resizable("destroy"));(f&&typeof e=="string"&&c.resizable("option","handles",e));(f||this._makeResizable(e));break;case"title":b(".ui-dialog-title",this.uiDialogTitlebar).html(e||"&nbsp;");break;case"width":this.uiDialog.width(e);break}b.widget.prototype._setData.apply(this,arguments)},_size:function(){var d=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var c=this.uiDialog.css({height:"auto",width:d.width}).height();this.element.css({minHeight:Math.max(d.minHeight-c,0),height:d.height=="auto"?"auto":d.height-c})},_createShadow:function(){this.shadow=b('<div class="ui-widget-shadow"></div>').css("position","absolute").appendTo(document.body);this._refreshShadow();return this.shadow},_refreshShadow:function(c){if(c&&b.browser.msie&&b.browser.version<7){return}var d=this.uiDialog.offset();this.shadow.css({left:d.left,top:d.top,width:this.uiDialog.outerWidth(),height:this.uiDialog.outerHeight()})},_destroyShadow:function(){this.shadow.remove();this.shadow=null}});b.extend(b.ui.dialog,{version:"1.6rc6",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",draggable:true,height:"auto",minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,shadow:true,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,getTitleId:function(c){return"ui-dialog-title-"+(c.attr("id")||++this.uuid)},overlay:function(c){this.$el=b.ui.dialog.overlay.create(c)}});b.extend(b.ui.dialog.overlay,{instances:[],events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(c){return c+".dialog-overlay"}).join(" "),create:function(d){if(this.instances.length===0){setTimeout(function(){b("a, :input").bind(b.ui.dialog.overlay.events,function(){var f=false;var h=b(this).parents(".ui-dialog");if(h.length){var e=b(".ui-dialog-overlay");if(e.length){var g=parseInt(e.css("z-index"),10);e.each(function(){g=Math.max(g,parseInt(b(this).css("z-index"),10))});f=parseInt(h.css("z-index"),10)>g}else{f=true}}return f})},1);b(document).bind("keydown.dialog-overlay",function(e){(d.options.closeOnEscape&&e.keyCode&&e.keyCode==b.ui.keyCode.ESCAPE&&d.close(e))});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var c=b("<div></div>").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(d.options.bgiframe&&b.fn.bgiframe&&c.bgiframe());this.instances.push(c);return c},destroy:function(c){this.instances.splice(b.inArray(this.instances,c),1);if(this.instances.length===0){b("a, :input").add([document,window]).unbind(".dialog-overlay")}c.remove()},height:function(){if(b.browser.msie&&b.browser.version<7){var d=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(d<c){return b(window).height()+"px"}else{return d+"px"}}else{return b(document).height()+"px"}},width:function(){if(b.browser.msie&&b.browser.version<7){var c=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var d=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(c<d){return b(window).width()+"px"}else{return c+"px"}}else{return b(document).width()+"px"}},resize:function(){var c=b([]);b.each(b.ui.dialog.overlay.instances,function(){c=c.add(this)});c.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);;/*
+ * jQuery UI Effects 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */ (function(d){d.effects=d.effects||{};d.extend(d.effects,{version:"1.6rc6",save:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.data("ec.storage."+h[f],g[0].style[h[f]])}}},restore:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.css(h[f],g.data("ec.storage."+h[f]))}}},setMode:function(f,g){if(g=="toggle"){g=f.is(":hidden")?"show":"hide"}return g},getBaseline:function(g,h){var i,f;switch(g[0]){case"top":i=0;break;case"middle":i=0.5;break;case"bottom":i=1;break;default:i=g[0]/h.height}switch(g[1]){case"left":f=0;break;case"center":f=0.5;break;case"right":f=1;break;default:f=g[1]/h.width}return{x:f,y:i}},createWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent()}var g={width:f.outerWidth(true),height:f.outerHeight(true),"float":f.css("float")};f.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}});function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:i.duration;h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return -(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f},easeOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return h*Math.pow(2,-10*i)*Math.sin((i*l-j)*(2*Math.PI)/k)+m+f},easeInOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l/2)==2){return f+m}if(!k){k=l*(0.3*1.5)}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}if(i<1){return -0.5*(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f}return h*Math.pow(2,-10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k)*0.5+m+f},easeInBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*(h/=j)*h*((i+1)*h-i)+f},easeOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*((h=h/j-1)*h*((i+1)*h+i)+1)+f},easeInOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}if((h/=j/2)<1){return k/2*(h*h*(((i*=(1.525))+1)*h-i))+f}return k/2*((h-=2)*h*(((i*=(1.525))+1)*h+i)+2)+f},easeInBounce:function(g,h,f,j,i){return j-d.easing.easeOutBounce(g,i-h,0,j,i)+f},easeOutBounce:function(g,h,f,j,i){if((h/=i)<(1/2.75)){return j*(7.5625*h*h)+f}else{if(h<(2/2.75)){return j*(7.5625*(h-=(1.5/2.75))*h+0.75)+f}else{if(h<(2.5/2.75)){return j*(7.5625*(h-=(2.25/2.75))*h+0.9375)+f}else{return j*(7.5625*(h-=(2.625/2.75))*h+0.984375)+f}}}},easeInOutBounce:function(g,h,f,j,i){if(h<i/2){return d.easing.easeInBounce(g,h*2,0,j,i)*0.5+f}return d.easing.easeOutBounce(g,h*2-i,0,j,i)*0.5+j*0.5+f}})})(jQuery);;/*
+ * jQuery UI Effects Blind 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.blind=function(b){return this.queue(function(){var d=a(this),c=["position","top","left"];var h=a.effects.setMode(d,b.options.mode||"hide");var g=b.options.direction||"vertical";a.effects.save(d,c);d.show();var j=a.effects.createWrapper(d).css({overflow:"hidden"});var e=(g=="vertical")?"height":"width";var i=(g=="vertical")?j.height():j.width();if(h=="show"){j.css(e,0)}var f={};f[e]=h=="show"?i:0;j.animate(f,b.duration,b.options.easing,function(){if(h=="hide"){d.hide()}a.effects.restore(d,c);a.effects.removeWrapper(d);if(b.callback){b.callback.apply(d[0],arguments)}d.dequeue()})})}})(jQuery);;/*
+ * jQuery UI Effects Bounce 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.bounce=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"up";var c=b.options.distance||20;var d=b.options.times||5;var g=b.duration||250;if(/show|hide/.test(k)){l.push("opacity")}a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var c=b.options.distance||(f=="top"?e.outerHeight({margin:true})/3:e.outerWidth({margin:true})/3);if(k=="show"){e.css("opacity",0).css(f,p=="pos"?-c:c)}if(k=="hide"){c=c/(d*2)}if(k!="hide"){d--}if(k=="show"){var h={opacity:1};h[f]=(p=="pos"?"+=":"-=")+c;e.animate(h,g/2,b.options.easing);c=c/2;d--}for(var j=0;j<d;j++){var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing);c=(k=="hide")?c*2:c/2}if(k=="hide"){var h={opacity:0};h[f]=(p=="pos"?"-=":"+=")+c;e.animate(h,g/2,b.options.easing,function(){e.hide();a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}else{var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Clip 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.clip=function(b){return this.queue(function(){var f=a(this),j=["position","top","left","height","width"];var i=a.effects.setMode(f,b.options.mode||"hide");var k=b.options.direction||"vertical";a.effects.save(f,j);f.show();var c=a.effects.createWrapper(f).css({overflow:"hidden"});var e=f[0].tagName=="IMG"?c:f;var g={size:(k=="vertical")?"height":"width",position:(k=="vertical")?"top":"left"};var d=(k=="vertical")?e.height():e.width();if(i=="show"){e.css(g.size,0);e.css(g.position,d/2)}var h={};h[g.size]=i=="show"?d:0;h[g.position]=i=="show"?0:d/2;e.animate(h,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){f.hide()}a.effects.restore(f,j);a.effects.removeWrapper(f);if(b.callback){b.callback.apply(f[0],arguments)}f.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Drop 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.drop=function(b){return this.queue(function(){var e=a(this),d=["position","top","left","opacity"];var i=a.effects.setMode(e,b.options.mode||"hide");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e);var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true})/2:e.outerWidth({margin:true})/2);if(i=="show"){e.css("opacity",0).css(f,c=="pos"?-j:j)}var g={opacity:i=="show"?1:0};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Explode 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.explode=function(b){return this.queue(function(){var k=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;var e=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):b.options.mode;var h=a(this).show().css("visibility","hidden");var l=h.offset();l.top-=parseInt(h.css("marginTop"))||0;l.left-=parseInt(h.css("marginLeft"))||0;var g=h.outerWidth(true);var c=h.outerHeight(true);for(var f=0;f<k;f++){for(var d=0;d<e;d++){h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*
+ * jQuery UI Effects Fold 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1])/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;/*
+ * jQuery UI Effects Highlight 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Pulsate 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c<f;c++){d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing)}if(g=="hide"){d.animate({opacity:0},e,b.options.easing,function(){d.hide();if(b.callback){b.callback.apply(this,arguments)}})}else{d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing,function(){if(b.callback){b.callback.apply(this,arguments)}})}d.queue("fx",function(){d.dequeue()});d.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Scale 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.puff=function(b){return this.queue(function(){var f=a(this);var c=a.extend(true,{},b.options);var h=a.effects.setMode(f,b.options.mode||"hide");var g=parseInt(b.options.percent)||150;c.fade=true;var e={height:f.height(),width:f.width()};var d=g/100;f.from=(h=="hide")?e:{height:e.height*d,width:e.width*d};c.from=f.from;c.percent=(h=="hide")?g:100;c.mode=h;f.effect("scale",c,b.duration,b.callback);f.dequeue()})};a.effects.scale=function(b){return this.queue(function(){var g=a(this);var d=a.extend(true,{},b.options);var j=a.effects.setMode(g,b.options.mode||"effect");var h=parseInt(b.options.percent)||(parseInt(b.options.percent)==0?0:(j=="hide"?0:100));var i=b.options.direction||"both";var c=b.options.origin;if(j!="effect"){d.origin=c||["middle","center"];d.restore=true}var f={height:g.height(),width:g.width()};g.from=b.options.from||(j=="show"?{height:0,width:0}:f);var e={y:i!="horizontal"?(h/100):1,x:i!="vertical"?(h/100):1};g.to={height:f.height*e.y,width:f.width*e.x};if(b.options.fade){if(j=="show"){g.from.opacity=0;g.to.opacity=1}if(j=="hide"){g.from.opacity=1;g.to.opacity=0}}d.from=g.from;d.to=g.to;d.mode=j;g.effect("size",d,b.duration,b.callback);g.dequeue()})};a.effects.size=function(b){return this.queue(function(){var c=a(this),n=["position","top","left","width","height","overflow","opacity"];var m=["position","top","left","overflow","opacity"];var j=["width","height","overflow"];var p=["fontSize"];var k=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var f=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var g=a.effects.setMode(c,b.options.mode||"effect");var i=b.options.restore||false;var e=b.options.scale||"both";var o=b.options.origin;var d={height:c.height(),width:c.width()};c.from=b.options.from||d;c.to=b.options.to||d;if(o){var h=a.effects.getBaseline(o,d);c.from.top=(d.height-c.from.height)*h.y;c.from.left=(d.width-c.from.width)*h.x;c.to.top=(d.height-c.to.height)*h.y;c.to.left=(d.width-c.to.width)*h.x}var l={from:{y:c.from.height/d.height,x:c.from.width/d.width},to:{y:c.to.height/d.height,x:c.to.width/d.width}};if(e=="box"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(k);c.from=a.effects.setTransition(c,k,l.from.y,c.from);c.to=a.effects.setTransition(c,k,l.to.y,c.to)}if(l.from.x!=l.to.x){n=n.concat(f);c.from=a.effects.setTransition(c,f,l.from.x,c.from);c.to=a.effects.setTransition(c,f,l.to.x,c.to)}}if(e=="content"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(p);c.from=a.effects.setTransition(c,p,l.from.y,c.from);c.to=a.effects.setTransition(c,p,l.to.y,c.to)}}a.effects.save(c,i?n:m);c.show();a.effects.createWrapper(c);c.css("overflow","hidden").css(c.from);if(e=="content"||e=="both"){k=k.concat(["marginTop","marginBottom"]).concat(p);f=f.concat(["marginLeft","marginRight"]);j=n.concat(k).concat(f);c.find("*[width]").each(function(){child=a(this);if(i){a.effects.save(child,j)}var q={height:child.height(),width:child.width()};child.from={height:q.height*l.from.y,width:q.width*l.from.x};child.to={height:q.height*l.to.y,width:q.width*l.to.x};if(l.from.y!=l.to.y){child.from=a.effects.setTransition(child,k,l.from.y,child.from);child.to=a.effects.setTransition(child,k,l.to.y,child.to)}if(l.from.x!=l.to.x){child.from=a.effects.setTransition(child,f,l.from.x,child.from);child.to=a.effects.setTransition(child,f,l.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){if(i){a.effects.restore(child,j)}})})}c.animate(c.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(g=="hide"){c.hide()}a.effects.restore(c,i?n:m);a.effects.removeWrapper(c);if(b.callback){b.callback.apply(this,arguments)}c.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Shake 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.shake=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"left";var c=b.options.distance||20;var d=b.options.times||3;var g=b.duration||b.options.duration||140;a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var h={},o={},m={};h[f]=(p=="pos"?"-=":"+=")+c;o[f]=(p=="pos"?"+=":"-=")+c*2;m[f]=(p=="pos"?"-=":"+=")+c*2;e.animate(h,g,b.options.easing);for(var j=1;j<d;j++){e.animate(o,g,b.options.easing).animate(m,g,b.options.easing)}e.animate(o,g,b.options.easing).animate(h,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}});e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Slide 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.slide=function(b){return this.queue(function(){var e=a(this),d=["position","top","left"];var i=a.effects.setMode(e,b.options.mode||"show");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true}):e.outerWidth({margin:true}));if(i=="show"){e.css(f,c=="pos"?-j:j)}var g={};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Transfer 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */ (function(a){a.effects.transfer=function(b){return this.queue(function(){var e=a(this);var g=a.effects.setMode(e,b.options.mode||"effect");var f=a(b.options.to);var c=e.offset();var d=a('<div class="ui-effects-transfer"></div>').appendTo(document.body);if(b.options.className){d.addClass(b.options.className)}d.addClass(b.options.className);d.css({top:c.top,left:c.left,height:e.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:e.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth")),position:"absolute"});c=f.offset();animation={top:c.top,left:c.left,height:f.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:f.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth"))};d.animate(animation,b.duration,b.options.easing,function(){d.remove();if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);; \ No newline at end of file