diff options
author | Andrew Arnott <andrewarnott@gmail.com> | 2013-03-26 11:19:06 -0700 |
---|---|---|
committer | Andrew Arnott <andrewarnott@gmail.com> | 2013-03-26 11:19:06 -0700 |
commit | 3d37ff45cab6838d80b22e6b782a0b9b4c2f4aeb (patch) | |
tree | c15816c3d7f6e74334553f2ff98605ce1c22c538 /samples | |
parent | 5e9014f36b2d53b8e419918675df636540ea24e2 (diff) | |
parent | e6f7409f4caceb7bc2a5b4ddbcb1a4097af340f2 (diff) | |
download | DotNetOpenAuth-3d37ff45cab6838d80b22e6b782a0b9b4c2f4aeb.zip DotNetOpenAuth-3d37ff45cab6838d80b22e6b782a0b9b4c2f4aeb.tar.gz DotNetOpenAuth-3d37ff45cab6838d80b22e6b782a0b9b4c2f4aeb.tar.bz2 |
Move to HttpClient throughout library.
Diffstat (limited to 'samples')
262 files changed, 36603 insertions, 3329 deletions
diff --git a/samples/DotNetOpenAuth.ApplicationBlock/DotNetOpenAuth.ApplicationBlock.csproj b/samples/DotNetOpenAuth.ApplicationBlock/DotNetOpenAuth.ApplicationBlock.csproj index 81160f2..19f26b5 100644 --- a/samples/DotNetOpenAuth.ApplicationBlock/DotNetOpenAuth.ApplicationBlock.csproj +++ b/samples/DotNetOpenAuth.ApplicationBlock/DotNetOpenAuth.ApplicationBlock.csproj @@ -33,6 +33,7 @@ <ApplicationVersion>1.0.0.%2a</ApplicationVersion> <UseApplicationTrust>false</UseApplicationTrust> <BootstrapperEnabled>true</BootstrapperEnabled> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> </PropertyGroup> <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> <DebugSymbols>true</DebugSymbols> @@ -68,11 +69,16 @@ <DefineConstants>$(DefineConstants);SAMPLESONLY</DefineConstants> </PropertyGroup> <ItemGroup> + <Reference Include="Newtonsoft.Json"> + <HintPath>..\..\src\packages\Newtonsoft.Json.4.5.11\lib\net40\Newtonsoft.Json.dll</HintPath> + </Reference> <Reference Include="System" /> <Reference Include="System.configuration" /> <Reference Include="System.Core"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Runtime.Serialization" /> <Reference Include="System.ServiceModel.Web" /> <Reference Include="System.Web" /> @@ -93,10 +99,8 @@ <Compile Include="Facebook\FacebookGraph.cs" /> <Compile Include="CustomExtensions\UIRequestAtRelyingPartyFactory.cs" /> <Compile Include="GoogleConsumer.cs" /> + <Compile Include="HttpAsyncHandlerBase.cs" /> <Compile Include="InMemoryClientAuthorizationTracker.cs" /> - <Compile Include="InMemoryTokenManager.cs"> - <SubType>Code</SubType> - </Compile> <Compile Include="Properties\AssemblyInfo.cs" /> <Compile Include="TwitterConsumer.cs" /> <Compile Include="Util.cs" /> @@ -131,6 +135,10 @@ <Project>{60426312-6AE5-4835-8667-37EDEA670222}</Project> <Name>DotNetOpenAuth.Core</Name> </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth.Common\DotNetOpenAuth.OAuth.Common.csproj"> + <Project>{115217c5-22cd-415c-a292-0dd0238cdd89}</Project> + <Name>DotNetOpenAuth.OAuth.Common</Name> + </ProjectReference> <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth.Consumer\DotNetOpenAuth.OAuth.Consumer.csproj"> <Project>{B202E40D-4663-4A2B-ACDA-865F88FF7CAA}</Project> <Name>DotNetOpenAuth.OAuth.Consumer</Name> @@ -168,6 +176,10 @@ <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> </ItemGroup> + <ItemGroup> + <None Include="packages.config" /> + </ItemGroup> <Import Project="$(MSBuildToolsPath)\Microsoft.CSharp.targets" /> <Import Project="$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))\EnlistmentInfo.targets" Condition=" '$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))' != '' " /> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> </Project>
\ No newline at end of file diff --git a/samples/DotNetOpenAuth.ApplicationBlock/GoogleConsumer.cs b/samples/DotNetOpenAuth.ApplicationBlock/GoogleConsumer.cs index 1bdb04d..a7c062e 100644 --- a/samples/DotNetOpenAuth.ApplicationBlock/GoogleConsumer.cs +++ b/samples/DotNetOpenAuth.ApplicationBlock/GoogleConsumer.cs @@ -7,14 +7,20 @@ namespace DotNetOpenAuth.ApplicationBlock { using System; using System.Collections.Generic; + using System.Configuration; using System.Diagnostics; using System.Globalization; using System.IO; using System.Linq; using System.Net; + using System.Net.Http; + using System.Net.Http.Headers; using System.Security.Cryptography.X509Certificates; using System.Text; using System.Text.RegularExpressions; + using System.Threading; + using System.Threading.Tasks; + using System.Web; using System.Xml; using System.Xml.Linq; using DotNetOpenAuth.Messaging; @@ -24,16 +30,15 @@ namespace DotNetOpenAuth.ApplicationBlock { /// <summary> /// A consumer capable of communicating with Google Data APIs. /// </summary> - public static class GoogleConsumer { + public class GoogleConsumer : Consumer { /// <summary> /// The Consumer to use for accessing Google data APIs. /// </summary> - public static readonly ServiceProviderDescription ServiceDescription = new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthGetRequestToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthAuthorizeToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthGetAccessToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - }; + public static readonly ServiceProviderDescription ServiceDescription = + new ServiceProviderDescription( + "https://www.google.com/accounts/OAuthGetRequestToken", + "https://www.google.com/accounts/OAuthAuthorizeToken", + "https://www.google.com/accounts/OAuthGetAccessToken"); /// <summary> /// A mapping between Google's applications and their URI scope values. @@ -60,7 +65,19 @@ namespace DotNetOpenAuth.ApplicationBlock { /// <summary> /// The URI to get contacts once authorization is granted. /// </summary> - private static readonly MessageReceivingEndpoint GetContactsEndpoint = new MessageReceivingEndpoint("http://www.google.com/m8/feeds/contacts/default/full/", HttpDeliveryMethods.GetRequest); + private static readonly Uri GetContactsEndpoint = new Uri("http://www.google.com/m8/feeds/contacts/default/full/"); + + /// <summary> + /// Initializes a new instance of the <see cref="GoogleConsumer"/> class. + /// </summary> + public GoogleConsumer() { + this.ServiceProvider = ServiceDescription; + this.ConsumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; + this.ConsumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; + this.TemporaryCredentialStorage = HttpContext.Current != null + ? (ITemporaryCredentialStorage)new CookieTemporaryCredentialStorage() + : new MemoryTemporaryCredentialStorage(); + } /// <summary> /// The many specific authorization scopes Google offers. @@ -149,91 +166,60 @@ namespace DotNetOpenAuth.ApplicationBlock { } /// <summary> - /// The service description to use for accessing Google data APIs using an X509 certificate. + /// Gets the scope URI in Google's format. /// </summary> - /// <param name="signingCertificate">The signing certificate.</param> - /// <returns>A service description that can be used to create an instance of - /// <see cref="DesktopConsumer"/> or <see cref="WebConsumer"/>. </returns> - public static ServiceProviderDescription CreateRsaSha1ServiceDescription(X509Certificate2 signingCertificate) { - if (signingCertificate == null) { - throw new ArgumentNullException("signingCertificate"); - } - - return new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthGetRequestToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthAuthorizeToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint("https://www.google.com/accounts/OAuthGetAccessToken", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new RsaSha1ConsumerSigningBindingElement(signingCertificate) }, - }; + /// <param name="scope">The scope, which may include one or several Google applications.</param> + /// <returns>A space-delimited list of URIs for the requested Google applications.</returns> + public static string GetScopeUri(Applications scope) { + return string.Join(" ", Util.GetIndividualFlags(scope).Select(app => DataScopeUris[(Applications)app]).ToArray()); } /// <summary> /// Requests authorization from Google to access data from a set of Google applications. /// </summary> - /// <param name="consumer">The Google consumer previously constructed using <see cref="CreateWebConsumer"/> or <see cref="CreateDesktopConsumer"/>.</param> /// <param name="requestedAccessScope">The requested access scope.</param> - public static void RequestAuthorization(WebConsumer consumer, Applications requestedAccessScope) { - if (consumer == null) { - throw new ArgumentNullException("consumer"); - } - + /// <param name="cancellationToken">The cancellation token.</param> + /// <returns> + /// A task that completes with the asynchronous operation. + /// </returns> + public Task<Uri> RequestUserAuthorizationAsync(Applications requestedAccessScope, CancellationToken cancellationToken = default(CancellationToken)) { var extraParameters = new Dictionary<string, string> { { "scope", GetScopeUri(requestedAccessScope) }, }; Uri callback = Util.GetCallbackUrlFromContext(); - var request = consumer.PrepareRequestUserAuthorization(callback, extraParameters, null); - consumer.Channel.Send(request); - } - - /// <summary> - /// Requests authorization from Google to access data from a set of Google applications. - /// </summary> - /// <param name="consumer">The Google consumer previously constructed using <see cref="CreateWebConsumer"/> or <see cref="CreateDesktopConsumer"/>.</param> - /// <param name="requestedAccessScope">The requested access scope.</param> - /// <param name="requestToken">The unauthorized request token assigned by Google.</param> - /// <returns>The request token</returns> - public static Uri RequestAuthorization(DesktopConsumer consumer, Applications requestedAccessScope, out string requestToken) { - if (consumer == null) { - throw new ArgumentNullException("consumer"); - } - - var extraParameters = new Dictionary<string, string> { - { "scope", GetScopeUri(requestedAccessScope) }, - }; - - return consumer.RequestUserAuthorization(extraParameters, null, out requestToken); + return this.RequestUserAuthorizationAsync(callback, extraParameters, cancellationToken); } /// <summary> /// Gets the Gmail address book's contents. /// </summary> - /// <param name="consumer">The Google consumer.</param> /// <param name="accessToken">The access token previously retrieved.</param> /// <param name="maxResults">The maximum number of entries to return. If you want to receive all of the contacts, rather than only the default maximum, you can specify a very large number here.</param> /// <param name="startIndex">The 1-based index of the first result to be retrieved (for paging).</param> - /// <returns>An XML document returned by Google.</returns> - public static XDocument GetContacts(ConsumerBase consumer, string accessToken, int maxResults/* = 25*/, int startIndex/* = 1*/) { - if (consumer == null) { - throw new ArgumentNullException("consumer"); - } - - var extraData = new Dictionary<string, string>() { - { "start-index", startIndex.ToString(CultureInfo.InvariantCulture) }, - { "max-results", maxResults.ToString(CultureInfo.InvariantCulture) }, - }; - var request = consumer.PrepareAuthorizedRequest(GetContactsEndpoint, accessToken, extraData); - + /// <param name="cancellationToken">The cancellation token.</param> + /// <returns> + /// An XML document returned by Google. + /// </returns> + public async Task<XDocument> GetContactsAsync(AccessToken accessToken, int maxResults = 25, int startIndex = 1, CancellationToken cancellationToken = default(CancellationToken)) { // Enable gzip compression. Google only compresses the response for recognized user agent headers. - Mike Lim - request.AutomaticDecompression = DecompressionMethods.GZip; - request.UserAgent = "Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.16 (KHTML, like Gecko) Chrome/10.0.648.151 Safari/534.16"; - - var response = consumer.Channel.WebRequestHandler.GetResponse(request); - string body = response.GetResponseReader().ReadToEnd(); - XDocument result = XDocument.Parse(body); - return result; + var handler = new HttpClientHandler { AutomaticDecompression = DecompressionMethods.GZip }; + using (var httpClient = this.CreateHttpClient(accessToken, handler)) { + var request = new HttpRequestMessage(HttpMethod.Get, GetContactsEndpoint); + request.Content = new FormUrlEncodedContent( + new Dictionary<string, string>() { + { "start-index", startIndex.ToString(CultureInfo.InvariantCulture) }, + { "max-results", maxResults.ToString(CultureInfo.InvariantCulture) }, + }); + request.Headers.UserAgent.Add(ProductInfoHeaderValue.Parse("Mozilla/5.0 (Windows; U; Windows NT 6.1; en-US) AppleWebKit/534.16 (KHTML, like Gecko) Chrome/10.0.648.151 Safari/534.16")); + using (var response = await httpClient.SendAsync(request, cancellationToken)) { + string body = await response.Content.ReadAsStringAsync(); + XDocument result = XDocument.Parse(body); + return result; + } + } } - public static void PostBlogEntry(ConsumerBase consumer, string accessToken, string blogUrl, string title, XElement body) { + public async Task PostBlogEntryAsync(AccessToken accessToken, string blogUrl, string title, XElement body, CancellationToken cancellationToken = default(CancellationToken)) { string feedUrl; var getBlogHome = WebRequest.Create(blogUrl); using (var blogHomeResponse = getBlogHome.GetResponse()) { @@ -258,31 +244,21 @@ namespace DotNetOpenAuth.ApplicationBlock { XmlWriter xw = XmlWriter.Create(ms, xws); entry.WriteTo(xw); xw.Flush(); - - WebRequest request = consumer.PrepareAuthorizedRequest(new MessageReceivingEndpoint(feedUrl, HttpDeliveryMethods.PostRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), accessToken); - request.ContentType = "application/atom+xml"; - request.Method = "POST"; - request.ContentLength = ms.Length; ms.Seek(0, SeekOrigin.Begin); - using (Stream requestStream = request.GetRequestStream()) { - ms.CopyTo(requestStream); - } - using (HttpWebResponse response = (HttpWebResponse)request.GetResponse()) { - if (response.StatusCode == HttpStatusCode.Created) { - // Success - } else { - // Error! + + var request = new HttpRequestMessage(HttpMethod.Post, feedUrl); + request.Content = new StreamContent(ms); + request.Content.Headers.ContentType = new MediaTypeHeaderValue("application/atom+xml"); + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (var response = await httpClient.SendAsync(request, cancellationToken)) { + if (response.StatusCode == HttpStatusCode.Created) { + // Success + } else { + // Error! + response.EnsureSuccessStatusCode(); // throw some meaningful exception. + } } } } - - /// <summary> - /// Gets the scope URI in Google's format. - /// </summary> - /// <param name="scope">The scope, which may include one or several Google applications.</param> - /// <returns>A space-delimited list of URIs for the requested Google applications.</returns> - public static string GetScopeUri(Applications scope) { - return string.Join(" ", Util.GetIndividualFlags(scope).Select(app => DataScopeUris[(Applications)app]).ToArray()); - } } } diff --git a/samples/DotNetOpenAuth.ApplicationBlock/HttpAsyncHandlerBase.cs b/samples/DotNetOpenAuth.ApplicationBlock/HttpAsyncHandlerBase.cs new file mode 100644 index 0000000..a72a9b1 --- /dev/null +++ b/samples/DotNetOpenAuth.ApplicationBlock/HttpAsyncHandlerBase.cs @@ -0,0 +1,60 @@ +//----------------------------------------------------------------------- +// <copyright file="HttpAsyncHandlerBase.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace DotNetOpenAuth.ApplicationBlock { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Text; + using System.Threading; + using System.Threading.Tasks; + using System.Web; + + public abstract class HttpAsyncHandlerBase : IHttpAsyncHandler { + public abstract bool IsReusable { get; } + + public IAsyncResult BeginProcessRequest(HttpContext context, System.AsyncCallback cb, object extraData) { + return ToApm(this.ProcessRequestAsync(context), cb, extraData); + } + + public void EndProcessRequest(IAsyncResult result) { + ((Task)result).Wait(); // rethrows exceptions + } + + public void ProcessRequest(HttpContext context) { + this.ProcessRequestAsync(context).GetAwaiter().GetResult(); + } + + protected abstract Task ProcessRequestAsync(HttpContext context); + + private static Task ToApm(Task task, AsyncCallback callback, object state) { + if (task == null) { + throw new ArgumentNullException("task"); + } + + var tcs = new TaskCompletionSource<object>(state); + task.ContinueWith( + t => { + if (t.IsFaulted) { + tcs.TrySetException(t.Exception.InnerExceptions); + } else if (t.IsCanceled) { + tcs.TrySetCanceled(); + } else { + tcs.TrySetResult(null); + } + + if (callback != null) { + callback(tcs.Task); + } + }, + CancellationToken.None, + TaskContinuationOptions.None, + TaskScheduler.Default); + + return tcs.Task; + } + } +} diff --git a/samples/DotNetOpenAuth.ApplicationBlock/InMemoryTokenManager.cs b/samples/DotNetOpenAuth.ApplicationBlock/InMemoryTokenManager.cs deleted file mode 100644 index 35f6c08..0000000 --- a/samples/DotNetOpenAuth.ApplicationBlock/InMemoryTokenManager.cs +++ /dev/null @@ -1,147 +0,0 @@ -//----------------------------------------------------------------------- -// <copyright file="InMemoryTokenManager.cs" company="Outercurve Foundation"> -// Copyright (c) Outercurve Foundation. All rights reserved. -// </copyright> -//----------------------------------------------------------------------- - -namespace DotNetOpenAuth.ApplicationBlock { - using System; - using System.Collections.Generic; - using System.Diagnostics; - using DotNetOpenAuth.OAuth.ChannelElements; - using DotNetOpenAuth.OAuth.Messages; - using DotNetOpenAuth.OpenId.Extensions.OAuth; - -#if SAMPLESONLY - /// <summary> - /// A token manager that only retains tokens in memory. - /// Meant for SHORT TERM USE TOKENS ONLY. - /// </summary> - /// <remarks> - /// A likely application of this class is for "Sign In With Twitter", - /// where the user only signs in without providing any authorization to access - /// Twitter APIs except to authenticate, since that access token is only useful once. - /// </remarks> - internal class InMemoryTokenManager : IConsumerTokenManager, IOpenIdOAuthTokenManager { - private Dictionary<string, string> tokensAndSecrets = new Dictionary<string, string>(); - - /// <summary> - /// Initializes a new instance of the <see cref="InMemoryTokenManager"/> class. - /// </summary> - /// <param name="consumerKey">The consumer key.</param> - /// <param name="consumerSecret">The consumer secret.</param> - public InMemoryTokenManager(string consumerKey, string consumerSecret) { - if (string.IsNullOrEmpty(consumerKey)) { - throw new ArgumentNullException("consumerKey"); - } - - this.ConsumerKey = consumerKey; - this.ConsumerSecret = consumerSecret; - } - - /// <summary> - /// Gets the consumer key. - /// </summary> - /// <value>The consumer key.</value> - public string ConsumerKey { get; private set; } - - /// <summary> - /// Gets the consumer secret. - /// </summary> - /// <value>The consumer secret.</value> - public string ConsumerSecret { get; private set; } - - #region ITokenManager Members - - /// <summary> - /// Gets the Token Secret given a request or access token. - /// </summary> - /// <param name="token">The request or access token.</param> - /// <returns> - /// The secret associated with the given token. - /// </returns> - /// <exception cref="ArgumentException">Thrown if the secret cannot be found for the given token.</exception> - public string GetTokenSecret(string token) { - return this.tokensAndSecrets[token]; - } - - /// <summary> - /// Stores a newly generated unauthorized request token, secret, and optional - /// application-specific parameters for later recall. - /// </summary> - /// <param name="request">The request message that resulted in the generation of a new unauthorized request token.</param> - /// <param name="response">The response message that includes the unauthorized request token.</param> - /// <exception cref="ArgumentException">Thrown if the consumer key is not registered, or a required parameter was not found in the parameters collection.</exception> - /// <remarks> - /// Request tokens stored by this method SHOULD NOT associate any user account with this token. - /// It usually opens up security holes in your application to do so. Instead, you associate a user - /// account with access tokens (not request tokens) in the <see cref="ExpireRequestTokenAndStoreNewAccessToken"/> - /// method. - /// </remarks> - public void StoreNewRequestToken(UnauthorizedTokenRequest request, ITokenSecretContainingMessage response) { - this.tokensAndSecrets[response.Token] = response.TokenSecret; - } - - /// <summary> - /// Deletes a request token and its associated secret and stores a new access token and secret. - /// </summary> - /// <param name="consumerKey">The Consumer that is exchanging its request token for an access token.</param> - /// <param name="requestToken">The Consumer's request token that should be deleted/expired.</param> - /// <param name="accessToken">The new access token that is being issued to the Consumer.</param> - /// <param name="accessTokenSecret">The secret associated with the newly issued access token.</param> - /// <remarks> - /// <para> - /// Any scope of granted privileges associated with the request token from the - /// original call to <see cref="StoreNewRequestToken"/> should be carried over - /// to the new Access Token. - /// </para> - /// <para> - /// To associate a user account with the new access token, - /// <see cref="System.Web.HttpContext.User">HttpContext.Current.User</see> may be - /// useful in an ASP.NET web application within the implementation of this method. - /// Alternatively you may store the access token here without associating with a user account, - /// and wait until <see cref="WebConsumer.ProcessUserAuthorization()"/> or - /// <see cref="DesktopConsumer.ProcessUserAuthorization(string, string)"/> return the access - /// token to associate the access token with a user account at that point. - /// </para> - /// </remarks> - public void ExpireRequestTokenAndStoreNewAccessToken(string consumerKey, string requestToken, string accessToken, string accessTokenSecret) { - this.tokensAndSecrets.Remove(requestToken); - this.tokensAndSecrets[accessToken] = accessTokenSecret; - } - - /// <summary> - /// Classifies a token as a request token or an access token. - /// </summary> - /// <param name="token">The token to classify.</param> - /// <returns>Request or Access token, or invalid if the token is not recognized.</returns> - public TokenType GetTokenType(string token) { - throw new NotImplementedException(); - } - - #endregion - - #region IOpenIdOAuthTokenManager Members - - /// <summary> - /// Stores a new request token obtained over an OpenID request. - /// </summary> - /// <param name="consumerKey">The consumer key.</param> - /// <param name="authorization">The authorization message carrying the request token and authorized access scope.</param> - /// <remarks> - /// <para>The token secret is the empty string.</para> - /// <para>Tokens stored by this method should be short-lived to mitigate - /// possible security threats. Their lifetime should be sufficient for the - /// relying party to receive the positive authentication assertion and immediately - /// send a follow-up request for the access token.</para> - /// </remarks> - public void StoreOpenIdAuthorizedRequestToken(string consumerKey, AuthorizationApprovedResponse authorization) { - this.tokensAndSecrets[authorization.RequestToken] = string.Empty; - } - - #endregion - } -#else -#error The InMemoryTokenManager class is only for samples as it forgets all tokens whenever the application restarts! You should implement IConsumerTokenManager in your own app that stores tokens in a persistent store (like a SQL database). -#endif -}
\ No newline at end of file diff --git a/samples/DotNetOpenAuth.ApplicationBlock/TwitterConsumer.cs b/samples/DotNetOpenAuth.ApplicationBlock/TwitterConsumer.cs index 013e66b..16f1c92 100644 --- a/samples/DotNetOpenAuth.ApplicationBlock/TwitterConsumer.cs +++ b/samples/DotNetOpenAuth.ApplicationBlock/TwitterConsumer.cs @@ -11,71 +11,80 @@ namespace DotNetOpenAuth.ApplicationBlock { using System.Globalization; using System.IO; using System.Net; + using System.Net.Http; + using System.Net.Http.Headers; + using System.Runtime.Serialization.Json; + using System.Threading; + using System.Threading.Tasks; using System.Web; using System.Xml; using System.Xml.Linq; using System.Xml.XPath; using DotNetOpenAuth.Messaging; + using DotNetOpenAuth.Messaging.Bindings; using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.ChannelElements; + using Newtonsoft.Json.Linq; + /// <summary> /// A consumer capable of communicating with Twitter. /// </summary> - public static class TwitterConsumer { + public class TwitterConsumer : Consumer { /// <summary> /// The description of Twitter's OAuth protocol URIs for use with actually reading/writing /// a user's private Twitter data. /// </summary> - public static readonly ServiceProviderDescription ServiceDescription = new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/request_token", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/authorize", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/access_token", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - }; + public static readonly ServiceProviderDescription ServiceDescription = new ServiceProviderDescription( + "https://api.twitter.com/oauth/request_token", + "https://api.twitter.com/oauth/authorize", + "https://api.twitter.com/oauth/access_token"); /// <summary> /// The description of Twitter's OAuth protocol URIs for use with their "Sign in with Twitter" feature. /// </summary> - public static readonly ServiceProviderDescription SignInWithTwitterServiceDescription = new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/request_token", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/authenticate", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint("http://twitter.com/oauth/access_token", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - }; + public static readonly ServiceProviderDescription SignInWithTwitterServiceDescription = new ServiceProviderDescription( + "https://api.twitter.com/oauth/request_token", + "https://api.twitter.com/oauth/authenticate", + "https://api.twitter.com/oauth/access_token"); /// <summary> /// The URI to get a user's favorites. /// </summary> - private static readonly MessageReceivingEndpoint GetFavoritesEndpoint = new MessageReceivingEndpoint("http://twitter.com/favorites.xml", HttpDeliveryMethods.GetRequest); + private static readonly Uri GetFavoritesEndpoint = new Uri("http://twitter.com/favorites.xml"); /// <summary> /// The URI to get the data on the user's home page. /// </summary> - private static readonly MessageReceivingEndpoint GetFriendTimelineStatusEndpoint = new MessageReceivingEndpoint("http://twitter.com/statuses/friends_timeline.xml", HttpDeliveryMethods.GetRequest); + private static readonly Uri GetFriendTimelineStatusEndpoint = new Uri("https://api.twitter.com/1.1/statuses/home_timeline.json"); - private static readonly MessageReceivingEndpoint UpdateProfileBackgroundImageEndpoint = new MessageReceivingEndpoint("http://twitter.com/account/update_profile_background_image.xml", HttpDeliveryMethods.PostRequest | HttpDeliveryMethods.AuthorizationHeaderRequest); + private static readonly Uri UpdateProfileBackgroundImageEndpoint = new Uri("http://twitter.com/account/update_profile_background_image.xml"); - private static readonly MessageReceivingEndpoint UpdateProfileImageEndpoint = new MessageReceivingEndpoint("http://twitter.com/account/update_profile_image.xml", HttpDeliveryMethods.PostRequest | HttpDeliveryMethods.AuthorizationHeaderRequest); + private static readonly Uri UpdateProfileImageEndpoint = new Uri("http://twitter.com/account/update_profile_image.xml"); - private static readonly MessageReceivingEndpoint VerifyCredentialsEndpoint = new MessageReceivingEndpoint("http://api.twitter.com/1/account/verify_credentials.xml", HttpDeliveryMethods.GetRequest | HttpDeliveryMethods.AuthorizationHeaderRequest); + private static readonly Uri VerifyCredentialsEndpoint = new Uri("http://api.twitter.com/1/account/verify_credentials.xml"); /// <summary> - /// The consumer used for the Sign in to Twitter feature. + /// Initializes a new instance of the <see cref="TwitterConsumer"/> class. /// </summary> - private static WebConsumer signInConsumer; - - /// <summary> - /// The lock acquired to initialize the <see cref="signInConsumer"/> field. - /// </summary> - private static object signInConsumerInitLock = new object(); + public TwitterConsumer() { + this.ServiceProvider = ServiceDescription; + this.ConsumerKey = ConfigurationManager.AppSettings["twitterConsumerKey"]; + this.ConsumerSecret = ConfigurationManager.AppSettings["twitterConsumerSecret"]; + this.TemporaryCredentialStorage = HttpContext.Current != null + ? (ITemporaryCredentialStorage)new CookieTemporaryCredentialStorage() + : new MemoryTemporaryCredentialStorage(); + } /// <summary> - /// Initializes static members of the <see cref="TwitterConsumer"/> class. + /// Initializes a new instance of the <see cref="TwitterConsumer"/> class. /// </summary> - static TwitterConsumer() { - // Twitter can't handle the Expect 100 Continue HTTP header. - ServicePointManager.FindServicePoint(GetFavoritesEndpoint.Location).Expect100Continue = false; + /// <param name="consumerKey">The consumer key.</param> + /// <param name="consumerSecret">The consumer secret.</param> + public TwitterConsumer(string consumerKey, string consumerSecret) + : this() { + this.ConsumerKey = consumerKey; + this.ConsumerSecret = consumerSecret; } /// <summary> @@ -88,137 +97,160 @@ namespace DotNetOpenAuth.ApplicationBlock { } } + public static Consumer CreateConsumer(bool forWeb = true) { + string consumerKey = ConfigurationManager.AppSettings["twitterConsumerKey"]; + string consumerSecret = ConfigurationManager.AppSettings["twitterConsumerSecret"]; + if (IsTwitterConsumerConfigured) { + ITemporaryCredentialStorage storage = forWeb ? (ITemporaryCredentialStorage)new CookieTemporaryCredentialStorage() : new MemoryTemporaryCredentialStorage(); + return new Consumer(consumerKey, consumerSecret, ServiceDescription, storage) { + HostFactories = new TwitterHostFactories(), + }; + } else { + throw new InvalidOperationException("No Twitter OAuth consumer key and secret could be found in web.config AppSettings."); + } + } + /// <summary> - /// Gets the consumer to use for the Sign in to Twitter feature. + /// Prepares a redirect that will send the user to Twitter to sign in. /// </summary> - /// <value>The twitter sign in.</value> - private static WebConsumer TwitterSignIn { - get { - if (signInConsumer == null) { - lock (signInConsumerInitLock) { - if (signInConsumer == null) { - signInConsumer = new WebConsumer(SignInWithTwitterServiceDescription, ShortTermUserSessionTokenManager); - } - } - } + /// <param name="forceNewLogin">if set to <c>true</c> the user will be required to re-enter their Twitter credentials even if already logged in to Twitter.</param> + /// <param name="cancellationToken">The cancellation token.</param> + /// <returns> + /// The redirect message. + /// </returns> + public static async Task<Uri> StartSignInWithTwitterAsync(bool forceNewLogin = false, CancellationToken cancellationToken = default(CancellationToken)) { + var redirectParameters = new Dictionary<string, string>(); + if (forceNewLogin) { + redirectParameters["force_login"] = "true"; + } + Uri callback = MessagingUtilities.GetRequestUrlFromContext().StripQueryArgumentsWithPrefix("oauth_"); + + var consumer = CreateConsumer(); + consumer.ServiceProvider = SignInWithTwitterServiceDescription; + Uri redirectUrl = await consumer.RequestUserAuthorizationAsync(callback, cancellationToken: cancellationToken); + return redirectUrl; + } - return signInConsumer; + /// <summary> + /// Checks the incoming web request to see if it carries a Twitter authentication response, + /// and provides the user's Twitter screen name and unique id if available. + /// </summary> + /// <param name="completeUrl">The URL that came back from the service provider to complete the authorization.</param> + /// <param name="cancellationToken">The cancellation token.</param> + /// <returns> + /// A tuple with the screen name and Twitter unique user ID if successful; otherwise <c>null</c>. + /// </returns> + public static async Task<Tuple<string, int>> TryFinishSignInWithTwitterAsync(Uri completeUrl = null, CancellationToken cancellationToken = default(CancellationToken)) { + var consumer = CreateConsumer(); + consumer.ServiceProvider = SignInWithTwitterServiceDescription; + var response = await consumer.ProcessUserAuthorizationAsync(completeUrl ?? HttpContext.Current.Request.Url, cancellationToken: cancellationToken); + if (response == null) { + return null; } + + string screenName = response.ExtraData["screen_name"]; + int userId = int.Parse(response.ExtraData["user_id"]); + return Tuple.Create(screenName, userId); } - private static InMemoryTokenManager ShortTermUserSessionTokenManager { - get { - var store = HttpContext.Current.Session; - var tokenManager = (InMemoryTokenManager)store["TwitterShortTermUserSessionTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["twitterConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["twitterConsumerSecret"]; - if (IsTwitterConsumerConfigured) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - store["TwitterShortTermUserSessionTokenManager"] = tokenManager; - } else { - throw new InvalidOperationException("No Twitter OAuth consumer key and secret could be found in web.config AppSettings."); - } - } + public async Task<JArray> GetUpdatesAsync(AccessToken accessToken, CancellationToken cancellationToken = default(CancellationToken)) { + if (String.IsNullOrEmpty(accessToken.Token)) { + throw new ArgumentNullException("accessToken.Token"); + } - return tokenManager; + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (var response = await httpClient.GetAsync(GetFriendTimelineStatusEndpoint, cancellationToken)) { + response.EnsureSuccessStatusCode(); + string jsonString = await response.Content.ReadAsStringAsync(); + var json = JArray.Parse(jsonString); + return json; + } } } - public static XDocument GetUpdates(ConsumerBase twitter, string accessToken) { - IncomingWebResponse response = twitter.PrepareAuthorizedRequestAndSend(GetFriendTimelineStatusEndpoint, accessToken); - return XDocument.Load(XmlReader.Create(response.GetResponseReader())); - } + public async Task<XDocument> GetFavorites(AccessToken accessToken, CancellationToken cancellationToken = default(CancellationToken)) { + if (String.IsNullOrEmpty(accessToken.Token)) { + throw new ArgumentNullException("accessToken.Token"); + } - public static XDocument GetFavorites(ConsumerBase twitter, string accessToken) { - IncomingWebResponse response = twitter.PrepareAuthorizedRequestAndSend(GetFavoritesEndpoint, accessToken); - return XDocument.Load(XmlReader.Create(response.GetResponseReader())); + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (HttpResponseMessage response = await httpClient.GetAsync(GetFavoritesEndpoint, cancellationToken)) { + response.EnsureSuccessStatusCode(); + return XDocument.Parse(await response.Content.ReadAsStringAsync()); + } + } } - public static XDocument UpdateProfileBackgroundImage(ConsumerBase twitter, string accessToken, string image, bool tile) { - var parts = new[] { - MultipartPostPart.CreateFormFilePart("image", image, "image/" + Path.GetExtension(image).Substring(1).ToLowerInvariant()), - MultipartPostPart.CreateFormPart("tile", tile.ToString().ToLowerInvariant()), - }; - HttpWebRequest request = twitter.PrepareAuthorizedRequest(UpdateProfileBackgroundImageEndpoint, accessToken, parts); - request.ServicePoint.Expect100Continue = false; - IncomingWebResponse response = twitter.Channel.WebRequestHandler.GetResponse(request); - string responseString = response.GetResponseReader().ReadToEnd(); - return XDocument.Parse(responseString); + public async Task<XDocument> UpdateProfileBackgroundImageAsync(AccessToken accessToken, string image, bool tile, CancellationToken cancellationToken) { + var imageAttachment = new StreamContent(File.OpenRead(image)); + imageAttachment.Headers.ContentType = new MediaTypeHeaderValue("image/" + Path.GetExtension(image).Substring(1).ToLowerInvariant()); + HttpRequestMessage request = new HttpRequestMessage(HttpMethod.Post, UpdateProfileBackgroundImageEndpoint); + var content = new MultipartFormDataContent(); + content.Add(imageAttachment, "image"); + content.Add(new StringContent(tile.ToString().ToLowerInvariant()), "tile"); + request.Content = content; + request.Headers.ExpectContinue = false; + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (HttpResponseMessage response = await httpClient.SendAsync(request, cancellationToken)) { + response.EnsureSuccessStatusCode(); + string responseString = await response.Content.ReadAsStringAsync(); + return XDocument.Parse(responseString); + } + } } - public static XDocument UpdateProfileImage(ConsumerBase twitter, string accessToken, string pathToImage) { + public Task<XDocument> UpdateProfileImageAsync(AccessToken accessToken, string pathToImage, CancellationToken cancellationToken = default(CancellationToken)) { string contentType = "image/" + Path.GetExtension(pathToImage).Substring(1).ToLowerInvariant(); - return UpdateProfileImage(twitter, accessToken, File.OpenRead(pathToImage), contentType); + return this.UpdateProfileImageAsync(accessToken, File.OpenRead(pathToImage), contentType, cancellationToken); } - public static XDocument UpdateProfileImage(ConsumerBase twitter, string accessToken, Stream image, string contentType) { - var parts = new[] { - MultipartPostPart.CreateFormFilePart("image", "twitterPhoto", contentType, image), - }; - HttpWebRequest request = twitter.PrepareAuthorizedRequest(UpdateProfileImageEndpoint, accessToken, parts); - IncomingWebResponse response = twitter.Channel.WebRequestHandler.GetResponse(request); - string responseString = response.GetResponseReader().ReadToEnd(); - return XDocument.Parse(responseString); + public async Task<XDocument> UpdateProfileImageAsync(AccessToken accessToken, Stream image, string contentType, CancellationToken cancellationToken = default(CancellationToken)) { + var imageAttachment = new StreamContent(image); + imageAttachment.Headers.ContentType = new MediaTypeHeaderValue(contentType); + HttpRequestMessage request = new HttpRequestMessage(HttpMethod.Post, UpdateProfileImageEndpoint); + var content = new MultipartFormDataContent(); + content.Add(imageAttachment, "image", "twitterPhoto"); + request.Content = content; + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (HttpResponseMessage response = await httpClient.SendAsync(request, cancellationToken)) { + response.EnsureSuccessStatusCode(); + string responseString = await response.Content.ReadAsStringAsync(); + return XDocument.Parse(responseString); + } + } } - public static XDocument VerifyCredentials(ConsumerBase twitter, string accessToken) { - IncomingWebResponse response = twitter.PrepareAuthorizedRequestAndSend(VerifyCredentialsEndpoint, accessToken); - return XDocument.Load(XmlReader.Create(response.GetResponseReader())); + public async Task<XDocument> VerifyCredentialsAsync(AccessToken accessToken, CancellationToken cancellationToken = default(CancellationToken)) { + using (var httpClient = this.CreateHttpClient(accessToken)) { + using (var response = await httpClient.GetAsync(VerifyCredentialsEndpoint, cancellationToken)) { + response.EnsureSuccessStatusCode(); + using (var stream = await response.Content.ReadAsStreamAsync()) { + return XDocument.Load(XmlReader.Create(stream)); + } + } + } } - public static string GetUsername(ConsumerBase twitter, string accessToken) { - XDocument xml = VerifyCredentials(twitter, accessToken); + public async Task<string> GetUsername(AccessToken accessToken, CancellationToken cancellationToken = default(CancellationToken)) { + XDocument xml = await this.VerifyCredentialsAsync(accessToken, cancellationToken); XPathNavigator nav = xml.CreateNavigator(); return nav.SelectSingleNode("/user/screen_name").Value; } - /// <summary> - /// Prepares a redirect that will send the user to Twitter to sign in. - /// </summary> - /// <param name="forceNewLogin">if set to <c>true</c> the user will be required to re-enter their Twitter credentials even if already logged in to Twitter.</param> - /// <returns>The redirect message.</returns> - /// <remarks> - /// Call <see cref="OutgoingWebResponse.Send"/> or - /// <c>return StartSignInWithTwitter().<see cref="MessagingUtilities.AsActionResult">AsActionResult()</see></c> - /// to actually perform the redirect. - /// </remarks> - public static OutgoingWebResponse StartSignInWithTwitter(bool forceNewLogin) { - var redirectParameters = new Dictionary<string, string>(); - if (forceNewLogin) { - redirectParameters["force_login"] = "true"; - } - Uri callback = MessagingUtilities.GetRequestUrlFromContext().StripQueryArgumentsWithPrefix("oauth_"); - var request = TwitterSignIn.PrepareRequestUserAuthorization(callback, null, redirectParameters); - return TwitterSignIn.Channel.PrepareResponse(request); - } + private class TwitterHostFactories : IHostFactories { + private static readonly IHostFactories underlyingFactories = new DefaultOAuthHostFactories(); - /// <summary> - /// Checks the incoming web request to see if it carries a Twitter authentication response, - /// and provides the user's Twitter screen name and unique id if available. - /// </summary> - /// <param name="screenName">The user's Twitter screen name.</param> - /// <param name="userId">The user's Twitter unique user ID.</param> - /// <returns> - /// A value indicating whether Twitter authentication was successful; - /// otherwise <c>false</c> to indicate that no Twitter response was present. - /// </returns> - public static bool TryFinishSignInWithTwitter(out string screenName, out int userId) { - screenName = null; - userId = 0; - var response = TwitterSignIn.ProcessUserAuthorization(); - if (response == null) { - return false; + public HttpMessageHandler CreateHttpMessageHandler() { + return new WebRequestHandler(); } - screenName = response.ExtraData["screen_name"]; - userId = int.Parse(response.ExtraData["user_id"]); + public HttpClient CreateHttpClient(HttpMessageHandler handler = null) { + var client = underlyingFactories.CreateHttpClient(handler); - // If we were going to make this LOOK like OpenID even though it isn't, - // this seems like a reasonable, secure claimed id to allow the user to assume. - OpenId.Identifier fake_claimed_id = string.Format(CultureInfo.InvariantCulture, "http://twitter.com/{0}#{1}", screenName, userId); - - return true; + // Twitter can't handle the Expect 100 Continue HTTP header. + client.DefaultRequestHeaders.ExpectContinue = false; + return client; + } } } } diff --git a/samples/DotNetOpenAuth.ApplicationBlock/Util.cs b/samples/DotNetOpenAuth.ApplicationBlock/Util.cs index 0bec372..3e0795a 100644 --- a/samples/DotNetOpenAuth.ApplicationBlock/Util.cs +++ b/samples/DotNetOpenAuth.ApplicationBlock/Util.cs @@ -13,33 +13,6 @@ internal static readonly Random NonCryptoRandomDataGenerator = new Random(); /// <summary> - /// Sets the channel's outgoing HTTP requests to use default network credentials. - /// </summary> - /// <param name="channel">The channel to modify.</param> - public static void UseDefaultNetworkCredentialsOnOutgoingHttpRequests(this Channel channel) - { - Debug.Assert(!(channel.WebRequestHandler is WrappingWebRequestHandler), "Wrapping an already wrapped web request handler. This is legal, but highly suspect of a bug as you don't want to wrap the same channel repeatedly to apply the same effect."); - AddOutgoingHttpRequestTransform(channel, http => http.Credentials = CredentialCache.DefaultNetworkCredentials); - } - - /// <summary> - /// Adds some action to any outgoing HTTP request on this channel. - /// </summary> - /// <param name="channel">The channel's whose outgoing HTTP requests should be modified.</param> - /// <param name="action">The action to perform on outgoing HTTP requests.</param> - internal static void AddOutgoingHttpRequestTransform(this Channel channel, Action<HttpWebRequest> action) { - if (channel == null) { - throw new ArgumentNullException("channel"); - } - - if (action == null) { - throw new ArgumentNullException("action"); - } - - channel.WebRequestHandler = new WrappingWebRequestHandler(channel.WebRequestHandler, action); - } - - /// <summary> /// Enumerates through the individual set bits in a flag enum. /// </summary> /// <param name="flags">The flags enum value.</param> @@ -106,154 +79,5 @@ return totalCopiedBytes; } - - /// <summary> - /// Wraps some instance of a web request handler in order to perform some extra operation on all - /// outgoing HTTP requests. - /// </summary> - private class WrappingWebRequestHandler : IDirectWebRequestHandler - { - /// <summary> - /// The handler being wrapped. - /// </summary> - private readonly IDirectWebRequestHandler wrappedHandler; - - /// <summary> - /// The action to perform on outgoing HTTP requests. - /// </summary> - private readonly Action<HttpWebRequest> action; - - /// <summary> - /// Initializes a new instance of the <see cref="WrappingWebRequestHandler"/> class. - /// </summary> - /// <param name="wrappedHandler">The HTTP handler to wrap.</param> - /// <param name="action">The action to perform on outgoing HTTP requests.</param> - internal WrappingWebRequestHandler(IDirectWebRequestHandler wrappedHandler, Action<HttpWebRequest> action) - { - if (wrappedHandler == null) { - throw new ArgumentNullException("wrappedHandler"); - } - - if (action == null) { - throw new ArgumentNullException("action"); - } - - this.wrappedHandler = wrappedHandler; - this.action = action; - } - - #region Implementation of IDirectWebRequestHandler - - /// <summary> - /// Determines whether this instance can support the specified options. - /// </summary> - /// <param name="options">The set of options that might be given in a subsequent web request.</param> - /// <returns> - /// <c>true</c> if this instance can support the specified options; otherwise, <c>false</c>. - /// </returns> - public bool CanSupport(DirectWebRequestOptions options) - { - return this.wrappedHandler.CanSupport(options); - } - - /// <summary> - /// Prepares an <see cref="HttpWebRequest"/> that contains an POST entity for sending the entity. - /// </summary> - /// <param name="request">The <see cref="HttpWebRequest"/> that should contain the entity.</param> - /// <returns> - /// The stream the caller should write out the entity data to. - /// </returns> - /// <exception cref="ProtocolException">Thrown for any network error.</exception> - /// <remarks> - /// <para>The caller should have set the <see cref="HttpWebRequest.ContentLength"/> - /// and any other appropriate properties <i>before</i> calling this method. - /// Callers <i>must</i> close and dispose of the request stream when they are done - /// writing to it to avoid taking up the connection too long and causing long waits on - /// subsequent requests.</para> - /// <para>Implementations should catch <see cref="WebException"/> and wrap it in a - /// <see cref="ProtocolException"/> to abstract away the transport and provide - /// a single exception type for hosts to catch.</para> - /// </remarks> - public Stream GetRequestStream(HttpWebRequest request) - { - this.action(request); - return this.wrappedHandler.GetRequestStream(request); - } - - /// <summary> - /// Prepares an <see cref="HttpWebRequest"/> that contains an POST entity for sending the entity. - /// </summary> - /// <param name="request">The <see cref="HttpWebRequest"/> that should contain the entity.</param> - /// <param name="options">The options to apply to this web request.</param> - /// <returns> - /// The stream the caller should write out the entity data to. - /// </returns> - /// <exception cref="ProtocolException">Thrown for any network error.</exception> - /// <remarks> - /// <para>The caller should have set the <see cref="HttpWebRequest.ContentLength"/> - /// and any other appropriate properties <i>before</i> calling this method. - /// Callers <i>must</i> close and dispose of the request stream when they are done - /// writing to it to avoid taking up the connection too long and causing long waits on - /// subsequent requests.</para> - /// <para>Implementations should catch <see cref="WebException"/> and wrap it in a - /// <see cref="ProtocolException"/> to abstract away the transport and provide - /// a single exception type for hosts to catch.</para> - /// </remarks> - public Stream GetRequestStream(HttpWebRequest request, DirectWebRequestOptions options) - { - this.action(request); - return this.wrappedHandler.GetRequestStream(request, options); - } - - /// <summary> - /// Processes an <see cref="HttpWebRequest"/> and converts the - /// <see cref="HttpWebResponse"/> to a <see cref="IncomingWebResponse"/> instance. - /// </summary> - /// <param name="request">The <see cref="HttpWebRequest"/> to handle.</param> - /// <returns>An instance of <see cref="IncomingWebResponse"/> describing the response.</returns> - /// <exception cref="ProtocolException">Thrown for any network error.</exception> - /// <remarks> - /// <para>Implementations should catch <see cref="WebException"/> and wrap it in a - /// <see cref="ProtocolException"/> to abstract away the transport and provide - /// a single exception type for hosts to catch. The <see cref="WebException.Response"/> - /// value, if set, should be Closed before throwing.</para> - /// </remarks> - public IncomingWebResponse GetResponse(HttpWebRequest request) - { - // If the request has an entity, the action would have already been processed in GetRequestStream. - if (request.Method == "GET") - { - this.action(request); - } - - return this.wrappedHandler.GetResponse(request); - } - - /// <summary> - /// Processes an <see cref="HttpWebRequest"/> and converts the - /// <see cref="HttpWebResponse"/> to a <see cref="IncomingWebResponse"/> instance. - /// </summary> - /// <param name="request">The <see cref="HttpWebRequest"/> to handle.</param> - /// <param name="options">The options to apply to this web request.</param> - /// <returns>An instance of <see cref="IncomingWebResponse"/> describing the response.</returns> - /// <exception cref="ProtocolException">Thrown for any network error.</exception> - /// <remarks> - /// <para>Implementations should catch <see cref="WebException"/> and wrap it in a - /// <see cref="ProtocolException"/> to abstract away the transport and provide - /// a single exception type for hosts to catch. The <see cref="WebException.Response"/> - /// value, if set, should be Closed before throwing.</para> - /// </remarks> - public IncomingWebResponse GetResponse(HttpWebRequest request, DirectWebRequestOptions options) - { - // If the request has an entity, the action would have already been processed in GetRequestStream. - if (request.Method == "GET") { - this.action(request); - } - - return this.wrappedHandler.GetResponse(request, options); - } - - #endregion - } } } diff --git a/samples/DotNetOpenAuth.ApplicationBlock/YammerConsumer.cs b/samples/DotNetOpenAuth.ApplicationBlock/YammerConsumer.cs index bbeb861..1dff5b6 100644 --- a/samples/DotNetOpenAuth.ApplicationBlock/YammerConsumer.cs +++ b/samples/DotNetOpenAuth.ApplicationBlock/YammerConsumer.cs @@ -7,55 +7,45 @@ namespace DotNetOpenAuth.ApplicationBlock { using System; using System.Collections.Generic; + using System.Configuration; using System.Linq; using System.Net; using System.Text; + using System.Threading; + using System.Threading.Tasks; + using System.Web; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.ChannelElements; using DotNetOpenAuth.OAuth.Messages; - public static class YammerConsumer { + public class YammerConsumer : Consumer { /// <summary> /// The Consumer to use for accessing Google data APIs. /// </summary> - public static readonly ServiceProviderDescription ServiceDescription = new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint("https://www.yammer.com/oauth/request_token", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.PostRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint("https://www.yammer.com/oauth/authorize", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.GetRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint("https://www.yammer.com/oauth/access_token", HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.PostRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new PlaintextSigningBindingElement() }, - ProtocolVersion = ProtocolVersion.V10, - }; + public static readonly ServiceProviderDescription ServiceDescription = + new ServiceProviderDescription( + "https://www.yammer.com/oauth/request_token", + "https://www.yammer.com/oauth/authorize", + "https://www.yammer.com/oauth/access_token"); - public static DesktopConsumer CreateConsumer(IConsumerTokenManager tokenManager) { - return new DesktopConsumer(ServiceDescription, tokenManager); + public YammerConsumer() { + this.ServiceProvider = ServiceDescription; + this.ConsumerKey = ConfigurationManager.AppSettings["YammerConsumerKey"]; + this.ConsumerSecret = ConfigurationManager.AppSettings["YammerConsumerSecret"]; + this.TemporaryCredentialStorage = HttpContext.Current != null + ? (ITemporaryCredentialStorage)new CookieTemporaryCredentialStorage() + : new MemoryTemporaryCredentialStorage(); } - public static Uri PrepareRequestAuthorization(DesktopConsumer consumer, out string requestToken) { - if (consumer == null) { - throw new ArgumentNullException("consumer"); + /// <summary> + /// Gets a value indicating whether the Twitter consumer key and secret are set in the web.config file. + /// </summary> + public static bool IsConsumerConfigured { + get { + return !string.IsNullOrEmpty(ConfigurationManager.AppSettings["yammerConsumerKey"]) && + !string.IsNullOrEmpty(ConfigurationManager.AppSettings["yammerConsumerSecret"]); } - - Uri authorizationUrl = consumer.RequestUserAuthorization(null, null, out requestToken); - return authorizationUrl; - } - - public static AuthorizedTokenResponse CompleteAuthorization(DesktopConsumer consumer, string requestToken, string userCode) { - // Because Yammer has a proprietary callback_token parameter, and it's passed - // with the message that specifically bans extra arguments being passed, we have - // to cheat by adding the data to the URL itself here. - var customServiceDescription = new ServiceProviderDescription { - RequestTokenEndpoint = ServiceDescription.RequestTokenEndpoint, - UserAuthorizationEndpoint = ServiceDescription.UserAuthorizationEndpoint, - AccessTokenEndpoint = new MessageReceivingEndpoint(ServiceDescription.AccessTokenEndpoint.Location.AbsoluteUri + "?oauth_verifier=" + Uri.EscapeDataString(userCode), HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.PostRequest), - TamperProtectionElements = ServiceDescription.TamperProtectionElements, - ProtocolVersion = ProtocolVersion.V10, - }; - - // To use a custom service description we also must create a new WebConsumer. - var customConsumer = new DesktopConsumer(customServiceDescription, consumer.TokenManager); - var response = customConsumer.ProcessUserAuthorization(requestToken, userCode); - return response; } } } diff --git a/samples/DotNetOpenAuth.ApplicationBlock/packages.config b/samples/DotNetOpenAuth.ApplicationBlock/packages.config new file mode 100644 index 0000000..d7219c5 --- /dev/null +++ b/samples/DotNetOpenAuth.ApplicationBlock/packages.config @@ -0,0 +1,5 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Newtonsoft.Json" version="4.5.11" targetFramework="net45" /> +</packages>
\ No newline at end of file diff --git a/samples/InfoCardRelyingParty/web.config b/samples/InfoCardRelyingParty/web.config index 835625c..9575005 100644 --- a/samples/InfoCardRelyingParty/web.config +++ b/samples/InfoCardRelyingParty/web.config @@ -38,7 +38,9 @@ <defaultProxy enabled="true" /> </system.net> - <appSettings/> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> <connectionStrings/> <system.web> @@ -53,11 +55,7 @@ where data loss can occur. Set explicit="true" to force declaration of all variables. --> - <compilation debug="true" strict="false" explicit="true" targetFramework="4.5"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="true" strict="false" explicit="true" targetFramework="4.5" /> <pages controlRenderingCompatibilityVersion="4.0" clientIDMode="AutoID"> <namespaces> <clear/> @@ -100,7 +98,7 @@ </customErrors> --> <!-- Force ASP.NET 4.0 to respect ValidateRequest="false" in the login page to avoid false reports from the SAML token. --> - <httpRuntime requestValidationMode="2.0" /> + <httpRuntime requestValidationMode="2.0" targetFramework="4.5" /> </system.web> <!-- The system.webServer section is required for running ASP.NET AJAX under Internet diff --git a/samples/OAuth2ProtectedWebApi/App_Start/BundleConfig.cs b/samples/OAuth2ProtectedWebApi/App_Start/BundleConfig.cs new file mode 100644 index 0000000..6524cf6 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/App_Start/BundleConfig.cs @@ -0,0 +1,40 @@ +using System.Web; +using System.Web.Optimization; + +namespace OAuth2ProtectedWebApi { + public class BundleConfig { + // For more information on Bundling, visit http://go.microsoft.com/fwlink/?LinkId=254725 + public static void RegisterBundles(BundleCollection bundles) { + bundles.Add(new ScriptBundle("~/bundles/jquery").Include( + "~/Scripts/jquery-{version}.js")); + + bundles.Add(new ScriptBundle("~/bundles/jqueryui").Include( + "~/Scripts/jquery-ui-{version}.js")); + + bundles.Add(new ScriptBundle("~/bundles/jqueryval").Include( + "~/Scripts/jquery.unobtrusive*", + "~/Scripts/jquery.validate*")); + + // Use the development version of Modernizr to develop with and learn from. Then, when you're + // ready for production, use the build tool at http://modernizr.com to pick only the tests you need. + bundles.Add(new ScriptBundle("~/bundles/modernizr").Include( + "~/Scripts/modernizr-*")); + + bundles.Add(new StyleBundle("~/Content/css").Include("~/Content/site.css")); + + bundles.Add(new StyleBundle("~/Content/themes/base/css").Include( + "~/Content/themes/base/jquery.ui.core.css", + "~/Content/themes/base/jquery.ui.resizable.css", + "~/Content/themes/base/jquery.ui.selectable.css", + "~/Content/themes/base/jquery.ui.accordion.css", + "~/Content/themes/base/jquery.ui.autocomplete.css", + "~/Content/themes/base/jquery.ui.button.css", + "~/Content/themes/base/jquery.ui.dialog.css", + "~/Content/themes/base/jquery.ui.slider.css", + "~/Content/themes/base/jquery.ui.tabs.css", + "~/Content/themes/base/jquery.ui.datepicker.css", + "~/Content/themes/base/jquery.ui.progressbar.css", + "~/Content/themes/base/jquery.ui.theme.css")); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/App_Start/FilterConfig.cs b/samples/OAuth2ProtectedWebApi/App_Start/FilterConfig.cs new file mode 100644 index 0000000..a482091 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/App_Start/FilterConfig.cs @@ -0,0 +1,10 @@ +using System.Web; +using System.Web.Mvc; + +namespace OAuth2ProtectedWebApi { + public class FilterConfig { + public static void RegisterGlobalFilters(GlobalFilterCollection filters) { + filters.Add(new HandleErrorAttribute()); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/App_Start/RouteConfig.cs b/samples/OAuth2ProtectedWebApi/App_Start/RouteConfig.cs new file mode 100644 index 0000000..d64e426 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/App_Start/RouteConfig.cs @@ -0,0 +1,20 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web; +using System.Web.Mvc; +using System.Web.Routing; + +namespace OAuth2ProtectedWebApi { + public class RouteConfig { + public static void RegisterRoutes(RouteCollection routes) { + routes.IgnoreRoute("{resource}.axd/{*pathInfo}"); + + routes.MapRoute( + name: "Default", + url: "{controller}/{action}/{id}", + defaults: new { controller = "Home", action = "Index", id = UrlParameter.Optional } + ); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/App_Start/WebApiConfig.cs b/samples/OAuth2ProtectedWebApi/App_Start/WebApiConfig.cs new file mode 100644 index 0000000..d783d13 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/App_Start/WebApiConfig.cs @@ -0,0 +1,20 @@ +namespace OAuth2ProtectedWebApi { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web.Http; + + using OAuth2ProtectedWebApi.Code; + + public static class WebApiConfig { + public static void Register(HttpConfiguration config) { + config.Routes.MapHttpRoute( + name: "DefaultApi", + routeTemplate: "api/{controller}/{id}", + defaults: new { id = RouteParameter.Optional } + ); + + config.MessageHandlers.Add(new BearerTokenHandler()); + } + } +} diff --git a/samples/OAuth2ProtectedWebApi/Code/AuthorizationServerHost.cs b/samples/OAuth2ProtectedWebApi/Code/AuthorizationServerHost.cs new file mode 100644 index 0000000..843280b --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Code/AuthorizationServerHost.cs @@ -0,0 +1,181 @@ +namespace OAuth2ProtectedWebApi.Code { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.Security; + using DotNetOpenAuth.Messaging.Bindings; + using DotNetOpenAuth.OAuth2; + using DotNetOpenAuth.OAuth2.ChannelElements; + using DotNetOpenAuth.OAuth2.Messages; + using OAuth2ProtectedWebApi.Code; + + /// <summary> + /// Provides application-specific policy and persistence for OAuth 2.0 authorization servers. + /// </summary> + public class AuthorizationServerHost : IAuthorizationServerHost { + /// <summary> + /// Storage for the cryptographic keys used to protect authorization codes, refresh tokens and access tokens. + /// </summary> + /// <remarks> + /// A single, hard-coded symmetric key is hardly adequate. Applications that rely on decent security should + /// replace this implementation with one that actually stores and retrieves keys in some persistent store + /// (e.g. a database). DotNetOpenAuth will automatically take care of generating, rotating, and expiring keys + /// if you provide a real implementation of this interface. + /// TODO: Consider replacing use of <see cref="HardCodedKeyCryptoKeyStore"/> with a real persisted database table. + /// </remarks> + internal static readonly ICryptoKeyStore HardCodedCryptoKeyStore = new HardCodedKeyCryptoKeyStore("p7J1L24Qj4KGYUOrnfENF0XAhqn6rZc5dx4nxvI22Kg="); + + /// <summary> + /// Gets the store for storing crypto keys used to symmetrically encrypt and sign authorization codes and refresh tokens. + /// </summary> + /// <remarks> + /// This store should be kept strictly confidential in the authorization server(s) + /// and NOT shared with the resource server. Anyone with these secrets can mint + /// tokens to essentially grant themselves access to anything they want. + /// </remarks> + public ICryptoKeyStore CryptoKeyStore { + get { return HardCodedCryptoKeyStore; } + } + + /// <summary> + /// Gets the authorization code nonce store to use to ensure that authorization codes can only be used once. + /// </summary> + /// <value> + /// The authorization code nonce store. + /// </value> + public INonceStore NonceStore { + get { + // TODO: Consider implementing a nonce store to mitigate replay attacks on authorization codes. + return null; + } + } + + /// <summary> + /// Acquires the access token and related parameters that go into the formulation of the token endpoint's response to a client. + /// </summary> + /// <param name="accessTokenRequestMessage">Details regarding the resources that the access token will grant access to, and the identity of the client + /// that will receive that access. + /// Based on this information the receiving resource server can be determined and the lifetime of the access + /// token can be set based on the sensitivity of the resources.</param> + /// <returns> + /// A non-null parameters instance that DotNetOpenAuth will dispose after it has been used. + /// </returns> + public AccessTokenResult CreateAccessToken(IAccessTokenRequest accessTokenRequestMessage) { + // If your resource server and authorization server are different web apps, + // consider using asymmetric keys instead of symmetric ones by setting different + // properties on the access token below. + var accessToken = new AuthorizationServerAccessToken { + Lifetime = TimeSpan.FromHours(1), + SymmetricKeyStore = this.CryptoKeyStore, + }; + var result = new AccessTokenResult(accessToken); + return result; + } + + /// <summary> + /// Gets the client with a given identifier. + /// </summary> + /// <param name="clientIdentifier">The client identifier.</param> + /// <returns> + /// The client registration. Never null. + /// </returns> + /// <exception cref="ArgumentException">Thrown when no client with the given identifier is registered with this authorization server.</exception> + public IClientDescription GetClient(string clientIdentifier) { + // TODO: Consider adding a clients table in your database to track actual client accounts + // with authenticating secrets. + // For now, just allow all clients regardless of ID, and consider them "Public" clients. + return new AnyCallbackClient(); + } + + /// <summary> + /// Determines whether a described authorization is (still) valid. + /// </summary> + /// <param name="authorization">The authorization.</param> + /// <returns> + /// <c>true</c> if the original authorization is still valid; otherwise, <c>false</c>. + /// </returns> + /// <remarks> + /// <para>When establishing that an authorization is still valid, + /// it's very important to only match on recorded authorizations that + /// meet these criteria:</para> + /// 1) The client identifier matches. + /// 2) The user account matches. + /// 3) The scope on the recorded authorization must include all scopes in the given authorization. + /// 4) The date the recorded authorization was issued must be <em>no later</em> that the date the given authorization was issued. + /// <para>One possible scenario is where the user authorized a client, later revoked authorization, + /// and even later reinstated authorization. This subsequent recorded authorization + /// would not satisfy requirement #4 in the above list. This is important because the revocation + /// the user went through should invalidate all previously issued tokens as a matter of + /// security in the event the user was revoking access in order to sever authorization on a stolen + /// account or piece of hardware in which the tokens were stored. </para> + /// </remarks> + public bool IsAuthorizationValid(IAuthorizationDescription authorization) { + // If your application supports access revocation (highly recommended), + // this method should return false if the specified authorization is not + // discovered in your current authorizations table. + //// TODO: code here + + return true; + } + + /// <summary> + /// Determines whether a given set of resource owner credentials is valid based on the authorization server's user database + /// and if so records an authorization entry such that subsequent calls to <see cref="IsAuthorizationValid" /> would + /// return <c>true</c>. + /// </summary> + /// <param name="userName">Username on the account.</param> + /// <param name="password">The user's password.</param> + /// <param name="accessRequest">The access request the credentials came with. + /// This may be useful if the authorization server wishes to apply some policy based on the client that is making the request.</param> + /// <returns> + /// A value that describes the result of the authorization check. + /// </returns> + /// <exception cref="System.NotSupportedException"></exception> + public AutomatedUserAuthorizationCheckResponse CheckAuthorizeResourceOwnerCredentialGrant(string userName, string password, IAccessTokenRequest accessRequest) { + // TODO: Consider only accepting resource owner credential grants from specific clients + // based on accessRequest.ClientIdentifier and accessRequest.ClientAuthenticated. + if (Membership.ValidateUser(userName, password)) { + // Add an entry to your authorization table to record that access was granted so that + // you can conditionally return true from IsAuthorizationValid when the row is discovered. + //// TODO: code here + + // Inform DotNetOpenAuth that it may proceed to issue an access token. + return new AutomatedUserAuthorizationCheckResponse(accessRequest, true, Membership.GetUser(userName).UserName); + } else { + return new AutomatedUserAuthorizationCheckResponse(accessRequest, false, null); + } + } + + /// <summary> + /// Determines whether an access token request given a client credential grant should be authorized + /// and if so records an authorization entry such that subsequent calls to <see cref="IsAuthorizationValid" /> would + /// return <c>true</c>. + /// </summary> + /// <param name="accessRequest">The access request the credentials came with. + /// This may be useful if the authorization server wishes to apply some policy based on the client that is making the request.</param> + /// <returns> + /// A value that describes the result of the authorization check. + /// </returns> + /// <exception cref="System.NotSupportedException"></exception> + public AutomatedAuthorizationCheckResponse CheckAuthorizeClientCredentialsGrant(IAccessTokenRequest accessRequest) { + // TODO: Consider implementing this if your application should support clients that access data that + // doesn't belong to specific people, or clients that have elevated privileges and can access other + // people's data. + if (accessRequest.ClientAuthenticated) { + // Before returning a positive response, be *very careful* to validate the requested access scope + // to make sure it is appropriate for the requesting client. + throw new NotSupportedException(); + } else { + // Only authenticated clients should be given access. + return new AutomatedAuthorizationCheckResponse(accessRequest, false); + } + } + + private class AnyCallbackClient : ClientDescription { + public override bool IsCallbackAllowed(Uri callback) { + return true; + } + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Code/BearerTokenHandler.cs b/samples/OAuth2ProtectedWebApi/Code/BearerTokenHandler.cs new file mode 100644 index 0000000..23ec087 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Code/BearerTokenHandler.cs @@ -0,0 +1,30 @@ +namespace OAuth2ProtectedWebApi.Code { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net.Http; + using System.Threading; + using System.Threading.Tasks; + using System.Web; + + using DotNetOpenAuth.OAuth2; + + /// <summary> + /// An HTTP server message handler that detects OAuth 2 bearer tokens in the authorization header + /// and applies the appropriate principal to the request when found. + /// </summary> + public class BearerTokenHandler : DelegatingHandler { + protected override async Task<HttpResponseMessage> SendAsync(HttpRequestMessage request, CancellationToken cancellationToken) { + if (request.Headers.Authorization != null) { + if (request.Headers.Authorization.Scheme == "Bearer") { + var resourceServer = new ResourceServer(new StandardAccessTokenAnalyzer(AuthorizationServerHost.HardCodedCryptoKeyStore)); + var principal = await resourceServer.GetPrincipalAsync(request, cancellationToken); + HttpContext.Current.User = principal; + Thread.CurrentPrincipal = principal; + } + } + + return await base.SendAsync(request, cancellationToken); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Code/HttpHeaderAttribute.cs b/samples/OAuth2ProtectedWebApi/Code/HttpHeaderAttribute.cs new file mode 100644 index 0000000..3bff848 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Code/HttpHeaderAttribute.cs @@ -0,0 +1,41 @@ +namespace OAuth2ProtectedWebApi.Code { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.Mvc; + + /// <summary> + /// Represents an attribute that is used to add HTTP Headers to a Controller Action response. + /// </summary> + public class HttpHeaderAttribute : ActionFilterAttribute { + /// <summary> + /// Initializes a new instance of the <see cref="HttpHeaderAttribute"/> class. + /// </summary> + /// <param name="name">The HTTP header name.</param> + /// <param name="value">The HTTP header value.</param> + public HttpHeaderAttribute(string name, string value) { + this.Name = name; + this.Value = value; + } + + /// <summary> + /// Gets or sets the name of the HTTP Header. + /// </summary> + public string Name { get; set; } + + /// <summary> + /// Gets or sets the value of the HTTP Header. + /// </summary> + public string Value { get; set; } + + /// <summary> + /// Called by the MVC framework after the action result executes. + /// </summary> + /// <param name="filterContext">The filter context.</param> + public override void OnResultExecuted(ResultExecutedContext filterContext) { + filterContext.HttpContext.Response.AppendHeader(this.Name, this.Value); + base.OnResultExecuted(filterContext); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/Site.css b/samples/OAuth2ProtectedWebApi/Content/Site.css new file mode 100644 index 0000000..be14409 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/Site.css @@ -0,0 +1,756 @@ +html { + background-color: #e2e2e2; + margin: 0; + padding: 0; +} + +body { + background-color: #fff; + border-top: solid 10px #000; + color: #333; + font-size: .85em; + font-family: "Segoe UI", Verdana, Helvetica, Sans-Serif; + margin: 0; + padding: 0; +} + +a { + color: #333; + outline: none; + padding-left: 3px; + padding-right: 3px; + text-decoration: underline; +} + + a:link, a:visited, + a:active, a:hover { + color: #333; + } + + a:hover { + background-color: #c7d1d6; + } + +header, footer, hgroup, +nav, section { + display: block; +} + +mark { + background-color: #a6dbed; + padding-left: 5px; + padding-right: 5px; +} + +.float-left { + float: left; +} + +.float-right { + float: right; +} + +.clear-fix:after { + content: "."; + clear: both; + display: block; + height: 0; + visibility: hidden; +} + +h1, h2, h3, +h4, h5, h6 { + color: #000; + margin-bottom: 0; + padding-bottom: 0; +} + +h1 { + font-size: 2em; +} + +h2 { + font-size: 1.75em; +} + +h3 { + font-size: 1.2em; +} + +h4 { + font-size: 1.1em; +} + +h5, h6 { + font-size: 1em; +} + + h5 a:link, h5 a:visited, h5 a:active { + padding: 0; + text-decoration: none; + } + + +/* main layout +----------------------------------------------------------*/ +.content-wrapper { + margin: 0 auto; + max-width: 960px; +} + +#body { + background-color: #efeeef; + clear: both; + padding-bottom: 35px; +} + + .main-content { + background: url("../Images/accent.png") no-repeat; + padding-left: 10px; + padding-top: 30px; + } + + .featured + .main-content { + background: url("../Images/heroAccent.png") no-repeat; + } + +header .content-wrapper { + padding-top: 20px; +} + +footer { + clear: both; + background-color: #e2e2e2; + font-size: .8em; + height: 100px; +} + + +/* site title +----------------------------------------------------------*/ +.site-title { + color: #c8c8c8; + font-family: Rockwell, Consolas, "Courier New", Courier, monospace; + font-size: 2.3em; + margin: 0; +} + +.site-title a, .site-title a:hover, .site-title a:active { + background: none; + color: #c8c8c8; + outline: none; + text-decoration: none; +} + + +/* login +----------------------------------------------------------*/ +#login { + display: block; + font-size: .85em; + margin: 0 0 10px; + text-align: right; +} + + #login a { + background-color: #d3dce0; + margin-left: 10px; + margin-right: 3px; + padding: 2px 3px; + text-decoration: none; + } + + #login a.username { + background: none; + margin: 0; + padding: 0; + text-decoration: underline; + } + + #login ul { + margin: 0; + } + + #login li { + display: inline; + list-style: none; + } + + +/* menu +----------------------------------------------------------*/ +ul#menu { + font-size: 1.3em; + font-weight: 600; + margin: 0 0 5px; + padding: 0; + text-align: right; +} + + ul#menu li { + display: inline; + list-style: none; + padding-left: 15px; + } + + ul#menu li a { + background: none; + color: #999; + text-decoration: none; + } + + ul#menu li a:hover { + color: #333; + text-decoration: none; + } + + +/* page elements +----------------------------------------------------------*/ +/* featured */ +.featured { + background-color: #fff; +} + + .featured .content-wrapper { + background-color: #7ac0da; + background-image: -ms-linear-gradient(left, #7ac0da 0%, #a4d4e6 100%); + background-image: -o-linear-gradient(left, #7ac0da 0%, #a4d4e6 100%); + background-image: -webkit-gradient(linear, left top, right top, color-stop(0, #7ac0da), color-stop(1, #a4d4e6)); + background-image: -webkit-linear-gradient(left, #7ac0da 0%, #a4d4e6 100%); + background-image: linear-gradient(left, #7ac0da 0%, #a4d4e6 100%); + color: #3e5667; + padding: 20px 40px 30px 40px; + } + + .featured hgroup.title h1, .featured hgroup.title h2 { + color: #fff; + } + + .featured p { + font-size: 1.1em; + } + +/* page titles */ +hgroup.title { + margin-bottom: 10px; +} + +hgroup.title h1, hgroup.title h2 { + display: inline; +} + +hgroup.title h2 { + font-weight: normal; + margin-left: 3px; +} + +/* features */ +section.feature { + width: 300px; + float: left; + padding: 10px; +} + +/* ordered list */ +ol.round { + list-style-type: none; + padding-left: 0; +} + + ol.round li { + margin: 25px 0; + padding-left: 45px; + } + + ol.round li.zero { + background: url("../Images/orderedList0.png") no-repeat; + } + + ol.round li.one { + background: url("../Images/orderedList1.png") no-repeat; + } + + ol.round li.two { + background: url("../Images/orderedList2.png") no-repeat; + } + + ol.round li.three { + background: url("../Images/orderedList3.png") no-repeat; + } + + ol.round li.four { + background: url("../Images/orderedList4.png") no-repeat; + } + + ol.round li.five { + background: url("../Images/orderedList5.png") no-repeat; + } + + ol.round li.six { + background: url("../Images/orderedList6.png") no-repeat; + } + + ol.round li.seven { + background: url("../Images/orderedList7.png") no-repeat; + } + + ol.round li.eight { + background: url("../Images/orderedList8.png") no-repeat; + } + + ol.round li.nine { + background: url("../Images/orderedList9.png") no-repeat; + } + +/* content */ +article { + float: left; + width: 70%; +} + +aside { + float: right; + width: 25%; +} + + aside ul { + list-style: none; + padding: 0; + } + + aside ul li { + background: url("../Images/bullet.png") no-repeat 0 50%; + padding: 2px 0 2px 20px; + } + +.label { + font-weight: 700; +} + +/* login page */ +#loginForm { + border-right: solid 2px #c8c8c8; + float: left; + width: 55%; +} + + #loginForm .validation-error { + display: block; + margin-left: 15px; + } + + #loginForm .validation-summary-errors ul { + margin: 0; + padding: 0; + } + + #loginForm .validation-summary-errors li { + display: inline; + list-style: none; + margin: 0; + } + + #loginForm input { + width: 250px; + } + + #loginForm input[type="checkbox"], + #loginForm input[type="submit"], + #loginForm input[type="button"], + #loginForm button { + width: auto; + } + +#socialLoginForm { + margin-left: 40px; + float: left; + width: 40%; +} + + #socialLoginForm h2 { + margin-bottom: 5px; + } + +#socialLoginList button { + margin-bottom: 12px; +} + +#logoutForm { + display: inline; +} + +/* contact */ +.contact h3 { + font-size: 1.2em; +} + +.contact p { + margin: 5px 0 0 10px; +} + +.contact iframe { + border: 1px solid #333; + margin: 5px 0 0 10px; +} + +/* forms */ +fieldset { + border: none; + margin: 0; + padding: 0; +} + + fieldset legend { + display: none; + } + + fieldset ol { + padding: 0; + list-style: none; + } + + fieldset ol li { + padding-bottom: 5px; + } + +label { + display: block; + font-size: 1.2em; + font-weight: 600; +} + +label.checkbox { + display: inline; +} + +input, textarea { + border: 1px solid #e2e2e2; + background: #fff; + color: #333; + font-size: 1.2em; + margin: 5px 0 6px 0; + padding: 5px; + width: 300px; +} + +textarea { + font-family: inherit; + width: 500px; +} + + input:focus, textarea:focus { + border: 1px solid #7ac0da; + } + + input[type="checkbox"] { + background: transparent; + border: inherit; + width: auto; + } + + input[type="submit"], + input[type="button"], + button { + background-color: #d3dce0; + border: 1px solid #787878; + cursor: pointer; + font-size: 1.2em; + font-weight: 600; + padding: 7px; + margin-right: 8px; + width: auto; + } + + td input[type="submit"], + td input[type="button"], + td button { + font-size: 1em; + padding: 4px; + margin-right: 4px; + } + +/* info and errors */ +.message-info { + border: 1px solid; + clear: both; + padding: 10px 20px; +} + +.message-error { + clear: both; + color: #e80c4d; + font-size: 1.1em; + font-weight: bold; + margin: 20px 0 10px 0; +} + +.message-success { + color: #7ac0da; + font-size: 1.3em; + font-weight: bold; + margin: 20px 0 10px 0; +} + +.error { + color: #e80c4d; +} + +/* styles for validation helpers */ +.field-validation-error { + color: #e80c4d; + font-weight: bold; +} + +.field-validation-valid { + display: none; +} + +input.input-validation-error { + border: 1px solid #e80c4d; +} + +input[type="checkbox"].input-validation-error { + border: 0 none; +} + +.validation-summary-errors { + color: #e80c4d; + font-weight: bold; + font-size: 1.1em; +} + +.validation-summary-valid { + display: none; +} + + +/* tables +----------------------------------------------------------*/ +table { + border-collapse: collapse; + border-spacing: 0; + margin-top: 0.75em; + border: 0 none; +} + +th { + font-size: 1.2em; + text-align: left; + border: none 0px; + padding-left: 0; +} + + th a { + display: block; + position: relative; + } + + th a:link, th a:visited, th a:active, th a:hover { + color: #333; + font-weight: 600; + text-decoration: none; + padding: 0; + } + + th a:hover { + color: #000; + } + + th.asc a, th.desc a { + margin-right: .75em; + } + + th.asc a:after, th.desc a:after { + display: block; + position: absolute; + right: 0em; + top: 0; + font-size: 0.75em; + } + + th.asc a:after { + content: '▲'; + } + + th.desc a:after { + content: '▼'; + } + +td { + padding: 0.25em 2em 0.25em 0em; + border: 0 none; +} + +tr.pager td { + padding: 0 0.25em 0 0; +} + + +/******************** +* Mobile Styles * +********************/ +@media only screen and (max-width: 850px) { + + /* header + ----------------------------------------------------------*/ + header .float-left, + header .float-right { + float: none; + } + + /* logo */ + header .site-title { + margin: 10px; + text-align: center; + } + + /* login */ + #login { + font-size: .85em; + margin: 0 0 12px; + text-align: center; + } + + #login ul { + margin: 5px 0; + padding: 0; + } + + #login li { + display: inline; + list-style: none; + margin: 0; + padding: 0; + } + + #login a { + background: none; + color: #999; + font-weight: 600; + margin: 2px; + padding: 0; + } + + #login a:hover { + color: #333; + } + + /* menu */ + nav { + margin-bottom: 5px; + } + + ul#menu { + margin: 0; + padding: 0; + text-align: center; + } + + ul#menu li { + margin: 0; + padding: 0; + } + + + /* main layout + ----------------------------------------------------------*/ + .main-content, + .featured + .main-content { + background-position: 10px 0; + } + + .content-wrapper { + padding-right: 10px; + padding-left: 10px; + } + + .featured .content-wrapper { + padding: 10px; + } + + /* page content */ + article, aside { + float: none; + width: 100%; + } + + /* ordered list */ + ol.round { + list-style-type: none; + padding-left: 0; + } + + ol.round li { + padding-left: 10px; + margin: 25px 0; + } + + ol.round li.zero, + ol.round li.one, + ol.round li.two, + ol.round li.three, + ol.round li.four, + ol.round li.five, + ol.round li.six, + ol.round li.seven, + ol.round li.eight, + ol.round li.nine { + background: none; + } + + /* features */ + section.feature { + float: none; + padding: 10px; + width: auto; + } + + section.feature img { + color: #999; + content: attr(alt); + font-size: 1.5em; + font-weight: 600; + } + + /* forms */ + input { + width: 90%; + } + + /* login page */ + #loginForm { + border-right: none; + float: none; + width: auto; + } + + #loginForm .validation-error { + display: block; + margin-left: 15px; + } + + #socialLoginForm { + margin-left: 0; + float: none; + width: auto; + } + + + /* footer + ----------------------------------------------------------*/ + footer .float-left, + footer .float-right { + float: none; + } + + footer { + text-align: center; + height: auto; + padding: 10px 0; + } + + footer p { + margin: 0; + } +} diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100644 index 0000000..5b5dab2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100644 index 0000000..ac8b229 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png Binary files differnew file mode 100644 index 0000000..ad3d634 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 0000000..42ccba2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png Binary files differnew file mode 100644 index 0000000..5a46b47 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png Binary files differnew file mode 100644 index 0000000..86c2baa --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100644 index 0000000..4443fdc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png Binary files differnew file mode 100644 index 0000000..7c9fa6c --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_222222_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 0000000..ee039dc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_222222_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_2e83ff_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100644 index 0000000..45e8928 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_2e83ff_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_454545_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_454545_256x240.png Binary files differnew file mode 100644 index 0000000..7ec70d1 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_454545_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_888888_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_888888_256x240.png Binary files differnew file mode 100644 index 0000000..5ba708c --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_888888_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_cd0a0a_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100644 index 0000000..7930a55 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/images/ui-icons_cd0a0a_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery-ui.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery-ui.css new file mode 100644 index 0000000..764b8f9 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery-ui.css @@ -0,0 +1,466 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.tabs.css, jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } + +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.20 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} + +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ + +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } + +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } + +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.accordion.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.accordion.css new file mode 100644 index 0000000..5198833 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.accordion.css @@ -0,0 +1,19 @@ +/*! + * jQuery UI Accordion 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.all.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.all.css new file mode 100644 index 0000000..af6d2ce --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.all.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import "jquery.ui.base.css"; +@import "jquery.ui.theme.css"; diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.autocomplete.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.autocomplete.css new file mode 100644 index 0000000..56a7710 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.autocomplete.css @@ -0,0 +1,53 @@ +/*! + * jQuery UI Autocomplete 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.20 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.base.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.base.css new file mode 100644 index 0000000..49775ee --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.base.css @@ -0,0 +1,21 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming + */ +@import url("jquery.ui.core.css"); + +@import url("jquery.ui.accordion.css"); +@import url("jquery.ui.autocomplete.css"); +@import url("jquery.ui.button.css"); +@import url("jquery.ui.datepicker.css"); +@import url("jquery.ui.dialog.css"); +@import url("jquery.ui.progressbar.css"); +@import url("jquery.ui.resizable.css"); +@import url("jquery.ui.selectable.css"); +@import url("jquery.ui.slider.css"); +@import url("jquery.ui.tabs.css"); diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.button.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.button.css new file mode 100644 index 0000000..47b8f33 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.button.css @@ -0,0 +1,38 @@ +/*! + * jQuery UI Button 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.core.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.core.css new file mode 100644 index 0000000..a622030 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.core.css @@ -0,0 +1,38 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.datepicker.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.datepicker.css new file mode 100644 index 0000000..11d1e78 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.datepicker.css @@ -0,0 +1,68 @@ +/*! + * jQuery UI Datepicker 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.dialog.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.dialog.css new file mode 100644 index 0000000..ac039f0 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.dialog.css @@ -0,0 +1,21 @@ +/*! + * jQuery UI Dialog 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.progressbar.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.progressbar.css new file mode 100644 index 0000000..f6fc5df --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.progressbar.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI Progressbar 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.resizable.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.resizable.css new file mode 100644 index 0000000..6a55fe7 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.resizable.css @@ -0,0 +1,20 @@ +/*! + * jQuery UI Resizable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.selectable.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.selectable.css new file mode 100644 index 0000000..3baebf8 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.selectable.css @@ -0,0 +1,10 @@ +/*! + * jQuery UI Selectable 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.slider.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.slider.css new file mode 100644 index 0000000..9b36d77 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.slider.css @@ -0,0 +1,24 @@ +/*! + * jQuery UI Slider 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.tabs.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.tabs.css new file mode 100644 index 0000000..2e78303 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.tabs.css @@ -0,0 +1,18 @@ +/*! + * jQuery UI Tabs 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.theme.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.theme.css new file mode 100644 index 0000000..a58368a --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/jquery.ui.theme.css @@ -0,0 +1,247 @@ +/*! + * jQuery UI CSS Framework 1.8.20 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Licensed under the MIT license. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100644 index 0000000..5b5dab2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100644 index 0000000..ac8b229 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png Binary files differnew file mode 100644 index 0000000..ad3d634 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 0000000..42ccba2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png Binary files differnew file mode 100644 index 0000000..5a46b47 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_dadada_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_e6e6e6_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_e6e6e6_1x400.png Binary files differnew file mode 100644 index 0000000..86c2baa --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_95_fef1ec_1x400.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100644 index 0000000..4443fdc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png Binary files differnew file mode 100644 index 0000000..7c9fa6c --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_222222_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 0000000..ee039dc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_222222_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100644 index 0000000..45e8928 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_2e83ff_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_454545_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_454545_256x240.png Binary files differnew file mode 100644 index 0000000..7ec70d1 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_454545_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_888888_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_888888_256x240.png Binary files differnew file mode 100644 index 0000000..5ba708c --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_888888_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_cd0a0a_256x240.png b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100644 index 0000000..7930a55 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/images/ui-icons_cd0a0a_256x240.png diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery-ui.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery-ui.min.css new file mode 100644 index 0000000..1e76dbc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery-ui.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.tabs.css, jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{zoom:1}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block}.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0em}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{display:none;display position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tabs .ui-tabs-hide{display:none!important}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget:active{outline:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.accordion.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.accordion.min.css new file mode 100644 index 0000000..3f59045 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.accordion.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.accordion.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.autocomplete.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.autocomplete.min.css new file mode 100644 index 0000000..631b8bc --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.autocomplete.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.autocomplete.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.button.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.button.min.css new file mode 100644 index 0000000..9148a97 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.button.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.button.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.core.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.core.min.css new file mode 100644 index 0000000..644b714 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.core.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{zoom:1}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.datepicker.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.datepicker.min.css new file mode 100644 index 0000000..7bd6969 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.datepicker.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.datepicker.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0em}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{display:none;display position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.dialog.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.dialog.min.css new file mode 100644 index 0000000..97b6c44 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.dialog.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.dialog.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.progressbar.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.progressbar.min.css new file mode 100644 index 0000000..7ac8e04 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.progressbar.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.progressbar.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.resizable.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.resizable.min.css new file mode 100644 index 0000000..1085d30 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.resizable.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.resizable.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.selectable.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.selectable.min.css new file mode 100644 index 0000000..ce3e674 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.selectable.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.selectable.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.slider.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.slider.min.css new file mode 100644 index 0000000..322578a --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.slider.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.slider.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.tabs.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.tabs.min.css new file mode 100644 index 0000000..11fb82b --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.tabs.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.tabs.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tabs .ui-tabs-hide{display:none!important}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.theme.min.css b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.theme.min.css new file mode 100644 index 0000000..8875d98 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Content/themes/base/minified/jquery.ui.theme.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.theme.css +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget:active{outline:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Controllers/HomeController.cs b/samples/OAuth2ProtectedWebApi/Controllers/HomeController.cs new file mode 100644 index 0000000..3244000 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Controllers/HomeController.cs @@ -0,0 +1,13 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web; +using System.Web.Mvc; + +namespace OAuth2ProtectedWebApi.Controllers { + public class HomeController : Controller { + public ActionResult Index() { + return View(); + } + } +} diff --git a/samples/OAuth2ProtectedWebApi/Controllers/TokenController.cs b/samples/OAuth2ProtectedWebApi/Controllers/TokenController.cs new file mode 100644 index 0000000..a6ecf32 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Controllers/TokenController.cs @@ -0,0 +1,17 @@ +namespace OAuth2ProtectedWebApi.Controllers { + using System.Net.Http; + using System.Threading.Tasks; + using System.Web.Http; + + using DotNetOpenAuth.OAuth2; + + using OAuth2ProtectedWebApi.Code; + + public class TokenController : ApiController { + // POST /api/token + public Task<HttpResponseMessage> Post(HttpRequestMessage request) { + var authServer = new AuthorizationServer(new AuthorizationServerHost()); + return authServer.HandleTokenRequestAsync(request); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Controllers/UserController.cs b/samples/OAuth2ProtectedWebApi/Controllers/UserController.cs new file mode 100644 index 0000000..e627dc2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Controllers/UserController.cs @@ -0,0 +1,76 @@ +namespace OAuth2ProtectedWebApi.Controllers { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net.Http; + using System.Security.Principal; + using System.Threading.Tasks; + using System.Web; + using System.Web.Mvc; + using System.Web.Security; + using DotNetOpenAuth.Messaging; + using DotNetOpenAuth.OAuth2; + using DotNetOpenAuth.OAuth2.Messages; + using DotNetOpenAuth.OpenId; + using DotNetOpenAuth.OpenId.RelyingParty; + using OAuth2ProtectedWebApi.Code; + + public class UserController : Controller { + [Authorize] + [HttpGet] + [HttpHeader("x-frame-options", "SAMEORIGIN")] // mitigates clickjacking + public async Task<ActionResult> Authorize() { + var authServer = new AuthorizationServer(new AuthorizationServerHost()); + var authRequest = await authServer.ReadAuthorizationRequestAsync(this.Request); + this.ViewData["scope"] = authRequest.Scope; + this.ViewData["request"] = this.Request.Url; + return View(); + } + + [Authorize] + [HttpPost, ValidateAntiForgeryToken] + public async Task<ActionResult> Respond(string request, bool approval) { + var authServer = new AuthorizationServer(new AuthorizationServerHost()); + var authRequest = await authServer.ReadAuthorizationRequestAsync(new Uri(request)); + IProtocolMessage responseMessage; + if (approval) { + var grantedResponse = authServer.PrepareApproveAuthorizationRequest( + authRequest, this.User.Identity.Name, authRequest.Scope); + responseMessage = grantedResponse; + } else { + var rejectionResponse = authServer.PrepareRejectAuthorizationRequest(authRequest); + rejectionResponse.Error = Protocol.EndUserAuthorizationRequestErrorCodes.AccessDenied; + responseMessage = rejectionResponse; + } + + var response = await authServer.Channel.PrepareResponseAsync(responseMessage); + return response.AsActionResult(); + } + + public async Task<ActionResult> Login(string returnUrl) { + var rp = new OpenIdRelyingParty(null); + Realm officialWebSiteHome = Realm.AutoDetect; + Uri returnTo = new Uri(this.Request.Url, this.Url.Action("Authenticate")); + var request = await rp.CreateRequestAsync(WellKnownProviders.Google, officialWebSiteHome, returnTo); + if (returnUrl != null) { + request.SetUntrustedCallbackArgument("returnUrl", returnUrl); + } + + var redirectingResponse = await request.GetRedirectingResponseAsync(); + return redirectingResponse.AsActionResult(); + } + + public async Task<ActionResult> Authenticate() { + var rp = new OpenIdRelyingParty(null); + var response = await rp.GetResponseAsync(this.Request); + if (response != null) { + if (response.Status == AuthenticationStatus.Authenticated) { + FormsAuthentication.SetAuthCookie(response.ClaimedIdentifier, false); + return this.Redirect(FormsAuthentication.GetRedirectUrl(response.ClaimedIdentifier, false)); + } + } + + return this.RedirectToAction("Index", "Home"); + } + } +} diff --git a/samples/OAuth2ProtectedWebApi/Controllers/ValuesController.cs b/samples/OAuth2ProtectedWebApi/Controllers/ValuesController.cs new file mode 100644 index 0000000..1c84c99 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Controllers/ValuesController.cs @@ -0,0 +1,33 @@ +namespace OAuth2ProtectedWebApi.Controllers { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net; + using System.Net.Http; + using System.Web.Http; + + [Authorize(Roles = "Values")] + public class ValuesController : ApiController { + // GET api/values + public IEnumerable<string> Get() { + return new string[] { "value1", this.User.Identity.Name, "value2" }; + } + + // GET api/values/5 + public string Get(int id) { + return "value"; + } + + // POST api/values + public void Post([FromBody]string value) { + } + + // PUT api/values/5 + public void Put(int id, [FromBody]string value) { + } + + // DELETE api/values/5 + public void Delete(int id) { + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Global.asax b/samples/OAuth2ProtectedWebApi/Global.asax new file mode 100644 index 0000000..87e66de --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Global.asax @@ -0,0 +1 @@ +<%@ Application Codebehind="Global.asax.cs" Inherits="OAuth2ProtectedWebApi.WebApiApplication" Language="C#" %> diff --git a/samples/OAuth2ProtectedWebApi/Global.asax.cs b/samples/OAuth2ProtectedWebApi/Global.asax.cs new file mode 100644 index 0000000..0f71597 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Global.asax.cs @@ -0,0 +1,24 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web; +using System.Web.Http; +using System.Web.Mvc; +using System.Web.Optimization; +using System.Web.Routing; + +namespace OAuth2ProtectedWebApi { + // Note: For instructions on enabling IIS6 or IIS7 classic mode, + // visit http://go.microsoft.com/?LinkId=9394801 + + public class WebApiApplication : System.Web.HttpApplication { + protected void Application_Start() { + AreaRegistration.RegisterAllAreas(); + + WebApiConfig.Register(GlobalConfiguration.Configuration); + FilterConfig.RegisterGlobalFilters(GlobalFilters.Filters); + RouteConfig.RegisterRoutes(RouteTable.Routes); + BundleConfig.RegisterBundles(BundleTable.Bundles); + } + } +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Images/accent.png b/samples/OAuth2ProtectedWebApi/Images/accent.png Binary files differnew file mode 100644 index 0000000..cd07580 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/accent.png diff --git a/samples/OAuth2ProtectedWebApi/Images/bullet.png b/samples/OAuth2ProtectedWebApi/Images/bullet.png Binary files differnew file mode 100644 index 0000000..d3824c1 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/bullet.png diff --git a/samples/OAuth2ProtectedWebApi/Images/heroAccent.png b/samples/OAuth2ProtectedWebApi/Images/heroAccent.png Binary files differnew file mode 100644 index 0000000..14ea59b --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/heroAccent.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList0.png b/samples/OAuth2ProtectedWebApi/Images/orderedList0.png Binary files differnew file mode 100644 index 0000000..7a4ea25 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList0.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList1.png b/samples/OAuth2ProtectedWebApi/Images/orderedList1.png Binary files differnew file mode 100644 index 0000000..523c24d --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList1.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList2.png b/samples/OAuth2ProtectedWebApi/Images/orderedList2.png Binary files differnew file mode 100644 index 0000000..553a2da --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList2.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList3.png b/samples/OAuth2ProtectedWebApi/Images/orderedList3.png Binary files differnew file mode 100644 index 0000000..0714981 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList3.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList4.png b/samples/OAuth2ProtectedWebApi/Images/orderedList4.png Binary files differnew file mode 100644 index 0000000..ce91e8f --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList4.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList5.png b/samples/OAuth2ProtectedWebApi/Images/orderedList5.png Binary files differnew file mode 100644 index 0000000..c073485 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList5.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList6.png b/samples/OAuth2ProtectedWebApi/Images/orderedList6.png Binary files differnew file mode 100644 index 0000000..3b9aa05 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList6.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList7.png b/samples/OAuth2ProtectedWebApi/Images/orderedList7.png Binary files differnew file mode 100644 index 0000000..f99c609 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList7.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList8.png b/samples/OAuth2ProtectedWebApi/Images/orderedList8.png Binary files differnew file mode 100644 index 0000000..127596d --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList8.png diff --git a/samples/OAuth2ProtectedWebApi/Images/orderedList9.png b/samples/OAuth2ProtectedWebApi/Images/orderedList9.png Binary files differnew file mode 100644 index 0000000..39cfdcf --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Images/orderedList9.png diff --git a/samples/OAuth2ProtectedWebApi/OAuth2ProtectedWebApi.csproj b/samples/OAuth2ProtectedWebApi/OAuth2ProtectedWebApi.csproj new file mode 100644 index 0000000..9c54bcd --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/OAuth2ProtectedWebApi.csproj @@ -0,0 +1,313 @@ +<?xml version="1.0" encoding="utf-8"?> +<Project ToolsVersion="4.0" DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003"> + <Import Project="$(MSBuildExtensionsPath)\$(MSBuildToolsVersion)\Microsoft.Common.props" Condition="Exists('$(MSBuildExtensionsPath)\$(MSBuildToolsVersion)\Microsoft.Common.props')" /> + <PropertyGroup> + <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> + <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform> + <ProductVersion> + </ProductVersion> + <SchemaVersion>2.0</SchemaVersion> + <ProjectGuid>{58A3721F-5B5C-4CA7-BE39-91640B5B4924}</ProjectGuid> + <ProjectTypeGuids>{E3E379DF-F4C6-4180-9B81-6769533ABE47};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> + <OutputType>Library</OutputType> + <AppDesignerFolder>Properties</AppDesignerFolder> + <RootNamespace>OAuth2ProtectedWebApi</RootNamespace> + <AssemblyName>OAuth2ProtectedWebApi</AssemblyName> + <TargetFrameworkVersion>v4.5</TargetFrameworkVersion> + <MvcBuildViews>false</MvcBuildViews> + <UseIISExpress>true</UseIISExpress> + <IISExpressSSLPort /> + <IISExpressAnonymousAuthentication /> + <IISExpressWindowsAuthentication /> + <IISExpressUseClassicPipelineMode /> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> + <RestorePackages>true</RestorePackages> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> + <DebugSymbols>true</DebugSymbols> + <DebugType>full</DebugType> + <Optimize>false</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>DEBUG;TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' "> + <DebugType>pdbonly</DebugType> + <Optimize>true</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <ItemGroup> + <Reference Include="Microsoft.CSharp" /> + <Reference Include="System" /> + <Reference Include="System.Data" /> + <Reference Include="System.Data.Entity" /> + <Reference Include="System.Drawing" /> + <Reference Include="System.ServiceModel" /> + <Reference Include="System.Web.Entity" /> + <Reference Include="System.Web.ApplicationServices" /> + <Reference Include="System.ComponentModel.DataAnnotations" /> + <Reference Include="System.Core" /> + <Reference Include="System.Data.DataSetExtensions" /> + <Reference Include="System.Xml.Linq" /> + <Reference Include="System.Web" /> + <Reference Include="System.Web.Abstractions" /> + <Reference Include="System.Web.Routing" /> + <Reference Include="System.Xml" /> + <Reference Include="System.Configuration" /> + <Reference Include="EntityFramework"> + <HintPath>..\..\src\packages\EntityFramework.5.0.0\lib\net45\EntityFramework.dll</HintPath> + </Reference> + <Reference Include="Microsoft.Web.Infrastructure, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll</HintPath> + </Reference> + <Reference Include="Newtonsoft.Json"> + <HintPath>..\..\src\packages\Newtonsoft.Json.4.5.6\lib\net40\Newtonsoft.Json.dll</HintPath> + </Reference> + <Reference Include="System.Net.Http"> + </Reference> + <Reference Include="System.Net.Http.Formatting, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.Client.4.0.20710.0\lib\net40\System.Net.Http.Formatting.dll</HintPath> + </Reference> + <Reference Include="System.Net.Http.WebRequest"> + </Reference> + <Reference Include="System.Web.Helpers, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.Helpers.dll</HintPath> + </Reference> + <Reference Include="System.Web.Http, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.Core.4.0.20710.0\lib\net40\System.Web.Http.dll</HintPath> + </Reference> + <Reference Include="System.Web.Http.WebHost, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.WebHost.4.0.20710.0\lib\net40\System.Web.Http.WebHost.dll</HintPath> + </Reference> + <Reference Include="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Mvc.4.0.20710.0\lib\net40\System.Web.Mvc.dll</HintPath> + </Reference> + <Reference Include="System.Web.Optimization"> + <HintPath>..\..\src\packages\Microsoft.AspNet.Web.Optimization.1.0.0\lib\net40\System.Web.Optimization.dll</HintPath> + </Reference> + <Reference Include="System.Web.Providers"> + <HintPath>..\..\src\packages\Microsoft.AspNet.Providers.Core.1.1\lib\net40\System.Web.Providers.dll</HintPath> + </Reference> + <Reference Include="System.Web.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Razor.2.0.20710.0\lib\net40\System.Web.Razor.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Deployment, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Deployment.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Razor.dll</HintPath> + </Reference> + <Reference Include="WebGrease"> + <Private>True</Private> + <HintPath>..\..\src\packages\WebGrease.1.1.0\lib\WebGrease.dll</HintPath> + </Reference> + <Reference Include="Antlr3.Runtime"> + <Private>True</Private> + <HintPath>..\..\src\packages\WebGrease.1.1.0\lib\Antlr3.Runtime.dll</HintPath> + </Reference> + </ItemGroup> + <ItemGroup> + <Compile Include="App_Start\BundleConfig.cs" /> + <Compile Include="App_Start\FilterConfig.cs" /> + <Compile Include="App_Start\RouteConfig.cs" /> + <Compile Include="App_Start\WebApiConfig.cs" /> + <Compile Include="Code\AuthorizationServerHost.cs" /> + <Compile Include="Code\BearerTokenHandler.cs" /> + <Compile Include="Code\HttpHeaderAttribute.cs" /> + <Compile Include="Controllers\HomeController.cs" /> + <Compile Include="Controllers\TokenController.cs" /> + <Compile Include="Controllers\UserController.cs" /> + <Compile Include="Controllers\ValuesController.cs" /> + <Compile Include="Global.asax.cs"> + <DependentUpon>Global.asax</DependentUpon> + </Compile> + <Compile Include="Properties\AssemblyInfo.cs" /> + </ItemGroup> + <ItemGroup> + <Content Include="Content\themes\base\images\ui-bg_flat_0_aaaaaa_40x100.png" /> + <Content Include="Content\themes\base\images\ui-bg_flat_75_ffffff_40x100.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_55_fbf9ee_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_65_ffffff_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_75_dadada_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_75_e6e6e6_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_95_fef1ec_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_highlight-soft_75_cccccc_1x100.png" /> + <Content Include="Content\themes\base\images\ui-icons_222222_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_2e83ff_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_454545_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_888888_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_cd0a0a_256x240.png" /> + <Content Include="Content\themes\base\jquery-ui.css" /> + <Content Include="Content\themes\base\jquery.ui.accordion.css" /> + <Content Include="Content\themes\base\jquery.ui.all.css" /> + <Content Include="Content\themes\base\jquery.ui.autocomplete.css" /> + <Content Include="Content\themes\base\jquery.ui.base.css" /> + <Content Include="Content\themes\base\jquery.ui.button.css" /> + <Content Include="Content\themes\base\jquery.ui.core.css" /> + <Content Include="Content\themes\base\jquery.ui.datepicker.css" /> + <Content Include="Content\themes\base\jquery.ui.dialog.css" /> + <Content Include="Content\themes\base\jquery.ui.progressbar.css" /> + <Content Include="Content\themes\base\jquery.ui.resizable.css" /> + <Content Include="Content\themes\base\jquery.ui.selectable.css" /> + <Content Include="Content\themes\base\jquery.ui.slider.css" /> + <Content Include="Content\themes\base\jquery.ui.tabs.css" /> + <Content Include="Content\themes\base\jquery.ui.theme.css" /> + <Content Include="Content\themes\base\minified\images\ui-bg_flat_0_aaaaaa_40x100.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_flat_75_ffffff_40x100.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_glass_55_fbf9ee_1x400.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_glass_65_ffffff_1x400.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_glass_75_dadada_1x400.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_glass_75_e6e6e6_1x400.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_glass_95_fef1ec_1x400.png" /> + <Content Include="Content\themes\base\minified\images\ui-bg_highlight-soft_75_cccccc_1x100.png" /> + <Content Include="Content\themes\base\minified\images\ui-icons_222222_256x240.png" /> + <Content Include="Content\themes\base\minified\images\ui-icons_2e83ff_256x240.png" /> + <Content Include="Content\themes\base\minified\images\ui-icons_454545_256x240.png" /> + <Content Include="Content\themes\base\minified\images\ui-icons_888888_256x240.png" /> + <Content Include="Content\themes\base\minified\images\ui-icons_cd0a0a_256x240.png" /> + <Content Include="Content\themes\base\minified\jquery-ui.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.accordion.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.autocomplete.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.button.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.core.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.datepicker.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.dialog.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.progressbar.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.resizable.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.selectable.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.slider.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.tabs.min.css" /> + <Content Include="Content\themes\base\minified\jquery.ui.theme.min.css" /> + <Content Include="favicon.ico" /> + <Content Include="Global.asax" /> + <None Include="Scripts\jquery-1.7.1.intellisense.js" /> + <Content Include="Scripts\jquery-1.7.1.js" /> + <Content Include="Scripts\jquery-1.7.1.min.js" /> + <None Include="Scripts\jquery.validate-vsdoc.js" /> + <Content Include="Scripts\jquery-ui-1.8.20.js" /> + <Content Include="Scripts\jquery-ui-1.8.20.min.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.min.js" /> + <Content Include="Scripts\jquery.validate.js" /> + <Content Include="Scripts\jquery.validate.min.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.min.js" /> + <Content Include="Scripts\knockout-2.1.0.debug.js" /> + <Content Include="Scripts\knockout-2.1.0.js" /> + <Content Include="Scripts\modernizr-2.5.3.js" /> + <Content Include="Web.config" /> + <Content Include="Web.Debug.config"> + <DependentUpon>Web.config</DependentUpon> + </Content> + <Content Include="Web.Release.config"> + <DependentUpon>Web.config</DependentUpon> + </Content> + <Content Include="Content\Site.css" /> + <Content Include="Images\accent.png" /> + <Content Include="Images\bullet.png" /> + <Content Include="Images\heroAccent.png" /> + <Content Include="Images\orderedList0.png" /> + <Content Include="Images\orderedList1.png" /> + <Content Include="Images\orderedList2.png" /> + <Content Include="Images\orderedList3.png" /> + <Content Include="Images\orderedList4.png" /> + <Content Include="Images\orderedList5.png" /> + <Content Include="Images\orderedList6.png" /> + <Content Include="Images\orderedList7.png" /> + <Content Include="Images\orderedList8.png" /> + <Content Include="Images\orderedList9.png" /> + <Content Include="Scripts\_references.js" /> + <Content Include="Views\Web.config" /> + <Content Include="Views\_ViewStart.cshtml" /> + <Content Include="Views\Home\Index.cshtml" /> + <Content Include="Views\Shared\Error.cshtml" /> + <Content Include="Views\Shared\_Layout.cshtml" /> + <Content Include="Views\User\Authorize.cshtml" /> + </ItemGroup> + <ItemGroup> + <Folder Include="App_Data\" /> + <Folder Include="Models\" /> + </ItemGroup> + <ItemGroup> + <Content Include="packages.config" /> + </ItemGroup> + <ItemGroup> + <ProjectReference Include="..\..\src\DotNetOpenAuth.Core\DotNetOpenAuth.Core.csproj"> + <Project>{60426312-6ae5-4835-8667-37edea670222}</Project> + <Name>DotNetOpenAuth.Core</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth2.AuthorizationServer\DotNetOpenAuth.OAuth2.AuthorizationServer.csproj"> + <Project>{99bb7543-ea16-43ee-a7bc-d7a25a3b22f6}</Project> + <Name>DotNetOpenAuth.OAuth2.AuthorizationServer</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth2.ClientAuthorization\DotNetOpenAuth.OAuth2.ClientAuthorization.csproj"> + <Project>{ccf3728a-b3d7-404a-9bc6-75197135f2d7}</Project> + <Name>DotNetOpenAuth.OAuth2.ClientAuthorization</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth2.ResourceServer\DotNetOpenAuth.OAuth2.ResourceServer.csproj"> + <Project>{a1a3150a-7b0e-4a34-8e35-045296cd3c76}</Project> + <Name>DotNetOpenAuth.OAuth2.ResourceServer</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OAuth2\DotNetOpenAuth.OAuth2.csproj"> + <Project>{56459a6c-6ba2-4bac-a9c0-27e3bd961fa6}</Project> + <Name>DotNetOpenAuth.OAuth2</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OpenId.RelyingParty\DotNetOpenAuth.OpenId.RelyingParty.csproj"> + <Project>{f458ab60-ba1c-43d9-8cef-ec01b50be87b}</Project> + <Name>DotNetOpenAuth.OpenId.RelyingParty</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OpenId\DotNetOpenAuth.OpenId.csproj"> + <Project>{3896a32a-e876-4c23-b9b8-78e17d134cd3}</Project> + <Name>DotNetOpenAuth.OpenId</Name> + </ProjectReference> + </ItemGroup> + <PropertyGroup> + <VisualStudioVersion Condition="'$(VisualStudioVersion)' == ''">10.0</VisualStudioVersion> + <VSToolsPath Condition="'$(VSToolsPath)' == ''">$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v$(VisualStudioVersion)</VSToolsPath> + </PropertyGroup> + <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> + <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> + <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" Condition="false" /> + <Target Name="MvcBuildViews" AfterTargets="AfterBuild" Condition="'$(MvcBuildViews)'=='true'"> + <AspNetCompiler VirtualPath="temp" PhysicalPath="$(WebProjectOutputDir)" /> + </Target> + <ProjectExtensions> + <VisualStudio> + <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> + <WebProjectProperties> + <UseIIS>True</UseIIS> + <AutoAssignPort>True</AutoAssignPort> + <DevelopmentServerPort>11473</DevelopmentServerPort> + <DevelopmentServerVPath>/</DevelopmentServerVPath> + <IISUrl>http://localhost:23603/</IISUrl> + <NTLMAuthentication>False</NTLMAuthentication> + <UseCustomServer>False</UseCustomServer> + <CustomServerUrl> + </CustomServerUrl> + <SaveServerSettingsInUserFile>False</SaveServerSettingsInUserFile> + </WebProjectProperties> + </FlavorProperties> + </VisualStudio> + </ProjectExtensions> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> + <!-- To modify your build process, add your task inside one of the targets below and uncomment it. + Other similar extension points exist, see Microsoft.Common.targets. + <Target Name="BeforeBuild"> + </Target> + <Target Name="AfterBuild"> + </Target> --> +</Project>
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Properties/AssemblyInfo.cs b/samples/OAuth2ProtectedWebApi/Properties/AssemblyInfo.cs new file mode 100644 index 0000000..085e1be --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Properties/AssemblyInfo.cs @@ -0,0 +1,35 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// General Information about an assembly is controlled through the following +// set of attributes. Change these attribute values to modify the information +// associated with an assembly. +[assembly: AssemblyTitle("OAuth2ProtectedWebApi")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("OAuth2ProtectedWebApi")] +[assembly: AssemblyCopyright("Copyright © 2013")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Setting ComVisible to false makes the types in this assembly not visible +// to COM components. If you need to access a type in this assembly from +// COM, set the ComVisible attribute to true on that type. +[assembly: ComVisible(false)] + +// The following GUID is for the ID of the typelib if this project is exposed to COM +[assembly: Guid("8c6f3cfe-891a-44f1-8fe6-ef407834ebaf")] + +// Version information for an assembly consists of the following four values: +// +// Major Version +// Minor Version +// Build Number +// Revision +// +// You can specify all the values or you can default the Revision and Build Numbers +// by using the '*' as shown below: +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/samples/OAuth2ProtectedWebApi/Scripts/_references.js b/samples/OAuth2ProtectedWebApi/Scripts/_references.js Binary files differnew file mode 100644 index 0000000..2ff8876 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/_references.js diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.intellisense.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.intellisense.js new file mode 100644 index 0000000..35a9a25 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.intellisense.js @@ -0,0 +1,2521 @@ +/*! + * Documentation Content + * Copyright (c) 2009 Packt Publishing, http://packtpub.com/ + * Copyright (c) 2012 jQuery Foundation, http://jquery.org/ + * + * This software consists of voluntary contributions made by many + * individuals. For exact contribution history, see the revision history + * and logs, available at http://github.com/jquery/api.jquery.com + * + * Permission is hereby granted, free of charge, to any person obtaining + * a copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, sublicense, and/or sell copies of the Software, and to + * permit persons to whom the Software is furnished to do so, subject to + * the following conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE + * LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION + * OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + * WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +*/ +intellisense.annotate(jQuery, { + 'ajax': function() { + /// <signature> + /// <summary>Perform an asynchronous HTTP (Ajax) request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="settings" type="Object">A set of key/value pairs that configure the Ajax request. All settings are optional. A default can be set for any option with $.ajaxSetup(). See jQuery.ajax( settings ) below for a complete list of all settings.</param> + /// <returns type="jqXHR" /> + /// </signature> + /// <signature> + /// <summary>Perform an asynchronous HTTP (Ajax) request.</summary> + /// <param name="settings" type="Object">A set of key/value pairs that configure the Ajax request. All settings are optional. A default can be set for any option with $.ajaxSetup().</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'ajaxPrefilter': function() { + /// <signature> + /// <summary>Handle custom Ajax options or modify existing options before each request is sent and before they are processed by $.ajax().</summary> + /// <param name="dataTypes" type="String">An optional string containing one or more space-separated dataTypes</param> + /// <param name="handler(options, originalOptions, jqXHR)" type="Function">A handler to set default values for future Ajax requests.</param> + /// </signature> + }, + 'ajaxSetup': function() { + /// <signature> + /// <summary>Set default values for future Ajax requests.</summary> + /// <param name="options" type="Object">A set of key/value pairs that configure the default Ajax request. All options are optional.</param> + /// </signature> + }, + 'boxModel': function() { + /// <summary>Deprecated in jQuery 1.3 (see jQuery.support). States if the current page, in the user's browser, is being rendered using the W3C CSS Box Model.</summary> + /// <returns type="Boolean" /> + }, + 'browser': function() { + /// <summary>Contains flags for the useragent, read from navigator.userAgent. We recommend against using this property; please try to use feature detection instead (see jQuery.support). jQuery.browser may be moved to a plugin in a future release of jQuery.</summary> + /// <returns type="Map" /> + }, + 'browser.version': function() { + /// <summary>The version number of the rendering engine for the user's browser.</summary> + /// <returns type="String" /> + }, + 'Callbacks': function() { + /// <signature> + /// <summary>A multi-purpose callbacks list object that provides a powerful way to manage callback lists.</summary> + /// <param name="flags" type="String">An optional list of space-separated flags that change how the callback list behaves.</param> + /// </signature> + }, + 'contains': function() { + /// <signature> + /// <summary>Check to see if a DOM element is within another DOM element.</summary> + /// <param name="container" type="Element">The DOM element that may contain the other element.</param> + /// <param name="contained" type="Element">The DOM element that may be contained by the other element.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'cssHooks': function() { + /// <summary>Hook directly into jQuery to override how particular CSS properties are retrieved or set, normalize CSS property naming, or create custom properties.</summary> + /// <returns type="Object" /> + }, + 'data': function() { + /// <signature> + /// <summary>Returns value at named data store for the element, as set by jQuery.data(element, name, value), or the full data store for the element.</summary> + /// <param name="element" type="Element">The DOM element to query for the data.</param> + /// <param name="key" type="String">Name of the data stored.</param> + /// <returns type="Object" /> + /// </signature> + /// <signature> + /// <summary>Returns value at named data store for the element, as set by jQuery.data(element, name, value), or the full data store for the element.</summary> + /// <param name="element" type="Element">The DOM element to query for the data.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'dequeue': function() { + /// <signature> + /// <summary>Execute the next function on the queue for the matched element.</summary> + /// <param name="element" type="Element">A DOM element from which to remove and execute a queued function.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'each': function() { + /// <signature> + /// <summary>A generic iterator function, which can be used to seamlessly iterate over both objects and arrays. Arrays and array-like objects with a length property (such as a function's arguments object) are iterated by numeric index, from 0 to length-1. Other objects are iterated via their named properties.</summary> + /// <param name="collection" type="Object">The object or array to iterate over.</param> + /// <param name="callback(indexInArray, valueOfElement)" type="Function">The function that will be executed on every object.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'error': function() { + /// <signature> + /// <summary>Takes a string and throws an exception containing it.</summary> + /// <param name="message" type="String">The message to send out.</param> + /// </signature> + }, + 'extend': function() { + /// <signature> + /// <summary>Merge the contents of two or more objects together into the first object.</summary> + /// <param name="target" type="Object">An object that will receive the new properties if additional objects are passed in or that will extend the jQuery namespace if it is the sole argument.</param> + /// <param name="object1" type="Object">An object containing additional properties to merge in.</param> + /// <param name="objectN" type="Object">Additional objects containing properties to merge in.</param> + /// <returns type="Object" /> + /// </signature> + /// <signature> + /// <summary>Merge the contents of two or more objects together into the first object.</summary> + /// <param name="deep" type="Boolean">If true, the merge becomes recursive (aka. deep copy).</param> + /// <param name="target" type="Object">The object to extend. It will receive the new properties.</param> + /// <param name="object1" type="Object">An object containing additional properties to merge in.</param> + /// <param name="objectN" type="Object">Additional objects containing properties to merge in.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'get': function() { + /// <signature> + /// <summary>Load data from the server using a HTTP GET request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="String">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <param name="dataType" type="String">The type of data expected from the server. Default: Intelligent Guess (xml, json, script, or html).</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'getJSON': function() { + /// <signature> + /// <summary>Load JSON-encoded data from the server using a GET HTTP request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="Object">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'getScript': function() { + /// <signature> + /// <summary>Load a JavaScript file from the server using a GET HTTP request, then execute it.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="success(script, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'globalEval': function() { + /// <signature> + /// <summary>Execute some JavaScript code globally.</summary> + /// <param name="code" type="String">The JavaScript code to execute.</param> + /// </signature> + }, + 'grep': function() { + /// <signature> + /// <summary>Finds the elements of an array which satisfy a filter function. The original array is not affected.</summary> + /// <param name="array" type="Array">The array to search through.</param> + /// <param name="function(elementOfArray, indexInArray)" type="Function">The function to process each item against. The first argument to the function is the item, and the second argument is the index. The function should return a Boolean value. this will be the global window object.</param> + /// <param name="invert" type="Boolean">If "invert" is false, or not provided, then the function returns an array consisting of all elements for which "callback" returns true. If "invert" is true, then the function returns an array consisting of all elements for which "callback" returns false.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'hasData': function() { + /// <signature> + /// <summary>Determine whether an element has any jQuery data associated with it.</summary> + /// <param name="element" type="Element">A DOM element to be checked for data.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'holdReady': function() { + /// <signature> + /// <summary>Holds or releases the execution of jQuery's ready event.</summary> + /// <param name="hold" type="Boolean">Indicates whether the ready hold is being requested or released</param> + /// </signature> + }, + 'inArray': function() { + /// <signature> + /// <summary>Search for a specified value within an array and return its index (or -1 if not found).</summary> + /// <param name="value" type="Object">The value to search for.</param> + /// <param name="array" type="Array">An array through which to search.</param> + /// <param name="fromIndex" type="Number">The index of the array at which to begin the search. The default is 0, which will search the whole array.</param> + /// <returns type="Number" /> + /// </signature> + }, + 'isArray': function() { + /// <signature> + /// <summary>Determine whether the argument is an array.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is an array.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isEmptyObject': function() { + /// <signature> + /// <summary>Check to see if an object is empty (contains no properties).</summary> + /// <param name="object" type="Object">The object that will be checked to see if it's empty.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isFunction': function() { + /// <signature> + /// <summary>Determine if the argument passed is a Javascript function object.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is a function.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isNumeric': function() { + /// <signature> + /// <summary>Determines whether its argument is a number.</summary> + /// <param name="value" type="Object">The value to be tested.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isPlainObject': function() { + /// <signature> + /// <summary>Check to see if an object is a plain object (created using "{}" or "new Object").</summary> + /// <param name="object" type="Object">The object that will be checked to see if it's a plain object.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isWindow': function() { + /// <signature> + /// <summary>Determine whether the argument is a window.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is a window.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isXMLDoc': function() { + /// <signature> + /// <summary>Check to see if a DOM node is within an XML document (or is an XML document).</summary> + /// <param name="node" type="Element">The DOM node that will be checked to see if it's in an XML document.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'makeArray': function() { + /// <signature> + /// <summary>Convert an array-like object into a true JavaScript array.</summary> + /// <param name="obj" type="Object">Any object to turn into a native Array.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'map': function() { + /// <signature> + /// <summary>Translate all items in an array or object to new array of items.</summary> + /// <param name="array" type="Array">The Array to translate.</param> + /// <param name="callback(elementOfArray, indexInArray)" type="Function">The function to process each item against. The first argument to the function is the array item, the second argument is the index in array The function can return any value. Within the function, this refers to the global (window) object.</param> + /// <returns type="Array" /> + /// </signature> + /// <signature> + /// <summary>Translate all items in an array or object to new array of items.</summary> + /// <param name="arrayOrObject" type="Object">The Array or Object to translate.</param> + /// <param name="callback( value, indexOrKey )" type="Function">The function to process each item against. The first argument to the function is the value; the second argument is the index or key of the array or object property. The function can return any value to add to the array. A returned array will be flattened into the resulting array. Within the function, this refers to the global (window) object.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'merge': function() { + /// <signature> + /// <summary>Merge the contents of two arrays together into the first array.</summary> + /// <param name="first" type="Array">The first array to merge, the elements of second added.</param> + /// <param name="second" type="Array">The second array to merge into the first, unaltered.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'noConflict': function() { + /// <signature> + /// <summary>Relinquish jQuery's control of the $ variable.</summary> + /// <param name="removeAll" type="Boolean">A Boolean indicating whether to remove all jQuery variables from the global scope (including jQuery itself).</param> + /// <returns type="Object" /> + /// </signature> + }, + 'noop': function() { + /// <summary>An empty function.</summary> + /// <returns type="Function" /> + }, + 'now': function() { + /// <summary>Return a number representing the current time.</summary> + /// <returns type="Number" /> + }, + 'param': function() { + /// <signature> + /// <summary>Create a serialized representation of an array or object, suitable for use in a URL query string or Ajax request.</summary> + /// <param name="obj" type="Object">An array or object to serialize.</param> + /// <returns type="String" /> + /// </signature> + /// <signature> + /// <summary>Create a serialized representation of an array or object, suitable for use in a URL query string or Ajax request.</summary> + /// <param name="obj" type="Object">An array or object to serialize.</param> + /// <param name="traditional" type="Boolean">A Boolean indicating whether to perform a traditional "shallow" serialization.</param> + /// <returns type="String" /> + /// </signature> + }, + 'parseJSON': function() { + /// <signature> + /// <summary>Takes a well-formed JSON string and returns the resulting JavaScript object.</summary> + /// <param name="json" type="String">The JSON string to parse.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'parseXML': function() { + /// <signature> + /// <summary>Parses a string into an XML document.</summary> + /// <param name="data" type="String">a well-formed XML string to be parsed</param> + /// <returns type="XMLDocument" /> + /// </signature> + }, + 'post': function() { + /// <signature> + /// <summary>Load data from the server using a HTTP POST request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="String">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <param name="dataType" type="String">The type of data expected from the server. Default: Intelligent Guess (xml, json, script, text, html).</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'proxy': function() { + /// <signature> + /// <summary>Takes a function and returns a new one that will always have a particular context.</summary> + /// <param name="function" type="Function">The function whose context will be changed.</param> + /// <param name="context" type="Object">The object to which the context (this) of the function should be set.</param> + /// <returns type="Function" /> + /// </signature> + /// <signature> + /// <summary>Takes a function and returns a new one that will always have a particular context.</summary> + /// <param name="context" type="Object">The object to which the context of the function should be set.</param> + /// <param name="name" type="String">The name of the function whose context will be changed (should be a property of the context object).</param> + /// <returns type="Function" /> + /// </signature> + }, + 'queue': function() { + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched element.</summary> + /// <param name="element" type="Element">A DOM element where the array of queued functions is attached.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="newQueue" type="Array">An array of functions to replace the current queue contents.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched element.</summary> + /// <param name="element" type="Element">A DOM element on which to add a queued function.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="callback()" type="Function">The new function to add to the queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeData': function() { + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="element" type="Element">A DOM element from which to remove data.</param> + /// <param name="name" type="String">A string naming the piece of data to remove.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'sub': function() { + /// <summary>Creates a new copy of jQuery whose properties and methods can be modified without affecting the original jQuery object.</summary> + /// <returns type="jQuery" /> + }, + 'support': function() { + /// <summary>A collection of properties that represent the presence of different browser features or bugs. Primarily intended for jQuery's internal use; specific properties may be removed when they are no longer needed internally to improve page startup performance.</summary> + /// <returns type="Object" /> + }, + 'trim': function() { + /// <signature> + /// <summary>Remove the whitespace from the beginning and end of a string.</summary> + /// <param name="str" type="String">The string to trim.</param> + /// <returns type="String" /> + /// </signature> + }, + 'type': function() { + /// <signature> + /// <summary>Determine the internal JavaScript [[Class]] of an object.</summary> + /// <param name="obj" type="Object">Object to get the internal JavaScript [[Class]] of.</param> + /// <returns type="String" /> + /// </signature> + }, + 'unique': function() { + /// <signature> + /// <summary>Sorts an array of DOM elements, in place, with the duplicates removed. Note that this only works on arrays of DOM elements, not strings or numbers.</summary> + /// <param name="array" type="Array">The Array of DOM elements.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'when': function() { + /// <signature> + /// <summary>Provides a way to execute callback functions based on one or more objects, usually Deferred objects that represent asynchronous events.</summary> + /// <param name="deferreds" type="Deferred">One or more Deferred objects, or plain JavaScript objects.</param> + /// <returns type="Promise" /> + /// </signature> + }, +}); + +var _1228819969 = jQuery.Callbacks; +jQuery.Callbacks = function(flags) { +var _object = _1228819969(flags); +intellisense.annotate(_object, { + 'add': function() { + /// <signature> + /// <summary>Add a callback or a collection of callbacks to a callback list.</summary> + /// <param name="callbacks" type="Function">A function, or array of functions, that are to be added to the callback list.</param> + /// </signature> + }, + 'disable': function() { + /// <summary>Disable a callback list from doing anything more.</summary> + }, + 'empty': function() { + /// <summary>Remove all of the callbacks from a list.</summary> + }, + 'fire': function() { + /// <signature> + /// <summary>Call all of the callbacks with the given arguments</summary> + /// <param name="arguments" type="">The argument or list of arguments to pass back to the callback list.</param> + /// </signature> + }, + 'fired': function() { + /// <summary>Determine if the callbacks have already been called at least once.</summary> + /// <returns type="Boolean" /> + }, + 'fireWith': function() { + /// <signature> + /// <summary>Call all callbacks in a list with the given context and arguments.</summary> + /// <param name="context" type="">A reference to the context in which the callbacks in the list should be fired.</param> + /// <param name="args" type="">An argument, or array of arguments, to pass to the callbacks in the list.</param> + /// </signature> + }, + 'has': function() { + /// <signature> + /// <summary>Determine whether a supplied callback is in a list</summary> + /// <param name="callback" type="Function">The callback to search for.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'lock': function() { + /// <summary>Lock a callback list in its current state.</summary> + }, + 'locked': function() { + /// <summary>Determine if the callbacks list has been locked.</summary> + /// <returns type="Boolean" /> + }, + 'remove': function() { + /// <signature> + /// <summary>Remove a callback or a collection of callbacks from a callback list.</summary> + /// <param name="callbacks" type="Function">A function, or array of functions, that are to be removed from the callback list.</param> + /// </signature> + }, +}); + +return _object; +}; + +var _731531622 = jQuery.Deferred; +jQuery.Deferred = function(func) { +var _object = _731531622(func); +intellisense.annotate(_object, { + 'always': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is either resolved or rejected.</summary> + /// <param name="alwaysCallbacks" type="Function">A function, or array of functions, that is called when the Deferred is resolved or rejected.</param> + /// <param name="alwaysCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is resolved or rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'done': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, that are called when the Deferred is resolved.</param> + /// <param name="doneCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is resolved.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'fail': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is rejected.</summary> + /// <param name="failCallbacks" type="Function">A function, or array of functions, that are called when the Deferred is rejected.</param> + /// <param name="failCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'isRejected': function() { + /// <summary>Determine whether a Deferred object has been rejected.</summary> + /// <returns type="Boolean" /> + }, + 'isResolved': function() { + /// <summary>Determine whether a Deferred object has been resolved.</summary> + /// <returns type="Boolean" /> + }, + 'notify': function() { + /// <signature> + /// <summary>Call the progressCallbacks on a Deferred object with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the progressCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'notifyWith': function() { + /// <signature> + /// <summary>Call the progressCallbacks on a Deferred object with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the progressCallbacks as the this object.</param> + /// <param name="args" type="Object">Optional arguments that are passed to the progressCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'pipe': function() { + /// <signature> + /// <summary>Utility method to filter and/or chain Deferreds.</summary> + /// <param name="doneFilter" type="Function">An optional function that is called when the Deferred is resolved.</param> + /// <param name="failFilter" type="Function">An optional function that is called when the Deferred is rejected.</param> + /// <returns type="Promise" /> + /// </signature> + /// <signature> + /// <summary>Utility method to filter and/or chain Deferreds.</summary> + /// <param name="doneFilter" type="Function">An optional function that is called when the Deferred is resolved.</param> + /// <param name="failFilter" type="Function">An optional function that is called when the Deferred is rejected.</param> + /// <param name="progressFilter" type="Function">An optional function that is called when progress notifications are sent to the Deferred.</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'progress': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object generates progress notifications.</summary> + /// <param name="progressCallbacks" type="Function">A function, or array of functions, that is called when the Deferred generates progress notifications.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'promise': function() { + /// <signature> + /// <summary>Return a Deferred's Promise object.</summary> + /// <param name="target" type="Object">Object onto which the promise methods have to be attached</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'reject': function() { + /// <signature> + /// <summary>Reject a Deferred object and call any failCallbacks with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the failCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'rejectWith': function() { + /// <signature> + /// <summary>Reject a Deferred object and call any failCallbacks with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the failCallbacks as the this object.</param> + /// <param name="args" type="Array">An optional array of arguments that are passed to the failCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'resolve': function() { + /// <signature> + /// <summary>Resolve a Deferred object and call any doneCallbacks with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the doneCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'resolveWith': function() { + /// <signature> + /// <summary>Resolve a Deferred object and call any doneCallbacks with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the doneCallbacks as the this object.</param> + /// <param name="args" type="Array">An optional array of arguments that are passed to the doneCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'state': function() { + /// <summary>Determine the current state of a Deferred object.</summary> + /// <returns type="String" /> + }, + 'then': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved or rejected.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, called when the Deferred is resolved.</param> + /// <param name="failCallbacks" type="Function">A function, or array of functions, called when the Deferred is rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved or rejected.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, called when the Deferred is resolved.</param> + /// <param name="failCallbacks" type="Function">A function, or array of functions, called when the Deferred is rejected.</param> + /// <param name="progressCallbacks" type="Function">A function, or array of functions, called when the Deferred notifies progress.</param> + /// <returns type="Deferred" /> + /// </signature> + }, +}); + +return _object; +}; + +intellisense.annotate(jQuery.Event.prototype, { + 'currentTarget': function() { + /// <summary>The current DOM element within the event bubbling phase.</summary> + /// <returns type="Element" /> + }, + 'data': function() { + /// <summary>An optional data map passed to an event method when the current executing handler is bound.</summary> + }, + 'delegateTarget': function() { + /// <summary>The element where the currently-called jQuery event handler was attached.</summary> + /// <returns type="Element" /> + }, + 'isDefaultPrevented': function() { + /// <summary>Returns whether event.preventDefault() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'isImmediatePropagationStopped': function() { + /// <summary>Returns whether event.stopImmediatePropagation() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'isPropagationStopped': function() { + /// <summary>Returns whether event.stopPropagation() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'namespace': function() { + /// <summary>The namespace specified when the event was triggered.</summary> + /// <returns type="String" /> + }, + 'pageX': function() { + /// <summary>The mouse position relative to the left edge of the document.</summary> + /// <returns type="Number" /> + }, + 'pageY': function() { + /// <summary>The mouse position relative to the top edge of the document.</summary> + /// <returns type="Number" /> + }, + 'preventDefault': function() { + /// <summary>If this method is called, the default action of the event will not be triggered.</summary> + }, + 'relatedTarget': function() { + /// <summary>The other DOM element involved in the event, if any.</summary> + /// <returns type="Element" /> + }, + 'result': function() { + /// <summary>The last value returned by an event handler that was triggered by this event, unless the value was undefined.</summary> + /// <returns type="Object" /> + }, + 'stopImmediatePropagation': function() { + /// <summary>Keeps the rest of the handlers from being executed and prevents the event from bubbling up the DOM tree.</summary> + }, + 'stopPropagation': function() { + /// <summary>Prevents the event from bubbling up the DOM tree, preventing any parent handlers from being notified of the event.</summary> + }, + 'target': function() { + /// <summary>The DOM element that initiated the event.</summary> + /// <returns type="Element" /> + }, + 'timeStamp': function() { + /// <summary>The difference in milliseconds between the time the browser created the event and January 1, 1970.</summary> + /// <returns type="Number" /> + }, + 'type': function() { + /// <summary>Describes the nature of the event.</summary> + /// <returns type="String" /> + }, + 'which': function() { + /// <summary>For key or mouse events, this property indicates the specific key or button that was pressed.</summary> + /// <returns type="Number" /> + }, +}); + +intellisense.annotate(jQuery.fn, { + 'add': function() { + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="selector" type="String">A string representing a selector expression to find additional elements to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="elements" type="Array">One or more elements to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="html" type="String">An HTML fragment to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="jQuery object" type="jQuery object ">An existing jQuery object to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="selector" type="String">A string representing a selector expression to find additional elements to add to the set of matched elements.</param> + /// <param name="context" type="Element">The point in the document at which the selector should begin matching; similar to the context argument of the $(selector, context) method.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'addClass': function() { + /// <signature> + /// <summary>Adds the specified class(es) to each of the set of matched elements.</summary> + /// <param name="className" type="String">One or more class names to be added to the class attribute of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Adds the specified class(es) to each of the set of matched elements.</summary> + /// <param name="function(index, currentClass)" type="Function">A function returning one or more space-separated class names to be added to the existing class name(s). Receives the index position of the element in the set and the existing class name(s) as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'after': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, after each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">HTML string, DOM element, or jQuery object to insert after each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert after each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, after each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert after each element in the set of matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxComplete': function() { + /// <signature> + /// <summary>Register a handler to be called when Ajax requests complete. This is an Ajax Event.</summary> + /// <param name="handler(event, XMLHttpRequest, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxError': function() { + /// <signature> + /// <summary>Register a handler to be called when Ajax requests complete with an error. This is an Ajax Event.</summary> + /// <param name="handler(event, jqXHR, ajaxSettings, thrownError)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxSend': function() { + /// <signature> + /// <summary>Attach a function to be executed before an Ajax request is sent. This is an Ajax Event.</summary> + /// <param name="handler(event, jqXHR, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxStart': function() { + /// <signature> + /// <summary>Register a handler to be called when the first Ajax request begins. This is an Ajax Event.</summary> + /// <param name="handler()" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxStop': function() { + /// <signature> + /// <summary>Register a handler to be called when all Ajax requests have completed. This is an Ajax Event.</summary> + /// <param name="handler()" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxSuccess': function() { + /// <signature> + /// <summary>Attach a function to be executed whenever an Ajax request completes successfully. This is an Ajax Event.</summary> + /// <param name="handler(event, XMLHttpRequest, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'all': function() { + /// <summary>Selects all elements.</summary> + }, + 'andSelf': function() { + /// <summary>Add the previous set of elements on the stack to the current set.</summary> + /// <returns type="jQuery" /> + }, + 'animate': function() { + /// <signature> + /// <summary>Perform a custom animation of a set of CSS properties.</summary> + /// <param name="properties" type="Object">A map of CSS properties that the animation will move toward.</param> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="complete" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Perform a custom animation of a set of CSS properties.</summary> + /// <param name="properties" type="Object">A map of CSS properties that the animation will move toward.</param> + /// <param name="options" type="Object">A map of additional options to pass to the method. Supported keys: duration: A string or number determining how long the animation will run.easing: A string indicating which easing function to use for the transition.complete: A function to call once the animation is complete.step: A function to be called after each step of the animation.queue: A Boolean indicating whether to place the animation in the effects queue. If false, the animation will begin immediately. As of jQuery 1.7, the queue option can also accept a string, in which case the animation is added to the queue represented by that string.specialEasing: A map of one or more of the CSS properties defined by the properties argument and their corresponding easing functions (added 1.4).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'animated': function() { + /// <summary>Select all elements that are in the progress of an animation at the time the selector is run.</summary> + }, + 'append': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, to the end of each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">DOM element, HTML string, or jQuery object to insert at the end of each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert at the end of each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, to the end of each element in the set of matched elements.</summary> + /// <param name="function(index, html)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert at the end of each element in the set of matched elements. Receives the index position of the element in the set and the old HTML value of the element as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'appendTo': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements to the end of the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted at the end of the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'attr': function() { + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="attributeName" type="String">The name of the attribute to set.</param> + /// <param name="value" type="Number">A value to set for the attribute.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of attribute-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="attributeName" type="String">The name of the attribute to set.</param> + /// <param name="function(index, attr)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old attribute value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'attributeContains': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value containing the a given substring.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeContainsPrefix': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value either equal to a given string or starting with that string followed by a hyphen (-).</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeContainsWord': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value containing a given word, delimited by spaces.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeEndsWith': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value ending exactly with a given string. The comparison is case sensitive.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeEquals': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value exactly equal to a certain value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeHas': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute, with any value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// </signature> + }, + 'attributeMultiple': function() { + /// <signature> + /// <summary>Matches elements that match all of the specified attribute filters.</summary> + /// <param name="attributeFilter1" type="String">An attribute filter.</param> + /// <param name="attributeFilter2" type="String">Another attribute filter, reducing the selection even more</param> + /// <param name="attributeFilterN" type="String">As many more attribute filters as necessary</param> + /// </signature> + }, + 'attributeNotEqual': function() { + /// <signature> + /// <summary>Select elements that either don't have the specified attribute, or do have the specified attribute but not with a certain value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeStartsWith': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value beginning exactly with a given string.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'before': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, before each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">HTML string, DOM element, or jQuery object to insert before each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert before each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, before each element in the set of matched elements.</summary> + /// <param name="function" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert before each element in the set of matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'bind': function() { + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="eventType" type="String">A string containing one or more DOM event types, such as "click" or "submit," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="eventType" type="String">A string containing one or more DOM event types, such as "click" or "submit," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="preventBubble" type="Boolean">Setting the third argument to false will attach a function that prevents the default action from occurring and stops the event from bubbling. The default is true.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="events" type="Object">A map of one or more DOM event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'blur': function() { + /// <signature> + /// <summary>Bind an event handler to the "blur" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "blur" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'button': function() { + /// <summary>Selects all button elements and elements of type button.</summary> + }, + 'change': function() { + /// <signature> + /// <summary>Bind an event handler to the "change" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "change" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'checkbox': function() { + /// <summary>Selects all elements of type checkbox.</summary> + }, + 'checked': function() { + /// <summary>Matches all elements that are checked.</summary> + }, + 'child': function() { + /// <signature> + /// <summary>Selects all direct child elements specified by "child" of elements specified by "parent".</summary> + /// <param name="parent" type="String">Any valid selector.</param> + /// <param name="child" type="String">A selector to filter the child elements.</param> + /// </signature> + }, + 'children': function() { + /// <signature> + /// <summary>Get the children of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'class': function() { + /// <signature> + /// <summary>Selects all elements with the given class.</summary> + /// <param name="class" type="String">A class to search for. An element can have multiple classes; only one of them must match.</param> + /// </signature> + }, + 'clearQueue': function() { + /// <signature> + /// <summary>Remove from the queue all items that have not yet been run.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'click': function() { + /// <signature> + /// <summary>Bind an event handler to the "click" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "click" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'clone': function() { + /// <signature> + /// <summary>Create a deep copy of the set of matched elements.</summary> + /// <param name="withDataAndEvents" type="Boolean">A Boolean indicating whether event handlers should be copied along with the elements. As of jQuery 1.4, element data will be copied as well.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Create a deep copy of the set of matched elements.</summary> + /// <param name="withDataAndEvents" type="Boolean">A Boolean indicating whether event handlers and data should be copied along with the elements. The default value is false. *In jQuery 1.5.0 the default value was incorrectly true; it was changed back to false in 1.5.1 and up.</param> + /// <param name="deepWithDataAndEvents" type="Boolean">A Boolean indicating whether event handlers and data for all children of the cloned element should be copied. By default its value matches the first argument's value (which defaults to false).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'closest': function() { + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <param name="context" type="Element">A DOM element within which a matching element may be found. If no context is passed in then the context of the jQuery set will be used instead.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="jQuery object" type="jQuery">A jQuery object to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="element" type="Element">An element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'contains': function() { + /// <signature> + /// <summary>Select all elements that contain the specified text.</summary> + /// <param name="text" type="String">A string of text to look for. It's case sensitive.</param> + /// </signature> + }, + 'contents': function() { + /// <summary>Get the children of each element in the set of matched elements, including text and comment nodes.</summary> + /// <returns type="jQuery" /> + }, + 'context': function() { + /// <summary>The DOM node context originally passed to jQuery(); if none was passed then context will likely be the document.</summary> + /// <returns type="Element" /> + }, + 'css': function() { + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">A CSS property name.</param> + /// <param name="value" type="Number">A value to set for the property.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">A CSS property name.</param> + /// <param name="function(index, value)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of property-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'data': function() { + /// <signature> + /// <summary>Store arbitrary data associated with the matched elements.</summary> + /// <param name="key" type="String">A string naming the piece of data to set.</param> + /// <param name="value" type="Object">The new data value; it can be any Javascript type including Array or Object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Store arbitrary data associated with the matched elements.</summary> + /// <param name="obj" type="Object">An object of key-value pairs of data to update.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'dblclick': function() { + /// <signature> + /// <summary>Bind an event handler to the "dblclick" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "dblclick" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'delay': function() { + /// <signature> + /// <summary>Set a timer to delay execution of subsequent items in the queue.</summary> + /// <param name="duration" type="Number">An integer indicating the number of milliseconds to delay execution of the next item in the queue.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'delegate': function() { + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="eventType" type="String">A string containing one or more space-separated JavaScript event types, such as "click" or "keydown," or custom event names.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="eventType" type="String">A string containing one or more space-separated JavaScript event types, such as "click" or "keydown," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="events" type="Object">A map of one or more event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'dequeue': function() { + /// <signature> + /// <summary>Execute the next function on the queue for the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'descendant': function() { + /// <signature> + /// <summary>Selects all elements that are descendants of a given ancestor.</summary> + /// <param name="ancestor" type="String">Any valid selector.</param> + /// <param name="descendant" type="String">A selector to filter the descendant elements.</param> + /// </signature> + }, + 'detach': function() { + /// <signature> + /// <summary>Remove the set of matched elements from the DOM.</summary> + /// <param name="selector" type="String">A selector expression that filters the set of matched elements to be removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'die': function() { + /// <signature> + /// <summary>Remove an event handler previously attached using .live() from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or keydown.</param> + /// <param name="handler" type="String">The function that is no longer to be executed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove an event handler previously attached using .live() from the elements.</summary> + /// <param name="eventTypes" type="Object">A map of one or more event types, such as click or keydown and their corresponding functions that are no longer to be executed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'disabled': function() { + /// <summary>Selects all elements that are disabled.</summary> + }, + 'each': function() { + /// <signature> + /// <summary>Iterate over a jQuery object, executing a function for each matched element.</summary> + /// <param name="function(index, Element)" type="Function">A function to execute for each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'element': function() { + /// <signature> + /// <summary>Selects all elements with the given tag name.</summary> + /// <param name="element" type="String">An element to search for. Refers to the tagName of DOM nodes.</param> + /// </signature> + }, + 'empty': function() { + /// <summary>Select all elements that have no children (including text nodes).</summary> + }, + 'enabled': function() { + /// <summary>Selects all elements that are enabled.</summary> + }, + 'end': function() { + /// <summary>End the most recent filtering operation in the current chain and return the set of matched elements to its previous state.</summary> + /// <returns type="jQuery" /> + }, + 'eq': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to the one at the specified index.</summary> + /// <param name="index" type="Number">An integer indicating the 0-based position of the element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to the one at the specified index.</summary> + /// <param name="-index" type="Number">An integer indicating the position of the element, counting backwards from the last element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'error': function() { + /// <signature> + /// <summary>Bind an event handler to the "error" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "error" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'even': function() { + /// <summary>Selects even elements, zero-indexed. See also odd.</summary> + }, + 'fadeIn': function() { + /// <signature> + /// <summary>Display the matched elements by fading them to opaque.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements by fading them to opaque.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeOut': function() { + /// <signature> + /// <summary>Hide the matched elements by fading them to transparent.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements by fading them to transparent.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeTo': function() { + /// <signature> + /// <summary>Adjust the opacity of the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="opacity" type="Number">A number between 0 and 1 denoting the target opacity.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Adjust the opacity of the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="opacity" type="Number">A number between 0 and 1 denoting the target opacity.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeToggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements by animating their opacity.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'file': function() { + /// <summary>Selects all elements of type file.</summary> + }, + 'filter': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="function(index)" type="Function">A function used as a test for each element in the set. this is the current DOM element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="element" type="Element">An element to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'find': function() { + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="jQuery object" type="Object">A jQuery object to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="element" type="Element">An element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'first': function() { + /// <summary>Selects the first matched element.</summary> + }, + 'first-child': function() { + /// <summary>Selects all elements that are the first child of their parent.</summary> + }, + 'focus': function() { + /// <signature> + /// <summary>Bind an event handler to the "focus" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focus" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'focusin': function() { + /// <signature> + /// <summary>Bind an event handler to the "focusin" event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focusin" event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'focusout': function() { + /// <signature> + /// <summary>Bind an event handler to the "focusout" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focusout" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'get': function() { + /// <signature> + /// <summary>Retrieve the DOM elements matched by the jQuery object.</summary> + /// <param name="index" type="Number">A zero-based integer indicating which element to retrieve.</param> + /// <returns type="Element, Array" /> + /// </signature> + }, + 'gt': function() { + /// <signature> + /// <summary>Select all elements at an index greater than index within the matched set.</summary> + /// <param name="index" type="Number">Zero-based index.</param> + /// </signature> + }, + 'has': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to those that have a descendant that matches the selector or DOM element.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that have a descendant that matches the selector or DOM element.</summary> + /// <param name="contained" type="Element">A DOM element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hasClass': function() { + /// <signature> + /// <summary>Determine whether any of the matched elements are assigned the given class.</summary> + /// <param name="className" type="String">The class name to search for.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'header': function() { + /// <summary>Selects all elements that are headers, like h1, h2, h3 and so on.</summary> + }, + 'height': function() { + /// <signature> + /// <summary>Set the CSS height of every matched element.</summary> + /// <param name="value" type="Number">An integer representing the number of pixels, or an integer with an optional unit of measure appended (as a string).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the CSS height of every matched element.</summary> + /// <param name="function(index, height)" type="Function">A function returning the height to set. Receives the index position of the element in the set and the old height as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hidden': function() { + /// <summary>Selects all elements that are hidden.</summary> + }, + 'hide': function() { + /// <signature> + /// <summary>Hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hover': function() { + /// <signature> + /// <summary>Bind two handlers to the matched elements, to be executed when the mouse pointer enters and leaves the elements.</summary> + /// <param name="handlerIn(eventObject)" type="Function">A function to execute when the mouse pointer enters the element.</param> + /// <param name="handlerOut(eventObject)" type="Function">A function to execute when the mouse pointer leaves the element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'html': function() { + /// <signature> + /// <summary>Set the HTML contents of each element in the set of matched elements.</summary> + /// <param name="htmlString" type="String">A string of HTML to set as the content of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the HTML contents of each element in the set of matched elements.</summary> + /// <param name="function(index, oldhtml)" type="Function">A function returning the HTML content to set. Receives the index position of the element in the set and the old HTML value as arguments. jQuery empties the element before calling the function; use the oldhtml argument to reference the previous content. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'id': function() { + /// <signature> + /// <summary>Selects a single element with the given id attribute.</summary> + /// <param name="id" type="String">An ID to search for, specified via the id attribute of an element.</param> + /// </signature> + }, + 'image': function() { + /// <summary>Selects all elements of type image.</summary> + }, + 'index': function() { + /// <signature> + /// <summary>Search for a given element from among the matched elements.</summary> + /// <param name="selector" type="String">A selector representing a jQuery collection in which to look for an element.</param> + /// <returns type="Number" /> + /// </signature> + /// <signature> + /// <summary>Search for a given element from among the matched elements.</summary> + /// <param name="element" type="jQuery">The DOM element or first element within the jQuery object to look for.</param> + /// <returns type="Number" /> + /// </signature> + }, + 'init': function() { + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression</param> + /// <param name="context" type="jQuery">A DOM Element, Document, or jQuery to use as context</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="element" type="Element">A DOM element to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="object" type="Object">A plain object to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="elementArray" type="Array">An array containing a set of DOM elements to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to clone.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'innerHeight': function() { + /// <summary>Get the current computed height for the first element in the set of matched elements, including padding but not border.</summary> + /// <returns type="Integer" /> + }, + 'innerWidth': function() { + /// <summary>Get the current computed width for the first element in the set of matched elements, including padding but not border.</summary> + /// <returns type="Integer" /> + }, + 'input': function() { + /// <summary>Selects all input, textarea, select and button elements.</summary> + }, + 'insertAfter': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements after the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted after the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'insertBefore': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements before the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted before the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'is': function() { + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="function(index)" type="Function">A function used as a test for the set of elements. It accepts one argument, index, which is the element's index in the jQuery collection.Within the function, this refers to the current DOM element.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="element" type="Element">An element to match the current set of elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'jquery': function() { + /// <summary>A string containing the jQuery version number.</summary> + /// <returns type="String" /> + }, + 'keydown': function() { + /// <signature> + /// <summary>Bind an event handler to the "keydown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keydown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'keypress': function() { + /// <signature> + /// <summary>Bind an event handler to the "keypress" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keypress" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'keyup': function() { + /// <signature> + /// <summary>Bind an event handler to the "keyup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keyup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'last': function() { + /// <summary>Selects the last matched element.</summary> + }, + 'last-child': function() { + /// <summary>Selects all elements that are the last child of their parent.</summary> + }, + 'length': function() { + /// <summary>The number of elements in the jQuery object.</summary> + /// <returns type="Number" /> + }, + 'live': function() { + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events" type="String">A string containing a JavaScript event type, such as "click" or "keydown." As of jQuery 1.4 the string can contain multiple, space-separated event types or custom event names.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events" type="String">A string containing a JavaScript event type, such as "click" or "keydown." As of jQuery 1.4 the string can contain multiple, space-separated event types or custom event names.</param> + /// <param name="data" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events-map" type="Object">A map of one or more JavaScript event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'load': function() { + /// <signature> + /// <summary>Bind an event handler to the "load" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "load" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'lt': function() { + /// <signature> + /// <summary>Select all elements at an index less than index within the matched set.</summary> + /// <param name="index" type="Number">Zero-based index.</param> + /// </signature> + }, + 'map': function() { + /// <signature> + /// <summary>Pass each element in the current matched set through a function, producing a new jQuery object containing the return values.</summary> + /// <param name="callback(index, domElement)" type="Function">A function object that will be invoked for each element in the current set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mousedown': function() { + /// <signature> + /// <summary>Bind an event handler to the "mousedown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mousedown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseenter': function() { + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse enters an element, or trigger that handler on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse enters an element, or trigger that handler on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseleave': function() { + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse leaves an element, or trigger that handler on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse leaves an element, or trigger that handler on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mousemove': function() { + /// <signature> + /// <summary>Bind an event handler to the "mousemove" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mousemove" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseout': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseout" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseout" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseover': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseover" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseover" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseup': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'multiple': function() { + /// <signature> + /// <summary>Selects the combined results of all the specified selectors.</summary> + /// <param name="selector1" type="String">Any valid selector.</param> + /// <param name="selector2" type="String">Another valid selector.</param> + /// <param name="selectorN" type="String">As many more valid selectors as you like.</param> + /// </signature> + }, + 'next': function() { + /// <signature> + /// <summary>Get the immediately following sibling of each element in the set of matched elements. If a selector is provided, it retrieves the next sibling only if it matches that selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'next adjacent': function() { + /// <signature> + /// <summary>Selects all next elements matching "next" that are immediately preceded by a sibling "prev".</summary> + /// <param name="prev" type="String">Any valid selector.</param> + /// <param name="next" type="String">A selector to match the element that is next to the first selector.</param> + /// </signature> + }, + 'next siblings': function() { + /// <signature> + /// <summary>Selects all sibling elements that follow after the "prev" element, have the same parent, and match the filtering "siblings" selector.</summary> + /// <param name="prev" type="String">Any valid selector.</param> + /// <param name="siblings" type="String">A selector to filter elements that are the following siblings of the first selector.</param> + /// </signature> + }, + 'nextAll': function() { + /// <signature> + /// <summary>Get all following siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'nextUntil': function() { + /// <signature> + /// <summary>Get all following siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object passed.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching following sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get all following siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object passed.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching following sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'not': function() { + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="elements" type="Array">One or more DOM elements to remove from the matched set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A function used as a test for each element in the set. this is the current DOM element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'nth-child': function() { + /// <signature> + /// <summary>Selects all elements that are the nth-child of their parent.</summary> + /// <param name="index" type="String">The index of each child to match, starting with 1, the string even or odd, or an equation ( eg. :nth-child(even), :nth-child(4n) )</param> + /// </signature> + }, + 'odd': function() { + /// <summary>Selects odd elements, zero-indexed. See also even.</summary> + }, + 'off': function() { + /// <signature> + /// <summary>Remove an event handler.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, or just namespaces, such as "click", "keydown.myPlugin", or ".myPlugin".</param> + /// <param name="selector" type="String">A selector which should match the one originally passed to .on() when attaching event handlers.</param> + /// <param name="handler(eventObject)" type="Function">A handler function previously attached for the event(s), or the special value false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove an event handler.</summary> + /// <param name="events-map" type="Object">A map where the string keys represent one or more space-separated event types and optional namespaces, and the values represent handler functions previously attached for the event(s).</param> + /// <param name="selector" type="String">A selector which should match the one originally passed to .on() when attaching event handlers.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'offset': function() { + /// <signature> + /// <summary>Set the current coordinates of every element in the set of matched elements, relative to the document.</summary> + /// <param name="coordinates" type="Object">An object containing the properties top and left, which are integers indicating the new top and left coordinates for the elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the current coordinates of every element in the set of matched elements, relative to the document.</summary> + /// <param name="function(index, coords)" type="Function">A function to return the coordinates to set. Receives the index of the element in the collection as the first argument and the current coordinates as the second argument. The function should return an object with the new top and left properties.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'offsetParent': function() { + /// <summary>Get the closest ancestor element that is positioned.</summary> + /// <returns type="jQuery" /> + }, + 'on': function() { + /// <signature> + /// <summary>Attach an event handler function for one or more events to the selected elements.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, such as "click" or "keydown.myPlugin".</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that trigger the event. If the selector is null or omitted, the event is always triggered when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event is triggered.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered. The value false is also allowed as a shorthand for a function that simply does return false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler function for one or more events to the selected elements.</summary> + /// <param name="events-map" type="Object">A map in which the string keys represent one or more space-separated event types and optional namespaces, and the values represent a handler function to be called for the event(s).</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that will call the handler. If the selector is null or omitted, the handler is always called when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event occurs.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'one': function() { + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events" type="String">A string containing one or more JavaScript event types, such as "click" or "submit," or custom event names.</param> + /// <param name="data" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, such as "click" or "keydown.myPlugin".</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that trigger the event. If the selector is null or omitted, the event is always triggered when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event is triggered.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered. The value false is also allowed as a shorthand for a function that simply does return false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events-map" type="Object">A map in which the string keys represent one or more space-separated event types and optional namespaces, and the values represent a handler function to be called for the event(s).</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that will call the handler. If the selector is null or omitted, the handler is always called when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event occurs.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'only-child': function() { + /// <summary>Selects all elements that are the only child of their parent.</summary> + }, + 'outerHeight': function() { + /// <signature> + /// <summary>Get the current computed height for the first element in the set of matched elements, including padding, border, and optionally margin. Returns an integer (without "px") representation of the value or null if called on an empty set of elements.</summary> + /// <param name="includeMargin" type="Boolean">A Boolean indicating whether to include the element's margin in the calculation.</param> + /// <returns type="Integer" /> + /// </signature> + }, + 'outerWidth': function() { + /// <signature> + /// <summary>Get the current computed width for the first element in the set of matched elements, including padding and border.</summary> + /// <param name="includeMargin" type="Boolean">A Boolean indicating whether to include the element's margin in the calculation.</param> + /// <returns type="Integer" /> + /// </signature> + }, + 'parent': function() { + /// <signature> + /// <summary>Get the parent of each element in the current set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'parents': function() { + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'parentsUntil': function() { + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching ancestor elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching ancestor elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'password': function() { + /// <summary>Selects all elements of type password.</summary> + }, + 'position': function() { + /// <summary>Get the current coordinates of the first element in the set of matched elements, relative to the offset parent.</summary> + /// <returns type="Object" /> + }, + 'prepend': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, to the beginning of each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">DOM element, array of elements, HTML string, or jQuery object to insert at the beginning of each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert at the beginning of each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, to the beginning of each element in the set of matched elements.</summary> + /// <param name="function(index, html)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert at the beginning of each element in the set of matched elements. Receives the index position of the element in the set and the old HTML value of the element as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prependTo': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements to the beginning of the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted at the beginning of the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prev': function() { + /// <signature> + /// <summary>Get the immediately preceding sibling of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prevAll': function() { + /// <signature> + /// <summary>Get all preceding siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prevUntil': function() { + /// <signature> + /// <summary>Get all preceding siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching preceding sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get all preceding siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching preceding sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'promise': function() { + /// <signature> + /// <summary>Return a Promise object to observe when all actions of a certain type bound to the collection, queued or not, have finished.</summary> + /// <param name="type" type="String">The type of queue that needs to be observed.</param> + /// <param name="target" type="Object">Object onto which the promise methods have to be attached</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'prop': function() { + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <param name="value" type="Boolean">A value to set for the property.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of property-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <param name="function(index, oldPropertyValue)" type="Function">A function returning the value to set. Receives the index position of the element in the set and the old property value as arguments. Within the function, the keyword this refers to the current element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'pushStack': function() { + /// <signature> + /// <summary>Add a collection of DOM elements onto the jQuery stack.</summary> + /// <param name="elements" type="Array">An array of elements to push onto the stack and make into a new jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add a collection of DOM elements onto the jQuery stack.</summary> + /// <param name="elements" type="Array">An array of elements to push onto the stack and make into a new jQuery object.</param> + /// <param name="name" type="String">The name of a jQuery method that generated the array of elements.</param> + /// <param name="arguments" type="Array">The arguments that were passed in to the jQuery method (for serialization).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'queue': function() { + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="newQueue" type="Array">An array of functions to replace the current queue contents.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="callback( next )" type="Function">The new function to add to the queue, with a function to call that will dequeue the next item.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'radio': function() { + /// <summary>Selects all elements of type radio.</summary> + }, + 'ready': function() { + /// <signature> + /// <summary>Specify a function to execute when the DOM is fully loaded.</summary> + /// <param name="handler" type="Function">A function to execute after the DOM is ready.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'remove': function() { + /// <signature> + /// <summary>Remove the set of matched elements from the DOM.</summary> + /// <param name="selector" type="String">A selector expression that filters the set of matched elements to be removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeAttr': function() { + /// <signature> + /// <summary>Remove an attribute from each element in the set of matched elements.</summary> + /// <param name="attributeName" type="String">An attribute to remove; as of version 1.7, it can be a space-separated list of attributes.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeClass': function() { + /// <signature> + /// <summary>Remove a single class, multiple classes, or all classes from each element in the set of matched elements.</summary> + /// <param name="className" type="String">One or more space-separated classes to be removed from the class attribute of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a single class, multiple classes, or all classes from each element in the set of matched elements.</summary> + /// <param name="function(index, class)" type="Function">A function returning one or more space-separated class names to be removed. Receives the index position of the element in the set and the old class value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeData': function() { + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="name" type="String">A string naming the piece of data to delete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="list" type="String">An array or space-separated string naming the pieces of data to delete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeProp': function() { + /// <signature> + /// <summary>Remove a property for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'replaceAll': function() { + /// <signature> + /// <summary>Replace each target element with the set of matched elements.</summary> + /// <param name="target" type="String">A selector expression indicating which element(s) to replace.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'replaceWith': function() { + /// <signature> + /// <summary>Replace each element in the set of matched elements with the provided new content.</summary> + /// <param name="newContent" type="jQuery">The content to insert. May be an HTML string, DOM element, or jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Replace each element in the set of matched elements with the provided new content.</summary> + /// <param name="function" type="Function">A function that returns content with which to replace the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'reset': function() { + /// <summary>Selects all elements of type reset.</summary> + }, + 'resize': function() { + /// <signature> + /// <summary>Bind an event handler to the "resize" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "resize" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scroll': function() { + /// <signature> + /// <summary>Bind an event handler to the "scroll" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "scroll" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scrollLeft': function() { + /// <signature> + /// <summary>Set the current horizontal position of the scroll bar for each of the set of matched elements.</summary> + /// <param name="value" type="Number">An integer indicating the new position to set the scroll bar to.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scrollTop': function() { + /// <signature> + /// <summary>Set the current vertical position of the scroll bar for each of the set of matched elements.</summary> + /// <param name="value" type="Number">An integer indicating the new position to set the scroll bar to.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'select': function() { + /// <signature> + /// <summary>Bind an event handler to the "select" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "select" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'selected': function() { + /// <summary>Selects all elements that are selected.</summary> + }, + 'serialize': function() { + /// <summary>Encode a set of form elements as a string for submission.</summary> + /// <returns type="String" /> + }, + 'serializeArray': function() { + /// <summary>Encode a set of form elements as an array of names and values.</summary> + /// <returns type="Array" /> + }, + 'show': function() { + /// <signature> + /// <summary>Display the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'siblings': function() { + /// <signature> + /// <summary>Get the siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'size': function() { + /// <summary>Return the number of elements in the jQuery object.</summary> + /// <returns type="Number" /> + }, + 'slice': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to a subset specified by a range of indices.</summary> + /// <param name="start" type="Number">An integer indicating the 0-based position at which the elements begin to be selected. If negative, it indicates an offset from the end of the set.</param> + /// <param name="end" type="Number">An integer indicating the 0-based position at which the elements stop being selected. If negative, it indicates an offset from the end of the set. If omitted, the range continues until the end of the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideDown': function() { + /// <signature> + /// <summary>Display the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideToggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideUp': function() { + /// <signature> + /// <summary>Hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'stop': function() { + /// <signature> + /// <summary>Stop the currently-running animation on the matched elements.</summary> + /// <param name="clearQueue" type="Boolean">A Boolean indicating whether to remove queued animation as well. Defaults to false.</param> + /// <param name="jumpToEnd" type="Boolean">A Boolean indicating whether to complete the current animation immediately. Defaults to false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Stop the currently-running animation on the matched elements.</summary> + /// <param name="queue" type="String">The name of the queue in which to stop animations.</param> + /// <param name="clearQueue" type="Boolean">A Boolean indicating whether to remove queued animation as well. Defaults to false.</param> + /// <param name="jumpToEnd" type="Boolean">A Boolean indicating whether to complete the current animation immediately. Defaults to false.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'submit': function() { + /// <signature> + /// <summary>Bind an event handler to the "submit" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "submit" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'text': function() { + /// <signature> + /// <summary>Set the content of each element in the set of matched elements to the specified text.</summary> + /// <param name="textString" type="String">A string of text to set as the content of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the content of each element in the set of matched elements to the specified text.</summary> + /// <param name="function(index, text)" type="Function">A function returning the text content to set. Receives the index position of the element in the set and the old text value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'toArray': function() { + /// <summary>Retrieve all the DOM elements contained in the jQuery set, as an array.</summary> + /// <returns type="Array" /> + }, + 'toggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="showOrHide" type="Boolean">A Boolean indicating whether to show or hide the elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'toggleClass': function() { + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="className" type="String">One or more class names (separated by spaces) to be toggled for each element in the matched set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="className" type="String">One or more class names (separated by spaces) to be toggled for each element in the matched set.</param> + /// <param name="switch" type="Boolean">A Boolean (not just truthy/falsy) value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="switch" type="Boolean">A boolean value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="function(index, class, switch)" type="Function">A function that returns class names to be toggled in the class attribute of each element in the matched set. Receives the index position of the element in the set, the old class value, and the switch as arguments.</param> + /// <param name="switch" type="Boolean">A boolean value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'trigger': function() { + /// <signature> + /// <summary>Execute all handlers and behaviors attached to the matched elements for the given event type.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="extraParameters" type="Object">Additional parameters to pass along to the event handler.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Execute all handlers and behaviors attached to the matched elements for the given event type.</summary> + /// <param name="event" type="Event">A jQuery.Event object.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'triggerHandler': function() { + /// <signature> + /// <summary>Execute all handlers attached to an element for an event.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="extraParameters" type="Array">An array of additional parameters to pass along to the event handler.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'unbind': function() { + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="handler(eventObject)" type="Function">The function that is to be no longer executed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="false" type="Boolean">Unbinds the corresponding 'return false' function that was bound using .bind( eventType, false ).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="event" type="Object">A JavaScript event object as passed to an event handler.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'undelegate': function() { + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as "click" or "keydown"</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as "click" or "keydown"</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="events" type="Object">A map of one or more event types and previously bound functions to unbind from them.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="namespace" type="String">A string containing a namespace to unbind all events from.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'unload': function() { + /// <signature> + /// <summary>Bind an event handler to the "unload" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "unload" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'unwrap': function() { + /// <summary>Remove the parents of the set of matched elements from the DOM, leaving the matched elements in their place.</summary> + /// <returns type="jQuery" /> + }, + 'val': function() { + /// <signature> + /// <summary>Set the value of each element in the set of matched elements.</summary> + /// <param name="value" type="String">A string of text or an array of strings corresponding to the value of each matched element to set as selected/checked.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the value of each element in the set of matched elements.</summary> + /// <param name="function(index, value)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'visible': function() { + /// <summary>Selects all elements that are visible.</summary> + }, + 'width': function() { + /// <signature> + /// <summary>Set the CSS width of each element in the set of matched elements.</summary> + /// <param name="value" type="Number">An integer representing the number of pixels, or an integer along with an optional unit of measure appended (as a string).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the CSS width of each element in the set of matched elements.</summary> + /// <param name="function(index, width)" type="Function">A function returning the width to set. Receives the index position of the element in the set and the old width as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrap': function() { + /// <signature> + /// <summary>Wrap an HTML structure around each element in the set of matched elements.</summary> + /// <param name="wrappingElement" type="jQuery">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Wrap an HTML structure around each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A callback function returning the HTML content or jQuery object to wrap around the matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrapAll': function() { + /// <signature> + /// <summary>Wrap an HTML structure around all elements in the set of matched elements.</summary> + /// <param name="wrappingElement" type="jQuery">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrapInner': function() { + /// <signature> + /// <summary>Wrap an HTML structure around the content of each element in the set of matched elements.</summary> + /// <param name="wrappingElement" type="String">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the content of the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Wrap an HTML structure around the content of each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A callback function which generates a structure to wrap around the content of the matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, +}); + +intellisense.annotate(window, { + '$': function() { + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression</param> + /// <param name="context" type="jQuery">A DOM Element, Document, or jQuery to use as context</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="element" type="Element">A DOM element to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="object" type="Object">A plain object to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="elementArray" type="Array">An array containing a set of DOM elements to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to clone.</param> + /// <returns type="jQuery" /> + /// </signature> + }, +}); + diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.js new file mode 100644 index 0000000..b4ec7f8 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.js @@ -0,0 +1,9266 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Released under the the MIT License. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT and BSD Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context ? context.ownerDocument || context : document ); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.7.1", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.add( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.fireWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).off( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery.Callbacks( "once memory" ); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array, i ) { + var len; + + if ( array ) { + if ( indexOf ) { + return indexOf.call( array, elem, i ); + } + + len = array.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in array && array[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return ( new Date() ).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +// String to Object flags format cache +var flagsCache = {}; + +// Convert String-formatted flags into Object-formatted ones and store in cache +function createFlags( flags ) { + var object = flagsCache[ flags ] = {}, + i, length; + flags = flags.split( /\s+/ ); + for ( i = 0, length = flags.length; i < length; i++ ) { + object[ flags[i] ] = true; + } + return object; +} + +/* + * Create a callback list using the following parameters: + * + * flags: an optional list of space-separated flags that will change how + * the callback list behaves + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible flags: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( flags ) { + + // Convert flags from String-formatted to Object-formatted + // (we check in cache first) + flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + + var // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = [], + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Add one or several callbacks to the list + add = function( args ) { + var i, + length, + elem, + type, + actual; + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + // Inspect recursively + add( elem ); + } else if ( type === "function" ) { + // Add if not in unique mode and callback is not in + if ( !flags.unique || !self.has( elem ) ) { + list.push( elem ); + } + } + } + }, + // Fire callbacks + fire = function( context, args ) { + args = args || []; + memory = !flags.memory || [ context, args ]; + firing = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { + memory = true; // Mark as halted + break; + } + } + firing = false; + if ( list ) { + if ( !flags.once ) { + if ( stack && stack.length ) { + memory = stack.shift(); + self.fireWith( memory[ 0 ], memory[ 1 ] ); + } + } else if ( memory === true ) { + self.disable(); + } else { + list = []; + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + var length = list.length; + add( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away, unless previous + // firing was halted (stopOnFalse) + } else if ( memory && memory !== true ) { + firingStart = length; + fire( memory[ 0 ], memory[ 1 ] ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + var args = arguments, + argIndex = 0, + argLength = args.length; + for ( ; argIndex < argLength ; argIndex++ ) { + for ( var i = 0; i < list.length; i++ ) { + if ( args[ argIndex ] === list[ i ] ) { + // Handle firingIndex and firingLength + if ( firing ) { + if ( i <= firingLength ) { + firingLength--; + if ( i <= firingIndex ) { + firingIndex--; + } + } + } + // Remove the element + list.splice( i--, 1 ); + // If we have some unicity property then + // we only need to do this once + if ( flags.unique ) { + break; + } + } + } + } + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + if ( list ) { + var i = 0, + length = list.length; + for ( ; i < length; i++ ) { + if ( fn === list[ i ] ) { + return true; + } + } + } + return false; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory || memory === true ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( stack ) { + if ( firing ) { + if ( !flags.once ) { + stack.push( [ context, args ] ); + } + } else if ( !( flags.once && memory ) ) { + fire( context, args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!memory; + } + }; + + return self; +}; + + + + +var // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + + Deferred: function( func ) { + var doneList = jQuery.Callbacks( "once memory" ), + failList = jQuery.Callbacks( "once memory" ), + progressList = jQuery.Callbacks( "memory" ), + state = "pending", + lists = { + resolve: doneList, + reject: failList, + notify: progressList + }, + promise = { + done: doneList.add, + fail: failList.add, + progress: progressList.add, + + state: function() { + return state; + }, + + // Deprecated + isResolved: doneList.fired, + isRejected: failList.fired, + + then: function( doneCallbacks, failCallbacks, progressCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); + return this; + }, + always: function() { + deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); + return this; + }, + pipe: function( fnDone, fnFail, fnProgress ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ], + progress: [ fnProgress, "notify" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + obj = promise; + } else { + for ( var key in promise ) { + obj[ key ] = promise[ key ]; + } + } + return obj; + } + }, + deferred = promise.promise({}), + key; + + for ( key in lists ) { + deferred[ key ] = lists[ key ].fire; + deferred[ key + "With" ] = lists[ key ].fireWith; + } + + // Handle state + deferred.done( function() { + state = "resolved"; + }, failList.disable, progressList.lock ).fail( function() { + state = "rejected"; + }, doneList.disable, progressList.lock ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = sliceDeferred.call( arguments, 0 ), + i = 0, + length = args.length, + pValues = new Array( length ), + count = length, + pCount = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(), + promise = deferred.promise(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( deferred, args ); + } + }; + } + function progressFunc( i ) { + return function( value ) { + pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + deferred.notifyWith( promise, pValues ); + }; + } + if ( length > 1 ) { + for ( ; i < length; i++ ) { + if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return promise; + } +}); + + + + +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + marginDiv, + fragment, + tds, + events, + eventName, + i, + isSupported, + div = document.createElement( "div" ), + documentElement = document.documentElement; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( window.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.style.width = "2px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + fragment.removeChild( div ); + + // Null elements to avoid leaks in IE + fragment = select = opt = marginDiv = div = input = null; + + // Run tests that need a body at doc ready + jQuery(function() { + var container, outer, inner, table, td, offsetSupport, + conMarginTop, ptlm, vb, style, html, + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + conMarginTop = 1; + ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;"; + vb = "visibility:hidden;border:0;"; + style = "style='" + ptlm + "border:5px solid #000;padding:0;'"; + html = "<div " + style + "><div></div></div>" + + "<table " + style + " cellpadding='0' cellspacing='0'>" + + "<tr><td></td></tr></table>"; + + container = document.createElement("div"); + container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Figure out if the W3C box model works as expected + div.innerHTML = ""; + div.style.width = div.style.paddingLeft = "1px"; + jQuery.boxModel = support.boxModel = div.offsetWidth === 2; + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.style.cssText = ptlm + vb; + div.innerHTML = html; + + outer = div.firstChild; + inner = outer.firstChild; + td = outer.nextSibling.firstChild.firstChild; + + offsetSupport = { + doesNotAddBorder: ( inner.offsetTop !== 5 ), + doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + }; + + inner.style.position = "fixed"; + inner.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); + inner.style.position = inner.style.top = ""; + + outer.style.overflow = "hidden"; + outer.style.position = "relative"; + + offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); + offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + + body.removeChild( container ); + div = container = null; + + jQuery.extend( support, offsetSupport ); + }); + + return support; +})(); + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var privateCache, thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, + isEvents = name === "events"; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + privateCache = thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Users should not attempt to inspect the internal events object using jQuery.data, + // it is undocumented and subject to change. But does anyone listen? No. + if ( isEvents && !thisCache[ name ] ) { + return privateCache.events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ internalKey ] : internalKey; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the cache and need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ internalKey ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + } else { + elem[ internalKey ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, attr, name, + data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { + attr = this[0].attributes; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + jQuery._data( this[0], "parsedAttrs", true ); + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var self = jQuery( this ), + args = [ parts[0], value ]; + + self.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + jQuery.isNumeric( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery._data( elem, deferDataKey ); + if ( defer && + ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && + ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery._data( elem, queueDataKey ) && + !jQuery._data( elem, markDataKey ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.fire(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = ( type || "fx" ) + "mark"; + jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); + if ( count ) { + jQuery._data( elem, key, count ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + var q; + if ( elem ) { + type = ( type || "fx" ) + "queue"; + q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = {}; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + jQuery._data( elem, type + ".run", hooks ); + fn.call( elem, function() { + jQuery.dequeue( elem, type ); + }, hooks ); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue " + type + ".run", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { + count++; + tmp.add( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + nodeHook, boolHook, fixSpecified; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = ( value || "" ).split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, l, + i = 0; + + if ( value && elem.nodeType === 1 ) { + attrNames = value.toLowerCase().split( rspace ); + l = attrNames.length; + + for ( ; i < l; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + + // See #9699 for explanation of this approach (setting first, then removal) + jQuery.attr( elem, name, "" ); + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) +jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.nodeValue = value + "" ); + } + }; + + // Apply the nodeHook to tabindex + jQuery.attrHooks.tabindex.set = nodeHook.set; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + + + + +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, + rhoverHack = /\bhover(\.\S+)?\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, + quickParse = function( selector ) { + var quick = rquickIs.exec( selector ); + if ( quick ) { + // 0 1 2 3 + // [ _, tag, id, class ] + quick[1] = ( quick[1] || "" ).toLowerCase(); + quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); + } + return quick; + }, + quickIs = function( elem, m ) { + var attrs = elem.attributes || {}; + return ( + (!m[1] || elem.nodeName.toLowerCase() === m[1]) && + (!m[2] || (attrs.id || {}).value === m[2]) && + (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) + ); + }, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, quick, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + quick: quickParse( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + t, tns, type, origType, namespaces, origCount, + j, events, special, handle, eventType, handleObj; + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, [ "events", "handle" ], true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var type = event.type || event, + namespaces = [], + cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + old = null; + for ( ; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old && old === elem.ownerDocument ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments, 0 ), + run_all = !event.exclusive && !event.namespace, + handlerQueue = [], + i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Determine handlers that should run if there are delegated events + // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this.ownerDocument || this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = ( + handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) + ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) + if ( event.metaKey === undefined ) { + event.metaKey = event.ctrlKey; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector, + ret; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !form._submit_attached ) { + jQuery.event.add( form, "submit._submit", function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + }); + form._submit_attached = true; + } + }); + // return undefined since we don't need an event listener + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + jQuery.event.simulate( "change", this, event, true ); + } + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + elem._change_attached = true; + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on.call( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + var handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( var type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + expando = "sizcache" + (Math.random() + '').replace('.', ''), + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rReturn = /\r\n/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context, seed ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set, seed ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set, i, len, match, type, left; + + if ( !expr ) { + return []; + } + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + type, found, item, filter, left, + i, pass, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + filter = Expr.filter[ type ]; + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + pass = not ^ found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Utility function for retreiving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var i, node, + nodeType = elem.nodeType, + ret = ""; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 ) { + // Use textContent || innerText for elements + if ( typeof elem.textContent === 'string' ) { + return elem.textContent; + } else if ( typeof elem.innerText === 'string' ) { + // Replace IE's carriage returns + return elem.innerText.replace( rReturn, '' ); + } else { + // Traverse it's children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + } else { + + // If no nodeType, this is expected to be an array + for ( i = 0; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + if ( node.nodeType !== 8 ) { + ret += getText( node ); + } + } + } + return ret; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var first, last, + doneName, parent, cache, + count, diff, + type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + first = match[2]; + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + doneName = match[0]; + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { + count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent[ expando ] = doneName; + } + + diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Sizzle.attr ? + Sizzle.attr( elem, name ) : + Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + !type && Sizzle.attr ? + result != null : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context, seed ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet, seed ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +Sizzle.selectors.attrMap = {}; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + POS.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array (deprecated as of jQuery 1.7) + if ( jQuery.isArray( selectors ) ) { + var level = 1; + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( i = 0; i < selectors.length; i++ ) { + + if ( jQuery( cur ).is( selectors[ i ] ) ) { + ret.push({ selector: selectors[ i ], elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} + + + + +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style)/i, + rnocache = /<(?:script|object|embed|option|style)/i, + rnoshimcache = new RegExp("<(?:" + nodeNames + ")", "i"), + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery.clean( arguments ); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery.clean(arguments) ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || ( l > 1 && i < lastIndex ) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc, + first = args[ 0 ]; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ first ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ first ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + var nodeName = ( elem.nodeName || "" ).toLowerCase(); + if ( nodeName === "input" ) { + fixDefaultChecked( elem ); + // Skip scripts, get other children + } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +// Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js +function shimCloneNode( elem ) { + var div = document.createElement( "div" ); + safeFragment.appendChild( div ); + + div.innerHTML = elem.outerHTML; + return div.firstChild; +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + // IE<=8 does not properly clone detached, unknown element nodes + clone = jQuery.support.html5Clone || !rnoshimcache.test( "<" + elem.nodeName ) ? + elem.cloneNode( true ) : + shimCloneNode( elem ); + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Append wrapper element to unknown element safe doc fragment + if ( context === document ) { + // Use the fragment we've already created for this document + safeFragment.appendChild( div ); + } else { + // Use a fragment created with the owner document + createSafeFragment( context ).appendChild( div ); + } + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, + cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^([\-+])=([\-+.\de]+)/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( (defaultView = elem.ownerDocument.defaultView) && + (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, uncomputed, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret === null && style && (uncomputed = style[ name ]) ) { + ret = uncomputed; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ( ret || 0 ); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight, + i = 0, + len = which.length; + + if ( val > 0 ) { + if ( extra !== "border" ) { + for ( ; i < len; i++ ) { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0; + } + } + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + for ( ; i < len; i++ ) { + val += parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0; + } + } + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + var isSuccess, + success, + error, + statusText = nativeStatusText, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for ( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for ( key in s.converters ) { + if ( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if ( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for ( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback ); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css(elem, "display") === "none" ) { + jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + var elem, display, + i = 0, + j = this.length; + + for ( ; i < j; i++ ) { + elem = this[i]; + if ( elem.style ) { + display = jQuery.css( elem, "display" ); + + if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed( speed, easing, callback ); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + function doAnimation() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, e, + parts, start, end, unit, + method; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.zoom = 1; + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test( val ) ) { + + // Tracks whether to show or hide based on private + // data attached to the element + method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); + if ( method ) { + jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); + e[ method ](); + } else { + e[ val ](); + } + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ( (end || 1) / e.cur() ) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + } + + return optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + + stop: function( type, clearQueue, gotoEnd ) { + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var index, + hadTimers = false, + timers = jQuery.timers, + data = jQuery._data( this ); + + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + + function stopQueue( elem, data, index ) { + var hooks = data[ index ]; + jQuery.removeData( elem, index, true ); + hooks.stop( gotoEnd ); + } + + if ( type == null ) { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) { + stopQueue( this, data, index ); + } + } + } else if ( data[ index = type + ".run" ] && data[ index ].stop ){ + stopQueue( this, data, index ); + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + if ( gotoEnd ) { + + // force the next step to be the last + timers[ index ]( true ); + } else { + timers[ index ].saveState(); + } + hadTimers = true; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( !( gotoEnd && hadTimers ) ) { + jQuery.dequeue( this, type ); + } + }); + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx( "show", 1 ), + slideUp: genFx( "hide", 1 ), + slideToggle: genFx( "toggle", 1 ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ( ( -Math.cos( p*Math.PI ) / 2 ) + 0.5 ) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = fxNow || createFxNow(); + this.end = to; + this.now = this.start = from; + this.pos = this.state = 0; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + + function t( gotoEnd ) { + return self.step( gotoEnd ); + } + + t.queue = this.options.queue; + t.elem = this.elem; + t.saveState = function() { + if ( self.options.hide && jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { + jQuery._data( self.elem, "fxshow" + self.prop, self.start ); + } + }; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval( fx.tick, fx.interval ); + } + }, + + // Simple 'show' function + show: function() { + var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); + + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any flash of content + if ( dataShow !== undefined ) { + // This show is picking up where a previous hide or show left off + this.custom( this.cur(), dataShow ); + } else { + this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); + } + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom( this.cur(), 0 ); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var p, n, complete, + t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( p in options.animatedProperties ) { + if ( options.animatedProperties[ p ] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function( index, value ) { + elem.style[ "overflow" + value ] = options.overflow[ index ]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery( elem ).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[ p ] ); + jQuery.removeData( elem, "fxshow" + p, true ); + // Toggle data is no longer needed + jQuery.removeData( elem, "toggle" + p, true ); + } + } + + // Execute the complete function + // in the event that the complete function throws an exception + // we must ensure it won't be called twice. #5684 + + complete = options.complete; + if ( complete ) { + + options.complete = false; + complete.call( elem ); + } + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ( (this.end - this.start) * this.pos ); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +// Adds width/height step functions +// Do not set anything below 0 +jQuery.each([ "width", "height" ], function( i, prop ) { + jQuery.fx.step[ prop ] = function( fx ) { + jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit ); + }; +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + this[ type ]() : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + this[ type ]() : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ], + body = elem.document.body; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + body && body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNumeric( ret ) ? ret : orig; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + + + +})( window ); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.min.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.min.js new file mode 100644 index 0000000..198b3ff --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery-1.7.1.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.7.1 jquery.com | jquery.org/license */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!ck[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){cl||(cl=c.createElement("iframe"),cl.frameBorder=cl.width=cl.height=0),b.appendChild(cl);if(!cm||!cl.createElement)cm=(cl.contentWindow||cl.contentDocument).document,cm.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),cm.close();d=cm.createElement(a),cm.body.appendChild(d),e=f.css(d,"display"),b.removeChild(cl)}ck[a]=e}return ck[a]}function cu(a,b){var c={};f.each(cq.concat.apply([],cq.slice(0,b)),function(){c[this]=a});return c}function ct(){cr=b}function cs(){setTimeout(ct,0);return cr=f.now()}function cj(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ci(){try{return new a.XMLHttpRequest}catch(b){}}function cc(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function cb(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function ca(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bE.test(a)?d(a,e):ca(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)ca(a+"["+e+"]",b[e],c,d);else d(a,b)}function b_(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bT,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bP),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bC(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bx:by,g=0,h=e.length;if(d>0){if(c!=="border")for(;g<h;g++)c||(d-=parseFloat(f.css(a,"padding"+e[g]))||0),c==="margin"?d+=parseFloat(f.css(a,c+e[g]))||0:d-=parseFloat(f.css(a,"border"+e[g]+"Width"))||0;return d+"px"}d=bz(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0;if(c)for(;g<h;g++)d+=parseFloat(f.css(a,"padding"+e[g]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+e[g]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+e[g]))||0);return d+"px"}function bp(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c+(i[c][d].namespace?".":"")+i[c][d].namespace,i[c][d],i[c][d].data)}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?parseFloat(d):j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?m(g):h==="function"&&(!a.unique||!o.has(g))&&c.push(g)},n=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,l=j||0,j=0,k=c.length;for(;c&&l<k;l++)if(c[l].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}i=!1,c&&(a.once?e===!0?o.disable():c=[]:d&&d.length&&(e=d.shift(),o.fireWith(e[0],e[1])))},o={add:function(){if(c){var a=c.length;m(arguments),i?k=c.length:e&&e!==!0&&(j=a,n(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){i&&f<=k&&(k--,f<=l&&l--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&o.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(i?a.once||d.push([b,c]):(!a.once||!e)&&n(b,c));return this},fire:function(){o.fireWith(this,arguments);return this},fired:function(){return!!e}};return o};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p,q=c.createElement("div"),r=c.documentElement;q.setAttribute("className","t"),q.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=q.getElementsByTagName("*"),e=q.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=q.getElementsByTagName("input")[0],b={leadingWhitespace:q.firstChild.nodeType===3,tbody:!q.getElementsByTagName("tbody").length,htmlSerialize:!!q.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:q.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete q.test}catch(s){b.deleteExpando=!1}!q.addEventListener&&q.attachEvent&&q.fireEvent&&(q.attachEvent("onclick",function(){b.noCloneEvent=!1}),q.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),q.appendChild(i),k=c.createDocumentFragment(),k.appendChild(q.lastChild),b.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,k.removeChild(i),k.appendChild(q),q.innerHTML="",a.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",q.style.width="2px",q.appendChild(j),b.reliableMarginRight=(parseInt((a.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0);if(q.attachEvent)for(o in{submit:1,change:1,focusin:1})n="on"+o,p=n in q,p||(q.setAttribute(n,"return;"),p=typeof q[n]=="function"),b[o+"Bubbles"]=p;k.removeChild(q),k=g=h=j=q=i=null,f(function(){var a,d,e,g,h,i,j,k,m,n,o,r=c.getElementsByTagName("body")[0];!r||(j=1,k="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;",m="visibility:hidden;border:0;",n="style='"+k+"border:5px solid #000;padding:0;'",o="<div "+n+"><div></div></div>"+"<table "+n+" cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",a=c.createElement("div"),a.style.cssText=m+"width:0;height:0;position:static;top:0;margin-top:"+j+"px",r.insertBefore(a,r.firstChild),q=c.createElement("div"),a.appendChild(q),q.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",l=q.getElementsByTagName("td"),p=l[0].offsetHeight===0,l[0].style.display="",l[1].style.display="none",b.reliableHiddenOffsets=p&&l[0].offsetHeight===0,q.innerHTML="",q.style.width=q.style.paddingLeft="1px",f.boxModel=b.boxModel=q.offsetWidth===2,typeof q.style.zoom!="undefined"&&(q.style.display="inline",q.style.zoom=1,b.inlineBlockNeedsLayout=q.offsetWidth===2,q.style.display="",q.innerHTML="<div style='width:4px;'></div>",b.shrinkWrapBlocks=q.offsetWidth!==2),q.style.cssText=k+m,q.innerHTML=o,d=q.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,i={doesNotAddBorder:e.offsetTop!==5,doesAddBorderForTableAndCells:h.offsetTop===5},e.style.position="fixed",e.style.top="20px",i.fixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",i.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,i.doesNotIncludeMarginInBodyOffset=r.offsetTop!==j,r.removeChild(a),q=a=null,f.extend(b,i))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h=null;if(typeof a=="undefined"){if(this.length){h=f.data(this[0]);if(this[0].nodeType===1&&!f._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var i=0,j=e.length;i<j;i++)g=e[i].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),l(this[0],g,h[g]));f._data(this[0],"parsedAttrs",!0)}}return h}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split("."),d[1]=d[1]?"."+d[1]:"";if(c===b){h=this.triggerHandler("getData"+d[1]+"!",[d[0]]),h===b&&this.length&&(h=f.data(this[0],a),h=l(this[0],a,h));return h===b&&d[1]?this.data(d[0]):h}return this.each(function(){var b=f(this),e=[d[0],c];b.triggerHandler("setData"+d[1]+"!",e),f.data(this,a,c),b.triggerHandler("changeData"+d[1]+"!",e)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise()}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.nodeName.toLowerCase()]||f.valHooks[g.type];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;h<g;h++)e=d[h],e&&(c=f.propFix[e]||e,f.attr(a,e,""),a.removeAttribute(v?e:c),u.test(e)&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/\bhover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")}; +f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=[],j,k,l,m,n,o,p,q,r,s,t;g[0]=c,c.delegateTarget=this;if(e&&!c.target.disabled&&(!c.button||c.type!=="click")){m=f(this),m.context=this.ownerDocument||this;for(l=c.target;l!=this;l=l.parentNode||this){o={},q=[],m[0]=l;for(j=0;j<e;j++)r=d[j],s=r.selector,o[s]===b&&(o[s]=r.quick?H(l,r.quick):m.is(s)),o[s]&&q.push(r);q.length&&i.push({elem:l,matches:q})}}d.length>e&&i.push({elem:this,matches:d.slice(e)});for(j=0;j<i.length&&!c.isPropagationStopped();j++){p=i[j],c.currentTarget=p.elem;for(k=0;k<p.matches.length&&!c.isImmediatePropagationStopped();k++){r=p.matches[k];if(h||!c.namespace&&!r.namespace||c.namespace_re&&c.namespace_re.test(r.namespace))c.data=r.data,c.handleObj=r,n=((f.event.special[r.origType]||{}).handle||r.handler).apply(p.elem,g),n!==b&&(c.result=n,n===!1&&(c.preventDefault(),c.stopPropagation()))}}return c.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0)}),d._submit_attached=!0)})},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on.call(this,a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.type+"."+e.namespace:e.type,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.POS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function() +{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bp)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||!bc.test("<"+a.nodeName)?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1></$2>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");b===c?bh.appendChild(o):U(b).appendChild(o),o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bn(k[i]);else bn(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bq=/alpha\([^)]*\)/i,br=/opacity=([^)]*)/,bs=/([A-Z]|^ms)/g,bt=/^-?\d+(?:px)?$/i,bu=/^-?\d/,bv=/^([\-+])=([\-+.\de]+)/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bv.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bC(a,b,d);f.swap(a,bw,function(){e=bC(a,b,d)});return e}},set:function(a,b){if(!bt.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return br.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bq,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bq.test(g)?g.replace(bq,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,b){var c,d,e;b=b.replace(bs,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b)));return c}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f===null&&g&&(e=g[b])&&(f=e),!bt.test(f)&&bu.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f||0,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bD=/%20/g,bE=/\[\]$/,bF=/\r?\n/g,bG=/#.*$/,bH=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bI=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bJ=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bK=/^(?:GET|HEAD)$/,bL=/^\/\//,bM=/\?/,bN=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cv(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cn.test(h)?(o=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),o?(f._data(this,"toggle"+i,o==="show"?"hide":"show"),j[o]()):j[h]()):(k=co.exec(h),l=j.cur(),k?(m=parseFloat(k[2]),n=k[3]||(f.cssNumber[i]?"":"px"),n!=="px"&&(f.style(this,i,(m||1)+n),l=(m||1)/j.cur()*l,f.style(this,i,l+n)),k[1]&&(m=(k[1]==="-="?-1:1)*m+l),j.custom(l,m,n)):j.custom(l,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cr||cs(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){e.options.hide&&f._data(e.elem,"fxshow"+e.prop)===b&&f._data(e.elem,"fxshow"+e.prop,e.start)},h()&&f.timers.push(h)&&!cp&&(cp=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cr||cs(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cp),cp=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(["width","height"],function(a,b){f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.support.fixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.support.fixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.js new file mode 100644 index 0000000..3ce1541 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.js @@ -0,0 +1,11464 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ + +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.20", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.20" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.20" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.20" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.20" +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.20" +}); + +})(jQuery); + +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.20", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + element.wrap(wrapper); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); + +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.20", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); + +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.20" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.20"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.20", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.20" +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.20" +}); + +}(jQuery)); + +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.20" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.min.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.min.js new file mode 100644 index 0000000..e1d2668 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery-ui-1.8.20.min.js @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.20",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e<d.length;e++)a.options[d[e][0]]&&d[e][1].apply(a.element,c)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(b,c){if(a(b).css("overflow")==="hidden")return!1;var d=c&&c==="left"?"scrollLeft":"scrollTop",e=!1;return b[d]>0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a<b+c},isOver:function(b,c,d,e,f,g){return a.ui.isOverAxis(b,d,f)&&a.ui.isOverAxis(c,e,g)}})})(jQuery),function(a,b){if(a.cleanData){var c=a.cleanData;a.cleanData=function(b){for(var d=0,e;(e=b[d])!=null;d++)try{a(e).triggerHandler("remove")}catch(f){}c(b)}}else{var d=a.fn.remove;a.fn.remove=function(b,c){return this.each(function(){return c||(!b||a.filter(b,[this]).length)&&a("*",this).add([this]).each(function(){try{a(this).triggerHandler("remove")}catch(b){}}),d.call(a(this),b,c)})}}a.widget=function(b,c,d){var e=b.split(".")[0],f;b=b.split(".")[1],f=e+"-"+b,d||(d=c,c=a.Widget),a.expr[":"][f]=function(c){return!!a.data(c,b)},a[e]=a[e]||{},a[e][b]=function(a,b){arguments.length&&this._createWidget(a,b)};var g=new c;g.options=a.extend(!0,{},g.options),a[e][b].prototype=a.extend(!0,g,{namespace:e,widgetName:b,widgetEventPrefix:a[e][b].prototype.widgetEventPrefix||b,widgetBaseClass:f},d),a.widget.bridge(b,a[e][b])},a.widget.bridge=function(c,d){a.fn[c]=function(e){var f=typeof e=="string",g=Array.prototype.slice.call(arguments,1),h=this;return e=!f&&g.length?a.extend.apply(null,[!0,e].concat(g)):e,f&&e.charAt(0)==="_"?h:(f?this.each(function(){var d=a.data(this,c),f=d&&a.isFunction(d[e])?d[e].apply(d,g):d;if(f!==d&&f!==b)return h=f,!1}):this.each(function(){var b=a.data(this,c);b?b.option(e||{})._init():a.data(this,c,new d(e,this))}),h)}},a.Widget=function(a,b){arguments.length&&this._createWidget(a,b)},a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:!1},_createWidget:function(b,c){a.data(c,this.widgetName,this),this.element=a(c),this.options=a.extend(!0,{},this.options,this._getCreateOptions(),b);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()}),this._create(),this._trigger("create"),this._init()},_getCreateOptions:function(){return a.metadata&&a.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName),this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled "+"ui-state-disabled")},widget:function(){return this.element},option:function(c,d){var e=c;if(arguments.length===0)return a.extend({},this.options);if(typeof c=="string"){if(d===b)return this.options[c];e={},e[c]=d}return this._setOptions(e),this},_setOptions:function(b){var c=this;return a.each(b,function(a,b){c._setOption(a,b)}),this},_setOption:function(a,b){return this.options[a]=b,a==="disabled"&&this.widget()[b?"addClass":"removeClass"](this.widgetBaseClass+"-disabled"+" "+"ui-state-disabled").attr("aria-disabled",b),this},enable:function(){return this._setOption("disabled",!1)},disable:function(){return this._setOption("disabled",!0)},_trigger:function(b,c,d){var e,f,g=this.options[b];d=d||{},c=a.Event(c),c.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase(),c.target=this.element[0],f=c.originalEvent;if(f)for(e in f)e in c||(c[e]=f[e]);return this.element.trigger(c,d),!(a.isFunction(g)&&g.call(this.element[0],c,d)===!1||c.isDefaultPrevented())}}}(jQuery),function(a,b){var c=!1;a(document).mouseup(function(a){c=!1}),a.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var b=this;this.element.bind("mousedown."+this.widgetName,function(a){return b._mouseDown(a)}).bind("click."+this.widgetName,function(c){if(!0===a.data(c.target,b.widgetName+".preventClickEvent"))return a.removeData(c.target,b.widgetName+".preventClickEvent"),c.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.unbind("."+this.widgetName),a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(b){if(c)return;this._mouseStarted&&this._mouseUp(b),this._mouseDownEvent=b;var d=this,e=b.which==1,f=typeof this.options.cancel=="string"&&b.target.nodeName?a(b.target).closest(this.options.cancel).length:!1;if(!e||f||!this._mouseCapture(b))return!0;this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){d.mouseDelayMet=!0},this.options.delay));if(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)){this._mouseStarted=this._mouseStart(b)!==!1;if(!this._mouseStarted)return b.preventDefault(),!0}return!0===a.data(b.target,this.widgetName+".preventClickEvent")&&a.removeData(b.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(a){return d._mouseMove(a)},this._mouseUpDelegate=function(a){return d._mouseUp(a)},a(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate),b.preventDefault(),c=!0,!0},_mouseMove:function(b){return!a.browser.msie||document.documentMode>=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})}(jQuery),function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.helper.addClass("ui-draggable-dragging"),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.left<h[0]&&(f=h[0]+this.offset.click.left),b.pageY-this.offset.click.top<h[1]&&(g=h[1]+this.offset.click.top),b.pageX-this.offset.click.left>h[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.top<h[1]||j-this.offset.click.top>h[3]?j-this.offset.click.top<h[1]?j+c.grid[1]:j-c.grid[1]:j:j;var k=c.grid[0]?this.originalPageX+Math.round((f-this.originalPageX)/c.grid[0])*c.grid[0]:this.originalPageX;f=h?k-this.offset.click.left<h[0]||k-this.offset.click.left>h[2]?k-this.offset.click.left<h[0]?k+c.grid[0]:k-c.grid[0]:k:k}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:d.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:d.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"),this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1},_trigger:function(b,c,d){return d=d||this._uiHash(),a.ui.plugin.call(this,b,[c,d]),b=="drag"&&(this.positionAbs=this._convertPositionTo("absolute")),a.Widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(a){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),a.extend(a.ui.draggable,{version:"1.8.20"}),a.ui.plugin.add("draggable","connectToSortable",{start:function(b,c){var d=a(this).data("draggable"),e=d.options,f=a.extend({},c,{item:d.element});d.sortables=[],a(e.connectToSortable).each(function(){var c=a.data(this,"sortable");c&&!c.options.disabled&&(d.sortables.push({instance:c,shouldRevert:c.options.revert}),c.refreshPositions(),c._trigger("activate",b,f))})},stop:function(b,c){var d=a(this).data("draggable"),e=a.extend({},c,{item:d.element});a.each(d.sortables,function(){this.instance.isOver?(this.instance.isOver=0,d.cancelHelperRemoval=!0,this.instance.cancelHelperRemoval=!1,this.shouldRevert&&(this.instance.options.revert=!0),this.instance._mouseStop(b),this.instance.options.helper=this.instance.options._helper,d.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})):(this.instance.cancelHelperRemoval=!1,this.instance._trigger("deactivate",b,e))})},drag:function(b,c){var d=a(this).data("draggable"),e=this,f=function(b){var c=this.offset.click.top,d=this.offset.click.left,e=this.positionAbs.top,f=this.positionAbs.left,g=b.height,h=b.width,i=b.top,j=b.left;return a.ui.isOver(e+c,f+d,i,j,g,h)};a.each(d.sortables,function(f){this.instance.positionAbs=d.positionAbs,this.instance.helperProportions=d.helperProportions,this.instance.offset.click=d.offset.click,this.instance._intersectsWith(this.instance.containerCache)?(this.instance.isOver||(this.instance.isOver=1,this.instance.currentItem=a(e).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",!0),this.instance.options._helper=this.instance.options.helper,this.instance.options.helper=function(){return c.helper[0]},b.target=this.instance.currentItem[0],this.instance._mouseCapture(b,!0),this.instance._mouseStart(b,!0,!0),this.instance.offset.click.top=d.offset.click.top,this.instance.offset.click.left=d.offset.click.left,this.instance.offset.parent.left-=d.offset.parent.left-this.instance.offset.parent.left,this.instance.offset.parent.top-=d.offset.parent.top-this.instance.offset.parent.top,d._trigger("toSortable",b),d.dropped=this.instance.element,d.currentItem=d.element,this.instance.fromOutside=d),this.instance.currentItem&&this.instance._mouseDrag(b)):this.instance.isOver&&(this.instance.isOver=0,this.instance.cancelHelperRemoval=!0,this.instance.options.revert=!1,this.instance._trigger("out",b,this.instance._uiHash(this.instance)),this.instance._mouseStop(b,!0),this.instance.options.helper=this.instance.options._helper,this.instance.currentItem.remove(),this.instance.placeholder&&this.instance.placeholder.remove(),d._trigger("fromSortable",b),d.dropped=!1)})}}),a.ui.plugin.add("draggable","cursor",{start:function(b,c){var d=a("body"),e=a(this).data("draggable").options;d.css("cursor")&&(e._cursor=d.css("cursor")),d.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;d._cursor&&a("body").css("cursor",d._cursor)}}),a.ui.plugin.add("draggable","opacity",{start:function(b,c){var d=a(c.helper),e=a(this).data("draggable").options;d.css("opacity")&&(e._opacity=d.css("opacity")),d.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;d._opacity&&a(c.helper).css("opacity",d._opacity)}}),a.ui.plugin.add("draggable","scroll",{start:function(b,c){var d=a(this).data("draggable");d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"&&(d.overflowOffset=d.scrollParent.offset())},drag:function(b,c){var d=a(this).data("draggable"),e=d.options,f=!1;if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"){if(!e.axis||e.axis!="x")d.overflowOffset.top+d.scrollParent[0].offsetHeight-b.pageY<e.scrollSensitivity?d.scrollParent[0].scrollTop=f=d.scrollParent[0].scrollTop+e.scrollSpeed:b.pageY-d.overflowOffset.top<e.scrollSensitivity&&(d.scrollParent[0].scrollTop=f=d.scrollParent[0].scrollTop-e.scrollSpeed);if(!e.axis||e.axis!="y")d.overflowOffset.left+d.scrollParent[0].offsetWidth-b.pageX<e.scrollSensitivity?d.scrollParent[0].scrollLeft=f=d.scrollParent[0].scrollLeft+e.scrollSpeed:b.pageX-d.overflowOffset.left<e.scrollSensitivity&&(d.scrollParent[0].scrollLeft=f=d.scrollParent[0].scrollLeft-e.scrollSpeed)}else{if(!e.axis||e.axis!="x")b.pageY-a(document).scrollTop()<e.scrollSensitivity?f=a(document).scrollTop(a(document).scrollTop()-e.scrollSpeed):a(window).height()-(b.pageY-a(document).scrollTop())<e.scrollSensitivity&&(f=a(document).scrollTop(a(document).scrollTop()+e.scrollSpeed));if(!e.axis||e.axis!="y")b.pageX-a(document).scrollLeft()<e.scrollSensitivity?f=a(document).scrollLeft(a(document).scrollLeft()-e.scrollSpeed):a(window).width()-(b.pageX-a(document).scrollLeft())<e.scrollSensitivity&&(f=a(document).scrollLeft(a(document).scrollLeft()+e.scrollSpeed))}f!==!1&&a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(d,b)}}),a.ui.plugin.add("draggable","snap",{start:function(b,c){var d=a(this).data("draggable"),e=d.options;d.snapElements=[],a(e.snap.constructor!=String?e.snap.items||":data(draggable)":e.snap).each(function(){var b=a(this),c=b.offset();this!=d.element[0]&&d.snapElements.push({item:this,width:b.outerWidth(),height:b.outerHeight(),top:c.top,left:c.left})})},drag:function(b,c){var d=a(this).data("draggable"),e=d.options,f=e.snapTolerance,g=c.offset.left,h=g+d.helperProportions.width,i=c.offset.top,j=i+d.helperProportions.height;for(var k=d.snapElements.length-1;k>=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f<g&&g<m+f&&n-f<i&&i<o+f||l-f<g&&g<m+f&&n-f<j&&j<o+f||l-f<h&&h<m+f&&n-f<i&&i<o+f||l-f<h&&h<m+f&&n-f<j&&j<o+f)){d.snapElements[k].snapping&&d.options.snap.release&&d.options.snap.release.call(d.element,b,a.extend(d._uiHash(),{snapItem:d.snapElements[k].item})),d.snapElements[k].snapping=!1;continue}if(e.snapMode!="inner"){var p=Math.abs(n-j)<=f,q=Math.abs(o-i)<=f,r=Math.abs(l-h)<=f,s=Math.abs(m-g)<=f;p&&(c.position.top=d._convertPositionTo("relative",{top:n-d.helperProportions.height,left:0}).top-d.margins.top),q&&(c.position.top=d._convertPositionTo("relative",{top:o,left:0}).top-d.margins.top),r&&(c.position.left=d._convertPositionTo("relative",{top:0,left:l-d.helperProportions.width}).left-d.margins.left),s&&(c.position.left=d._convertPositionTo("relative",{top:0,left:m}).left-d.margins.left)}var t=p||q||r||s;if(e.snapMode!="outer"){var p=Math.abs(n-i)<=f,q=Math.abs(o-j)<=f,r=Math.abs(l-g)<=f,s=Math.abs(m-h)<=f;p&&(c.position.top=d._convertPositionTo("relative",{top:n,left:0}).top-d.margins.top),q&&(c.position.top=d._convertPositionTo("relative",{top:o-d.helperProportions.height,left:0}).top-d.margins.top),r&&(c.position.left=d._convertPositionTo("relative",{top:0,left:l}).left-d.margins.left),s&&(c.position.left=d._convertPositionTo("relative",{top:0,left:m-d.helperProportions.width}).left-d.margins.left)}!d.snapElements[k].snapping&&(p||q||r||s||t)&&d.options.snap.snap&&d.options.snap.snap.call(d.element,b,a.extend(d._uiHash(),{snapItem:d.snapElements[k].item})),d.snapElements[k].snapping=p||q||r||s||t}}}),a.ui.plugin.add("draggable","stack",{start:function(b,c){var d=a(this).data("draggable").options,e=a.makeArray(a(d.stack)).sort(function(b,c){return(parseInt(a(b).css("zIndex"),10)||0)-(parseInt(a(c).css("zIndex"),10)||0)});if(!e.length)return;var f=parseInt(e[0].style.zIndex)||0;a(e).each(function(a){this.style.zIndex=f+a}),this[0].style.zIndex=f+e.length}}),a.ui.plugin.add("draggable","zIndex",{start:function(b,c){var d=a(c.helper),e=a(this).data("draggable").options;d.css("zIndex")&&(e._zIndex=d.css("zIndex")),d.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;d._zIndex&&a(c.helper).css("zIndex",d._zIndex)}})}(jQuery),function(a,b){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:!1,addClasses:!0,greedy:!1,hoverClass:!1,scope:"default",tolerance:"intersect"},_create:function(){var b=this.options,c=b.accept;this.isover=0,this.isout=1,this.accept=a.isFunction(c)?c:function(a){return a.is(c)},this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight},a.ui.ddmanager.droppables[b.scope]=a.ui.ddmanager.droppables[b.scope]||[],a.ui.ddmanager.droppables[b.scope].push(this),b.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){var b=a.ui.ddmanager.droppables[this.options.scope];for(var c=0;c<b.length;c++)b[c]==this&&b.splice(c,1);return this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable"),this},_setOption:function(b,c){b=="accept"&&(this.accept=a.isFunction(c)?c:function(a){return a.is(c)}),a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(b){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.addClass(this.options.activeClass),c&&this._trigger("activate",b,this.ui(c))},_deactivate:function(b){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass),c&&this._trigger("deactivate",b,this.ui(c))},_over:function(b){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return;this.accept.call(this.element[0],c.currentItem||c.element)&&(this.options.hoverClass&&this.element.addClass(this.options.hoverClass),this._trigger("over",b,this.ui(c)))},_out:function(b){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return;this.accept.call(this.element[0],c.currentItem||c.element)&&(this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("out",b,this.ui(c)))},_drop:function(b,c){var d=c||a.ui.ddmanager.current;if(!d||(d.currentItem||d.element)[0]==this.element[0])return!1;var e=!1;return this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var b=a.data(this,"droppable");if(b.options.greedy&&!b.options.disabled&&b.options.scope==d.options.scope&&b.accept.call(b.element[0],d.currentItem||d.element)&&a.ui.intersect(d,a.extend(b,{offset:b.element.offset()}),b.options.tolerance))return e=!0,!1}),e?!1:this.accept.call(this.element[0],d.currentItem||d.element)?(this.options.activeClass&&this.element.removeClass(this.options.activeClass),this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("drop",b,this.ui(d)),this.element):!1},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}}),a.extend(a.ui.droppable,{version:"1.8.20"}),a.ui.intersect=function(b,c,d){if(!c.offset)return!1;var e=(b.positionAbs||b.position.absolute).left,f=e+b.helperProportions.width,g=(b.positionAbs||b.position.absolute).top,h=g+b.helperProportions.height,i=c.offset.left,j=i+c.proportions.width,k=c.offset.top,l=k+c.proportions.height;switch(d){case"fit":return i<=e&&f<=j&&k<=g&&h<=l;case"intersect":return i<e+b.helperProportions.width/2&&f-b.helperProportions.width/2<j&&k<g+b.helperProportions.height/2&&h-b.helperProportions.height/2<l;case"pointer":var m=(b.positionAbs||b.position.absolute).left+(b.clickOffset||b.offset.click).left,n=(b.positionAbs||b.position.absolute).top+(b.clickOffset||b.offset.click).top,o=a.ui.isOver(n,m,k,i,c.proportions.height,c.proportions.width);return o;case"touch":return(g>=k&&g<=l||h>=k&&h<=l||g<k&&h>l)&&(e>=i&&e<=j||f>=i&&f<=j||e<i&&f>j);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h<d.length;h++){if(d[h].options.disabled||b&&!d[h].accept.call(d[h].element[0],b.currentItem||b.element))continue;for(var i=0;i<f.length;i++)if(f[i]==d[h].element[0]){d[h].proportions.height=0;continue g}d[h].visible=d[h].element.css("display")!="none";if(!d[h].visible)continue;e=="mousedown"&&d[h]._activate.call(d[h],c),d[h].offset=d[h].element.offset(),d[h].proportions={width:d[h].element[0].offsetWidth,height:d[h].element[0].offsetHeight}}},drop:function(b,c){var d=!1;return a.each(a.ui.ddmanager.droppables[b.options.scope]||[],function(){if(!this.options)return;!this.options.disabled&&this.visible&&a.ui.intersect(b,this,this.options.tolerance)&&(d=this._drop.call(this,c)||d),!this.options.disabled&&this.visible&&this.accept.call(this.element[0],b.currentItem||b.element)&&(this.isout=1,this.isover=0,this._deactivate.call(this,c))}),d},dragStart:function(b,c){b.element.parents(":not(body,html)").bind("scroll.droppable",function(){b.options.refreshPositions||a.ui.ddmanager.prepareOffsets(b,c)})},drag:function(b,c){b.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(b,c),a.each(a.ui.ddmanager.droppables[b.options.scope]||[],function(){if(this.options.disabled||this.greedyChild||!this.visible)return;var d=a.ui.intersect(b,this,this.options.tolerance),e=!d&&this.isover==1?"isout":d&&this.isover==0?"isover":null;if(!e)return;var f;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");g.length&&(f=a.data(g[0],"droppable"),f.greedyChild=e=="isover"?1:0)}f&&e=="isover"&&(f.isover=0,f.isout=1,f._out.call(f,c)),this[e]=1,this[e=="isout"?"isover":"isout"]=0,this[e=="isover"?"_over":"_out"].call(this,c),f&&e=="isout"&&(f.isout=0,f.isover=1,f._over.call(f,c))})},dragStop:function(b,c){b.element.parents(":not(body,html)").unbind("scroll.droppable"),b.options.refreshPositions||a.ui.ddmanager.prepareOffsets(b,c)}}}(jQuery),function(a,b){a.widget("ui.resizable",a.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1e3},_create:function(){var b=this,c=this.options;this.element.addClass("ui-resizable"),a.extend(this,{_aspectRatio:!!c.aspectRatio,aspectRatio:c.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:c.helper||c.ghost||c.animate?c.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)&&(this.element.wrap(a('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e<d.length;e++){var f=a.trim(d[e]),g="ui-resizable-"+f,h=a('<div class="ui-resizable-handle '+g+'"></div>');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),e<h.maxWidth&&(h.maxWidth=e),g<h.maxHeight&&(h.maxHeight=g);this._vBoundaries=h},_updateCache:function(a){var b=this.options;this.offset=this.helper.offset(),d(a.left)&&(this.position.left=a.left),d(a.top)&&(this.position.top=a.top),d(a.height)&&(this.size.height=a.height),d(a.width)&&(this.size.width=a.width)},_updateRatio:function(a,b){var c=this.options,e=this.position,f=this.size,g=this.axis;return d(a.height)?a.width=a.height*this.aspectRatio:d(a.width)&&(a.height=a.width/this.aspectRatio),g=="sw"&&(a.left=e.left+(f.width-a.width),a.top=null),g=="nw"&&(a.top=e.top+(f.height-a.height),a.left=e.left+(f.width-a.width)),a},_respectSize:function(a,b){var c=this.helper,e=this._vBoundaries,f=this._aspectRatio||b.shiftKey,g=this.axis,h=d(a.width)&&e.maxWidth&&e.maxWidth<a.width,i=d(a.height)&&e.maxHeight&&e.maxHeight<a.height,j=d(a.width)&&e.minWidth&&e.minWidth>a.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d<this._proportionallyResizeElements.length;d++){var e=this._proportionallyResizeElements[d];if(!this.borderDif){var f=[e.css("borderTopWidth"),e.css("borderRightWidth"),e.css("borderBottomWidth"),e.css("borderLeftWidth")],g=[e.css("paddingTop"),e.css("paddingRight"),e.css("paddingBottom"),e.css("paddingLeft")];this.borderDif=a.map(f,function(a,b){var c=parseInt(a,10)||0,d=parseInt(g[b],10)||0;return c+d})}if(!a.browser.msie||!a(c).is(":hidden")&&!a(c).parents(":hidden").length)e.css({height:c.height()-this.borderDif[0]-this.borderDif[2]||0,width:c.width()-this.borderDif[1]-this.borderDif[3]||0});else continue}},_renderProxy:function(){var b=this.element,c=this.options;this.elementOffset=b.offset();if(this._helper){this.helper=this.helper||a('<div style="overflow:hidden;"></div>');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.20"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}}(jQuery),function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.right<e||i.top>h||i.bottom<f):d.tolerance=="fit"&&(j=i.left>e&&i.right<g&&i.top>f&&i.bottom<h),j?(i.selected&&(i.$element.removeClass("ui-selected"),i.selected=!1),i.unselecting&&(i.$element.removeClass("ui-unselecting"),i.unselecting=!1),i.selecting||(i.$element.addClass("ui-selecting"),i.selecting=!0,c._trigger("selecting",b,{selecting:i.element}))):(i.selecting&&((b.metaKey||b.ctrlKey)&&i.startselected?(i.$element.removeClass("ui-selecting"),i.selecting=!1,i.$element.addClass("ui-selected"),i.selected=!0):(i.$element.removeClass("ui-selecting"),i.selecting=!1,i.startselected&&(i.$element.addClass("ui-unselecting"),i.unselecting=!0),c._trigger("unselecting",b,{unselecting:i.element}))),i.selected&&!b.metaKey&&!b.ctrlKey&&!i.startselected&&(i.$element.removeClass("ui-selected"),i.selected=!1,i.$element.addClass("ui-unselecting"),i.unselecting=!0,c._trigger("unselecting",b,{unselecting:i.element})))}),!1},_mouseStop:function(b){var c=this;this.dragged=!1;var d=this.options;return a(".ui-unselecting",this.element[0]).each(function(){var d=a.data(this,"selectable-item");d.$element.removeClass("ui-unselecting"),d.unselecting=!1,d.startselected=!1,c._trigger("unselected",b,{unselected:d.element})}),a(".ui-selecting",this.element[0]).each(function(){var d=a.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected"),d.selecting=!1,d.selected=!0,d.startselected=!0,c._trigger("selected",b,{selected:d.element})}),this._trigger("stop",b),this.helper.remove(),!1}}),a.extend(a.ui.selectable,{version:"1.8.20"})}(jQuery),function(a,b){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY<c.scrollSensitivity?this.scrollParent[0].scrollTop=d=this.scrollParent[0].scrollTop+c.scrollSpeed:b.pageY-this.overflowOffset.top<c.scrollSensitivity&&(this.scrollParent[0].scrollTop=d=this.scrollParent[0].scrollTop-c.scrollSpeed),this.overflowOffset.left+this.scrollParent[0].offsetWidth-b.pageX<c.scrollSensitivity?this.scrollParent[0].scrollLeft=d=this.scrollParent[0].scrollLeft+c.scrollSpeed:b.pageX-this.overflowOffset.left<c.scrollSensitivity&&(this.scrollParent[0].scrollLeft=d=this.scrollParent[0].scrollLeft-c.scrollSpeed)):(b.pageY-a(document).scrollTop()<c.scrollSensitivity?d=a(document).scrollTop(a(document).scrollTop()-c.scrollSpeed):a(window).height()-(b.pageY-a(document).scrollTop())<c.scrollSensitivity&&(d=a(document).scrollTop(a(document).scrollTop()+c.scrollSpeed)),b.pageX-a(document).scrollLeft()<c.scrollSensitivity?d=a(document).scrollLeft(a(document).scrollLeft()-c.scrollSpeed):a(window).width()-(b.pageX-a(document).scrollLeft())<c.scrollSensitivity&&(d=a(document).scrollLeft(a(document).scrollLeft()+c.scrollSpeed))),d!==!1&&a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(var e=this.items.length-1;e>=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+j<i&&b+k>f&&b+k<g;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?l:f<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<g&&h<d+this.helperProportions.height/2&&e-this.helperProportions.height/2<i},_intersectsWithPointer:function(b){var c=this.options.axis==="x"||a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,b.top,b.height),d=this.options.axis==="y"||a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,b.left,b.width),e=c&&d,f=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();return e?this.floating?g&&g=="right"||f=="down"?2:1:f&&(f=="down"?2:1):!1},_intersectsWithSides:function(b){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,b.top+b.height/2,b.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,b.left+b.width/2,b.width),e=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();return this.floating&&f?f=="right"&&d||f=="left"&&!d:e&&(e=="down"&&c||e=="up"&&!c)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(b){this.items=[],this.containers=[this];var c=this.items,d=this,e=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],b,{item:this.currentItem}):a(this.options.items,this.element),this]],f=this._connectWith();if(f&&this.ready)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i<m;i++){var n=a(l[i]);n.data(this.widgetName+"-item",k),c.push({item:n,instance:k,width:0,height:0,left:0,top:0})}}},refreshPositions:function(b){this.offsetParent&&this.helper&&(this.offset.parent=this._getParentOffset());for(var c=this.items.length-1;c>=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.items[i][this.containers[d].floating?"left":"top"];Math.abs(j-h)<f&&(f=Math.abs(j-h),g=this.items[i])}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.left<this.containment[0]&&(f=this.containment[0]+this.offset.click.left),b.pageY-this.offset.click.top<this.containment[1]&&(g=this.containment[1]+this.offset.click.top),b.pageX-this.offset.click.left>this.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.top<this.containment[1]||h-this.offset.click.top>this.containment[3]?h-this.offset.click.top<this.containment[1]?h+c.grid[1]:h-c.grid[1]:h:h;var i=this.originalPageX+Math.round((f-this.originalPageX)/c.grid[0])*c.grid[0];f=this.containment?i-this.offset.click.left<this.containment[0]||i-this.offset.click.left>this.containment[2]?i-this.offset.click.left<this.containment[0]?i+c.grid[0]:i-c.grid[0]:i:i}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:d.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:d.scrollLeft())}},_rearrange:function(a,b,c,d){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling),this.counter=this.counter?++this.counter:1;var e=this,f=this.counter;window.setTimeout(function(){f==e.counter&&e.refreshPositions(!d)},0)},_clear:function(b,c){this.reverting=!1;var d=[],e=this;!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem),this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var f in this._storedCSS)if(this._storedCSS[f]=="auto"||this._storedCSS[f]=="static")this._storedCSS[f]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!c&&d.push(function(a){this._trigger("receive",a,this._uiHash(this.fromOutside))}),(this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!c&&d.push(function(a){this._trigger("update",a,this._uiHash())});if(!a.ui.contains(this.element[0],this.currentItem[0])){c||d.push(function(a){this._trigger("remove",a,this._uiHash())});for(var f=this.containers.length-1;f>=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f<d.length;f++)d[f].call(this,b);this._trigger("stop",b,this._uiHash())}return!1}c||this._trigger("beforeStop",b,this._uiHash()),this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.helper[0]!=this.currentItem[0]&&this.helper.remove(),this.helper=null;if(!c){for(var f=0;f<d.length;f++)d[f].call(this,b);this._trigger("stop",b,this._uiHash())}return this.fromOutside=!1,!0},_trigger:function(){a.Widget.prototype._trigger.apply(this,arguments)===!1&&this.cancel()},_uiHash:function(b){var c=b||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:b?b.element:null}}}),a.extend(a.ui.sortable,{version:"1.8.20"})}(jQuery),jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=a.curCSS(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.20",save:function(a,b){for(var c=0;c<b.length;c++)b[c]!==null&&a.data("ec.storage."+b[c],a[0].style[b[c]])},restore:function(a,b){for(var c=0;c<b.length;c++)b[c]!==null&&a.css(b[c],a.data("ec.storage."+b[c]))},setMode:function(a,b){return b=="toggle"&&(b=a.is(":hidden")?"show":"hide"),b},getBaseline:function(a,b){var c,d;switch(a[0]){case"top":c=0;break;case"middle":c=.5;break;case"bottom":c=1;break;default:c=a[0]/b.height}switch(a[1]){case"left":d=0;break;case"center":d=.5;break;case"right":d=1;break;default:d=a[1]/b.width}return{x:d,y:c}},createWrapper:function(b){if(b.parent().is(".ui-effects-wrapper"))return b.parent();var c={width:b.outerWidth(!0),height:b.outerHeight(!0),"float":b.css("float")},d=a("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin((b*e-f)*2*Math.PI/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e/2)==2)return c+d;g||(g=e*.3*1.5);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return b<1?-0.5*h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g)+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g)*.5+d+c},easeInBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),e*(c/=f)*c*((g+1)*c-g)+d},easeOutBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),e*((c=c/f-1)*c*((g+1)*c+g)+1)+d},easeInOutBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),(c/=f/2)<1?e/2*c*c*(((g*=1.525)+1)*c-g)+d:e/2*((c-=2)*c*(((g*=1.525)+1)*c+g)+2)+d},easeInBounce:function(b,c,d,e,f){return e-a.easing.easeOutBounce(b,f-c,0,e,f)+d},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*7.5625*b*b+c:b<2/2.75?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:b<2.5/2.75?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(b,c,d,e,f){return c<f/2?a.easing.easeInBounce(b,c*2,0,e,f)*.5+d:a.easing.easeOutBounce(b,c*2-f,0,e,f)*.5+e*.5+d}})}(jQuery),function(a,b){a.effects.blind=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=f=="vertical"?"height":"width",i=f=="vertical"?g.height():g.width();e=="show"&&g.css(h,0);var j={};j[h]=e=="show"?i:0,g.animate(j,b.duration,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.bounce=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"up",g=b.options.distance||20,h=b.options.times||5,i=b.duration||250;/show|hide/.test(e)&&d.push("opacity"),a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",g=b.options.distance||(j=="top"?c.outerHeight({margin:!0})/3:c.outerWidth({margin:!0})/3);e=="show"&&c.css("opacity",0).css(j,k=="pos"?-g:g),e=="hide"&&(g=g/(h*2)),e!="hide"&&h--;if(e=="show"){var l={opacity:1};l[j]=(k=="pos"?"+=":"-=")+g,c.animate(l,i/2,b.options.easing),g=g/2,h--}for(var m=0;m<h;m++){var n={},p={};n[j]=(k=="pos"?"-=":"+=")+g,p[j]=(k=="pos"?"+=":"-=")+g,c.animate(n,i/2,b.options.easing).animate(p,i/2,b.options.easing),g=e=="hide"?g*2:g/2}if(e=="hide"){var l={opacity:0};l[j]=(k=="pos"?"-=":"+=")+g,c.animate(l,i/2,b.options.easing,function(){c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)})}else{var n={},p={};n[j]=(k=="pos"?"-=":"+=")+g,p[j]=(k=="pos"?"+=":"-=")+g,c.animate(n,i/2,b.options.easing).animate(p,i/2,b.options.easing,function(){a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)})}c.queue("fx",function(){c.dequeue()}),c.dequeue()})}}(jQuery),function(a,b){a.effects.clip=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","height","width"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=c[0].tagName=="IMG"?g:c,i={size:f=="vertical"?"height":"width",position:f=="vertical"?"top":"left"},j=f=="vertical"?h.height():h.width();e=="show"&&(h.css(i.size,0),h.css(i.position,j/2));var k={};k[i.size]=e=="show"?j:0,k[i.position]=e=="show"?0:j/2,h.animate(k,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.drop=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","opacity"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"left";a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var g=f=="up"||f=="down"?"top":"left",h=f=="up"||f=="left"?"pos":"neg",i=b.options.distance||(g=="top"?c.outerHeight({margin:!0})/2:c.outerWidth({margin:!0})/2);e=="show"&&c.css("opacity",0).css(g,h=="pos"?-i:i);var j={opacity:e=="show"?1:0};j[g]=(e=="show"?h=="pos"?"+=":"-=":h=="pos"?"-=":"+=")+i,c.animate(j,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.explode=function(b){return this.queue(function(){var c=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3,d=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?a(this).is(":visible")?"hide":"show":b.options.mode;var e=a(this).show().css("visibility","hidden"),f=e.offset();f.top-=parseInt(e.css("marginTop"),10)||0,f.left-=parseInt(e.css("marginLeft"),10)||0;var g=e.outerWidth(!0),h=e.outerHeight(!0);for(var i=0;i<c;i++)for(var j=0;j<d;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}}(jQuery),function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i<e;i++)c.animate({opacity:h},f,b.options.easing),h=(h+1)%2;c.animate({opacity:h},f,b.options.easing,function(){h==0&&c.hide(),b.callback&&b.callback.apply(this,arguments)}),c.queue("fx",function(){c.dequeue()}).dequeue()})}}(jQuery),function(a,b){a.effects.puff=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide"),e=parseInt(b.options.percent,10)||150,f=e/100,g={height:c.height(),width:c.width()};a.extend(b.options,{fade:!0,mode:d,percent:d=="hide"?e:100,from:d=="hide"?g:{height:g.height*f,width:g.width*f}}),c.effect("scale",b.options,b.duration,b.callback),c.dequeue()})},a.effects.scale=function(b){return this.queue(function(){var c=a(this),d=a.extend(!0,{},b.options),e=a.effects.setMode(c,b.options.mode||"effect"),f=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:e=="hide"?0:100),g=b.options.direction||"both",h=b.options.origin;e!="effect"&&(d.origin=h||["middle","center"],d.restore=!0);var i={height:c.height(),width:c.width()};c.from=b.options.from||(e=="show"?{height:0,width:0}:i);var j={y:g!="horizontal"?f/100:1,x:g!="vertical"?f/100:1};c.to={height:i.height*j.y,width:i.width*j.x},b.options.fade&&(e=="show"&&(c.from.opacity=0,c.to.opacity=1),e=="hide"&&(c.from.opacity=1,c.to.opacity=0)),d.from=c.from,d.to=c.to,d.mode=e,c.effect("size",d,b.duration,b.callback),c.dequeue()})},a.effects.size=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","width","height","overflow","opacity"],e=["position","top","bottom","left","right","overflow","opacity"],f=["width","height","overflow"],g=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],j=a.effects.setMode(c,b.options.mode||"effect"),k=b.options.restore||!1,l=b.options.scale||"both",m=b.options.origin,n={height:c.height(),width:c.width()};c.from=b.options.from||n,c.to=b.options.to||n;if(m){var p=a.effects.getBaseline(m,n);c.from.top=(n.height-c.from.height)*p.y,c.from.left=(n.width-c.from.width)*p.x,c.to.top=(n.height-c.to.height)*p.y,c.to.left=(n.width-c.to.width)*p.x}var q={from:{y:c.from.height/n.height,x:c.from.width/n.width},to:{y:c.to.height/n.height,x:c.to.width/n.width}};if(l=="box"||l=="both")q.from.y!=q.to.y&&(d=d.concat(h),c.from=a.effects.setTransition(c,h,q.from.y,c.from),c.to=a.effects.setTransition(c,h,q.to.y,c.to)),q.from.x!=q.to.x&&(d=d.concat(i),c.from=a.effects.setTransition(c,i,q.from.x,c.from),c.to=a.effects.setTransition(c,i,q.to.x,c.to));(l=="content"||l=="both")&&q.from.y!=q.to.y&&(d=d.concat(g),c.from=a.effects.setTransition(c,g,q.from.y,c.from),c.to=a.effects.setTransition(c,g,q.to.y,c.to)),a.effects.save(c,k?d:e),c.show(),a.effects.createWrapper(c),c.css("overflow","hidden").css(c.from);if(l=="content"||l=="both")h=h.concat(["marginTop","marginBottom"]).concat(g),i=i.concat(["marginLeft","marginRight"]),f=d.concat(h).concat(i),c.find("*[width]").each(function(){var c=a(this);k&&a.effects.save(c,f);var d={height:c.height(),width:c.width()};c.from={height:d.height*q.from.y,width:d.width*q.from.x},c.to={height:d.height*q.to.y,width:d.width*q.to.x},q.from.y!=q.to.y&&(c.from=a.effects.setTransition(c,h,q.from.y,c.from),c.to=a.effects.setTransition(c,h,q.to.y,c.to)),q.from.x!=q.to.x&&(c.from=a.effects.setTransition(c,i,q.from.x,c.from),c.to=a.effects.setTransition(c,i,q.to.x,c.to)),c.css(c.from),c.animate(c.to,b.duration,b.options.easing,function(){k&&a.effects.restore(c,f)})});c.animate(c.to,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){c.to.opacity===0&&c.css("opacity",c.from.opacity),j=="hide"&&c.hide(),a.effects.restore(c,k?d:e),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.shake=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"left",g=b.options.distance||20,h=b.options.times||3,i=b.duration||b.options.duration||140;a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",l={},m={},n={};l[j]=(k=="pos"?"-=":"+=")+g,m[j]=(k=="pos"?"+=":"-=")+g*2,n[j]=(k=="pos"?"-=":"+=")+g*2,c.animate(l,i,b.options.easing);for(var p=1;p<h;p++)c.animate(m,i,b.options.easing).animate(n,i,b.options.easing);c.animate(m,i,b.options.easing).animate(l,i/2,b.options.easing,function(){a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)}),c.queue("fx",function(){c.dequeue()}),c.dequeue()})}}(jQuery),function(a,b){a.effects.slide=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"show"),f=b.options.direction||"left";a.effects.save(c,d),c.show(),a.effects.createWrapper(c).css({overflow:"hidden"});var g=f=="up"||f=="down"?"top":"left",h=f=="up"||f=="left"?"pos":"neg",i=b.options.distance||(g=="top"?c.outerHeight({margin:!0}):c.outerWidth({margin:!0}));e=="show"&&c.css(g,h=="pos"?isNaN(i)?"-"+i:-i:i);var j={};j[g]=(e=="show"?h=="pos"?"+=":"-=":h=="pos"?"-=":"+=")+i,c.animate(j,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.transfer=function(b){return this.queue(function(){var c=a(this),d=a(b.options.to),e=d.offset(),f={top:e.top,left:e.left,height:d.innerHeight(),width:d.innerWidth()},g=c.offset(),h=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:!0,clearStyle:!1,collapsible:!1,event:"click",fillSpace:!1,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("<span></span>").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.20",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})}(jQuery),function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)===!1)return;return this._search(a)},_search:function(a){this.pending++,this.element.addClass("ui-autocomplete-loading"),this.source({term:a},this._response())},_response:function(){var a=this,b=++c;return function(d){b===c&&a.__response(d),a.pending--,a.pending||a.element.removeClass("ui-autocomplete-loading")}},__response:function(a){!this.options.disabled&&a&&a.length?(a=this._normalize(a),this._suggest(a),this._trigger("open")):this.close()},close:function(a){clearTimeout(this.closing),this.menu.element.is(":visible")&&(this.menu.element.hide(),this.menu.deactivate(),this._trigger("close",a))},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(b){return b.length&&b[0].label&&b[0].value?b:a.map(b,function(b){return typeof b=="string"?{label:b,value:b}:a.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(b){var c=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(c,b),this.menu.deactivate(),this.menu.refresh(),c.show(),this._resizeMenu(),c.position(a.extend({of:this.element},this.options.position)),this.options.autoFocus&&this.menu.next(new a.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth()+1,this.element.outerWidth()))},_renderMenu:function(b,c){var d=this;a.each(c,function(a,c){d._renderItem(b,c)})},_renderItem:function(b,c){return a("<li></li>").data("item.autocomplete",c).append(a("<a></a>").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})}(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[a.fn.prop?"prop":"attr"]("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})}(jQuery),function(a,b){var c,d,e,f,g="ui-button ui-widget ui-state-default ui-corner-all",h="ui-state-hover ui-state-active ",i="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",j=function(){var b=a(this).find(":ui-button");setTimeout(function(){b.button("refresh")},1)},k=function(b){var c=b.name,d=b.form,e=a([]);return c&&(d?e=a(d).find("[name='"+c+"']"):e=a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form})),e};a.widget("ui.button",{options:{disabled:null,text:!0,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",j),typeof this.options.disabled!="boolean"?this.options.disabled=!!this.element.propAttr("disabled"):this.element.propAttr("disabled",this.options.disabled),this._determineButtonType(),this.hasTitle=!!this.buttonElement.attr("title");var b=this,h=this.options,i=this.type==="checkbox"||this.type==="radio",l="ui-state-hover"+(i?"":" ui-state-active"),m="ui-state-focus";h.label===null&&(h.label=this.buttonElement.html()),this.buttonElement.addClass(g).attr("role","button").bind("mouseenter.button",function(){if(h.disabled)return;a(this).addClass("ui-state-hover"),this===c&&a(this).addClass("ui-state-active")}).bind("mouseleave.button",function(){if(h.disabled)return;a(this).removeClass(l)}).bind("click.button",function(a){h.disabled&&(a.preventDefault(),a.stopImmediatePropagation())}),this.element.bind("focus.button",function(){b.buttonElement.addClass(m)}).bind("blur.button",function(){b.buttonElement.removeClass(m)}),i&&(this.element.bind("change.button",function(){if(f)return;b.refresh()}),this.buttonElement.bind("mousedown.button",function(a){if(h.disabled)return;f=!1,d=a.pageX,e=a.pageY}).bind("mouseup.button",function(a){if(h.disabled)return;if(d!==a.pageX||e!==a.pageY)f=!0})),this.type==="checkbox"?this.buttonElement.bind("click.button",function(){if(h.disabled||f)return!1;a(this).toggleClass("ui-state-active"),b.buttonElement.attr("aria-pressed",b.element[0].checked)}):this.type==="radio"?this.buttonElement.bind("click.button",function(){if(h.disabled||f)return!1;a(this).addClass("ui-state-active"),b.buttonElement.attr("aria-pressed","true");var c=b.element[0];k(c).not(c).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")}):(this.buttonElement.bind("mousedown.button",function(){if(h.disabled)return!1;a(this).addClass("ui-state-active"),c=this,a(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(h.disabled)return!1;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(b){if(h.disabled)return!1;(b.keyCode==a.ui.keyCode.SPACE||b.keyCode==a.ui.keyCode.ENTER)&&a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")}),this.buttonElement.is("a")&&this.buttonElement.keyup(function(b){b.keyCode===a.ui.keyCode.SPACE&&a(this).click()})),this._setOption("disabled",h.disabled),this._resetButton()},_determineButtonType:function(){this.element.is(":checkbox")?this.type="checkbox":this.element.is(":radio")?this.type="radio":this.element.is("input")?this.type="input":this.type="button";if(this.type==="checkbox"||this.type==="radio"){var a=this.element.parents().filter(":last"),b="label[for='"+this.element.attr("id")+"']";this.buttonElement=a.find(b),this.buttonElement.length||(a=a.length?a.siblings():this.element.siblings(),this.buttonElement=a.filter(b),this.buttonElement.length||(this.buttonElement=a.find(b))),this.element.addClass("ui-helper-hidden-accessible");var c=this.element.is(":checked");c&&this.buttonElement.addClass("ui-state-active"),this.buttonElement.attr("aria-pressed",c)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible"),this.buttonElement.removeClass(g+" "+h+" "+i).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()),this.hasTitle||this.buttonElement.removeAttr("title"),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled"){c?this.element.propAttr("disabled",!0):this.element.propAttr("disabled",!1);return}this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b),this.type==="radio"?k(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed","true"):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")}):this.type==="checkbox"&&(this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false"))},_resetButton:function(){if(this.type==="input"){this.options.label&&this.element.val(this.options.label);return}var b=this.buttonElement.removeClass(i),c=a("<span></span>",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>"),d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>"),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})}(jQuery),function($,undefined){function Datepicker(){this.debug=!1,this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},$.extend(this._defaults,this.regional[""]),this.dpDiv=bindHover($('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.20"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$('<span class="'+this._appendClass+'">'+c+"</span>"),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('<button type="button"></button>').addClass(this._triggerClass).html(g==""?f:$("<img/>").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;d<a.length;d++)a[d].length>b&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$('<input type="text" id="'+g+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return!0;return!1},_getInst:function(a){try{return $.data(a,PROP_NAME)}catch(b){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(a,b,c){var d=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?$.extend({},$.datepicker._defaults):d?b=="all"?$.extend({},d.settings):this._get(d,b):null;var e=b||{};typeof b=="string"&&(e={},e[b]=c);if(d){this._curInst==d&&this._hideDatepicker();var f=this._getDateDatepicker(a,!0),g=this._getMinMaxDate(d,"min"),h=this._getMinMaxDate(d,"max");extendRemove(d.settings,e),g!==null&&e.dateFormat!==undefined&&e.minDate===undefined&&(d.settings.minDate=this._formatDate(d,g)),h!==null&&e.dateFormat!==undefined&&e.maxDate===undefined&&(d.settings.maxDate=this._formatDate(d,h)),this._attachments($(a),d),this._autoSize(d),this._setDate(d,f),this._updateAlternate(d),this._updateDatepicker(d)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){var b=this._getInst(a);b&&this._updateDatepicker(b)},_setDateDatepicker:function(a,b){var c=this._getInst(a);c&&(this._setDate(c,b),this._updateDatepicker(c),this._updateAlternate(c))},_getDateDatepicker:function(a,b){var c=this._getInst(a);return c&&!c.inline&&this._setDateFromField(c,b),c?this._getDate(c):null},_doKeyDown:function(a){var b=$.datepicker._getInst(a.target),c=!0,d=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=!0;if($.datepicker._datepickerShowing)switch(a.keyCode){case 9:$.datepicker._hideDatepicker(),c=!1;break;case 13:var e=$("td."+$.datepicker._dayOverClass+":not(."+$.datepicker._currentClass+")",b.dpDiv);e[0]&&$.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,e[0]);var f=$.datepicker._get(b,"onSelect");if(f){var g=$.datepicker._formatDate(b);f.apply(b.input?b.input[0]:null,[g,b])}else $.datepicker._hideDatepicker();return!1;case 27:$.datepicker._hideDatepicker();break;case 33:$.datepicker._adjustDate(a.target,a.ctrlKey?-$.datepicker._get(b,"stepBigMonths"):-$.datepicker._get(b,"stepMonths"),"M");break;case 34:$.datepicker._adjustDate(a.target,a.ctrlKey?+$.datepicker._get(b,"stepBigMonths"):+$.datepicker._get(b,"stepMonths"),"M");break;case 35:(a.ctrlKey||a.metaKey)&&$.datepicker._clearDate(a.target),c=a.ctrlKey||a.metaKey;break;case 36:(a.ctrlKey||a.metaKey)&&$.datepicker._gotoToday(a.target),c=a.ctrlKey||a.metaKey;break;case 37:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,d?1:-1,"D"),c=a.ctrlKey||a.metaKey,a.originalEvent.altKey&&$.datepicker._adjustDate(a.target,a.ctrlKey?-$.datepicker._get(b,"stepBigMonths"):-$.datepicker._get(b,"stepMonths"),"M");break;case 38:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,-7,"D"),c=a.ctrlKey||a.metaKey;break;case 39:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,d?-1:1,"D"),c=a.ctrlKey||a.metaKey,a.originalEvent.altKey&&$.datepicker._adjustDate(a.target,a.ctrlKey?+$.datepicker._get(b,"stepBigMonths"):+$.datepicker._get(b,"stepMonths"),"M");break;case 40:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,7,"D"),c=a.ctrlKey||a.metaKey;break;default:c=!1}else a.keyCode==36&&a.ctrlKey?$.datepicker._showDatepicker(this):c=!1;c&&(a.preventDefault(),a.stopPropagation())},_doKeyPress:function(a){var b=$.datepicker._getInst(a.target);if($.datepicker._get(b,"constrainInput")){var c=$.datepicker._possibleChars($.datepicker._get(b,"dateFormat")),d=String.fromCharCode(a.charCode==undefined?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||d<" "||!c||c.indexOf(d)>-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a));var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+$(document).scrollLeft(),i=document.documentElement.clientHeight+$(document).scrollTop();return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1<a.length&&a.charAt(s+1)==b;return c&&s++,c},o=function(a){var c=n(a),d=a=="@"?14:a=="!"?20:a=="y"&&c?4:a=="o"?3:2,e=new RegExp("^\\d{1,"+d+"}"),f=b.substring(r).match(e);if(!f)throw"Missing number at position "+r;return r+=f[0].length,parseInt(f[0],10)},p=function(a,c,d){var e=$.map(n(a)?d:c,function(a,b){return[[b,a]]}).sort(function(a,b){return-(a[1].length-b[1].length)}),f=-1;$.each(e,function(a,c){var d=c[1];if(b.substr(r,d.length).toLowerCase()==d.toLowerCase())return f=c[0],r+=d.length,!1});if(f!=-1)return f+1;throw"Unknown name at position "+r},q=function(){if(b.charAt(r)!=a.charAt(s))throw"Unexpected literal at position "+r;r++},r=0;for(var s=0;s<a.length;s++)if(m)a.charAt(s)=="'"&&!n("'")?m=!1:q();else switch(a.charAt(s)){case"d":k=o("d");break;case"D":p("D",e,f);break;case"o":l=o("o");break;case"m":j=o("m");break;case"M":j=p("M",g,h);break;case"y":i=o("y");break;case"@":var t=new Date(o("@"));i=t.getFullYear(),j=t.getMonth()+1,k=t.getDate();break;case"!":var t=new Date((o("!")-this._ticksTo1970)/1e4);i=t.getFullYear(),j=t.getMonth()+1,k=t.getDate();break;case"'":n("'")?q():m=!0;break;default:q()}if(r<b.length)throw"Extra/unparsed characters found in date: "+b.substring(r);i==-1?i=(new Date).getFullYear():i<100&&(i+=(new Date).getFullYear()-(new Date).getFullYear()%100+(i<=d?0:-100));if(l>-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+1<a.length&&a.charAt(m+1)==b;return c&&m++,c},i=function(a,b,c){var d=""+b;if(h(a))while(d.length<c)d="0"+d;return d},j=function(a,b,c,d){return h(a)?d[b]:c[b]},k="",l=!1;if(b)for(var m=0;m<a.length;m++)if(l)a.charAt(m)=="'"&&!h("'")?l=!1:k+=a.charAt(m);else switch(a.charAt(m)){case"d":k+=i("d",b.getDate(),2);break;case"D":k+=j("D",b.getDay(),d,e);break;case"o":k+=i("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864e5),3);break;case"m":k+=i("m",b.getMonth()+1,2);break;case"M":k+=j("M",b.getMonth(),f,g);break;case"y":k+=h("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case"@":k+=b.getTime();break;case"!":k+=b.getTime()*1e4+this._ticksTo1970;break;case"'":h("'")?k+="'":l=!0;break;default:k+=a.charAt(m)}return k},_possibleChars:function(a){var b="",c=!1,d=function(b){var c=e+1<a.length&&a.charAt(e+1)==b;return c&&e++,c};for(var e=0;e<a.length;e++)if(c)a.charAt(e)=="'"&&!d("'")?c=!1:b+=a.charAt(e);else switch(a.charAt(e)){case"d":case"m":case"y":case"@":b+="0123456789";break;case"D":case"M":return null;case"'":d("'")?b+="'":c=!0;break;default:b+=a.charAt(e)}return b},_get:function(a,b){return a.settings[b]!==undefined?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()==a.lastVal)return;var c=this._get(a,"dateFormat"),d=a.lastVal=a.input?a.input.val():null,e,f;e=f=this._getDefaultDate(a);var g=this._getFormatConfig(a);try{e=this.parseDate(c,d,g)||f}catch(h){this.log(h),d=b?"":d}a.selectedDay=e.getDate(),a.drawMonth=a.selectedMonth=e.getMonth(),a.drawYear=a.selectedYear=e.getFullYear(),a.currentDay=d?e.getDate():0,a.currentMonth=d?e.getMonth():0,a.currentYear=d?e.getFullYear():0,this._adjustInstDate(a)},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var d=function(a){var b=new Date;return b.setDate(b.getDate()+a),b},e=function(b){try{return $.datepicker.parseDate($.datepicker._get(a,"dateFormat"),b,$.datepicker._getFormatConfig(a))}catch(c){}var d=(b.toLowerCase().match(/^c/)?$.datepicker._getDate(a):null)||new Date,e=d.getFullYear(),f=d.getMonth(),g=d.getDate(),h=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,i=h.exec(b);while(i){switch(i[2]||"d"){case"d":case"D":g+=parseInt(i[1],10);break;case"w":case"W":g+=parseInt(i[1],10)*7;break;case"m":case"M":f+=parseInt(i[1],10),g=Math.min(g,$.datepicker._getDaysInMonth(e,f));break;case"y":case"Y":e+=parseInt(i[1],10),g=Math.min(g,$.datepicker._getDaysInMonth(e,f))}i=h.exec(b)}return new Date(e,f,g)},f=b==null||b===""?c:typeof b=="string"?e(b):typeof b=="number"?isNaN(b)?c:d(b):new Date(b.getTime());return f=f&&f.toString()=="Invalid Date"?c:f,f&&(f.setHours(0),f.setMinutes(0),f.setSeconds(0),f.setMilliseconds(0)),this._daylightSavingAdjust(f)},_daylightSavingAdjust:function(a){return a?(a.setHours(a.getHours()>12?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&p<l?l:p;while(this._daylightSavingAdjust(new Date(o,n,1))>p)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+a.id+"', -"+i+", 'M');\""+' title="'+q+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+q+"</span></a>":e?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+q+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+q+"</span></a>",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+a.id+"', +"+i+", 'M');\""+' title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>":e?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+dpuuid+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>",x=d?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?w:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._gotoToday('#"+a.id+"');\""+">"+u+"</button>":"")+(c?"":w)+"</div>":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L<g[0];L++){var M="";this.maxRows=4;for(var N=0;N<g[1];N++){var O=this._daylightSavingAdjust(new Date(o,n,a.selectedDay)),P=" ui-corner-all",Q="";if(j){Q+='<div class="ui-datepicker-group';if(g[1]>1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+P+'">'+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'</div><table class="ui-datepicker-calendar"><thead>'+"<tr>";var R=z?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="<th"+((S+y+6)%7>=5?' class="ui-datepicker-week-end"':"")+">"+'<span title="'+A[T]+'">'+C[T]+"</span></th>"}Q+=R+"</tr></thead><tbody>";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z<X;Z++){Q+="<tr>";var _=z?'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(Y)+"</td>":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Y<l||m&&Y>m;_+='<td class="'+((S+y+6)%7>=5?" ui-datepicker-week-end":"")+(bb?" ui-datepicker-other-month":"")+(Y.getTime()==O.getTime()&&n==a.selectedMonth&&a._keyEvent||J.getTime()==Y.getTime()&&J.getTime()==O.getTime()?" "+this._dayOverClass:"")+(bc?" "+this._unselectableClass+" ui-state-disabled":"")+(bb&&!G?"":" "+ba[1]+(Y.getTime()==k.getTime()?" "+this._currentClass:"")+(Y.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!bb||G)&&ba[2]?' title="'+ba[2]+'"':"")+(bc?"":' onclick="DP_jQuery_'+dpuuid+".datepicker._selectDay('#"+a.id+"',"+Y.getMonth()+","+Y.getFullYear()+', this);return false;"')+">"+(bb&&!G?" ":bc?'<span class="ui-state-default">'+Y.getDate()+"</span>":'<a class="ui-state-default'+(Y.getTime()==b.getTime()?" ui-state-highlight":"")+(Y.getTime()==k.getTime()?" ui-state-active":"")+(bb?" ui-priority-secondary":"")+'" href="#">'+Y.getDate()+"</a>")+"</td>",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+"</tr>"}n++,n>11&&(n=0,o++),Q+="</tbody></table>"+(j?"</div>"+(g[0]>0&&N==g[1]-1?'<div class="ui-datepicker-row-break"></div>':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='<div class="ui-datepicker-title">',m="";if(f||!i)m+='<span class="ui-datepicker-month">'+g[b]+"</span>";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" "+">";for(var p=0;p<12;p++)(!n||p>=d.getMonth())&&(!o||p<=e.getMonth())&&(m+='<option value="'+p+'"'+(p==b?' selected="selected"':"")+">"+h[p]+"</option>");m+="</select>"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+='<span class="ui-datepicker-year">'+c+"</span>";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" "+">";for(;t<=u;t++)a.yearshtml+='<option value="'+t+'"'+(t==c?' selected="selected"':"")+">"+t+"</option>";a.yearshtml+="</select>",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="</div>",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&b<c?c:b;return e=d&&e>d?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.20",window["DP_jQuery_"+dpuuid]=$}(jQuery),function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("<div></div>")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("<span></span>")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("<span></span>").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('<button type="button"></button>').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.20",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()<a.ui.dialog.overlay.maxZ)return!1})},1),a(document).bind("keydown.dialog-overlay",function(c){b.options.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}),a(window).bind("resize.dialog-overlay",a.ui.dialog.overlay.resize));var c=(this.oldInstances.pop()||a("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b<c?a(window).height()+"px":b+"px"):a(document).height()+"px"},width:function(){var b,c;return a.browser.msie?(b=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth),c=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth),b<c?a(window).width()+"px":b+"px"):a(document).width()+"px"},resize:function(){var b=a([]);a.each(a.ui.dialog.overlay.instances,function(){b=b.add(this)}),b.css({width:0,height:0}).css({width:a.ui.dialog.overlay.width(),height:a.ui.dialog.overlay.height()})}}),a.extend(a.ui.dialog.overlay.prototype,{destroy:function(){a.ui.dialog.overlay.destroy(this.$el)}})}(jQuery),function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()}(jQuery),function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.20"})}(jQuery),function(a,b){var c=5;a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:!1,distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null},_create:function(){var b=this,d=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f="<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",g=d.values&&d.values.length||1,h=[];this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget"+" ui-widget-content"+" ui-corner-all"+(d.disabled?" ui-slider-disabled ui-disabled":"")),this.range=a([]),d.range&&(d.range===!0&&(d.values||(d.values=[this._valueMin(),this._valueMin()]),d.values.length&&d.values.length!==2&&(d.values=[d.values[0],d.values[0]])),this.range=a("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;i<g;i+=1)h.push(f);this.handles=e.add(a(h.join("")).appendTo(b.element)),this.handle=this.handles.eq(0),this.handles.add(this.range).filter("a").click(function(a){a.preventDefault()}).hover(function(){d.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){d.disabled?a(this).blur():(a(".ui-slider .ui-state-focus").removeClass("ui-state-focus"),a(this).addClass("ui-state-focus"))}).blur(function(){a(this).removeClass("ui-state-focus")}),this.handles.each(function(b){a(this).data("index.ui-slider-handle",b)}),this.handles.keydown(function(d){var e=a(this).data("index.ui-slider-handle"),f,g,h,i;if(b.options.disabled)return;switch(d.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:d.preventDefault();if(!b._keySliding){b._keySliding=!0,a(this).addClass("ui-state-active"),f=b._start(d,e);if(f===!1)return}}i=b.options.step,b.options.values&&b.options.values.length?g=h=b.values(e):g=h=b.value();switch(d.keyCode){case a.ui.keyCode.HOME:h=b._valueMin();break;case a.ui.keyCode.END:h=b._valueMax();break;case a.ui.keyCode.PAGE_UP:h=b._trimAlignValue(g+(b._valueMax()-b._valueMin())/c);break;case a.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(g-(b._valueMax()-b._valueMin())/c);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g===b._valueMax())return;h=b._trimAlignValue(g+i);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g===b._valueMin())return;h=b._trimAlignValue(g-i)}b._slide(d,e,h)}).keyup(function(c){var d=a(this).data("index.ui-slider-handle");b._keySliding&&(b._keySliding=!1,b._stop(c,d),b._change(c,d),a(this).removeClass("ui-state-active"))}),this._refreshValue(),this._animateOff=!1},destroy:function(){return this.handles.remove(),this.range.remove(),this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options,d,e,f,g,h,i,j,k,l;return c.disabled?!1:(this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()},this.elementOffset=this.element.offset(),d={x:b.pageX,y:b.pageY},e=this._normValueFromMouse(d),f=this._valueMax()-this._valueMin()+1,h=this,this.handles.each(function(b){var c=Math.abs(e-h.values(b));f>c&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c<d)&&(c=d),c!==this.values(b)&&(e=this.values(),e[b]=c,f=this._trigger("slide",a,{handle:this.handles[b],value:c,values:e}),d=this.values(b?0:1),f!==!1&&this.values(b,c,!0))):c!==this.value()&&(f=this._trigger("slide",a,{handle:this.handles[b],value:c}),f!==!1&&this.value(c))},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=this._trimAlignValue(a),this._refreshValue(),this._change(null,0);return}return this._value()},values:function(b,c){var d,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f<d.length;f+=1)d[f]=this._trimAlignValue(e[f]),this._change(null,f);this._refreshValue()},_setOption:function(b,c){var d,e=0;a.isArray(this.options.values)&&(e=this.options.values.length),a.Widget.prototype._setOption.apply(this,arguments);switch(b){case"disabled":c?(this.handles.filter(".ui-state-focus").blur(),this.handles.removeClass("ui-state-hover"),this.handles.propAttr("disabled",!0),this.element.addClass("ui-disabled")):(this.handles.propAttr("disabled",!1),this.element.removeClass("ui-disabled"));break;case"orientation":this._detectOrientation(),this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation),this._refreshValue();break;case"value":this._animateOff=!0,this._refreshValue(),this._change(null,0),this._animateOff=!1;break;case"values":this._animateOff=!0,this._refreshValue();for(d=0;d<e;d+=1)this._change(null,d);this._animateOff=!1}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a),a},_values:function(a){var b,c,d;if(arguments.length)return b=this.options.values[a],b=this._trimAlignValue(b),b;c=this.options.values.slice();for(d=0;d<c.length;d+=1)c[d]=this._trimAlignValue(c[d]);return c},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.20"})}(jQuery),function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1<this.anchors.length?1:-1)),c.disabled=a.map(a.grep(c.disabled,function(a,c){return a!=b}),function(a,c){return a>=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.20"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a<c.anchors.length?a:0)},a),b&&b.stopPropagation()}),f=c._unrotate||(c._unrotate=b?function(a){e()}:function(a){a.clientX&&c.rotate(null)});return a?(this.element.bind("tabsshow",e),this.anchors.bind(d.event+".tabs",f),e()):(clearTimeout(c.rotation),this.element.unbind("tabsshow",e),this.anchors.unbind(d.event+".tabs",f),delete this._rotate,delete this._unrotate),this}})}(jQuery);
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.js new file mode 100644 index 0000000..eecd7c9 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.js @@ -0,0 +1,163 @@ +/*! +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global window: false, jQuery: false */ + +(function ($) { + var data_click = "unobtrusiveAjaxClick", + data_validation = "unobtrusiveValidation"; + + function getFunction(code, argNames) { + var fn = window, parts = (code || "").split("."); + while (fn && parts.length) { + fn = fn[parts.shift()]; + } + if (typeof (fn) === "function") { + return fn; + } + argNames.push(code); + return Function.constructor.apply(null, argNames); + } + + function isMethodProxySafe(method) { + return method === "GET" || method === "POST"; + } + + function asyncOnBeforeSend(xhr, method) { + if (!isMethodProxySafe(method)) { + xhr.setRequestHeader("X-HTTP-Method-Override", method); + } + } + + function asyncOnSuccess(element, data, contentType) { + var mode; + + if (contentType.indexOf("application/x-javascript") !== -1) { // jQuery already executes JavaScript for us + return; + } + + mode = (element.getAttribute("data-ajax-mode") || "").toUpperCase(); + $(element.getAttribute("data-ajax-update")).each(function (i, update) { + var top; + + switch (mode) { + case "BEFORE": + top = update.firstChild; + $("<div />").html(data).contents().each(function () { + update.insertBefore(this, top); + }); + break; + case "AFTER": + $("<div />").html(data).contents().each(function () { + update.appendChild(this); + }); + break; + default: + $(update).html(data); + break; + } + }); + } + + function asyncRequest(element, options) { + var confirm, loading, method, duration; + + confirm = element.getAttribute("data-ajax-confirm"); + if (confirm && !window.confirm(confirm)) { + return; + } + + loading = $(element.getAttribute("data-ajax-loading")); + duration = element.getAttribute("data-ajax-loading-duration") || 0; + + $.extend(options, { + type: element.getAttribute("data-ajax-method") || undefined, + url: element.getAttribute("data-ajax-url") || undefined, + beforeSend: function (xhr) { + var result; + asyncOnBeforeSend(xhr, method); + result = getFunction(element.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments); + if (result !== false) { + loading.show(duration); + } + return result; + }, + complete: function () { + loading.hide(duration); + getFunction(element.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments); + }, + success: function (data, status, xhr) { + asyncOnSuccess(element, data, xhr.getResponseHeader("Content-Type") || "text/html"); + getFunction(element.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments); + }, + error: getFunction(element.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }); + + options.data.push({ name: "X-Requested-With", value: "XMLHttpRequest" }); + + method = options.type.toUpperCase(); + if (!isMethodProxySafe(method)) { + options.type = "POST"; + options.data.push({ name: "X-HTTP-Method-Override", value: method }); + } + + $.ajax(options); + } + + function validate(form) { + var validationInfo = $(form).data(data_validation); + return !validationInfo || !validationInfo.validate || validationInfo.validate(); + } + + $("a[data-ajax=true]").live("click", function (evt) { + evt.preventDefault(); + asyncRequest(this, { + url: this.href, + type: "GET", + data: [] + }); + }); + + $("form[data-ajax=true] input[type=image]").live("click", function (evt) { + var name = evt.target.name, + $target = $(evt.target), + form = $target.parents("form")[0], + offset = $target.offset(); + + $(form).data(data_click, [ + { name: name + ".x", value: Math.round(evt.pageX - offset.left) }, + { name: name + ".y", value: Math.round(evt.pageY - offset.top) } + ]); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true] :submit").live("click", function (evt) { + var name = evt.target.name, + form = $(evt.target).parents("form")[0]; + + $(form).data(data_click, name ? [{ name: name, value: evt.target.value }] : []); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true]").live("submit", function (evt) { + var clickInfo = $(this).data(data_click) || []; + evt.preventDefault(); + if (!validate(this)) { + return; + } + asyncRequest(this, { + url: this.action, + type: this.method || "GET", + data: clickInfo.concat($(this).serializeArray()) + }); + }); +}(jQuery));
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.min.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.min.js new file mode 100644 index 0000000..3542991 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.unobtrusive-ajax.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var b="unobtrusiveAjaxClick",g="unobtrusiveValidation";function c(d,b){var a=window,c=(d||"").split(".");while(a&&c.length)a=a[c.shift()];if(typeof a==="function")return a;b.push(d);return Function.constructor.apply(null,b)}function d(a){return a==="GET"||a==="POST"}function f(b,a){!d(a)&&b.setRequestHeader("X-HTTP-Method-Override",a)}function h(c,b,e){var d;if(e.indexOf("application/x-javascript")!==-1)return;d=(c.getAttribute("data-ajax-mode")||"").toUpperCase();a(c.getAttribute("data-ajax-update")).each(function(f,c){var e;switch(d){case"BEFORE":e=c.firstChild;a("<div />").html(b).contents().each(function(){c.insertBefore(this,e)});break;case"AFTER":a("<div />").html(b).contents().each(function(){c.appendChild(this)});break;default:a(c).html(b)}})}function e(b,e){var j,k,g,i;j=b.getAttribute("data-ajax-confirm");if(j&&!window.confirm(j))return;k=a(b.getAttribute("data-ajax-loading"));i=b.getAttribute("data-ajax-loading-duration")||0;a.extend(e,{type:b.getAttribute("data-ajax-method")||undefined,url:b.getAttribute("data-ajax-url")||undefined,beforeSend:function(d){var a;f(d,g);a=c(b.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments);a!==false&&k.show(i);return a},complete:function(){k.hide(i);c(b.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(a,e,d){h(b,a,d.getResponseHeader("Content-Type")||"text/html");c(b.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:c(b.getAttribute("data-ajax-failure"),["xhr","status","error"])});e.data.push({name:"X-Requested-With",value:"XMLHttpRequest"});g=e.type.toUpperCase();if(!d(g)){e.type="POST";e.data.push({name:"X-HTTP-Method-Override",value:g})}a.ajax(e)}function i(c){var b=a(c).data(g);return!b||!b.validate||b.validate()}a("a[data-ajax=true]").live("click",function(a){a.preventDefault();e(this,{url:this.href,type:"GET",data:[]})});a("form[data-ajax=true] input[type=image]").live("click",function(c){var g=c.target.name,d=a(c.target),f=d.parents("form")[0],e=d.offset();a(f).data(b,[{name:g+".x",value:Math.round(c.pageX-e.left)},{name:g+".y",value:Math.round(c.pageY-e.top)}]);setTimeout(function(){a(f).removeData(b)},0)});a("form[data-ajax=true] :submit").live("click",function(c){var e=c.target.name,d=a(c.target).parents("form")[0];a(d).data(b,e?[{name:e,value:c.target.value}]:[]);setTimeout(function(){a(d).removeData(b)},0)});a("form[data-ajax=true]").live("submit",function(d){var c=a(this).data(b)||[];d.preventDefault();if(!i(this))return;e(this,{url:this.action,type:this.method||"GET",data:c.concat(a(this).serializeArray())})})})(jQuery);
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate-vsdoc.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate-vsdoc.js new file mode 100644 index 0000000..22a5460 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate-vsdoc.js @@ -0,0 +1,1291 @@ +/* +* This file has been commented to support Visual Studio Intellisense. +* You should not use this file at runtime inside the browser--it is only +* intended to be used only for design-time IntelliSense. Please use the +* standard jQuery library for all production use. +* +* Comment version: 1.8 +*/ + +/* +* Note: While Microsoft is not the author of this file, Microsoft is +* offering you a license subject to the terms of the Microsoft Software +* License Terms for Microsoft ASP.NET Model View Controller 3. +* Microsoft reserves all other rights. The notices below are provided +* for informational purposes only and are not the license terms under +* which Microsoft distributed this file. +* +* jQuery validation plugin 1.8.0 +* +* http://bassistance.de/jquery-plugins/jquery-plugin-validation/ +* http://docs.jquery.com/Plugins/Validation +* +* Copyright (c) 2006 - 2011 Jörn Zaefferer +* +*/ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + /// <summary> + /// Validates the selected form. This method sets up event handlers for submit, focus, + /// keyup, blur and click to trigger validation of the entire form or individual + /// elements. Each one can be disabled, see the onxxx options (onsubmit, onfocusout, + /// onkeyup, onclick). focusInvalid focuses elements when submitting a invalid form. + /// </summary> + /// <param name="options" type="Object"> + /// A set of key/value pairs that configure the validate. All options are optional. + /// </param> + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + // allow suppresing validation by adding a cancel class to the submit button + this.find("input, button").filter(".cancel").click(function() { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + this.find("input, button").filter(":submit").click(function() { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("<input type='hidden'/>").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + /// <summary> + /// Checks if the selected form is valid or if all selected elements are valid. + /// validate() needs to be called on the form before checking it using this method. + /// </summary> + /// <returns type="Boolean" /> + + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + /// <summary> + /// Remove the specified attributes from the first matched element and return them. + /// </summary> + /// <param name="attributes" type="String"> + /// A space-seperated list of attribute names to remove. + /// </param> + + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + /// <summary> + /// Return the validations rules for the first selected element. + /// </summary> + /// <param name="command" type="String"> + /// Can be either "add" or "remove". + /// </param> + /// <param name="argument" type=""> + /// A list of rules to add or remove. + /// </param> + + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + /// <summary> + /// Replaces {n} placeholders with arguments. + /// One or more arguments can be passed, in addition to the string template itself, to insert + /// into the string. + /// </summary> + /// <param name="source" type="String"> + /// The string to format. + /// </param> + /// <param name="params" type="String"> + /// The first argument to insert, or an array of Strings to insert + /// </param> + /// <returns type="String" /> + + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: [], + ignoreTitle: false, + onfocusin: function(element) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.addWrapper(this.errorsFor(element)).hide(); + } + }, + onfocusout: function(element) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function( element, errorClass, validClass ) { + $(element).addClass(errorClass).removeClass(validClass); + }, + unhighlight: function( element, errorClass, validClass ) { + $(element).removeClass(errorClass).addClass(validClass); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + /// <summary> + /// Modify default settings for validation. + /// Accepts everything that Plugins/Validation/validate accepts. + /// </summary> + /// <param name="settings" type="Options"> + /// Options to set as default. + /// </param> + + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0] ); + } + $(this.currentForm) + .validateDelegate(":text, :password, :file, select, textarea", "focusin focusout keyup", delegate) + .validateDelegate(":radio, :checkbox, select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + /// <summary> + /// Validates the form, returns true if it is valid, false otherwise. + /// This behaves as a normal submit event, but returns the result. + /// </summary> + /// <returns type="Boolean" /> + + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + /// <summary> + /// Validates a single element, returns true if it is valid, false otherwise. + /// This behaves as validation on blur or keyup, but returns the result. + /// </summary> + /// <param name="element" type="Selector"> + /// An element to validate, must be inside the validated form. + /// </param> + /// <returns type="Boolean" /> + + element = this.clean( element ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + /// <summary> + /// Show the specified messages. + /// Keys have to refer to the names of elements, values are displayed for those elements, using the configured error placement. + /// </summary> + /// <param name="errors" type="Object"> + /// One or more key/value pairs of input names and messages. + /// </param> + + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + /// <summary> + /// Resets the controlled form. + /// Resets input fields to their original value (requires form plugin), removes classes + /// indicating invalid elements and hides error messages. + /// </summary> + + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + /// <summary> + /// Returns the number of invalid fields. + /// This depends on the internal validator state. It covers all fields only after + /// validating the complete form (on submit or via $("form").valid()). After validating + /// a single element, only that element is counted. Most useful in combination with the + /// invalidHandler-option. + /// </summary> + /// <returns type="Number" /> + + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + // workaround $Query([]).add until http://dev.jquery.com/ticket/2114 is solved + return $([]).add(this.currentForm.elements) + .filter(":input") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.clean( element ); + + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName(element.name).not(this.settings.ignore)[0]; + } + + var rules = $(element).rules(); + var dependencyMismatch = false; + for (var method in rules) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "<strong>Warning: No message defined for " + element.name + "</strong>" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass().addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + /// <summary> + /// Add a compound class method - useful to refactor common combinations of rules into a single + /// class. + /// </summary> + /// <param name="name" type="String"> + /// The name of the class rule to add + /// </param> + /// <param name="rules" type="Options"> + /// The compound rules + /// </param> + + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (var method in $.validator.methods) { + var value = $element.attr(method); + if (value) { + rules[method] = value; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + /// <summary> + /// Add a custom validation method. It must consist of a name (must be a legal javascript + /// identifier), a javascript based function and a default string message. + /// </summary> + /// <param name="name" type="String"> + /// The name of the method, used to identify and referencing it, must be a valid javascript + /// identifier + /// </param> + /// <param name="method" type="Function"> + /// The actual method implementation, returning true if an element is valid + /// </param> + /// <param name="message" type="String" optional="true"> + /// (Optional) The default message to display for this method. Can be a function created by + /// jQuery.validator.format(value). When undefined, an already existing message is used + /// (handy for localization), otherwise the field-specific messages have to be defined. + /// </param> + + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( this.pending[element.name] ) { + return "pending"; + } + if ( previous.old === value ) { + return previous.valid; + } + + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = response || validator.defaultMessage(element, "remote"); + errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only digits and dashes + if (/[^0-9-]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var pendingRequests = {}; + // Use a prefilter if available (1.5+) + if ( $.ajaxPrefilter ) { + $.ajaxPrefilter(function(settings, _, xhr) { + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } pendingRequests[port] = xhr; + } + }); + } else { + // Proxy ajax + var ajax = $.ajax; + $.ajax = function(settings) { + var mode = ( "mode" in settings ? settings : $.ajaxSettings ).mode, + port = ( "port" in settings ? settings : $.ajaxSettings ).port; + if (mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; + } +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.js new file mode 100644 index 0000000..c71dbb2 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.js @@ -0,0 +1,1186 @@ +/** + * jQuery Validation Plugin 1.9.0 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2011 Jörn Zaefferer + * + * Licensed under MIT: http://www.opensource.org/licenses/mit-license.php + */ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + // Add novalidate tag if HTML5. + this.attr('novalidate', 'novalidate'); + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + var inputsAndButtons = this.find("input, button"); + + // allow suppresing validation by adding a cancel class to the submit button + inputsAndButtons.filter(".cancel").click(function () { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + inputsAndButtons.filter(":submit").click(function () { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("<input type='hidden'/>").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: ":hidden", + ignoreTitle: false, + onfocusin: function(element, event) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.addWrapper(this.errorsFor(element)).hide(); + } + }, + onfocusout: function(element, event) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element, event) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element, event) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).addClass(errorClass).removeClass(validClass); + } else { + $(element).addClass(errorClass).removeClass(validClass); + } + }, + unhighlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).removeClass(errorClass).addClass(validClass); + } else { + $(element).removeClass(errorClass).addClass(validClass); + } + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0], event); + } + $(this.currentForm) + .validateDelegate("[type='text'], [type='password'], [type='file'], select, textarea, " + + "[type='number'], [type='search'] ,[type='tel'], [type='url'], " + + "[type='email'], [type='datetime'], [type='date'], [type='month'], " + + "[type='week'], [type='time'], [type='datetime-local'], " + + "[type='range'], [type='color'] ", + "focusin focusout keyup", delegate) + .validateDelegate("[type='radio'], [type='checkbox'], select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + element = this.validationTargetFor( this.clean( element ) ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.lastElement = null; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + return $(this.currentForm) + .find("input, select, textarea") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.validationTargetFor( this.clean( element ) ); + + var rules = $(element).rules(); + var dependencyMismatch = false; + for (var method in rules ) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "<strong>Warning: No message defined for " + element.name + "</strong>" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass( this.settings.validClass ).addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + validationTargetFor: function(element) { + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName( element.name ).not(this.settings.ignore)[0]; + } + return element; + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (var method in $.validator.methods) { + var value; + // If .prop exists (jQuery >= 1.6), use it to get true/false for required + if (method === 'required' && typeof $.fn.prop === 'function') { + value = $element.prop(method); + } else { + value = $element.attr(method); + } + if (value) { + rules[method] = value; + } else if ($element[0].getAttribute("type") === method) { + rules[method] = true; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( this.pending[element.name] ) { + return "pending"; + } + if ( previous.old === value ) { + return previous.valid; + } + + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = response || validator.defaultMessage( element, "remote" ); + errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only spaces, digits and dashes + if (/[^0-9 -]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var pendingRequests = {}; + // Use a prefilter if available (1.5+) + if ( $.ajaxPrefilter ) { + $.ajaxPrefilter(function(settings, _, xhr) { + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + pendingRequests[port] = xhr; + } + }); + } else { + // Proxy ajax + var ajax = $.ajax; + $.ajax = function(settings) { + var mode = ( "mode" in settings ? settings : $.ajaxSettings ).mode, + port = ( "port" in settings ? settings : $.ajaxSettings ).port; + if (mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; + } +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.min.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.min.js new file mode 100644 index 0000000..ebf8367 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.min.js @@ -0,0 +1,49 @@ +/** + * jQuery Validation Plugin 1.9.0 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2011 Jörn Zaefferer + * + * Licensed under MIT: http://www.opensource.org/licenses/mit-license.php + */ +(function(c){c.extend(c.fn,{validate:function(a){if(this.length){var b=c.data(this[0],"validator");if(b)return b;this.attr("novalidate","novalidate");b=new c.validator(a,this[0]);c.data(this[0],"validator",b);if(b.settings.onsubmit){a=this.find("input, button");a.filter(".cancel").click(function(){b.cancelSubmit=true});b.settings.submitHandler&&a.filter(":submit").click(function(){b.submitButton=this});this.submit(function(d){function e(){if(b.settings.submitHandler){if(b.submitButton)var f=c("<input type='hidden'/>").attr("name", +b.submitButton.name).val(b.submitButton.value).appendTo(b.currentForm);b.settings.submitHandler.call(b,b.currentForm);b.submitButton&&f.remove();return false}return true}b.settings.debug&&d.preventDefault();if(b.cancelSubmit){b.cancelSubmit=false;return e()}if(b.form()){if(b.pendingRequest){b.formSubmitted=true;return false}return e()}else{b.focusInvalid();return false}})}return b}else a&&a.debug&&window.console&&console.warn("nothing selected, can't validate, returning nothing")},valid:function(){if(c(this[0]).is("form"))return this.validate().form(); +else{var a=true,b=c(this[0].form).validate();this.each(function(){a&=b.element(this)});return a}},removeAttrs:function(a){var b={},d=this;c.each(a.split(/\s/),function(e,f){b[f]=d.attr(f);d.removeAttr(f)});return b},rules:function(a,b){var d=this[0];if(a){var e=c.data(d.form,"validator").settings,f=e.rules,g=c.validator.staticRules(d);switch(a){case "add":c.extend(g,c.validator.normalizeRule(b));f[d.name]=g;if(b.messages)e.messages[d.name]=c.extend(e.messages[d.name],b.messages);break;case "remove":if(!b){delete f[d.name]; +return g}var h={};c.each(b.split(/\s/),function(j,i){h[i]=g[i];delete g[i]});return h}}d=c.validator.normalizeRules(c.extend({},c.validator.metadataRules(d),c.validator.classRules(d),c.validator.attributeRules(d),c.validator.staticRules(d)),d);if(d.required){e=d.required;delete d.required;d=c.extend({required:e},d)}return d}});c.extend(c.expr[":"],{blank:function(a){return!c.trim(""+a.value)},filled:function(a){return!!c.trim(""+a.value)},unchecked:function(a){return!a.checked}});c.validator=function(a, +b){this.settings=c.extend(true,{},c.validator.defaults,a);this.currentForm=b;this.init()};c.validator.format=function(a,b){if(arguments.length==1)return function(){var d=c.makeArray(arguments);d.unshift(a);return c.validator.format.apply(this,d)};if(arguments.length>2&&b.constructor!=Array)b=c.makeArray(arguments).slice(1);if(b.constructor!=Array)b=[b];c.each(b,function(d,e){a=a.replace(RegExp("\\{"+d+"\\}","g"),e)});return a};c.extend(c.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error", +validClass:"valid",errorElement:"label",focusInvalid:true,errorContainer:c([]),errorLabelContainer:c([]),onsubmit:true,ignore:":hidden",ignoreTitle:false,onfocusin:function(a){this.lastActive=a;if(this.settings.focusCleanup&&!this.blockFocusCleanup){this.settings.unhighlight&&this.settings.unhighlight.call(this,a,this.settings.errorClass,this.settings.validClass);this.addWrapper(this.errorsFor(a)).hide()}},onfocusout:function(a){if(!this.checkable(a)&&(a.name in this.submitted||!this.optional(a)))this.element(a)}, +onkeyup:function(a){if(a.name in this.submitted||a==this.lastElement)this.element(a)},onclick:function(a){if(a.name in this.submitted)this.element(a);else a.parentNode.name in this.submitted&&this.element(a.parentNode)},highlight:function(a,b,d){a.type==="radio"?this.findByName(a.name).addClass(b).removeClass(d):c(a).addClass(b).removeClass(d)},unhighlight:function(a,b,d){a.type==="radio"?this.findByName(a.name).removeClass(b).addClass(d):c(a).removeClass(b).addClass(d)}},setDefaults:function(a){c.extend(c.validator.defaults, +a)},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",accept:"Please enter a value with a valid extension.",maxlength:c.validator.format("Please enter no more than {0} characters."), +minlength:c.validator.format("Please enter at least {0} characters."),rangelength:c.validator.format("Please enter a value between {0} and {1} characters long."),range:c.validator.format("Please enter a value between {0} and {1}."),max:c.validator.format("Please enter a value less than or equal to {0}."),min:c.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:false,prototype:{init:function(){function a(e){var f=c.data(this[0].form,"validator"),g="on"+e.type.replace(/^validate/, +"");f.settings[g]&&f.settings[g].call(f,this[0],e)}this.labelContainer=c(this.settings.errorLabelContainer);this.errorContext=this.labelContainer.length&&this.labelContainer||c(this.currentForm);this.containers=c(this.settings.errorContainer).add(this.settings.errorLabelContainer);this.submitted={};this.valueCache={};this.pendingRequest=0;this.pending={};this.invalid={};this.reset();var b=this.groups={};c.each(this.settings.groups,function(e,f){c.each(f.split(/\s/),function(g,h){b[h]=e})});var d= +this.settings.rules;c.each(d,function(e,f){d[e]=c.validator.normalizeRule(f)});c(this.currentForm).validateDelegate("[type='text'], [type='password'], [type='file'], select, textarea, [type='number'], [type='search'] ,[type='tel'], [type='url'], [type='email'], [type='datetime'], [type='date'], [type='month'], [type='week'], [type='time'], [type='datetime-local'], [type='range'], [type='color'] ","focusin focusout keyup",a).validateDelegate("[type='radio'], [type='checkbox'], select, option","click", +a);this.settings.invalidHandler&&c(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler)},form:function(){this.checkForm();c.extend(this.submitted,this.errorMap);this.invalid=c.extend({},this.errorMap);this.valid()||c(this.currentForm).triggerHandler("invalid-form",[this]);this.showErrors();return this.valid()},checkForm:function(){this.prepareForm();for(var a=0,b=this.currentElements=this.elements();b[a];a++)this.check(b[a]);return this.valid()},element:function(a){this.lastElement= +a=this.validationTargetFor(this.clean(a));this.prepareElement(a);this.currentElements=c(a);var b=this.check(a);if(b)delete this.invalid[a.name];else this.invalid[a.name]=true;if(!this.numberOfInvalids())this.toHide=this.toHide.add(this.containers);this.showErrors();return b},showErrors:function(a){if(a){c.extend(this.errorMap,a);this.errorList=[];for(var b in a)this.errorList.push({message:a[b],element:this.findByName(b)[0]});this.successList=c.grep(this.successList,function(d){return!(d.name in a)})}this.settings.showErrors? +this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors()},resetForm:function(){c.fn.resetForm&&c(this.currentForm).resetForm();this.submitted={};this.lastElement=null;this.prepareForm();this.hideErrors();this.elements().removeClass(this.settings.errorClass)},numberOfInvalids:function(){return this.objectLength(this.invalid)},objectLength:function(a){var b=0,d;for(d in a)b++;return b},hideErrors:function(){this.addWrapper(this.toHide).hide()},valid:function(){return this.size()== +0},size:function(){return this.errorList.length},focusInvalid:function(){if(this.settings.focusInvalid)try{c(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin")}catch(a){}},findLastActive:function(){var a=this.lastActive;return a&&c.grep(this.errorList,function(b){return b.element.name==a.name}).length==1&&a},elements:function(){var a=this,b={};return c(this.currentForm).find("input, select, textarea").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){!this.name&& +a.settings.debug&&window.console&&console.error("%o has no name assigned",this);if(this.name in b||!a.objectLength(c(this).rules()))return false;return b[this.name]=true})},clean:function(a){return c(a)[0]},errors:function(){return c(this.settings.errorElement+"."+this.settings.errorClass,this.errorContext)},reset:function(){this.successList=[];this.errorList=[];this.errorMap={};this.toShow=c([]);this.toHide=c([]);this.currentElements=c([])},prepareForm:function(){this.reset();this.toHide=this.errors().add(this.containers)}, +prepareElement:function(a){this.reset();this.toHide=this.errorsFor(a)},check:function(a){a=this.validationTargetFor(this.clean(a));var b=c(a).rules(),d=false,e;for(e in b){var f={method:e,parameters:b[e]};try{var g=c.validator.methods[e].call(this,a.value.replace(/\r/g,""),a,f.parameters);if(g=="dependency-mismatch")d=true;else{d=false;if(g=="pending"){this.toHide=this.toHide.not(this.errorsFor(a));return}if(!g){this.formatAndAdd(a,f);return false}}}catch(h){this.settings.debug&&window.console&&console.log("exception occured when checking element "+ +a.id+", check the '"+f.method+"' method",h);throw h;}}if(!d){this.objectLength(b)&&this.successList.push(a);return true}},customMetaMessage:function(a,b){if(c.metadata){var d=this.settings.meta?c(a).metadata()[this.settings.meta]:c(a).metadata();return d&&d.messages&&d.messages[b]}},customMessage:function(a,b){var d=this.settings.messages[a];return d&&(d.constructor==String?d:d[b])},findDefined:function(){for(var a=0;a<arguments.length;a++)if(arguments[a]!==undefined)return arguments[a]},defaultMessage:function(a, +b){return this.findDefined(this.customMessage(a.name,b),this.customMetaMessage(a,b),!this.settings.ignoreTitle&&a.title||undefined,c.validator.messages[b],"<strong>Warning: No message defined for "+a.name+"</strong>")},formatAndAdd:function(a,b){var d=this.defaultMessage(a,b.method),e=/\$?\{(\d+)\}/g;if(typeof d=="function")d=d.call(this,b.parameters,a);else if(e.test(d))d=jQuery.format(d.replace(e,"{$1}"),b.parameters);this.errorList.push({message:d,element:a});this.errorMap[a.name]=d;this.submitted[a.name]= +d},addWrapper:function(a){if(this.settings.wrapper)a=a.add(a.parent(this.settings.wrapper));return a},defaultShowErrors:function(){for(var a=0;this.errorList[a];a++){var b=this.errorList[a];this.settings.highlight&&this.settings.highlight.call(this,b.element,this.settings.errorClass,this.settings.validClass);this.showLabel(b.element,b.message)}if(this.errorList.length)this.toShow=this.toShow.add(this.containers);if(this.settings.success)for(a=0;this.successList[a];a++)this.showLabel(this.successList[a]); +if(this.settings.unhighlight){a=0;for(b=this.validElements();b[a];a++)this.settings.unhighlight.call(this,b[a],this.settings.errorClass,this.settings.validClass)}this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show()},validElements:function(){return this.currentElements.not(this.invalidElements())},invalidElements:function(){return c(this.errorList).map(function(){return this.element})},showLabel:function(a,b){var d=this.errorsFor(a);if(d.length){d.removeClass(this.settings.validClass).addClass(this.settings.errorClass); +d.attr("generated")&&d.html(b)}else{d=c("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(a),generated:true}).addClass(this.settings.errorClass).html(b||"");if(this.settings.wrapper)d=d.hide().show().wrap("<"+this.settings.wrapper+"/>").parent();this.labelContainer.append(d).length||(this.settings.errorPlacement?this.settings.errorPlacement(d,c(a)):d.insertAfter(a))}if(!b&&this.settings.success){d.text("");typeof this.settings.success=="string"?d.addClass(this.settings.success):this.settings.success(d)}this.toShow= +this.toShow.add(d)},errorsFor:function(a){var b=this.idOrName(a);return this.errors().filter(function(){return c(this).attr("for")==b})},idOrName:function(a){return this.groups[a.name]||(this.checkable(a)?a.name:a.id||a.name)},validationTargetFor:function(a){if(this.checkable(a))a=this.findByName(a.name).not(this.settings.ignore)[0];return a},checkable:function(a){return/radio|checkbox/i.test(a.type)},findByName:function(a){var b=this.currentForm;return c(document.getElementsByName(a)).map(function(d, +e){return e.form==b&&e.name==a&&e||null})},getLength:function(a,b){switch(b.nodeName.toLowerCase()){case "select":return c("option:selected",b).length;case "input":if(this.checkable(b))return this.findByName(b.name).filter(":checked").length}return a.length},depend:function(a,b){return this.dependTypes[typeof a]?this.dependTypes[typeof a](a,b):true},dependTypes:{"boolean":function(a){return a},string:function(a,b){return!!c(a,b.form).length},"function":function(a,b){return a(b)}},optional:function(a){return!c.validator.methods.required.call(this, +c.trim(a.value),a)&&"dependency-mismatch"},startRequest:function(a){if(!this.pending[a.name]){this.pendingRequest++;this.pending[a.name]=true}},stopRequest:function(a,b){this.pendingRequest--;if(this.pendingRequest<0)this.pendingRequest=0;delete this.pending[a.name];if(b&&this.pendingRequest==0&&this.formSubmitted&&this.form()){c(this.currentForm).submit();this.formSubmitted=false}else if(!b&&this.pendingRequest==0&&this.formSubmitted){c(this.currentForm).triggerHandler("invalid-form",[this]);this.formSubmitted= +false}},previousValue:function(a){return c.data(a,"previousValue")||c.data(a,"previousValue",{old:null,valid:true,message:this.defaultMessage(a,"remote")})}},classRuleSettings:{required:{required:true},email:{email:true},url:{url:true},date:{date:true},dateISO:{dateISO:true},dateDE:{dateDE:true},number:{number:true},numberDE:{numberDE:true},digits:{digits:true},creditcard:{creditcard:true}},addClassRules:function(a,b){a.constructor==String?this.classRuleSettings[a]=b:c.extend(this.classRuleSettings, +a)},classRules:function(a){var b={};(a=c(a).attr("class"))&&c.each(a.split(" "),function(){this in c.validator.classRuleSettings&&c.extend(b,c.validator.classRuleSettings[this])});return b},attributeRules:function(a){var b={};a=c(a);for(var d in c.validator.methods){var e;if(e=d==="required"&&typeof c.fn.prop==="function"?a.prop(d):a.attr(d))b[d]=e;else if(a[0].getAttribute("type")===d)b[d]=true}b.maxlength&&/-1|2147483647|524288/.test(b.maxlength)&&delete b.maxlength;return b},metadataRules:function(a){if(!c.metadata)return{}; +var b=c.data(a.form,"validator").settings.meta;return b?c(a).metadata()[b]:c(a).metadata()},staticRules:function(a){var b={},d=c.data(a.form,"validator");if(d.settings.rules)b=c.validator.normalizeRule(d.settings.rules[a.name])||{};return b},normalizeRules:function(a,b){c.each(a,function(d,e){if(e===false)delete a[d];else if(e.param||e.depends){var f=true;switch(typeof e.depends){case "string":f=!!c(e.depends,b.form).length;break;case "function":f=e.depends.call(b,b)}if(f)a[d]=e.param!==undefined? +e.param:true;else delete a[d]}});c.each(a,function(d,e){a[d]=c.isFunction(e)?e(b):e});c.each(["minlength","maxlength","min","max"],function(){if(a[this])a[this]=Number(a[this])});c.each(["rangelength","range"],function(){if(a[this])a[this]=[Number(a[this][0]),Number(a[this][1])]});if(c.validator.autoCreateRanges){if(a.min&&a.max){a.range=[a.min,a.max];delete a.min;delete a.max}if(a.minlength&&a.maxlength){a.rangelength=[a.minlength,a.maxlength];delete a.minlength;delete a.maxlength}}a.messages&&delete a.messages; +return a},normalizeRule:function(a){if(typeof a=="string"){var b={};c.each(a.split(/\s/),function(){b[this]=true});a=b}return a},addMethod:function(a,b,d){c.validator.methods[a]=b;c.validator.messages[a]=d!=undefined?d:c.validator.messages[a];b.length<3&&c.validator.addClassRules(a,c.validator.normalizeRule(a))},methods:{required:function(a,b,d){if(!this.depend(d,b))return"dependency-mismatch";switch(b.nodeName.toLowerCase()){case "select":return(a=c(b).val())&&a.length>0;case "input":if(this.checkable(b))return this.getLength(a, +b)>0;default:return c.trim(a).length>0}},remote:function(a,b,d){if(this.optional(b))return"dependency-mismatch";var e=this.previousValue(b);this.settings.messages[b.name]||(this.settings.messages[b.name]={});e.originalMessage=this.settings.messages[b.name].remote;this.settings.messages[b.name].remote=e.message;d=typeof d=="string"&&{url:d}||d;if(this.pending[b.name])return"pending";if(e.old===a)return e.valid;e.old=a;var f=this;this.startRequest(b);var g={};g[b.name]=a;c.ajax(c.extend(true,{url:d, +mode:"abort",port:"validate"+b.name,dataType:"json",data:g,success:function(h){f.settings.messages[b.name].remote=e.originalMessage;var j=h===true;if(j){var i=f.formSubmitted;f.prepareElement(b);f.formSubmitted=i;f.successList.push(b);f.showErrors()}else{i={};h=h||f.defaultMessage(b,"remote");i[b.name]=e.message=c.isFunction(h)?h(a):h;f.showErrors(i)}e.valid=j;f.stopRequest(b,j)}},d));return"pending"},minlength:function(a,b,d){return this.optional(b)||this.getLength(c.trim(a),b)>=d},maxlength:function(a, +b,d){return this.optional(b)||this.getLength(c.trim(a),b)<=d},rangelength:function(a,b,d){a=this.getLength(c.trim(a),b);return this.optional(b)||a>=d[0]&&a<=d[1]},min:function(a,b,d){return this.optional(b)||a>=d},max:function(a,b,d){return this.optional(b)||a<=d},range:function(a,b,d){return this.optional(b)||a>=d[0]&&a<=d[1]},email:function(a,b){return this.optional(b)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(a)}, +url:function(a,b){return this.optional(b)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(a)}, +date:function(a,b){return this.optional(b)||!/Invalid|NaN/.test(new Date(a))},dateISO:function(a,b){return this.optional(b)||/^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(a)},number:function(a,b){return this.optional(b)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(a)},digits:function(a,b){return this.optional(b)||/^\d+$/.test(a)},creditcard:function(a,b){if(this.optional(b))return"dependency-mismatch";if(/[^0-9 -]+/.test(a))return false;var d=0,e=0,f=false;a=a.replace(/\D/g,"");for(var g=a.length-1;g>= +0;g--){e=a.charAt(g);e=parseInt(e,10);if(f)if((e*=2)>9)e-=9;d+=e;f=!f}return d%10==0},accept:function(a,b,d){d=typeof d=="string"?d.replace(/,/g,"|"):"png|jpe?g|gif";return this.optional(b)||a.match(RegExp(".("+d+")$","i"))},equalTo:function(a,b,d){d=c(d).unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){c(b).valid()});return a==d.val()}}});c.format=c.validator.format})(jQuery); +(function(c){var a={};if(c.ajaxPrefilter)c.ajaxPrefilter(function(d,e,f){e=d.port;if(d.mode=="abort"){a[e]&&a[e].abort();a[e]=f}});else{var b=c.ajax;c.ajax=function(d){var e=("port"in d?d:c.ajaxSettings).port;if(("mode"in d?d:c.ajaxSettings).mode=="abort"){a[e]&&a[e].abort();return a[e]=b.apply(this,arguments)}return b.apply(this,arguments)}}})(jQuery); +(function(c){!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(e){e=c.event.fix(e);e.type=b;return c.event.handle.call(this,e)}c.event.special[b]={setup:function(){this.addEventListener(a,d,true)},teardown:function(){this.removeEventListener(a,d,true)},handler:function(e){arguments[0]=c.event.fix(e);arguments[0].type=b;return c.event.handle.apply(this,arguments)}}});c.extend(c.fn,{validateDelegate:function(a, +b,d){return this.bind(b,function(e){var f=c(e.target);if(f.is(a))return d.apply(f,arguments)})}})})(jQuery); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.js new file mode 100644 index 0000000..e2a410f --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.js @@ -0,0 +1,365 @@ +/*! +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global document: false, jQuery: false */ + +(function ($) { + var $jQval = $.validator, + adapters, + data_validation = "unobtrusiveValidation"; + + function setValidationValues(options, ruleName, value) { + options.rules[ruleName] = value; + if (options.message) { + options.messages[ruleName] = options.message; + } + } + + function splitAndTrim(value) { + return value.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g); + } + + function escapeAttributeValue(value) { + // As mentioned on http://api.jquery.com/category/selectors/ + return value.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g, "\\$1"); + } + + function getModelPrefix(fieldName) { + return fieldName.substr(0, fieldName.lastIndexOf(".") + 1); + } + + function appendModelPrefix(value, prefix) { + if (value.indexOf("*.") === 0) { + value = value.replace("*.", prefix); + } + return value; + } + + function onError(error, inputElement) { // 'this' is the form element + var container = $(this).find("[data-valmsg-for='" + escapeAttributeValue(inputElement[0].name) + "']"), + replace = $.parseJSON(container.attr("data-valmsg-replace")) !== false; + + container.removeClass("field-validation-valid").addClass("field-validation-error"); + error.data("unobtrusiveContainer", container); + + if (replace) { + container.empty(); + error.removeClass("input-validation-error").appendTo(container); + } + else { + error.hide(); + } + } + + function onErrors(event, validator) { // 'this' is the form element + var container = $(this).find("[data-valmsg-summary=true]"), + list = container.find("ul"); + + if (list && list.length && validator.errorList.length) { + list.empty(); + container.addClass("validation-summary-errors").removeClass("validation-summary-valid"); + + $.each(validator.errorList, function () { + $("<li />").html(this.message).appendTo(list); + }); + } + } + + function onSuccess(error) { // 'this' is the form element + var container = error.data("unobtrusiveContainer"), + replace = $.parseJSON(container.attr("data-valmsg-replace")); + + if (container) { + container.addClass("field-validation-valid").removeClass("field-validation-error"); + error.removeData("unobtrusiveContainer"); + + if (replace) { + container.empty(); + } + } + } + + function onReset(event) { // 'this' is the form element + var $form = $(this); + $form.data("validator").resetForm(); + $form.find(".validation-summary-errors") + .addClass("validation-summary-valid") + .removeClass("validation-summary-errors"); + $form.find(".field-validation-error") + .addClass("field-validation-valid") + .removeClass("field-validation-error") + .removeData("unobtrusiveContainer") + .find(">*") // If we were using valmsg-replace, get the underlying error + .removeData("unobtrusiveContainer"); + } + + function validationInfo(form) { + var $form = $(form), + result = $form.data(data_validation), + onResetProxy = $.proxy(onReset, form); + + if (!result) { + result = { + options: { // options structure passed to jQuery Validate's validate() method + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: $.proxy(onError, form), + invalidHandler: $.proxy(onErrors, form), + messages: {}, + rules: {}, + success: $.proxy(onSuccess, form) + }, + attachValidation: function () { + $form + .unbind("reset." + data_validation, onResetProxy) + .bind("reset." + data_validation, onResetProxy) + .validate(this.options); + }, + validate: function () { // a validation function that is called by unobtrusive Ajax + $form.validate(); + return $form.valid(); + } + }; + $form.data(data_validation, result); + } + + return result; + } + + $jQval.unobtrusive = { + adapters: [], + + parseElement: function (element, skipAttach) { + /// <summary> + /// Parses a single HTML element for unobtrusive validation attributes. + /// </summary> + /// <param name="element" domElement="true">The HTML element to be parsed.</param> + /// <param name="skipAttach" type="Boolean">[Optional] true to skip attaching the + /// validation to the form. If parsing just this single element, you should specify true. + /// If parsing several elements, you should specify false, and manually attach the validation + /// to the form when you are finished. The default is false.</param> + var $element = $(element), + form = $element.parents("form")[0], + valInfo, rules, messages; + + if (!form) { // Cannot do client-side validation without a form + return; + } + + valInfo = validationInfo(form); + valInfo.options.rules[element.name] = rules = {}; + valInfo.options.messages[element.name] = messages = {}; + + $.each(this.adapters, function () { + var prefix = "data-val-" + this.name, + message = $element.attr(prefix), + paramValues = {}; + + if (message !== undefined) { // Compare against undefined, because an empty message is legal (and falsy) + prefix += "-"; + + $.each(this.params, function () { + paramValues[this] = $element.attr(prefix + this); + }); + + this.adapt({ + element: element, + form: form, + message: message, + params: paramValues, + rules: rules, + messages: messages + }); + } + }); + + $.extend(rules, { "__dummy__": true }); + + if (!skipAttach) { + valInfo.attachValidation(); + } + }, + + parse: function (selector) { + /// <summary> + /// Parses all the HTML elements in the specified selector. It looks for input elements decorated + /// with the [data-val=true] attribute value and enables validation according to the data-val-* + /// attribute values. + /// </summary> + /// <param name="selector" type="String">Any valid jQuery selector.</param> + var $forms = $(selector) + .parents("form") + .andSelf() + .add($(selector).find("form")) + .filter("form"); + + $(selector).find(":input[data-val=true]").each(function () { + $jQval.unobtrusive.parseElement(this, true); + }); + + $forms.each(function () { + var info = validationInfo(this); + if (info) { + info.attachValidation(); + } + }); + } + }; + + adapters = $jQval.unobtrusive.adapters; + + adapters.add = function (adapterName, params, fn) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="params" type="Array" optional="true">[Optional] An array of parameter names (strings) that will + /// be extracted from the data-val-nnnn-mmmm HTML attributes (where nnnn is the adapter name, and + /// mmmm is the parameter name).</param> + /// <param name="fn" type="Function">The function to call, which adapts the values from the HTML + /// attributes into jQuery Validate rules and/or messages.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + if (!fn) { // Called with no params, just a function + fn = params; + params = []; + } + this.push({ name: adapterName, params: params, adapt: fn }); + return this; + }; + + adapters.addBool = function (adapterName, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has no parameter values.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, function (options) { + setValidationValues(options, ruleName || adapterName, true); + }); + }; + + adapters.addMinMax = function (adapterName, minRuleName, maxRuleName, minMaxRuleName, minAttribute, maxAttribute) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation has three potential rules (one for min-only, one for max-only, and + /// one for min-and-max). The HTML parameters are expected to be named -min and -max.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="minRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a minimum value.</param> + /// <param name="maxRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a maximum value.</param> + /// <param name="minMaxRuleName" type="String">The name of the jQuery Validate rule to be used when you + /// have both a minimum and maximum value.</param> + /// <param name="minAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the minimum value. The default is "min".</param> + /// <param name="maxAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the maximum value. The default is "max".</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [minAttribute || "min", maxAttribute || "max"], function (options) { + var min = options.params.min, + max = options.params.max; + + if (min && max) { + setValidationValues(options, minMaxRuleName, [min, max]); + } + else if (min) { + setValidationValues(options, minRuleName, min); + } + else if (max) { + setValidationValues(options, maxRuleName, max); + } + }); + }; + + adapters.addSingleVal = function (adapterName, attribute, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has a single value.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute(where nnnn is the adapter name).</param> + /// <param name="attribute" type="String">[Optional] The name of the HTML attribute that contains the value. + /// The default is "val".</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [attribute || "val"], function (options) { + setValidationValues(options, ruleName || adapterName, options.params[attribute]); + }); + }; + + $jQval.addMethod("__dummy__", function (value, element, params) { + return true; + }); + + $jQval.addMethod("regex", function (value, element, params) { + var match; + if (this.optional(element)) { + return true; + } + + match = new RegExp(params).exec(value); + return (match && (match.index === 0) && (match[0].length === value.length)); + }); + + $jQval.addMethod("nonalphamin", function (value, element, nonalphamin) { + var match; + if (nonalphamin) { + match = value.match(/\W/g); + match = match && match.length >= nonalphamin; + } + return match; + }); + + adapters.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + adapters.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + adapters.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + adapters.add("equalto", ["other"], function (options) { + var prefix = getModelPrefix(options.element.name), + other = options.params.other, + fullOtherName = appendModelPrefix(other, prefix), + element = $(options.form).find(":input[name='" + escapeAttributeValue(fullOtherName) + "']")[0]; + + setValidationValues(options, "equalTo", element); + }); + adapters.add("required", function (options) { + // jQuery Validate equates "required" with "mandatory" for checkbox elements + if (options.element.tagName.toUpperCase() !== "INPUT" || options.element.type.toUpperCase() !== "CHECKBOX") { + setValidationValues(options, "required", true); + } + }); + adapters.add("remote", ["url", "type", "additionalfields"], function (options) { + var value = { + url: options.params.url, + type: options.params.type || "GET", + data: {} + }, + prefix = getModelPrefix(options.element.name); + + $.each(splitAndTrim(options.params.additionalfields || options.element.name), function (i, fieldName) { + var paramName = appendModelPrefix(fieldName, prefix); + value.data[paramName] = function () { + return $(options.form).find(":input[name='" + escapeAttributeValue(paramName) + "']").val(); + }; + }); + + setValidationValues(options, "remote", value); + }); + adapters.add("password", ["min", "nonalphamin", "regex"], function (options) { + if (options.params.min) { + setValidationValues(options, "minlength", options.params.min); + } + if (options.params.nonalphamin) { + setValidationValues(options, "nonalphamin", options.params.nonalphamin); + } + if (options.params.regex) { + setValidationValues(options, "regex", options.params.regex); + } + }); + + $(function () { + $jQval.unobtrusive.parse(document); + }); +} (jQuery));
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.min.js b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.min.js new file mode 100644 index 0000000..e5e675b --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/jquery.validate.unobtrusive.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var d=a.validator,b,e="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function j(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function f(a){return a.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g,"\\$1")}function h(a){return a.substr(0,a.lastIndexOf(".")+1)}function g(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function m(c,d){var b=a(this).find("[data-valmsg-for='"+f(d[0].name)+"']"),e=a.parseJSON(b.attr("data-valmsg-replace"))!==false;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(e){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function l(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("<li />").html(this.message).appendTo(b)})}}function k(c){var b=c.data("unobtrusiveContainer"),d=a.parseJSON(b.attr("data-valmsg-replace"));if(b){b.addClass("field-validation-valid").removeClass("field-validation-error");c.removeData("unobtrusiveContainer");d&&b.empty()}}function n(){var b=a(this);b.data("validator").resetForm();b.find(".validation-summary-errors").addClass("validation-summary-valid").removeClass("validation-summary-errors");b.find(".field-validation-error").addClass("field-validation-valid").removeClass("field-validation-error").removeData("unobtrusiveContainer").find(">*").removeData("unobtrusiveContainer")}function i(c){var b=a(c),d=b.data(e),f=a.proxy(n,c);if(!d){d={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:a.proxy(m,c),invalidHandler:a.proxy(l,c),messages:{},rules:{},success:a.proxy(k,c)},attachValidation:function(){b.unbind("reset."+e,f).bind("reset."+e,f).validate(this.options)},validate:function(){b.validate();return b.valid()}};b.data(e,d)}return d}d.unobtrusive={adapters:[],parseElement:function(b,h){var d=a(b),f=d.parents("form")[0],c,e,g;if(!f)return;c=i(f);c.options.rules[b.name]=e={};c.options.messages[b.name]=g={};a.each(this.adapters,function(){var c="data-val-"+this.name,i=d.attr(c),h={};if(i!==undefined){c+="-";a.each(this.params,function(){h[this]=d.attr(c+this)});this.adapt({element:b,form:f,message:i,params:h,rules:e,messages:g})}});a.extend(e,{__dummy__:true});!h&&c.attachValidation()},parse:function(b){var c=a(b).parents("form").andSelf().add(a(b).find("form")).filter("form");a(b).find(":input[data-val=true]").each(function(){d.unobtrusive.parseElement(this,true)});c.each(function(){var a=i(this);a&&a.attachValidation()})}};b=d.unobtrusive.adapters;b.add=function(c,a,b){if(!b){b=a;a=[]}this.push({name:c,params:a,adapt:b});return this};b.addBool=function(a,b){return this.add(a,function(d){c(d,b||a,true)})};b.addMinMax=function(e,g,f,a,d,b){return this.add(e,[d||"min",b||"max"],function(b){var e=b.params.min,d=b.params.max;if(e&&d)c(b,a,[e,d]);else if(e)c(b,g,e);else d&&c(b,f,d)})};b.addSingleVal=function(a,b,d){return this.add(a,[b||"val"],function(e){c(e,d||a,e.params[b])})};d.addMethod("__dummy__",function(){return true});d.addMethod("regex",function(b,c,d){var a;if(this.optional(c))return true;a=(new RegExp(d)).exec(b);return a&&a.index===0&&a[0].length===b.length});d.addMethod("nonalphamin",function(c,d,b){var a;if(b){a=c.match(/\W/g);a=a&&a.length>=b}return a});b.addSingleVal("accept","exts").addSingleVal("regex","pattern");b.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");b.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");b.add("equalto",["other"],function(b){var i=h(b.element.name),j=b.params.other,d=g(j,i),e=a(b.form).find(":input[name='"+f(d)+"']")[0];c(b,"equalTo",e)});b.add("required",function(a){(a.element.tagName.toUpperCase()!=="INPUT"||a.element.type.toUpperCase()!=="CHECKBOX")&&c(a,"required",true)});b.add("remote",["url","type","additionalfields"],function(b){var d={url:b.params.url,type:b.params.type||"GET",data:{}},e=h(b.element.name);a.each(j(b.params.additionalfields||b.element.name),function(i,h){var c=g(h,e);d.data[c]=function(){return a(b.form).find(":input[name='"+f(c)+"']").val()}});c(b,"remote",d)});b.add("password",["min","nonalphamin","regex"],function(a){a.params.min&&c(a,"minlength",a.params.min);a.params.nonalphamin&&c(a,"nonalphamin",a.params.nonalphamin);a.params.regex&&c(a,"regex",a.params.regex)});a(function(){d.unobtrusive.parse(document)})})(jQuery);
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.debug.js b/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.debug.js new file mode 100644 index 0000000..79882ce --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.debug.js @@ -0,0 +1,3443 @@ +// Knockout JavaScript library v2.1.0 +// (c) Steven Sanderson - http://knockoutjs.com/ +// License: MIT (http://www.opensource.org/licenses/mit-license.php) + +(function(window,document,navigator,undefined){ +var DEBUG=true; +!function(factory) { + // Support three module loading scenarios + if (typeof require === 'function' && typeof exports === 'object' && typeof module === 'object') { + // [1] CommonJS/Node.js + var target = module['exports'] || exports; // module.exports is for Node.js + factory(target); + } else if (typeof define === 'function' && define['amd']) { + // [2] AMD anonymous module + define(['exports'], factory); + } else { + // [3] No module loader (plain <script> tag) - put directly in global namespace + factory(window['ko'] = {}); + } +}(function(koExports){ +// Internally, all KO objects are attached to koExports (even the non-exported ones whose names will be minified by the closure compiler). +// In the future, the following "ko" variable may be made distinct from "koExports" so that private objects are not externally reachable. +var ko = typeof koExports !== 'undefined' ? koExports : {}; +// Google Closure Compiler helpers (used only to make the minified file smaller) +ko.exportSymbol = function(koPath, object) { + var tokens = koPath.split("."); + + // In the future, "ko" may become distinct from "koExports" (so that non-exported objects are not reachable) + // At that point, "target" would be set to: (typeof koExports !== "undefined" ? koExports : ko) + var target = ko; + + for (var i = 0; i < tokens.length - 1; i++) + target = target[tokens[i]]; + target[tokens[tokens.length - 1]] = object; +}; +ko.exportProperty = function(owner, publicName, object) { + owner[publicName] = object; +}; +ko.version = "2.1.0"; + +ko.exportSymbol('version', ko.version); +ko.utils = new (function () { + var stringTrimRegex = /^(\s|\u00A0)+|(\s|\u00A0)+$/g; + + // Represent the known event types in a compact way, then at runtime transform it into a hash with event name as key (for fast lookup) + var knownEvents = {}, knownEventTypesByEventName = {}; + var keyEventTypeName = /Firefox\/2/i.test(navigator.userAgent) ? 'KeyboardEvent' : 'UIEvents'; + knownEvents[keyEventTypeName] = ['keyup', 'keydown', 'keypress']; + knownEvents['MouseEvents'] = ['click', 'dblclick', 'mousedown', 'mouseup', 'mousemove', 'mouseover', 'mouseout', 'mouseenter', 'mouseleave']; + for (var eventType in knownEvents) { + var knownEventsForType = knownEvents[eventType]; + if (knownEventsForType.length) { + for (var i = 0, j = knownEventsForType.length; i < j; i++) + knownEventTypesByEventName[knownEventsForType[i]] = eventType; + } + } + var eventsThatMustBeRegisteredUsingAttachEvent = { 'propertychange': true }; // Workaround for an IE9 issue - https://github.com/SteveSanderson/knockout/issues/406 + + // Detect IE versions for bug workarounds (uses IE conditionals, not UA string, for robustness) + var ieVersion = (function() { + var version = 3, div = document.createElement('div'), iElems = div.getElementsByTagName('i'); + + // Keep constructing conditional HTML blocks until we hit one that resolves to an empty fragment + while ( + div.innerHTML = '<!--[if gt IE ' + (++version) + ']><i></i><![endif]-->', + iElems[0] + ); + return version > 4 ? version : undefined; + }()); + var isIe6 = ieVersion === 6, + isIe7 = ieVersion === 7; + + function isClickOnCheckableElement(element, eventType) { + if ((ko.utils.tagNameLower(element) !== "input") || !element.type) return false; + if (eventType.toLowerCase() != "click") return false; + var inputType = element.type; + return (inputType == "checkbox") || (inputType == "radio"); + } + + return { + fieldsIncludedWithJsonPost: ['authenticity_token', /^__RequestVerificationToken(_.*)?$/], + + arrayForEach: function (array, action) { + for (var i = 0, j = array.length; i < j; i++) + action(array[i]); + }, + + arrayIndexOf: function (array, item) { + if (typeof Array.prototype.indexOf == "function") + return Array.prototype.indexOf.call(array, item); + for (var i = 0, j = array.length; i < j; i++) + if (array[i] === item) + return i; + return -1; + }, + + arrayFirst: function (array, predicate, predicateOwner) { + for (var i = 0, j = array.length; i < j; i++) + if (predicate.call(predicateOwner, array[i])) + return array[i]; + return null; + }, + + arrayRemoveItem: function (array, itemToRemove) { + var index = ko.utils.arrayIndexOf(array, itemToRemove); + if (index >= 0) + array.splice(index, 1); + }, + + arrayGetDistinctValues: function (array) { + array = array || []; + var result = []; + for (var i = 0, j = array.length; i < j; i++) { + if (ko.utils.arrayIndexOf(result, array[i]) < 0) + result.push(array[i]); + } + return result; + }, + + arrayMap: function (array, mapping) { + array = array || []; + var result = []; + for (var i = 0, j = array.length; i < j; i++) + result.push(mapping(array[i])); + return result; + }, + + arrayFilter: function (array, predicate) { + array = array || []; + var result = []; + for (var i = 0, j = array.length; i < j; i++) + if (predicate(array[i])) + result.push(array[i]); + return result; + }, + + arrayPushAll: function (array, valuesToPush) { + if (valuesToPush instanceof Array) + array.push.apply(array, valuesToPush); + else + for (var i = 0, j = valuesToPush.length; i < j; i++) + array.push(valuesToPush[i]); + return array; + }, + + extend: function (target, source) { + if (source) { + for(var prop in source) { + if(source.hasOwnProperty(prop)) { + target[prop] = source[prop]; + } + } + } + return target; + }, + + emptyDomNode: function (domNode) { + while (domNode.firstChild) { + ko.removeNode(domNode.firstChild); + } + }, + + moveCleanedNodesToContainerElement: function(nodes) { + // Ensure it's a real array, as we're about to reparent the nodes and + // we don't want the underlying collection to change while we're doing that. + var nodesArray = ko.utils.makeArray(nodes); + + var container = document.createElement('div'); + for (var i = 0, j = nodesArray.length; i < j; i++) { + ko.cleanNode(nodesArray[i]); + container.appendChild(nodesArray[i]); + } + return container; + }, + + setDomNodeChildren: function (domNode, childNodes) { + ko.utils.emptyDomNode(domNode); + if (childNodes) { + for (var i = 0, j = childNodes.length; i < j; i++) + domNode.appendChild(childNodes[i]); + } + }, + + replaceDomNodes: function (nodeToReplaceOrNodeArray, newNodesArray) { + var nodesToReplaceArray = nodeToReplaceOrNodeArray.nodeType ? [nodeToReplaceOrNodeArray] : nodeToReplaceOrNodeArray; + if (nodesToReplaceArray.length > 0) { + var insertionPoint = nodesToReplaceArray[0]; + var parent = insertionPoint.parentNode; + for (var i = 0, j = newNodesArray.length; i < j; i++) + parent.insertBefore(newNodesArray[i], insertionPoint); + for (var i = 0, j = nodesToReplaceArray.length; i < j; i++) { + ko.removeNode(nodesToReplaceArray[i]); + } + } + }, + + setOptionNodeSelectionState: function (optionNode, isSelected) { + // IE6 sometimes throws "unknown error" if you try to write to .selected directly, whereas Firefox struggles with setAttribute. Pick one based on browser. + if (navigator.userAgent.indexOf("MSIE 6") >= 0) + optionNode.setAttribute("selected", isSelected); + else + optionNode.selected = isSelected; + }, + + stringTrim: function (string) { + return (string || "").replace(stringTrimRegex, ""); + }, + + stringTokenize: function (string, delimiter) { + var result = []; + var tokens = (string || "").split(delimiter); + for (var i = 0, j = tokens.length; i < j; i++) { + var trimmed = ko.utils.stringTrim(tokens[i]); + if (trimmed !== "") + result.push(trimmed); + } + return result; + }, + + stringStartsWith: function (string, startsWith) { + string = string || ""; + if (startsWith.length > string.length) + return false; + return string.substring(0, startsWith.length) === startsWith; + }, + + buildEvalWithinScopeFunction: function (expression, scopeLevels) { + // Build the source for a function that evaluates "expression" + // For each scope variable, add an extra level of "with" nesting + // Example result: with(sc[1]) { with(sc[0]) { return (expression) } } + var functionBody = "return (" + expression + ")"; + for (var i = 0; i < scopeLevels; i++) { + functionBody = "with(sc[" + i + "]) { " + functionBody + " } "; + } + return new Function("sc", functionBody); + }, + + domNodeIsContainedBy: function (node, containedByNode) { + if (containedByNode.compareDocumentPosition) + return (containedByNode.compareDocumentPosition(node) & 16) == 16; + while (node != null) { + if (node == containedByNode) + return true; + node = node.parentNode; + } + return false; + }, + + domNodeIsAttachedToDocument: function (node) { + return ko.utils.domNodeIsContainedBy(node, node.ownerDocument); + }, + + tagNameLower: function(element) { + // For HTML elements, tagName will always be upper case; for XHTML elements, it'll be lower case. + // Possible future optimization: If we know it's an element from an XHTML document (not HTML), + // we don't need to do the .toLowerCase() as it will always be lower case anyway. + return element && element.tagName && element.tagName.toLowerCase(); + }, + + registerEventHandler: function (element, eventType, handler) { + var mustUseAttachEvent = ieVersion && eventsThatMustBeRegisteredUsingAttachEvent[eventType]; + if (!mustUseAttachEvent && typeof jQuery != "undefined") { + if (isClickOnCheckableElement(element, eventType)) { + // For click events on checkboxes, jQuery interferes with the event handling in an awkward way: + // it toggles the element checked state *after* the click event handlers run, whereas native + // click events toggle the checked state *before* the event handler. + // Fix this by intecepting the handler and applying the correct checkedness before it runs. + var originalHandler = handler; + handler = function(event, eventData) { + var jQuerySuppliedCheckedState = this.checked; + if (eventData) + this.checked = eventData.checkedStateBeforeEvent !== true; + originalHandler.call(this, event); + this.checked = jQuerySuppliedCheckedState; // Restore the state jQuery applied + }; + } + jQuery(element)['bind'](eventType, handler); + } else if (!mustUseAttachEvent && typeof element.addEventListener == "function") + element.addEventListener(eventType, handler, false); + else if (typeof element.attachEvent != "undefined") + element.attachEvent("on" + eventType, function (event) { + handler.call(element, event); + }); + else + throw new Error("Browser doesn't support addEventListener or attachEvent"); + }, + + triggerEvent: function (element, eventType) { + if (!(element && element.nodeType)) + throw new Error("element must be a DOM node when calling triggerEvent"); + + if (typeof jQuery != "undefined") { + var eventData = []; + if (isClickOnCheckableElement(element, eventType)) { + // Work around the jQuery "click events on checkboxes" issue described above by storing the original checked state before triggering the handler + eventData.push({ checkedStateBeforeEvent: element.checked }); + } + jQuery(element)['trigger'](eventType, eventData); + } else if (typeof document.createEvent == "function") { + if (typeof element.dispatchEvent == "function") { + var eventCategory = knownEventTypesByEventName[eventType] || "HTMLEvents"; + var event = document.createEvent(eventCategory); + event.initEvent(eventType, true, true, window, 0, 0, 0, 0, 0, false, false, false, false, 0, element); + element.dispatchEvent(event); + } + else + throw new Error("The supplied element doesn't support dispatchEvent"); + } else if (typeof element.fireEvent != "undefined") { + // Unlike other browsers, IE doesn't change the checked state of checkboxes/radiobuttons when you trigger their "click" event + // so to make it consistent, we'll do it manually here + if (isClickOnCheckableElement(element, eventType)) + element.checked = element.checked !== true; + element.fireEvent("on" + eventType); + } + else + throw new Error("Browser doesn't support triggering events"); + }, + + unwrapObservable: function (value) { + return ko.isObservable(value) ? value() : value; + }, + + toggleDomNodeCssClass: function (node, className, shouldHaveClass) { + var currentClassNames = (node.className || "").split(/\s+/); + var hasClass = ko.utils.arrayIndexOf(currentClassNames, className) >= 0; + + if (shouldHaveClass && !hasClass) { + node.className += (currentClassNames[0] ? " " : "") + className; + } else if (hasClass && !shouldHaveClass) { + var newClassName = ""; + for (var i = 0; i < currentClassNames.length; i++) + if (currentClassNames[i] != className) + newClassName += currentClassNames[i] + " "; + node.className = ko.utils.stringTrim(newClassName); + } + }, + + setTextContent: function(element, textContent) { + var value = ko.utils.unwrapObservable(textContent); + if ((value === null) || (value === undefined)) + value = ""; + + 'innerText' in element ? element.innerText = value + : element.textContent = value; + + if (ieVersion >= 9) { + // Believe it or not, this actually fixes an IE9 rendering bug + // (See https://github.com/SteveSanderson/knockout/issues/209) + element.style.display = element.style.display; + } + }, + + ensureSelectElementIsRenderedCorrectly: function(selectElement) { + // Workaround for IE9 rendering bug - it doesn't reliably display all the text in dynamically-added select boxes unless you force it to re-render by updating the width. + // (See https://github.com/SteveSanderson/knockout/issues/312, http://stackoverflow.com/questions/5908494/select-only-shows-first-char-of-selected-option) + if (ieVersion >= 9) { + var originalWidth = selectElement.style.width; + selectElement.style.width = 0; + selectElement.style.width = originalWidth; + } + }, + + range: function (min, max) { + min = ko.utils.unwrapObservable(min); + max = ko.utils.unwrapObservable(max); + var result = []; + for (var i = min; i <= max; i++) + result.push(i); + return result; + }, + + makeArray: function(arrayLikeObject) { + var result = []; + for (var i = 0, j = arrayLikeObject.length; i < j; i++) { + result.push(arrayLikeObject[i]); + }; + return result; + }, + + isIe6 : isIe6, + isIe7 : isIe7, + ieVersion : ieVersion, + + getFormFields: function(form, fieldName) { + var fields = ko.utils.makeArray(form.getElementsByTagName("input")).concat(ko.utils.makeArray(form.getElementsByTagName("textarea"))); + var isMatchingField = (typeof fieldName == 'string') + ? function(field) { return field.name === fieldName } + : function(field) { return fieldName.test(field.name) }; // Treat fieldName as regex or object containing predicate + var matches = []; + for (var i = fields.length - 1; i >= 0; i--) { + if (isMatchingField(fields[i])) + matches.push(fields[i]); + }; + return matches; + }, + + parseJson: function (jsonString) { + if (typeof jsonString == "string") { + jsonString = ko.utils.stringTrim(jsonString); + if (jsonString) { + if (window.JSON && window.JSON.parse) // Use native parsing where available + return window.JSON.parse(jsonString); + return (new Function("return " + jsonString))(); // Fallback on less safe parsing for older browsers + } + } + return null; + }, + + stringifyJson: function (data, replacer, space) { // replacer and space are optional + if ((typeof JSON == "undefined") || (typeof JSON.stringify == "undefined")) + throw new Error("Cannot find JSON.stringify(). Some browsers (e.g., IE < 8) don't support it natively, but you can overcome this by adding a script reference to json2.js, downloadable from http://www.json.org/json2.js"); + return JSON.stringify(ko.utils.unwrapObservable(data), replacer, space); + }, + + postJson: function (urlOrForm, data, options) { + options = options || {}; + var params = options['params'] || {}; + var includeFields = options['includeFields'] || this.fieldsIncludedWithJsonPost; + var url = urlOrForm; + + // If we were given a form, use its 'action' URL and pick out any requested field values + if((typeof urlOrForm == 'object') && (ko.utils.tagNameLower(urlOrForm) === "form")) { + var originalForm = urlOrForm; + url = originalForm.action; + for (var i = includeFields.length - 1; i >= 0; i--) { + var fields = ko.utils.getFormFields(originalForm, includeFields[i]); + for (var j = fields.length - 1; j >= 0; j--) + params[fields[j].name] = fields[j].value; + } + } + + data = ko.utils.unwrapObservable(data); + var form = document.createElement("form"); + form.style.display = "none"; + form.action = url; + form.method = "post"; + for (var key in data) { + var input = document.createElement("input"); + input.name = key; + input.value = ko.utils.stringifyJson(ko.utils.unwrapObservable(data[key])); + form.appendChild(input); + } + for (var key in params) { + var input = document.createElement("input"); + input.name = key; + input.value = params[key]; + form.appendChild(input); + } + document.body.appendChild(form); + options['submitter'] ? options['submitter'](form) : form.submit(); + setTimeout(function () { form.parentNode.removeChild(form); }, 0); + } + } +})(); + +ko.exportSymbol('utils', ko.utils); +ko.exportSymbol('utils.arrayForEach', ko.utils.arrayForEach); +ko.exportSymbol('utils.arrayFirst', ko.utils.arrayFirst); +ko.exportSymbol('utils.arrayFilter', ko.utils.arrayFilter); +ko.exportSymbol('utils.arrayGetDistinctValues', ko.utils.arrayGetDistinctValues); +ko.exportSymbol('utils.arrayIndexOf', ko.utils.arrayIndexOf); +ko.exportSymbol('utils.arrayMap', ko.utils.arrayMap); +ko.exportSymbol('utils.arrayPushAll', ko.utils.arrayPushAll); +ko.exportSymbol('utils.arrayRemoveItem', ko.utils.arrayRemoveItem); +ko.exportSymbol('utils.extend', ko.utils.extend); +ko.exportSymbol('utils.fieldsIncludedWithJsonPost', ko.utils.fieldsIncludedWithJsonPost); +ko.exportSymbol('utils.getFormFields', ko.utils.getFormFields); +ko.exportSymbol('utils.postJson', ko.utils.postJson); +ko.exportSymbol('utils.parseJson', ko.utils.parseJson); +ko.exportSymbol('utils.registerEventHandler', ko.utils.registerEventHandler); +ko.exportSymbol('utils.stringifyJson', ko.utils.stringifyJson); +ko.exportSymbol('utils.range', ko.utils.range); +ko.exportSymbol('utils.toggleDomNodeCssClass', ko.utils.toggleDomNodeCssClass); +ko.exportSymbol('utils.triggerEvent', ko.utils.triggerEvent); +ko.exportSymbol('utils.unwrapObservable', ko.utils.unwrapObservable); + +if (!Function.prototype['bind']) { + // Function.prototype.bind is a standard part of ECMAScript 5th Edition (December 2009, http://www.ecma-international.org/publications/files/ECMA-ST/ECMA-262.pdf) + // In case the browser doesn't implement it natively, provide a JavaScript implementation. This implementation is based on the one in prototype.js + Function.prototype['bind'] = function (object) { + var originalFunction = this, args = Array.prototype.slice.call(arguments), object = args.shift(); + return function () { + return originalFunction.apply(object, args.concat(Array.prototype.slice.call(arguments))); + }; + }; +} + +ko.utils.domData = new (function () { + var uniqueId = 0; + var dataStoreKeyExpandoPropertyName = "__ko__" + (new Date).getTime(); + var dataStore = {}; + return { + get: function (node, key) { + var allDataForNode = ko.utils.domData.getAll(node, false); + return allDataForNode === undefined ? undefined : allDataForNode[key]; + }, + set: function (node, key, value) { + if (value === undefined) { + // Make sure we don't actually create a new domData key if we are actually deleting a value + if (ko.utils.domData.getAll(node, false) === undefined) + return; + } + var allDataForNode = ko.utils.domData.getAll(node, true); + allDataForNode[key] = value; + }, + getAll: function (node, createIfNotFound) { + var dataStoreKey = node[dataStoreKeyExpandoPropertyName]; + var hasExistingDataStore = dataStoreKey && (dataStoreKey !== "null"); + if (!hasExistingDataStore) { + if (!createIfNotFound) + return undefined; + dataStoreKey = node[dataStoreKeyExpandoPropertyName] = "ko" + uniqueId++; + dataStore[dataStoreKey] = {}; + } + return dataStore[dataStoreKey]; + }, + clear: function (node) { + var dataStoreKey = node[dataStoreKeyExpandoPropertyName]; + if (dataStoreKey) { + delete dataStore[dataStoreKey]; + node[dataStoreKeyExpandoPropertyName] = null; + } + } + } +})(); + +ko.exportSymbol('utils.domData', ko.utils.domData); +ko.exportSymbol('utils.domData.clear', ko.utils.domData.clear); // Exporting only so specs can clear up after themselves fully + +ko.utils.domNodeDisposal = new (function () { + var domDataKey = "__ko_domNodeDisposal__" + (new Date).getTime(); + var cleanableNodeTypes = { 1: true, 8: true, 9: true }; // Element, Comment, Document + var cleanableNodeTypesWithDescendants = { 1: true, 9: true }; // Element, Document + + function getDisposeCallbacksCollection(node, createIfNotFound) { + var allDisposeCallbacks = ko.utils.domData.get(node, domDataKey); + if ((allDisposeCallbacks === undefined) && createIfNotFound) { + allDisposeCallbacks = []; + ko.utils.domData.set(node, domDataKey, allDisposeCallbacks); + } + return allDisposeCallbacks; + } + function destroyCallbacksCollection(node) { + ko.utils.domData.set(node, domDataKey, undefined); + } + + function cleanSingleNode(node) { + // Run all the dispose callbacks + var callbacks = getDisposeCallbacksCollection(node, false); + if (callbacks) { + callbacks = callbacks.slice(0); // Clone, as the array may be modified during iteration (typically, callbacks will remove themselves) + for (var i = 0; i < callbacks.length; i++) + callbacks[i](node); + } + + // Also erase the DOM data + ko.utils.domData.clear(node); + + // Special support for jQuery here because it's so commonly used. + // Many jQuery plugins (including jquery.tmpl) store data using jQuery's equivalent of domData + // so notify it to tear down any resources associated with the node & descendants here. + if ((typeof jQuery == "function") && (typeof jQuery['cleanData'] == "function")) + jQuery['cleanData']([node]); + + // Also clear any immediate-child comment nodes, as these wouldn't have been found by + // node.getElementsByTagName("*") in cleanNode() (comment nodes aren't elements) + if (cleanableNodeTypesWithDescendants[node.nodeType]) + cleanImmediateCommentTypeChildren(node); + } + + function cleanImmediateCommentTypeChildren(nodeWithChildren) { + var child, nextChild = nodeWithChildren.firstChild; + while (child = nextChild) { + nextChild = child.nextSibling; + if (child.nodeType === 8) + cleanSingleNode(child); + } + } + + return { + addDisposeCallback : function(node, callback) { + if (typeof callback != "function") + throw new Error("Callback must be a function"); + getDisposeCallbacksCollection(node, true).push(callback); + }, + + removeDisposeCallback : function(node, callback) { + var callbacksCollection = getDisposeCallbacksCollection(node, false); + if (callbacksCollection) { + ko.utils.arrayRemoveItem(callbacksCollection, callback); + if (callbacksCollection.length == 0) + destroyCallbacksCollection(node); + } + }, + + cleanNode : function(node) { + // First clean this node, where applicable + if (cleanableNodeTypes[node.nodeType]) { + cleanSingleNode(node); + + // ... then its descendants, where applicable + if (cleanableNodeTypesWithDescendants[node.nodeType]) { + // Clone the descendants list in case it changes during iteration + var descendants = []; + ko.utils.arrayPushAll(descendants, node.getElementsByTagName("*")); + for (var i = 0, j = descendants.length; i < j; i++) + cleanSingleNode(descendants[i]); + } + } + }, + + removeNode : function(node) { + ko.cleanNode(node); + if (node.parentNode) + node.parentNode.removeChild(node); + } + } +})(); +ko.cleanNode = ko.utils.domNodeDisposal.cleanNode; // Shorthand name for convenience +ko.removeNode = ko.utils.domNodeDisposal.removeNode; // Shorthand name for convenience +ko.exportSymbol('cleanNode', ko.cleanNode); +ko.exportSymbol('removeNode', ko.removeNode); +ko.exportSymbol('utils.domNodeDisposal', ko.utils.domNodeDisposal); +ko.exportSymbol('utils.domNodeDisposal.addDisposeCallback', ko.utils.domNodeDisposal.addDisposeCallback); +ko.exportSymbol('utils.domNodeDisposal.removeDisposeCallback', ko.utils.domNodeDisposal.removeDisposeCallback); +(function () { + var leadingCommentRegex = /^(\s*)<!--(.*?)-->/; + + function simpleHtmlParse(html) { + // Based on jQuery's "clean" function, but only accounting for table-related elements. + // If you have referenced jQuery, this won't be used anyway - KO will use jQuery's "clean" function directly + + // Note that there's still an issue in IE < 9 whereby it will discard comment nodes that are the first child of + // a descendant node. For example: "<div><!-- mycomment -->abc</div>" will get parsed as "<div>abc</div>" + // This won't affect anyone who has referenced jQuery, and there's always the workaround of inserting a dummy node + // (possibly a text node) in front of the comment. So, KO does not attempt to workaround this IE issue automatically at present. + + // Trim whitespace, otherwise indexOf won't work as expected + var tags = ko.utils.stringTrim(html).toLowerCase(), div = document.createElement("div"); + + // Finds the first match from the left column, and returns the corresponding "wrap" data from the right column + var wrap = tags.match(/^<(thead|tbody|tfoot)/) && [1, "<table>", "</table>"] || + !tags.indexOf("<tr") && [2, "<table><tbody>", "</tbody></table>"] || + (!tags.indexOf("<td") || !tags.indexOf("<th")) && [3, "<table><tbody><tr>", "</tr></tbody></table>"] || + /* anything else */ [0, "", ""]; + + // Go to html and back, then peel off extra wrappers + // Note that we always prefix with some dummy text, because otherwise, IE<9 will strip out leading comment nodes in descendants. Total madness. + var markup = "ignored<div>" + wrap[1] + html + wrap[2] + "</div>"; + if (typeof window['innerShiv'] == "function") { + div.appendChild(window['innerShiv'](markup)); + } else { + div.innerHTML = markup; + } + + // Move to the right depth + while (wrap[0]--) + div = div.lastChild; + + return ko.utils.makeArray(div.lastChild.childNodes); + } + + function jQueryHtmlParse(html) { + var elems = jQuery['clean']([html]); + + // As of jQuery 1.7.1, jQuery parses the HTML by appending it to some dummy parent nodes held in an in-memory document fragment. + // Unfortunately, it never clears the dummy parent nodes from the document fragment, so it leaks memory over time. + // Fix this by finding the top-most dummy parent element, and detaching it from its owner fragment. + if (elems && elems[0]) { + // Find the top-most parent element that's a direct child of a document fragment + var elem = elems[0]; + while (elem.parentNode && elem.parentNode.nodeType !== 11 /* i.e., DocumentFragment */) + elem = elem.parentNode; + // ... then detach it + if (elem.parentNode) + elem.parentNode.removeChild(elem); + } + + return elems; + } + + ko.utils.parseHtmlFragment = function(html) { + return typeof jQuery != 'undefined' ? jQueryHtmlParse(html) // As below, benefit from jQuery's optimisations where possible + : simpleHtmlParse(html); // ... otherwise, this simple logic will do in most common cases. + }; + + ko.utils.setHtml = function(node, html) { + ko.utils.emptyDomNode(node); + + if ((html !== null) && (html !== undefined)) { + if (typeof html != 'string') + html = html.toString(); + + // jQuery contains a lot of sophisticated code to parse arbitrary HTML fragments, + // for example <tr> elements which are not normally allowed to exist on their own. + // If you've referenced jQuery we'll use that rather than duplicating its code. + if (typeof jQuery != 'undefined') { + jQuery(node)['html'](html); + } else { + // ... otherwise, use KO's own parsing logic. + var parsedNodes = ko.utils.parseHtmlFragment(html); + for (var i = 0; i < parsedNodes.length; i++) + node.appendChild(parsedNodes[i]); + } + } + }; +})(); + +ko.exportSymbol('utils.parseHtmlFragment', ko.utils.parseHtmlFragment); +ko.exportSymbol('utils.setHtml', ko.utils.setHtml); + +ko.memoization = (function () { + var memos = {}; + + function randomMax8HexChars() { + return (((1 + Math.random()) * 0x100000000) | 0).toString(16).substring(1); + } + function generateRandomId() { + return randomMax8HexChars() + randomMax8HexChars(); + } + function findMemoNodes(rootNode, appendToArray) { + if (!rootNode) + return; + if (rootNode.nodeType == 8) { + var memoId = ko.memoization.parseMemoText(rootNode.nodeValue); + if (memoId != null) + appendToArray.push({ domNode: rootNode, memoId: memoId }); + } else if (rootNode.nodeType == 1) { + for (var i = 0, childNodes = rootNode.childNodes, j = childNodes.length; i < j; i++) + findMemoNodes(childNodes[i], appendToArray); + } + } + + return { + memoize: function (callback) { + if (typeof callback != "function") + throw new Error("You can only pass a function to ko.memoization.memoize()"); + var memoId = generateRandomId(); + memos[memoId] = callback; + return "<!--[ko_memo:" + memoId + "]-->"; + }, + + unmemoize: function (memoId, callbackParams) { + var callback = memos[memoId]; + if (callback === undefined) + throw new Error("Couldn't find any memo with ID " + memoId + ". Perhaps it's already been unmemoized."); + try { + callback.apply(null, callbackParams || []); + return true; + } + finally { delete memos[memoId]; } + }, + + unmemoizeDomNodeAndDescendants: function (domNode, extraCallbackParamsArray) { + var memos = []; + findMemoNodes(domNode, memos); + for (var i = 0, j = memos.length; i < j; i++) { + var node = memos[i].domNode; + var combinedParams = [node]; + if (extraCallbackParamsArray) + ko.utils.arrayPushAll(combinedParams, extraCallbackParamsArray); + ko.memoization.unmemoize(memos[i].memoId, combinedParams); + node.nodeValue = ""; // Neuter this node so we don't try to unmemoize it again + if (node.parentNode) + node.parentNode.removeChild(node); // If possible, erase it totally (not always possible - someone else might just hold a reference to it then call unmemoizeDomNodeAndDescendants again) + } + }, + + parseMemoText: function (memoText) { + var match = memoText.match(/^\[ko_memo\:(.*?)\]$/); + return match ? match[1] : null; + } + }; +})(); + +ko.exportSymbol('memoization', ko.memoization); +ko.exportSymbol('memoization.memoize', ko.memoization.memoize); +ko.exportSymbol('memoization.unmemoize', ko.memoization.unmemoize); +ko.exportSymbol('memoization.parseMemoText', ko.memoization.parseMemoText); +ko.exportSymbol('memoization.unmemoizeDomNodeAndDescendants', ko.memoization.unmemoizeDomNodeAndDescendants); +ko.extenders = { + 'throttle': function(target, timeout) { + // Throttling means two things: + + // (1) For dependent observables, we throttle *evaluations* so that, no matter how fast its dependencies + // notify updates, the target doesn't re-evaluate (and hence doesn't notify) faster than a certain rate + target['throttleEvaluation'] = timeout; + + // (2) For writable targets (observables, or writable dependent observables), we throttle *writes* + // so the target cannot change value synchronously or faster than a certain rate + var writeTimeoutInstance = null; + return ko.dependentObservable({ + 'read': target, + 'write': function(value) { + clearTimeout(writeTimeoutInstance); + writeTimeoutInstance = setTimeout(function() { + target(value); + }, timeout); + } + }); + }, + + 'notify': function(target, notifyWhen) { + target["equalityComparer"] = notifyWhen == "always" + ? function() { return false } // Treat all values as not equal + : ko.observable["fn"]["equalityComparer"]; + return target; + } +}; + +function applyExtenders(requestedExtenders) { + var target = this; + if (requestedExtenders) { + for (var key in requestedExtenders) { + var extenderHandler = ko.extenders[key]; + if (typeof extenderHandler == 'function') { + target = extenderHandler(target, requestedExtenders[key]); + } + } + } + return target; +} + +ko.exportSymbol('extenders', ko.extenders); + +ko.subscription = function (target, callback, disposeCallback) { + this.target = target; + this.callback = callback; + this.disposeCallback = disposeCallback; + ko.exportProperty(this, 'dispose', this.dispose); +}; +ko.subscription.prototype.dispose = function () { + this.isDisposed = true; + this.disposeCallback(); +}; + +ko.subscribable = function () { + this._subscriptions = {}; + + ko.utils.extend(this, ko.subscribable['fn']); + ko.exportProperty(this, 'subscribe', this.subscribe); + ko.exportProperty(this, 'extend', this.extend); + ko.exportProperty(this, 'getSubscriptionsCount', this.getSubscriptionsCount); +} + +var defaultEvent = "change"; + +ko.subscribable['fn'] = { + subscribe: function (callback, callbackTarget, event) { + event = event || defaultEvent; + var boundCallback = callbackTarget ? callback.bind(callbackTarget) : callback; + + var subscription = new ko.subscription(this, boundCallback, function () { + ko.utils.arrayRemoveItem(this._subscriptions[event], subscription); + }.bind(this)); + + if (!this._subscriptions[event]) + this._subscriptions[event] = []; + this._subscriptions[event].push(subscription); + return subscription; + }, + + "notifySubscribers": function (valueToNotify, event) { + event = event || defaultEvent; + if (this._subscriptions[event]) { + ko.utils.arrayForEach(this._subscriptions[event].slice(0), function (subscription) { + // In case a subscription was disposed during the arrayForEach cycle, check + // for isDisposed on each subscription before invoking its callback + if (subscription && (subscription.isDisposed !== true)) + subscription.callback(valueToNotify); + }); + } + }, + + getSubscriptionsCount: function () { + var total = 0; + for (var eventName in this._subscriptions) { + if (this._subscriptions.hasOwnProperty(eventName)) + total += this._subscriptions[eventName].length; + } + return total; + }, + + extend: applyExtenders +}; + + +ko.isSubscribable = function (instance) { + return typeof instance.subscribe == "function" && typeof instance["notifySubscribers"] == "function"; +}; + +ko.exportSymbol('subscribable', ko.subscribable); +ko.exportSymbol('isSubscribable', ko.isSubscribable); + +ko.dependencyDetection = (function () { + var _frames = []; + + return { + begin: function (callback) { + _frames.push({ callback: callback, distinctDependencies:[] }); + }, + + end: function () { + _frames.pop(); + }, + + registerDependency: function (subscribable) { + if (!ko.isSubscribable(subscribable)) + throw new Error("Only subscribable things can act as dependencies"); + if (_frames.length > 0) { + var topFrame = _frames[_frames.length - 1]; + if (ko.utils.arrayIndexOf(topFrame.distinctDependencies, subscribable) >= 0) + return; + topFrame.distinctDependencies.push(subscribable); + topFrame.callback(subscribable); + } + } + }; +})(); +var primitiveTypes = { 'undefined':true, 'boolean':true, 'number':true, 'string':true }; + +ko.observable = function (initialValue) { + var _latestValue = initialValue; + + function observable() { + if (arguments.length > 0) { + // Write + + // Ignore writes if the value hasn't changed + if ((!observable['equalityComparer']) || !observable['equalityComparer'](_latestValue, arguments[0])) { + observable.valueWillMutate(); + _latestValue = arguments[0]; + if (DEBUG) observable._latestValue = _latestValue; + observable.valueHasMutated(); + } + return this; // Permits chained assignments + } + else { + // Read + ko.dependencyDetection.registerDependency(observable); // The caller only needs to be notified of changes if they did a "read" operation + return _latestValue; + } + } + if (DEBUG) observable._latestValue = _latestValue; + ko.subscribable.call(observable); + observable.valueHasMutated = function () { observable["notifySubscribers"](_latestValue); } + observable.valueWillMutate = function () { observable["notifySubscribers"](_latestValue, "beforeChange"); } + ko.utils.extend(observable, ko.observable['fn']); + + ko.exportProperty(observable, "valueHasMutated", observable.valueHasMutated); + ko.exportProperty(observable, "valueWillMutate", observable.valueWillMutate); + + return observable; +} + +ko.observable['fn'] = { + "equalityComparer": function valuesArePrimitiveAndEqual(a, b) { + var oldValueIsPrimitive = (a === null) || (typeof(a) in primitiveTypes); + return oldValueIsPrimitive ? (a === b) : false; + } +}; + +var protoProperty = ko.observable.protoProperty = "__ko_proto__"; +ko.observable['fn'][protoProperty] = ko.observable; + +ko.hasPrototype = function(instance, prototype) { + if ((instance === null) || (instance === undefined) || (instance[protoProperty] === undefined)) return false; + if (instance[protoProperty] === prototype) return true; + return ko.hasPrototype(instance[protoProperty], prototype); // Walk the prototype chain +}; + +ko.isObservable = function (instance) { + return ko.hasPrototype(instance, ko.observable); +} +ko.isWriteableObservable = function (instance) { + // Observable + if ((typeof instance == "function") && instance[protoProperty] === ko.observable) + return true; + // Writeable dependent observable + if ((typeof instance == "function") && (instance[protoProperty] === ko.dependentObservable) && (instance.hasWriteFunction)) + return true; + // Anything else + return false; +} + + +ko.exportSymbol('observable', ko.observable); +ko.exportSymbol('isObservable', ko.isObservable); +ko.exportSymbol('isWriteableObservable', ko.isWriteableObservable); +ko.observableArray = function (initialValues) { + if (arguments.length == 0) { + // Zero-parameter constructor initializes to empty array + initialValues = []; + } + if ((initialValues !== null) && (initialValues !== undefined) && !('length' in initialValues)) + throw new Error("The argument passed when initializing an observable array must be an array, or null, or undefined."); + + var result = ko.observable(initialValues); + ko.utils.extend(result, ko.observableArray['fn']); + return result; +} + +ko.observableArray['fn'] = { + 'remove': function (valueOrPredicate) { + var underlyingArray = this(); + var removedValues = []; + var predicate = typeof valueOrPredicate == "function" ? valueOrPredicate : function (value) { return value === valueOrPredicate; }; + for (var i = 0; i < underlyingArray.length; i++) { + var value = underlyingArray[i]; + if (predicate(value)) { + if (removedValues.length === 0) { + this.valueWillMutate(); + } + removedValues.push(value); + underlyingArray.splice(i, 1); + i--; + } + } + if (removedValues.length) { + this.valueHasMutated(); + } + return removedValues; + }, + + 'removeAll': function (arrayOfValues) { + // If you passed zero args, we remove everything + if (arrayOfValues === undefined) { + var underlyingArray = this(); + var allValues = underlyingArray.slice(0); + this.valueWillMutate(); + underlyingArray.splice(0, underlyingArray.length); + this.valueHasMutated(); + return allValues; + } + // If you passed an arg, we interpret it as an array of entries to remove + if (!arrayOfValues) + return []; + return this['remove'](function (value) { + return ko.utils.arrayIndexOf(arrayOfValues, value) >= 0; + }); + }, + + 'destroy': function (valueOrPredicate) { + var underlyingArray = this(); + var predicate = typeof valueOrPredicate == "function" ? valueOrPredicate : function (value) { return value === valueOrPredicate; }; + this.valueWillMutate(); + for (var i = underlyingArray.length - 1; i >= 0; i--) { + var value = underlyingArray[i]; + if (predicate(value)) + underlyingArray[i]["_destroy"] = true; + } + this.valueHasMutated(); + }, + + 'destroyAll': function (arrayOfValues) { + // If you passed zero args, we destroy everything + if (arrayOfValues === undefined) + return this['destroy'](function() { return true }); + + // If you passed an arg, we interpret it as an array of entries to destroy + if (!arrayOfValues) + return []; + return this['destroy'](function (value) { + return ko.utils.arrayIndexOf(arrayOfValues, value) >= 0; + }); + }, + + 'indexOf': function (item) { + var underlyingArray = this(); + return ko.utils.arrayIndexOf(underlyingArray, item); + }, + + 'replace': function(oldItem, newItem) { + var index = this['indexOf'](oldItem); + if (index >= 0) { + this.valueWillMutate(); + this()[index] = newItem; + this.valueHasMutated(); + } + } +} + +// Populate ko.observableArray.fn with read/write functions from native arrays +ko.utils.arrayForEach(["pop", "push", "reverse", "shift", "sort", "splice", "unshift"], function (methodName) { + ko.observableArray['fn'][methodName] = function () { + var underlyingArray = this(); + this.valueWillMutate(); + var methodCallResult = underlyingArray[methodName].apply(underlyingArray, arguments); + this.valueHasMutated(); + return methodCallResult; + }; +}); + +// Populate ko.observableArray.fn with read-only functions from native arrays +ko.utils.arrayForEach(["slice"], function (methodName) { + ko.observableArray['fn'][methodName] = function () { + var underlyingArray = this(); + return underlyingArray[methodName].apply(underlyingArray, arguments); + }; +}); + +ko.exportSymbol('observableArray', ko.observableArray); +ko.dependentObservable = function (evaluatorFunctionOrOptions, evaluatorFunctionTarget, options) { + var _latestValue, + _hasBeenEvaluated = false, + _isBeingEvaluated = false, + readFunction = evaluatorFunctionOrOptions; + + if (readFunction && typeof readFunction == "object") { + // Single-parameter syntax - everything is on this "options" param + options = readFunction; + readFunction = options["read"]; + } else { + // Multi-parameter syntax - construct the options according to the params passed + options = options || {}; + if (!readFunction) + readFunction = options["read"]; + } + // By here, "options" is always non-null + if (typeof readFunction != "function") + throw new Error("Pass a function that returns the value of the ko.computed"); + + var writeFunction = options["write"]; + if (!evaluatorFunctionTarget) + evaluatorFunctionTarget = options["owner"]; + + var _subscriptionsToDependencies = []; + function disposeAllSubscriptionsToDependencies() { + ko.utils.arrayForEach(_subscriptionsToDependencies, function (subscription) { + subscription.dispose(); + }); + _subscriptionsToDependencies = []; + } + var dispose = disposeAllSubscriptionsToDependencies; + + // Build "disposeWhenNodeIsRemoved" and "disposeWhenNodeIsRemovedCallback" option values + // (Note: "disposeWhenNodeIsRemoved" option both proactively disposes as soon as the node is removed using ko.removeNode(), + // plus adds a "disposeWhen" callback that, on each evaluation, disposes if the node was removed by some other means.) + var disposeWhenNodeIsRemoved = (typeof options["disposeWhenNodeIsRemoved"] == "object") ? options["disposeWhenNodeIsRemoved"] : null; + var disposeWhen = options["disposeWhen"] || function() { return false; }; + if (disposeWhenNodeIsRemoved) { + dispose = function() { + ko.utils.domNodeDisposal.removeDisposeCallback(disposeWhenNodeIsRemoved, arguments.callee); + disposeAllSubscriptionsToDependencies(); + }; + ko.utils.domNodeDisposal.addDisposeCallback(disposeWhenNodeIsRemoved, dispose); + var existingDisposeWhenFunction = disposeWhen; + disposeWhen = function () { + return !ko.utils.domNodeIsAttachedToDocument(disposeWhenNodeIsRemoved) || existingDisposeWhenFunction(); + } + } + + var evaluationTimeoutInstance = null; + function evaluatePossiblyAsync() { + var throttleEvaluationTimeout = dependentObservable['throttleEvaluation']; + if (throttleEvaluationTimeout && throttleEvaluationTimeout >= 0) { + clearTimeout(evaluationTimeoutInstance); + evaluationTimeoutInstance = setTimeout(evaluateImmediate, throttleEvaluationTimeout); + } else + evaluateImmediate(); + } + + function evaluateImmediate() { + if (_isBeingEvaluated) { + // If the evaluation of a ko.computed causes side effects, it's possible that it will trigger its own re-evaluation. + // This is not desirable (it's hard for a developer to realise a chain of dependencies might cause this, and they almost + // certainly didn't intend infinite re-evaluations). So, for predictability, we simply prevent ko.computeds from causing + // their own re-evaluation. Further discussion at https://github.com/SteveSanderson/knockout/pull/387 + return; + } + + // Don't dispose on first evaluation, because the "disposeWhen" callback might + // e.g., dispose when the associated DOM element isn't in the doc, and it's not + // going to be in the doc until *after* the first evaluation + if (_hasBeenEvaluated && disposeWhen()) { + dispose(); + return; + } + + _isBeingEvaluated = true; + try { + // Initially, we assume that none of the subscriptions are still being used (i.e., all are candidates for disposal). + // Then, during evaluation, we cross off any that are in fact still being used. + var disposalCandidates = ko.utils.arrayMap(_subscriptionsToDependencies, function(item) {return item.target;}); + + ko.dependencyDetection.begin(function(subscribable) { + var inOld; + if ((inOld = ko.utils.arrayIndexOf(disposalCandidates, subscribable)) >= 0) + disposalCandidates[inOld] = undefined; // Don't want to dispose this subscription, as it's still being used + else + _subscriptionsToDependencies.push(subscribable.subscribe(evaluatePossiblyAsync)); // Brand new subscription - add it + }); + + var newValue = readFunction.call(evaluatorFunctionTarget); + + // For each subscription no longer being used, remove it from the active subscriptions list and dispose it + for (var i = disposalCandidates.length - 1; i >= 0; i--) { + if (disposalCandidates[i]) + _subscriptionsToDependencies.splice(i, 1)[0].dispose(); + } + _hasBeenEvaluated = true; + + dependentObservable["notifySubscribers"](_latestValue, "beforeChange"); + _latestValue = newValue; + if (DEBUG) dependentObservable._latestValue = _latestValue; + } finally { + ko.dependencyDetection.end(); + } + + dependentObservable["notifySubscribers"](_latestValue); + _isBeingEvaluated = false; + + } + + function dependentObservable() { + if (arguments.length > 0) { + set.apply(dependentObservable, arguments); + } else { + return get(); + } + } + + function set() { + if (typeof writeFunction === "function") { + // Writing a value + writeFunction.apply(evaluatorFunctionTarget, arguments); + } else { + throw new Error("Cannot write a value to a ko.computed unless you specify a 'write' option. If you wish to read the current value, don't pass any parameters."); + } + } + + function get() { + // Reading the value + if (!_hasBeenEvaluated) + evaluateImmediate(); + ko.dependencyDetection.registerDependency(dependentObservable); + return _latestValue; + } + + dependentObservable.getDependenciesCount = function () { return _subscriptionsToDependencies.length; }; + dependentObservable.hasWriteFunction = typeof options["write"] === "function"; + dependentObservable.dispose = function () { dispose(); }; + + ko.subscribable.call(dependentObservable); + ko.utils.extend(dependentObservable, ko.dependentObservable['fn']); + + if (options['deferEvaluation'] !== true) + evaluateImmediate(); + + ko.exportProperty(dependentObservable, 'dispose', dependentObservable.dispose); + ko.exportProperty(dependentObservable, 'getDependenciesCount', dependentObservable.getDependenciesCount); + + return dependentObservable; +}; + +ko.isComputed = function(instance) { + return ko.hasPrototype(instance, ko.dependentObservable); +}; + +var protoProp = ko.observable.protoProperty; // == "__ko_proto__" +ko.dependentObservable[protoProp] = ko.observable; + +ko.dependentObservable['fn'] = {}; +ko.dependentObservable['fn'][protoProp] = ko.dependentObservable; + +ko.exportSymbol('dependentObservable', ko.dependentObservable); +ko.exportSymbol('computed', ko.dependentObservable); // Make "ko.computed" an alias for "ko.dependentObservable" +ko.exportSymbol('isComputed', ko.isComputed); + +(function() { + var maxNestedObservableDepth = 10; // Escape the (unlikely) pathalogical case where an observable's current value is itself (or similar reference cycle) + + ko.toJS = function(rootObject) { + if (arguments.length == 0) + throw new Error("When calling ko.toJS, pass the object you want to convert."); + + // We just unwrap everything at every level in the object graph + return mapJsObjectGraph(rootObject, function(valueToMap) { + // Loop because an observable's value might in turn be another observable wrapper + for (var i = 0; ko.isObservable(valueToMap) && (i < maxNestedObservableDepth); i++) + valueToMap = valueToMap(); + return valueToMap; + }); + }; + + ko.toJSON = function(rootObject, replacer, space) { // replacer and space are optional + var plainJavaScriptObject = ko.toJS(rootObject); + return ko.utils.stringifyJson(plainJavaScriptObject, replacer, space); + }; + + function mapJsObjectGraph(rootObject, mapInputCallback, visitedObjects) { + visitedObjects = visitedObjects || new objectLookup(); + + rootObject = mapInputCallback(rootObject); + var canHaveProperties = (typeof rootObject == "object") && (rootObject !== null) && (rootObject !== undefined) && (!(rootObject instanceof Date)); + if (!canHaveProperties) + return rootObject; + + var outputProperties = rootObject instanceof Array ? [] : {}; + visitedObjects.save(rootObject, outputProperties); + + visitPropertiesOrArrayEntries(rootObject, function(indexer) { + var propertyValue = mapInputCallback(rootObject[indexer]); + + switch (typeof propertyValue) { + case "boolean": + case "number": + case "string": + case "function": + outputProperties[indexer] = propertyValue; + break; + case "object": + case "undefined": + var previouslyMappedValue = visitedObjects.get(propertyValue); + outputProperties[indexer] = (previouslyMappedValue !== undefined) + ? previouslyMappedValue + : mapJsObjectGraph(propertyValue, mapInputCallback, visitedObjects); + break; + } + }); + + return outputProperties; + } + + function visitPropertiesOrArrayEntries(rootObject, visitorCallback) { + if (rootObject instanceof Array) { + for (var i = 0; i < rootObject.length; i++) + visitorCallback(i); + + // For arrays, also respect toJSON property for custom mappings (fixes #278) + if (typeof rootObject['toJSON'] == 'function') + visitorCallback('toJSON'); + } else { + for (var propertyName in rootObject) + visitorCallback(propertyName); + } + }; + + function objectLookup() { + var keys = []; + var values = []; + this.save = function(key, value) { + var existingIndex = ko.utils.arrayIndexOf(keys, key); + if (existingIndex >= 0) + values[existingIndex] = value; + else { + keys.push(key); + values.push(value); + } + }; + this.get = function(key) { + var existingIndex = ko.utils.arrayIndexOf(keys, key); + return (existingIndex >= 0) ? values[existingIndex] : undefined; + }; + }; +})(); + +ko.exportSymbol('toJS', ko.toJS); +ko.exportSymbol('toJSON', ko.toJSON); +(function () { + var hasDomDataExpandoProperty = '__ko__hasDomDataOptionValue__'; + + // Normally, SELECT elements and their OPTIONs can only take value of type 'string' (because the values + // are stored on DOM attributes). ko.selectExtensions provides a way for SELECTs/OPTIONs to have values + // that are arbitrary objects. This is very convenient when implementing things like cascading dropdowns. + ko.selectExtensions = { + readValue : function(element) { + switch (ko.utils.tagNameLower(element)) { + case 'option': + if (element[hasDomDataExpandoProperty] === true) + return ko.utils.domData.get(element, ko.bindingHandlers.options.optionValueDomDataKey); + return element.getAttribute("value"); + case 'select': + return element.selectedIndex >= 0 ? ko.selectExtensions.readValue(element.options[element.selectedIndex]) : undefined; + default: + return element.value; + } + }, + + writeValue: function(element, value) { + switch (ko.utils.tagNameLower(element)) { + case 'option': + switch(typeof value) { + case "string": + ko.utils.domData.set(element, ko.bindingHandlers.options.optionValueDomDataKey, undefined); + if (hasDomDataExpandoProperty in element) { // IE <= 8 throws errors if you delete non-existent properties from a DOM node + delete element[hasDomDataExpandoProperty]; + } + element.value = value; + break; + default: + // Store arbitrary object using DomData + ko.utils.domData.set(element, ko.bindingHandlers.options.optionValueDomDataKey, value); + element[hasDomDataExpandoProperty] = true; + + // Special treatment of numbers is just for backward compatibility. KO 1.2.1 wrote numerical values to element.value. + element.value = typeof value === "number" ? value : ""; + break; + } + break; + case 'select': + for (var i = element.options.length - 1; i >= 0; i--) { + if (ko.selectExtensions.readValue(element.options[i]) == value) { + element.selectedIndex = i; + break; + } + } + break; + default: + if ((value === null) || (value === undefined)) + value = ""; + element.value = value; + break; + } + } + }; +})(); + +ko.exportSymbol('selectExtensions', ko.selectExtensions); +ko.exportSymbol('selectExtensions.readValue', ko.selectExtensions.readValue); +ko.exportSymbol('selectExtensions.writeValue', ko.selectExtensions.writeValue); + +ko.jsonExpressionRewriting = (function () { + var restoreCapturedTokensRegex = /\@ko_token_(\d+)\@/g; + var javaScriptAssignmentTarget = /^[\_$a-z][\_$a-z0-9]*(\[.*?\])*(\.[\_$a-z][\_$a-z0-9]*(\[.*?\])*)*$/i; + var javaScriptReservedWords = ["true", "false"]; + + function restoreTokens(string, tokens) { + var prevValue = null; + while (string != prevValue) { // Keep restoring tokens until it no longer makes a difference (they may be nested) + prevValue = string; + string = string.replace(restoreCapturedTokensRegex, function (match, tokenIndex) { + return tokens[tokenIndex]; + }); + } + return string; + } + + function isWriteableValue(expression) { + if (ko.utils.arrayIndexOf(javaScriptReservedWords, ko.utils.stringTrim(expression).toLowerCase()) >= 0) + return false; + return expression.match(javaScriptAssignmentTarget) !== null; + } + + function ensureQuoted(key) { + var trimmedKey = ko.utils.stringTrim(key); + switch (trimmedKey.length && trimmedKey.charAt(0)) { + case "'": + case '"': + return key; + default: + return "'" + trimmedKey + "'"; + } + } + + return { + bindingRewriteValidators: [], + + parseObjectLiteral: function(objectLiteralString) { + // A full tokeniser+lexer would add too much weight to this library, so here's a simple parser + // that is sufficient just to split an object literal string into a set of top-level key-value pairs + + var str = ko.utils.stringTrim(objectLiteralString); + if (str.length < 3) + return []; + if (str.charAt(0) === "{")// Ignore any braces surrounding the whole object literal + str = str.substring(1, str.length - 1); + + // Pull out any string literals and regex literals + var tokens = []; + var tokenStart = null, tokenEndChar; + for (var position = 0; position < str.length; position++) { + var c = str.charAt(position); + if (tokenStart === null) { + switch (c) { + case '"': + case "'": + case "/": + tokenStart = position; + tokenEndChar = c; + break; + } + } else if ((c == tokenEndChar) && (str.charAt(position - 1) !== "\\")) { + var token = str.substring(tokenStart, position + 1); + tokens.push(token); + var replacement = "@ko_token_" + (tokens.length - 1) + "@"; + str = str.substring(0, tokenStart) + replacement + str.substring(position + 1); + position -= (token.length - replacement.length); + tokenStart = null; + } + } + + // Next pull out balanced paren, brace, and bracket blocks + tokenStart = null; + tokenEndChar = null; + var tokenDepth = 0, tokenStartChar = null; + for (var position = 0; position < str.length; position++) { + var c = str.charAt(position); + if (tokenStart === null) { + switch (c) { + case "{": tokenStart = position; tokenStartChar = c; + tokenEndChar = "}"; + break; + case "(": tokenStart = position; tokenStartChar = c; + tokenEndChar = ")"; + break; + case "[": tokenStart = position; tokenStartChar = c; + tokenEndChar = "]"; + break; + } + } + + if (c === tokenStartChar) + tokenDepth++; + else if (c === tokenEndChar) { + tokenDepth--; + if (tokenDepth === 0) { + var token = str.substring(tokenStart, position + 1); + tokens.push(token); + var replacement = "@ko_token_" + (tokens.length - 1) + "@"; + str = str.substring(0, tokenStart) + replacement + str.substring(position + 1); + position -= (token.length - replacement.length); + tokenStart = null; + } + } + } + + // Now we can safely split on commas to get the key/value pairs + var result = []; + var keyValuePairs = str.split(","); + for (var i = 0, j = keyValuePairs.length; i < j; i++) { + var pair = keyValuePairs[i]; + var colonPos = pair.indexOf(":"); + if ((colonPos > 0) && (colonPos < pair.length - 1)) { + var key = pair.substring(0, colonPos); + var value = pair.substring(colonPos + 1); + result.push({ 'key': restoreTokens(key, tokens), 'value': restoreTokens(value, tokens) }); + } else { + result.push({ 'unknown': restoreTokens(pair, tokens) }); + } + } + return result; + }, + + insertPropertyAccessorsIntoJson: function (objectLiteralStringOrKeyValueArray) { + var keyValueArray = typeof objectLiteralStringOrKeyValueArray === "string" + ? ko.jsonExpressionRewriting.parseObjectLiteral(objectLiteralStringOrKeyValueArray) + : objectLiteralStringOrKeyValueArray; + var resultStrings = [], propertyAccessorResultStrings = []; + + var keyValueEntry; + for (var i = 0; keyValueEntry = keyValueArray[i]; i++) { + if (resultStrings.length > 0) + resultStrings.push(","); + + if (keyValueEntry['key']) { + var quotedKey = ensureQuoted(keyValueEntry['key']), val = keyValueEntry['value']; + resultStrings.push(quotedKey); + resultStrings.push(":"); + resultStrings.push(val); + + if (isWriteableValue(ko.utils.stringTrim(val))) { + if (propertyAccessorResultStrings.length > 0) + propertyAccessorResultStrings.push(", "); + propertyAccessorResultStrings.push(quotedKey + " : function(__ko_value) { " + val + " = __ko_value; }"); + } + } else if (keyValueEntry['unknown']) { + resultStrings.push(keyValueEntry['unknown']); + } + } + + var combinedResult = resultStrings.join(""); + if (propertyAccessorResultStrings.length > 0) { + var allPropertyAccessors = propertyAccessorResultStrings.join(""); + combinedResult = combinedResult + ", '_ko_property_writers' : { " + allPropertyAccessors + " } "; + } + + return combinedResult; + }, + + keyValueArrayContainsKey: function(keyValueArray, key) { + for (var i = 0; i < keyValueArray.length; i++) + if (ko.utils.stringTrim(keyValueArray[i]['key']) == key) + return true; + return false; + }, + + // Internal, private KO utility for updating model properties from within bindings + // property: If the property being updated is (or might be) an observable, pass it here + // If it turns out to be a writable observable, it will be written to directly + // allBindingsAccessor: All bindings in the current execution context. + // This will be searched for a '_ko_property_writers' property in case you're writing to a non-observable + // key: The key identifying the property to be written. Example: for { hasFocus: myValue }, write to 'myValue' by specifying the key 'hasFocus' + // value: The value to be written + // checkIfDifferent: If true, and if the property being written is a writable observable, the value will only be written if + // it is !== existing value on that writable observable + writeValueToProperty: function(property, allBindingsAccessor, key, value, checkIfDifferent) { + if (!property || !ko.isWriteableObservable(property)) { + var propWriters = allBindingsAccessor()['_ko_property_writers']; + if (propWriters && propWriters[key]) + propWriters[key](value); + } else if (!checkIfDifferent || property() !== value) { + property(value); + } + } + }; +})(); + +ko.exportSymbol('jsonExpressionRewriting', ko.jsonExpressionRewriting); +ko.exportSymbol('jsonExpressionRewriting.bindingRewriteValidators', ko.jsonExpressionRewriting.bindingRewriteValidators); +ko.exportSymbol('jsonExpressionRewriting.parseObjectLiteral', ko.jsonExpressionRewriting.parseObjectLiteral); +ko.exportSymbol('jsonExpressionRewriting.insertPropertyAccessorsIntoJson', ko.jsonExpressionRewriting.insertPropertyAccessorsIntoJson); +(function() { + // "Virtual elements" is an abstraction on top of the usual DOM API which understands the notion that comment nodes + // may be used to represent hierarchy (in addition to the DOM's natural hierarchy). + // If you call the DOM-manipulating functions on ko.virtualElements, you will be able to read and write the state + // of that virtual hierarchy + // + // The point of all this is to support containerless templates (e.g., <!-- ko foreach:someCollection -->blah<!-- /ko -->) + // without having to scatter special cases all over the binding and templating code. + + // IE 9 cannot reliably read the "nodeValue" property of a comment node (see https://github.com/SteveSanderson/knockout/issues/186) + // but it does give them a nonstandard alternative property called "text" that it can read reliably. Other browsers don't have that property. + // So, use node.text where available, and node.nodeValue elsewhere + var commentNodesHaveTextProperty = document.createComment("test").text === "<!--test-->"; + + var startCommentRegex = commentNodesHaveTextProperty ? /^<!--\s*ko\s+(.*\:.*)\s*-->$/ : /^\s*ko\s+(.*\:.*)\s*$/; + var endCommentRegex = commentNodesHaveTextProperty ? /^<!--\s*\/ko\s*-->$/ : /^\s*\/ko\s*$/; + var htmlTagsWithOptionallyClosingChildren = { 'ul': true, 'ol': true }; + + function isStartComment(node) { + return (node.nodeType == 8) && (commentNodesHaveTextProperty ? node.text : node.nodeValue).match(startCommentRegex); + } + + function isEndComment(node) { + return (node.nodeType == 8) && (commentNodesHaveTextProperty ? node.text : node.nodeValue).match(endCommentRegex); + } + + function getVirtualChildren(startComment, allowUnbalanced) { + var currentNode = startComment; + var depth = 1; + var children = []; + while (currentNode = currentNode.nextSibling) { + if (isEndComment(currentNode)) { + depth--; + if (depth === 0) + return children; + } + + children.push(currentNode); + + if (isStartComment(currentNode)) + depth++; + } + if (!allowUnbalanced) + throw new Error("Cannot find closing comment tag to match: " + startComment.nodeValue); + return null; + } + + function getMatchingEndComment(startComment, allowUnbalanced) { + var allVirtualChildren = getVirtualChildren(startComment, allowUnbalanced); + if (allVirtualChildren) { + if (allVirtualChildren.length > 0) + return allVirtualChildren[allVirtualChildren.length - 1].nextSibling; + return startComment.nextSibling; + } else + return null; // Must have no matching end comment, and allowUnbalanced is true + } + + function getUnbalancedChildTags(node) { + // e.g., from <div>OK</div><!-- ko blah --><span>Another</span>, returns: <!-- ko blah --><span>Another</span> + // from <div>OK</div><!-- /ko --><!-- /ko -->, returns: <!-- /ko --><!-- /ko --> + var childNode = node.firstChild, captureRemaining = null; + if (childNode) { + do { + if (captureRemaining) // We already hit an unbalanced node and are now just scooping up all subsequent nodes + captureRemaining.push(childNode); + else if (isStartComment(childNode)) { + var matchingEndComment = getMatchingEndComment(childNode, /* allowUnbalanced: */ true); + if (matchingEndComment) // It's a balanced tag, so skip immediately to the end of this virtual set + childNode = matchingEndComment; + else + captureRemaining = [childNode]; // It's unbalanced, so start capturing from this point + } else if (isEndComment(childNode)) { + captureRemaining = [childNode]; // It's unbalanced (if it wasn't, we'd have skipped over it already), so start capturing + } + } while (childNode = childNode.nextSibling); + } + return captureRemaining; + } + + ko.virtualElements = { + allowedBindings: {}, + + childNodes: function(node) { + return isStartComment(node) ? getVirtualChildren(node) : node.childNodes; + }, + + emptyNode: function(node) { + if (!isStartComment(node)) + ko.utils.emptyDomNode(node); + else { + var virtualChildren = ko.virtualElements.childNodes(node); + for (var i = 0, j = virtualChildren.length; i < j; i++) + ko.removeNode(virtualChildren[i]); + } + }, + + setDomNodeChildren: function(node, childNodes) { + if (!isStartComment(node)) + ko.utils.setDomNodeChildren(node, childNodes); + else { + ko.virtualElements.emptyNode(node); + var endCommentNode = node.nextSibling; // Must be the next sibling, as we just emptied the children + for (var i = 0, j = childNodes.length; i < j; i++) + endCommentNode.parentNode.insertBefore(childNodes[i], endCommentNode); + } + }, + + prepend: function(containerNode, nodeToPrepend) { + if (!isStartComment(containerNode)) { + if (containerNode.firstChild) + containerNode.insertBefore(nodeToPrepend, containerNode.firstChild); + else + containerNode.appendChild(nodeToPrepend); + } else { + // Start comments must always have a parent and at least one following sibling (the end comment) + containerNode.parentNode.insertBefore(nodeToPrepend, containerNode.nextSibling); + } + }, + + insertAfter: function(containerNode, nodeToInsert, insertAfterNode) { + if (!isStartComment(containerNode)) { + // Insert after insertion point + if (insertAfterNode.nextSibling) + containerNode.insertBefore(nodeToInsert, insertAfterNode.nextSibling); + else + containerNode.appendChild(nodeToInsert); + } else { + // Children of start comments must always have a parent and at least one following sibling (the end comment) + containerNode.parentNode.insertBefore(nodeToInsert, insertAfterNode.nextSibling); + } + }, + + firstChild: function(node) { + if (!isStartComment(node)) + return node.firstChild; + if (!node.nextSibling || isEndComment(node.nextSibling)) + return null; + return node.nextSibling; + }, + + nextSibling: function(node) { + if (isStartComment(node)) + node = getMatchingEndComment(node); + if (node.nextSibling && isEndComment(node.nextSibling)) + return null; + return node.nextSibling; + }, + + virtualNodeBindingValue: function(node) { + var regexMatch = isStartComment(node); + return regexMatch ? regexMatch[1] : null; + }, + + normaliseVirtualElementDomStructure: function(elementVerified) { + // Workaround for https://github.com/SteveSanderson/knockout/issues/155 + // (IE <= 8 or IE 9 quirks mode parses your HTML weirdly, treating closing </li> tags as if they don't exist, thereby moving comment nodes + // that are direct descendants of <ul> into the preceding <li>) + if (!htmlTagsWithOptionallyClosingChildren[ko.utils.tagNameLower(elementVerified)]) + return; + + // Scan immediate children to see if they contain unbalanced comment tags. If they do, those comment tags + // must be intended to appear *after* that child, so move them there. + var childNode = elementVerified.firstChild; + if (childNode) { + do { + if (childNode.nodeType === 1) { + var unbalancedTags = getUnbalancedChildTags(childNode); + if (unbalancedTags) { + // Fix up the DOM by moving the unbalanced tags to where they most likely were intended to be placed - *after* the child + var nodeToInsertBefore = childNode.nextSibling; + for (var i = 0; i < unbalancedTags.length; i++) { + if (nodeToInsertBefore) + elementVerified.insertBefore(unbalancedTags[i], nodeToInsertBefore); + else + elementVerified.appendChild(unbalancedTags[i]); + } + } + } + } while (childNode = childNode.nextSibling); + } + } + }; +})(); +ko.exportSymbol('virtualElements', ko.virtualElements); +ko.exportSymbol('virtualElements.allowedBindings', ko.virtualElements.allowedBindings); +ko.exportSymbol('virtualElements.emptyNode', ko.virtualElements.emptyNode); +//ko.exportSymbol('virtualElements.firstChild', ko.virtualElements.firstChild); // firstChild is not minified +ko.exportSymbol('virtualElements.insertAfter', ko.virtualElements.insertAfter); +//ko.exportSymbol('virtualElements.nextSibling', ko.virtualElements.nextSibling); // nextSibling is not minified +ko.exportSymbol('virtualElements.prepend', ko.virtualElements.prepend); +ko.exportSymbol('virtualElements.setDomNodeChildren', ko.virtualElements.setDomNodeChildren); +(function() { + var defaultBindingAttributeName = "data-bind"; + + ko.bindingProvider = function() { + this.bindingCache = {}; + }; + + ko.utils.extend(ko.bindingProvider.prototype, { + 'nodeHasBindings': function(node) { + switch (node.nodeType) { + case 1: return node.getAttribute(defaultBindingAttributeName) != null; // Element + case 8: return ko.virtualElements.virtualNodeBindingValue(node) != null; // Comment node + default: return false; + } + }, + + 'getBindings': function(node, bindingContext) { + var bindingsString = this['getBindingsString'](node, bindingContext); + return bindingsString ? this['parseBindingsString'](bindingsString, bindingContext) : null; + }, + + // The following function is only used internally by this default provider. + // It's not part of the interface definition for a general binding provider. + 'getBindingsString': function(node, bindingContext) { + switch (node.nodeType) { + case 1: return node.getAttribute(defaultBindingAttributeName); // Element + case 8: return ko.virtualElements.virtualNodeBindingValue(node); // Comment node + default: return null; + } + }, + + // The following function is only used internally by this default provider. + // It's not part of the interface definition for a general binding provider. + 'parseBindingsString': function(bindingsString, bindingContext) { + try { + var viewModel = bindingContext['$data'], + scopes = (typeof viewModel == 'object' && viewModel != null) ? [viewModel, bindingContext] : [bindingContext], + bindingFunction = createBindingsStringEvaluatorViaCache(bindingsString, scopes.length, this.bindingCache); + return bindingFunction(scopes); + } catch (ex) { + throw new Error("Unable to parse bindings.\nMessage: " + ex + ";\nBindings value: " + bindingsString); + } + } + }); + + ko.bindingProvider['instance'] = new ko.bindingProvider(); + + function createBindingsStringEvaluatorViaCache(bindingsString, scopesCount, cache) { + var cacheKey = scopesCount + '_' + bindingsString; + return cache[cacheKey] + || (cache[cacheKey] = createBindingsStringEvaluator(bindingsString, scopesCount)); + } + + function createBindingsStringEvaluator(bindingsString, scopesCount) { + var rewrittenBindings = " { " + ko.jsonExpressionRewriting.insertPropertyAccessorsIntoJson(bindingsString) + " } "; + return ko.utils.buildEvalWithinScopeFunction(rewrittenBindings, scopesCount); + } +})(); + +ko.exportSymbol('bindingProvider', ko.bindingProvider); +(function () { + ko.bindingHandlers = {}; + + ko.bindingContext = function(dataItem, parentBindingContext) { + if (parentBindingContext) { + ko.utils.extend(this, parentBindingContext); // Inherit $root and any custom properties + this['$parentContext'] = parentBindingContext; + this['$parent'] = parentBindingContext['$data']; + this['$parents'] = (parentBindingContext['$parents'] || []).slice(0); + this['$parents'].unshift(this['$parent']); + } else { + this['$parents'] = []; + this['$root'] = dataItem; + } + this['$data'] = dataItem; + } + ko.bindingContext.prototype['createChildContext'] = function (dataItem) { + return new ko.bindingContext(dataItem, this); + }; + ko.bindingContext.prototype['extend'] = function(properties) { + var clone = ko.utils.extend(new ko.bindingContext(), this); + return ko.utils.extend(clone, properties); + }; + + function validateThatBindingIsAllowedForVirtualElements(bindingName) { + var validator = ko.virtualElements.allowedBindings[bindingName]; + if (!validator) + throw new Error("The binding '" + bindingName + "' cannot be used with virtual elements") + } + + function applyBindingsToDescendantsInternal (viewModel, elementOrVirtualElement, bindingContextsMayDifferFromDomParentElement) { + var currentChild, nextInQueue = ko.virtualElements.firstChild(elementOrVirtualElement); + while (currentChild = nextInQueue) { + // Keep a record of the next child *before* applying bindings, in case the binding removes the current child from its position + nextInQueue = ko.virtualElements.nextSibling(currentChild); + applyBindingsToNodeAndDescendantsInternal(viewModel, currentChild, bindingContextsMayDifferFromDomParentElement); + } + } + + function applyBindingsToNodeAndDescendantsInternal (viewModel, nodeVerified, bindingContextMayDifferFromDomParentElement) { + var shouldBindDescendants = true; + + // Perf optimisation: Apply bindings only if... + // (1) We need to store the binding context on this node (because it may differ from the DOM parent node's binding context) + // Note that we can't store binding contexts on non-elements (e.g., text nodes), as IE doesn't allow expando properties for those + // (2) It might have bindings (e.g., it has a data-bind attribute, or it's a marker for a containerless template) + var isElement = (nodeVerified.nodeType === 1); + if (isElement) // Workaround IE <= 8 HTML parsing weirdness + ko.virtualElements.normaliseVirtualElementDomStructure(nodeVerified); + + var shouldApplyBindings = (isElement && bindingContextMayDifferFromDomParentElement) // Case (1) + || ko.bindingProvider['instance']['nodeHasBindings'](nodeVerified); // Case (2) + if (shouldApplyBindings) + shouldBindDescendants = applyBindingsToNodeInternal(nodeVerified, null, viewModel, bindingContextMayDifferFromDomParentElement).shouldBindDescendants; + + if (shouldBindDescendants) { + // We're recursing automatically into (real or virtual) child nodes without changing binding contexts. So, + // * For children of a *real* element, the binding context is certainly the same as on their DOM .parentNode, + // hence bindingContextsMayDifferFromDomParentElement is false + // * For children of a *virtual* element, we can't be sure. Evaluating .parentNode on those children may + // skip over any number of intermediate virtual elements, any of which might define a custom binding context, + // hence bindingContextsMayDifferFromDomParentElement is true + applyBindingsToDescendantsInternal(viewModel, nodeVerified, /* bindingContextsMayDifferFromDomParentElement: */ !isElement); + } + } + + function applyBindingsToNodeInternal (node, bindings, viewModelOrBindingContext, bindingContextMayDifferFromDomParentElement) { + // Need to be sure that inits are only run once, and updates never run until all the inits have been run + var initPhase = 0; // 0 = before all inits, 1 = during inits, 2 = after all inits + + // Each time the dependentObservable is evaluated (after data changes), + // the binding attribute is reparsed so that it can pick out the correct + // model properties in the context of the changed data. + // DOM event callbacks need to be able to access this changed data, + // so we need a single parsedBindings variable (shared by all callbacks + // associated with this node's bindings) that all the closures can access. + var parsedBindings; + function makeValueAccessor(bindingKey) { + return function () { return parsedBindings[bindingKey] } + } + function parsedBindingsAccessor() { + return parsedBindings; + } + + var bindingHandlerThatControlsDescendantBindings; + ko.dependentObservable( + function () { + // Ensure we have a nonnull binding context to work with + var bindingContextInstance = viewModelOrBindingContext && (viewModelOrBindingContext instanceof ko.bindingContext) + ? viewModelOrBindingContext + : new ko.bindingContext(ko.utils.unwrapObservable(viewModelOrBindingContext)); + var viewModel = bindingContextInstance['$data']; + + // Optimization: Don't store the binding context on this node if it's definitely the same as on node.parentNode, because + // we can easily recover it just by scanning up the node's ancestors in the DOM + // (note: here, parent node means "real DOM parent" not "virtual parent", as there's no O(1) way to find the virtual parent) + if (bindingContextMayDifferFromDomParentElement) + ko.storedBindingContextForNode(node, bindingContextInstance); + + // Use evaluatedBindings if given, otherwise fall back on asking the bindings provider to give us some bindings + var evaluatedBindings = (typeof bindings == "function") ? bindings() : bindings; + parsedBindings = evaluatedBindings || ko.bindingProvider['instance']['getBindings'](node, bindingContextInstance); + + if (parsedBindings) { + // First run all the inits, so bindings can register for notification on changes + if (initPhase === 0) { + initPhase = 1; + for (var bindingKey in parsedBindings) { + var binding = ko.bindingHandlers[bindingKey]; + if (binding && node.nodeType === 8) + validateThatBindingIsAllowedForVirtualElements(bindingKey); + + if (binding && typeof binding["init"] == "function") { + var handlerInitFn = binding["init"]; + var initResult = handlerInitFn(node, makeValueAccessor(bindingKey), parsedBindingsAccessor, viewModel, bindingContextInstance); + + // If this binding handler claims to control descendant bindings, make a note of this + if (initResult && initResult['controlsDescendantBindings']) { + if (bindingHandlerThatControlsDescendantBindings !== undefined) + throw new Error("Multiple bindings (" + bindingHandlerThatControlsDescendantBindings + " and " + bindingKey + ") are trying to control descendant bindings of the same element. You cannot use these bindings together on the same element."); + bindingHandlerThatControlsDescendantBindings = bindingKey; + } + } + } + initPhase = 2; + } + + // ... then run all the updates, which might trigger changes even on the first evaluation + if (initPhase === 2) { + for (var bindingKey in parsedBindings) { + var binding = ko.bindingHandlers[bindingKey]; + if (binding && typeof binding["update"] == "function") { + var handlerUpdateFn = binding["update"]; + handlerUpdateFn(node, makeValueAccessor(bindingKey), parsedBindingsAccessor, viewModel, bindingContextInstance); + } + } + } + } + }, + null, + { 'disposeWhenNodeIsRemoved' : node } + ); + + return { + shouldBindDescendants: bindingHandlerThatControlsDescendantBindings === undefined + }; + }; + + var storedBindingContextDomDataKey = "__ko_bindingContext__"; + ko.storedBindingContextForNode = function (node, bindingContext) { + if (arguments.length == 2) + ko.utils.domData.set(node, storedBindingContextDomDataKey, bindingContext); + else + return ko.utils.domData.get(node, storedBindingContextDomDataKey); + } + + ko.applyBindingsToNode = function (node, bindings, viewModel) { + if (node.nodeType === 1) // If it's an element, workaround IE <= 8 HTML parsing weirdness + ko.virtualElements.normaliseVirtualElementDomStructure(node); + return applyBindingsToNodeInternal(node, bindings, viewModel, true); + }; + + ko.applyBindingsToDescendants = function(viewModel, rootNode) { + if (rootNode.nodeType === 1 || rootNode.nodeType === 8) + applyBindingsToDescendantsInternal(viewModel, rootNode, true); + }; + + ko.applyBindings = function (viewModel, rootNode) { + if (rootNode && (rootNode.nodeType !== 1) && (rootNode.nodeType !== 8)) + throw new Error("ko.applyBindings: first parameter should be your view model; second parameter should be a DOM node"); + rootNode = rootNode || window.document.body; // Make "rootNode" parameter optional + + applyBindingsToNodeAndDescendantsInternal(viewModel, rootNode, true); + }; + + // Retrieving binding context from arbitrary nodes + ko.contextFor = function(node) { + // We can only do something meaningful for elements and comment nodes (in particular, not text nodes, as IE can't store domdata for them) + switch (node.nodeType) { + case 1: + case 8: + var context = ko.storedBindingContextForNode(node); + if (context) return context; + if (node.parentNode) return ko.contextFor(node.parentNode); + break; + } + return undefined; + }; + ko.dataFor = function(node) { + var context = ko.contextFor(node); + return context ? context['$data'] : undefined; + }; + + ko.exportSymbol('bindingHandlers', ko.bindingHandlers); + ko.exportSymbol('applyBindings', ko.applyBindings); + ko.exportSymbol('applyBindingsToDescendants', ko.applyBindingsToDescendants); + ko.exportSymbol('applyBindingsToNode', ko.applyBindingsToNode); + ko.exportSymbol('contextFor', ko.contextFor); + ko.exportSymbol('dataFor', ko.dataFor); +})(); +// For certain common events (currently just 'click'), allow a simplified data-binding syntax +// e.g. click:handler instead of the usual full-length event:{click:handler} +var eventHandlersWithShortcuts = ['click']; +ko.utils.arrayForEach(eventHandlersWithShortcuts, function(eventName) { + ko.bindingHandlers[eventName] = { + 'init': function(element, valueAccessor, allBindingsAccessor, viewModel) { + var newValueAccessor = function () { + var result = {}; + result[eventName] = valueAccessor(); + return result; + }; + return ko.bindingHandlers['event']['init'].call(this, element, newValueAccessor, allBindingsAccessor, viewModel); + } + } +}); + + +ko.bindingHandlers['event'] = { + 'init' : function (element, valueAccessor, allBindingsAccessor, viewModel) { + var eventsToHandle = valueAccessor() || {}; + for(var eventNameOutsideClosure in eventsToHandle) { + (function() { + var eventName = eventNameOutsideClosure; // Separate variable to be captured by event handler closure + if (typeof eventName == "string") { + ko.utils.registerEventHandler(element, eventName, function (event) { + var handlerReturnValue; + var handlerFunction = valueAccessor()[eventName]; + if (!handlerFunction) + return; + var allBindings = allBindingsAccessor(); + + try { + // Take all the event args, and prefix with the viewmodel + var argsForHandler = ko.utils.makeArray(arguments); + argsForHandler.unshift(viewModel); + handlerReturnValue = handlerFunction.apply(viewModel, argsForHandler); + } finally { + if (handlerReturnValue !== true) { // Normally we want to prevent default action. Developer can override this be explicitly returning true. + if (event.preventDefault) + event.preventDefault(); + else + event.returnValue = false; + } + } + + var bubble = allBindings[eventName + 'Bubble'] !== false; + if (!bubble) { + event.cancelBubble = true; + if (event.stopPropagation) + event.stopPropagation(); + } + }); + } + })(); + } + } +}; + +ko.bindingHandlers['submit'] = { + 'init': function (element, valueAccessor, allBindingsAccessor, viewModel) { + if (typeof valueAccessor() != "function") + throw new Error("The value for a submit binding must be a function"); + ko.utils.registerEventHandler(element, "submit", function (event) { + var handlerReturnValue; + var value = valueAccessor(); + try { handlerReturnValue = value.call(viewModel, element); } + finally { + if (handlerReturnValue !== true) { // Normally we want to prevent default action. Developer can override this be explicitly returning true. + if (event.preventDefault) + event.preventDefault(); + else + event.returnValue = false; + } + } + }); + } +}; + +ko.bindingHandlers['visible'] = { + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()); + var isCurrentlyVisible = !(element.style.display == "none"); + if (value && !isCurrentlyVisible) + element.style.display = ""; + else if ((!value) && isCurrentlyVisible) + element.style.display = "none"; + } +} + +ko.bindingHandlers['enable'] = { + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()); + if (value && element.disabled) + element.removeAttribute("disabled"); + else if ((!value) && (!element.disabled)) + element.disabled = true; + } +}; + +ko.bindingHandlers['disable'] = { + 'update': function (element, valueAccessor) { + ko.bindingHandlers['enable']['update'](element, function() { return !ko.utils.unwrapObservable(valueAccessor()) }); + } +}; + +function ensureDropdownSelectionIsConsistentWithModelValue(element, modelValue, preferModelValue) { + if (preferModelValue) { + if (modelValue !== ko.selectExtensions.readValue(element)) + ko.selectExtensions.writeValue(element, modelValue); + } + + // No matter which direction we're syncing in, we want the end result to be equality between dropdown value and model value. + // If they aren't equal, either we prefer the dropdown value, or the model value couldn't be represented, so either way, + // change the model value to match the dropdown. + if (modelValue !== ko.selectExtensions.readValue(element)) + ko.utils.triggerEvent(element, "change"); +}; + +ko.bindingHandlers['value'] = { + 'init': function (element, valueAccessor, allBindingsAccessor) { + // Always catch "change" event; possibly other events too if asked + var eventsToCatch = ["change"]; + var requestedEventsToCatch = allBindingsAccessor()["valueUpdate"]; + if (requestedEventsToCatch) { + if (typeof requestedEventsToCatch == "string") // Allow both individual event names, and arrays of event names + requestedEventsToCatch = [requestedEventsToCatch]; + ko.utils.arrayPushAll(eventsToCatch, requestedEventsToCatch); + eventsToCatch = ko.utils.arrayGetDistinctValues(eventsToCatch); + } + + var valueUpdateHandler = function() { + var modelValue = valueAccessor(); + var elementValue = ko.selectExtensions.readValue(element); + ko.jsonExpressionRewriting.writeValueToProperty(modelValue, allBindingsAccessor, 'value', elementValue, /* checkIfDifferent: */ true); + } + + // Workaround for https://github.com/SteveSanderson/knockout/issues/122 + // IE doesn't fire "change" events on textboxes if the user selects a value from its autocomplete list + var ieAutoCompleteHackNeeded = ko.utils.ieVersion && element.tagName.toLowerCase() == "input" && element.type == "text" + && element.autocomplete != "off" && (!element.form || element.form.autocomplete != "off"); + if (ieAutoCompleteHackNeeded && ko.utils.arrayIndexOf(eventsToCatch, "propertychange") == -1) { + var propertyChangedFired = false; + ko.utils.registerEventHandler(element, "propertychange", function () { propertyChangedFired = true }); + ko.utils.registerEventHandler(element, "blur", function() { + if (propertyChangedFired) { + propertyChangedFired = false; + valueUpdateHandler(); + } + }); + } + + ko.utils.arrayForEach(eventsToCatch, function(eventName) { + // The syntax "after<eventname>" means "run the handler asynchronously after the event" + // This is useful, for example, to catch "keydown" events after the browser has updated the control + // (otherwise, ko.selectExtensions.readValue(this) will receive the control's value *before* the key event) + var handler = valueUpdateHandler; + if (ko.utils.stringStartsWith(eventName, "after")) { + handler = function() { setTimeout(valueUpdateHandler, 0) }; + eventName = eventName.substring("after".length); + } + ko.utils.registerEventHandler(element, eventName, handler); + }); + }, + 'update': function (element, valueAccessor) { + var valueIsSelectOption = ko.utils.tagNameLower(element) === "select"; + var newValue = ko.utils.unwrapObservable(valueAccessor()); + var elementValue = ko.selectExtensions.readValue(element); + var valueHasChanged = (newValue != elementValue); + + // JavaScript's 0 == "" behavious is unfortunate here as it prevents writing 0 to an empty text box (loose equality suggests the values are the same). + // We don't want to do a strict equality comparison as that is more confusing for developers in certain cases, so we specifically special case 0 != "" here. + if ((newValue === 0) && (elementValue !== 0) && (elementValue !== "0")) + valueHasChanged = true; + + if (valueHasChanged) { + var applyValueAction = function () { ko.selectExtensions.writeValue(element, newValue); }; + applyValueAction(); + + // Workaround for IE6 bug: It won't reliably apply values to SELECT nodes during the same execution thread + // right after you've changed the set of OPTION nodes on it. So for that node type, we'll schedule a second thread + // to apply the value as well. + var alsoApplyAsynchronously = valueIsSelectOption; + if (alsoApplyAsynchronously) + setTimeout(applyValueAction, 0); + } + + // If you try to set a model value that can't be represented in an already-populated dropdown, reject that change, + // because you're not allowed to have a model value that disagrees with a visible UI selection. + if (valueIsSelectOption && (element.length > 0)) + ensureDropdownSelectionIsConsistentWithModelValue(element, newValue, /* preferModelValue */ false); + } +}; + +ko.bindingHandlers['options'] = { + 'update': function (element, valueAccessor, allBindingsAccessor) { + if (ko.utils.tagNameLower(element) !== "select") + throw new Error("options binding applies only to SELECT elements"); + + var selectWasPreviouslyEmpty = element.length == 0; + var previousSelectedValues = ko.utils.arrayMap(ko.utils.arrayFilter(element.childNodes, function (node) { + return node.tagName && (ko.utils.tagNameLower(node) === "option") && node.selected; + }), function (node) { + return ko.selectExtensions.readValue(node) || node.innerText || node.textContent; + }); + var previousScrollTop = element.scrollTop; + + var value = ko.utils.unwrapObservable(valueAccessor()); + var selectedValue = element.value; + + // Remove all existing <option>s. + // Need to use .remove() rather than .removeChild() for <option>s otherwise IE behaves oddly (https://github.com/SteveSanderson/knockout/issues/134) + while (element.length > 0) { + ko.cleanNode(element.options[0]); + element.remove(0); + } + + if (value) { + var allBindings = allBindingsAccessor(); + if (typeof value.length != "number") + value = [value]; + if (allBindings['optionsCaption']) { + var option = document.createElement("option"); + ko.utils.setHtml(option, allBindings['optionsCaption']); + ko.selectExtensions.writeValue(option, undefined); + element.appendChild(option); + } + for (var i = 0, j = value.length; i < j; i++) { + var option = document.createElement("option"); + + // Apply a value to the option element + var optionValue = typeof allBindings['optionsValue'] == "string" ? value[i][allBindings['optionsValue']] : value[i]; + optionValue = ko.utils.unwrapObservable(optionValue); + ko.selectExtensions.writeValue(option, optionValue); + + // Apply some text to the option element + var optionsTextValue = allBindings['optionsText']; + var optionText; + if (typeof optionsTextValue == "function") + optionText = optionsTextValue(value[i]); // Given a function; run it against the data value + else if (typeof optionsTextValue == "string") + optionText = value[i][optionsTextValue]; // Given a string; treat it as a property name on the data value + else + optionText = optionValue; // Given no optionsText arg; use the data value itself + if ((optionText === null) || (optionText === undefined)) + optionText = ""; + + ko.utils.setTextContent(option, optionText); + + element.appendChild(option); + } + + // IE6 doesn't like us to assign selection to OPTION nodes before they're added to the document. + // That's why we first added them without selection. Now it's time to set the selection. + var newOptions = element.getElementsByTagName("option"); + var countSelectionsRetained = 0; + for (var i = 0, j = newOptions.length; i < j; i++) { + if (ko.utils.arrayIndexOf(previousSelectedValues, ko.selectExtensions.readValue(newOptions[i])) >= 0) { + ko.utils.setOptionNodeSelectionState(newOptions[i], true); + countSelectionsRetained++; + } + } + + element.scrollTop = previousScrollTop; + + if (selectWasPreviouslyEmpty && ('value' in allBindings)) { + // Ensure consistency between model value and selected option. + // If the dropdown is being populated for the first time here (or was otherwise previously empty), + // the dropdown selection state is meaningless, so we preserve the model value. + ensureDropdownSelectionIsConsistentWithModelValue(element, ko.utils.unwrapObservable(allBindings['value']), /* preferModelValue */ true); + } + + // Workaround for IE9 bug + ko.utils.ensureSelectElementIsRenderedCorrectly(element); + } + } +}; +ko.bindingHandlers['options'].optionValueDomDataKey = '__ko.optionValueDomData__'; + +ko.bindingHandlers['selectedOptions'] = { + getSelectedValuesFromSelectNode: function (selectNode) { + var result = []; + var nodes = selectNode.childNodes; + for (var i = 0, j = nodes.length; i < j; i++) { + var node = nodes[i], tagName = ko.utils.tagNameLower(node); + if (tagName == "option" && node.selected) + result.push(ko.selectExtensions.readValue(node)); + else if (tagName == "optgroup") { + var selectedValuesFromOptGroup = ko.bindingHandlers['selectedOptions'].getSelectedValuesFromSelectNode(node); + Array.prototype.splice.apply(result, [result.length, 0].concat(selectedValuesFromOptGroup)); // Add new entries to existing 'result' instance + } + } + return result; + }, + 'init': function (element, valueAccessor, allBindingsAccessor) { + ko.utils.registerEventHandler(element, "change", function () { + var value = valueAccessor(); + var valueToWrite = ko.bindingHandlers['selectedOptions'].getSelectedValuesFromSelectNode(this); + ko.jsonExpressionRewriting.writeValueToProperty(value, allBindingsAccessor, 'value', valueToWrite); + }); + }, + 'update': function (element, valueAccessor) { + if (ko.utils.tagNameLower(element) != "select") + throw new Error("values binding applies only to SELECT elements"); + + var newValue = ko.utils.unwrapObservable(valueAccessor()); + if (newValue && typeof newValue.length == "number") { + var nodes = element.childNodes; + for (var i = 0, j = nodes.length; i < j; i++) { + var node = nodes[i]; + if (ko.utils.tagNameLower(node) === "option") + ko.utils.setOptionNodeSelectionState(node, ko.utils.arrayIndexOf(newValue, ko.selectExtensions.readValue(node)) >= 0); + } + } + } +}; + +ko.bindingHandlers['text'] = { + 'update': function (element, valueAccessor) { + ko.utils.setTextContent(element, valueAccessor()); + } +}; + +ko.bindingHandlers['html'] = { + 'init': function() { + // Prevent binding on the dynamically-injected HTML (as developers are unlikely to expect that, and it has security implications) + return { 'controlsDescendantBindings': true }; + }, + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()); + ko.utils.setHtml(element, value); + } +}; + +ko.bindingHandlers['css'] = { + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor() || {}); + for (var className in value) { + if (typeof className == "string") { + var shouldHaveClass = ko.utils.unwrapObservable(value[className]); + ko.utils.toggleDomNodeCssClass(element, className, shouldHaveClass); + } + } + } +}; + +ko.bindingHandlers['style'] = { + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor() || {}); + for (var styleName in value) { + if (typeof styleName == "string") { + var styleValue = ko.utils.unwrapObservable(value[styleName]); + element.style[styleName] = styleValue || ""; // Empty string removes the value, whereas null/undefined have no effect + } + } + } +}; + +ko.bindingHandlers['uniqueName'] = { + 'init': function (element, valueAccessor) { + if (valueAccessor()) { + element.name = "ko_unique_" + (++ko.bindingHandlers['uniqueName'].currentIndex); + + // Workaround IE 6/7 issue + // - https://github.com/SteveSanderson/knockout/issues/197 + // - http://www.matts411.com/post/setting_the_name_attribute_in_ie_dom/ + if (ko.utils.isIe6 || ko.utils.isIe7) + element.mergeAttributes(document.createElement("<input name='" + element.name + "'/>"), false); + } + } +}; +ko.bindingHandlers['uniqueName'].currentIndex = 0; + +ko.bindingHandlers['checked'] = { + 'init': function (element, valueAccessor, allBindingsAccessor) { + var updateHandler = function() { + var valueToWrite; + if (element.type == "checkbox") { + valueToWrite = element.checked; + } else if ((element.type == "radio") && (element.checked)) { + valueToWrite = element.value; + } else { + return; // "checked" binding only responds to checkboxes and selected radio buttons + } + + var modelValue = valueAccessor(); + if ((element.type == "checkbox") && (ko.utils.unwrapObservable(modelValue) instanceof Array)) { + // For checkboxes bound to an array, we add/remove the checkbox value to that array + // This works for both observable and non-observable arrays + var existingEntryIndex = ko.utils.arrayIndexOf(ko.utils.unwrapObservable(modelValue), element.value); + if (element.checked && (existingEntryIndex < 0)) + modelValue.push(element.value); + else if ((!element.checked) && (existingEntryIndex >= 0)) + modelValue.splice(existingEntryIndex, 1); + } else { + ko.jsonExpressionRewriting.writeValueToProperty(modelValue, allBindingsAccessor, 'checked', valueToWrite, true); + } + }; + ko.utils.registerEventHandler(element, "click", updateHandler); + + // IE 6 won't allow radio buttons to be selected unless they have a name + if ((element.type == "radio") && !element.name) + ko.bindingHandlers['uniqueName']['init'](element, function() { return true }); + }, + 'update': function (element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()); + + if (element.type == "checkbox") { + if (value instanceof Array) { + // When bound to an array, the checkbox being checked represents its value being present in that array + element.checked = ko.utils.arrayIndexOf(value, element.value) >= 0; + } else { + // When bound to anything other value (not an array), the checkbox being checked represents the value being trueish + element.checked = value; + } + } else if (element.type == "radio") { + element.checked = (element.value == value); + } + } +}; + +var attrHtmlToJavascriptMap = { 'class': 'className', 'for': 'htmlFor' }; +ko.bindingHandlers['attr'] = { + 'update': function(element, valueAccessor, allBindingsAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()) || {}; + for (var attrName in value) { + if (typeof attrName == "string") { + var attrValue = ko.utils.unwrapObservable(value[attrName]); + + // To cover cases like "attr: { checked:someProp }", we want to remove the attribute entirely + // when someProp is a "no value"-like value (strictly null, false, or undefined) + // (because the absence of the "checked" attr is how to mark an element as not checked, etc.) + var toRemove = (attrValue === false) || (attrValue === null) || (attrValue === undefined); + if (toRemove) + element.removeAttribute(attrName); + + // In IE <= 7 and IE8 Quirks Mode, you have to use the Javascript property name instead of the + // HTML attribute name for certain attributes. IE8 Standards Mode supports the correct behavior, + // but instead of figuring out the mode, we'll just set the attribute through the Javascript + // property for IE <= 8. + if (ko.utils.ieVersion <= 8 && attrName in attrHtmlToJavascriptMap) { + attrName = attrHtmlToJavascriptMap[attrName]; + if (toRemove) + element.removeAttribute(attrName); + else + element[attrName] = attrValue; + } else if (!toRemove) { + element.setAttribute(attrName, attrValue.toString()); + } + } + } + } +}; + +ko.bindingHandlers['hasfocus'] = { + 'init': function(element, valueAccessor, allBindingsAccessor) { + var writeValue = function(valueToWrite) { + var modelValue = valueAccessor(); + ko.jsonExpressionRewriting.writeValueToProperty(modelValue, allBindingsAccessor, 'hasfocus', valueToWrite, true); + }; + ko.utils.registerEventHandler(element, "focus", function() { writeValue(true) }); + ko.utils.registerEventHandler(element, "focusin", function() { writeValue(true) }); // For IE + ko.utils.registerEventHandler(element, "blur", function() { writeValue(false) }); + ko.utils.registerEventHandler(element, "focusout", function() { writeValue(false) }); // For IE + }, + 'update': function(element, valueAccessor) { + var value = ko.utils.unwrapObservable(valueAccessor()); + value ? element.focus() : element.blur(); + ko.utils.triggerEvent(element, value ? "focusin" : "focusout"); // For IE, which doesn't reliably fire "focus" or "blur" events synchronously + } +}; + +// "with: someExpression" is equivalent to "template: { if: someExpression, data: someExpression }" +ko.bindingHandlers['with'] = { + makeTemplateValueAccessor: function(valueAccessor) { + return function() { var value = valueAccessor(); return { 'if': value, 'data': value, 'templateEngine': ko.nativeTemplateEngine.instance } }; + }, + 'init': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['init'](element, ko.bindingHandlers['with'].makeTemplateValueAccessor(valueAccessor)); + }, + 'update': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['update'](element, ko.bindingHandlers['with'].makeTemplateValueAccessor(valueAccessor), allBindingsAccessor, viewModel, bindingContext); + } +}; +ko.jsonExpressionRewriting.bindingRewriteValidators['with'] = false; // Can't rewrite control flow bindings +ko.virtualElements.allowedBindings['with'] = true; + +// "if: someExpression" is equivalent to "template: { if: someExpression }" +ko.bindingHandlers['if'] = { + makeTemplateValueAccessor: function(valueAccessor) { + return function() { return { 'if': valueAccessor(), 'templateEngine': ko.nativeTemplateEngine.instance } }; + }, + 'init': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['init'](element, ko.bindingHandlers['if'].makeTemplateValueAccessor(valueAccessor)); + }, + 'update': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['update'](element, ko.bindingHandlers['if'].makeTemplateValueAccessor(valueAccessor), allBindingsAccessor, viewModel, bindingContext); + } +}; +ko.jsonExpressionRewriting.bindingRewriteValidators['if'] = false; // Can't rewrite control flow bindings +ko.virtualElements.allowedBindings['if'] = true; + +// "ifnot: someExpression" is equivalent to "template: { ifnot: someExpression }" +ko.bindingHandlers['ifnot'] = { + makeTemplateValueAccessor: function(valueAccessor) { + return function() { return { 'ifnot': valueAccessor(), 'templateEngine': ko.nativeTemplateEngine.instance } }; + }, + 'init': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['init'](element, ko.bindingHandlers['ifnot'].makeTemplateValueAccessor(valueAccessor)); + }, + 'update': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['update'](element, ko.bindingHandlers['ifnot'].makeTemplateValueAccessor(valueAccessor), allBindingsAccessor, viewModel, bindingContext); + } +}; +ko.jsonExpressionRewriting.bindingRewriteValidators['ifnot'] = false; // Can't rewrite control flow bindings +ko.virtualElements.allowedBindings['ifnot'] = true; + +// "foreach: someExpression" is equivalent to "template: { foreach: someExpression }" +// "foreach: { data: someExpression, afterAdd: myfn }" is equivalent to "template: { foreach: someExpression, afterAdd: myfn }" +ko.bindingHandlers['foreach'] = { + makeTemplateValueAccessor: function(valueAccessor) { + return function() { + var bindingValue = ko.utils.unwrapObservable(valueAccessor()); + + // If bindingValue is the array, just pass it on its own + if ((!bindingValue) || typeof bindingValue.length == "number") + return { 'foreach': bindingValue, 'templateEngine': ko.nativeTemplateEngine.instance }; + + // If bindingValue.data is the array, preserve all relevant options + return { + 'foreach': bindingValue['data'], + 'includeDestroyed': bindingValue['includeDestroyed'], + 'afterAdd': bindingValue['afterAdd'], + 'beforeRemove': bindingValue['beforeRemove'], + 'afterRender': bindingValue['afterRender'], + 'templateEngine': ko.nativeTemplateEngine.instance + }; + }; + }, + 'init': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['init'](element, ko.bindingHandlers['foreach'].makeTemplateValueAccessor(valueAccessor)); + }, + 'update': function(element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + return ko.bindingHandlers['template']['update'](element, ko.bindingHandlers['foreach'].makeTemplateValueAccessor(valueAccessor), allBindingsAccessor, viewModel, bindingContext); + } +}; +ko.jsonExpressionRewriting.bindingRewriteValidators['foreach'] = false; // Can't rewrite control flow bindings +ko.virtualElements.allowedBindings['foreach'] = true; +// If you want to make a custom template engine, +// +// [1] Inherit from this class (like ko.nativeTemplateEngine does) +// [2] Override 'renderTemplateSource', supplying a function with this signature: +// +// function (templateSource, bindingContext, options) { +// // - templateSource.text() is the text of the template you should render +// // - bindingContext.$data is the data you should pass into the template +// // - you might also want to make bindingContext.$parent, bindingContext.$parents, +// // and bindingContext.$root available in the template too +// // - options gives you access to any other properties set on "data-bind: { template: options }" +// // +// // Return value: an array of DOM nodes +// } +// +// [3] Override 'createJavaScriptEvaluatorBlock', supplying a function with this signature: +// +// function (script) { +// // Return value: Whatever syntax means "Evaluate the JavaScript statement 'script' and output the result" +// // For example, the jquery.tmpl template engine converts 'someScript' to '${ someScript }' +// } +// +// This is only necessary if you want to allow data-bind attributes to reference arbitrary template variables. +// If you don't want to allow that, you can set the property 'allowTemplateRewriting' to false (like ko.nativeTemplateEngine does) +// and then you don't need to override 'createJavaScriptEvaluatorBlock'. + +ko.templateEngine = function () { }; + +ko.templateEngine.prototype['renderTemplateSource'] = function (templateSource, bindingContext, options) { + throw new Error("Override renderTemplateSource"); +}; + +ko.templateEngine.prototype['createJavaScriptEvaluatorBlock'] = function (script) { + throw new Error("Override createJavaScriptEvaluatorBlock"); +}; + +ko.templateEngine.prototype['makeTemplateSource'] = function(template, templateDocument) { + // Named template + if (typeof template == "string") { + templateDocument = templateDocument || document; + var elem = templateDocument.getElementById(template); + if (!elem) + throw new Error("Cannot find template with ID " + template); + return new ko.templateSources.domElement(elem); + } else if ((template.nodeType == 1) || (template.nodeType == 8)) { + // Anonymous template + return new ko.templateSources.anonymousTemplate(template); + } else + throw new Error("Unknown template type: " + template); +}; + +ko.templateEngine.prototype['renderTemplate'] = function (template, bindingContext, options, templateDocument) { + var templateSource = this['makeTemplateSource'](template, templateDocument); + return this['renderTemplateSource'](templateSource, bindingContext, options); +}; + +ko.templateEngine.prototype['isTemplateRewritten'] = function (template, templateDocument) { + // Skip rewriting if requested + if (this['allowTemplateRewriting'] === false) + return true; + + // Perf optimisation - see below + var templateIsInExternalDocument = templateDocument && templateDocument != document; + if (!templateIsInExternalDocument && this.knownRewrittenTemplates && this.knownRewrittenTemplates[template]) + return true; + + return this['makeTemplateSource'](template, templateDocument)['data']("isRewritten"); +}; + +ko.templateEngine.prototype['rewriteTemplate'] = function (template, rewriterCallback, templateDocument) { + var templateSource = this['makeTemplateSource'](template, templateDocument); + var rewritten = rewriterCallback(templateSource['text']()); + templateSource['text'](rewritten); + templateSource['data']("isRewritten", true); + + // Perf optimisation - for named templates, track which ones have been rewritten so we can + // answer 'isTemplateRewritten' *without* having to use getElementById (which is slow on IE < 8) + // + // Note that we only cache the status for templates in the main document, because caching on a per-doc + // basis complicates the implementation excessively. In a future version of KO, we will likely remove + // this 'isRewritten' cache entirely anyway, because the benefit is extremely minor and only applies + // to rewritable templates, which are pretty much deprecated since KO 2.0. + var templateIsInExternalDocument = templateDocument && templateDocument != document; + if (!templateIsInExternalDocument && typeof template == "string") { + this.knownRewrittenTemplates = this.knownRewrittenTemplates || {}; + this.knownRewrittenTemplates[template] = true; + } +}; + +ko.exportSymbol('templateEngine', ko.templateEngine); + +ko.templateRewriting = (function () { + var memoizeDataBindingAttributeSyntaxRegex = /(<[a-z]+\d*(\s+(?!data-bind=)[a-z0-9\-]+(=(\"[^\"]*\"|\'[^\']*\'))?)*\s+)data-bind=(["'])([\s\S]*?)\5/gi; + var memoizeVirtualContainerBindingSyntaxRegex = /<!--\s*ko\b\s*([\s\S]*?)\s*-->/g; + + function validateDataBindValuesForRewriting(keyValueArray) { + var allValidators = ko.jsonExpressionRewriting.bindingRewriteValidators; + for (var i = 0; i < keyValueArray.length; i++) { + var key = keyValueArray[i]['key']; + if (allValidators.hasOwnProperty(key)) { + var validator = allValidators[key]; + + if (typeof validator === "function") { + var possibleErrorMessage = validator(keyValueArray[i]['value']); + if (possibleErrorMessage) + throw new Error(possibleErrorMessage); + } else if (!validator) { + throw new Error("This template engine does not support the '" + key + "' binding within its templates"); + } + } + } + } + + function constructMemoizedTagReplacement(dataBindAttributeValue, tagToRetain, templateEngine) { + var dataBindKeyValueArray = ko.jsonExpressionRewriting.parseObjectLiteral(dataBindAttributeValue); + validateDataBindValuesForRewriting(dataBindKeyValueArray); + var rewrittenDataBindAttributeValue = ko.jsonExpressionRewriting.insertPropertyAccessorsIntoJson(dataBindKeyValueArray); + + // For no obvious reason, Opera fails to evaluate rewrittenDataBindAttributeValue unless it's wrapped in an additional + // anonymous function, even though Opera's built-in debugger can evaluate it anyway. No other browser requires this + // extra indirection. + var applyBindingsToNextSiblingScript = "ko.templateRewriting.applyMemoizedBindingsToNextSibling(function() { \ + return (function() { return { " + rewrittenDataBindAttributeValue + " } })() \ + })"; + return templateEngine['createJavaScriptEvaluatorBlock'](applyBindingsToNextSiblingScript) + tagToRetain; + } + + return { + ensureTemplateIsRewritten: function (template, templateEngine, templateDocument) { + if (!templateEngine['isTemplateRewritten'](template, templateDocument)) + templateEngine['rewriteTemplate'](template, function (htmlString) { + return ko.templateRewriting.memoizeBindingAttributeSyntax(htmlString, templateEngine); + }, templateDocument); + }, + + memoizeBindingAttributeSyntax: function (htmlString, templateEngine) { + return htmlString.replace(memoizeDataBindingAttributeSyntaxRegex, function () { + return constructMemoizedTagReplacement(/* dataBindAttributeValue: */ arguments[6], /* tagToRetain: */ arguments[1], templateEngine); + }).replace(memoizeVirtualContainerBindingSyntaxRegex, function() { + return constructMemoizedTagReplacement(/* dataBindAttributeValue: */ arguments[1], /* tagToRetain: */ "<!-- ko -->", templateEngine); + }); + }, + + applyMemoizedBindingsToNextSibling: function (bindings) { + return ko.memoization.memoize(function (domNode, bindingContext) { + if (domNode.nextSibling) + ko.applyBindingsToNode(domNode.nextSibling, bindings, bindingContext); + }); + } + } +})(); + +ko.exportSymbol('templateRewriting', ko.templateRewriting); +ko.exportSymbol('templateRewriting.applyMemoizedBindingsToNextSibling', ko.templateRewriting.applyMemoizedBindingsToNextSibling); // Exported only because it has to be referenced by string lookup from within rewritten template +(function() { + // A template source represents a read/write way of accessing a template. This is to eliminate the need for template loading/saving + // logic to be duplicated in every template engine (and means they can all work with anonymous templates, etc.) + // + // Two are provided by default: + // 1. ko.templateSources.domElement - reads/writes the text content of an arbitrary DOM element + // 2. ko.templateSources.anonymousElement - uses ko.utils.domData to read/write text *associated* with the DOM element, but + // without reading/writing the actual element text content, since it will be overwritten + // with the rendered template output. + // You can implement your own template source if you want to fetch/store templates somewhere other than in DOM elements. + // Template sources need to have the following functions: + // text() - returns the template text from your storage location + // text(value) - writes the supplied template text to your storage location + // data(key) - reads values stored using data(key, value) - see below + // data(key, value) - associates "value" with this template and the key "key". Is used to store information like "isRewritten". + // + // Optionally, template sources can also have the following functions: + // nodes() - returns a DOM element containing the nodes of this template, where available + // nodes(value) - writes the given DOM element to your storage location + // If a DOM element is available for a given template source, template engines are encouraged to use it in preference over text() + // for improved speed. However, all templateSources must supply text() even if they don't supply nodes(). + // + // Once you've implemented a templateSource, make your template engine use it by subclassing whatever template engine you were + // using and overriding "makeTemplateSource" to return an instance of your custom template source. + + ko.templateSources = {}; + + // ---- ko.templateSources.domElement ----- + + ko.templateSources.domElement = function(element) { + this.domElement = element; + } + + ko.templateSources.domElement.prototype['text'] = function(/* valueToWrite */) { + var tagNameLower = ko.utils.tagNameLower(this.domElement), + elemContentsProperty = tagNameLower === "script" ? "text" + : tagNameLower === "textarea" ? "value" + : "innerHTML"; + + if (arguments.length == 0) { + return this.domElement[elemContentsProperty]; + } else { + var valueToWrite = arguments[0]; + if (elemContentsProperty === "innerHTML") + ko.utils.setHtml(this.domElement, valueToWrite); + else + this.domElement[elemContentsProperty] = valueToWrite; + } + }; + + ko.templateSources.domElement.prototype['data'] = function(key /*, valueToWrite */) { + if (arguments.length === 1) { + return ko.utils.domData.get(this.domElement, "templateSourceData_" + key); + } else { + ko.utils.domData.set(this.domElement, "templateSourceData_" + key, arguments[1]); + } + }; + + // ---- ko.templateSources.anonymousTemplate ----- + // Anonymous templates are normally saved/retrieved as DOM nodes through "nodes". + // For compatibility, you can also read "text"; it will be serialized from the nodes on demand. + // Writing to "text" is still supported, but then the template data will not be available as DOM nodes. + + var anonymousTemplatesDomDataKey = "__ko_anon_template__"; + ko.templateSources.anonymousTemplate = function(element) { + this.domElement = element; + } + ko.templateSources.anonymousTemplate.prototype = new ko.templateSources.domElement(); + ko.templateSources.anonymousTemplate.prototype['text'] = function(/* valueToWrite */) { + if (arguments.length == 0) { + var templateData = ko.utils.domData.get(this.domElement, anonymousTemplatesDomDataKey) || {}; + if (templateData.textData === undefined && templateData.containerData) + templateData.textData = templateData.containerData.innerHTML; + return templateData.textData; + } else { + var valueToWrite = arguments[0]; + ko.utils.domData.set(this.domElement, anonymousTemplatesDomDataKey, {textData: valueToWrite}); + } + }; + ko.templateSources.domElement.prototype['nodes'] = function(/* valueToWrite */) { + if (arguments.length == 0) { + var templateData = ko.utils.domData.get(this.domElement, anonymousTemplatesDomDataKey) || {}; + return templateData.containerData; + } else { + var valueToWrite = arguments[0]; + ko.utils.domData.set(this.domElement, anonymousTemplatesDomDataKey, {containerData: valueToWrite}); + } + }; + + ko.exportSymbol('templateSources', ko.templateSources); + ko.exportSymbol('templateSources.domElement', ko.templateSources.domElement); + ko.exportSymbol('templateSources.anonymousTemplate', ko.templateSources.anonymousTemplate); +})(); +(function () { + var _templateEngine; + ko.setTemplateEngine = function (templateEngine) { + if ((templateEngine != undefined) && !(templateEngine instanceof ko.templateEngine)) + throw new Error("templateEngine must inherit from ko.templateEngine"); + _templateEngine = templateEngine; + } + + function invokeForEachNodeOrCommentInContinuousRange(firstNode, lastNode, action) { + var node, nextInQueue = firstNode, firstOutOfRangeNode = ko.virtualElements.nextSibling(lastNode); + while (nextInQueue && ((node = nextInQueue) !== firstOutOfRangeNode)) { + nextInQueue = ko.virtualElements.nextSibling(node); + if (node.nodeType === 1 || node.nodeType === 8) + action(node); + } + } + + function activateBindingsOnContinuousNodeArray(continuousNodeArray, bindingContext) { + // To be used on any nodes that have been rendered by a template and have been inserted into some parent element + // Walks through continuousNodeArray (which *must* be continuous, i.e., an uninterrupted sequence of sibling nodes, because + // the algorithm for walking them relies on this), and for each top-level item in the virtual-element sense, + // (1) Does a regular "applyBindings" to associate bindingContext with this node and to activate any non-memoized bindings + // (2) Unmemoizes any memos in the DOM subtree (e.g., to activate bindings that had been memoized during template rewriting) + + if (continuousNodeArray.length) { + var firstNode = continuousNodeArray[0], lastNode = continuousNodeArray[continuousNodeArray.length - 1]; + + // Need to applyBindings *before* unmemoziation, because unmemoization might introduce extra nodes (that we don't want to re-bind) + // whereas a regular applyBindings won't introduce new memoized nodes + invokeForEachNodeOrCommentInContinuousRange(firstNode, lastNode, function(node) { + ko.applyBindings(bindingContext, node); + }); + invokeForEachNodeOrCommentInContinuousRange(firstNode, lastNode, function(node) { + ko.memoization.unmemoizeDomNodeAndDescendants(node, [bindingContext]); + }); + } + } + + function getFirstNodeFromPossibleArray(nodeOrNodeArray) { + return nodeOrNodeArray.nodeType ? nodeOrNodeArray + : nodeOrNodeArray.length > 0 ? nodeOrNodeArray[0] + : null; + } + + function executeTemplate(targetNodeOrNodeArray, renderMode, template, bindingContext, options) { + options = options || {}; + var firstTargetNode = targetNodeOrNodeArray && getFirstNodeFromPossibleArray(targetNodeOrNodeArray); + var templateDocument = firstTargetNode && firstTargetNode.ownerDocument; + var templateEngineToUse = (options['templateEngine'] || _templateEngine); + ko.templateRewriting.ensureTemplateIsRewritten(template, templateEngineToUse, templateDocument); + var renderedNodesArray = templateEngineToUse['renderTemplate'](template, bindingContext, options, templateDocument); + + // Loosely check result is an array of DOM nodes + if ((typeof renderedNodesArray.length != "number") || (renderedNodesArray.length > 0 && typeof renderedNodesArray[0].nodeType != "number")) + throw new Error("Template engine must return an array of DOM nodes"); + + var haveAddedNodesToParent = false; + switch (renderMode) { + case "replaceChildren": + ko.virtualElements.setDomNodeChildren(targetNodeOrNodeArray, renderedNodesArray); + haveAddedNodesToParent = true; + break; + case "replaceNode": + ko.utils.replaceDomNodes(targetNodeOrNodeArray, renderedNodesArray); + haveAddedNodesToParent = true; + break; + case "ignoreTargetNode": break; + default: + throw new Error("Unknown renderMode: " + renderMode); + } + + if (haveAddedNodesToParent) { + activateBindingsOnContinuousNodeArray(renderedNodesArray, bindingContext); + if (options['afterRender']) + options['afterRender'](renderedNodesArray, bindingContext['$data']); + } + + return renderedNodesArray; + } + + ko.renderTemplate = function (template, dataOrBindingContext, options, targetNodeOrNodeArray, renderMode) { + options = options || {}; + if ((options['templateEngine'] || _templateEngine) == undefined) + throw new Error("Set a template engine before calling renderTemplate"); + renderMode = renderMode || "replaceChildren"; + + if (targetNodeOrNodeArray) { + var firstTargetNode = getFirstNodeFromPossibleArray(targetNodeOrNodeArray); + + var whenToDispose = function () { return (!firstTargetNode) || !ko.utils.domNodeIsAttachedToDocument(firstTargetNode); }; // Passive disposal (on next evaluation) + var activelyDisposeWhenNodeIsRemoved = (firstTargetNode && renderMode == "replaceNode") ? firstTargetNode.parentNode : firstTargetNode; + + return ko.dependentObservable( // So the DOM is automatically updated when any dependency changes + function () { + // Ensure we've got a proper binding context to work with + var bindingContext = (dataOrBindingContext && (dataOrBindingContext instanceof ko.bindingContext)) + ? dataOrBindingContext + : new ko.bindingContext(ko.utils.unwrapObservable(dataOrBindingContext)); + + // Support selecting template as a function of the data being rendered + var templateName = typeof(template) == 'function' ? template(bindingContext['$data']) : template; + + var renderedNodesArray = executeTemplate(targetNodeOrNodeArray, renderMode, templateName, bindingContext, options); + if (renderMode == "replaceNode") { + targetNodeOrNodeArray = renderedNodesArray; + firstTargetNode = getFirstNodeFromPossibleArray(targetNodeOrNodeArray); + } + }, + null, + { 'disposeWhen': whenToDispose, 'disposeWhenNodeIsRemoved': activelyDisposeWhenNodeIsRemoved } + ); + } else { + // We don't yet have a DOM node to evaluate, so use a memo and render the template later when there is a DOM node + return ko.memoization.memoize(function (domNode) { + ko.renderTemplate(template, dataOrBindingContext, options, domNode, "replaceNode"); + }); + } + }; + + ko.renderTemplateForEach = function (template, arrayOrObservableArray, options, targetNode, parentBindingContext) { + // Since setDomNodeChildrenFromArrayMapping always calls executeTemplateForArrayItem and then + // activateBindingsCallback for added items, we can store the binding context in the former to use in the latter. + var arrayItemContext; + + // This will be called by setDomNodeChildrenFromArrayMapping to get the nodes to add to targetNode + var executeTemplateForArrayItem = function (arrayValue, index) { + // Support selecting template as a function of the data being rendered + var templateName = typeof(template) == 'function' ? template(arrayValue) : template; + arrayItemContext = parentBindingContext['createChildContext'](ko.utils.unwrapObservable(arrayValue)); + arrayItemContext['$index'] = index; + return executeTemplate(null, "ignoreTargetNode", templateName, arrayItemContext, options); + } + + // This will be called whenever setDomNodeChildrenFromArrayMapping has added nodes to targetNode + var activateBindingsCallback = function(arrayValue, addedNodesArray, index) { + activateBindingsOnContinuousNodeArray(addedNodesArray, arrayItemContext); + if (options['afterRender']) + options['afterRender'](addedNodesArray, arrayValue); + }; + + return ko.dependentObservable(function () { + var unwrappedArray = ko.utils.unwrapObservable(arrayOrObservableArray) || []; + if (typeof unwrappedArray.length == "undefined") // Coerce single value into array + unwrappedArray = [unwrappedArray]; + + // Filter out any entries marked as destroyed + var filteredArray = ko.utils.arrayFilter(unwrappedArray, function(item) { + return options['includeDestroyed'] || item === undefined || item === null || !ko.utils.unwrapObservable(item['_destroy']); + }); + + ko.utils.setDomNodeChildrenFromArrayMapping(targetNode, filteredArray, executeTemplateForArrayItem, options, activateBindingsCallback); + + }, null, { 'disposeWhenNodeIsRemoved': targetNode }); + }; + + var templateSubscriptionDomDataKey = '__ko__templateSubscriptionDomDataKey__'; + function disposeOldSubscriptionAndStoreNewOne(element, newSubscription) { + var oldSubscription = ko.utils.domData.get(element, templateSubscriptionDomDataKey); + if (oldSubscription && (typeof(oldSubscription.dispose) == 'function')) + oldSubscription.dispose(); + ko.utils.domData.set(element, templateSubscriptionDomDataKey, newSubscription); + } + + ko.bindingHandlers['template'] = { + 'init': function(element, valueAccessor) { + // Support anonymous templates + var bindingValue = ko.utils.unwrapObservable(valueAccessor()); + if ((typeof bindingValue != "string") && (!bindingValue['name']) && (element.nodeType == 1 || element.nodeType == 8)) { + // It's an anonymous template - store the element contents, then clear the element + var templateNodes = element.nodeType == 1 ? element.childNodes : ko.virtualElements.childNodes(element), + container = ko.utils.moveCleanedNodesToContainerElement(templateNodes); // This also removes the nodes from their current parent + new ko.templateSources.anonymousTemplate(element)['nodes'](container); + } + return { 'controlsDescendantBindings': true }; + }, + 'update': function (element, valueAccessor, allBindingsAccessor, viewModel, bindingContext) { + var bindingValue = ko.utils.unwrapObservable(valueAccessor()); + var templateName; + var shouldDisplay = true; + + if (typeof bindingValue == "string") { + templateName = bindingValue; + } else { + templateName = bindingValue['name']; + + // Support "if"/"ifnot" conditions + if ('if' in bindingValue) + shouldDisplay = shouldDisplay && ko.utils.unwrapObservable(bindingValue['if']); + if ('ifnot' in bindingValue) + shouldDisplay = shouldDisplay && !ko.utils.unwrapObservable(bindingValue['ifnot']); + } + + var templateSubscription = null; + + if ((typeof bindingValue === 'object') && ('foreach' in bindingValue)) { // Note: can't use 'in' operator on strings + // Render once for each data point (treating data set as empty if shouldDisplay==false) + var dataArray = (shouldDisplay && bindingValue['foreach']) || []; + templateSubscription = ko.renderTemplateForEach(templateName || element, dataArray, /* options: */ bindingValue, element, bindingContext); + } else { + if (shouldDisplay) { + // Render once for this single data point (or use the viewModel if no data was provided) + var innerBindingContext = (typeof bindingValue == 'object') && ('data' in bindingValue) + ? bindingContext['createChildContext'](ko.utils.unwrapObservable(bindingValue['data'])) // Given an explitit 'data' value, we create a child binding context for it + : bindingContext; // Given no explicit 'data' value, we retain the same binding context + templateSubscription = ko.renderTemplate(templateName || element, innerBindingContext, /* options: */ bindingValue, element); + } else + ko.virtualElements.emptyNode(element); + } + + // It only makes sense to have a single template subscription per element (otherwise which one should have its output displayed?) + disposeOldSubscriptionAndStoreNewOne(element, templateSubscription); + } + }; + + // Anonymous templates can't be rewritten. Give a nice error message if you try to do it. + ko.jsonExpressionRewriting.bindingRewriteValidators['template'] = function(bindingValue) { + var parsedBindingValue = ko.jsonExpressionRewriting.parseObjectLiteral(bindingValue); + + if ((parsedBindingValue.length == 1) && parsedBindingValue[0]['unknown']) + return null; // It looks like a string literal, not an object literal, so treat it as a named template (which is allowed for rewriting) + + if (ko.jsonExpressionRewriting.keyValueArrayContainsKey(parsedBindingValue, "name")) + return null; // Named templates can be rewritten, so return "no error" + return "This template engine does not support anonymous templates nested within its templates"; + }; + + ko.virtualElements.allowedBindings['template'] = true; +})(); + +ko.exportSymbol('setTemplateEngine', ko.setTemplateEngine); +ko.exportSymbol('renderTemplate', ko.renderTemplate); + +(function () { + // Simple calculation based on Levenshtein distance. + function calculateEditDistanceMatrix(oldArray, newArray, maxAllowedDistance) { + var distances = []; + for (var i = 0; i <= newArray.length; i++) + distances[i] = []; + + // Top row - transform old array into empty array via deletions + for (var i = 0, j = Math.min(oldArray.length, maxAllowedDistance); i <= j; i++) + distances[0][i] = i; + + // Left row - transform empty array into new array via additions + for (var i = 1, j = Math.min(newArray.length, maxAllowedDistance); i <= j; i++) { + distances[i][0] = i; + } + + // Fill out the body of the array + var oldIndex, oldIndexMax = oldArray.length, newIndex, newIndexMax = newArray.length; + var distanceViaAddition, distanceViaDeletion; + for (oldIndex = 1; oldIndex <= oldIndexMax; oldIndex++) { + var newIndexMinForRow = Math.max(1, oldIndex - maxAllowedDistance); + var newIndexMaxForRow = Math.min(newIndexMax, oldIndex + maxAllowedDistance); + for (newIndex = newIndexMinForRow; newIndex <= newIndexMaxForRow; newIndex++) { + if (oldArray[oldIndex - 1] === newArray[newIndex - 1]) + distances[newIndex][oldIndex] = distances[newIndex - 1][oldIndex - 1]; + else { + var northDistance = distances[newIndex - 1][oldIndex] === undefined ? Number.MAX_VALUE : distances[newIndex - 1][oldIndex] + 1; + var westDistance = distances[newIndex][oldIndex - 1] === undefined ? Number.MAX_VALUE : distances[newIndex][oldIndex - 1] + 1; + distances[newIndex][oldIndex] = Math.min(northDistance, westDistance); + } + } + } + + return distances; + } + + function findEditScriptFromEditDistanceMatrix(editDistanceMatrix, oldArray, newArray) { + var oldIndex = oldArray.length; + var newIndex = newArray.length; + var editScript = []; + var maxDistance = editDistanceMatrix[newIndex][oldIndex]; + if (maxDistance === undefined) + return null; // maxAllowedDistance must be too small + while ((oldIndex > 0) || (newIndex > 0)) { + var me = editDistanceMatrix[newIndex][oldIndex]; + var distanceViaAdd = (newIndex > 0) ? editDistanceMatrix[newIndex - 1][oldIndex] : maxDistance + 1; + var distanceViaDelete = (oldIndex > 0) ? editDistanceMatrix[newIndex][oldIndex - 1] : maxDistance + 1; + var distanceViaRetain = (newIndex > 0) && (oldIndex > 0) ? editDistanceMatrix[newIndex - 1][oldIndex - 1] : maxDistance + 1; + if ((distanceViaAdd === undefined) || (distanceViaAdd < me - 1)) distanceViaAdd = maxDistance + 1; + if ((distanceViaDelete === undefined) || (distanceViaDelete < me - 1)) distanceViaDelete = maxDistance + 1; + if (distanceViaRetain < me - 1) distanceViaRetain = maxDistance + 1; + + if ((distanceViaAdd <= distanceViaDelete) && (distanceViaAdd < distanceViaRetain)) { + editScript.push({ status: "added", value: newArray[newIndex - 1] }); + newIndex--; + } else if ((distanceViaDelete < distanceViaAdd) && (distanceViaDelete < distanceViaRetain)) { + editScript.push({ status: "deleted", value: oldArray[oldIndex - 1] }); + oldIndex--; + } else { + editScript.push({ status: "retained", value: oldArray[oldIndex - 1] }); + newIndex--; + oldIndex--; + } + } + return editScript.reverse(); + } + + ko.utils.compareArrays = function (oldArray, newArray, maxEditsToConsider) { + if (maxEditsToConsider === undefined) { + return ko.utils.compareArrays(oldArray, newArray, 1) // First consider likely case where there is at most one edit (very fast) + || ko.utils.compareArrays(oldArray, newArray, 10) // If that fails, account for a fair number of changes while still being fast + || ko.utils.compareArrays(oldArray, newArray, Number.MAX_VALUE); // Ultimately give the right answer, even though it may take a long time + } else { + oldArray = oldArray || []; + newArray = newArray || []; + var editDistanceMatrix = calculateEditDistanceMatrix(oldArray, newArray, maxEditsToConsider); + return findEditScriptFromEditDistanceMatrix(editDistanceMatrix, oldArray, newArray); + } + }; +})(); + +ko.exportSymbol('utils.compareArrays', ko.utils.compareArrays); + +(function () { + // Objective: + // * Given an input array, a container DOM node, and a function from array elements to arrays of DOM nodes, + // map the array elements to arrays of DOM nodes, concatenate together all these arrays, and use them to populate the container DOM node + // * Next time we're given the same combination of things (with the array possibly having mutated), update the container DOM node + // so that its children is again the concatenation of the mappings of the array elements, but don't re-map any array elements that we + // previously mapped - retain those nodes, and just insert/delete other ones + + // "callbackAfterAddingNodes" will be invoked after any "mapping"-generated nodes are inserted into the container node + // You can use this, for example, to activate bindings on those nodes. + + function fixUpVirtualElements(contiguousNodeArray) { + // Ensures that contiguousNodeArray really *is* an array of contiguous siblings, even if some of the interior + // ones have changed since your array was first built (e.g., because your array contains virtual elements, and + // their virtual children changed when binding was applied to them). + // This is needed so that we can reliably remove or update the nodes corresponding to a given array item + + if (contiguousNodeArray.length > 2) { + // Build up the actual new contiguous node set + var current = contiguousNodeArray[0], last = contiguousNodeArray[contiguousNodeArray.length - 1], newContiguousSet = [current]; + while (current !== last) { + current = current.nextSibling; + if (!current) // Won't happen, except if the developer has manually removed some DOM elements (then we're in an undefined scenario) + return; + newContiguousSet.push(current); + } + + // ... then mutate the input array to match this. + // (The following line replaces the contents of contiguousNodeArray with newContiguousSet) + Array.prototype.splice.apply(contiguousNodeArray, [0, contiguousNodeArray.length].concat(newContiguousSet)); + } + } + + function mapNodeAndRefreshWhenChanged(containerNode, mapping, valueToMap, callbackAfterAddingNodes, index) { + // Map this array value inside a dependentObservable so we re-map when any dependency changes + var mappedNodes = []; + var dependentObservable = ko.dependentObservable(function() { + var newMappedNodes = mapping(valueToMap, index) || []; + + // On subsequent evaluations, just replace the previously-inserted DOM nodes + if (mappedNodes.length > 0) { + fixUpVirtualElements(mappedNodes); + ko.utils.replaceDomNodes(mappedNodes, newMappedNodes); + if (callbackAfterAddingNodes) + callbackAfterAddingNodes(valueToMap, newMappedNodes); + } + + // Replace the contents of the mappedNodes array, thereby updating the record + // of which nodes would be deleted if valueToMap was itself later removed + mappedNodes.splice(0, mappedNodes.length); + ko.utils.arrayPushAll(mappedNodes, newMappedNodes); + }, null, { 'disposeWhenNodeIsRemoved': containerNode, 'disposeWhen': function() { return (mappedNodes.length == 0) || !ko.utils.domNodeIsAttachedToDocument(mappedNodes[0]) } }); + return { mappedNodes : mappedNodes, dependentObservable : dependentObservable }; + } + + var lastMappingResultDomDataKey = "setDomNodeChildrenFromArrayMapping_lastMappingResult"; + + ko.utils.setDomNodeChildrenFromArrayMapping = function (domNode, array, mapping, options, callbackAfterAddingNodes) { + // Compare the provided array against the previous one + array = array || []; + options = options || {}; + var isFirstExecution = ko.utils.domData.get(domNode, lastMappingResultDomDataKey) === undefined; + var lastMappingResult = ko.utils.domData.get(domNode, lastMappingResultDomDataKey) || []; + var lastArray = ko.utils.arrayMap(lastMappingResult, function (x) { return x.arrayEntry; }); + var editScript = ko.utils.compareArrays(lastArray, array); + + // Build the new mapping result + var newMappingResult = []; + var lastMappingResultIndex = 0; + var nodesToDelete = []; + var newMappingResultIndex = 0; + var nodesAdded = []; + var insertAfterNode = null; + for (var i = 0, j = editScript.length; i < j; i++) { + switch (editScript[i].status) { + case "retained": + // Just keep the information - don't touch the nodes + var dataToRetain = lastMappingResult[lastMappingResultIndex]; + dataToRetain.indexObservable(newMappingResultIndex); + newMappingResultIndex = newMappingResult.push(dataToRetain); + if (dataToRetain.domNodes.length > 0) + insertAfterNode = dataToRetain.domNodes[dataToRetain.domNodes.length - 1]; + lastMappingResultIndex++; + break; + + case "deleted": + // Stop tracking changes to the mapping for these nodes + lastMappingResult[lastMappingResultIndex].dependentObservable.dispose(); + + // Queue these nodes for later removal + fixUpVirtualElements(lastMappingResult[lastMappingResultIndex].domNodes); + ko.utils.arrayForEach(lastMappingResult[lastMappingResultIndex].domNodes, function (node) { + nodesToDelete.push({ + element: node, + index: i, + value: editScript[i].value + }); + insertAfterNode = node; + }); + lastMappingResultIndex++; + break; + + case "added": + var valueToMap = editScript[i].value; + var indexObservable = ko.observable(newMappingResultIndex); + var mapData = mapNodeAndRefreshWhenChanged(domNode, mapping, valueToMap, callbackAfterAddingNodes, indexObservable); + var mappedNodes = mapData.mappedNodes; + + // On the first evaluation, insert the nodes at the current insertion point + newMappingResultIndex = newMappingResult.push({ + arrayEntry: editScript[i].value, + domNodes: mappedNodes, + dependentObservable: mapData.dependentObservable, + indexObservable: indexObservable + }); + for (var nodeIndex = 0, nodeIndexMax = mappedNodes.length; nodeIndex < nodeIndexMax; nodeIndex++) { + var node = mappedNodes[nodeIndex]; + nodesAdded.push({ + element: node, + index: i, + value: editScript[i].value + }); + if (insertAfterNode == null) { + // Insert "node" (the newly-created node) as domNode's first child + ko.virtualElements.prepend(domNode, node); + } else { + // Insert "node" into "domNode" immediately after "insertAfterNode" + ko.virtualElements.insertAfter(domNode, node, insertAfterNode); + } + insertAfterNode = node; + } + if (callbackAfterAddingNodes) + callbackAfterAddingNodes(valueToMap, mappedNodes, indexObservable); + break; + } + } + + ko.utils.arrayForEach(nodesToDelete, function (node) { ko.cleanNode(node.element) }); + + var invokedBeforeRemoveCallback = false; + if (!isFirstExecution) { + if (options['afterAdd']) { + for (var i = 0; i < nodesAdded.length; i++) + options['afterAdd'](nodesAdded[i].element, nodesAdded[i].index, nodesAdded[i].value); + } + if (options['beforeRemove']) { + for (var i = 0; i < nodesToDelete.length; i++) + options['beforeRemove'](nodesToDelete[i].element, nodesToDelete[i].index, nodesToDelete[i].value); + invokedBeforeRemoveCallback = true; + } + } + if (!invokedBeforeRemoveCallback && nodesToDelete.length) { + for (var i = 0; i < nodesToDelete.length; i++) { + var element = nodesToDelete[i].element; + if (element.parentNode) + element.parentNode.removeChild(element); + } + } + + // Store a copy of the array items we just considered so we can difference it next time + ko.utils.domData.set(domNode, lastMappingResultDomDataKey, newMappingResult); + } +})(); + +ko.exportSymbol('utils.setDomNodeChildrenFromArrayMapping', ko.utils.setDomNodeChildrenFromArrayMapping); +ko.nativeTemplateEngine = function () { + this['allowTemplateRewriting'] = false; +} + +ko.nativeTemplateEngine.prototype = new ko.templateEngine(); +ko.nativeTemplateEngine.prototype['renderTemplateSource'] = function (templateSource, bindingContext, options) { + var useNodesIfAvailable = !(ko.utils.ieVersion < 9), // IE<9 cloneNode doesn't work properly + templateNodesFunc = useNodesIfAvailable ? templateSource['nodes'] : null, + templateNodes = templateNodesFunc ? templateSource['nodes']() : null; + + if (templateNodes) { + return ko.utils.makeArray(templateNodes.cloneNode(true).childNodes); + } else { + var templateText = templateSource['text'](); + return ko.utils.parseHtmlFragment(templateText); + } +}; + +ko.nativeTemplateEngine.instance = new ko.nativeTemplateEngine(); +ko.setTemplateEngine(ko.nativeTemplateEngine.instance); + +ko.exportSymbol('nativeTemplateEngine', ko.nativeTemplateEngine); +(function() { + ko.jqueryTmplTemplateEngine = function () { + // Detect which version of jquery-tmpl you're using. Unfortunately jquery-tmpl + // doesn't expose a version number, so we have to infer it. + // Note that as of Knockout 1.3, we only support jQuery.tmpl 1.0.0pre and later, + // which KO internally refers to as version "2", so older versions are no longer detected. + var jQueryTmplVersion = this.jQueryTmplVersion = (function() { + if ((typeof(jQuery) == "undefined") || !(jQuery['tmpl'])) + return 0; + // Since it exposes no official version number, we use our own numbering system. To be updated as jquery-tmpl evolves. + try { + if (jQuery['tmpl']['tag']['tmpl']['open'].toString().indexOf('__') >= 0) { + // Since 1.0.0pre, custom tags should append markup to an array called "__" + return 2; // Final version of jquery.tmpl + } + } catch(ex) { /* Apparently not the version we were looking for */ } + + return 1; // Any older version that we don't support + })(); + + function ensureHasReferencedJQueryTemplates() { + if (jQueryTmplVersion < 2) + throw new Error("Your version of jQuery.tmpl is too old. Please upgrade to jQuery.tmpl 1.0.0pre or later."); + } + + function executeTemplate(compiledTemplate, data, jQueryTemplateOptions) { + return jQuery['tmpl'](compiledTemplate, data, jQueryTemplateOptions); + } + + this['renderTemplateSource'] = function(templateSource, bindingContext, options) { + options = options || {}; + ensureHasReferencedJQueryTemplates(); + + // Ensure we have stored a precompiled version of this template (don't want to reparse on every render) + var precompiled = templateSource['data']('precompiled'); + if (!precompiled) { + var templateText = templateSource['text']() || ""; + // Wrap in "with($whatever.koBindingContext) { ... }" + templateText = "{{ko_with $item.koBindingContext}}" + templateText + "{{/ko_with}}"; + + precompiled = jQuery['template'](null, templateText); + templateSource['data']('precompiled', precompiled); + } + + var data = [bindingContext['$data']]; // Prewrap the data in an array to stop jquery.tmpl from trying to unwrap any arrays + var jQueryTemplateOptions = jQuery['extend']({ 'koBindingContext': bindingContext }, options['templateOptions']); + + var resultNodes = executeTemplate(precompiled, data, jQueryTemplateOptions); + resultNodes['appendTo'](document.createElement("div")); // Using "appendTo" forces jQuery/jQuery.tmpl to perform necessary cleanup work + + jQuery['fragments'] = {}; // Clear jQuery's fragment cache to avoid a memory leak after a large number of template renders + return resultNodes; + }; + + this['createJavaScriptEvaluatorBlock'] = function(script) { + return "{{ko_code ((function() { return " + script + " })()) }}"; + }; + + this['addTemplate'] = function(templateName, templateMarkup) { + document.write("<script type='text/html' id='" + templateName + "'>" + templateMarkup + "</script>"); + }; + + if (jQueryTmplVersion > 0) { + jQuery['tmpl']['tag']['ko_code'] = { + open: "__.push($1 || '');" + }; + jQuery['tmpl']['tag']['ko_with'] = { + open: "with($1) {", + close: "} " + }; + } + }; + + ko.jqueryTmplTemplateEngine.prototype = new ko.templateEngine(); + + // Use this one by default *only if jquery.tmpl is referenced* + var jqueryTmplTemplateEngineInstance = new ko.jqueryTmplTemplateEngine(); + if (jqueryTmplTemplateEngineInstance.jQueryTmplVersion > 0) + ko.setTemplateEngine(jqueryTmplTemplateEngineInstance); + + ko.exportSymbol('jqueryTmplTemplateEngine', ko.jqueryTmplTemplateEngine); +})(); +}); +})(window,document,navigator); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.js b/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.js new file mode 100644 index 0000000..107026d --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/knockout-2.1.0.js @@ -0,0 +1,86 @@ +// Knockout JavaScript library v2.1.0 +// (c) Steven Sanderson - http://knockoutjs.com/ +// License: MIT (http://www.opensource.org/licenses/mit-license.php) + +(function(window,document,navigator,undefined){ +function m(w){throw w;}var n=void 0,p=!0,s=null,t=!1;function A(w){return function(){return w}};function E(w){function B(b,c,d){d&&c!==a.k.r(b)&&a.k.S(b,c);c!==a.k.r(b)&&a.a.va(b,"change")}var a="undefined"!==typeof w?w:{};a.b=function(b,c){for(var d=b.split("."),f=a,g=0;g<d.length-1;g++)f=f[d[g]];f[d[d.length-1]]=c};a.B=function(a,c,d){a[c]=d};a.version="2.1.0";a.b("version",a.version);a.a=new function(){function b(b,c){if("input"!==a.a.o(b)||!b.type||"click"!=c.toLowerCase())return t;var e=b.type;return"checkbox"==e||"radio"==e}var c=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,d={},f={};d[/Firefox\/2/i.test(navigator.userAgent)? +"KeyboardEvent":"UIEvents"]=["keyup","keydown","keypress"];d.MouseEvents="click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave".split(" ");for(var g in d){var e=d[g];if(e.length)for(var h=0,j=e.length;h<j;h++)f[e[h]]=g}var k={propertychange:p},i=function(){for(var a=3,b=document.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<\!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return 4<a?a:n}();return{Ca:["authenticity_token",/^__RequestVerificationToken(_.*)?$/], +v:function(a,b){for(var c=0,e=a.length;c<e;c++)b(a[c])},j:function(a,b){if("function"==typeof Array.prototype.indexOf)return Array.prototype.indexOf.call(a,b);for(var c=0,e=a.length;c<e;c++)if(a[c]===b)return c;return-1},ab:function(a,b,c){for(var e=0,f=a.length;e<f;e++)if(b.call(c,a[e]))return a[e];return s},ba:function(b,c){var e=a.a.j(b,c);0<=e&&b.splice(e,1)},za:function(b){for(var b=b||[],c=[],e=0,f=b.length;e<f;e++)0>a.a.j(c,b[e])&&c.push(b[e]);return c},T:function(a,b){for(var a=a||[],c=[], +e=0,f=a.length;e<f;e++)c.push(b(a[e]));return c},aa:function(a,b){for(var a=a||[],c=[],e=0,f=a.length;e<f;e++)b(a[e])&&c.push(a[e]);return c},N:function(a,b){if(b instanceof Array)a.push.apply(a,b);else for(var c=0,e=b.length;c<e;c++)a.push(b[c]);return a},extend:function(a,b){if(b)for(var c in b)b.hasOwnProperty(c)&&(a[c]=b[c]);return a},ga:function(b){for(;b.firstChild;)a.removeNode(b.firstChild)},Ab:function(b){for(var b=a.a.L(b),c=document.createElement("div"),e=0,f=b.length;e<f;e++)a.F(b[e]), +c.appendChild(b[e]);return c},X:function(b,c){a.a.ga(b);if(c)for(var e=0,f=c.length;e<f;e++)b.appendChild(c[e])},Na:function(b,c){var e=b.nodeType?[b]:b;if(0<e.length){for(var f=e[0],d=f.parentNode,g=0,h=c.length;g<h;g++)d.insertBefore(c[g],f);g=0;for(h=e.length;g<h;g++)a.removeNode(e[g])}},Pa:function(a,b){0<=navigator.userAgent.indexOf("MSIE 6")?a.setAttribute("selected",b):a.selected=b},w:function(a){return(a||"").replace(c,"")},Ib:function(b,c){for(var e=[],f=(b||"").split(c),g=0,d=f.length;g< +d;g++){var h=a.a.w(f[g]);""!==h&&e.push(h)}return e},Hb:function(a,b){a=a||"";return b.length>a.length?t:a.substring(0,b.length)===b},eb:function(a,b){for(var c="return ("+a+")",e=0;e<b;e++)c="with(sc["+e+"]) { "+c+" } ";return new Function("sc",c)},kb:function(a,b){if(b.compareDocumentPosition)return 16==(b.compareDocumentPosition(a)&16);for(;a!=s;){if(a==b)return p;a=a.parentNode}return t},fa:function(b){return a.a.kb(b,b.ownerDocument)},o:function(a){return a&&a.tagName&&a.tagName.toLowerCase()}, +n:function(a,c,e){var f=i&&k[c];if(!f&&"undefined"!=typeof jQuery){if(b(a,c))var g=e,e=function(a,b){var c=this.checked;b&&(this.checked=b.fb!==p);g.call(this,a);this.checked=c};jQuery(a).bind(c,e)}else!f&&"function"==typeof a.addEventListener?a.addEventListener(c,e,t):"undefined"!=typeof a.attachEvent?a.attachEvent("on"+c,function(b){e.call(a,b)}):m(Error("Browser doesn't support addEventListener or attachEvent"))},va:function(a,c){(!a||!a.nodeType)&&m(Error("element must be a DOM node when calling triggerEvent")); +if("undefined"!=typeof jQuery){var e=[];b(a,c)&&e.push({fb:a.checked});jQuery(a).trigger(c,e)}else"function"==typeof document.createEvent?"function"==typeof a.dispatchEvent?(e=document.createEvent(f[c]||"HTMLEvents"),e.initEvent(c,p,p,window,0,0,0,0,0,t,t,t,t,0,a),a.dispatchEvent(e)):m(Error("The supplied element doesn't support dispatchEvent")):"undefined"!=typeof a.fireEvent?(b(a,c)&&(a.checked=a.checked!==p),a.fireEvent("on"+c)):m(Error("Browser doesn't support triggering events"))},d:function(b){return a.la(b)? +b():b},Ua:function(b,c,e){var f=(b.className||"").split(/\s+/),g=0<=a.a.j(f,c);if(e&&!g)b.className+=(f[0]?" ":"")+c;else if(g&&!e){e="";for(g=0;g<f.length;g++)f[g]!=c&&(e+=f[g]+" ");b.className=a.a.w(e)}},Qa:function(b,c){var e=a.a.d(c);if(e===s||e===n)e="";"innerText"in b?b.innerText=e:b.textContent=e;9<=i&&(b.style.display=b.style.display)},lb:function(a){if(9<=i){var b=a.style.width;a.style.width=0;a.style.width=b}},Eb:function(b,e){for(var b=a.a.d(b),e=a.a.d(e),c=[],f=b;f<=e;f++)c.push(f);return c}, +L:function(a){for(var b=[],e=0,c=a.length;e<c;e++)b.push(a[e]);return b},tb:6===i,ub:7===i,ja:i,Da:function(b,e){for(var c=a.a.L(b.getElementsByTagName("input")).concat(a.a.L(b.getElementsByTagName("textarea"))),f="string"==typeof e?function(a){return a.name===e}:function(a){return e.test(a.name)},g=[],d=c.length-1;0<=d;d--)f(c[d])&&g.push(c[d]);return g},Bb:function(b){return"string"==typeof b&&(b=a.a.w(b))?window.JSON&&window.JSON.parse?window.JSON.parse(b):(new Function("return "+b))():s},sa:function(b, +e,c){("undefined"==typeof JSON||"undefined"==typeof JSON.stringify)&&m(Error("Cannot find JSON.stringify(). Some browsers (e.g., IE < 8) don't support it natively, but you can overcome this by adding a script reference to json2.js, downloadable from http://www.json.org/json2.js"));return JSON.stringify(a.a.d(b),e,c)},Cb:function(b,e,c){var c=c||{},f=c.params||{},g=c.includeFields||this.Ca,d=b;if("object"==typeof b&&"form"===a.a.o(b))for(var d=b.action,h=g.length-1;0<=h;h--)for(var k=a.a.Da(b,g[h]), +j=k.length-1;0<=j;j--)f[k[j].name]=k[j].value;var e=a.a.d(e),i=document.createElement("form");i.style.display="none";i.action=d;i.method="post";for(var z in e)b=document.createElement("input"),b.name=z,b.value=a.a.sa(a.a.d(e[z])),i.appendChild(b);for(z in f)b=document.createElement("input"),b.name=z,b.value=f[z],i.appendChild(b);document.body.appendChild(i);c.submitter?c.submitter(i):i.submit();setTimeout(function(){i.parentNode.removeChild(i)},0)}}};a.b("utils",a.a);a.b("utils.arrayForEach",a.a.v); +a.b("utils.arrayFirst",a.a.ab);a.b("utils.arrayFilter",a.a.aa);a.b("utils.arrayGetDistinctValues",a.a.za);a.b("utils.arrayIndexOf",a.a.j);a.b("utils.arrayMap",a.a.T);a.b("utils.arrayPushAll",a.a.N);a.b("utils.arrayRemoveItem",a.a.ba);a.b("utils.extend",a.a.extend);a.b("utils.fieldsIncludedWithJsonPost",a.a.Ca);a.b("utils.getFormFields",a.a.Da);a.b("utils.postJson",a.a.Cb);a.b("utils.parseJson",a.a.Bb);a.b("utils.registerEventHandler",a.a.n);a.b("utils.stringifyJson",a.a.sa);a.b("utils.range",a.a.Eb); +a.b("utils.toggleDomNodeCssClass",a.a.Ua);a.b("utils.triggerEvent",a.a.va);a.b("utils.unwrapObservable",a.a.d);Function.prototype.bind||(Function.prototype.bind=function(a){var c=this,d=Array.prototype.slice.call(arguments),a=d.shift();return function(){return c.apply(a,d.concat(Array.prototype.slice.call(arguments)))}});a.a.f=new function(){var b=0,c="__ko__"+(new Date).getTime(),d={};return{get:function(b,c){var e=a.a.f.getAll(b,t);return e===n?n:e[c]},set:function(b,c,e){e===n&&a.a.f.getAll(b, +t)===n||(a.a.f.getAll(b,p)[c]=e)},getAll:function(a,g){var e=a[c];if(!(e&&"null"!==e)){if(!g)return;e=a[c]="ko"+b++;d[e]={}}return d[e]},clear:function(a){var b=a[c];b&&(delete d[b],a[c]=s)}}};a.b("utils.domData",a.a.f);a.b("utils.domData.clear",a.a.f.clear);a.a.G=new function(){function b(b,c){var f=a.a.f.get(b,d);f===n&&c&&(f=[],a.a.f.set(b,d,f));return f}function c(e){var f=b(e,t);if(f)for(var f=f.slice(0),d=0;d<f.length;d++)f[d](e);a.a.f.clear(e);"function"==typeof jQuery&&"function"==typeof jQuery.cleanData&& +jQuery.cleanData([e]);if(g[e.nodeType])for(f=e.firstChild;e=f;)f=e.nextSibling,8===e.nodeType&&c(e)}var d="__ko_domNodeDisposal__"+(new Date).getTime(),f={1:p,8:p,9:p},g={1:p,9:p};return{wa:function(a,c){"function"!=typeof c&&m(Error("Callback must be a function"));b(a,p).push(c)},Ma:function(c,f){var g=b(c,t);g&&(a.a.ba(g,f),0==g.length&&a.a.f.set(c,d,n))},F:function(b){if(f[b.nodeType]&&(c(b),g[b.nodeType])){var d=[];a.a.N(d,b.getElementsByTagName("*"));for(var b=0,j=d.length;b<j;b++)c(d[b])}}, +removeNode:function(b){a.F(b);b.parentNode&&b.parentNode.removeChild(b)}}};a.F=a.a.G.F;a.removeNode=a.a.G.removeNode;a.b("cleanNode",a.F);a.b("removeNode",a.removeNode);a.b("utils.domNodeDisposal",a.a.G);a.b("utils.domNodeDisposal.addDisposeCallback",a.a.G.wa);a.b("utils.domNodeDisposal.removeDisposeCallback",a.a.G.Ma);(function(){a.a.pa=function(b){var c;if("undefined"!=typeof jQuery){if((c=jQuery.clean([b]))&&c[0]){for(b=c[0];b.parentNode&&11!==b.parentNode.nodeType;)b=b.parentNode;b.parentNode&& +b.parentNode.removeChild(b)}}else{var d=a.a.w(b).toLowerCase();c=document.createElement("div");d=d.match(/^<(thead|tbody|tfoot)/)&&[1,"<table>","</table>"]||!d.indexOf("<tr")&&[2,"<table><tbody>","</tbody></table>"]||(!d.indexOf("<td")||!d.indexOf("<th"))&&[3,"<table><tbody><tr>","</tr></tbody></table>"]||[0,"",""];b="ignored<div>"+d[1]+b+d[2]+"</div>";for("function"==typeof window.innerShiv?c.appendChild(window.innerShiv(b)):c.innerHTML=b;d[0]--;)c=c.lastChild;c=a.a.L(c.lastChild.childNodes)}return c}; +a.a.Y=function(b,c){a.a.ga(b);if(c!==s&&c!==n)if("string"!=typeof c&&(c=c.toString()),"undefined"!=typeof jQuery)jQuery(b).html(c);else for(var d=a.a.pa(c),f=0;f<d.length;f++)b.appendChild(d[f])}})();a.b("utils.parseHtmlFragment",a.a.pa);a.b("utils.setHtml",a.a.Y);a.s=function(){function b(){return(4294967296*(1+Math.random())|0).toString(16).substring(1)}function c(b,g){if(b)if(8==b.nodeType){var e=a.s.Ja(b.nodeValue);e!=s&&g.push({jb:b,yb:e})}else if(1==b.nodeType)for(var e=0,d=b.childNodes,j=d.length;e< +j;e++)c(d[e],g)}var d={};return{na:function(a){"function"!=typeof a&&m(Error("You can only pass a function to ko.memoization.memoize()"));var c=b()+b();d[c]=a;return"<\!--[ko_memo:"+c+"]--\>"},Va:function(a,b){var c=d[a];c===n&&m(Error("Couldn't find any memo with ID "+a+". Perhaps it's already been unmemoized."));try{return c.apply(s,b||[]),p}finally{delete d[a]}},Wa:function(b,d){var e=[];c(b,e);for(var h=0,j=e.length;h<j;h++){var k=e[h].jb,i=[k];d&&a.a.N(i,d);a.s.Va(e[h].yb,i);k.nodeValue="";k.parentNode&& +k.parentNode.removeChild(k)}},Ja:function(a){return(a=a.match(/^\[ko_memo\:(.*?)\]$/))?a[1]:s}}}();a.b("memoization",a.s);a.b("memoization.memoize",a.s.na);a.b("memoization.unmemoize",a.s.Va);a.b("memoization.parseMemoText",a.s.Ja);a.b("memoization.unmemoizeDomNodeAndDescendants",a.s.Wa);a.Ba={throttle:function(b,c){b.throttleEvaluation=c;var d=s;return a.h({read:b,write:function(a){clearTimeout(d);d=setTimeout(function(){b(a)},c)}})},notify:function(b,c){b.equalityComparer="always"==c?A(t):a.m.fn.equalityComparer; +return b}};a.b("extenders",a.Ba);a.Sa=function(b,c,d){this.target=b;this.ca=c;this.ib=d;a.B(this,"dispose",this.A)};a.Sa.prototype.A=function(){this.sb=p;this.ib()};a.R=function(){this.u={};a.a.extend(this,a.R.fn);a.B(this,"subscribe",this.ta);a.B(this,"extend",this.extend);a.B(this,"getSubscriptionsCount",this.ob)};a.R.fn={ta:function(b,c,d){var d=d||"change",b=c?b.bind(c):b,f=new a.Sa(this,b,function(){a.a.ba(this.u[d],f)}.bind(this));this.u[d]||(this.u[d]=[]);this.u[d].push(f);return f},notifySubscribers:function(b, +c){c=c||"change";this.u[c]&&a.a.v(this.u[c].slice(0),function(a){a&&a.sb!==p&&a.ca(b)})},ob:function(){var a=0,c;for(c in this.u)this.u.hasOwnProperty(c)&&(a+=this.u[c].length);return a},extend:function(b){var c=this;if(b)for(var d in b){var f=a.Ba[d];"function"==typeof f&&(c=f(c,b[d]))}return c}};a.Ga=function(a){return"function"==typeof a.ta&&"function"==typeof a.notifySubscribers};a.b("subscribable",a.R);a.b("isSubscribable",a.Ga);a.U=function(){var b=[];return{bb:function(a){b.push({ca:a,Aa:[]})}, +end:function(){b.pop()},La:function(c){a.Ga(c)||m(Error("Only subscribable things can act as dependencies"));if(0<b.length){var d=b[b.length-1];0<=a.a.j(d.Aa,c)||(d.Aa.push(c),d.ca(c))}}}}();var G={undefined:p,"boolean":p,number:p,string:p};a.m=function(b){function c(){if(0<arguments.length){if(!c.equalityComparer||!c.equalityComparer(d,arguments[0]))c.I(),d=arguments[0],c.H();return this}a.U.La(c);return d}var d=b;a.R.call(c);c.H=function(){c.notifySubscribers(d)};c.I=function(){c.notifySubscribers(d, +"beforeChange")};a.a.extend(c,a.m.fn);a.B(c,"valueHasMutated",c.H);a.B(c,"valueWillMutate",c.I);return c};a.m.fn={equalityComparer:function(a,c){return a===s||typeof a in G?a===c:t}};var x=a.m.Db="__ko_proto__";a.m.fn[x]=a.m;a.ia=function(b,c){return b===s||b===n||b[x]===n?t:b[x]===c?p:a.ia(b[x],c)};a.la=function(b){return a.ia(b,a.m)};a.Ha=function(b){return"function"==typeof b&&b[x]===a.m||"function"==typeof b&&b[x]===a.h&&b.pb?p:t};a.b("observable",a.m);a.b("isObservable",a.la);a.b("isWriteableObservable", +a.Ha);a.Q=function(b){0==arguments.length&&(b=[]);b!==s&&(b!==n&&!("length"in b))&&m(Error("The argument passed when initializing an observable array must be an array, or null, or undefined."));var c=a.m(b);a.a.extend(c,a.Q.fn);return c};a.Q.fn={remove:function(a){for(var c=this(),d=[],f="function"==typeof a?a:function(c){return c===a},g=0;g<c.length;g++){var e=c[g];f(e)&&(0===d.length&&this.I(),d.push(e),c.splice(g,1),g--)}d.length&&this.H();return d},removeAll:function(b){if(b===n){var c=this(), +d=c.slice(0);this.I();c.splice(0,c.length);this.H();return d}return!b?[]:this.remove(function(c){return 0<=a.a.j(b,c)})},destroy:function(a){var c=this(),d="function"==typeof a?a:function(c){return c===a};this.I();for(var f=c.length-1;0<=f;f--)d(c[f])&&(c[f]._destroy=p);this.H()},destroyAll:function(b){return b===n?this.destroy(A(p)):!b?[]:this.destroy(function(c){return 0<=a.a.j(b,c)})},indexOf:function(b){var c=this();return a.a.j(c,b)},replace:function(a,c){var d=this.indexOf(a);0<=d&&(this.I(), +this()[d]=c,this.H())}};a.a.v("pop push reverse shift sort splice unshift".split(" "),function(b){a.Q.fn[b]=function(){var a=this();this.I();a=a[b].apply(a,arguments);this.H();return a}});a.a.v(["slice"],function(b){a.Q.fn[b]=function(){var a=this();return a[b].apply(a,arguments)}});a.b("observableArray",a.Q);a.h=function(b,c,d){function f(){a.a.v(v,function(a){a.A()});v=[]}function g(){var a=h.throttleEvaluation;a&&0<=a?(clearTimeout(x),x=setTimeout(e,a)):e()}function e(){if(!l)if(i&&w())u();else{l= +p;try{var b=a.a.T(v,function(a){return a.target});a.U.bb(function(c){var e;0<=(e=a.a.j(b,c))?b[e]=n:v.push(c.ta(g))});for(var e=q.call(c),f=b.length-1;0<=f;f--)b[f]&&v.splice(f,1)[0].A();i=p;h.notifySubscribers(k,"beforeChange");k=e}finally{a.U.end()}h.notifySubscribers(k);l=t}}function h(){if(0<arguments.length)j.apply(h,arguments);else return i||e(),a.U.La(h),k}function j(){"function"===typeof o?o.apply(c,arguments):m(Error("Cannot write a value to a ko.computed unless you specify a 'write' option. If you wish to read the current value, don't pass any parameters."))} +var k,i=t,l=t,q=b;q&&"object"==typeof q?(d=q,q=d.read):(d=d||{},q||(q=d.read));"function"!=typeof q&&m(Error("Pass a function that returns the value of the ko.computed"));var o=d.write;c||(c=d.owner);var v=[],u=f,r="object"==typeof d.disposeWhenNodeIsRemoved?d.disposeWhenNodeIsRemoved:s,w=d.disposeWhen||A(t);if(r){u=function(){a.a.G.Ma(r,arguments.callee);f()};a.a.G.wa(r,u);var y=w,w=function(){return!a.a.fa(r)||y()}}var x=s;h.nb=function(){return v.length};h.pb="function"===typeof d.write;h.A=function(){u()}; +a.R.call(h);a.a.extend(h,a.h.fn);d.deferEvaluation!==p&&e();a.B(h,"dispose",h.A);a.B(h,"getDependenciesCount",h.nb);return h};a.rb=function(b){return a.ia(b,a.h)};w=a.m.Db;a.h[w]=a.m;a.h.fn={};a.h.fn[w]=a.h;a.b("dependentObservable",a.h);a.b("computed",a.h);a.b("isComputed",a.rb);(function(){function b(a,g,e){e=e||new d;a=g(a);if(!("object"==typeof a&&a!==s&&a!==n&&!(a instanceof Date)))return a;var h=a instanceof Array?[]:{};e.save(a,h);c(a,function(c){var d=g(a[c]);switch(typeof d){case "boolean":case "number":case "string":case "function":h[c]= +d;break;case "object":case "undefined":var i=e.get(d);h[c]=i!==n?i:b(d,g,e)}});return h}function c(a,b){if(a instanceof Array){for(var c=0;c<a.length;c++)b(c);"function"==typeof a.toJSON&&b("toJSON")}else for(c in a)b(c)}function d(){var b=[],c=[];this.save=function(e,d){var j=a.a.j(b,e);0<=j?c[j]=d:(b.push(e),c.push(d))};this.get=function(e){e=a.a.j(b,e);return 0<=e?c[e]:n}}a.Ta=function(c){0==arguments.length&&m(Error("When calling ko.toJS, pass the object you want to convert."));return b(c,function(b){for(var c= +0;a.la(b)&&10>c;c++)b=b();return b})};a.toJSON=function(b,c,e){b=a.Ta(b);return a.a.sa(b,c,e)}})();a.b("toJS",a.Ta);a.b("toJSON",a.toJSON);(function(){a.k={r:function(b){switch(a.a.o(b)){case "option":return b.__ko__hasDomDataOptionValue__===p?a.a.f.get(b,a.c.options.oa):b.getAttribute("value");case "select":return 0<=b.selectedIndex?a.k.r(b.options[b.selectedIndex]):n;default:return b.value}},S:function(b,c){switch(a.a.o(b)){case "option":switch(typeof c){case "string":a.a.f.set(b,a.c.options.oa, +n);"__ko__hasDomDataOptionValue__"in b&&delete b.__ko__hasDomDataOptionValue__;b.value=c;break;default:a.a.f.set(b,a.c.options.oa,c),b.__ko__hasDomDataOptionValue__=p,b.value="number"===typeof c?c:""}break;case "select":for(var d=b.options.length-1;0<=d;d--)if(a.k.r(b.options[d])==c){b.selectedIndex=d;break}break;default:if(c===s||c===n)c="";b.value=c}}}})();a.b("selectExtensions",a.k);a.b("selectExtensions.readValue",a.k.r);a.b("selectExtensions.writeValue",a.k.S);a.g=function(){function b(a,b){for(var d= +s;a!=d;)d=a,a=a.replace(c,function(a,c){return b[c]});return a}var c=/\@ko_token_(\d+)\@/g,d=/^[\_$a-z][\_$a-z0-9]*(\[.*?\])*(\.[\_$a-z][\_$a-z0-9]*(\[.*?\])*)*$/i,f=["true","false"];return{D:[],W:function(c){var e=a.a.w(c);if(3>e.length)return[];"{"===e.charAt(0)&&(e=e.substring(1,e.length-1));for(var c=[],d=s,f,k=0;k<e.length;k++){var i=e.charAt(k);if(d===s)switch(i){case '"':case "'":case "/":d=k,f=i}else if(i==f&&"\\"!==e.charAt(k-1)){i=e.substring(d,k+1);c.push(i);var l="@ko_token_"+(c.length- +1)+"@",e=e.substring(0,d)+l+e.substring(k+1),k=k-(i.length-l.length),d=s}}f=d=s;for(var q=0,o=s,k=0;k<e.length;k++){i=e.charAt(k);if(d===s)switch(i){case "{":d=k;o=i;f="}";break;case "(":d=k;o=i;f=")";break;case "[":d=k,o=i,f="]"}i===o?q++:i===f&&(q--,0===q&&(i=e.substring(d,k+1),c.push(i),l="@ko_token_"+(c.length-1)+"@",e=e.substring(0,d)+l+e.substring(k+1),k-=i.length-l.length,d=s))}f=[];e=e.split(",");d=0;for(k=e.length;d<k;d++)q=e[d],o=q.indexOf(":"),0<o&&o<q.length-1?(i=q.substring(o+1),f.push({key:b(q.substring(0, +o),c),value:b(i,c)})):f.push({unknown:b(q,c)});return f},ka:function(b){for(var c="string"===typeof b?a.g.W(b):b,h=[],b=[],j,k=0;j=c[k];k++)if(0<h.length&&h.push(","),j.key){var i;a:{i=j.key;var l=a.a.w(i);switch(l.length&&l.charAt(0)){case "'":case '"':break a;default:i="'"+l+"'"}}j=j.value;h.push(i);h.push(":");h.push(j);l=a.a.w(j);if(0<=a.a.j(f,a.a.w(l).toLowerCase())?0:l.match(d)!==s)0<b.length&&b.push(", "),b.push(i+" : function(__ko_value) { "+j+" = __ko_value; }")}else j.unknown&&h.push(j.unknown); +c=h.join("");0<b.length&&(c=c+", '_ko_property_writers' : { "+b.join("")+" } ");return c},wb:function(b,c){for(var d=0;d<b.length;d++)if(a.a.w(b[d].key)==c)return p;return t},$:function(b,c,d,f,k){if(!b||!a.Ha(b)){if((b=c()._ko_property_writers)&&b[d])b[d](f)}else(!k||b()!==f)&&b(f)}}}();a.b("jsonExpressionRewriting",a.g);a.b("jsonExpressionRewriting.bindingRewriteValidators",a.g.D);a.b("jsonExpressionRewriting.parseObjectLiteral",a.g.W);a.b("jsonExpressionRewriting.insertPropertyAccessorsIntoJson", +a.g.ka);(function(){function b(a){return 8==a.nodeType&&(g?a.text:a.nodeValue).match(e)}function c(a){return 8==a.nodeType&&(g?a.text:a.nodeValue).match(h)}function d(a,e){for(var d=a,f=1,g=[];d=d.nextSibling;){if(c(d)&&(f--,0===f))return g;g.push(d);b(d)&&f++}e||m(Error("Cannot find closing comment tag to match: "+a.nodeValue));return s}function f(a,b){var c=d(a,b);return c?0<c.length?c[c.length-1].nextSibling:a.nextSibling:s}var g="<\!--test--\>"===document.createComment("test").text,e=g?/^<\!--\s*ko\s+(.*\:.*)\s*--\>$/: +/^\s*ko\s+(.*\:.*)\s*$/,h=g?/^<\!--\s*\/ko\s*--\>$/:/^\s*\/ko\s*$/,j={ul:p,ol:p};a.e={C:{},childNodes:function(a){return b(a)?d(a):a.childNodes},ha:function(c){if(b(c))for(var c=a.e.childNodes(c),e=0,d=c.length;e<d;e++)a.removeNode(c[e]);else a.a.ga(c)},X:function(c,e){if(b(c)){a.e.ha(c);for(var d=c.nextSibling,f=0,g=e.length;f<g;f++)d.parentNode.insertBefore(e[f],d)}else a.a.X(c,e)},Ka:function(a,c){b(a)?a.parentNode.insertBefore(c,a.nextSibling):a.firstChild?a.insertBefore(c,a.firstChild):a.appendChild(c)}, +Fa:function(a,c,e){b(a)?a.parentNode.insertBefore(c,e.nextSibling):e.nextSibling?a.insertBefore(c,e.nextSibling):a.appendChild(c)},firstChild:function(a){return!b(a)?a.firstChild:!a.nextSibling||c(a.nextSibling)?s:a.nextSibling},nextSibling:function(a){b(a)&&(a=f(a));return a.nextSibling&&c(a.nextSibling)?s:a.nextSibling},Xa:function(a){return(a=b(a))?a[1]:s},Ia:function(e){if(j[a.a.o(e)]){var d=e.firstChild;if(d){do if(1===d.nodeType){var g;g=d.firstChild;var h=s;if(g){do if(h)h.push(g);else if(b(g)){var o= +f(g,p);o?g=o:h=[g]}else c(g)&&(h=[g]);while(g=g.nextSibling)}if(g=h){h=d.nextSibling;for(o=0;o<g.length;o++)h?e.insertBefore(g[o],h):e.appendChild(g[o])}}while(d=d.nextSibling)}}}}})();a.b("virtualElements",a.e);a.b("virtualElements.allowedBindings",a.e.C);a.b("virtualElements.emptyNode",a.e.ha);a.b("virtualElements.insertAfter",a.e.Fa);a.b("virtualElements.prepend",a.e.Ka);a.b("virtualElements.setDomNodeChildren",a.e.X);(function(){a.J=function(){this.cb={}};a.a.extend(a.J.prototype,{nodeHasBindings:function(b){switch(b.nodeType){case 1:return b.getAttribute("data-bind")!= +s;case 8:return a.e.Xa(b)!=s;default:return t}},getBindings:function(a,c){var d=this.getBindingsString(a,c);return d?this.parseBindingsString(d,c):s},getBindingsString:function(b){switch(b.nodeType){case 1:return b.getAttribute("data-bind");case 8:return a.e.Xa(b);default:return s}},parseBindingsString:function(b,c){try{var d=c.$data,d="object"==typeof d&&d!=s?[d,c]:[c],f=d.length,g=this.cb,e=f+"_"+b,h;if(!(h=g[e])){var j=" { "+a.g.ka(b)+" } ";h=g[e]=a.a.eb(j,f)}return h(d)}catch(k){m(Error("Unable to parse bindings.\nMessage: "+ +k+";\nBindings value: "+b))}}});a.J.instance=new a.J})();a.b("bindingProvider",a.J);(function(){function b(b,d,e){for(var h=a.e.firstChild(d);d=h;)h=a.e.nextSibling(d),c(b,d,e)}function c(c,g,e){var h=p,j=1===g.nodeType;j&&a.e.Ia(g);if(j&&e||a.J.instance.nodeHasBindings(g))h=d(g,s,c,e).Gb;h&&b(c,g,!j)}function d(b,c,e,d){function j(a){return function(){return l[a]}}function k(){return l}var i=0,l,q;a.h(function(){var o=e&&e instanceof a.z?e:new a.z(a.a.d(e)),v=o.$data;d&&a.Ra(b,o);if(l=("function"== +typeof c?c():c)||a.J.instance.getBindings(b,o)){if(0===i){i=1;for(var u in l){var r=a.c[u];r&&8===b.nodeType&&!a.e.C[u]&&m(Error("The binding '"+u+"' cannot be used with virtual elements"));if(r&&"function"==typeof r.init&&(r=(0,r.init)(b,j(u),k,v,o))&&r.controlsDescendantBindings)q!==n&&m(Error("Multiple bindings ("+q+" and "+u+") are trying to control descendant bindings of the same element. You cannot use these bindings together on the same element.")),q=u}i=2}if(2===i)for(u in l)(r=a.c[u])&&"function"== +typeof r.update&&(0,r.update)(b,j(u),k,v,o)}},s,{disposeWhenNodeIsRemoved:b});return{Gb:q===n}}a.c={};a.z=function(b,c){c?(a.a.extend(this,c),this.$parentContext=c,this.$parent=c.$data,this.$parents=(c.$parents||[]).slice(0),this.$parents.unshift(this.$parent)):(this.$parents=[],this.$root=b);this.$data=b};a.z.prototype.createChildContext=function(b){return new a.z(b,this)};a.z.prototype.extend=function(b){var c=a.a.extend(new a.z,this);return a.a.extend(c,b)};a.Ra=function(b,c){if(2==arguments.length)a.a.f.set(b, +"__ko_bindingContext__",c);else return a.a.f.get(b,"__ko_bindingContext__")};a.ya=function(b,c,e){1===b.nodeType&&a.e.Ia(b);return d(b,c,e,p)};a.Ya=function(a,c){(1===c.nodeType||8===c.nodeType)&&b(a,c,p)};a.xa=function(a,b){b&&(1!==b.nodeType&&8!==b.nodeType)&&m(Error("ko.applyBindings: first parameter should be your view model; second parameter should be a DOM node"));b=b||window.document.body;c(a,b,p)};a.ea=function(b){switch(b.nodeType){case 1:case 8:var c=a.Ra(b);if(c)return c;if(b.parentNode)return a.ea(b.parentNode)}}; +a.hb=function(b){return(b=a.ea(b))?b.$data:n};a.b("bindingHandlers",a.c);a.b("applyBindings",a.xa);a.b("applyBindingsToDescendants",a.Ya);a.b("applyBindingsToNode",a.ya);a.b("contextFor",a.ea);a.b("dataFor",a.hb)})();a.a.v(["click"],function(b){a.c[b]={init:function(c,d,f,g){return a.c.event.init.call(this,c,function(){var a={};a[b]=d();return a},f,g)}}});a.c.event={init:function(b,c,d,f){var g=c()||{},e;for(e in g)(function(){var g=e;"string"==typeof g&&a.a.n(b,g,function(b){var e,i=c()[g];if(i){var l= +d();try{var q=a.a.L(arguments);q.unshift(f);e=i.apply(f,q)}finally{e!==p&&(b.preventDefault?b.preventDefault():b.returnValue=t)}l[g+"Bubble"]===t&&(b.cancelBubble=p,b.stopPropagation&&b.stopPropagation())}})})()}};a.c.submit={init:function(b,c,d,f){"function"!=typeof c()&&m(Error("The value for a submit binding must be a function"));a.a.n(b,"submit",function(a){var e,d=c();try{e=d.call(f,b)}finally{e!==p&&(a.preventDefault?a.preventDefault():a.returnValue=t)}})}};a.c.visible={update:function(b,c){var d= +a.a.d(c()),f="none"!=b.style.display;d&&!f?b.style.display="":!d&&f&&(b.style.display="none")}};a.c.enable={update:function(b,c){var d=a.a.d(c());d&&b.disabled?b.removeAttribute("disabled"):!d&&!b.disabled&&(b.disabled=p)}};a.c.disable={update:function(b,c){a.c.enable.update(b,function(){return!a.a.d(c())})}};a.c.value={init:function(b,c,d){function f(){var e=c(),f=a.k.r(b);a.g.$(e,d,"value",f,p)}var g=["change"],e=d().valueUpdate;e&&("string"==typeof e&&(e=[e]),a.a.N(g,e),g=a.a.za(g));if(a.a.ja&& +("input"==b.tagName.toLowerCase()&&"text"==b.type&&"off"!=b.autocomplete&&(!b.form||"off"!=b.form.autocomplete))&&-1==a.a.j(g,"propertychange")){var h=t;a.a.n(b,"propertychange",function(){h=p});a.a.n(b,"blur",function(){if(h){h=t;f()}})}a.a.v(g,function(c){var e=f;if(a.a.Hb(c,"after")){e=function(){setTimeout(f,0)};c=c.substring(5)}a.a.n(b,c,e)})},update:function(b,c){var d="select"===a.a.o(b),f=a.a.d(c()),g=a.k.r(b),e=f!=g;0===f&&(0!==g&&"0"!==g)&&(e=p);e&&(g=function(){a.k.S(b,f)},g(),d&&setTimeout(g, +0));d&&0<b.length&&B(b,f,t)}};a.c.options={update:function(b,c,d){"select"!==a.a.o(b)&&m(Error("options binding applies only to SELECT elements"));for(var f=0==b.length,g=a.a.T(a.a.aa(b.childNodes,function(b){return b.tagName&&"option"===a.a.o(b)&&b.selected}),function(b){return a.k.r(b)||b.innerText||b.textContent}),e=b.scrollTop,h=a.a.d(c());0<b.length;)a.F(b.options[0]),b.remove(0);if(h){d=d();"number"!=typeof h.length&&(h=[h]);if(d.optionsCaption){var j=document.createElement("option");a.a.Y(j, +d.optionsCaption);a.k.S(j,n);b.appendChild(j)}for(var c=0,k=h.length;c<k;c++){var j=document.createElement("option"),i="string"==typeof d.optionsValue?h[c][d.optionsValue]:h[c],i=a.a.d(i);a.k.S(j,i);var l=d.optionsText,i="function"==typeof l?l(h[c]):"string"==typeof l?h[c][l]:i;if(i===s||i===n)i="";a.a.Qa(j,i);b.appendChild(j)}h=b.getElementsByTagName("option");c=j=0;for(k=h.length;c<k;c++)0<=a.a.j(g,a.k.r(h[c]))&&(a.a.Pa(h[c],p),j++);b.scrollTop=e;f&&"value"in d&&B(b,a.a.d(d.value),p);a.a.lb(b)}}}; +a.c.options.oa="__ko.optionValueDomData__";a.c.selectedOptions={Ea:function(b){for(var c=[],b=b.childNodes,d=0,f=b.length;d<f;d++){var g=b[d],e=a.a.o(g);"option"==e&&g.selected?c.push(a.k.r(g)):"optgroup"==e&&(g=a.c.selectedOptions.Ea(g),Array.prototype.splice.apply(c,[c.length,0].concat(g)))}return c},init:function(b,c,d){a.a.n(b,"change",function(){var b=c(),g=a.c.selectedOptions.Ea(this);a.g.$(b,d,"value",g)})},update:function(b,c){"select"!=a.a.o(b)&&m(Error("values binding applies only to SELECT elements")); +var d=a.a.d(c());if(d&&"number"==typeof d.length)for(var f=b.childNodes,g=0,e=f.length;g<e;g++){var h=f[g];"option"===a.a.o(h)&&a.a.Pa(h,0<=a.a.j(d,a.k.r(h)))}}};a.c.text={update:function(b,c){a.a.Qa(b,c())}};a.c.html={init:function(){return{controlsDescendantBindings:p}},update:function(b,c){var d=a.a.d(c());a.a.Y(b,d)}};a.c.css={update:function(b,c){var d=a.a.d(c()||{}),f;for(f in d)if("string"==typeof f){var g=a.a.d(d[f]);a.a.Ua(b,f,g)}}};a.c.style={update:function(b,c){var d=a.a.d(c()||{}),f; +for(f in d)if("string"==typeof f){var g=a.a.d(d[f]);b.style[f]=g||""}}};a.c.uniqueName={init:function(b,c){c()&&(b.name="ko_unique_"+ ++a.c.uniqueName.gb,(a.a.tb||a.a.ub)&&b.mergeAttributes(document.createElement("<input name='"+b.name+"'/>"),t))}};a.c.uniqueName.gb=0;a.c.checked={init:function(b,c,d){a.a.n(b,"click",function(){var f;if("checkbox"==b.type)f=b.checked;else if("radio"==b.type&&b.checked)f=b.value;else return;var g=c();"checkbox"==b.type&&a.a.d(g)instanceof Array?(f=a.a.j(a.a.d(g),b.value), +b.checked&&0>f?g.push(b.value):!b.checked&&0<=f&&g.splice(f,1)):a.g.$(g,d,"checked",f,p)});"radio"==b.type&&!b.name&&a.c.uniqueName.init(b,A(p))},update:function(b,c){var d=a.a.d(c());"checkbox"==b.type?b.checked=d instanceof Array?0<=a.a.j(d,b.value):d:"radio"==b.type&&(b.checked=b.value==d)}};var F={"class":"className","for":"htmlFor"};a.c.attr={update:function(b,c){var d=a.a.d(c())||{},f;for(f in d)if("string"==typeof f){var g=a.a.d(d[f]),e=g===t||g===s||g===n;e&&b.removeAttribute(f);8>=a.a.ja&& +f in F?(f=F[f],e?b.removeAttribute(f):b[f]=g):e||b.setAttribute(f,g.toString())}}};a.c.hasfocus={init:function(b,c,d){function f(b){var e=c();a.g.$(e,d,"hasfocus",b,p)}a.a.n(b,"focus",function(){f(p)});a.a.n(b,"focusin",function(){f(p)});a.a.n(b,"blur",function(){f(t)});a.a.n(b,"focusout",function(){f(t)})},update:function(b,c){var d=a.a.d(c());d?b.focus():b.blur();a.a.va(b,d?"focusin":"focusout")}};a.c["with"]={p:function(b){return function(){var c=b();return{"if":c,data:c,templateEngine:a.q.K}}}, +init:function(b,c){return a.c.template.init(b,a.c["with"].p(c))},update:function(b,c,d,f,g){return a.c.template.update(b,a.c["with"].p(c),d,f,g)}};a.g.D["with"]=t;a.e.C["with"]=p;a.c["if"]={p:function(b){return function(){return{"if":b(),templateEngine:a.q.K}}},init:function(b,c){return a.c.template.init(b,a.c["if"].p(c))},update:function(b,c,d,f,g){return a.c.template.update(b,a.c["if"].p(c),d,f,g)}};a.g.D["if"]=t;a.e.C["if"]=p;a.c.ifnot={p:function(b){return function(){return{ifnot:b(),templateEngine:a.q.K}}}, +init:function(b,c){return a.c.template.init(b,a.c.ifnot.p(c))},update:function(b,c,d,f,g){return a.c.template.update(b,a.c.ifnot.p(c),d,f,g)}};a.g.D.ifnot=t;a.e.C.ifnot=p;a.c.foreach={p:function(b){return function(){var c=a.a.d(b());return!c||"number"==typeof c.length?{foreach:c,templateEngine:a.q.K}:{foreach:c.data,includeDestroyed:c.includeDestroyed,afterAdd:c.afterAdd,beforeRemove:c.beforeRemove,afterRender:c.afterRender,templateEngine:a.q.K}}},init:function(b,c){return a.c.template.init(b,a.c.foreach.p(c))}, +update:function(b,c,d,f,g){return a.c.template.update(b,a.c.foreach.p(c),d,f,g)}};a.g.D.foreach=t;a.e.C.foreach=p;a.t=function(){};a.t.prototype.renderTemplateSource=function(){m(Error("Override renderTemplateSource"))};a.t.prototype.createJavaScriptEvaluatorBlock=function(){m(Error("Override createJavaScriptEvaluatorBlock"))};a.t.prototype.makeTemplateSource=function(b,c){if("string"==typeof b){var c=c||document,d=c.getElementById(b);d||m(Error("Cannot find template with ID "+b));return new a.l.i(d)}if(1== +b.nodeType||8==b.nodeType)return new a.l.M(b);m(Error("Unknown template type: "+b))};a.t.prototype.renderTemplate=function(a,c,d,f){return this.renderTemplateSource(this.makeTemplateSource(a,f),c,d)};a.t.prototype.isTemplateRewritten=function(a,c){return this.allowTemplateRewriting===t||!(c&&c!=document)&&this.V&&this.V[a]?p:this.makeTemplateSource(a,c).data("isRewritten")};a.t.prototype.rewriteTemplate=function(a,c,d){var f=this.makeTemplateSource(a,d),c=c(f.text());f.text(c);f.data("isRewritten", +p);!(d&&d!=document)&&"string"==typeof a&&(this.V=this.V||{},this.V[a]=p)};a.b("templateEngine",a.t);a.Z=function(){function b(b,c,e){for(var b=a.g.W(b),d=a.g.D,j=0;j<b.length;j++){var k=b[j].key;if(d.hasOwnProperty(k)){var i=d[k];"function"===typeof i?(k=i(b[j].value))&&m(Error(k)):i||m(Error("This template engine does not support the '"+k+"' binding within its templates"))}}b="ko.templateRewriting.applyMemoizedBindingsToNextSibling(function() { return (function() { return { "+a.g.ka(b)+ +" } })() })";return e.createJavaScriptEvaluatorBlock(b)+c}var c=/(<[a-z]+\d*(\s+(?!data-bind=)[a-z0-9\-]+(=(\"[^\"]*\"|\'[^\']*\'))?)*\s+)data-bind=(["'])([\s\S]*?)\5/gi,d=/<\!--\s*ko\b\s*([\s\S]*?)\s*--\>/g;return{mb:function(b,c,e){c.isTemplateRewritten(b,e)||c.rewriteTemplate(b,function(b){return a.Z.zb(b,c)},e)},zb:function(a,g){return a.replace(c,function(a,c,d,f,i,l,q){return b(q,c,g)}).replace(d,function(a,c){return b(c,"<\!-- ko --\>",g)})},Za:function(b){return a.s.na(function(c, +e){c.nextSibling&&a.ya(c.nextSibling,b,e)})}}}();a.b("templateRewriting",a.Z);a.b("templateRewriting.applyMemoizedBindingsToNextSibling",a.Z.Za);(function(){a.l={};a.l.i=function(a){this.i=a};a.l.i.prototype.text=function(){var b=a.a.o(this.i),b="script"===b?"text":"textarea"===b?"value":"innerHTML";if(0==arguments.length)return this.i[b];var c=arguments[0];"innerHTML"===b?a.a.Y(this.i,c):this.i[b]=c};a.l.i.prototype.data=function(b){if(1===arguments.length)return a.a.f.get(this.i,"templateSourceData_"+ +b);a.a.f.set(this.i,"templateSourceData_"+b,arguments[1])};a.l.M=function(a){this.i=a};a.l.M.prototype=new a.l.i;a.l.M.prototype.text=function(){if(0==arguments.length){var b=a.a.f.get(this.i,"__ko_anon_template__")||{};b.ua===n&&b.da&&(b.ua=b.da.innerHTML);return b.ua}a.a.f.set(this.i,"__ko_anon_template__",{ua:arguments[0]})};a.l.i.prototype.nodes=function(){if(0==arguments.length)return(a.a.f.get(this.i,"__ko_anon_template__")||{}).da;a.a.f.set(this.i,"__ko_anon_template__",{da:arguments[0]})}; +a.b("templateSources",a.l);a.b("templateSources.domElement",a.l.i);a.b("templateSources.anonymousTemplate",a.l.M)})();(function(){function b(b,c,d){for(var f,c=a.e.nextSibling(c);b&&(f=b)!==c;)b=a.e.nextSibling(f),(1===f.nodeType||8===f.nodeType)&&d(f)}function c(c,d){if(c.length){var f=c[0],g=c[c.length-1];b(f,g,function(b){a.xa(d,b)});b(f,g,function(b){a.s.Wa(b,[d])})}}function d(a){return a.nodeType?a:0<a.length?a[0]:s}function f(b,f,j,k,i){var i=i||{},l=b&&d(b),l=l&&l.ownerDocument,q=i.templateEngine|| +g;a.Z.mb(j,q,l);j=q.renderTemplate(j,k,i,l);("number"!=typeof j.length||0<j.length&&"number"!=typeof j[0].nodeType)&&m(Error("Template engine must return an array of DOM nodes"));l=t;switch(f){case "replaceChildren":a.e.X(b,j);l=p;break;case "replaceNode":a.a.Na(b,j);l=p;break;case "ignoreTargetNode":break;default:m(Error("Unknown renderMode: "+f))}l&&(c(j,k),i.afterRender&&i.afterRender(j,k.$data));return j}var g;a.ra=function(b){b!=n&&!(b instanceof a.t)&&m(Error("templateEngine must inherit from ko.templateEngine")); +g=b};a.qa=function(b,c,j,k,i){j=j||{};(j.templateEngine||g)==n&&m(Error("Set a template engine before calling renderTemplate"));i=i||"replaceChildren";if(k){var l=d(k);return a.h(function(){var g=c&&c instanceof a.z?c:new a.z(a.a.d(c)),o="function"==typeof b?b(g.$data):b,g=f(k,i,o,g,j);"replaceNode"==i&&(k=g,l=d(k))},s,{disposeWhen:function(){return!l||!a.a.fa(l)},disposeWhenNodeIsRemoved:l&&"replaceNode"==i?l.parentNode:l})}return a.s.na(function(d){a.qa(b,c,j,d,"replaceNode")})};a.Fb=function(b, +d,g,k,i){function l(a,b){c(b,o);g.afterRender&&g.afterRender(b,a)}function q(c,d){var h="function"==typeof b?b(c):b;o=i.createChildContext(a.a.d(c));o.$index=d;return f(s,"ignoreTargetNode",h,o,g)}var o;return a.h(function(){var b=a.a.d(d)||[];"undefined"==typeof b.length&&(b=[b]);b=a.a.aa(b,function(b){return g.includeDestroyed||b===n||b===s||!a.a.d(b._destroy)});a.a.Oa(k,b,q,g,l)},s,{disposeWhenNodeIsRemoved:k})};a.c.template={init:function(b,c){var d=a.a.d(c());if("string"!=typeof d&&!d.name&& +(1==b.nodeType||8==b.nodeType))d=1==b.nodeType?b.childNodes:a.e.childNodes(b),d=a.a.Ab(d),(new a.l.M(b)).nodes(d);return{controlsDescendantBindings:p}},update:function(b,c,d,f,g){c=a.a.d(c());f=p;"string"==typeof c?d=c:(d=c.name,"if"in c&&(f=f&&a.a.d(c["if"])),"ifnot"in c&&(f=f&&!a.a.d(c.ifnot)));var l=s;"object"===typeof c&&"foreach"in c?l=a.Fb(d||b,f&&c.foreach||[],c,b,g):f?(g="object"==typeof c&&"data"in c?g.createChildContext(a.a.d(c.data)):g,l=a.qa(d||b,g,c,b)):a.e.ha(b);g=l;(c=a.a.f.get(b,"__ko__templateSubscriptionDomDataKey__"))&& +"function"==typeof c.A&&c.A();a.a.f.set(b,"__ko__templateSubscriptionDomDataKey__",g)}};a.g.D.template=function(b){b=a.g.W(b);return 1==b.length&&b[0].unknown||a.g.wb(b,"name")?s:"This template engine does not support anonymous templates nested within its templates"};a.e.C.template=p})();a.b("setTemplateEngine",a.ra);a.b("renderTemplate",a.qa);(function(){a.a.O=function(b,c,d){if(d===n)return a.a.O(b,c,1)||a.a.O(b,c,10)||a.a.O(b,c,Number.MAX_VALUE);for(var b=b||[],c=c||[],f=b,g=c,e=[],h=0;h<=g.length;h++)e[h]= +[];for(var h=0,j=Math.min(f.length,d);h<=j;h++)e[0][h]=h;h=1;for(j=Math.min(g.length,d);h<=j;h++)e[h][0]=h;for(var j=f.length,k,i=g.length,h=1;h<=j;h++){k=Math.max(1,h-d);for(var l=Math.min(i,h+d);k<=l;k++)e[k][h]=f[h-1]===g[k-1]?e[k-1][h-1]:Math.min(e[k-1][h]===n?Number.MAX_VALUE:e[k-1][h]+1,e[k][h-1]===n?Number.MAX_VALUE:e[k][h-1]+1)}d=b.length;f=c.length;g=[];h=e[f][d];if(h===n)e=s;else{for(;0<d||0<f;){j=e[f][d];i=0<f?e[f-1][d]:h+1;l=0<d?e[f][d-1]:h+1;k=0<f&&0<d?e[f-1][d-1]:h+1;if(i===n||i<j-1)i= +h+1;if(l===n||l<j-1)l=h+1;k<j-1&&(k=h+1);i<=l&&i<k?(g.push({status:"added",value:c[f-1]}),f--):(l<i&&l<k?g.push({status:"deleted",value:b[d-1]}):(g.push({status:"retained",value:b[d-1]}),f--),d--)}e=g.reverse()}return e}})();a.b("utils.compareArrays",a.a.O);(function(){function b(a){if(2<a.length){for(var b=a[0],c=a[a.length-1],e=[b];b!==c;){b=b.nextSibling;if(!b)return;e.push(b)}Array.prototype.splice.apply(a,[0,a.length].concat(e))}}function c(c,f,g,e,h){var j=[],c=a.h(function(){var c=f(g,h)|| +[];0<j.length&&(b(j),a.a.Na(j,c),e&&e(g,c));j.splice(0,j.length);a.a.N(j,c)},s,{disposeWhenNodeIsRemoved:c,disposeWhen:function(){return 0==j.length||!a.a.fa(j[0])}});return{xb:j,h:c}}a.a.Oa=function(d,f,g,e,h){for(var f=f||[],e=e||{},j=a.a.f.get(d,"setDomNodeChildrenFromArrayMapping_lastMappingResult")===n,k=a.a.f.get(d,"setDomNodeChildrenFromArrayMapping_lastMappingResult")||[],i=a.a.T(k,function(a){return a.$a}),l=a.a.O(i,f),f=[],q=0,o=[],v=0,i=[],u=s,r=0,w=l.length;r<w;r++)switch(l[r].status){case "retained":var y= +k[q];y.qb(v);v=f.push(y);0<y.P.length&&(u=y.P[y.P.length-1]);q++;break;case "deleted":k[q].h.A();b(k[q].P);a.a.v(k[q].P,function(a){o.push({element:a,index:r,value:l[r].value});u=a});q++;break;case "added":for(var y=l[r].value,x=a.m(v),v=c(d,g,y,h,x),C=v.xb,v=f.push({$a:l[r].value,P:C,h:v.h,qb:x}),z=0,B=C.length;z<B;z++){var D=C[z];i.push({element:D,index:r,value:l[r].value});u==s?a.e.Ka(d,D):a.e.Fa(d,D,u);u=D}h&&h(y,C,x)}a.a.v(o,function(b){a.F(b.element)});g=t;if(!j){if(e.afterAdd)for(r=0;r<i.length;r++)e.afterAdd(i[r].element, +i[r].index,i[r].value);if(e.beforeRemove){for(r=0;r<o.length;r++)e.beforeRemove(o[r].element,o[r].index,o[r].value);g=p}}if(!g&&o.length)for(r=0;r<o.length;r++)e=o[r].element,e.parentNode&&e.parentNode.removeChild(e);a.a.f.set(d,"setDomNodeChildrenFromArrayMapping_lastMappingResult",f)}})();a.b("utils.setDomNodeChildrenFromArrayMapping",a.a.Oa);a.q=function(){this.allowTemplateRewriting=t};a.q.prototype=new a.t;a.q.prototype.renderTemplateSource=function(b){var c=!(9>a.a.ja)&&b.nodes?b.nodes():s; +if(c)return a.a.L(c.cloneNode(p).childNodes);b=b.text();return a.a.pa(b)};a.q.K=new a.q;a.ra(a.q.K);a.b("nativeTemplateEngine",a.q);(function(){a.ma=function(){var a=this.vb=function(){if("undefined"==typeof jQuery||!jQuery.tmpl)return 0;try{if(0<=jQuery.tmpl.tag.tmpl.open.toString().indexOf("__"))return 2}catch(a){}return 1}();this.renderTemplateSource=function(b,f,g){g=g||{};2>a&&m(Error("Your version of jQuery.tmpl is too old. Please upgrade to jQuery.tmpl 1.0.0pre or later."));var e=b.data("precompiled"); +e||(e=b.text()||"",e=jQuery.template(s,"{{ko_with $item.koBindingContext}}"+e+"{{/ko_with}}"),b.data("precompiled",e));b=[f.$data];f=jQuery.extend({koBindingContext:f},g.templateOptions);f=jQuery.tmpl(e,b,f);f.appendTo(document.createElement("div"));jQuery.fragments={};return f};this.createJavaScriptEvaluatorBlock=function(a){return"{{ko_code ((function() { return "+a+" })()) }}"};this.addTemplate=function(a,b){document.write("<script type='text/html' id='"+a+"'>"+b+"<\/script>")};0<a&&(jQuery.tmpl.tag.ko_code= +{open:"__.push($1 || '');"},jQuery.tmpl.tag.ko_with={open:"with($1) {",close:"} "})};a.ma.prototype=new a.t;var b=new a.ma;0<b.vb&&a.ra(b);a.b("jqueryTmplTemplateEngine",a.ma)})()}"function"===typeof require&&"object"===typeof exports&&"object"===typeof module?E(module.exports||exports):"function"===typeof define&&define.amd?define(["exports"],E):E(window.ko={});p; +})(window,document,navigator); diff --git a/samples/OAuth2ProtectedWebApi/Scripts/modernizr-2.5.3.js b/samples/OAuth2ProtectedWebApi/Scripts/modernizr-2.5.3.js new file mode 100644 index 0000000..c1a6a9a --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Scripts/modernizr-2.5.3.js @@ -0,0 +1,1265 @@ +/*! + * Modernizr v2.5.3 + * www.modernizr.com + * + * Copyright (c) Faruk Ates, Paul Irish, Alex Sexton + * Available under the BSD and MIT licenses: www.modernizr.com/license/ + */ + +/* + * Modernizr tests which native CSS3 and HTML5 features are available in + * the current UA and makes the results available to you in two ways: + * as properties on a global Modernizr object, and as classes on the + * <html> element. This information allows you to progressively enhance + * your pages with a granular level of control over the experience. + * + * Modernizr has an optional (not included) conditional resource loader + * called Modernizr.load(), based on Yepnope.js (yepnopejs.com). + * To get a build that includes Modernizr.load(), as well as choosing + * which tests to include, go to www.modernizr.com/download/ + * + * Authors Faruk Ates, Paul Irish, Alex Sexton + * Contributors Ryan Seddon, Ben Alman + */ + +window.Modernizr = (function( window, document, undefined ) { + + var version = '2.5.3', + + Modernizr = {}, + + // option for enabling the HTML classes to be added + enableClasses = true, + + docElement = document.documentElement, + + /** + * Create our "modernizr" element that we do most feature tests on. + */ + mod = 'modernizr', + modElem = document.createElement(mod), + mStyle = modElem.style, + + /** + * Create the input element for various Web Forms feature tests. + */ + inputElem = document.createElement('input'), + + smile = ':)', + + toString = {}.toString, + + // List of property values to set for css tests. See ticket #21 + prefixes = ' -webkit- -moz- -o- -ms- '.split(' '), + + // Following spec is to expose vendor-specific style properties as: + // elem.style.WebkitBorderRadius + // and the following would be incorrect: + // elem.style.webkitBorderRadius + + // Webkit ghosts their properties in lowercase but Opera & Moz do not. + // Microsoft uses a lowercase `ms` instead of the correct `Ms` in IE8+ + // erik.eae.net/archives/2008/03/10/21.48.10/ + + // More here: github.com/Modernizr/Modernizr/issues/issue/21 + omPrefixes = 'Webkit Moz O ms', + + cssomPrefixes = omPrefixes.split(' '), + + domPrefixes = omPrefixes.toLowerCase().split(' '), + + ns = {'svg': 'http://www.w3.org/2000/svg'}, + + tests = {}, + inputs = {}, + attrs = {}, + + classes = [], + + slice = classes.slice, + + featureName, // used in testing loop + + + // Inject element with style element and some CSS rules + injectElementWithStyles = function( rule, callback, nodes, testnames ) { + + var style, ret, node, + div = document.createElement('div'), + // After page load injecting a fake body doesn't work so check if body exists + body = document.body, + // IE6 and 7 won't return offsetWidth or offsetHeight unless it's in the body element, so we fake it. + fakeBody = body ? body : document.createElement('body'); + + if ( parseInt(nodes, 10) ) { + // In order not to give false positives we create a node for each test + // This also allows the method to scale for unspecified uses + while ( nodes-- ) { + node = document.createElement('div'); + node.id = testnames ? testnames[nodes] : mod + (nodes + 1); + div.appendChild(node); + } + } + + // <style> elements in IE6-9 are considered 'NoScope' elements and therefore will be removed + // when injected with innerHTML. To get around this you need to prepend the 'NoScope' element + // with a 'scoped' element, in our case the soft-hyphen entity as it won't mess with our measurements. + // msdn.microsoft.com/en-us/library/ms533897%28VS.85%29.aspx + // Documents served as xml will throw if using ­ so use xml friendly encoded version. See issue #277 + style = ['­','<style>', rule, '</style>'].join(''); + div.id = mod; + // IE6 will false positive on some tests due to the style element inside the test div somehow interfering offsetHeight, so insert it into body or fakebody. + // Opera will act all quirky when injecting elements in documentElement when page is served as xml, needs fakebody too. #270 + fakeBody.innerHTML += style; + fakeBody.appendChild(div); + if(!body){ + //avoid crashing IE8, if background image is used + fakeBody.style.background = ""; + docElement.appendChild(fakeBody); + } + + ret = callback(div, rule); + // If this is done after page load we don't want to remove the body so check if body exists + !body ? fakeBody.parentNode.removeChild(fakeBody) : div.parentNode.removeChild(div); + + return !!ret; + + }, + + + // adapted from matchMedia polyfill + // by Scott Jehl and Paul Irish + // gist.github.com/786768 + testMediaQuery = function( mq ) { + + var matchMedia = window.matchMedia || window.msMatchMedia; + if ( matchMedia ) { + return matchMedia(mq).matches; + } + + var bool; + + injectElementWithStyles('@media ' + mq + ' { #' + mod + ' { position: absolute; } }', function( node ) { + bool = (window.getComputedStyle ? + getComputedStyle(node, null) : + node.currentStyle)['position'] == 'absolute'; + }); + + return bool; + + }, + + + /** + * isEventSupported determines if a given element supports the given event + * function from yura.thinkweb2.com/isEventSupported/ + */ + isEventSupported = (function() { + + var TAGNAMES = { + 'select': 'input', 'change': 'input', + 'submit': 'form', 'reset': 'form', + 'error': 'img', 'load': 'img', 'abort': 'img' + }; + + function isEventSupported( eventName, element ) { + + element = element || document.createElement(TAGNAMES[eventName] || 'div'); + eventName = 'on' + eventName; + + // When using `setAttribute`, IE skips "unload", WebKit skips "unload" and "resize", whereas `in` "catches" those + var isSupported = eventName in element; + + if ( !isSupported ) { + // If it has no `setAttribute` (i.e. doesn't implement Node interface), try generic element + if ( !element.setAttribute ) { + element = document.createElement('div'); + } + if ( element.setAttribute && element.removeAttribute ) { + element.setAttribute(eventName, ''); + isSupported = is(element[eventName], 'function'); + + // If property was created, "remove it" (by setting value to `undefined`) + if ( !is(element[eventName], 'undefined') ) { + element[eventName] = undefined; + } + element.removeAttribute(eventName); + } + } + + element = null; + return isSupported; + } + return isEventSupported; + })(); + + // hasOwnProperty shim by kangax needed for Safari 2.0 support + var _hasOwnProperty = ({}).hasOwnProperty, hasOwnProperty; + if ( !is(_hasOwnProperty, 'undefined') && !is(_hasOwnProperty.call, 'undefined') ) { + hasOwnProperty = function (object, property) { + return _hasOwnProperty.call(object, property); + }; + } + else { + hasOwnProperty = function (object, property) { /* yes, this can give false positives/negatives, but most of the time we don't care about those */ + return ((property in object) && is(object.constructor.prototype[property], 'undefined')); + }; + } + + // Taken from ES5-shim https://github.com/kriskowal/es5-shim/blob/master/es5-shim.js + // ES-5 15.3.4.5 + // http://es5.github.com/#x15.3.4.5 + + if (!Function.prototype.bind) { + + Function.prototype.bind = function bind(that) { + + var target = this; + + if (typeof target != "function") { + throw new TypeError(); + } + + var args = slice.call(arguments, 1), + bound = function () { + + if (this instanceof bound) { + + var F = function(){}; + F.prototype = target.prototype; + var self = new F; + + var result = target.apply( + self, + args.concat(slice.call(arguments)) + ); + if (Object(result) === result) { + return result; + } + return self; + + } else { + + return target.apply( + that, + args.concat(slice.call(arguments)) + ); + + } + + }; + + return bound; + }; + } + + /** + * setCss applies given styles to the Modernizr DOM node. + */ + function setCss( str ) { + mStyle.cssText = str; + } + + /** + * setCssAll extrapolates all vendor-specific css strings. + */ + function setCssAll( str1, str2 ) { + return setCss(prefixes.join(str1 + ';') + ( str2 || '' )); + } + + /** + * is returns a boolean for if typeof obj is exactly type. + */ + function is( obj, type ) { + return typeof obj === type; + } + + /** + * contains returns a boolean for if substr is found within str. + */ + function contains( str, substr ) { + return !!~('' + str).indexOf(substr); + } + + /** + * testProps is a generic CSS / DOM property test; if a browser supports + * a certain property, it won't return undefined for it. + * A supported CSS property returns empty string when its not yet set. + */ + function testProps( props, prefixed ) { + for ( var i in props ) { + if ( mStyle[ props[i] ] !== undefined ) { + return prefixed == 'pfx' ? props[i] : true; + } + } + return false; + } + + /** + * testDOMProps is a generic DOM property test; if a browser supports + * a certain property, it won't return undefined for it. + */ + function testDOMProps( props, obj, elem ) { + for ( var i in props ) { + var item = obj[props[i]]; + if ( item !== undefined) { + + // return the property name as a string + if (elem === false) return props[i]; + + // let's bind a function + if (is(item, 'function')){ + // default to autobind unless override + return item.bind(elem || obj); + } + + // return the unbound function or obj or value + return item; + } + } + return false; + } + + /** + * testPropsAll tests a list of DOM properties we want to check against. + * We specify literally ALL possible (known and/or likely) properties on + * the element including the non-vendor prefixed one, for forward- + * compatibility. + */ + function testPropsAll( prop, prefixed, elem ) { + + var ucProp = prop.charAt(0).toUpperCase() + prop.substr(1), + props = (prop + ' ' + cssomPrefixes.join(ucProp + ' ') + ucProp).split(' '); + + // did they call .prefixed('boxSizing') or are we just testing a prop? + if(is(prefixed, "string") || is(prefixed, "undefined")) { + return testProps(props, prefixed); + + // otherwise, they called .prefixed('requestAnimationFrame', window[, elem]) + } else { + props = (prop + ' ' + (domPrefixes).join(ucProp + ' ') + ucProp).split(' '); + return testDOMProps(props, prefixed, elem); + } + } + + /** + * testBundle tests a list of CSS features that require element and style injection. + * By bundling them together we can reduce the need to touch the DOM multiple times. + */ + /*>>testBundle*/ + var testBundle = (function( styles, tests ) { + var style = styles.join(''), + len = tests.length; + + injectElementWithStyles(style, function( node, rule ) { + var style = document.styleSheets[document.styleSheets.length - 1], + // IE8 will bork if you create a custom build that excludes both fontface and generatedcontent tests. + // So we check for cssRules and that there is a rule available + // More here: github.com/Modernizr/Modernizr/issues/288 & github.com/Modernizr/Modernizr/issues/293 + cssText = style ? (style.cssRules && style.cssRules[0] ? style.cssRules[0].cssText : style.cssText || '') : '', + children = node.childNodes, hash = {}; + + while ( len-- ) { + hash[children[len].id] = children[len]; + } + + /*>>touch*/ Modernizr['touch'] = ('ontouchstart' in window) || window.DocumentTouch && document instanceof DocumentTouch || (hash['touch'] && hash['touch'].offsetTop) === 9; /*>>touch*/ + /*>>csstransforms3d*/ Modernizr['csstransforms3d'] = (hash['csstransforms3d'] && hash['csstransforms3d'].offsetLeft) === 9 && hash['csstransforms3d'].offsetHeight === 3; /*>>csstransforms3d*/ + /*>>generatedcontent*/Modernizr['generatedcontent'] = (hash['generatedcontent'] && hash['generatedcontent'].offsetHeight) >= 1; /*>>generatedcontent*/ + /*>>fontface*/ Modernizr['fontface'] = /src/i.test(cssText) && + cssText.indexOf(rule.split(' ')[0]) === 0; /*>>fontface*/ + }, len, tests); + + })([ + // Pass in styles to be injected into document + /*>>fontface*/ '@font-face {font-family:"font";src:url("https://")}' /*>>fontface*/ + + /*>>touch*/ ,['@media (',prefixes.join('touch-enabled),('),mod,')', + '{#touch{top:9px;position:absolute}}'].join('') /*>>touch*/ + + /*>>csstransforms3d*/ ,['@media (',prefixes.join('transform-3d),('),mod,')', + '{#csstransforms3d{left:9px;position:absolute;height:3px;}}'].join('')/*>>csstransforms3d*/ + + /*>>generatedcontent*/,['#generatedcontent:after{content:"',smile,'";visibility:hidden}'].join('') /*>>generatedcontent*/ + ], + [ + /*>>fontface*/ 'fontface' /*>>fontface*/ + /*>>touch*/ ,'touch' /*>>touch*/ + /*>>csstransforms3d*/ ,'csstransforms3d' /*>>csstransforms3d*/ + /*>>generatedcontent*/,'generatedcontent' /*>>generatedcontent*/ + + ]);/*>>testBundle*/ + + + /** + * Tests + * ----- + */ + + // The *new* flexbox + // dev.w3.org/csswg/css3-flexbox + + tests['flexbox'] = function() { + return testPropsAll('flexOrder'); + }; + + // The *old* flexbox + // www.w3.org/TR/2009/WD-css3-flexbox-20090723/ + + tests['flexbox-legacy'] = function() { + return testPropsAll('boxDirection'); + }; + + // On the S60 and BB Storm, getContext exists, but always returns undefined + // so we actually have to call getContext() to verify + // github.com/Modernizr/Modernizr/issues/issue/97/ + + tests['canvas'] = function() { + var elem = document.createElement('canvas'); + return !!(elem.getContext && elem.getContext('2d')); + }; + + tests['canvastext'] = function() { + return !!(Modernizr['canvas'] && is(document.createElement('canvas').getContext('2d').fillText, 'function')); + }; + + // this test initiates a new webgl context. + // webk.it/70117 is tracking a legit feature detect proposal + + tests['webgl'] = function() { + try { + var canvas = document.createElement('canvas'), + ret; + ret = !!(window.WebGLRenderingContext && (canvas.getContext('experimental-webgl') || canvas.getContext('webgl'))); + canvas = undefined; + } catch (e){ + ret = false; + } + return ret; + }; + + /* + * The Modernizr.touch test only indicates if the browser supports + * touch events, which does not necessarily reflect a touchscreen + * device, as evidenced by tablets running Windows 7 or, alas, + * the Palm Pre / WebOS (touch) phones. + * + * Additionally, Chrome (desktop) used to lie about its support on this, + * but that has since been rectified: crbug.com/36415 + * + * We also test for Firefox 4 Multitouch Support. + * + * For more info, see: modernizr.github.com/Modernizr/touch.html + */ + + tests['touch'] = function() { + return Modernizr['touch']; + }; + + /** + * geolocation tests for the new Geolocation API specification. + * This test is a standards compliant-only test; for more complete + * testing, including a Google Gears fallback, please see: + * code.google.com/p/geo-location-javascript/ + * or view a fallback solution using google's geo API: + * gist.github.com/366184 + */ + tests['geolocation'] = function() { + return !!navigator.geolocation; + }; + + // Per 1.6: + // This used to be Modernizr.crosswindowmessaging but the longer + // name has been deprecated in favor of a shorter and property-matching one. + // The old API is still available in 1.6, but as of 2.0 will throw a warning, + // and in the first release thereafter disappear entirely. + tests['postmessage'] = function() { + return !!window.postMessage; + }; + + + // Chrome incognito mode used to throw an exception when using openDatabase + // It doesn't anymore. + tests['websqldatabase'] = function() { + return !!window.openDatabase; + }; + + // Vendors had inconsistent prefixing with the experimental Indexed DB: + // - Webkit's implementation is accessible through webkitIndexedDB + // - Firefox shipped moz_indexedDB before FF4b9, but since then has been mozIndexedDB + // For speed, we don't test the legacy (and beta-only) indexedDB + tests['indexedDB'] = function() { + return !!testPropsAll("indexedDB",window); + }; + + // documentMode logic from YUI to filter out IE8 Compat Mode + // which false positives. + tests['hashchange'] = function() { + return isEventSupported('hashchange', window) && (document.documentMode === undefined || document.documentMode > 7); + }; + + // Per 1.6: + // This used to be Modernizr.historymanagement but the longer + // name has been deprecated in favor of a shorter and property-matching one. + // The old API is still available in 1.6, but as of 2.0 will throw a warning, + // and in the first release thereafter disappear entirely. + tests['history'] = function() { + return !!(window.history && history.pushState); + }; + + tests['draganddrop'] = function() { + var div = document.createElement('div'); + return ('draggable' in div) || ('ondragstart' in div && 'ondrop' in div); + }; + + // FIXME: Once FF10 is sunsetted, we can drop prefixed MozWebSocket + // bugzil.la/695635 + tests['websockets'] = function() { + for ( var i = -1, len = cssomPrefixes.length; ++i < len; ){ + if ( window[cssomPrefixes[i] + 'WebSocket'] ){ + return true; + } + } + return 'WebSocket' in window; + }; + + + // css-tricks.com/rgba-browser-support/ + tests['rgba'] = function() { + // Set an rgba() color and check the returned value + + setCss('background-color:rgba(150,255,150,.5)'); + + return contains(mStyle.backgroundColor, 'rgba'); + }; + + tests['hsla'] = function() { + // Same as rgba(), in fact, browsers re-map hsla() to rgba() internally, + // except IE9 who retains it as hsla + + setCss('background-color:hsla(120,40%,100%,.5)'); + + return contains(mStyle.backgroundColor, 'rgba') || contains(mStyle.backgroundColor, 'hsla'); + }; + + tests['multiplebgs'] = function() { + // Setting multiple images AND a color on the background shorthand property + // and then querying the style.background property value for the number of + // occurrences of "url(" is a reliable method for detecting ACTUAL support for this! + + setCss('background:url(https://),url(https://),red url(https://)'); + + // If the UA supports multiple backgrounds, there should be three occurrences + // of the string "url(" in the return value for elemStyle.background + + return /(url\s*\(.*?){3}/.test(mStyle.background); + }; + + + // In testing support for a given CSS property, it's legit to test: + // `elem.style[styleName] !== undefined` + // If the property is supported it will return an empty string, + // if unsupported it will return undefined. + + // We'll take advantage of this quick test and skip setting a style + // on our modernizr element, but instead just testing undefined vs + // empty string. + + + tests['backgroundsize'] = function() { + return testPropsAll('backgroundSize'); + }; + + tests['borderimage'] = function() { + return testPropsAll('borderImage'); + }; + + + // Super comprehensive table about all the unique implementations of + // border-radius: muddledramblings.com/table-of-css3-border-radius-compliance + + tests['borderradius'] = function() { + return testPropsAll('borderRadius'); + }; + + // WebOS unfortunately false positives on this test. + tests['boxshadow'] = function() { + return testPropsAll('boxShadow'); + }; + + // FF3.0 will false positive on this test + tests['textshadow'] = function() { + return document.createElement('div').style.textShadow === ''; + }; + + + tests['opacity'] = function() { + // Browsers that actually have CSS Opacity implemented have done so + // according to spec, which means their return values are within the + // range of [0.0,1.0] - including the leading zero. + + setCssAll('opacity:.55'); + + // The non-literal . in this regex is intentional: + // German Chrome returns this value as 0,55 + // github.com/Modernizr/Modernizr/issues/#issue/59/comment/516632 + return /^0.55$/.test(mStyle.opacity); + }; + + + // Note, Android < 4 will pass this test, but can only animate + // a single property at a time + // daneden.me/2011/12/putting-up-with-androids-bullshit/ + tests['cssanimations'] = function() { + return testPropsAll('animationName'); + }; + + + tests['csscolumns'] = function() { + return testPropsAll('columnCount'); + }; + + + tests['cssgradients'] = function() { + /** + * For CSS Gradients syntax, please see: + * webkit.org/blog/175/introducing-css-gradients/ + * developer.mozilla.org/en/CSS/-moz-linear-gradient + * developer.mozilla.org/en/CSS/-moz-radial-gradient + * dev.w3.org/csswg/css3-images/#gradients- + */ + + var str1 = 'background-image:', + str2 = 'gradient(linear,left top,right bottom,from(#9f9),to(white));', + str3 = 'linear-gradient(left top,#9f9, white);'; + + setCss( + // legacy webkit syntax (FIXME: remove when syntax not in use anymore) + (str1 + '-webkit- '.split(' ').join(str2 + str1) + // standard syntax // trailing 'background-image:' + + prefixes.join(str3 + str1)).slice(0, -str1.length) + ); + + return contains(mStyle.backgroundImage, 'gradient'); + }; + + + tests['cssreflections'] = function() { + return testPropsAll('boxReflect'); + }; + + + tests['csstransforms'] = function() { + return !!testPropsAll('transform'); + }; + + + tests['csstransforms3d'] = function() { + + var ret = !!testPropsAll('perspective'); + + // Webkit's 3D transforms are passed off to the browser's own graphics renderer. + // It works fine in Safari on Leopard and Snow Leopard, but not in Chrome in + // some conditions. As a result, Webkit typically recognizes the syntax but + // will sometimes throw a false positive, thus we must do a more thorough check: + if ( ret && 'webkitPerspective' in docElement.style ) { + + // Webkit allows this media query to succeed only if the feature is enabled. + // `@media (transform-3d),(-o-transform-3d),(-moz-transform-3d),(-ms-transform-3d),(-webkit-transform-3d),(modernizr){ ... }` + ret = Modernizr['csstransforms3d']; + } + return ret; + }; + + + tests['csstransitions'] = function() { + return testPropsAll('transition'); + }; + + + /*>>fontface*/ + // @font-face detection routine by Diego Perini + // javascript.nwbox.com/CSSSupport/ + + // false positives in WebOS: github.com/Modernizr/Modernizr/issues/342 + tests['fontface'] = function() { + return Modernizr['fontface']; + }; + /*>>fontface*/ + + // CSS generated content detection + tests['generatedcontent'] = function() { + return Modernizr['generatedcontent']; + }; + + + + // These tests evaluate support of the video/audio elements, as well as + // testing what types of content they support. + // + // We're using the Boolean constructor here, so that we can extend the value + // e.g. Modernizr.video // true + // Modernizr.video.ogg // 'probably' + // + // Codec values from : github.com/NielsLeenheer/html5test/blob/9106a8/index.html#L845 + // thx to NielsLeenheer and zcorpan + + // Note: in some older browsers, "no" was a return value instead of empty string. + // It was live in FF3.5.0 and 3.5.1, but fixed in 3.5.2 + // It was also live in Safari 4.0.0 - 4.0.4, but fixed in 4.0.5 + + tests['video'] = function() { + var elem = document.createElement('video'), + bool = false; + + // IE9 Running on Windows Server SKU can cause an exception to be thrown, bug #224 + try { + if ( bool = !!elem.canPlayType ) { + bool = new Boolean(bool); + bool.ogg = elem.canPlayType('video/ogg; codecs="theora"') .replace(/^no$/,''); + + bool.h264 = elem.canPlayType('video/mp4; codecs="avc1.42E01E"') .replace(/^no$/,''); + + bool.webm = elem.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,''); + } + + } catch(e) { } + + return bool; + }; + + tests['audio'] = function() { + var elem = document.createElement('audio'), + bool = false; + + try { + if ( bool = !!elem.canPlayType ) { + bool = new Boolean(bool); + bool.ogg = elem.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,''); + bool.mp3 = elem.canPlayType('audio/mpeg;') .replace(/^no$/,''); + + // Mimetypes accepted: + // developer.mozilla.org/En/Media_formats_supported_by_the_audio_and_video_elements + // bit.ly/iphoneoscodecs + bool.wav = elem.canPlayType('audio/wav; codecs="1"') .replace(/^no$/,''); + bool.m4a = ( elem.canPlayType('audio/x-m4a;') || + elem.canPlayType('audio/aac;')) .replace(/^no$/,''); + } + } catch(e) { } + + return bool; + }; + + + // In FF4, if disabled, window.localStorage should === null. + + // Normally, we could not test that directly and need to do a + // `('localStorage' in window) && ` test first because otherwise Firefox will + // throw bugzil.la/365772 if cookies are disabled + + // Also in iOS5 Private Browsing mode, attepting to use localStorage.setItem + // will throw the exception: + // QUOTA_EXCEEDED_ERRROR DOM Exception 22. + // Peculiarly, getItem and removeItem calls do not throw. + + // Because we are forced to try/catch this, we'll go aggressive. + + // Just FWIW: IE8 Compat mode supports these features completely: + // www.quirksmode.org/dom/html5.html + // But IE8 doesn't support either with local files + + tests['localstorage'] = function() { + try { + localStorage.setItem(mod, mod); + localStorage.removeItem(mod); + return true; + } catch(e) { + return false; + } + }; + + tests['sessionstorage'] = function() { + try { + sessionStorage.setItem(mod, mod); + sessionStorage.removeItem(mod); + return true; + } catch(e) { + return false; + } + }; + + + tests['webworkers'] = function() { + return !!window.Worker; + }; + + + tests['applicationcache'] = function() { + return !!window.applicationCache; + }; + + + // Thanks to Erik Dahlstrom + tests['svg'] = function() { + return !!document.createElementNS && !!document.createElementNS(ns.svg, 'svg').createSVGRect; + }; + + // specifically for SVG inline in HTML, not within XHTML + // test page: paulirish.com/demo/inline-svg + tests['inlinesvg'] = function() { + var div = document.createElement('div'); + div.innerHTML = '<svg/>'; + return (div.firstChild && div.firstChild.namespaceURI) == ns.svg; + }; + + // SVG SMIL animation + tests['smil'] = function() { + return !!document.createElementNS && /SVGAnimate/.test(toString.call(document.createElementNS(ns.svg, 'animate'))); + }; + + // This test is only for clip paths in SVG proper, not clip paths on HTML content + // demo: srufaculty.sru.edu/david.dailey/svg/newstuff/clipPath4.svg + + // However read the comments to dig into applying SVG clippaths to HTML content here: + // github.com/Modernizr/Modernizr/issues/213#issuecomment-1149491 + tests['svgclippaths'] = function() { + return !!document.createElementNS && /SVGClipPath/.test(toString.call(document.createElementNS(ns.svg, 'clipPath'))); + }; + + // input features and input types go directly onto the ret object, bypassing the tests loop. + // Hold this guy to execute in a moment. + function webforms() { + // Run through HTML5's new input attributes to see if the UA understands any. + // We're using f which is the <input> element created early on + // Mike Taylr has created a comprehensive resource for testing these attributes + // when applied to all input types: + // miketaylr.com/code/input-type-attr.html + // spec: www.whatwg.org/specs/web-apps/current-work/multipage/the-input-element.html#input-type-attr-summary + + // Only input placeholder is tested while textarea's placeholder is not. + // Currently Safari 4 and Opera 11 have support only for the input placeholder + // Both tests are available in feature-detects/forms-placeholder.js + Modernizr['input'] = (function( props ) { + for ( var i = 0, len = props.length; i < len; i++ ) { + attrs[ props[i] ] = !!(props[i] in inputElem); + } + if (attrs.list){ + // safari false positive's on datalist: webk.it/74252 + // see also github.com/Modernizr/Modernizr/issues/146 + attrs.list = !!(document.createElement('datalist') && window.HTMLDataListElement); + } + return attrs; + })('autocomplete autofocus list placeholder max min multiple pattern required step'.split(' ')); + + // Run through HTML5's new input types to see if the UA understands any. + // This is put behind the tests runloop because it doesn't return a + // true/false like all the other tests; instead, it returns an object + // containing each input type with its corresponding true/false value + + // Big thanks to @miketaylr for the html5 forms expertise. miketaylr.com/ + Modernizr['inputtypes'] = (function(props) { + + for ( var i = 0, bool, inputElemType, defaultView, len = props.length; i < len; i++ ) { + + inputElem.setAttribute('type', inputElemType = props[i]); + bool = inputElem.type !== 'text'; + + // We first check to see if the type we give it sticks.. + // If the type does, we feed it a textual value, which shouldn't be valid. + // If the value doesn't stick, we know there's input sanitization which infers a custom UI + if ( bool ) { + + inputElem.value = smile; + inputElem.style.cssText = 'position:absolute;visibility:hidden;'; + + if ( /^range$/.test(inputElemType) && inputElem.style.WebkitAppearance !== undefined ) { + + docElement.appendChild(inputElem); + defaultView = document.defaultView; + + // Safari 2-4 allows the smiley as a value, despite making a slider + bool = defaultView.getComputedStyle && + defaultView.getComputedStyle(inputElem, null).WebkitAppearance !== 'textfield' && + // Mobile android web browser has false positive, so must + // check the height to see if the widget is actually there. + (inputElem.offsetHeight !== 0); + + docElement.removeChild(inputElem); + + } else if ( /^(search|tel)$/.test(inputElemType) ){ + // Spec doesnt define any special parsing or detectable UI + // behaviors so we pass these through as true + + // Interestingly, opera fails the earlier test, so it doesn't + // even make it here. + + } else if ( /^(url|email)$/.test(inputElemType) ) { + // Real url and email support comes with prebaked validation. + bool = inputElem.checkValidity && inputElem.checkValidity() === false; + + } else if ( /^color$/.test(inputElemType) ) { + // chuck into DOM and force reflow for Opera bug in 11.00 + // github.com/Modernizr/Modernizr/issues#issue/159 + docElement.appendChild(inputElem); + docElement.offsetWidth; + bool = inputElem.value != smile; + docElement.removeChild(inputElem); + + } else { + // If the upgraded input compontent rejects the :) text, we got a winner + bool = inputElem.value != smile; + } + } + + inputs[ props[i] ] = !!bool; + } + return inputs; + })('search tel url email datetime date month week time datetime-local number range color'.split(' ')); + } + + + // End of test definitions + // ----------------------- + + + + // Run through all tests and detect their support in the current UA. + // todo: hypothetically we could be doing an array of tests and use a basic loop here. + for ( var feature in tests ) { + if ( hasOwnProperty(tests, feature) ) { + // run the test, throw the return value into the Modernizr, + // then based on that boolean, define an appropriate className + // and push it into an array of classes we'll join later. + featureName = feature.toLowerCase(); + Modernizr[featureName] = tests[feature](); + + classes.push((Modernizr[featureName] ? '' : 'no-') + featureName); + } + } + + // input tests need to run. + Modernizr.input || webforms(); + + + /** + * addTest allows the user to define their own feature tests + * the result will be added onto the Modernizr object, + * as well as an appropriate className set on the html element + * + * @param feature - String naming the feature + * @param test - Function returning true if feature is supported, false if not + */ + Modernizr.addTest = function ( feature, test ) { + if ( typeof feature == 'object' ) { + for ( var key in feature ) { + if ( hasOwnProperty( feature, key ) ) { + Modernizr.addTest( key, feature[ key ] ); + } + } + } else { + + feature = feature.toLowerCase(); + + if ( Modernizr[feature] !== undefined ) { + // we're going to quit if you're trying to overwrite an existing test + // if we were to allow it, we'd do this: + // var re = new RegExp("\\b(no-)?" + feature + "\\b"); + // docElement.className = docElement.className.replace( re, '' ); + // but, no rly, stuff 'em. + return Modernizr; + } + + test = typeof test == 'function' ? test() : test; + + docElement.className += ' ' + (test ? '' : 'no-') + feature; + Modernizr[feature] = test; + + } + + return Modernizr; // allow chaining. + }; + + + // Reset modElem.cssText to nothing to reduce memory footprint. + setCss(''); + modElem = inputElem = null; + + //>>BEGIN IEPP + // Enable HTML 5 elements for styling in IE & add HTML5 css + /*! HTML5 Shiv v3.4 | @afarkas @jdalton @jon_neal @rem | MIT/GPL2 Licensed */ + ;(function(window, document) { + + /** Preset options */ + var options = window.html5 || {}; + + /** Used to skip problem elements */ + var reSkip = /^<|^(?:button|form|map|select|textarea)$/i; + + /** Detect whether the browser supports default html5 styles */ + var supportsHtml5Styles; + + /** Detect whether the browser supports unknown elements */ + var supportsUnknownElements; + + (function() { + var a = document.createElement('a'); + + a.innerHTML = '<xyz></xyz>'; + + //if the hidden property is implemented we can assume, that the browser supports HTML5 Styles + supportsHtml5Styles = ('hidden' in a); + supportsUnknownElements = a.childNodes.length == 1 || (function() { + // assign a false positive if unable to shiv + try { + (document.createElement)('a'); + } catch(e) { + return true; + } + var frag = document.createDocumentFragment(); + return ( + typeof frag.cloneNode == 'undefined' || + typeof frag.createDocumentFragment == 'undefined' || + typeof frag.createElement == 'undefined' + ); + }()); + + }()); + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a style sheet with the given CSS text and adds it to the document. + * @private + * @param {Document} ownerDocument The document. + * @param {String} cssText The CSS text. + * @returns {StyleSheet} The style element. + */ + function addStyleSheet(ownerDocument, cssText) { + var p = ownerDocument.createElement('p'), + parent = ownerDocument.getElementsByTagName('head')[0] || ownerDocument.documentElement; + + p.innerHTML = 'x<style>' + cssText + '</style>'; + return parent.insertBefore(p.lastChild, parent.firstChild); + } + + /** + * Returns the value of `html5.elements` as an array. + * @private + * @returns {Array} An array of shived element node names. + */ + function getElements() { + var elements = html5.elements; + return typeof elements == 'string' ? elements.split(' ') : elements; + } + + /** + * Shivs the `createElement` and `createDocumentFragment` methods of the document. + * @private + * @param {Document|DocumentFragment} ownerDocument The document. + */ + function shivMethods(ownerDocument) { + var cache = {}, + docCreateElement = ownerDocument.createElement, + docCreateFragment = ownerDocument.createDocumentFragment, + frag = docCreateFragment(); + + ownerDocument.createElement = function(nodeName) { + // Avoid adding some elements to fragments in IE < 9 because + // * Attributes like `name` or `type` cannot be set/changed once an element + // is inserted into a document/fragment + // * Link elements with `src` attributes that are inaccessible, as with + // a 403 response, will cause the tab/window to crash + // * Script elements appended to fragments will execute when their `src` + // or `text` property is set + var node = (cache[nodeName] || (cache[nodeName] = docCreateElement(nodeName))).cloneNode(); + return html5.shivMethods && node.canHaveChildren && !reSkip.test(nodeName) ? frag.appendChild(node) : node; + }; + + ownerDocument.createDocumentFragment = Function('h,f', 'return function(){' + + 'var n=f.cloneNode(),c=n.createElement;' + + 'h.shivMethods&&(' + + // unroll the `createElement` calls + getElements().join().replace(/\w+/g, function(nodeName) { + cache[nodeName] = docCreateElement(nodeName); + frag.createElement(nodeName); + return 'c("' + nodeName + '")'; + }) + + ');return n}' + )(html5, frag); + } + + /*--------------------------------------------------------------------------*/ + + /** + * Shivs the given document. + * @memberOf html5 + * @param {Document} ownerDocument The document to shiv. + * @returns {Document} The shived document. + */ + function shivDocument(ownerDocument) { + var shived; + if (ownerDocument.documentShived) { + return ownerDocument; + } + if (html5.shivCSS && !supportsHtml5Styles) { + shived = !!addStyleSheet(ownerDocument, + // corrects block display not defined in IE6/7/8/9 + 'article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block}' + + // corrects audio display not defined in IE6/7/8/9 + 'audio{display:none}' + + // corrects canvas and video display not defined in IE6/7/8/9 + 'canvas,video{display:inline-block;*display:inline;*zoom:1}' + + // corrects 'hidden' attribute and audio[controls] display not present in IE7/8/9 + '[hidden]{display:none}audio[controls]{display:inline-block;*display:inline;*zoom:1}' + + // adds styling not present in IE6/7/8/9 + 'mark{background:#FF0;color:#000}' + ); + } + if (!supportsUnknownElements) { + shived = !shivMethods(ownerDocument); + } + if (shived) { + ownerDocument.documentShived = shived; + } + return ownerDocument; + } + + /*--------------------------------------------------------------------------*/ + + /** + * The `html5` object is exposed so that more elements can be shived and + * existing shiving can be detected on iframes. + * @type Object + * @example + * + * // options can be changed before the script is included + * html5 = { 'elements': 'mark section', 'shivCSS': false, 'shivMethods': false }; + */ + var html5 = { + + /** + * An array or space separated string of node names of the elements to shiv. + * @memberOf html5 + * @type Array|String + */ + 'elements': options.elements || 'abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video', + + /** + * A flag to indicate that the HTML5 style sheet should be inserted. + * @memberOf html5 + * @type Boolean + */ + 'shivCSS': !(options.shivCSS === false), + + /** + * A flag to indicate that the document's `createElement` and `createDocumentFragment` + * methods should be overwritten. + * @memberOf html5 + * @type Boolean + */ + 'shivMethods': !(options.shivMethods === false), + + /** + * A string to describe the type of `html5` object ("default" or "default print"). + * @memberOf html5 + * @type String + */ + 'type': 'default', + + // shivs the document according to the specified `html5` object options + 'shivDocument': shivDocument + }; + + /*--------------------------------------------------------------------------*/ + + // expose html5 + window.html5 = html5; + + // shiv the document + shivDocument(document); + + }(this, document)); + + //>>END IEPP + + // Assign private properties to the return object with prefix + Modernizr._version = version; + + // expose these for the plugin API. Look in the source for how to join() them against your input + Modernizr._prefixes = prefixes; + Modernizr._domPrefixes = domPrefixes; + Modernizr._cssomPrefixes = cssomPrefixes; + + // Modernizr.mq tests a given media query, live against the current state of the window + // A few important notes: + // * If a browser does not support media queries at all (eg. oldIE) the mq() will always return false + // * A max-width or orientation query will be evaluated against the current state, which may change later. + // * You must specify values. Eg. If you are testing support for the min-width media query use: + // Modernizr.mq('(min-width:0)') + // usage: + // Modernizr.mq('only screen and (max-width:768)') + Modernizr.mq = testMediaQuery; + + // Modernizr.hasEvent() detects support for a given event, with an optional element to test on + // Modernizr.hasEvent('gesturestart', elem) + Modernizr.hasEvent = isEventSupported; + + // Modernizr.testProp() investigates whether a given style property is recognized + // Note that the property names must be provided in the camelCase variant. + // Modernizr.testProp('pointerEvents') + Modernizr.testProp = function(prop){ + return testProps([prop]); + }; + + // Modernizr.testAllProps() investigates whether a given style property, + // or any of its vendor-prefixed variants, is recognized + // Note that the property names must be provided in the camelCase variant. + // Modernizr.testAllProps('boxSizing') + Modernizr.testAllProps = testPropsAll; + + + + // Modernizr.testStyles() allows you to add custom styles to the document and test an element afterwards + // Modernizr.testStyles('#modernizr { position:absolute }', function(elem, rule){ ... }) + Modernizr.testStyles = injectElementWithStyles; + + + // Modernizr.prefixed() returns the prefixed or nonprefixed property name variant of your input + // Modernizr.prefixed('boxSizing') // 'MozBoxSizing' + + // Properties must be passed as dom-style camelcase, rather than `box-sizing` hypentated style. + // Return values will also be the camelCase variant, if you need to translate that to hypenated style use: + // + // str.replace(/([A-Z])/g, function(str,m1){ return '-' + m1.toLowerCase(); }).replace(/^ms-/,'-ms-'); + + // If you're trying to ascertain which transition end event to bind to, you might do something like... + // + // var transEndEventNames = { + // 'WebkitTransition' : 'webkitTransitionEnd', + // 'MozTransition' : 'transitionend', + // 'OTransition' : 'oTransitionEnd', + // 'msTransition' : 'MsTransitionEnd', + // 'transition' : 'transitionend' + // }, + // transEndEventName = transEndEventNames[ Modernizr.prefixed('transition') ]; + + Modernizr.prefixed = function(prop, obj, elem){ + if(!obj) { + return testPropsAll(prop, 'pfx'); + } else { + // Testing DOM property e.g. Modernizr.prefixed('requestAnimationFrame', window) // 'mozRequestAnimationFrame' + return testPropsAll(prop, obj, elem); + } + }; + + + + // Remove "no-js" class from <html> element, if it exists: + docElement.className = docElement.className.replace(/(^|\s)no-js(\s|$)/, '$1$2') + + + // Add the new classes to the <html> element. + (enableClasses ? ' js ' + classes.join(' ') : ''); + + return Modernizr; + +})(this, this.document); diff --git a/samples/OAuth2ProtectedWebApi/Views/Home/Index.cshtml b/samples/OAuth2ProtectedWebApi/Views/Home/Index.cshtml new file mode 100644 index 0000000..9d0b4a9 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/Home/Index.cshtml @@ -0,0 +1,53 @@ +<header> + <div class="content-wrapper"> + <div class="float-left"> + <p class="site-title"> + <a href="~/">ASP.NET Web API</a></p> + </div> + </div> +</header> +<div id="body"> + <section class="featured"> + <div class="content-wrapper"> + <hgroup class="title"> + <h1>Welcome to ASP.NET Web API!</h1> + <h2>Modify the code in this template to jump-start your ASP.NET Web API development.</h2> + </hgroup> + <p> + ASP.NET Web API allows you to expose your applications, data and services to the + web directly over HTTP. + </p> + <p> + To learn more about ASP.NET Web API visit + <a href="http://go.microsoft.com/fwlink/?LinkID=238195" title="ASP.NET Web API Website">http://asp.net/web-api</a>. + The page features <mark>videos, tutorials, and samples</mark> to help you get the most from ASP.NET Web API. + If you have any questions about ASP.NET Web API, visit + <a href="http://go.microsoft.com/fwlink/?LinkID=238196" title="ASP.NET Web API Forum">our forums</a>. + </p> + </div> + </section> + <section class="content-wrapper main-content clear-fix"> + <h3>We suggest the following steps:</h3> + <ol class="round"> + <li class="one"> + <h5>Getting Started</h5> + ASP.NET Web API is a framework that makes it easy to build HTTP services that reach + a broad range of clients, including browsers and mobile devices. ASP.NET Web API + is an ideal platform for building RESTful applications on the .NET Framework. + <a href="http://go.microsoft.com/fwlink/?LinkId=245160">Learn more…</a> + </li> + + <li class="two"> + <h5>Add NuGet packages and jump-start your coding</h5> + NuGet makes it easy to install and update free libraries and tools. + <a href="http://go.microsoft.com/fwlink/?LinkId=245161">Learn more…</a> + </li> + <li class="three"> + <h5>Find Web Hosting</h5> + You can easily find a web hosting company that offers the right mix of features + and price for your applications. + <a href="http://go.microsoft.com/fwlink/?LinkId=245164">Learn more…</a> + </li> + </ol> + </section> +</div> diff --git a/samples/OAuth2ProtectedWebApi/Views/Shared/Error.cshtml b/samples/OAuth2ProtectedWebApi/Views/Shared/Error.cshtml new file mode 100644 index 0000000..54c5886 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/Shared/Error.cshtml @@ -0,0 +1,16 @@ +@{ + Layout = null; +} + +<!DOCTYPE html> +<html> +<head> + <meta name="viewport" content="width=device-width" /> + <title>Error</title> +</head> +<body> + <h2> + Sorry, an error occurred while processing your request. + </h2> +</body> +</html>
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Views/Shared/_Layout.cshtml b/samples/OAuth2ProtectedWebApi/Views/Shared/_Layout.cshtml new file mode 100644 index 0000000..cdd3281 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/Shared/_Layout.cshtml @@ -0,0 +1,16 @@ +<!DOCTYPE html> +<html> +<head> + <meta charset="utf-8" /> + <meta name="viewport" content="width=device-width" /> + <title>@ViewBag.Title</title> + @Styles.Render("~/Content/css") + @Scripts.Render("~/bundles/modernizr") +</head> +<body> + @RenderBody() + + @Scripts.Render("~/bundles/jquery") + @RenderSection("scripts", required: false) +</body> +</html> diff --git a/samples/OAuth2ProtectedWebApi/Views/User/Authorize.cshtml b/samples/OAuth2ProtectedWebApi/Views/User/Authorize.cshtml new file mode 100644 index 0000000..930788e --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/User/Authorize.cshtml @@ -0,0 +1,14 @@ +@{ + ViewBag.Title = "Authorize"; + Layout = "~/Views/Shared/_Layout.cshtml"; +} + +<h2>Authorize</h2> + +@using (Html.BeginForm("Respond", "User", FormMethod.Post)) { + @AntiForgery.GetHtml() + @Html.Hidden("request", this.ViewData["request"]) + <p>Are you sure you want to allow the client to access your data, with this scope: <b>@string.Join(" ", (IEnumerable<string>)ViewData["Scope"])</b></p> + <input type="submit" name="approval" value="true" /> + <input type="submit" name="approval" value="false" /> +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Views/Web.config b/samples/OAuth2ProtectedWebApi/Views/Web.config new file mode 100644 index 0000000..aa52615 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/Web.config @@ -0,0 +1,59 @@ +<?xml version="1.0"?> + +<configuration> + <configSections> + <sectionGroup name="system.web.webPages.razor" type="System.Web.WebPages.Razor.Configuration.RazorWebSectionGroup, System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="host" type="System.Web.WebPages.Razor.Configuration.HostSection, System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + <section name="pages" type="System.Web.WebPages.Razor.Configuration.RazorPagesSection, System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + </sectionGroup> + </configSections> + + <system.web.webPages.razor> + <host factoryType="System.Web.Mvc.MvcWebRazorHostFactory, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <pages pageBaseType="System.Web.Mvc.WebViewPage"> + <namespaces> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Optimization"/> + <add namespace="System.Web.Routing" /> + </namespaces> + </pages> + </system.web.webPages.razor> + + <appSettings> + <add key="webpages:Enabled" value="false" /> + </appSettings> + + <system.web> + <httpHandlers> + <add path="*" verb="*" type="System.Web.HttpNotFoundHandler"/> + </httpHandlers> + + <!-- + Enabling request validation in view pages would cause validation to occur + after the input has already been processed by the controller. By default + MVC performs request validation before a controller processes the input. + To change this behavior apply the ValidateInputAttribute to a + controller or action. + --> + <pages + validateRequest="false" + pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" + pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" + userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <controls> + <add assembly="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" namespace="System.Web.Mvc" tagPrefix="mvc" /> + </controls> + </pages> + </system.web> + + <system.webServer> + <validation validateIntegratedModeConfiguration="false" /> + + <handlers> + <remove name="BlockViewHandler"/> + <add name="BlockViewHandler" path="*" verb="*" preCondition="integratedMode" type="System.Web.HttpNotFoundHandler" /> + </handlers> + </system.webServer> +</configuration> diff --git a/samples/OAuth2ProtectedWebApi/Views/_ViewStart.cshtml b/samples/OAuth2ProtectedWebApi/Views/_ViewStart.cshtml new file mode 100644 index 0000000..efda124 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Views/_ViewStart.cshtml @@ -0,0 +1,3 @@ +@{ + Layout = "~/Views/Shared/_Layout.cshtml"; +}
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Web.Debug.config b/samples/OAuth2ProtectedWebApi/Web.Debug.config new file mode 100644 index 0000000..3e2a97c --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Web.Debug.config @@ -0,0 +1,30 @@ +<?xml version="1.0"?> + +<!-- For more information on using Web.config transformation visit http://go.microsoft.com/fwlink/?LinkId=125889 --> + +<configuration xmlns:xdt="http://schemas.microsoft.com/XML-Document-Transform"> + <!-- + In the example below, the "SetAttributes" transform will change the value of + "connectionString" to use "ReleaseSQLServer" only when the "Match" locator + finds an atrribute "name" that has a value of "MyDB". + + <connectionStrings> + <add name="MyDB" + connectionString="Data Source=ReleaseSQLServer;Initial Catalog=MyReleaseDB;Integrated Security=True" + xdt:Transform="SetAttributes" xdt:Locator="Match(name)"/> + </connectionStrings> + --> + <system.web> + <!-- + In the example below, the "Replace" transform will replace the entire + <customErrors> section of your Web.config file. + Note that because there is only one customErrors section under the + <system.web> node, there is no need to use the "xdt:Locator" attribute. + + <customErrors defaultRedirect="GenericError.htm" + mode="RemoteOnly" xdt:Transform="Replace"> + <error statusCode="500" redirect="InternalError.htm"/> + </customErrors> + --> + </system.web> +</configuration>
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Web.Release.config b/samples/OAuth2ProtectedWebApi/Web.Release.config new file mode 100644 index 0000000..9fd481f --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Web.Release.config @@ -0,0 +1,31 @@ +<?xml version="1.0"?> + +<!-- For more information on using Web.config transformation visit http://go.microsoft.com/fwlink/?LinkId=125889 --> + +<configuration xmlns:xdt="http://schemas.microsoft.com/XML-Document-Transform"> + <!-- + In the example below, the "SetAttributes" transform will change the value of + "connectionString" to use "ReleaseSQLServer" only when the "Match" locator + finds an atrribute "name" that has a value of "MyDB". + + <connectionStrings> + <add name="MyDB" + connectionString="Data Source=ReleaseSQLServer;Initial Catalog=MyReleaseDB;Integrated Security=True" + xdt:Transform="SetAttributes" xdt:Locator="Match(name)"/> + </connectionStrings> + --> + <system.web> + <compilation xdt:Transform="RemoveAttributes(debug)" /> + <!-- + In the example below, the "Replace" transform will replace the entire + <customErrors> section of your Web.config file. + Note that because there is only one customErrors section under the + <system.web> node, there is no need to use the "xdt:Locator" attribute. + + <customErrors defaultRedirect="GenericError.htm" + mode="RemoteOnly" xdt:Transform="Replace"> + <error statusCode="500" redirect="InternalError.htm"/> + </customErrors> + --> + </system.web> +</configuration>
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/Web.config b/samples/OAuth2ProtectedWebApi/Web.config new file mode 100644 index 0000000..ef67291 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/Web.config @@ -0,0 +1,124 @@ +<?xml version="1.0" encoding="utf-8"?> +<!-- + For more information on how to configure your ASP.NET application, please visit + http://go.microsoft.com/fwlink/?LinkId=169433 + --> +<configuration> + <configSections> + <!-- For more information on Entity Framework configuration, visit http://go.microsoft.com/fwlink/?LinkID=237468 --> + <section name="entityFramework" type="System.Data.Entity.Internal.ConfigFile.EntityFrameworkSection, EntityFramework, Version=5.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089" requirePermission="false" /> + <section name="log4net" type="log4net.Config.Log4NetConfigurationSectionHandler" requirePermission="false"/> + <sectionGroup name="dotNetOpenAuth" type="DotNetOpenAuth.Configuration.DotNetOpenAuthSection, DotNetOpenAuth.Core"> + <section name="openid" type="DotNetOpenAuth.Configuration.OpenIdElement, DotNetOpenAuth.OpenId" requirePermission="false" allowLocation="true" /> + <section name="oauth" type="DotNetOpenAuth.Configuration.OAuthElement, DotNetOpenAuth.OAuth" requirePermission="false" allowLocation="true" /> + <sectionGroup name="oauth2" type="DotNetOpenAuth.Configuration.OAuth2SectionGroup, DotNetOpenAuth.OAuth2"> + <section name="authorizationServer" type="DotNetOpenAuth.Configuration.OAuth2AuthorizationServerSection, DotNetOpenAuth.OAuth2.AuthorizationServer" requirePermission="false" allowLocation="true" /> + </sectionGroup> + <section name="messaging" type="DotNetOpenAuth.Configuration.MessagingElement, DotNetOpenAuth.Core" requirePermission="false" allowLocation="true" /> + <section name="reporting" type="DotNetOpenAuth.Configuration.ReportingElement, DotNetOpenAuth.Core" requirePermission="false" allowLocation="true" /> + </sectionGroup> + </configSections> + <connectionStrings> + <add name="DefaultConnection" providerName="System.Data.SqlClient" connectionString="Data Source=(LocalDb)\v11.0;Initial Catalog=aspnet-OAuth2ProtectedWebApi-20130228210758;Integrated Security=SSPI;AttachDBFilename=|DataDirectory|\aspnet-OAuth2ProtectedWebApi-20130228210758.mdf" /> + </connectionStrings> + <appSettings> + <add key="webpages:Version" value="2.0.0.0" /> + <add key="webpages:Enabled" value="false" /> + <add key="PreserveLoginUrl" value="true" /> + <add key="ClientValidationEnabled" value="true" /> + <add key="UnobtrusiveJavaScriptEnabled" value="true" /> + </appSettings> + <system.web> + <compilation debug="true" targetFramework="4.5" /> + <httpRuntime targetFramework="4.5" /> + <authentication mode="Forms"> + <forms loginUrl="/user/login" defaultUrl="/" /> + </authentication> + <pages> + <namespaces> + <add namespace="System.Web.Helpers" /> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Optimization" /> + <add namespace="System.Web.Routing" /> + <add namespace="System.Web.WebPages" /> + </namespaces> + </pages> + <profile defaultProvider="DefaultProfileProvider"> + <providers> + <add name="DefaultProfileProvider" type="System.Web.Providers.DefaultProfileProvider, System.Web.Providers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" connectionStringName="DefaultConnection" applicationName="/" /> + </providers> + </profile> + <membership defaultProvider="DefaultMembershipProvider"> + <providers> + <add name="DefaultMembershipProvider" type="System.Web.Providers.DefaultMembershipProvider, System.Web.Providers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" connectionStringName="DefaultConnection" enablePasswordRetrieval="false" enablePasswordReset="true" requiresQuestionAndAnswer="false" requiresUniqueEmail="false" maxInvalidPasswordAttempts="5" minRequiredPasswordLength="6" minRequiredNonalphanumericCharacters="0" passwordAttemptWindow="10" applicationName="/" /> + </providers> + </membership> + <roleManager defaultProvider="DefaultRoleProvider"> + <providers> + <add name="DefaultRoleProvider" type="System.Web.Providers.DefaultRoleProvider, System.Web.Providers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" connectionStringName="DefaultConnection" applicationName="/" /> + </providers> + </roleManager> + <!-- + If you are deploying to a cloud environment that has multiple web server instances, + you should change session state mode from "InProc" to "Custom". In addition, + change the connection string named "DefaultConnection" to connect to an instance + of SQL Server (including SQL Azure and SQL Compact) instead of to SQL Server Express. + --> + <sessionState mode="InProc" customProvider="DefaultSessionProvider"> + <providers> + <add name="DefaultSessionProvider" type="System.Web.Providers.DefaultSessionStateProvider, System.Web.Providers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" connectionStringName="DefaultConnection" /> + </providers> + </sessionState> + </system.web> + <system.webServer> + <validation validateIntegratedModeConfiguration="false" /> + <handlers> + <remove name="ExtensionlessUrlHandler-ISAPI-4.0_32bit" /> + <remove name="ExtensionlessUrlHandler-ISAPI-4.0_64bit" /> + <remove name="ExtensionlessUrlHandler-Integrated-4.0" /> + <add name="ExtensionlessUrlHandler-ISAPI-4.0_32bit" path="*." verb="GET,HEAD,POST,DEBUG,PUT,DELETE,PATCH,OPTIONS" modules="IsapiModule" scriptProcessor="%windir%\Microsoft.NET\Framework\v4.0.30319\aspnet_isapi.dll" preCondition="classicMode,runtimeVersionv4.0,bitness32" responseBufferLimit="0" /> + <add name="ExtensionlessUrlHandler-ISAPI-4.0_64bit" path="*." verb="GET,HEAD,POST,DEBUG,PUT,DELETE,PATCH,OPTIONS" modules="IsapiModule" scriptProcessor="%windir%\Microsoft.NET\Framework64\v4.0.30319\aspnet_isapi.dll" preCondition="classicMode,runtimeVersionv4.0,bitness64" responseBufferLimit="0" /> + <add name="ExtensionlessUrlHandler-Integrated-4.0" path="*." verb="GET,HEAD,POST,DEBUG,PUT,DELETE,PATCH,OPTIONS" type="System.Web.Handlers.TransferRequestHandler" preCondition="integratedMode,runtimeVersionv4.0" /> + </handlers> + </system.webServer> + <!-- this is an optional configuration section where aspects of dotnetopenauth can be customized --> + <dotNetOpenAuth> + <!-- Allow DotNetOpenAuth to publish usage statistics to library authors to improve the library. --> + <reporting enabled="true" /> + <oauth2> + <authorizationServer> + </authorizationServer> + </oauth2> + + <!-- Relaxing SSL requirements is useful for simple samples, but NOT a good idea in production. --> + <messaging relaxSslRequirements="true"> + <untrustedWebRequest> + <whitelistHosts> + <!-- since this is a sample, and will often be used with localhost --> + <add name="localhost"/> + </whitelistHosts> + </untrustedWebRequest> + </messaging> + </dotNetOpenAuth> + <runtime> + <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> + <dependentAssembly> + <assemblyIdentity name="System.Web.Helpers" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-2.0.0.0" newVersion="2.0.0.0" /> + </dependentAssembly> + <dependentAssembly> + <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-4.0.0.0" newVersion="4.0.0.0" /> + </dependentAssembly> + <dependentAssembly> + <assemblyIdentity name="System.Web.WebPages" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-2.0.0.0" newVersion="2.0.0.0" /> + </dependentAssembly> + </assemblyBinding> + </runtime> + <entityFramework> + <defaultConnectionFactory type="System.Data.Entity.Infrastructure.SqlConnectionFactory, EntityFramework" /> + </entityFramework> +</configuration>
\ No newline at end of file diff --git a/samples/OAuth2ProtectedWebApi/favicon.ico b/samples/OAuth2ProtectedWebApi/favicon.ico Binary files differnew file mode 100644 index 0000000..a3a7999 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/favicon.ico diff --git a/samples/OAuth2ProtectedWebApi/packages.config b/samples/OAuth2ProtectedWebApi/packages.config new file mode 100644 index 0000000..9aada29 --- /dev/null +++ b/samples/OAuth2ProtectedWebApi/packages.config @@ -0,0 +1,25 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="EntityFramework" version="5.0.0" targetFramework="net45" /> + <package id="jQuery" version="1.7.1.1" targetFramework="net45" /> + <package id="jQuery.UI.Combined" version="1.8.20.1" targetFramework="net45" /> + <package id="jQuery.Validation" version="1.9.0.1" targetFramework="net45" /> + <package id="knockoutjs" version="2.1.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Mvc" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Providers.Core" version="1.1" targetFramework="net45" /> + <package id="Microsoft.AspNet.Providers.LocalDB" version="1.1" targetFramework="net45" /> + <package id="Microsoft.AspNet.Razor" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Web.Optimization" version="1.0.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.Client" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.Core" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.WebHost" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebPages" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.jQuery.Unobtrusive.Ajax" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.jQuery.Unobtrusive.Validation" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Web.Infrastructure" version="1.0.0.0" targetFramework="net45" /> + <package id="Modernizr" version="2.5.3" targetFramework="net45" /> + <package id="Newtonsoft.Json" version="4.5.6" targetFramework="net45" /> + <package id="WebGrease" version="1.1.0" targetFramework="net45" /> +</packages>
\ No newline at end of file diff --git a/samples/OAuthAuthorizationServer/Controllers/AccountController.cs b/samples/OAuthAuthorizationServer/Controllers/AccountController.cs index d69a3b5..336f9bd 100644 --- a/samples/OAuthAuthorizationServer/Controllers/AccountController.cs +++ b/samples/OAuthAuthorizationServer/Controllers/AccountController.cs @@ -1,13 +1,12 @@ namespace OAuthAuthorizationServer.Controllers { using System; using System.Linq; + using System.Threading.Tasks; using System.Web.Mvc; using System.Web.Security; - using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.RelyingParty; - using OAuthAuthorizationServer.Code; using OAuthAuthorizationServer.Models; @@ -21,16 +20,17 @@ } [HttpPost] - public ActionResult LogOn(LogOnModel model, string returnUrl) { + public async Task<ActionResult> LogOn(LogOnModel model, string returnUrl) { if (ModelState.IsValid) { var rp = new OpenIdRelyingParty(); - var request = rp.CreateRequest(model.UserSuppliedIdentifier, Realm.AutoDetect, new Uri(Request.Url, Url.Action("Authenticate"))); + var request = await rp.CreateRequestAsync(model.UserSuppliedIdentifier, Realm.AutoDetect, new Uri(Request.Url, Url.Action("Authenticate")), Response.ClientDisconnectedToken); if (request != null) { if (returnUrl != null) { request.AddCallbackArguments("returnUrl", returnUrl); } - return request.RedirectingResponse.AsActionResult(); + var response = await request.GetRedirectingResponseAsync(Response.ClientDisconnectedToken); + return response.AsActionResult(); } else { ModelState.AddModelError(string.Empty, "The identifier you supplied is not recognized as a valid OpenID Identifier."); } @@ -40,9 +40,9 @@ return View(model); } - public ActionResult Authenticate(string returnUrl) { + public async Task<ActionResult> Authenticate(string returnUrl) { var rp = new OpenIdRelyingParty(); - var response = rp.GetResponse(); + var response = await rp.GetResponseAsync(Request, Response.ClientDisconnectedToken); if (response != null) { switch (response.Status) { case AuthenticationStatus.Authenticated: diff --git a/samples/OAuthAuthorizationServer/Controllers/OAuthController.cs b/samples/OAuthAuthorizationServer/Controllers/OAuthController.cs index 4c3e4d4..3ab4096 100644 --- a/samples/OAuthAuthorizationServer/Controllers/OAuthController.cs +++ b/samples/OAuthAuthorizationServer/Controllers/OAuthController.cs @@ -4,12 +4,11 @@ using System.Linq;
using System.Net;
using System.Security.Cryptography;
+ using System.Threading.Tasks;
using System.Web;
using System.Web.Mvc;
-
using DotNetOpenAuth.Messaging;
using DotNetOpenAuth.OAuth2;
-
using OAuthAuthorizationServer.Code;
using OAuthAuthorizationServer.Models;
@@ -20,8 +19,9 @@ /// The OAuth 2.0 token endpoint.
/// </summary>
/// <returns>The response to the Client.</returns>
- public ActionResult Token() {
- return this.authorizationServer.HandleTokenRequest(this.Request).AsActionResult();
+ public async Task<ActionResult> Token() {
+ var request = await this.authorizationServer.HandleTokenRequestAsync(this.Request, this.Response.ClientDisconnectedToken);
+ return request.AsActionResult();
}
/// <summary>
@@ -30,8 +30,8 @@ /// <returns>The browser HTML response that prompts the user to authorize the client.</returns>
[Authorize, AcceptVerbs(HttpVerbs.Get | HttpVerbs.Post)]
[HttpHeader("x-frame-options", "SAMEORIGIN")] // mitigates clickjacking
- public ActionResult Authorize() {
- var pendingRequest = this.authorizationServer.ReadAuthorizationRequest();
+ public async Task<ActionResult> Authorize() {
+ var pendingRequest = await this.authorizationServer.ReadAuthorizationRequestAsync(Request, Response.ClientDisconnectedToken);
if (pendingRequest == null) {
throw new HttpException((int)HttpStatusCode.BadRequest, "Missing authorization request.");
}
@@ -41,7 +41,8 @@ // Consider auto-approving if safe to do so.
if (((OAuth2AuthorizationServer)this.authorizationServer.AuthorizationServerServices).CanBeAutoApproved(pendingRequest)) {
var approval = this.authorizationServer.PrepareApproveAuthorizationRequest(pendingRequest, HttpContext.User.Identity.Name);
- return this.authorizationServer.Channel.PrepareResponse(approval).AsActionResult();
+ var response = await this.authorizationServer.Channel.PrepareResponseAsync(approval, Response.ClientDisconnectedToken);
+ return response.AsActionResult();
}
var model = new AccountAuthorizeModel {
@@ -59,8 +60,8 @@ /// <param name="isApproved">if set to <c>true</c>, the user has authorized the Client; <c>false</c> otherwise.</param>
/// <returns>HTML response that redirects the browser to the Client.</returns>
[Authorize, HttpPost, ValidateAntiForgeryToken]
- public ActionResult AuthorizeResponse(bool isApproved) {
- var pendingRequest = this.authorizationServer.ReadAuthorizationRequest();
+ public async Task<ActionResult> AuthorizeResponse(bool isApproved) {
+ var pendingRequest = await this.authorizationServer.ReadAuthorizationRequestAsync(Request, Response.ClientDisconnectedToken);
if (pendingRequest == null) {
throw new HttpException((int)HttpStatusCode.BadRequest, "Missing authorization request.");
}
@@ -86,7 +87,8 @@ response = this.authorizationServer.PrepareRejectAuthorizationRequest(pendingRequest);
}
- return this.authorizationServer.Channel.PrepareResponse(response).AsActionResult();
+ var preparedResponse = await this.authorizationServer.Channel.PrepareResponseAsync(response, Response.ClientDisconnectedToken);
+ return preparedResponse.AsActionResult();
}
}
}
diff --git a/samples/OAuthAuthorizationServer/OAuthAuthorizationServer.csproj b/samples/OAuthAuthorizationServer/OAuthAuthorizationServer.csproj index 7715fe2..82402c8 100644 --- a/samples/OAuthAuthorizationServer/OAuthAuthorizationServer.csproj +++ b/samples/OAuthAuthorizationServer/OAuthAuthorizationServer.csproj @@ -48,6 +48,10 @@ <HintPath>..\..\src\packages\log4net.2.0.0\lib\net40-full\log4net.dll</HintPath> </Reference> <Reference Include="Microsoft.CSharp" /> + <Reference Include="Microsoft.Web.Infrastructure, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll</HintPath> + </Reference> <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.Linq" /> @@ -66,7 +70,30 @@ <Reference Include="System.Data.DataSetExtensions"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> - <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> + <Reference Include="System.Web.Helpers, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.Helpers.dll</HintPath> + </Reference> + <Reference Include="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Mvc.4.0.20710.0\lib\net40\System.Web.Mvc.dll</HintPath> + </Reference> + <Reference Include="System.Web.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Razor.2.0.20715.0\lib\net40\System.Web.Razor.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Deployment, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Deployment.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Razor.dll</HintPath> + </Reference> <Reference Include="System.Xml.Linq"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> diff --git a/samples/OAuthAuthorizationServer/Web.config b/samples/OAuthAuthorizationServer/Web.config index 37157fd..4e25f1e 100644 --- a/samples/OAuthAuthorizationServer/Web.config +++ b/samples/OAuthAuthorizationServer/Web.config @@ -75,12 +75,17 @@ providerName="System.Data.SqlClient" /> </connectionStrings> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> + <system.web> + <httpRuntime targetFramework="4.5" /> <compilation debug="true" targetFramework="4.0"> <assemblies> <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> - <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> </assemblies> </compilation> @@ -104,12 +109,10 @@ </system.webServer> <runtime> - <!-- When targeting ASP.NET MVC 3, this assemblyBinding makes MVC 1 and 2 references relink - to MVC 3 so libraries such as DotNetOpenAuth that compile against MVC 1 will work with it. --> <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> <dependentAssembly> <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> - <bindingRedirect oldVersion="1.0.0.0-3.0.0.0" newVersion="3.0.0.0" /> + <bindingRedirect oldVersion="1.0.0.0-4.0.0.0" newVersion="4.0.0.0" /> </dependentAssembly> </assemblyBinding> </runtime> diff --git a/samples/OAuthAuthorizationServer/packages.config b/samples/OAuthAuthorizationServer/packages.config index 8e40260..ce88802 100644 --- a/samples/OAuthAuthorizationServer/packages.config +++ b/samples/OAuthAuthorizationServer/packages.config @@ -1,5 +1,9 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Mvc" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Razor" version="2.0.20715.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebPages" version="2.0.20710.0" targetFramework="net45" /> <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Web.Infrastructure" version="1.0.0.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OAuthClient/Facebook.aspx b/samples/OAuthClient/Facebook.aspx index c227814..4cdc4b1 100644 --- a/samples/OAuthClient/Facebook.aspx +++ b/samples/OAuthClient/Facebook.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" Inherits="OAuthClient.Facebook" Codebehind="Facebook.aspx.cs" %> +<%@ Page Language="C#" AutoEventWireup="true" Inherits="OAuthClient.Facebook" Codebehind="Facebook.aspx.cs" Async="true" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> <html xmlns="http://www.w3.org/1999/xhtml"> diff --git a/samples/OAuthClient/Facebook.aspx.cs b/samples/OAuthClient/Facebook.aspx.cs index 4701d24..19211bc 100644 --- a/samples/OAuthClient/Facebook.aspx.cs +++ b/samples/OAuthClient/Facebook.aspx.cs @@ -3,8 +3,11 @@ using System.Configuration; using System.Net; using System.Web; + using System.Web.UI; + using DotNetOpenAuth.ApplicationBlock; using DotNetOpenAuth.ApplicationBlock.Facebook; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth2; public partial class Facebook : System.Web.UI.Page { @@ -14,19 +17,29 @@ }; protected void Page_Load(object sender, EventArgs e) { - IAuthorizationState authorization = client.ProcessUserAuthorization(); - if (authorization == null) { - // Kick off authorization request - client.RequestUserAuthorization(); - } else { - var request = WebRequest.Create("https://graph.facebook.com/me?access_token=" + Uri.EscapeDataString(authorization.AccessToken)); - using (var response = request.GetResponse()) { - using (var responseStream = response.GetResponseStream()) { - var graph = FacebookGraph.Deserialize(responseStream); - this.nameLabel.Text = HttpUtility.HtmlEncode(graph.Name); - } - } - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + IAuthorizationState authorization = + await client.ProcessUserAuthorizationAsync(new HttpRequestWrapper(Request), ct); + if (authorization == null) { + // Kick off authorization request + var request = + await client.PrepareRequestUserAuthorizationAsync(cancellationToken: ct); + await request.SendAsync(new HttpContextWrapper(Context), ct); + this.Context.Response.End(); + } else { + var request = + WebRequest.Create( + "https://graph.facebook.com/me?access_token=" + Uri.EscapeDataString(authorization.AccessToken)); + using (var response = request.GetResponse()) { + using (var responseStream = response.GetResponseStream()) { + var graph = FacebookGraph.Deserialize(responseStream); + this.nameLabel.Text = HttpUtility.HtmlEncode(graph.Name); + } + } + } + })); } } }
\ No newline at end of file diff --git a/samples/OAuthClient/GoogleAddressBook.aspx b/samples/OAuthClient/GoogleAddressBook.aspx deleted file mode 100644 index 11891f2..0000000 --- a/samples/OAuthClient/GoogleAddressBook.aspx +++ /dev/null @@ -1,26 +0,0 @@ -<%@ Page Title="Gmail address book demo" Language="C#" MasterPageFile="~/MasterPage.master" - AutoEventWireup="true" Inherits="OAuthClient.GoogleAddressBook" Codebehind="GoogleAddressBook.aspx.cs" %> - -<asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> - <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> - <asp:View runat="server"> - <h2>Google setup</h2> - <p>A Google client app must be endorsed by a Google user. </p> - <ol> - <li><a target="_blank" href="https://www.google.com/accounts/ManageDomains">Visit Google - and create a client app</a>. </li> - <li>Modify your web.config file to include your consumer key and consumer secret. - </li> - </ol> - </asp:View> - <asp:View runat="server"> - <h2>Updates</h2> - <p>Ok, Google has authorized us to download your contacts. Click 'Get address book' - to download the first 5 contacts to this sample. Notice how we never asked you - for your Google username or password. </p> - <asp:Button ID="getAddressBookButton" runat="server" OnClick="getAddressBookButton_Click" - Text="Get address book" /> - <asp:PlaceHolder ID="resultsPlaceholder" runat="server" /> - </asp:View> - </asp:MultiView> -</asp:Content> diff --git a/samples/OAuthClient/GoogleAddressBook.aspx.cs b/samples/OAuthClient/GoogleAddressBook.aspx.cs deleted file mode 100644 index b7221af..0000000 --- a/samples/OAuthClient/GoogleAddressBook.aspx.cs +++ /dev/null @@ -1,75 +0,0 @@ -namespace OAuthClient { - using System; - using System.Configuration; - using System.Linq; - using System.Text; - using System.Web; - using System.Web.UI; - using System.Web.UI.WebControls; - using System.Xml.Linq; - using DotNetOpenAuth.ApplicationBlock; - using DotNetOpenAuth.OAuth; - - /// <summary> - /// A page to demonstrate downloading a Gmail address book using OAuth. - /// </summary> - public partial class GoogleAddressBook : System.Web.UI.Page { - private string AccessToken { - get { return (string)Session["GoogleAccessToken"]; } - set { Session["GoogleAccessToken"] = value; } - } - - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["GoogleTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["GoogleTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { - this.MultiView1.ActiveViewIndex = 1; - - if (!IsPostBack) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); - - // Is Google calling back with authorization? - var accessTokenResponse = google.ProcessUserAuthorization(); - if (accessTokenResponse != null) { - this.AccessToken = accessTokenResponse.AccessToken; - } else if (this.AccessToken == null) { - // If we don't yet have access, immediately request it. - GoogleConsumer.RequestAuthorization(google, GoogleConsumer.Applications.Contacts); - } - } - } - } - - protected void getAddressBookButton_Click(object sender, EventArgs e) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); - - XDocument contactsDocument = GoogleConsumer.GetContacts(google, this.AccessToken, 5, 1); - var contacts = from entry in contactsDocument.Root.Elements(XName.Get("entry", "http://www.w3.org/2005/Atom")) - select new { Name = entry.Element(XName.Get("title", "http://www.w3.org/2005/Atom")).Value, Email = entry.Element(XName.Get("email", "http://schemas.google.com/g/2005")).Attribute("address").Value }; - StringBuilder tableBuilder = new StringBuilder(); - tableBuilder.Append("<table><tr><td>Name</td><td>Email</td></tr>"); - foreach (var contact in contacts) { - tableBuilder.AppendFormat( - "<tr><td>{0}</td><td>{1}</td></tr>", - HttpUtility.HtmlEncode(contact.Name), - HttpUtility.HtmlEncode(contact.Email)); - } - tableBuilder.Append("</table>"); - this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); - } - } -}
\ No newline at end of file diff --git a/samples/OAuthClient/GoogleAddressBook.aspx.designer.cs b/samples/OAuthClient/GoogleAddressBook.aspx.designer.cs deleted file mode 100644 index 576072e..0000000 --- a/samples/OAuthClient/GoogleAddressBook.aspx.designer.cs +++ /dev/null @@ -1,42 +0,0 @@ -//------------------------------------------------------------------------------ -// <auto-generated> -// This code was generated by a tool. -// -// Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. -// </auto-generated> -//------------------------------------------------------------------------------ - -namespace OAuthClient { - - - public partial class GoogleAddressBook { - - /// <summary> - /// MultiView1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.MultiView MultiView1; - - /// <summary> - /// getAddressBookButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button getAddressBookButton; - - /// <summary> - /// resultsPlaceholder control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.PlaceHolder resultsPlaceholder; - } -} diff --git a/samples/OAuthClient/GoogleApps2Legged.aspx b/samples/OAuthClient/GoogleApps2Legged.aspx deleted file mode 100644 index cd9d9a1..0000000 --- a/samples/OAuthClient/GoogleApps2Legged.aspx +++ /dev/null @@ -1,25 +0,0 @@ -<%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/MasterPage.master"CodeBehind="GoogleApps2Legged.aspx.cs" Inherits="OAuthConsumer.GoogleApps2Legged" %> - -<asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> - <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> - <asp:View runat="server"> - <h2>Google setup</h2> - <p>A Google client app must be endorsed by a Google user. </p> - <ol> - <li><a target="_blank" href="https://www.google.com/accounts/ManageDomains">Visit Google - and create a client app</a>. </li> - <li>Modify your web.config file to include your consumer key and consumer secret. - </li> - </ol> - </asp:View> - <asp:View runat="server"> - <h2>Updates</h2> - <p>Ok, Google has authorized us to download your contacts. Click 'Get address book' - to download the first 5 contacts to this sample. Notice how we never asked you - for your Google username or password. </p> - <asp:Button ID="getAddressBookButton" runat="server" OnClick="getAddressBookButton_Click" - Text="Get address book" /> - <asp:PlaceHolder ID="resultsPlaceholder" runat="server" /> - </asp:View> - </asp:MultiView> -</asp:Content> diff --git a/samples/OAuthClient/GoogleApps2Legged.aspx.cs b/samples/OAuthClient/GoogleApps2Legged.aspx.cs deleted file mode 100644 index afb156b..0000000 --- a/samples/OAuthClient/GoogleApps2Legged.aspx.cs +++ /dev/null @@ -1,39 +0,0 @@ -namespace OAuthConsumer { - using System; - using System.Collections.Generic; - using System.Configuration; - using System.Linq; - using System.Web; - using System.Web.UI; - using System.Web.UI.WebControls; - using DotNetOpenAuth.ApplicationBlock; - using DotNetOpenAuth.Messaging; - using DotNetOpenAuth.OAuth; - using DotNetOpenAuth.OAuth.Messages; - - public partial class GoogleApps2Legged : System.Web.UI.Page { - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["GoogleTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["GoogleTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - - protected void Page_Load(object sender, EventArgs e) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); - string accessToken = google.RequestNewClientAccount(); - ////string tokenSecret = google.TokenManager.GetTokenSecret(accessToken); - MessageReceivingEndpoint ep = null; // set up your authorized call here. - google.PrepareAuthorizedRequestAndSend(ep, accessToken); - } - } -}
\ No newline at end of file diff --git a/samples/OAuthClient/GoogleApps2Legged.aspx.designer.cs b/samples/OAuthClient/GoogleApps2Legged.aspx.designer.cs deleted file mode 100644 index f952937..0000000 --- a/samples/OAuthClient/GoogleApps2Legged.aspx.designer.cs +++ /dev/null @@ -1,42 +0,0 @@ -//------------------------------------------------------------------------------ -// <auto-generated> -// This code was generated by a tool. -// -// Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. -// </auto-generated> -//------------------------------------------------------------------------------ - -namespace OAuthConsumer { - - - public partial class GoogleApps2Legged { - - /// <summary> - /// MultiView1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.MultiView MultiView1; - - /// <summary> - /// getAddressBookButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button getAddressBookButton; - - /// <summary> - /// resultsPlaceholder control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.PlaceHolder resultsPlaceholder; - } -} diff --git a/samples/OAuthClient/OAuthClient.csproj b/samples/OAuthClient/OAuthClient.csproj index 8a5cc88..3c94f38 100644 --- a/samples/OAuthClient/OAuthClient.csproj +++ b/samples/OAuthClient/OAuthClient.csproj @@ -55,6 +55,8 @@ <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Runtime.Serialization" /> <Reference Include="System.ServiceModel" /> <Reference Include="System.Web.Abstractions" /> @@ -75,15 +77,12 @@ <Content Include="Facebook.aspx" /> <Content Include="favicon.ico" /> <Content Include="Global.asax" /> - <Content Include="GoogleAddressBook.aspx" /> - <Content Include="GoogleApps2Legged.aspx" /> <Content Include="images\Sign-in-with-Twitter-darker.png" /> <Content Include="SampleWcf2Javascript.html" /> <Content Include="SampleWcf2Javascript.js" /> <Content Include="Scripts\jquery-1.6.1.js" /> <Content Include="Scripts\jquery-1.6.1.min.js" /> <Content Include="WindowsLive.aspx" /> - <Content Include="Yammer.aspx" /> <Content Include="packages.config" /> <None Include="Service References\SampleResourceServer\DataApi.disco" /> <None Include="Service References\SampleResourceServer\configuration91.svcinfo" /> @@ -93,9 +92,7 @@ <LastGenOutput>Reference.cs</LastGenOutput> </None> <Content Include="SampleWcf2.aspx" /> - <Content Include="SignInWithTwitter.aspx" /> <Content Include="TracePage.aspx" /> - <Content Include="Twitter.aspx" /> <Content Include="Web.config" /> <None Include="Service References\SampleResourceServer\DataApi1.xsd"> <SubType>Designer</SubType> @@ -105,9 +102,7 @@ </None> </ItemGroup> <ItemGroup> - <Compile Include="..\DotNetOpenAuth.ApplicationBlock\InMemoryTokenManager.cs"> - <Link>Code\InMemoryTokenManager.cs</Link> - </Compile> + <Compile Include="Code\Logging.cs" /> <Compile Include="Facebook.aspx.cs"> <DependentUpon>Facebook.aspx</DependentUpon> <SubType>ASPXCodeBehind</SubType> @@ -118,20 +113,10 @@ <Compile Include="Global.asax.cs"> <DependentUpon>Global.asax</DependentUpon> </Compile> - <Compile Include="GoogleAddressBook.aspx.designer.cs"> - <DependentUpon>GoogleAddressBook.aspx</DependentUpon> - </Compile> <Compile Include="SampleWcf2.aspx.cs"> <DependentUpon>SampleWcf2.aspx</DependentUpon> <SubType>ASPXCodeBehind</SubType> </Compile> - <Compile Include="GoogleApps2Legged.aspx.cs"> - <DependentUpon>GoogleApps2Legged.aspx</DependentUpon> - <SubType>ASPXCodeBehind</SubType> - </Compile> - <Compile Include="GoogleApps2Legged.aspx.designer.cs"> - <DependentUpon>GoogleApps2Legged.aspx</DependentUpon> - </Compile> <Compile Include="SampleWcf2.aspx.designer.cs"> <DependentUpon>SampleWcf2.aspx</DependentUpon> </Compile> @@ -140,13 +125,6 @@ <DesignTime>True</DesignTime> <DependentUpon>Reference.svcmap</DependentUpon> </Compile> - <Compile Include="SignInWithTwitter.aspx.cs"> - <DependentUpon>SignInWithTwitter.aspx</DependentUpon> - <SubType>ASPXCodeBehind</SubType> - </Compile> - <Compile Include="SignInWithTwitter.aspx.designer.cs"> - <DependentUpon>SignInWithTwitter.aspx</DependentUpon> - </Compile> <Compile Include="TracePage.aspx.cs"> <DependentUpon>TracePage.aspx</DependentUpon> <SubType>ASPXCodeBehind</SubType> @@ -154,20 +132,8 @@ <Compile Include="TracePage.aspx.designer.cs"> <DependentUpon>TracePage.aspx</DependentUpon> </Compile> - <Compile Include="Twitter.aspx.cs"> - <DependentUpon>Twitter.aspx</DependentUpon> - <SubType>ASPXCodeBehind</SubType> - </Compile> - <Compile Include="Code\Logging.cs" /> <Compile Include="Code\TracePageAppender.cs" /> - <Compile Include="GoogleAddressBook.aspx.cs"> - <DependentUpon>GoogleAddressBook.aspx</DependentUpon> - <SubType>ASPXCodeBehind</SubType> - </Compile> <Compile Include="Properties\AssemblyInfo.cs" /> - <Compile Include="Twitter.aspx.designer.cs"> - <DependentUpon>Twitter.aspx</DependentUpon> - </Compile> <Compile Include="WindowsLive.aspx.cs"> <DependentUpon>WindowsLive.aspx</DependentUpon> <SubType>ASPXCodeBehind</SubType> @@ -175,13 +141,6 @@ <Compile Include="WindowsLive.aspx.designer.cs"> <DependentUpon>WindowsLive.aspx</DependentUpon> </Compile> - <Compile Include="Yammer.aspx.cs"> - <DependentUpon>Yammer.aspx</DependentUpon> - <SubType>ASPXCodeBehind</SubType> - </Compile> - <Compile Include="Yammer.aspx.designer.cs"> - <DependentUpon>Yammer.aspx</DependentUpon> - </Compile> </ItemGroup> <ItemGroup> <Folder Include="App_Data\" /> diff --git a/samples/OAuthClient/SampleWcf2.aspx b/samples/OAuthClient/SampleWcf2.aspx index cfacaf1..457a409 100644 --- a/samples/OAuthClient/SampleWcf2.aspx +++ b/samples/OAuthClient/SampleWcf2.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="OAuth 2.0 client (web server flow)" Language="C#" MasterPageFile="~/MasterPage.master" +<%@ Page Title="OAuth 2.0 client (web server flow)" Language="C#" MasterPageFile="~/MasterPage.master" Async="true" AutoEventWireup="true" Inherits="OAuthClient.SampleWcf2" CodeBehind="SampleWcf2.aspx.cs" %> <asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> diff --git a/samples/OAuthClient/SampleWcf2.aspx.cs b/samples/OAuthClient/SampleWcf2.aspx.cs index 06bbe9b..e96a5c0 100644 --- a/samples/OAuthClient/SampleWcf2.aspx.cs +++ b/samples/OAuthClient/SampleWcf2.aspx.cs @@ -1,143 +1,170 @@ -namespace OAuthClient {
- using System;
- using System.Collections.Generic;
- using System.Globalization;
- using System.Linq;
- using System.Net;
- using System.ServiceModel;
- using System.ServiceModel.Channels;
- using System.ServiceModel.Security;
- using System.Web;
- using System.Web.UI;
- using System.Web.UI.WebControls;
- using DotNetOpenAuth.OAuth2;
-
- using SampleResourceServer;
-
- public partial class SampleWcf2 : System.Web.UI.Page {
- /// <summary>
- /// The OAuth 2.0 client object to use to obtain authorization and authorize outgoing HTTP requests.
- /// </summary>
- private static readonly WebServerClient Client;
-
- /// <summary>
- /// The details about the sample OAuth-enabled WCF service that this sample client calls into.
- /// </summary>
- private static AuthorizationServerDescription authServerDescription = new AuthorizationServerDescription {
- TokenEndpoint = new Uri("http://localhost:50172/OAuth/Token"),
- AuthorizationEndpoint = new Uri("http://localhost:50172/OAuth/Authorize"),
- };
-
- /// <summary>
- /// Initializes static members of the <see cref="SampleWcf2"/> class.
- /// </summary>
- static SampleWcf2() {
- Client = new WebServerClient(authServerDescription, "sampleconsumer", "samplesecret");
- }
-
- /// <summary>
- /// Gets or sets the authorization details for the logged in user.
- /// </summary>
- /// <value>The authorization details.</value>
- /// <remarks>
- /// Because this is a sample, we simply store the authorization information in memory with the user session.
- /// A real web app should store at least the access and refresh tokens in this object in a database associated with the user.
- /// </remarks>
- private static IAuthorizationState Authorization {
- get { return (AuthorizationState)HttpContext.Current.Session["Authorization"]; }
- set { HttpContext.Current.Session["Authorization"] = value; }
- }
-
- protected void Page_Load(object sender, EventArgs e) {
- if (!IsPostBack) {
- // Check to see if we're receiving a end user authorization response.
- var authorization = Client.ProcessUserAuthorization();
- if (authorization != null) {
- // We are receiving an authorization response. Store it and associate it with this user.
- Authorization = authorization;
- Response.Redirect(Request.Path); // get rid of the /?code= parameter
- }
- }
-
- if (Authorization != null) {
- // Indicate to the user that we have already obtained authorization on some of these.
- foreach (var li in this.scopeList.Items.OfType<ListItem>().Where(li => Authorization.Scope.Contains(li.Value))) {
- li.Selected = true;
- }
- this.authorizationLabel.Text = "Authorization received!";
- if (Authorization.AccessTokenExpirationUtc.HasValue) {
- TimeSpan timeLeft = Authorization.AccessTokenExpirationUtc.Value - DateTime.UtcNow;
- this.authorizationLabel.Text += string.Format(CultureInfo.CurrentCulture, " (access token expires in {0} minutes)", Math.Round(timeLeft.TotalMinutes, 1));
- }
- }
-
- this.getNameButton.Enabled = this.getAgeButton.Enabled = this.getFavoriteSites.Enabled = Authorization != null;
- }
-
- protected void getAuthorizationButton_Click(object sender, EventArgs e) {
- string[] scopes = (from item in this.scopeList.Items.OfType<ListItem>()
- where item.Selected
- select item.Value).ToArray();
-
- Client.RequestUserAuthorization(scopes);
- }
-
- protected void getNameButton_Click(object sender, EventArgs e) {
- try {
- this.nameLabel.Text = this.CallService(client => client.GetName());
- } catch (SecurityAccessDeniedException) {
- this.nameLabel.Text = "Access denied!";
- } catch (MessageSecurityException) {
- this.nameLabel.Text = "Access denied!";
- }
- }
-
- protected void getAgeButton_Click(object sender, EventArgs e) {
- try {
- int? age = this.CallService(client => client.GetAge());
- this.ageLabel.Text = age.HasValue ? age.Value.ToString(CultureInfo.CurrentCulture) : "not available";
- } catch (SecurityAccessDeniedException) {
- this.ageLabel.Text = "Access denied!";
- } catch (MessageSecurityException) {
- this.ageLabel.Text = "Access denied!";
- }
- }
-
- protected void getFavoriteSites_Click(object sender, EventArgs e) {
- try {
- string[] favoriteSites = this.CallService(client => client.GetFavoriteSites());
- this.favoriteSitesLabel.Text = string.Join(", ", favoriteSites);
- } catch (SecurityAccessDeniedException) {
- this.favoriteSitesLabel.Text = "Access denied!";
- } catch (MessageSecurityException) {
- this.favoriteSitesLabel.Text = "Access denied!";
- }
- }
-
- private T CallService<T>(Func<DataApiClient, T> predicate) {
- if (Authorization == null) {
- throw new InvalidOperationException("No access token!");
- }
-
- var wcfClient = new DataApiClient();
-
- // Refresh the access token if it expires and if its lifetime is too short to be of use.
- if (Authorization.AccessTokenExpirationUtc.HasValue) {
- if (Client.RefreshAuthorization(Authorization, TimeSpan.FromSeconds(30))) {
- TimeSpan timeLeft = Authorization.AccessTokenExpirationUtc.Value - DateTime.UtcNow;
- this.authorizationLabel.Text += string.Format(CultureInfo.CurrentCulture, " - just renewed for {0} more minutes)", Math.Round(timeLeft.TotalMinutes, 1));
- }
- }
-
- var httpRequest = (HttpWebRequest)WebRequest.Create(wcfClient.Endpoint.Address.Uri);
- ClientBase.AuthorizeRequest(httpRequest, Authorization.AccessToken);
-
- var httpDetails = new HttpRequestMessageProperty();
- httpDetails.Headers[HttpRequestHeader.Authorization] = httpRequest.Headers[HttpRequestHeader.Authorization];
- using (var scope = new OperationContextScope(wcfClient.InnerChannel)) {
- OperationContext.Current.OutgoingMessageProperties[HttpRequestMessageProperty.Name] = httpDetails;
- return predicate(wcfClient);
- }
- }
- }
+namespace OAuthClient { + using System; + using System.Collections.Generic; + using System.Globalization; + using System.Linq; + using System.Net; + using System.ServiceModel; + using System.ServiceModel.Channels; + using System.ServiceModel.Security; + using System.Threading; + using System.Threading.Tasks; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + using DotNetOpenAuth.Messaging; + using DotNetOpenAuth.OAuth2; + using SampleResourceServer; + + public partial class SampleWcf2 : System.Web.UI.Page { + /// <summary> + /// The OAuth 2.0 client object to use to obtain authorization and authorize outgoing HTTP requests. + /// </summary> + private static readonly WebServerClient Client; + + /// <summary> + /// The details about the sample OAuth-enabled WCF service that this sample client calls into. + /// </summary> + private static AuthorizationServerDescription authServerDescription = new AuthorizationServerDescription { + TokenEndpoint = new Uri("http://localhost:50172/OAuth/Token"), + AuthorizationEndpoint = new Uri("http://localhost:50172/OAuth/Authorize"), + }; + + /// <summary> + /// Initializes static members of the <see cref="SampleWcf2"/> class. + /// </summary> + static SampleWcf2() { + Client = new WebServerClient(authServerDescription, "sampleconsumer", "samplesecret"); + } + + /// <summary> + /// Gets or sets the authorization details for the logged in user. + /// </summary> + /// <value>The authorization details.</value> + /// <remarks> + /// Because this is a sample, we simply store the authorization information in memory with the user session. + /// A real web app should store at least the access and refresh tokens in this object in a database associated with the user. + /// </remarks> + private static IAuthorizationState Authorization { + get { return (AuthorizationState)HttpContext.Current.Session["Authorization"]; } + set { HttpContext.Current.Session["Authorization"] = value; } + } + + protected void Page_Load(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!IsPostBack) { + // Check to see if we're receiving a end user authorization response. + var authorization = + await Client.ProcessUserAuthorizationAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (authorization != null) { + // We are receiving an authorization response. Store it and associate it with this user. + Authorization = authorization; + Response.Redirect(Request.Path); // get rid of the /?code= parameter + } + } + + if (Authorization != null) { + // Indicate to the user that we have already obtained authorization on some of these. + foreach (var li in this.scopeList.Items.OfType<ListItem>().Where(li => Authorization.Scope.Contains(li.Value))) { + li.Selected = true; + } + this.authorizationLabel.Text = "Authorization received!"; + if (Authorization.AccessTokenExpirationUtc.HasValue) { + TimeSpan timeLeft = Authorization.AccessTokenExpirationUtc.Value - DateTime.UtcNow; + this.authorizationLabel.Text += string.Format( + CultureInfo.CurrentCulture, " (access token expires in {0} minutes)", Math.Round(timeLeft.TotalMinutes, 1)); + } + } + + this.getNameButton.Enabled = this.getAgeButton.Enabled = this.getFavoriteSites.Enabled = Authorization != null; + })); + } + + protected void getAuthorizationButton_Click(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + string[] scopes = + (from item in this.scopeList.Items.OfType<ListItem>() where item.Selected select item.Value).ToArray(); + + var request = + await Client.PrepareRequestUserAuthorizationAsync(scopes, cancellationToken: Response.ClientDisconnectedToken); + await request.SendAsync(); + this.Context.Response.End(); + })); + } + + protected void getNameButton_Click(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + this.nameLabel.Text = await this.CallServiceAsync(client => client.GetName(), Response.ClientDisconnectedToken); + } catch (SecurityAccessDeniedException) { + this.nameLabel.Text = "Access denied!"; + } catch (MessageSecurityException) { + this.nameLabel.Text = "Access denied!"; + } + })); + } + + protected void getAgeButton_Click(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + int? age = await this.CallServiceAsync(client => client.GetAge(), Response.ClientDisconnectedToken); + this.ageLabel.Text = age.HasValue ? age.Value.ToString(CultureInfo.CurrentCulture) : "not available"; + } catch (SecurityAccessDeniedException) { + this.ageLabel.Text = "Access denied!"; + } catch (MessageSecurityException) { + this.ageLabel.Text = "Access denied!"; + } + })); + } + + protected void getFavoriteSites_Click(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + string[] favoriteSites = + await this.CallServiceAsync(client => client.GetFavoriteSites(), Response.ClientDisconnectedToken); + this.favoriteSitesLabel.Text = string.Join(", ", favoriteSites); + } catch (SecurityAccessDeniedException) { + this.favoriteSitesLabel.Text = "Access denied!"; + } catch (MessageSecurityException) { + this.favoriteSitesLabel.Text = "Access denied!"; + } + })); + } + + private async Task<T> CallServiceAsync<T>(Func<DataApiClient, T> predicate, CancellationToken cancellationToken) { + if (Authorization == null) { + throw new InvalidOperationException("No access token!"); + } + + var wcfClient = new DataApiClient(); + + // Refresh the access token if it expires and if its lifetime is too short to be of use. + if (Authorization.AccessTokenExpirationUtc.HasValue) { + if (await Client.RefreshAuthorizationAsync(Authorization, TimeSpan.FromSeconds(30))) { + TimeSpan timeLeft = Authorization.AccessTokenExpirationUtc.Value - DateTime.UtcNow; + this.authorizationLabel.Text += string.Format(CultureInfo.CurrentCulture, " - just renewed for {0} more minutes)", Math.Round(timeLeft.TotalMinutes, 1)); + } + } + + var httpRequest = (HttpWebRequest)WebRequest.Create(wcfClient.Endpoint.Address.Uri); + ClientBase.AuthorizeRequest(httpRequest, Authorization.AccessToken); + + var httpDetails = new HttpRequestMessageProperty(); + httpDetails.Headers[HttpRequestHeader.Authorization] = httpRequest.Headers[HttpRequestHeader.Authorization]; + using (var scope = new OperationContextScope(wcfClient.InnerChannel)) { + OperationContext.Current.OutgoingMessageProperties[HttpRequestMessageProperty.Name] = httpDetails; + return predicate(wcfClient); + } + } + } }
\ No newline at end of file diff --git a/samples/OAuthClient/SignInWithTwitter.aspx b/samples/OAuthClient/SignInWithTwitter.aspx deleted file mode 100644 index 9fda5c1..0000000 --- a/samples/OAuthClient/SignInWithTwitter.aspx +++ /dev/null @@ -1,38 +0,0 @@ -<%@ Page Language="C#" AutoEventWireup="true" - Inherits="OAuthClient.SignInWithTwitter" Codebehind="SignInWithTwitter.aspx.cs" %> - -<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> -<html xmlns="http://www.w3.org/1999/xhtml"> -<head runat="server"> - <title>Sign-in with Twitter</title> -</head> -<body> - <form id="form1" runat="server"> - <div> - <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> - <asp:View ID="View1" runat="server"> - <h2> - Twitter setup</h2> - <p> - A Twitter client app must be endorsed by a Twitter user. - </p> - <ol> - <li><a target="_blank" href="https://twitter.com/oauth_clients">Visit Twitter and create - a client app</a>. </li> - <li>Modify your web.config file to include your consumer key and consumer secret.</li> - </ol> - </asp:View> - <asp:View ID="View2" runat="server"> - <asp:ImageButton ImageUrl="~/images/Sign-in-with-Twitter-darker.png" runat="server" - AlternateText="Sign In With Twitter" ID="signInButton" OnClick="signInButton_Click" /> - <asp:CheckBox Text="force re-login" runat="server" ID="forceLoginCheckbox" /> - <br /> - <asp:Panel runat="server" ID="loggedInPanel" Visible="false"> - Now logged in as - <asp:Label Text="[name]" runat="server" ID="loggedInName" /> - </asp:Panel> - </asp:View> - </asp:MultiView> - </form> -</body> -</html> diff --git a/samples/OAuthClient/SignInWithTwitter.aspx.cs b/samples/OAuthClient/SignInWithTwitter.aspx.cs deleted file mode 100644 index 04b302c..0000000 --- a/samples/OAuthClient/SignInWithTwitter.aspx.cs +++ /dev/null @@ -1,39 +0,0 @@ -namespace OAuthClient { - using System; - using System.Collections.Generic; - using System.Configuration; - using System.Linq; - using System.Web; - using System.Web.Security; - using System.Web.UI; - using System.Web.UI.WebControls; - using System.Xml.Linq; - using System.Xml.XPath; - using DotNetOpenAuth.ApplicationBlock; - using DotNetOpenAuth.OAuth; - - public partial class SignInWithTwitter : System.Web.UI.Page { - protected void Page_Load(object sender, EventArgs e) { - if (TwitterConsumer.IsTwitterConsumerConfigured) { - this.MultiView1.ActiveViewIndex = 1; - - if (!IsPostBack) { - string screenName; - int userId; - if (TwitterConsumer.TryFinishSignInWithTwitter(out screenName, out userId)) { - this.loggedInPanel.Visible = true; - this.loggedInName.Text = screenName; - - // In a real app, the Twitter username would likely be used - // to log the user into the application. - ////FormsAuthentication.RedirectFromLoginPage(screenName, false); - } - } - } - } - - protected void signInButton_Click(object sender, ImageClickEventArgs e) { - TwitterConsumer.StartSignInWithTwitter(this.forceLoginCheckbox.Checked).Send(); - } - } -}
\ No newline at end of file diff --git a/samples/OAuthClient/SignInWithTwitter.aspx.designer.cs b/samples/OAuthClient/SignInWithTwitter.aspx.designer.cs deleted file mode 100644 index 00126de..0000000 --- a/samples/OAuthClient/SignInWithTwitter.aspx.designer.cs +++ /dev/null @@ -1,87 +0,0 @@ -//------------------------------------------------------------------------------ -// <auto-generated> -// This code was generated by a tool. -// -// Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. -// </auto-generated> -//------------------------------------------------------------------------------ - -namespace OAuthClient { - - - public partial class SignInWithTwitter { - - /// <summary> - /// form1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.HtmlControls.HtmlForm form1; - - /// <summary> - /// MultiView1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.MultiView MultiView1; - - /// <summary> - /// View1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View View1; - - /// <summary> - /// View2 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View View2; - - /// <summary> - /// signInButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.ImageButton signInButton; - - /// <summary> - /// forceLoginCheckbox control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.CheckBox forceLoginCheckbox; - - /// <summary> - /// loggedInPanel control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Panel loggedInPanel; - - /// <summary> - /// loggedInName control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Label loggedInName; - } -} diff --git a/samples/OAuthClient/Twitter.aspx b/samples/OAuthClient/Twitter.aspx deleted file mode 100644 index cb60851..0000000 --- a/samples/OAuthClient/Twitter.aspx +++ /dev/null @@ -1,35 +0,0 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthClient.Twitter" Codebehind="Twitter.aspx.cs" %> - -<asp:Content ID="Content1" ContentPlaceHolderID="head" runat="Server"> -</asp:Content> -<asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> - <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> - <asp:View ID="View1" runat="server"> - <h2>Twitter setup</h2> - <p>A Twitter client app must be endorsed by a Twitter user. </p> - <ol> - <li><a target="_blank" href="https://twitter.com/oauth_clients">Visit Twitter and create - a client app</a>. </li> - <li>Modify your web.config file to include your consumer key and consumer secret.</li> - </ol> - </asp:View> - <asp:View runat="server"> - <h2>Updates</h2> - <p>Ok, Twitter has authorized us to download your feeds. Notice how we never asked - you for your Twitter username or password. </p> - <p> - Upload a new profile photo: - <asp:FileUpload ID="profilePhoto" runat="server" /> - <asp:Button ID="uploadProfilePhotoButton" runat="server" - onclick="uploadProfilePhotoButton_Click" Text="Upload photo" /> - <asp:Label ID="photoUploadedLabel" runat="server" EnableViewState="False" - Text="Done!" Visible="False"></asp:Label> - </p> - <p> - Click 'Get updates' to download updates to this sample. - </p> - <asp:Button ID="downloadUpdates" runat="server" Text="Get updates" OnClick="downloadUpdates_Click" /> - <asp:PlaceHolder runat="server" ID="resultsPlaceholder" /> - </asp:View> - </asp:MultiView> -</asp:Content> diff --git a/samples/OAuthClient/Twitter.aspx.cs b/samples/OAuthClient/Twitter.aspx.cs deleted file mode 100644 index 9c0cb9a..0000000 --- a/samples/OAuthClient/Twitter.aspx.cs +++ /dev/null @@ -1,96 +0,0 @@ -namespace OAuthClient { - using System; - using System.Collections.Generic; - using System.Configuration; - using System.Linq; - using System.Text; - using System.Web; - using System.Web.UI; - using System.Web.UI.WebControls; - using System.Xml.Linq; - using System.Xml.XPath; - using DotNetOpenAuth.ApplicationBlock; - using DotNetOpenAuth.OAuth; - - public partial class Twitter : System.Web.UI.Page { - private string AccessToken { - get { return (string)Session["TwitterAccessToken"]; } - set { Session["TwitterAccessToken"] = value; } - } - - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["TwitterTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["twitterConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["twitterConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["TwitterTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { - this.MultiView1.ActiveViewIndex = 1; - - if (!IsPostBack) { - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - - // Is Twitter calling back with authorization? - var accessTokenResponse = twitter.ProcessUserAuthorization(); - if (accessTokenResponse != null) { - this.AccessToken = accessTokenResponse.AccessToken; - } else if (this.AccessToken == null) { - // If we don't yet have access, immediately request it. - twitter.Channel.Send(twitter.PrepareRequestUserAuthorization()); - } - } - } - } - - protected void downloadUpdates_Click(object sender, EventArgs e) { - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - XPathDocument updates = new XPathDocument(TwitterConsumer.GetUpdates(twitter, this.AccessToken).CreateReader()); - XPathNavigator nav = updates.CreateNavigator(); - var parsedUpdates = from status in nav.Select("/statuses/status").OfType<XPathNavigator>() - where !status.SelectSingleNode("user/protected").ValueAsBoolean - select new { - User = status.SelectSingleNode("user/name").InnerXml, - Status = status.SelectSingleNode("text").InnerXml, - }; - - StringBuilder tableBuilder = new StringBuilder(); - tableBuilder.Append("<table><tr><td>Name</td><td>Update</td></tr>"); - - foreach (var update in parsedUpdates) { - tableBuilder.AppendFormat( - "<tr><td>{0}</td><td>{1}</td></tr>", - HttpUtility.HtmlEncode(update.User), - HttpUtility.HtmlEncode(update.Status)); - } - tableBuilder.Append("</table>"); - this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); - } - - protected void uploadProfilePhotoButton_Click(object sender, EventArgs e) { - if (this.profilePhoto.PostedFile.ContentType == null) { - this.photoUploadedLabel.Visible = true; - this.photoUploadedLabel.Text = "Select a file first."; - return; - } - - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - XDocument imageResult = TwitterConsumer.UpdateProfileImage( - twitter, - this.AccessToken, - this.profilePhoto.PostedFile.InputStream, - this.profilePhoto.PostedFile.ContentType); - this.photoUploadedLabel.Visible = true; - } - } -}
\ No newline at end of file diff --git a/samples/OAuthClient/Twitter.aspx.designer.cs b/samples/OAuthClient/Twitter.aspx.designer.cs deleted file mode 100644 index e82f477..0000000 --- a/samples/OAuthClient/Twitter.aspx.designer.cs +++ /dev/null @@ -1,78 +0,0 @@ -//------------------------------------------------------------------------------ -// <auto-generated> -// This code was generated by a tool. -// -// Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. -// </auto-generated> -//------------------------------------------------------------------------------ - -namespace OAuthClient { - - - public partial class Twitter { - - /// <summary> - /// MultiView1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.MultiView MultiView1; - - /// <summary> - /// View1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View View1; - - /// <summary> - /// profilePhoto control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.FileUpload profilePhoto; - - /// <summary> - /// uploadProfilePhotoButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button uploadProfilePhotoButton; - - /// <summary> - /// photoUploadedLabel control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Label photoUploadedLabel; - - /// <summary> - /// downloadUpdates control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button downloadUpdates; - - /// <summary> - /// resultsPlaceholder control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.PlaceHolder resultsPlaceholder; - } -} diff --git a/samples/OAuthClient/Web.config b/samples/OAuthClient/Web.config index b17ae43..5fbb439 100644 --- a/samples/OAuthClient/Web.config +++ b/samples/OAuthClient/Web.config @@ -55,21 +55,20 @@ <!-- Windows Live sign-up: http://go.microsoft.com/fwlink/p/?LinkId=193157 --> <add key="windowsLiveAppID" value="000000004408E558" /> <add key="windowsLiveAppSecret" value="od8NVdanEIWqmlKu9hOepBE3AfUu4jCw" /> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <connectionStrings/> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this affects performance, set this value to true only during development. --> - <compilation debug="true" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="true" targetFramework="4.0" /> <!-- The <authentication> section enables configuration of the security authentication mode used by diff --git a/samples/OAuthClient/WindowsLive.aspx b/samples/OAuthClient/WindowsLive.aspx index ef51223..efdc582 100644 --- a/samples/OAuthClient/WindowsLive.aspx +++ b/samples/OAuthClient/WindowsLive.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="WindowsLive.aspx.cs" Inherits="OAuthClient.WindowsLive" %> +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="WindowsLive.aspx.cs" Inherits="OAuthClient.WindowsLive" Async="true" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> <html xmlns="http://www.w3.org/1999/xhtml"> diff --git a/samples/OAuthClient/WindowsLive.aspx.cs b/samples/OAuthClient/WindowsLive.aspx.cs index 05101a7..efe41ec 100644 --- a/samples/OAuthClient/WindowsLive.aspx.cs +++ b/samples/OAuthClient/WindowsLive.aspx.cs @@ -9,6 +9,7 @@ using System.Web.UI.WebControls; using DotNetOpenAuth.ApplicationBlock; using DotNetOpenAuth.ApplicationBlock.Facebook; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth2; public partial class WindowsLive : System.Web.UI.Page { @@ -18,28 +19,38 @@ }; protected void Page_Load(object sender, EventArgs e) { - if (string.Equals("localhost", this.Request.Headers["Host"].Split(':')[0], StringComparison.OrdinalIgnoreCase)) { - this.localhostDoesNotWorkPanel.Visible = true; - var builder = new UriBuilder(this.publicLink.NavigateUrl); - builder.Port = this.Request.Url.Port; - this.publicLink.NavigateUrl = builder.Uri.AbsoluteUri; - this.publicLink.Text = builder.Uri.AbsoluteUri; - } else { - IAuthorizationState authorization = client.ProcessUserAuthorization(); - if (authorization == null) { - // Kick off authorization request - client.RequestUserAuthorization(scope: new[] { WindowsLiveClient.Scopes.Basic }); // this scope isn't even required just to log in - } else { - var request = - WebRequest.Create("https://apis.live.net/v5.0/me?access_token=" + Uri.EscapeDataString(authorization.AccessToken)); - using (var response = request.GetResponse()) { - using (var responseStream = response.GetResponseStream()) { - var graph = WindowsLiveGraph.Deserialize(responseStream); - this.nameLabel.Text = HttpUtility.HtmlEncode(graph.Name); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (string.Equals("localhost", this.Request.Headers["Host"].Split(':')[0], StringComparison.OrdinalIgnoreCase)) { + this.localhostDoesNotWorkPanel.Visible = true; + var builder = new UriBuilder(this.publicLink.NavigateUrl); + builder.Port = this.Request.Url.Port; + this.publicLink.NavigateUrl = builder.Uri.AbsoluteUri; + this.publicLink.Text = builder.Uri.AbsoluteUri; + } else { + IAuthorizationState authorization = + await client.ProcessUserAuthorizationAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (authorization == null) { + // Kick off authorization request + var request = + await client.PrepareRequestUserAuthorizationAsync(scopes: new[] { WindowsLiveClient.Scopes.Basic }); + // this scope isn't even required just to log in + await request.SendAsync(new HttpContextWrapper(this.Context), Response.ClientDisconnectedToken); + this.Context.Response.End(); + } else { + var request = + WebRequest.Create( + "https://apis.live.net/v5.0/me?access_token=" + Uri.EscapeDataString(authorization.AccessToken)); + using (var response = request.GetResponse()) { + using (var responseStream = response.GetResponseStream()) { + var graph = WindowsLiveGraph.Deserialize(responseStream); + this.nameLabel.Text = HttpUtility.HtmlEncode(graph.Name); + } + } + } } - } - } - } + })); } } } diff --git a/samples/OAuthClient/Yammer.aspx b/samples/OAuthClient/Yammer.aspx deleted file mode 100644 index a900a2e..0000000 --- a/samples/OAuthClient/Yammer.aspx +++ /dev/null @@ -1,48 +0,0 @@ -<%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/MasterPage.master" - CodeBehind="Yammer.aspx.cs" Inherits="OAuthClient.Yammer" %> - -<asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> - <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> - <asp:View ID="ClientRegistrationRequiredView" runat="server"> - <h2> - Yammer setup</h2> - <p> - A Yammer client app must be registered. - </p> - <ol> - <li><a target="_blank" href="https://www.yammer.com/client_applications/new">Visit Yammer - and register a client app</a>. </li> - <li>Modify your web.config file to include your consumer key and consumer secret. - </li> - </ol> - </asp:View> - <asp:View ID="BeginAuthorizationView" runat="server"> - <asp:Label Text="An error occurred in authorization. You may try again." EnableViewState="false" Visible="false" ForeColor="Red" ID="authorizationErrorLabel" runat="server" /> - <asp:Button Text="Obtain authorization now" runat="server" ID="obtainAuthorizationButton" - OnClick="obtainAuthorizationButton_Click" /> - </asp:View> - <asp:View ID="CompleteAuthorizationView" runat="server"> - After you have authorized Yammer to share your information, please enter the code - Yammer gives you here: - <asp:TextBox runat="server" ID="yammerUserCode" EnableViewState="false" /> - <asp:RequiredFieldValidator ErrorMessage="*" ControlToValidate="yammerUserCode" runat="server" /> - <asp:Button Text="Finish" runat="server" ID="finishAuthorizationButton" OnClick="finishAuthorizationButton_Click" /> - </asp:View> - <asp:View ID="AuthorizationCompleteView" runat="server"> - <h2> - Updates - </h2> - <p>The access token we have obtained is: - <asp:Label ID="accessTokenLabel" runat="server" /> - </p> - <p> - Ok, Yammer has authorized us to download your messages. Click 'Get messages' - to download the latest few messages to this sample. Notice how we never asked you - for your Yammer username or password. - </p> - <asp:Button ID="getYammerMessagesButton" runat="server" OnClick="getYammerMessages_Click" - Text="Get address book" /> - <asp:PlaceHolder ID="resultsPlaceholder" runat="server" /> - </asp:View> - </asp:MultiView> -</asp:Content> diff --git a/samples/OAuthClient/Yammer.aspx.cs b/samples/OAuthClient/Yammer.aspx.cs deleted file mode 100644 index 2e87a62..0000000 --- a/samples/OAuthClient/Yammer.aspx.cs +++ /dev/null @@ -1,76 +0,0 @@ -namespace OAuthClient { - using System; - using System.Collections.Generic; - using System.Configuration; - using System.Linq; - using System.Web; - using System.Web.UI; - using System.Web.UI.WebControls; - using DotNetOpenAuth.ApplicationBlock; - using DotNetOpenAuth.Messaging; - using DotNetOpenAuth.OAuth; - - public partial class Yammer : System.Web.UI.Page { - private string RequestToken { - get { return (string)ViewState["YammerRequestToken"]; } - set { ViewState["YammerRequestToken"] = value; } - } - - private string AccessToken { - get { return (string)Session["YammerAccessToken"]; } - set { Session["YammerAccessToken"] = value; } - } - - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["YammerTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["YammerConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["YammerConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["YammerTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { - this.MultiView1.SetActiveView(this.BeginAuthorizationView); - } - } - - protected void getYammerMessages_Click(object sender, EventArgs e) { - var yammer = new WebConsumer(YammerConsumer.ServiceDescription, this.TokenManager); - } - - protected void obtainAuthorizationButton_Click(object sender, EventArgs e) { - var yammer = YammerConsumer.CreateConsumer(this.TokenManager); - string requestToken; - Uri popupWindowLocation = YammerConsumer.PrepareRequestAuthorization(yammer, out requestToken); - this.RequestToken = requestToken; - string javascript = "window.open('" + popupWindowLocation.AbsoluteUri + "');"; - this.Page.ClientScript.RegisterStartupScript(GetType(), "YammerPopup", javascript, true); - this.MultiView1.SetActiveView(this.CompleteAuthorizationView); - } - - protected void finishAuthorizationButton_Click(object sender, EventArgs e) { - if (!Page.IsValid) { - return; - } - - var yammer = YammerConsumer.CreateConsumer(this.TokenManager); - var authorizationResponse = YammerConsumer.CompleteAuthorization(yammer, this.RequestToken, this.yammerUserCode.Text); - if (authorizationResponse != null) { - this.accessTokenLabel.Text = HttpUtility.HtmlEncode(authorizationResponse.AccessToken); - this.MultiView1.SetActiveView(this.AuthorizationCompleteView); - } else { - this.MultiView1.SetActiveView(this.BeginAuthorizationView); - this.authorizationErrorLabel.Visible = true; - } - } - } -}
\ No newline at end of file diff --git a/samples/OAuthClient/Yammer.aspx.designer.cs b/samples/OAuthClient/Yammer.aspx.designer.cs deleted file mode 100644 index 84d75b8..0000000 --- a/samples/OAuthClient/Yammer.aspx.designer.cs +++ /dev/null @@ -1,123 +0,0 @@ -//------------------------------------------------------------------------------ -// <auto-generated> -// This code was generated by a tool. -// -// Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. -// </auto-generated> -//------------------------------------------------------------------------------ - -namespace OAuthClient { - - - public partial class Yammer { - - /// <summary> - /// MultiView1 control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.MultiView MultiView1; - - /// <summary> - /// ClientRegistrationRequiredView control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View ClientRegistrationRequiredView; - - /// <summary> - /// BeginAuthorizationView control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View BeginAuthorizationView; - - /// <summary> - /// authorizationErrorLabel control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Label authorizationErrorLabel; - - /// <summary> - /// obtainAuthorizationButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button obtainAuthorizationButton; - - /// <summary> - /// CompleteAuthorizationView control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View CompleteAuthorizationView; - - /// <summary> - /// yammerUserCode control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.TextBox yammerUserCode; - - /// <summary> - /// finishAuthorizationButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button finishAuthorizationButton; - - /// <summary> - /// AuthorizationCompleteView control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.View AuthorizationCompleteView; - - /// <summary> - /// accessTokenLabel control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Label accessTokenLabel; - - /// <summary> - /// getYammerMessagesButton control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.Button getYammerMessagesButton; - - /// <summary> - /// resultsPlaceholder control. - /// </summary> - /// <remarks> - /// Auto-generated field. - /// To modify move field declaration from designer file to code-behind file. - /// </remarks> - protected global::System.Web.UI.WebControls.PlaceHolder resultsPlaceholder; - } -} diff --git a/samples/OAuthClient/packages.config b/samples/OAuthClient/packages.config index 6562527..8e40260 100644 --- a/samples/OAuthClient/packages.config +++ b/samples/OAuthClient/packages.config @@ -1,4 +1,5 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OAuthConsumer/GoogleAddressBook.aspx b/samples/OAuthConsumer/GoogleAddressBook.aspx index 19fb505..b4d6a01 100644 --- a/samples/OAuthConsumer/GoogleAddressBook.aspx +++ b/samples/OAuthConsumer/GoogleAddressBook.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="Gmail address book demo" Language="C#" MasterPageFile="~/MasterPage.master" +<%@ Page Title="Gmail address book demo" Language="C#" MasterPageFile="~/MasterPage.master" Async="true" AutoEventWireup="true" Inherits="OAuthConsumer.GoogleAddressBook" Codebehind="GoogleAddressBook.aspx.cs" %> <asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> diff --git a/samples/OAuthConsumer/GoogleAddressBook.aspx.cs b/samples/OAuthConsumer/GoogleAddressBook.aspx.cs index ddca7e4..591f658 100644 --- a/samples/OAuthConsumer/GoogleAddressBook.aspx.cs +++ b/samples/OAuthConsumer/GoogleAddressBook.aspx.cs @@ -2,6 +2,7 @@ using System; using System.Configuration; using System.Linq; + using System.Net; using System.Text; using System.Web; using System.Web.UI; @@ -14,62 +15,58 @@ /// A page to demonstrate downloading a Gmail address book using OAuth. /// </summary> public partial class GoogleAddressBook : System.Web.UI.Page { - private string AccessToken { - get { return (string)Session["GoogleAccessToken"]; } + private AccessToken AccessToken { + get { return (AccessToken)Session["GoogleAccessToken"]; } set { Session["GoogleAccessToken"] = value; } } - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["GoogleTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["GoogleTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { - this.MultiView1.ActiveViewIndex = 1; - - if (!IsPostBack) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var google = new GoogleConsumer(); + if (google.ConsumerKey != null) { + this.MultiView1.ActiveViewIndex = 1; - // Is Google calling back with authorization? - var accessTokenResponse = google.ProcessUserAuthorization(); - if (accessTokenResponse != null) { - this.AccessToken = accessTokenResponse.AccessToken; - } else if (this.AccessToken == null) { - // If we don't yet have access, immediately request it. - GoogleConsumer.RequestAuthorization(google, GoogleConsumer.Applications.Contacts); - } - } - } + if (!IsPostBack) { + // Is Google calling back with authorization? + var accessTokenResponse = await google.ProcessUserAuthorizationAsync(this.Request.Url); + if (accessTokenResponse != null) { + this.AccessToken = accessTokenResponse.AccessToken; + } else if (this.AccessToken.Token == null) { + // If we don't yet have access, immediately request it. + Uri redirectUri = await google.RequestUserAuthorizationAsync(GoogleConsumer.Applications.Contacts); + this.Response.Redirect(redirectUri.AbsoluteUri); + } + } + } + })); } protected void getAddressBookButton_Click(object sender, EventArgs e) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var google = new GoogleConsumer(); - XDocument contactsDocument = GoogleConsumer.GetContacts(google, this.AccessToken, 5, 1); - var contacts = from entry in contactsDocument.Root.Elements(XName.Get("entry", "http://www.w3.org/2005/Atom")) - select new { Name = entry.Element(XName.Get("title", "http://www.w3.org/2005/Atom")).Value, Email = entry.Element(XName.Get("email", "http://schemas.google.com/g/2005")).Attribute("address").Value }; - StringBuilder tableBuilder = new StringBuilder(); - tableBuilder.Append("<table><tr><td>Name</td><td>Email</td></tr>"); - foreach (var contact in contacts) { - tableBuilder.AppendFormat( - "<tr><td>{0}</td><td>{1}</td></tr>", - HttpUtility.HtmlEncode(contact.Name), - HttpUtility.HtmlEncode(contact.Email)); - } - tableBuilder.Append("</table>"); - this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); + XDocument contactsDocument = + await google.GetContactsAsync(this.AccessToken, 5, 1, Response.ClientDisconnectedToken); + var contacts = from entry in contactsDocument.Root.Elements(XName.Get("entry", "http://www.w3.org/2005/Atom")) + select + new { + Name = entry.Element(XName.Get("title", "http://www.w3.org/2005/Atom")).Value, + Email = + entry.Element(XName.Get("email", "http://schemas.google.com/g/2005")).Attribute("address").Value + }; + StringBuilder tableBuilder = new StringBuilder(); + tableBuilder.Append("<table><tr><td>Name</td><td>Email</td></tr>"); + foreach (var contact in contacts) { + tableBuilder.AppendFormat( + "<tr><td>{0}</td><td>{1}</td></tr>", HttpUtility.HtmlEncode(contact.Name), HttpUtility.HtmlEncode(contact.Email)); + } + tableBuilder.Append("</table>"); + this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); + })); } } }
\ No newline at end of file diff --git a/samples/OAuthConsumer/GoogleApps2Legged.aspx b/samples/OAuthConsumer/GoogleApps2Legged.aspx index cd9d9a1..44f0ce2 100644 --- a/samples/OAuthConsumer/GoogleApps2Legged.aspx +++ b/samples/OAuthConsumer/GoogleApps2Legged.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/MasterPage.master"CodeBehind="GoogleApps2Legged.aspx.cs" Inherits="OAuthConsumer.GoogleApps2Legged" %> +<%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/MasterPage.master"CodeBehind="GoogleApps2Legged.aspx.cs" Inherits="OAuthConsumer.GoogleApps2Legged" Async="true" %> <asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> diff --git a/samples/OAuthConsumer/GoogleApps2Legged.aspx.cs b/samples/OAuthConsumer/GoogleApps2Legged.aspx.cs index afb156b..52cc885 100644 --- a/samples/OAuthConsumer/GoogleApps2Legged.aspx.cs +++ b/samples/OAuthConsumer/GoogleApps2Legged.aspx.cs @@ -12,28 +12,20 @@ using DotNetOpenAuth.OAuth.Messages; public partial class GoogleApps2Legged : System.Web.UI.Page { - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["GoogleTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["GoogleTokenManager"] = tokenManager; - } - } - - return tokenManager; - } + protected void Page_Load(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var google = new GoogleConsumer(); + var accessToken = await google.RequestNewClientAccountAsync(); + using (var httpClient = google.CreateHttpClient(accessToken.AccessToken)) { + await httpClient.GetAsync("http://someUri", Response.ClientDisconnectedToken); + } + })); } - protected void Page_Load(object sender, EventArgs e) { - var google = new WebConsumer(GoogleConsumer.ServiceDescription, this.TokenManager); - string accessToken = google.RequestNewClientAccount(); - ////string tokenSecret = google.TokenManager.GetTokenSecret(accessToken); - MessageReceivingEndpoint ep = null; // set up your authorized call here. - google.PrepareAuthorizedRequestAndSend(ep, accessToken); + protected void getAddressBookButton_Click(object sender, EventArgs e) { + throw new NotImplementedException(); } } }
\ No newline at end of file diff --git a/samples/OAuthConsumer/OAuthConsumer.csproj b/samples/OAuthConsumer/OAuthConsumer.csproj index a42022a..94bed9c 100644 --- a/samples/OAuthConsumer/OAuthConsumer.csproj +++ b/samples/OAuthConsumer/OAuthConsumer.csproj @@ -26,7 +26,7 @@ <AssemblyName>OAuthConsumer</AssemblyName> <TargetFrameworkVersion>v4.5</TargetFrameworkVersion> <TargetFrameworkProfile /> - <UseIISExpress>false</UseIISExpress> + <UseIISExpress>true</UseIISExpress> </PropertyGroup> <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> <DebugSymbols>true</DebugSymbols> @@ -53,9 +53,15 @@ <SpecificVersion>False</SpecificVersion> <HintPath>..\..\src\packages\log4net.2.0.0\lib\net40-full\log4net.dll</HintPath> </Reference> + <Reference Include="Microsoft.CSharp" /> + <Reference Include="Newtonsoft.Json"> + <HintPath>..\..\src\packages\Newtonsoft.Json.4.5.11\lib\net40\Newtonsoft.Json.dll</HintPath> + </Reference> <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Runtime.Serialization" /> <Reference Include="System.ServiceModel" /> <Reference Include="System.Drawing" /> @@ -101,9 +107,6 @@ </None> </ItemGroup> <ItemGroup> - <Compile Include="..\DotNetOpenAuth.ApplicationBlock\InMemoryTokenManager.cs"> - <Link>Code\InMemoryTokenManager.cs</Link> - </Compile> <Compile Include="Global.asax.cs"> <DependentUpon>Global.asax</DependentUpon> </Compile> @@ -215,12 +218,11 @@ <VisualStudio> <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> <WebProjectProperties> - <UseIIS>False</UseIIS> + <UseIIS>True</UseIIS> <AutoAssignPort>False</AutoAssignPort> <DevelopmentServerPort>59721</DevelopmentServerPort> <DevelopmentServerVPath>/</DevelopmentServerVPath> - <IISUrl> - </IISUrl> + <IISUrl>http://localhost:59721/</IISUrl> <NTLMAuthentication>False</NTLMAuthentication> <UseCustomServer>False</UseCustomServer> <CustomServerUrl> diff --git a/samples/OAuthConsumer/SampleWcf.aspx b/samples/OAuthConsumer/SampleWcf.aspx index fb318ce..a44ffa4 100644 --- a/samples/OAuthConsumer/SampleWcf.aspx +++ b/samples/OAuthConsumer/SampleWcf.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthConsumer.SampleWcf" Codebehind="SampleWcf.aspx.cs" %> +<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthConsumer.SampleWcf" Codebehind="SampleWcf.aspx.cs" Async="true" %> <asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> <fieldset title="Authorization"> diff --git a/samples/OAuthConsumer/SampleWcf.aspx.cs b/samples/OAuthConsumer/SampleWcf.aspx.cs index d56a161..764b4d7 100644 --- a/samples/OAuthConsumer/SampleWcf.aspx.cs +++ b/samples/OAuthConsumer/SampleWcf.aspx.cs @@ -4,9 +4,13 @@ using System.Globalization; using System.Linq; using System.Net; + using System.Net.Http; using System.ServiceModel; using System.ServiceModel.Channels; using System.ServiceModel.Security; + using System.Threading.Tasks; + using System.Web; + using System.Web.UI; using System.Web.UI.WebControls; using DotNetOpenAuth; using DotNetOpenAuth.ApplicationBlock; @@ -20,98 +24,109 @@ /// </summary> public partial class SampleWcf : System.Web.UI.Page { protected void Page_Load(object sender, EventArgs e) { - if (!IsPostBack) { - if (Session["WcfTokenManager"] != null) { - WebConsumer consumer = this.CreateConsumer(); - var accessTokenMessage = consumer.ProcessUserAuthorization(); - if (accessTokenMessage != null) { - Session["WcfAccessToken"] = accessTokenMessage.AccessToken; - this.authorizationLabel.Text = "Authorized! Access token: " + accessTokenMessage.AccessToken; - } - } - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!IsPostBack) { + var consumer = this.CreateConsumer(); + if (consumer.ConsumerKey != null) { + var accessTokenMessage = await consumer.ProcessUserAuthorizationAsync(this.Request.Url); + if (accessTokenMessage != null) { + Session["WcfAccessToken"] = accessTokenMessage.AccessToken; + this.authorizationLabel.Text = "Authorized! Access token: " + accessTokenMessage.AccessToken; + } + } + } + })); } protected void getAuthorizationButton_Click(object sender, EventArgs e) { - WebConsumer consumer = this.CreateConsumer(); - UriBuilder callback = new UriBuilder(Request.Url); - callback.Query = null; - string[] scopes = (from item in this.scopeList.Items.OfType<ListItem>() - where item.Selected - select item.Value).ToArray(); - string scope = string.Join("|", scopes); - var requestParams = new Dictionary<string, string> { - { "scope", scope }, - }; - var response = consumer.PrepareRequestUserAuthorization(callback.Uri, requestParams, null); - consumer.Channel.Send(response); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var consumer = this.CreateConsumer(); + UriBuilder callback = new UriBuilder(Request.Url); + callback.Query = null; + string[] scopes = + (from item in this.scopeList.Items.OfType<ListItem>() where item.Selected select item.Value).ToArray(); + string scope = string.Join("|", scopes); + var requestParams = new Dictionary<string, string> { { "scope", scope }, }; + Uri redirectUri = await consumer.RequestUserAuthorizationAsync(callback.Uri, requestParams); + this.Response.Redirect(redirectUri.AbsoluteUri); + })); } protected void getNameButton_Click(object sender, EventArgs e) { - try { - this.nameLabel.Text = this.CallService(client => client.GetName()); - } catch (SecurityAccessDeniedException) { - this.nameLabel.Text = "Access denied!"; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + this.nameLabel.Text = await this.CallServiceAsync(client => client.GetName()); + } catch (SecurityAccessDeniedException) { + this.nameLabel.Text = "Access denied!"; + } + })); } protected void getAgeButton_Click(object sender, EventArgs e) { - try { - int? age = this.CallService(client => client.GetAge()); - this.ageLabel.Text = age.HasValue ? age.Value.ToString(CultureInfo.CurrentCulture) : "not available"; - } catch (SecurityAccessDeniedException) { - this.ageLabel.Text = "Access denied!"; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + int? age = await this.CallServiceAsync(client => client.GetAge()); + this.ageLabel.Text = age.HasValue ? age.Value.ToString(CultureInfo.CurrentCulture) : "not available"; + } catch (SecurityAccessDeniedException) { + this.ageLabel.Text = "Access denied!"; + } + })); } protected void getFavoriteSites_Click(object sender, EventArgs e) { - try { - string[] favoriteSites = this.CallService(client => client.GetFavoriteSites()); - this.favoriteSitesLabel.Text = string.Join(", ", favoriteSites); - } catch (SecurityAccessDeniedException) { - this.favoriteSitesLabel.Text = "Access denied!"; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + try { + string[] favoriteSites = await this.CallServiceAsync(client => client.GetFavoriteSites()); + this.favoriteSitesLabel.Text = string.Join(", ", favoriteSites); + } catch (SecurityAccessDeniedException) { + this.favoriteSitesLabel.Text = "Access denied!"; + } + })); } - private T CallService<T>(Func<DataApiClient, T> predicate) { + private async Task<T> CallServiceAsync<T>(Func<DataApiClient, T> predicate) { DataApiClient client = new DataApiClient(); var serviceEndpoint = new MessageReceivingEndpoint(client.Endpoint.Address.Uri, HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.PostRequest); - var accessToken = Session["WcfAccessToken"] as string; - if (accessToken == null) { + var accessToken = (AccessToken)(Session["WcfAccessToken"] ?? default(AccessToken)); + if (accessToken.Token == null) { throw new InvalidOperationException("No access token!"); } - WebConsumer consumer = this.CreateConsumer(); - WebRequest httpRequest = consumer.PrepareAuthorizedRequest(serviceEndpoint, accessToken); + + var httpRequest = new HttpRequestMessage(HttpMethod.Post, client.Endpoint.Address.Uri); + var consumer = this.CreateConsumer(); + using (var handler = consumer.CreateMessageHandler(accessToken)) { + handler.ApplyAuthorization(httpRequest); + } HttpRequestMessageProperty httpDetails = new HttpRequestMessageProperty(); - httpDetails.Headers[HttpRequestHeader.Authorization] = httpRequest.Headers[HttpRequestHeader.Authorization]; + httpDetails.Headers[HttpRequestHeader.Authorization] = httpRequest.Headers.Authorization.ToString(); using (OperationContextScope scope = new OperationContextScope(client.InnerChannel)) { OperationContext.Current.OutgoingMessageProperties[HttpRequestMessageProperty.Name] = httpDetails; return predicate(client); } } - private WebConsumer CreateConsumer() { + private Consumer CreateConsumer() { string consumerKey = "sampleconsumer"; string consumerSecret = "samplesecret"; - var tokenManager = Session["WcfTokenManager"] as InMemoryTokenManager; - if (tokenManager == null) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Session["WcfTokenManager"] = tokenManager; - } MessageReceivingEndpoint oauthEndpoint = new MessageReceivingEndpoint( new Uri("http://localhost:65169/OAuth.ashx"), HttpDeliveryMethods.PostRequest); - WebConsumer consumer = new WebConsumer( - new ServiceProviderDescription { - RequestTokenEndpoint = oauthEndpoint, - UserAuthorizationEndpoint = oauthEndpoint, - AccessTokenEndpoint = oauthEndpoint, - TamperProtectionElements = new DotNetOpenAuth.Messaging.ITamperProtectionChannelBindingElement[] { - new HmacSha1SigningBindingElement(), - }, - }, - tokenManager); + var consumer = new Consumer( + consumerKey, + consumerSecret, + new ServiceProviderDescription(oauthEndpoint.Location.AbsoluteUri, oauthEndpoint.Location.AbsoluteUri, oauthEndpoint.Location.AbsoluteUri), + new CookieTemporaryCredentialStorage()); return consumer; } diff --git a/samples/OAuthConsumer/SignInWithTwitter.aspx b/samples/OAuthConsumer/SignInWithTwitter.aspx index 86d29a4..b5c6ad6 100644 --- a/samples/OAuthConsumer/SignInWithTwitter.aspx +++ b/samples/OAuthConsumer/SignInWithTwitter.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" +<%@ Page Language="C#" AutoEventWireup="true" Async="true" Inherits="OAuthConsumer.SignInWithTwitter" Codebehind="SignInWithTwitter.aspx.cs" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> @@ -33,6 +33,7 @@ </asp:Panel> </asp:View> </asp:MultiView> + </div> </form> </body> </html> diff --git a/samples/OAuthConsumer/SignInWithTwitter.aspx.cs b/samples/OAuthConsumer/SignInWithTwitter.aspx.cs index e104f3a..9e422e6 100644 --- a/samples/OAuthConsumer/SignInWithTwitter.aspx.cs +++ b/samples/OAuthConsumer/SignInWithTwitter.aspx.cs @@ -3,6 +3,7 @@ using System.Collections.Generic; using System.Configuration; using System.Linq; + using System.Net; using System.Web; using System.Web.Security; using System.Web.UI; @@ -10,30 +11,43 @@ using System.Xml.Linq; using System.Xml.XPath; using DotNetOpenAuth.ApplicationBlock; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; public partial class SignInWithTwitter : System.Web.UI.Page { protected void Page_Load(object sender, EventArgs e) { - if (TwitterConsumer.IsTwitterConsumerConfigured) { - this.MultiView1.ActiveViewIndex = 1; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (TwitterConsumer.IsTwitterConsumerConfigured) { + this.MultiView1.ActiveViewIndex = 1; - if (!IsPostBack) { - string screenName; - int userId; - if (TwitterConsumer.TryFinishSignInWithTwitter(out screenName, out userId)) { - this.loggedInPanel.Visible = true; - this.loggedInName.Text = screenName; + if (!IsPostBack) { + var tuple = await TwitterConsumer.TryFinishSignInWithTwitterAsync(); + if (tuple != null) { + string screenName = tuple.Item1; + int userId = tuple.Item2; + this.loggedInPanel.Visible = true; + this.loggedInName.Text = screenName; - // In a real app, the Twitter username would likely be used - // to log the user into the application. - ////FormsAuthentication.RedirectFromLoginPage(screenName, false); - } - } - } + // In a real app, the Twitter username would likely be used + // to log the user into the application. + ////FormsAuthentication.RedirectFromLoginPage(screenName, false); + } + } + } + })); } protected void signInButton_Click(object sender, ImageClickEventArgs e) { - TwitterConsumer.StartSignInWithTwitter(this.forceLoginCheckbox.Checked).Send(); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + Uri redirectUri = + await + TwitterConsumer.StartSignInWithTwitterAsync(this.forceLoginCheckbox.Checked, Response.ClientDisconnectedToken); + this.Response.Redirect(redirectUri.AbsoluteUri); + })); } } }
\ No newline at end of file diff --git a/samples/OAuthConsumer/Twitter.aspx b/samples/OAuthConsumer/Twitter.aspx index a24c7bd..cf81a12 100644 --- a/samples/OAuthConsumer/Twitter.aspx +++ b/samples/OAuthConsumer/Twitter.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthConsumer.Twitter" Codebehind="Twitter.aspx.cs" %> +<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthConsumer.Twitter" Codebehind="Twitter.aspx.cs" Async="true" %> <asp:Content ID="Content1" ContentPlaceHolderID="head" runat="Server"> </asp:Content> diff --git a/samples/OAuthConsumer/Twitter.aspx.cs b/samples/OAuthConsumer/Twitter.aspx.cs index 8288ed0..42ffa6e 100644 --- a/samples/OAuthConsumer/Twitter.aspx.cs +++ b/samples/OAuthConsumer/Twitter.aspx.cs @@ -3,6 +3,7 @@ using System.Collections.Generic; using System.Configuration; using System.Linq; + using System.Net; using System.Text; using System.Web; using System.Web.UI; @@ -10,87 +11,79 @@ using System.Xml.Linq; using System.Xml.XPath; using DotNetOpenAuth.ApplicationBlock; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; public partial class Twitter : System.Web.UI.Page { - private string AccessToken { - get { return (string)Session["TwitterAccessToken"]; } + private AccessToken AccessToken { + get { return (AccessToken)(Session["TwitterAccessToken"] ?? new AccessToken()); } set { Session["TwitterAccessToken"] = value; } } - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["TwitterTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["twitterConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["twitterConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["TwitterTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { - this.MultiView1.ActiveViewIndex = 1; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var twitter = new TwitterConsumer(); + if (twitter.ConsumerKey != null) { + this.MultiView1.ActiveViewIndex = 1; - if (!IsPostBack) { - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - - // Is Twitter calling back with authorization? - var accessTokenResponse = twitter.ProcessUserAuthorization(); - if (accessTokenResponse != null) { - this.AccessToken = accessTokenResponse.AccessToken; - } else if (this.AccessToken == null) { - // If we don't yet have access, immediately request it. - twitter.Channel.Send(twitter.PrepareRequestUserAuthorization()); - } - } - } + if (!IsPostBack) { + // Is Twitter calling back with authorization? + var accessTokenResponse = await twitter.ProcessUserAuthorizationAsync(this.Request.Url); + if (accessTokenResponse != null) { + this.AccessToken = accessTokenResponse.AccessToken; + } else { + // If we don't yet have access, immediately request it. + Uri redirectUri = await twitter.RequestUserAuthorizationAsync(MessagingUtilities.GetPublicFacingUrl()); + this.Response.Redirect(redirectUri.AbsoluteUri); + } + } + } + })); } protected void downloadUpdates_Click(object sender, EventArgs e) { - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - XPathDocument updates = new XPathDocument(TwitterConsumer.GetUpdates(twitter, this.AccessToken).CreateReader()); - XPathNavigator nav = updates.CreateNavigator(); - var parsedUpdates = from status in nav.Select("/statuses/status").OfType<XPathNavigator>() - where !status.SelectSingleNode("user/protected").ValueAsBoolean - select new { - User = status.SelectSingleNode("user/name").InnerXml, - Status = status.SelectSingleNode("text").InnerXml, - }; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var twitter = new TwitterConsumer(); + var statusesJson = await twitter.GetUpdatesAsync(this.AccessToken); + + StringBuilder tableBuilder = new StringBuilder(); + tableBuilder.Append("<table><tr><td>Name</td><td>Update</td></tr>"); - StringBuilder tableBuilder = new StringBuilder(); - tableBuilder.Append("<table><tr><td>Name</td><td>Update</td></tr>"); + foreach (dynamic update in statusesJson) { + if (!update.user.@protected.Value) { + tableBuilder.AppendFormat( + "<tr><td>{0}</td><td>{1}</td></tr>", + HttpUtility.HtmlEncode(update.user.screen_name), + HttpUtility.HtmlEncode(update.text)); + } + } - foreach (var update in parsedUpdates) { - tableBuilder.AppendFormat( - "<tr><td>{0}</td><td>{1}</td></tr>", - HttpUtility.HtmlEncode(update.User), - HttpUtility.HtmlEncode(update.Status)); - } - tableBuilder.Append("</table>"); - this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); + tableBuilder.Append("</table>"); + this.resultsPlaceholder.Controls.Add(new Literal { Text = tableBuilder.ToString() }); + })); } protected void uploadProfilePhotoButton_Click(object sender, EventArgs e) { - if (this.profilePhoto.PostedFile.ContentType == null) { - this.photoUploadedLabel.Visible = true; - this.photoUploadedLabel.Text = "Select a file first."; - return; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (this.profilePhoto.PostedFile.ContentType == null) { + this.photoUploadedLabel.Visible = true; + this.photoUploadedLabel.Text = "Select a file first."; + return; + } - var twitter = new WebConsumer(TwitterConsumer.ServiceDescription, this.TokenManager); - XDocument imageResult = TwitterConsumer.UpdateProfileImage( - twitter, - this.AccessToken, - this.profilePhoto.PostedFile.InputStream, - this.profilePhoto.PostedFile.ContentType); - this.photoUploadedLabel.Visible = true; + var twitter = new TwitterConsumer(); + XDocument imageResult = + await + twitter.UpdateProfileImageAsync( + this.AccessToken, this.profilePhoto.PostedFile.InputStream, this.profilePhoto.PostedFile.ContentType); + this.photoUploadedLabel.Visible = true; + })); } } }
\ No newline at end of file diff --git a/samples/OAuthConsumer/Web.config b/samples/OAuthConsumer/Web.config index 3330335..69dab78 100644 --- a/samples/OAuthConsumer/Web.config +++ b/samples/OAuthConsumer/Web.config @@ -37,29 +37,28 @@ <!-- Fill in your various consumer keys and secrets here to make the sample work. --> <!-- You must get these values by signing up with each individual service provider. --> <!-- Twitter sign-up: https://twitter.com/oauth_clients --> - <add key="twitterConsumerKey" value="" /> - <add key="twitterConsumerSecret" value="" /> + <add key="twitterConsumerKey" value="5ZxhT5fqIodtU8fa7mA0w" /> + <add key="twitterConsumerSecret" value="pZxtR63tLeMc8sd4rOqnZQqQjmfLiUMEWMokYFIjKq4" /> <!-- Google sign-up: https://www.google.com/accounts/ManageDomains --> <add key="googleConsumerKey" value="anonymous"/> <add key="googleConsumerSecret" value="anonymous"/> <!-- Yammer sign-up: https://www.yammer.com/client_applications/new --> <add key="yammerConsumerKey" value=""/> <add key="yammerConsumerSecret" value=""/> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <connectionStrings/> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this affects performance, set this value to true only during development. --> - <compilation debug="true" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="true" targetFramework="4.0" /> <!-- The <authentication> section enables configuration of the security authentication mode used by diff --git a/samples/OAuthConsumer/Yammer.aspx.cs b/samples/OAuthConsumer/Yammer.aspx.cs index d8993fe..d139e4f 100644 --- a/samples/OAuthConsumer/Yammer.aspx.cs +++ b/samples/OAuthConsumer/Yammer.aspx.cs @@ -11,66 +11,54 @@ using DotNetOpenAuth.OAuth; public partial class Yammer : System.Web.UI.Page { - private string RequestToken { - get { return (string)ViewState["YammerRequestToken"]; } - set { ViewState["YammerRequestToken"] = value; } - } - - private string AccessToken { - get { return (string)Session["YammerAccessToken"]; } + private AccessToken AccessToken { + get { return (AccessToken)Session["YammerAccessToken"]; } set { Session["YammerAccessToken"] = value; } } - private InMemoryTokenManager TokenManager { - get { - var tokenManager = (InMemoryTokenManager)Application["YammerTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["YammerConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["YammerConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - Application["YammerTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - protected void Page_Load(object sender, EventArgs e) { - if (this.TokenManager != null) { + var yammer = new YammerConsumer(); + if (yammer.ConsumerKey != null) { this.MultiView1.SetActiveView(this.BeginAuthorizationView); } } protected void getYammerMessages_Click(object sender, EventArgs e) { - var yammer = new WebConsumer(YammerConsumer.ServiceDescription, this.TokenManager); + var yammer = new YammerConsumer(); + + // TODO: code here } protected void obtainAuthorizationButton_Click(object sender, EventArgs e) { - var yammer = YammerConsumer.CreateConsumer(this.TokenManager); - string requestToken; - Uri popupWindowLocation = YammerConsumer.PrepareRequestAuthorization(yammer, out requestToken); - this.RequestToken = requestToken; - string javascript = "window.open('" + popupWindowLocation.AbsoluteUri + "');"; - this.Page.ClientScript.RegisterStartupScript(GetType(), "YammerPopup", javascript, true); - this.MultiView1.SetActiveView(this.CompleteAuthorizationView); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var yammer = new YammerConsumer(); + Uri popupWindowLocation = await yammer.RequestUserAuthorizationAsync(MessagingUtilities.GetPublicFacingUrl()); + string javascript = "window.open('" + popupWindowLocation.AbsoluteUri + "');"; + this.Page.ClientScript.RegisterStartupScript(GetType(), "YammerPopup", javascript, true); + this.MultiView1.SetActiveView(this.CompleteAuthorizationView); + })); } protected void finishAuthorizationButton_Click(object sender, EventArgs e) { - if (!Page.IsValid) { - return; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!Page.IsValid) { + return; + } - var yammer = YammerConsumer.CreateConsumer(this.TokenManager); - var authorizationResponse = YammerConsumer.CompleteAuthorization(yammer, this.RequestToken, this.yammerUserCode.Text); - if (authorizationResponse != null) { - this.accessTokenLabel.Text = HttpUtility.HtmlEncode(authorizationResponse.AccessToken); - this.MultiView1.SetActiveView(this.AuthorizationCompleteView); - } else { - this.MultiView1.SetActiveView(this.BeginAuthorizationView); - this.authorizationErrorLabel.Visible = true; - } + var yammer = new YammerConsumer(); + var authorizationResponse = await yammer.ProcessUserAuthorizationAsync(this.yammerUserCode.Text); + if (authorizationResponse != null) { + this.accessTokenLabel.Text = HttpUtility.HtmlEncode(authorizationResponse.AccessToken); + this.MultiView1.SetActiveView(this.AuthorizationCompleteView); + } else { + this.MultiView1.SetActiveView(this.BeginAuthorizationView); + this.authorizationErrorLabel.Visible = true; + } + })); } } }
\ No newline at end of file diff --git a/samples/OAuthConsumer/packages.config b/samples/OAuthConsumer/packages.config index 6562527..cf38da4 100644 --- a/samples/OAuthConsumer/packages.config +++ b/samples/OAuthConsumer/packages.config @@ -1,4 +1,6 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Newtonsoft.Json" version="4.5.11" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OAuthConsumerWpf/Authorize.xaml.cs b/samples/OAuthConsumerWpf/Authorize.xaml.cs index 4ed1932..78c9c70 100644 --- a/samples/OAuthConsumerWpf/Authorize.xaml.cs +++ b/samples/OAuthConsumerWpf/Authorize.xaml.cs @@ -4,6 +4,7 @@ using System.Linq; using System.Text; using System.Threading; + using System.Threading.Tasks; using System.Windows; using System.Windows.Controls; using System.Windows.Data; @@ -20,31 +21,28 @@ /// Interaction logic for Authorize.xaml /// </summary> public partial class Authorize : Window { - private DesktopConsumer consumer; - private string requestToken; + private Consumer consumer; - internal Authorize(DesktopConsumer consumer, FetchUri fetchUriCallback) { + internal Authorize(Consumer consumer, Func<Consumer, Task<Uri>> fetchUriCallback) { this.InitializeComponent(); this.consumer = consumer; Cursor original = this.Cursor; this.Cursor = Cursors.Wait; - ThreadPool.QueueUserWorkItem(delegate(object state) { - Uri browserAuthorizationLocation = fetchUriCallback(this.consumer, out this.requestToken); + Task.Run(async delegate { + Uri browserAuthorizationLocation = await fetchUriCallback(this.consumer); System.Diagnostics.Process.Start(browserAuthorizationLocation.AbsoluteUri); - this.Dispatcher.BeginInvoke(new Action(() => { + await this.Dispatcher.BeginInvoke(new Action(() => { this.Cursor = original; finishButton.IsEnabled = true; })); }); } - internal delegate Uri FetchUri(DesktopConsumer consumer, out string requestToken); + internal AccessToken AccessToken { get; set; } - internal string AccessToken { get; set; } - - private void finishButton_Click(object sender, RoutedEventArgs e) { - var grantedAccess = this.consumer.ProcessUserAuthorization(this.requestToken, this.verifierBox.Text); + private async void finishButton_Click(object sender, RoutedEventArgs e) { + var grantedAccess = await this.consumer.ProcessUserAuthorizationAsync(this.verifierBox.Text); this.AccessToken = grantedAccess.AccessToken; DialogResult = true; Close(); diff --git a/samples/OAuthConsumerWpf/Authorize2.xaml.cs b/samples/OAuthConsumerWpf/Authorize2.xaml.cs index f45af5c..71d76a8 100644 --- a/samples/OAuthConsumerWpf/Authorize2.xaml.cs +++ b/samples/OAuthConsumerWpf/Authorize2.xaml.cs @@ -31,8 +31,12 @@ get { return this.clientAuthorizationView.Authorization; } } + public ClientAuthorizationView ClientAuthorizationView { + get { return this.clientAuthorizationView; } + } + private void clientAuthorizationView_Completed(object sender, ClientAuthorizationCompleteEventArgs e) { - this.DialogResult = e.Authorization != null; + this.DialogResult = e.Authorization != null && e.Authorization.AccessToken != null; this.Close(); } } diff --git a/samples/OAuthConsumerWpf/InMemoryTokenManager.cs b/samples/OAuthConsumerWpf/InMemoryTokenManager.cs deleted file mode 100644 index 5266404..0000000 --- a/samples/OAuthConsumerWpf/InMemoryTokenManager.cs +++ /dev/null @@ -1,58 +0,0 @@ -//----------------------------------------------------------------------- -// <copyright file="InMemoryTokenManager.cs" company="Outercurve Foundation"> -// Copyright (c) Outercurve Foundation. All rights reserved. -// </copyright> -//----------------------------------------------------------------------- - -namespace DotNetOpenAuth.Samples.OAuthConsumerWpf { - using System; - using System.Collections.Generic; - using System.Diagnostics; - using DotNetOpenAuth.OAuth.ChannelElements; - using DotNetOpenAuth.OAuth.Messages; - - internal class InMemoryTokenManager : IConsumerTokenManager { - private Dictionary<string, string> tokensAndSecrets = new Dictionary<string, string>(); - - internal InMemoryTokenManager() { - } - - public string ConsumerKey { get; internal set; } - - public string ConsumerSecret { get; internal set; } - - #region ITokenManager Members - - public string GetConsumerSecret(string consumerKey) { - if (consumerKey == this.ConsumerKey) { - return this.ConsumerSecret; - } else { - throw new ArgumentException("Unrecognized consumer key.", "consumerKey"); - } - } - - public string GetTokenSecret(string token) { - return this.tokensAndSecrets[token]; - } - - public void StoreNewRequestToken(UnauthorizedTokenRequest request, ITokenSecretContainingMessage response) { - this.tokensAndSecrets[response.Token] = response.TokenSecret; - } - - public void ExpireRequestTokenAndStoreNewAccessToken(string consumerKey, string requestToken, string accessToken, string accessTokenSecret) { - this.tokensAndSecrets.Remove(requestToken); - this.tokensAndSecrets[accessToken] = accessTokenSecret; - } - - /// <summary> - /// Classifies a token as a request token or an access token. - /// </summary> - /// <param name="token">The token to classify.</param> - /// <returns>Request or Access token, or invalid if the token is not recognized.</returns> - public TokenType GetTokenType(string token) { - throw new NotImplementedException(); - } - - #endregion - } -} diff --git a/samples/OAuthConsumerWpf/MainWindow.xaml b/samples/OAuthConsumerWpf/MainWindow.xaml index 48eb0c4..979bc7e 100644 --- a/samples/OAuthConsumerWpf/MainWindow.xaml +++ b/samples/OAuthConsumerWpf/MainWindow.xaml @@ -92,30 +92,20 @@ </Grid.ColumnDefinitions> <Label Grid.Row="0">Request Token URL</Label> <TextBox Grid.Column="1" x:Name="requestTokenUrlBox" /> - <ComboBox Grid.Column="2" x:Name="requestTokenHttpMethod" SelectedIndex="1"> - <ComboBox.Items> - <ComboBoxItem>GET</ComboBoxItem> - <ComboBoxItem>POST</ComboBoxItem> - </ComboBox.Items> - </ComboBox> + <Label Grid.Column="2">POST</Label> <Label Grid.Row="1">Authorize URL</Label> <TextBox Grid.Row="1" Grid.Column="1" x:Name="authorizeUrlBox" /> <Label Grid.Row="1" Grid.Column="2">GET</Label> <Label Grid.Row="2">Access Token URL</Label> <TextBox Grid.Row="2" Grid.Column="1" x:Name="accessTokenUrlBox" /> - <ComboBox Grid.Row="2" Grid.Column="2" x:Name="accessTokenHttpMethod" SelectedIndex="1"> - <ComboBox.Items> - <ComboBoxItem>GET</ComboBoxItem> - <ComboBoxItem>POST</ComboBoxItem> - </ComboBox.Items> - </ComboBox> + <Label Grid.Row="2" Grid.Column="2">POST</Label> <Label Grid.Row="3">Resource URL</Label> <TextBox Grid.Row="3" Grid.Column="1" x:Name="resourceUrlBox" /> <ComboBox Grid.Row="3" Grid.Column="2" x:Name="resourceHttpMethodList" SelectedIndex="0"> <ComboBox.Items> - <ComboBoxItem>GET w/ header</ComboBoxItem> - <ComboBoxItem>GET w/ querystring</ComboBoxItem> - <ComboBoxItem>POST</ComboBoxItem> + <ComboBoxItem>GET w/ header</ComboBoxItem> + <ComboBoxItem>GET w/ querystring</ComboBoxItem> + <ComboBoxItem>POST</ComboBoxItem> </ComboBox.Items> </ComboBox> <Label Grid.Row="4">Consumer key</Label> @@ -123,10 +113,9 @@ <Label Grid.Row="5">Consumer secret</Label> <TextBox Grid.Row="5" Grid.Column="1" x:Name="consumerSecretBox" Grid.ColumnSpan="2"/> <Label Grid.Row="6">OAuth version</Label> - <ComboBox Grid.Row="6" Grid.Column="1" SelectedIndex="1" x:Name="oauthVersion"> + <ComboBox Grid.Row="6" Grid.Column="1" SelectedIndex="0" x:Name="oauthVersion"> <ComboBox.Items> - <ComboBoxItem>1.0</ComboBoxItem> - <ComboBoxItem>1.0a</ComboBoxItem> + <ComboBoxItem>RFC 5849</ComboBoxItem> </ComboBox.Items> </ComboBox> <Button Grid.Row="7" Grid.Column="1" x:Name="beginButton" Click="beginButton_Click">Begin</Button> @@ -153,27 +142,26 @@ <ColumnDefinition Width="auto" /> </Grid.ColumnDefinitions> <Label Grid.Row="1" TabIndex="202">Token Endpoint URL</Label> - <TextBox Grid.Row="1" Grid.Column="1" x:Name="oauth2TokenEndpointBox" Text="http://localhost:18916/OAuthTokenEndpoint.ashx" TabIndex="203" /> + <TextBox Grid.Row="1" Grid.Column="1" x:Name="oauth2TokenEndpointBox" Text="http://localhost:23603/api/token" TabIndex="203" /> <Label Grid.Row="1" Grid.Column="2" TabIndex="204">POST</Label> <Label Grid.Row="2" TabIndex="205">User Authorization URL</Label> - <TextBox Grid.Row="2" Grid.Column="1" x:Name="oauth2AuthorizationUrlBox" Text="http://localhost:18916/Account/Authorize" TabIndex="206" /> + <TextBox Grid.Row="2" Grid.Column="1" x:Name="oauth2AuthorizationUrlBox" Text="http://localhost:23603/user/Authorize" TabIndex="206" /> <Label Grid.Row="2" Grid.Column="2" TabIndex="207">GET</Label> <Label Grid.Row="0" TabIndex="200">Grant Type</Label> <ComboBox Grid.Row="0" Grid.Column="1" Grid.ColumnSpan="2" x:Name="flowBox" SelectedIndex="0" TabIndex="201"> <ComboBox.Items> <ComboBoxItem>Authorization Code</ComboBoxItem> <ComboBoxItem>Implicit Grant</ComboBoxItem> - <ComboBoxItem>Resource Owner Password Credentials</ComboBoxItem> + <!--<ComboBoxItem>Resource Owner Password Credentials</ComboBoxItem>--> </ComboBox.Items> </ComboBox> <Label Grid.Row="3" TabIndex="207">Resource URL</Label> - <TextBox Grid.Row="3" Grid.Column="1" x:Name="oauth2ResourceUrlBox" Text="http://localhost:18916/" TabIndex="208" /> + <TextBox Grid.Row="3" Grid.Column="1" x:Name="oauth2ResourceUrlBox" Text="http://localhost:23603/api/values" TabIndex="208" /> <ComboBox Grid.Row="3" Grid.Column="2" x:Name="oauth2ResourceHttpMethodList" SelectedIndex="0" TabIndex="209"> <ComboBox.Items> - <ComboBoxItem>GET w/ header</ComboBoxItem> - <ComboBoxItem>GET w/ querystring</ComboBoxItem> - <ComboBoxItem>POST</ComboBoxItem> - </ComboBox.Items> + <ComboBoxItem>GET</ComboBoxItem> + <ComboBoxItem>POST</ComboBoxItem> + </ComboBox.Items> </ComboBox> <Label Grid.Row="4" TabIndex="210">Client Identifier</Label> <TextBox Grid.Row="4" Grid.Column="1" x:Name="oauth2ClientIdentifierBox" Grid.ColumnSpan="2" Text="a" TabIndex="211" /> @@ -184,7 +172,7 @@ <Label Grid.Row="7" TabIndex="216">OAuth 2.0 version</Label> <ComboBox Grid.Row="7" Grid.Column="1" SelectedIndex="0" x:Name="oauth2Version" TabIndex="217"> <ComboBox.Items> - <ComboBoxItem>2.0 DRAFT 16</ComboBoxItem> + <ComboBoxItem>RFC 6749</ComboBoxItem> </ComboBox.Items> </ComboBox> <Button Grid.Row="8" Grid.Column="1" x:Name="oauth2BeginButton" Click="oauth2BeginButton_Click" TabIndex="218">Begin</Button> diff --git a/samples/OAuthConsumerWpf/MainWindow.xaml.cs b/samples/OAuthConsumerWpf/MainWindow.xaml.cs index 310c2c6..d58df8c 100644 --- a/samples/OAuthConsumerWpf/MainWindow.xaml.cs +++ b/samples/OAuthConsumerWpf/MainWindow.xaml.cs @@ -6,21 +6,21 @@ using System.IO; using System.Linq; using System.Net; + using System.Net.Http; using System.Security.Cryptography.X509Certificates; using System.ServiceModel; using System.ServiceModel.Channels; + using System.Threading; + using System.Threading.Tasks; using System.Windows; using System.Windows.Controls; using System.Xml.Linq; - using DotNetOpenAuth.ApplicationBlock; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.ChannelElements; using DotNetOpenAuth.Samples.OAuthConsumerWpf.WcfSampleService; - using OAuth2; - using OAuth2 = DotNetOpenAuth.OAuth2; using ProtocolVersion = DotNetOpenAuth.OAuth.ProtocolVersion; @@ -28,9 +28,8 @@ /// Interaction logic for MainWindow.xaml /// </summary> public partial class MainWindow : Window { - private InMemoryTokenManager googleTokenManager = new InMemoryTokenManager(); - private DesktopConsumer google; - private string googleAccessToken; + private GoogleConsumer google; + private DotNetOpenAuth.OAuth.AccessToken googleAccessToken; private UserAgentClient wcf; private IAuthorizationState wcfAccessToken; @@ -42,17 +41,12 @@ } private void InitializeGoogleConsumer() { - this.googleTokenManager.ConsumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - this.googleTokenManager.ConsumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - string pfxFile = ConfigurationManager.AppSettings["googleConsumerCertificateFile"]; - if (string.IsNullOrEmpty(pfxFile)) { - this.google = new DesktopConsumer(GoogleConsumer.ServiceDescription, this.googleTokenManager); - } else { + this.google = new GoogleConsumer(); + if (!string.IsNullOrEmpty(pfxFile)) { string pfxPassword = ConfigurationManager.AppSettings["googleConsumerCertificatePassword"]; var signingCertificate = new X509Certificate2(pfxFile, pfxPassword); - var service = GoogleConsumer.CreateRsaSha1ServiceDescription(signingCertificate); - this.google = new DesktopConsumer(service, this.googleTokenManager); + this.google.ConsumerCertificate = signingCertificate; } } @@ -64,25 +58,22 @@ this.wcf = new UserAgentClient(authServer, "sampleconsumer", "samplesecret"); } - private void beginAuthorizationButton_Click(object sender, RoutedEventArgs e) { - if (string.IsNullOrEmpty(this.googleTokenManager.ConsumerKey)) { + private async void beginAuthorizationButton_Click(object sender, RoutedEventArgs e) { + if (string.IsNullOrEmpty(this.google.ConsumerKey)) { MessageBox.Show(this, "You must modify the App.config or OAuthConsumerWpf.exe.config file for this application to include your Google OAuth consumer key first.", "Configuration required", MessageBoxButton.OK, MessageBoxImage.Stop); return; } var auth = new Authorize( this.google, - (DesktopConsumer consumer, out string requestToken) => - GoogleConsumer.RequestAuthorization( - consumer, - GoogleConsumer.Applications.Contacts | GoogleConsumer.Applications.Blogger, - out requestToken)); + consumer => + ((GoogleConsumer)consumer).RequestUserAuthorizationAsync(GoogleConsumer.Applications.Contacts | GoogleConsumer.Applications.Blogger)); bool? result = auth.ShowDialog(); if (result.HasValue && result.Value) { this.googleAccessToken = auth.AccessToken; this.postButton.IsEnabled = true; - XDocument contactsDocument = GoogleConsumer.GetContacts(this.google, this.googleAccessToken, 25, 1); + XDocument contactsDocument = await this.google.GetContactsAsync(this.googleAccessToken); var contacts = from entry in contactsDocument.Root.Elements(XName.Get("entry", "http://www.w3.org/2005/Atom")) select new { Name = entry.Element(XName.Get("title", "http://www.w3.org/2005/Atom")).Value, Email = entry.Element(XName.Get("email", "http://schemas.google.com/g/2005")).Attribute("address").Value }; this.contactsGrid.Children.Clear(); @@ -99,12 +90,12 @@ } } - private void postButton_Click(object sender, RoutedEventArgs e) { + private async void postButton_Click(object sender, RoutedEventArgs e) { XElement postBodyXml = XElement.Parse(this.postBodyBox.Text); - GoogleConsumer.PostBlogEntry(this.google, this.googleAccessToken, this.blogUrlBox.Text, this.postTitleBox.Text, postBodyXml); + await this.google.PostBlogEntryAsync(this.googleAccessToken, this.blogUrlBox.Text, this.postTitleBox.Text, postBodyXml); } - private void beginWcfAuthorizationButton_Click(object sender, RoutedEventArgs e) { + private async void beginWcfAuthorizationButton_Click(object sender, RoutedEventArgs e) { var auth = new Authorize2(this.wcf); auth.Authorization.Scope.AddRange(OAuthUtilities.SplitScopes("http://tempuri.org/IDataApi/GetName http://tempuri.org/IDataApi/GetAge http://tempuri.org/IDataApi/GetFavoriteSites")); auth.Authorization.Callback = new Uri("http://localhost:59721/"); @@ -112,20 +103,20 @@ bool? result = auth.ShowDialog(); if (result.HasValue && result.Value) { this.wcfAccessToken = auth.Authorization; - this.wcfName.Content = this.CallService(client => client.GetName()); - this.wcfAge.Content = this.CallService(client => client.GetAge()); - this.wcfFavoriteSites.Content = this.CallService(client => string.Join(", ", client.GetFavoriteSites())); + this.wcfName.Content = await this.CallServiceAsync(client => client.GetName()); + this.wcfAge.Content = await this.CallServiceAsync(client => client.GetAge()); + this.wcfFavoriteSites.Content = await this.CallServiceAsync(client => string.Join(", ", client.GetFavoriteSites())); } } - private T CallService<T>(Func<DataApiClient, T> predicate) { + private async Task<T> CallServiceAsync<T>(Func<DataApiClient, T> predicate) { DataApiClient client = new DataApiClient(); if (this.wcfAccessToken == null) { throw new InvalidOperationException("No access token!"); } var httpRequest = (HttpWebRequest)WebRequest.Create(client.Endpoint.Address.Uri); - this.wcf.AuthorizeRequest(httpRequest, this.wcfAccessToken); + await this.wcf.AuthorizeRequestAsync(httpRequest, this.wcfAccessToken, CancellationToken.None); HttpRequestMessageProperty httpDetails = new HttpRequestMessageProperty(); httpDetails.Headers[HttpRequestHeader.Authorization] = httpRequest.Headers[HttpRequestHeader.Authorization]; @@ -135,54 +126,42 @@ } } - private void beginButton_Click(object sender, RoutedEventArgs e) { + private async void beginButton_Click(object sender, RoutedEventArgs e) { try { - var service = new ServiceProviderDescription { - RequestTokenEndpoint = new MessageReceivingEndpoint(this.requestTokenUrlBox.Text, this.requestTokenHttpMethod.SelectedIndex == 0 ? HttpDeliveryMethods.GetRequest : HttpDeliveryMethods.PostRequest), - UserAuthorizationEndpoint = new MessageReceivingEndpoint(this.authorizeUrlBox.Text, HttpDeliveryMethods.GetRequest), - AccessTokenEndpoint = new MessageReceivingEndpoint(this.accessTokenUrlBox.Text, this.accessTokenHttpMethod.SelectedIndex == 0 ? HttpDeliveryMethods.GetRequest : HttpDeliveryMethods.PostRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - ProtocolVersion = this.oauthVersion.SelectedIndex == 0 ? ProtocolVersion.V10 : ProtocolVersion.V10a, - }; - var tokenManager = new InMemoryTokenManager(); - tokenManager.ConsumerKey = this.consumerKeyBox.Text; - tokenManager.ConsumerSecret = this.consumerSecretBox.Text; - - var consumer = new DesktopConsumer(service, tokenManager); - string accessToken; - if (service.ProtocolVersion == ProtocolVersion.V10) { - string requestToken; - Uri authorizeUrl = consumer.RequestUserAuthorization(null, null, out requestToken); - Process.Start(authorizeUrl.AbsoluteUri); - MessageBox.Show(this, "Click OK when you've authorized the app."); - var authorizationResponse = consumer.ProcessUserAuthorization(requestToken, null); - accessToken = authorizationResponse.AccessToken; + var service = new ServiceProviderDescription( + this.requestTokenUrlBox.Text, + this.authorizeUrlBox.Text, + this.accessTokenUrlBox.Text); + + var consumer = new Consumer(this.consumerKeyBox.Text, this.consumerSecretBox.Text, service, new MemoryTemporaryCredentialStorage()); + DotNetOpenAuth.OAuth.AccessToken accessToken; + var authorizePopup = new Authorize(consumer, c => c.RequestUserAuthorizationAsync(null, null)); + authorizePopup.Owner = this; + bool? result = authorizePopup.ShowDialog(); + if (result.HasValue && result.Value) { + accessToken = authorizePopup.AccessToken; } else { - var authorizePopup = new Authorize( - consumer, - (DesktopConsumer c, out string requestToken) => c.RequestUserAuthorization(null, null, out requestToken)); - authorizePopup.Owner = this; - bool? result = authorizePopup.ShowDialog(); - if (result.HasValue && result.Value) { - accessToken = authorizePopup.AccessToken; - } else { - return; - } - } - HttpDeliveryMethods resourceHttpMethod = this.resourceHttpMethodList.SelectedIndex < 2 ? HttpDeliveryMethods.GetRequest : HttpDeliveryMethods.PostRequest; - if (this.resourceHttpMethodList.SelectedIndex == 1) { - resourceHttpMethod |= HttpDeliveryMethods.AuthorizationHeaderRequest; + return; } - var resourceEndpoint = new MessageReceivingEndpoint(this.resourceUrlBox.Text, resourceHttpMethod); - using (IncomingWebResponse resourceResponse = consumer.PrepareAuthorizedRequestAndSend(resourceEndpoint, accessToken)) { - this.resultsBox.Text = resourceResponse.GetResponseReader().ReadToEnd(); + + HttpMethod resourceHttpMethod = this.resourceHttpMethodList.SelectedIndex < 2 ? HttpMethod.Get : HttpMethod.Post; + using (var handler = consumer.CreateMessageHandler(accessToken)) { + handler.Location = this.resourceHttpMethodList.SelectedIndex == 1 + ? OAuth1HttpMessageHandlerBase.OAuthParametersLocation.AuthorizationHttpHeader + : OAuth1HttpMessageHandlerBase.OAuthParametersLocation.QueryString; + using (var httpClient = consumer.CreateHttpClient(handler)) { + var request = new HttpRequestMessage(resourceHttpMethod, this.resourceUrlBox.Text); + using (var resourceResponse = await httpClient.SendAsync(request)) { + this.resultsBox.Text = await resourceResponse.Content.ReadAsStringAsync(); + } + } } } catch (DotNetOpenAuth.Messaging.ProtocolException ex) { MessageBox.Show(this, ex.Message); } } - private void oauth2BeginButton_Click(object sender, RoutedEventArgs e) { + private async void oauth2BeginButton_Click(object sender, RoutedEventArgs e) { var authServer = new DotNetOpenAuth.OAuth2.AuthorizationServerDescription { AuthorizationEndpoint = new Uri(this.oauth2AuthorizationUrlBox.Text), }; @@ -195,27 +174,19 @@ var authorizePopup = new Authorize2(client); authorizePopup.Authorization.Scope.AddRange(OAuthUtilities.SplitScopes(this.oauth2ScopeBox.Text)); + authorizePopup.Authorization.Callback = new Uri("http://www.microsoft.com/en-us/default.aspx"); authorizePopup.Owner = this; + authorizePopup.ClientAuthorizationView.RequestImplicitGrant = flowBox.SelectedIndex == 1; bool? result = authorizePopup.ShowDialog(); if (result.HasValue && result.Value) { - var requestUri = new UriBuilder(this.oauth2ResourceUrlBox.Text); - if (this.oauth2ResourceHttpMethodList.SelectedIndex > 0) { - requestUri.AppendQueryArgument("access_token", authorizePopup.Authorization.AccessToken); - } - - var request = (HttpWebRequest)WebRequest.Create(requestUri.Uri); - request.Method = this.oauth2ResourceHttpMethodList.SelectedIndex < 2 ? "GET" : "POST"; - if (this.oauth2ResourceHttpMethodList.SelectedIndex == 0) { - client.AuthorizeRequest(request, authorizePopup.Authorization); - } - - using (var resourceResponse = request.GetResponse()) { - using (var responseStream = new StreamReader(resourceResponse.GetResponseStream())) { - this.oauth2ResultsBox.Text = responseStream.ReadToEnd(); + var request = new HttpRequestMessage( + new HttpMethod(((ComboBoxItem)this.oauth2ResourceHttpMethodList.SelectedValue).Content.ToString()), + this.oauth2ResourceUrlBox.Text); + using (var httpClient = new HttpClient(client.CreateAuthorizingHandler(authorizePopup.Authorization))) { + using (var resourceResponse = await httpClient.SendAsync(request)) { + this.oauth2ResultsBox.Text = await resourceResponse.Content.ReadAsStringAsync(); } } - } else { - return; } } catch (Messaging.ProtocolException ex) { MessageBox.Show(this, ex.Message); diff --git a/samples/OAuthConsumerWpf/OAuthConsumerWpf.csproj b/samples/OAuthConsumerWpf/OAuthConsumerWpf.csproj index 03dbc50..ee06daa 100644 --- a/samples/OAuthConsumerWpf/OAuthConsumerWpf.csproj +++ b/samples/OAuthConsumerWpf/OAuthConsumerWpf.csproj @@ -76,6 +76,8 @@ <Reference Include="System.Core"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Runtime.Serialization"> <RequiredTargetFramework>3.0</RequiredTargetFramework> </Reference> @@ -92,8 +94,7 @@ <Reference Include="System.Data" /> <Reference Include="System.Xml" /> <Reference Include="Validation"> - <HintPath>..\..\src\packages\Validation.2.0.1.12362\lib\portable-windows8+net40+sl5+windowsphone8\Validation.dll</HintPath> - <Private>True</Private> + <HintPath>..\..\src\packages\Validation.2.0.2.13022\lib\portable-windows8+net40+sl5+windowsphone8\Validation.dll</HintPath> </Reference> <Reference Include="WindowsFormsIntegration" /> <Reference Include="System.Windows.Forms" /> @@ -152,7 +153,6 @@ <Compile Include="Authorize.xaml.cs"> <DependentUpon>Authorize.xaml</DependentUpon> </Compile> - <Compile Include="InMemoryTokenManager.cs" /> <Compile Include="Properties\AssemblyInfo.cs"> <SubType>Code</SubType> </Compile> diff --git a/samples/OAuthConsumerWpf/packages.config b/samples/OAuthConsumerWpf/packages.config index 1b0250a..2f4e283 100644 --- a/samples/OAuthConsumerWpf/packages.config +++ b/samples/OAuthConsumerWpf/packages.config @@ -1,5 +1,6 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> - <package id="Validation" version="2.0.1.12362" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Validation" version="2.0.2.13022" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OAuthResourceServer/Code/OAuthAuthorizationManager.cs b/samples/OAuthResourceServer/Code/OAuthAuthorizationManager.cs index 31371db..091c9bb 100644 --- a/samples/OAuthResourceServer/Code/OAuthAuthorizationManager.cs +++ b/samples/OAuthResourceServer/Code/OAuthAuthorizationManager.cs @@ -3,11 +3,14 @@ using System.Collections.Generic; using System.IdentityModel.Policy; using System.Linq; + using System.Net.Http; using System.Security.Principal; using System.ServiceModel; using System.ServiceModel.Channels; using System.ServiceModel.Security; using System.ServiceModel.Web; + using System.Threading; + using System.Threading.Tasks; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth2; using ProtocolException = System.ServiceModel.ProtocolException; @@ -27,53 +30,71 @@ var httpDetails = operationContext.RequestContext.RequestMessage.Properties[HttpRequestMessageProperty.Name] as HttpRequestMessageProperty; var requestUri = operationContext.RequestContext.RequestMessage.Properties.Via; - try { - var principal = VerifyOAuth2(httpDetails, requestUri, operationContext.IncomingMessageHeaders.Action ?? operationContext.IncomingMessageHeaders.To.AbsolutePath); - if (principal != null) { - var policy = new OAuthPrincipalAuthorizationPolicy(principal); - var policies = new List<IAuthorizationPolicy> { - policy, - }; + return Task.Run(async delegate { + ProtocolFaultResponseException exception = null; + try { + var principal = await VerifyOAuth2Async( + httpDetails, + requestUri, + operationContext.IncomingMessageHeaders.Action ?? operationContext.IncomingMessageHeaders.To.AbsolutePath); + if (principal != null) { + var policy = new OAuthPrincipalAuthorizationPolicy(principal); + var policies = new List<IAuthorizationPolicy> { policy, }; - var securityContext = new ServiceSecurityContext(policies.AsReadOnly()); - if (operationContext.IncomingMessageProperties.Security != null) { - operationContext.IncomingMessageProperties.Security.ServiceSecurityContext = securityContext; - } else { - operationContext.IncomingMessageProperties.Security = new SecurityMessageProperty { - ServiceSecurityContext = securityContext, - }; - } + var securityContext = new ServiceSecurityContext(policies.AsReadOnly()); + if (operationContext.IncomingMessageProperties.Security != null) { + operationContext.IncomingMessageProperties.Security.ServiceSecurityContext = securityContext; + } else { + operationContext.IncomingMessageProperties.Security = new SecurityMessageProperty { + ServiceSecurityContext = securityContext, + }; + } - securityContext.AuthorizationContext.Properties["Identities"] = new List<IIdentity> { - principal.Identity, - }; + securityContext.AuthorizationContext.Properties["Identities"] = new List<IIdentity> { principal.Identity, }; - return true; - } else { - return false; + return true; + } else { + return false; + } + } catch (ProtocolFaultResponseException ex) { + Global.Logger.Error("Error processing OAuth messages.", ex); + exception = ex; + } catch (ProtocolException ex) { + Global.Logger.Error("Error processing OAuth messages.", ex); } - } catch (ProtocolFaultResponseException ex) { - Global.Logger.Error("Error processing OAuth messages.", ex); - // Return the appropriate unauthorized response to the client. - var outgoingResponse = ex.CreateErrorResponse(); - outgoingResponse.Respond(WebOperationContext.Current.OutgoingResponse); - } catch (ProtocolException ex) { - Global.Logger.Error("Error processing OAuth messages.", ex); - } + if (exception != null) { + // Return the appropriate unauthorized response to the client. + var outgoingResponse = await exception.CreateErrorResponseAsync(CancellationToken.None); + this.Respond(WebOperationContext.Current.OutgoingResponse, outgoingResponse); + } - return false; + return false; + }).GetAwaiter().GetResult(); } - private static IPrincipal VerifyOAuth2(HttpRequestMessageProperty httpDetails, Uri requestUri, params string[] requiredScopes) { + private static async Task<IPrincipal> VerifyOAuth2Async(HttpRequestMessageProperty httpDetails, Uri requestUri, params string[] requiredScopes) { // for this sample where the auth server and resource server are the same site, // we use the same public/private key. using (var signing = Global.CreateAuthorizationServerSigningServiceProvider()) { using (var encrypting = Global.CreateResourceServerEncryptionServiceProvider()) { var resourceServer = new ResourceServer(new StandardAccessTokenAnalyzer(signing, encrypting)); - return resourceServer.GetPrincipal(httpDetails, requestUri, requiredScopes); + return await resourceServer.GetPrincipalAsync(httpDetails, requestUri, requiredScopes: requiredScopes); } } } + + /// <summary> + /// Submits this response to a WCF response context. Only available when no response body is included. + /// </summary> + /// <param name="responseContext">The response context to apply the response to.</param> + /// <param name="responseMessage">The response message.</param> + private void Respond(OutgoingWebResponseContext responseContext, HttpResponseMessage responseMessage) { + responseContext.StatusCode = responseMessage.StatusCode; + responseContext.SuppressEntityBody = true; + foreach (var header in responseMessage.Headers) { + responseContext.Headers[header.Key] = header.Value.First(); + } + } } } diff --git a/samples/OAuthResourceServer/OAuthResourceServer.csproj b/samples/OAuthResourceServer/OAuthResourceServer.csproj index db40ea3..4afe367 100644 --- a/samples/OAuthResourceServer/OAuthResourceServer.csproj +++ b/samples/OAuthResourceServer/OAuthResourceServer.csproj @@ -132,6 +132,18 @@ <Project>{56459A6C-6BA2-4BAC-A9C0-27E3BD961FA6}</Project> <Name>DotNetOpenAuth.OAuth2</Name> </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OpenId.RelyingParty.UI\DotNetOpenAuth.OpenId.RelyingParty.UI.csproj"> + <Project>{1ed8d424-f8ab-4050-aceb-f27f4f909484}</Project> + <Name>DotNetOpenAuth.OpenId.RelyingParty.UI</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OpenId.RelyingParty\DotNetOpenAuth.OpenId.RelyingParty.csproj"> + <Project>{f458ab60-ba1c-43d9-8cef-ec01b50be87b}</Project> + <Name>DotNetOpenAuth.OpenId.RelyingParty</Name> + </ProjectReference> + <ProjectReference Include="..\..\src\DotNetOpenAuth.OpenId\DotNetOpenAuth.OpenId.csproj"> + <Project>{3896a32a-e876-4c23-b9b8-78e17d134cd3}</Project> + <Name>DotNetOpenAuth.OpenId</Name> + </ProjectReference> </ItemGroup> <ItemGroup> <Content Include="packages.config" /> diff --git a/samples/OAuthResourceServer/Web.config b/samples/OAuthResourceServer/Web.config index 978c20b..d76a04a 100644 --- a/samples/OAuthResourceServer/Web.config +++ b/samples/OAuthResourceServer/Web.config @@ -37,13 +37,16 @@ <messaging relaxSslRequirements="true" /> </dotNetOpenAuth> - <appSettings/> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> <connectionStrings> <add name="DatabaseConnectionString" connectionString="Data Source=.\SQLEXPRESS;AttachDbFilename=|DataDirectory|\Database.mdf;Integrated Security=True;User Instance=True" providerName="System.Data.SqlClient" /> </connectionStrings> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this @@ -52,7 +55,6 @@ --> <compilation debug="true" targetFramework="4.0"> <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> </assemblies> </compilation> diff --git a/samples/OAuthServiceProvider/Code/Constants.cs b/samples/OAuthServiceProvider/Code/Constants.cs index 3e629f0..9115f1c 100644 --- a/samples/OAuthServiceProvider/Code/Constants.cs +++ b/samples/OAuthServiceProvider/Code/Constants.cs @@ -10,9 +10,9 @@ public static class Constants { public static Uri WebRootUrl { get; set; } - public static ServiceProviderDescription SelfDescription { + public static ServiceProviderHostDescription SelfDescription { get { - ServiceProviderDescription description = new ServiceProviderDescription { + var description = new ServiceProviderHostDescription { AccessTokenEndpoint = new MessageReceivingEndpoint(new Uri(WebRootUrl, "/OAuth.ashx"), HttpDeliveryMethods.PostRequest), RequestTokenEndpoint = new MessageReceivingEndpoint(new Uri(WebRootUrl, "/OAuth.ashx"), HttpDeliveryMethods.PostRequest), UserAuthorizationEndpoint = new MessageReceivingEndpoint(new Uri(WebRootUrl, "/OAuth.ashx"), HttpDeliveryMethods.PostRequest), diff --git a/samples/OAuthServiceProvider/Code/DatabaseTokenManager.cs b/samples/OAuthServiceProvider/Code/DatabaseTokenManager.cs index 49da45d..7c80275 100644 --- a/samples/OAuthServiceProvider/Code/DatabaseTokenManager.cs +++ b/samples/OAuthServiceProvider/Code/DatabaseTokenManager.cs @@ -9,13 +9,18 @@ namespace OAuthServiceProvider.Code { using System.Collections.Generic; using System.Diagnostics; using System.Linq; + using System.ServiceModel; + using DotNetOpenAuth.OAuth.ChannelElements; using DotNetOpenAuth.OAuth.Messages; public class DatabaseTokenManager : IServiceProviderTokenManager { + internal OperationContext OperationContext { get; set; } + #region IServiceProviderTokenManager public IConsumerDescription GetConsumer(string consumerKey) { + this.ApplyOperationContext(); var consumerRow = Global.DataContext.OAuthConsumers.SingleOrDefault( consumerCandidate => consumerCandidate.ConsumerKey == consumerKey); if (consumerRow == null) { @@ -27,6 +32,7 @@ namespace OAuthServiceProvider.Code { public IServiceProviderRequestToken GetRequestToken(string token) { try { + this.ApplyOperationContext(); return Global.DataContext.OAuthTokens.First(t => t.Token == token && t.State != TokenAuthorizationState.AccessToken); } catch (InvalidOperationException ex) { throw new KeyNotFoundException("Unrecognized token", ex); @@ -34,6 +40,7 @@ namespace OAuthServiceProvider.Code { } public IServiceProviderAccessToken GetAccessToken(string token) { + this.ApplyOperationContext(); try { return Global.DataContext.OAuthTokens.First(t => t.Token == token && t.State == TokenAuthorizationState.AccessToken); } catch (InvalidOperationException ex) { @@ -54,6 +61,7 @@ namespace OAuthServiceProvider.Code { #region ITokenManager Members public string GetTokenSecret(string token) { + this.ApplyOperationContext(); var tokenRow = Global.DataContext.OAuthTokens.SingleOrDefault( tokenCandidate => tokenCandidate.Token == token); if (tokenRow == null) { @@ -64,6 +72,7 @@ namespace OAuthServiceProvider.Code { } public void StoreNewRequestToken(UnauthorizedTokenRequest request, ITokenSecretContainingMessage response) { + this.ApplyOperationContext(); RequestScopedTokenMessage scopedRequest = (RequestScopedTokenMessage)request; var consumer = Global.DataContext.OAuthConsumers.Single(consumerRow => consumerRow.ConsumerKey == request.ConsumerKey); string scope = scopedRequest.Scope; @@ -90,6 +99,7 @@ namespace OAuthServiceProvider.Code { /// been authorized, has expired or does not exist. /// </returns> public bool IsRequestTokenAuthorized(string requestToken) { + this.ApplyOperationContext(); var tokenFound = Global.DataContext.OAuthTokens.SingleOrDefault( token => token.Token == requestToken && token.State == TokenAuthorizationState.AuthorizedRequestToken); @@ -97,6 +107,8 @@ namespace OAuthServiceProvider.Code { } public void ExpireRequestTokenAndStoreNewAccessToken(string consumerKey, string requestToken, string accessToken, string accessTokenSecret) { + this.ApplyOperationContext(); + var data = Global.DataContext; var consumerRow = data.OAuthConsumers.Single(consumer => consumer.ConsumerKey == consumerKey); var tokenRow = data.OAuthTokens.Single(token => token.Token == requestToken && token.OAuthConsumer == consumerRow); @@ -115,6 +127,7 @@ namespace OAuthServiceProvider.Code { /// <param name="token">The token to classify.</param> /// <returns>Request or Access token, or invalid if the token is not recognized.</returns> public TokenType GetTokenType(string token) { + this.ApplyOperationContext(); var tokenRow = Global.DataContext.OAuthTokens.SingleOrDefault(tokenCandidate => tokenCandidate.Token == token); if (tokenRow == null) { return TokenType.InvalidToken; @@ -135,6 +148,7 @@ namespace OAuthServiceProvider.Code { throw new ArgumentNullException("user"); } + this.ApplyOperationContext(); var tokenRow = Global.DataContext.OAuthTokens.SingleOrDefault( tokenCandidate => tokenCandidate.Token == requestToken && tokenCandidate.State == TokenAuthorizationState.UnauthorizedRequestToken); @@ -151,6 +165,7 @@ namespace OAuthServiceProvider.Code { throw new ArgumentNullException("requestToken"); } + this.ApplyOperationContext(); var tokenRow = Global.DataContext.OAuthTokens.SingleOrDefault( tokenCandidate => tokenCandidate.Token == token); if (tokenRow == null) { @@ -159,5 +174,11 @@ namespace OAuthServiceProvider.Code { return tokenRow.OAuthConsumer; } + + private void ApplyOperationContext() { + if (this.OperationContext != null && OperationContext.Current == null) { + OperationContext.Current = this.OperationContext; + } + } } }
\ No newline at end of file diff --git a/samples/OAuthServiceProvider/Code/Global.cs b/samples/OAuthServiceProvider/Code/Global.cs index 60fed9f..37206ab 100644 --- a/samples/OAuthServiceProvider/Code/Global.cs +++ b/samples/OAuthServiceProvider/Code/Global.cs @@ -10,6 +10,10 @@ /// The web application global events and properties. /// </summary> public class Global : HttpApplication { + private readonly object syncObject = new object(); + + private volatile bool initialized; + /// <summary> /// An application memory cache of recent log messages. /// </summary> @@ -95,17 +99,6 @@ private void Application_Start(object sender, EventArgs e) { log4net.Config.XmlConfigurator.Configure(); Logger.Info("Sample starting..."); - string appPath = HttpContext.Current.Request.ApplicationPath; - if (!appPath.EndsWith("/")) { - appPath += "/"; - } - - // This will break in IIS Integrated Pipeline mode, since applications - // start before the first incoming request context is available. - // TODO: fix this. - Constants.WebRootUrl = new Uri(HttpContext.Current.Request.Url, appPath); - Global.TokenManager = new DatabaseTokenManager(); - Global.NonceStore = new DatabaseNonceStore(); } private void Application_End(object sender, EventArgs e) { @@ -128,8 +121,30 @@ } } + private void Application_BeginRequest(object sender, EventArgs e) { + this.EnsureInitialized(); + } + private void Application_EndRequest(object sender, EventArgs e) { CommitAndCloseDatabaseIfNecessary(); } + + private void EnsureInitialized() { + if (!this.initialized) { + lock (this.syncObject) { + if (!this.initialized) { + string appPath = HttpContext.Current.Request.ApplicationPath; + if (!appPath.EndsWith("/")) { + appPath += "/"; + } + + Constants.WebRootUrl = new Uri(HttpContext.Current.Request.Url, appPath); + Global.TokenManager = new DatabaseTokenManager(); + Global.NonceStore = new DatabaseNonceStore(); + this.initialized = true; + } + } + } + } } }
\ No newline at end of file diff --git a/samples/OAuthServiceProvider/Code/OAuthAuthorizationManager.cs b/samples/OAuthServiceProvider/Code/OAuthAuthorizationManager.cs index 917a252..2d942b5 100644 --- a/samples/OAuthServiceProvider/Code/OAuthAuthorizationManager.cs +++ b/samples/OAuthServiceProvider/Code/OAuthAuthorizationManager.cs @@ -7,6 +7,7 @@ using System.ServiceModel; using System.ServiceModel.Channels; using System.ServiceModel.Security; + using System.Threading.Tasks; using DotNetOpenAuth; using DotNetOpenAuth.OAuth; @@ -25,41 +26,41 @@ HttpRequestMessageProperty httpDetails = operationContext.RequestContext.RequestMessage.Properties[HttpRequestMessageProperty.Name] as HttpRequestMessageProperty; Uri requestUri = operationContext.RequestContext.RequestMessage.Properties.Via; ServiceProvider sp = Constants.CreateServiceProvider(); - try { - var auth = sp.ReadProtectedResourceAuthorization(httpDetails, requestUri); - if (auth != null) { - var accessToken = Global.DataContext.OAuthTokens.Single(token => token.Token == auth.AccessToken); + ((DatabaseTokenManager)sp.TokenManager).OperationContext = operationContext; // artificially preserve this across thread changes. + return Task.Run( + async delegate { + try { + var auth = await sp.ReadProtectedResourceAuthorizationAsync(httpDetails, requestUri); + if (auth != null) { + var accessToken = Global.DataContext.OAuthTokens.Single(token => token.Token == auth.AccessToken); - var principal = sp.CreatePrincipal(auth); - var policy = new OAuthPrincipalAuthorizationPolicy(principal); - var policies = new List<IAuthorizationPolicy> { - policy, - }; + var principal = sp.CreatePrincipal(auth); + var policy = new OAuthPrincipalAuthorizationPolicy(principal); + var policies = new List<IAuthorizationPolicy> { policy, }; - var securityContext = new ServiceSecurityContext(policies.AsReadOnly()); - if (operationContext.IncomingMessageProperties.Security != null) { - operationContext.IncomingMessageProperties.Security.ServiceSecurityContext = securityContext; - } else { - operationContext.IncomingMessageProperties.Security = new SecurityMessageProperty { - ServiceSecurityContext = securityContext, - }; - } + var securityContext = new ServiceSecurityContext(policies.AsReadOnly()); + if (operationContext.IncomingMessageProperties.Security != null) { + operationContext.IncomingMessageProperties.Security.ServiceSecurityContext = securityContext; + } else { + operationContext.IncomingMessageProperties.Security = new SecurityMessageProperty { + ServiceSecurityContext = securityContext, + }; + } - securityContext.AuthorizationContext.Properties["Identities"] = new List<IIdentity> { - principal.Identity, - }; + securityContext.AuthorizationContext.Properties["Identities"] = new List<IIdentity> { principal.Identity, }; - // Only allow this method call if the access token scope permits it. - string[] scopes = accessToken.Scope.Split('|'); - if (scopes.Contains(operationContext.IncomingMessageHeaders.Action)) { - return true; + // Only allow this method call if the access token scope permits it. + string[] scopes = accessToken.Scope.Split('|'); + if (scopes.Contains(operationContext.IncomingMessageHeaders.Action)) { + return true; + } + } + } catch (ProtocolException ex) { + Global.Logger.Error("Error processing OAuth messages.", ex); } - } - } catch (ProtocolException ex) { - Global.Logger.Error("Error processing OAuth messages.", ex); - } - return false; + return false; + }).GetAwaiter().GetResult(); } } }
\ No newline at end of file diff --git a/samples/OAuthServiceProvider/Code/OAuthPrincipalAuthorizationPolicy.cs b/samples/OAuthServiceProvider/Code/OAuthPrincipalAuthorizationPolicy.cs index a25f4c5..4ce60bb 100644 --- a/samples/OAuthServiceProvider/Code/OAuthPrincipalAuthorizationPolicy.cs +++ b/samples/OAuthServiceProvider/Code/OAuthPrincipalAuthorizationPolicy.cs @@ -4,18 +4,19 @@ using System.IdentityModel.Claims; using System.IdentityModel.Policy; using System.Linq; + using System.Security.Principal; using System.Web; using DotNetOpenAuth.OAuth.ChannelElements; public class OAuthPrincipalAuthorizationPolicy : IAuthorizationPolicy { private readonly Guid uniqueId = Guid.NewGuid(); - private readonly OAuthPrincipal principal; + private readonly IPrincipal principal; /// <summary> /// Initializes a new instance of the <see cref="OAuthPrincipalAuthorizationPolicy"/> class. /// </summary> /// <param name="principal">The principal.</param> - public OAuthPrincipalAuthorizationPolicy(OAuthPrincipal principal) { + public OAuthPrincipalAuthorizationPolicy(IPrincipal principal) { this.principal = principal; } diff --git a/samples/OAuthServiceProvider/Login.aspx b/samples/OAuthServiceProvider/Login.aspx index 4498ee0..0b84ab9 100644 --- a/samples/OAuthServiceProvider/Login.aspx +++ b/samples/OAuthServiceProvider/Login.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="Login" Language="C#" MasterPageFile="~/MasterPage.master" %> +<%@ Page Title="Login" Language="C#" MasterPageFile="~/MasterPage.master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> diff --git a/samples/OAuthServiceProvider/Members/Authorize.aspx b/samples/OAuthServiceProvider/Members/Authorize.aspx index b3e2c6a..e7be651 100644 --- a/samples/OAuthServiceProvider/Members/Authorize.aspx +++ b/samples/OAuthServiceProvider/Members/Authorize.aspx @@ -1,4 +1,4 @@ -<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthServiceProvider.Authorize" Codebehind="Authorize.aspx.cs" %> +<%@ Page Title="" Language="C#" MasterPageFile="~/MasterPage.master" AutoEventWireup="true" Inherits="OAuthServiceProvider.Authorize" Codebehind="Authorize.aspx.cs" Async="true" %> <asp:Content ID="Content2" ContentPlaceHolderID="Body" runat="Server"> <asp:MultiView runat="server" ActiveViewIndex="0" ID="multiView"> diff --git a/samples/OAuthServiceProvider/Members/Authorize.aspx.cs b/samples/OAuthServiceProvider/Members/Authorize.aspx.cs index faa2147..073231b 100644 --- a/samples/OAuthServiceProvider/Members/Authorize.aspx.cs +++ b/samples/OAuthServiceProvider/Members/Authorize.aspx.cs @@ -7,6 +7,7 @@ using System.Web.UI; using System.Web.UI.WebControls; using DotNetOpenAuth; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.Messages; using OAuthServiceProvider.Code; @@ -46,30 +47,36 @@ } protected void allowAccessButton_Click(object sender, EventArgs e) { - if (this.AuthorizationSecret != this.OAuthAuthorizationSecToken.Value) { - throw new ArgumentException(); // probably someone trying to hack in. - } - this.AuthorizationSecret = null; // clear one time use secret - var pending = Global.PendingOAuthAuthorization; - Global.AuthorizePendingRequestToken(); - this.multiView.ActiveViewIndex = 1; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (this.AuthorizationSecret != this.OAuthAuthorizationSecToken.Value) { + throw new ArgumentException(); // probably someone trying to hack in. + } + this.AuthorizationSecret = null; // clear one time use secret + var pending = Global.PendingOAuthAuthorization; + Global.AuthorizePendingRequestToken(); + this.multiView.ActiveViewIndex = 1; - ServiceProvider sp = new ServiceProvider(Constants.SelfDescription, Global.TokenManager); - var response = sp.PrepareAuthorizationResponse(pending); - if (response != null) { - sp.Channel.Send(response); - } else { - if (pending.IsUnsafeRequest) { - this.verifierMultiView.ActiveViewIndex = 1; - } else { - string verifier = ServiceProvider.CreateVerificationCode(VerificationCodeFormat.AlphaNumericNoLookAlikes, 10); - this.verificationCodeLabel.Text = verifier; - ITokenContainingMessage requestTokenMessage = pending; - var requestToken = Global.TokenManager.GetRequestToken(requestTokenMessage.Token); - requestToken.VerificationCode = verifier; - Global.TokenManager.UpdateToken(requestToken); - } - } + ServiceProvider sp = new ServiceProvider(Constants.SelfDescription, Global.TokenManager); + var response = sp.PrepareAuthorizationResponse(pending); + if (response != null) { + var responseMessage = await sp.Channel.PrepareResponseAsync(response, Response.ClientDisconnectedToken); + await responseMessage.SendAsync(); + this.Context.Response.End(); + } else { + if (pending.IsUnsafeRequest) { + this.verifierMultiView.ActiveViewIndex = 1; + } else { + string verifier = ServiceProvider.CreateVerificationCode(VerificationCodeFormat.AlphaNumericNoLookAlikes, 10); + this.verificationCodeLabel.Text = verifier; + ITokenContainingMessage requestTokenMessage = pending; + var requestToken = Global.TokenManager.GetRequestToken(requestTokenMessage.Token); + requestToken.VerificationCode = verifier; + Global.TokenManager.UpdateToken(requestToken); + } + } + })); } protected void denyAccessButton_Click(object sender, EventArgs e) { diff --git a/samples/OAuthServiceProvider/OAuth.ashx b/samples/OAuthServiceProvider/OAuth.ashx index 8a74926..003735c 100644 --- a/samples/OAuthServiceProvider/OAuth.ashx +++ b/samples/OAuthServiceProvider/OAuth.ashx @@ -2,41 +2,45 @@ using System; using System.Linq; +using System.Threading.Tasks; using System.Web; using System.Web.SessionState; +using DotNetOpenAuth.ApplicationBlock; using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.ChannelElements; using DotNetOpenAuth.OAuth.Messages; using DotNetOpenAuth.Messaging; using OAuthServiceProvider.Code; -public class OAuth : IHttpHandler, IRequiresSessionState { +public class OAuth : HttpAsyncHandlerBase, IRequiresSessionState { ServiceProvider sp; public OAuth() { sp = new ServiceProvider(Constants.SelfDescription, Global.TokenManager, new CustomOAuthMessageFactory(Global.TokenManager)); } - public void ProcessRequest(HttpContext context) { - IProtocolMessage request = sp.ReadRequest(); + public override bool IsReusable { + get { return true; } + } + + protected override async Task ProcessRequestAsync(HttpContext context) { + IProtocolMessage request = await sp.ReadRequestAsync(); RequestScopedTokenMessage requestToken; UserAuthorizationRequest requestAuth; AuthorizedTokenRequest requestAccessToken; if ((requestToken = request as RequestScopedTokenMessage) != null) { var response = sp.PrepareUnauthorizedTokenMessage(requestToken); - sp.Channel.Send(response); + var responseMessage = await sp.Channel.PrepareResponseAsync(response); + await responseMessage.SendAsync(new HttpContextWrapper(context)); } else if ((requestAuth = request as UserAuthorizationRequest) != null) { Global.PendingOAuthAuthorization = requestAuth; HttpContext.Current.Response.Redirect("~/Members/Authorize.aspx"); } else if ((requestAccessToken = request as AuthorizedTokenRequest) != null) { var response = sp.PrepareAccessTokenMessage(requestAccessToken); - sp.Channel.Send(response); + var responseMessage = await sp.Channel.PrepareResponseAsync(response); + await responseMessage.SendAsync(new HttpContextWrapper(context)); } else { throw new InvalidOperationException(); } } - - public bool IsReusable { - get { return true; } - } } diff --git a/samples/OAuthServiceProvider/OAuthServiceProvider.csproj b/samples/OAuthServiceProvider/OAuthServiceProvider.csproj index 5419347..65d5a1f 100644 --- a/samples/OAuthServiceProvider/OAuthServiceProvider.csproj +++ b/samples/OAuthServiceProvider/OAuthServiceProvider.csproj @@ -26,7 +26,7 @@ <RootNamespace>OAuthServiceProvider</RootNamespace> <AssemblyName>OAuthServiceProvider</AssemblyName> <TargetFrameworkVersion>v4.5</TargetFrameworkVersion> - <UseIISExpress>false</UseIISExpress> + <UseIISExpress>true</UseIISExpress> </PropertyGroup> <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> <DebugSymbols>true</DebugSymbols> @@ -54,6 +54,8 @@ <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Data.Linq" /> <Reference Include="System.IdentityModel" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.ServiceModel" /> <Reference Include="System.Web.ApplicationServices" /> <Reference Include="System.Web.DynamicData" /> @@ -188,6 +190,10 @@ <Project>{3896A32A-E876-4C23-B9B8-78E17D134CD3}</Project> <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> + <ProjectReference Include="..\DotNetOpenAuth.ApplicationBlock\DotNetOpenAuth.ApplicationBlock.csproj"> + <Project>{aa78d112-d889-414b-a7d4-467b34c7b663}</Project> + <Name>DotNetOpenAuth.ApplicationBlock</Name> + </ProjectReference> </ItemGroup> <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> @@ -196,12 +202,11 @@ <VisualStudio> <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> <WebProjectProperties> - <UseIIS>False</UseIIS> + <UseIIS>True</UseIIS> <AutoAssignPort>False</AutoAssignPort> <DevelopmentServerPort>65169</DevelopmentServerPort> <DevelopmentServerVPath>/</DevelopmentServerVPath> - <IISUrl> - </IISUrl> + <IISUrl>http://localhost:65169/</IISUrl> <NTLMAuthentication>False</NTLMAuthentication> <UseCustomServer>False</UseCustomServer> <CustomServerUrl> diff --git a/samples/OAuthServiceProvider/Web.config b/samples/OAuthServiceProvider/Web.config index 21fe388..84aea1e 100644 --- a/samples/OAuthServiceProvider/Web.config +++ b/samples/OAuthServiceProvider/Web.config @@ -40,13 +40,16 @@ </messaging> </dotNetOpenAuth> - <appSettings/> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> <connectionStrings> <add name="DatabaseConnectionString" connectionString="Data Source=.\SQLEXPRESS;AttachDbFilename=|DataDirectory|\Database.mdf;Integrated Security=True;User Instance=True" providerName="System.Data.SqlClient" /> </connectionStrings> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this @@ -55,8 +58,8 @@ --> <compilation debug="true" targetFramework="4.0"> <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089"/> + <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> + <add assembly="System.Net.Http, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b03f5f7f11d50a3a" /> </assemblies> </compilation> <authentication mode="Forms"> diff --git a/samples/OAuthServiceProvider/packages.config b/samples/OAuthServiceProvider/packages.config index 6562527..8e40260 100644 --- a/samples/OAuthServiceProvider/packages.config +++ b/samples/OAuthServiceProvider/packages.config @@ -1,4 +1,5 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OpenIdOfflineProvider/CheckIdWindow.xaml.cs b/samples/OpenIdOfflineProvider/CheckIdWindow.xaml.cs index 27bb802..9394bd9 100644 --- a/samples/OpenIdOfflineProvider/CheckIdWindow.xaml.cs +++ b/samples/OpenIdOfflineProvider/CheckIdWindow.xaml.cs @@ -9,6 +9,8 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { using System.Collections.Generic; using System.Linq; using System.Text; + using System.Threading; + using System.Threading.Tasks; using System.Windows; using System.Windows.Controls; using System.Windows.Data; @@ -18,6 +20,7 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { using System.Windows.Media.Imaging; using System.Windows.Shapes; using DotNetOpenAuth.Messaging; + using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.Provider; using Validation; @@ -28,9 +31,9 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { /// <summary> /// Initializes a new instance of the <see cref="CheckIdWindow"/> class. /// </summary> - /// <param name="provider">The OpenID Provider host.</param> + /// <param name="userIdentityPageBase">The base URI upon which user identity pages are created.</param> /// <param name="request">The incoming authentication request.</param> - private CheckIdWindow(HostedProvider provider, IAuthenticationRequest request) { + private CheckIdWindow(Uri userIdentityPageBase, IAuthenticationRequest request) { Requires.NotNull(request, "request"); this.InitializeComponent(); @@ -40,13 +43,9 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { this.immediateModeLabel.Visibility = request.Immediate ? Visibility.Visible : Visibility.Collapsed; this.setupModeLabel.Visibility = request.Immediate ? Visibility.Collapsed : Visibility.Visible; - bool isRPDiscoverable = request.IsReturnUrlDiscoverable(provider.Provider.Channel.WebRequestHandler) == RelyingPartyDiscoveryResult.Success; - this.discoverableYesLabel.Visibility = isRPDiscoverable ? Visibility.Visible : Visibility.Collapsed; - this.discoverableNoLabel.Visibility = isRPDiscoverable ? Visibility.Collapsed : Visibility.Visible; - if (request.IsDirectedIdentity) { - this.claimedIdentifierBox.Text = provider.UserIdentityPageBase.AbsoluteUri; - this.localIdentifierBox.Text = provider.UserIdentityPageBase.AbsoluteUri; + this.claimedIdentifierBox.Text = userIdentityPageBase.AbsoluteUri; + this.localIdentifierBox.Text = userIdentityPageBase.AbsoluteUri; } else { this.claimedIdentifierBox.Text = request.ClaimedIdentifier; this.localIdentifierBox.Text = request.LocalIdentifier; @@ -56,13 +55,22 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { /// <summary> /// Processes an authentication request by a popup window. /// </summary> - /// <param name="provider">The OpenID Provider host.</param> + /// <param name="userIdentityPageBase">The base URI upon which user identity pages are created.</param> /// <param name="request">The incoming authentication request.</param> - internal static void ProcessAuthentication(HostedProvider provider, IAuthenticationRequest request) { - Requires.NotNull(provider, "provider"); + /// <param name="cancellationToken">The cancellation token.</param> + /// <returns> + /// A task that completes with the asynchronous operation. + /// </returns> + internal static async Task ProcessAuthenticationAsync(Uri userIdentityPageBase, IAuthenticationRequest request, CancellationToken cancellationToken) { + Requires.NotNull(userIdentityPageBase, "userIdentityPageBase"); Requires.NotNull(request, "request"); - var window = new CheckIdWindow(provider, request); + var window = new CheckIdWindow(userIdentityPageBase, request); + + bool isRPDiscoverable = await request.IsReturnUrlDiscoverableAsync(cancellationToken: cancellationToken) == RelyingPartyDiscoveryResult.Success; + window.discoverableYesLabel.Visibility = isRPDiscoverable ? Visibility.Visible : Visibility.Collapsed; + window.discoverableNoLabel.Visibility = isRPDiscoverable ? Visibility.Collapsed : Visibility.Visible; + bool? result = window.ShowDialog(); // If the user pressed Esc or cancel, just send a negative assertion. diff --git a/samples/OpenIdOfflineProvider/Controllers/HomeController.cs b/samples/OpenIdOfflineProvider/Controllers/HomeController.cs new file mode 100644 index 0000000..f5a8763 --- /dev/null +++ b/samples/OpenIdOfflineProvider/Controllers/HomeController.cs @@ -0,0 +1,54 @@ +namespace DotNetOpenAuth.OpenIdOfflineProvider.Controllers { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net.Http; + using System.Text; + using System.Threading.Tasks; + using System.Web.Http; + + using Validation; + + public class HomeController : ApiController { + public HttpResponseMessage Get() { + App.Logger.Info("Discovery on OP Identifier detected."); + var opEndpoint = this.Url.Link("default", new { controller = "provider" }); + var opEndpointUri = new Uri(opEndpoint); + return new HttpResponseMessage() { + Content = new StringContent(GenerateXrdsOPIdentifierDocument(opEndpointUri, Enumerable.Empty<string>()), Encoding.UTF8, "application/xrds+xml"), + }; + } + + /// <summary> + /// Generates the OP Identifier XRDS document. + /// </summary> + /// <param name="providerEndpoint">The provider endpoint.</param> + /// <param name="supportedExtensions">The supported extensions.</param> + /// <returns>The content of the XRDS document.</returns> + private static string GenerateXrdsOPIdentifierDocument(Uri providerEndpoint, IEnumerable<string> supportedExtensions) { + Requires.NotNull(providerEndpoint, "providerEndpoint"); + Requires.NotNull(supportedExtensions, "supportedExtensions"); + + const string OPIdentifierDiscoveryFormat = @"<xrds:XRDS + xmlns:xrds='xri://$xrds' + xmlns:openid='http://openid.net/xmlns/1.0' + xmlns='xri://$xrd*($v*2.0)'> + <XRD> + <Service priority='10'> + <Type>http://specs.openid.net/auth/2.0/server</Type> + {1} + <URI>{0}</URI> + </Service> + </XRD> +</xrds:XRDS>"; + + string extensions = string.Join( + "\n\t\t\t", + supportedExtensions.Select(ext => "<Type>" + ext + "</Type>").ToArray()); + return string.Format( + OPIdentifierDiscoveryFormat, + providerEndpoint.AbsoluteUri, + extensions); + } + } +} diff --git a/samples/OpenIdOfflineProvider/Controllers/ProviderController.cs b/samples/OpenIdOfflineProvider/Controllers/ProviderController.cs new file mode 100644 index 0000000..b0d243b --- /dev/null +++ b/samples/OpenIdOfflineProvider/Controllers/ProviderController.cs @@ -0,0 +1,81 @@ +namespace DotNetOpenAuth.OpenIdOfflineProvider.Controllers { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net; + using System.Net.Http; + using System.Text; + using System.Threading; + using System.Threading.Tasks; + using System.Web.Http; + + using DotNetOpenAuth.OpenId; + using DotNetOpenAuth.OpenId.Provider; + + public class ProviderController : ApiController { + private static readonly IOpenIdApplicationStore store = new StandardProviderApplicationStore(); + + private MainWindow MainWindow { + get { return MainWindow.Instance; } + } + + public Task<HttpResponseMessage> Get() { + return this.HandleAsync(); + } + + public Task<HttpResponseMessage> Post() { + return this.HandleAsync(); + } + + private async Task<HttpResponseMessage> HandleAsync() { + var provider = new OpenIdProvider(store); + IRequest request = await provider.GetRequestAsync(this.Request); + if (request == null) { + App.Logger.Error("A request came in that did not carry an OpenID message."); + return new HttpResponseMessage(HttpStatusCode.BadRequest) { + Content = new StringContent("<html><body>This is an OpenID Provider endpoint.</body></html>", Encoding.UTF8, "text/html"), + }; + } + + return await await this.MainWindow.Dispatcher.InvokeAsync(async delegate { + if (!request.IsResponseReady) { + var authRequest = request as IAuthenticationRequest; + if (authRequest != null) { + string userIdentityPageBase = this.Url.Link("default", new { controller = "user" }) + "/"; + var userIdentityPageBaseUri = new Uri(userIdentityPageBase); + switch (this.MainWindow.checkidRequestList.SelectedIndex) { + case 0: + if (authRequest.IsDirectedIdentity) { + if (this.MainWindow.capitalizedHostName.IsChecked.Value) { + userIdentityPageBase = (userIdentityPageBaseUri.Scheme + Uri.SchemeDelimiter + userIdentityPageBaseUri.Authority).ToUpperInvariant() + userIdentityPageBaseUri.PathAndQuery; + } + string leafPath = "directedidentity"; + if (this.MainWindow.directedIdentityTrailingPeriodsCheckbox.IsChecked.Value) { + leafPath += "."; + } + authRequest.ClaimedIdentifier = Identifier.Parse(userIdentityPageBase + leafPath, true); + authRequest.LocalIdentifier = authRequest.ClaimedIdentifier; + } + authRequest.IsAuthenticated = true; + break; + case 1: + authRequest.IsAuthenticated = false; + break; + case 2: + IntPtr oldForegroundWindow = NativeMethods.GetForegroundWindow(); + bool stoleFocus = NativeMethods.SetForegroundWindow(this.MainWindow); + await CheckIdWindow.ProcessAuthenticationAsync(userIdentityPageBaseUri, authRequest, CancellationToken.None); + if (stoleFocus) { + NativeMethods.SetForegroundWindow(oldForegroundWindow); + } + break; + } + } + } + + var responseMessage = await provider.PrepareResponseAsync(request); + return responseMessage; + }); + } + } +} diff --git a/samples/OpenIdOfflineProvider/Controllers/UserController.cs b/samples/OpenIdOfflineProvider/Controllers/UserController.cs new file mode 100644 index 0000000..9385b7f --- /dev/null +++ b/samples/OpenIdOfflineProvider/Controllers/UserController.cs @@ -0,0 +1,49 @@ +namespace DotNetOpenAuth.OpenIdOfflineProvider.Controllers { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Net.Http; + using System.Text; + using System.Threading.Tasks; + using System.Web.Http; + + using Validation; + + public class UserController : ApiController { + public HttpResponseMessage Get(string id) { + string localId = null; // string.Format("http://localhost:{0}/user", context.Request.Url.Port); + var opEndpoint = this.Url.Link("default", new { controller = "provider" }); + var opEndpointUri = new Uri(opEndpoint); + return new HttpResponseMessage() { + Content = new StringContent(GenerateHtmlDiscoveryDocument(opEndpointUri, localId), Encoding.UTF8, "text/html"), + }; + } + + /// <summary> + /// Generates HTML for an identity page. + /// </summary> + /// <param name="providerEndpoint">The provider endpoint.</param> + /// <param name="localId">The local id.</param> + /// <returns>The HTML document to return to the RP.</returns> + private static string GenerateHtmlDiscoveryDocument(Uri providerEndpoint, string localId) { + Requires.NotNull(providerEndpoint, "providerEndpoint"); + + const string DelegatedHtmlDiscoveryFormat = @"<html><head> + <link rel=""openid.server"" href=""{0}"" /> + <link rel=""openid.delegate"" href=""{1}"" /> + <link rel=""openid2.provider"" href=""{0}"" /> + <link rel=""openid2.local_id"" href=""{1}"" /> + </head><body></body></html>"; + + const string NonDelegatedHtmlDiscoveryFormat = @"<html><head> + <link rel=""openid.server"" href=""{0}"" /> + <link rel=""openid2.provider"" href=""{0}"" /> + </head><body></body></html>"; + + return string.Format( + localId != null ? DelegatedHtmlDiscoveryFormat : NonDelegatedHtmlDiscoveryFormat, + providerEndpoint.AbsoluteUri, + localId); + } + } +} diff --git a/samples/OpenIdOfflineProvider/HostedProvider.cs b/samples/OpenIdOfflineProvider/HostedProvider.cs deleted file mode 100644 index 3c7692d..0000000 --- a/samples/OpenIdOfflineProvider/HostedProvider.cs +++ /dev/null @@ -1,254 +0,0 @@ -//----------------------------------------------------------------------- -// <copyright file="HostedProvider.cs" company="Outercurve Foundation"> -// Copyright (c) Outercurve Foundation. All rights reserved. -// </copyright> -//----------------------------------------------------------------------- - -namespace DotNetOpenAuth.OpenIdOfflineProvider { - using System; - using System.Collections.Generic; - using System.IO; - using System.Linq; - using System.Net; - using System.Web; - - using DotNetOpenAuth.Messaging; - using DotNetOpenAuth.OpenId.Provider; - using log4net; - using Validation; - - /// <summary> - /// The OpenID Provider host. - /// </summary> - internal class HostedProvider : IDisposable { - /// <summary> - /// The path to the Provider Endpoint. - /// </summary> - private const string ProviderPath = "/provider"; - - /// <summary> - /// The path to the OP Identifier. - /// </summary> - private const string OPIdentifierPath = "/"; - - /// <summary> - /// The URL path with which all user identities must start. - /// </summary> - private const string UserIdentifierPath = "/user/"; - - /// <summary> - /// The <see cref="OpenIdProvider"/> instance that processes incoming requests. - /// </summary> - private OpenIdProvider provider = new OpenIdProvider(new StandardProviderApplicationStore()); - - /// <summary> - /// The HTTP listener that acts as the OpenID Provider socket. - /// </summary> - private HttpHost httpHost; - - /// <summary> - /// Initializes a new instance of the <see cref="HostedProvider"/> class. - /// </summary> - internal HostedProvider() { - } - - /// <summary> - /// Gets a value indicating whether this instance is running. - /// </summary> - /// <value> - /// <c>true</c> if this instance is running; otherwise, <c>false</c>. - /// </value> - internal bool IsRunning { - get { return this.httpHost != null; } - } - - /// <summary> - /// Gets the <see cref="OpenIdProvider"/> instance that processes incoming requests. - /// </summary> - internal OpenIdProvider Provider { - get { return this.provider; } - } - - /// <summary> - /// Gets or sets the delegate that handles authentication requests. - /// </summary> - internal Action<HttpRequestBase, HttpListenerResponse> ProcessRequest { get; set; } - - /// <summary> - /// Gets the provider endpoint. - /// </summary> - internal Uri ProviderEndpoint { - get { - Assumes.True(this.IsRunning); - return new Uri(this.httpHost.BaseUri, ProviderPath); - } - } - - /// <summary> - /// Gets the base URI that all user identities must start with. - /// </summary> - internal Uri UserIdentityPageBase { - get { - Assumes.True(this.IsRunning); - return new Uri(this.httpHost.BaseUri, UserIdentifierPath); - } - } - - /// <summary> - /// Gets the OP identifier. - /// </summary> - internal Uri OPIdentifier { - get { - Assumes.True(this.IsRunning); - return new Uri(this.httpHost.BaseUri, OPIdentifierPath); - } - } - - /// <summary> - /// Performs application-defined tasks associated with freeing, releasing, or resetting unmanaged resources. - /// </summary> - public void Dispose() { - this.Dispose(true); - } - - /// <summary> - /// Starts the provider. - /// </summary> - internal void StartProvider() { - this.httpHost = HttpHost.CreateHost(this.RequestHandler); - } - - /// <summary> - /// Stops the provider. - /// </summary> - internal void StopProvider() { - if (this.httpHost != null) { - this.httpHost.Dispose(); - this.httpHost = null; - } - } - - #region IDisposable Members - - /// <summary> - /// Releases unmanaged and - optionally - managed resources - /// </summary> - /// <param name="disposing"><c>true</c> to release both managed and unmanaged resources; <c>false</c> to release only unmanaged resources.</param> - protected virtual void Dispose(bool disposing) { - if (disposing) { - var host = this.httpHost as IDisposable; - if (host != null) { - host.Dispose(); - } - - this.httpHost = null; - } - } - - #endregion - - /// <summary> - /// Generates HTML for an identity page. - /// </summary> - /// <param name="providerEndpoint">The provider endpoint.</param> - /// <param name="localId">The local id.</param> - /// <returns>The HTML document to return to the RP.</returns> - private static string GenerateHtmlDiscoveryDocument(Uri providerEndpoint, string localId) { - Requires.NotNull(providerEndpoint, "providerEndpoint"); - - const string DelegatedHtmlDiscoveryFormat = @"<html><head> - <link rel=""openid.server"" href=""{0}"" /> - <link rel=""openid.delegate"" href=""{1}"" /> - <link rel=""openid2.provider"" href=""{0}"" /> - <link rel=""openid2.local_id"" href=""{1}"" /> - </head><body></body></html>"; - - const string NonDelegatedHtmlDiscoveryFormat = @"<html><head> - <link rel=""openid.server"" href=""{0}"" /> - <link rel=""openid2.provider"" href=""{0}"" /> - </head><body></body></html>"; - - return string.Format( - localId != null ? DelegatedHtmlDiscoveryFormat : NonDelegatedHtmlDiscoveryFormat, - providerEndpoint.AbsoluteUri, - localId); - } - - /// <summary> - /// Generates the OP Identifier XRDS document. - /// </summary> - /// <param name="providerEndpoint">The provider endpoint.</param> - /// <param name="supportedExtensions">The supported extensions.</param> - /// <returns>The content of the XRDS document.</returns> - private static string GenerateXrdsOPIdentifierDocument(Uri providerEndpoint, IEnumerable<string> supportedExtensions) { - Requires.NotNull(providerEndpoint, "providerEndpoint"); - Requires.NotNull(supportedExtensions, "supportedExtensions"); - - const string OPIdentifierDiscoveryFormat = @"<xrds:XRDS - xmlns:xrds='xri://$xrds' - xmlns:openid='http://openid.net/xmlns/1.0' - xmlns='xri://$xrd*($v*2.0)'> - <XRD> - <Service priority='10'> - <Type>http://specs.openid.net/auth/2.0/server</Type> - {1} - <URI>{0}</URI> - </Service> - </XRD> -</xrds:XRDS>"; - - string extensions = string.Join( - "\n\t\t\t", - supportedExtensions.Select(ext => "<Type>" + ext + "</Type>").ToArray()); - return string.Format( - OPIdentifierDiscoveryFormat, - providerEndpoint.AbsoluteUri, - extensions); - } - - /// <summary> - /// Handles incoming HTTP requests. - /// </summary> - /// <param name="context">The HttpListener context.</param> - private void RequestHandler(HttpListenerContext context) { - Requires.NotNull(context, "context"); - Requires.NotNull(context.Response.OutputStream, "context.Response.OutputStream"); - Requires.NotNull(this.ProcessRequest, "this.ProcessRequest"); - - Stream outputStream = context.Response.OutputStream; - Assumes.True(outputStream != null); // CC static verification shortcoming. - - UriBuilder providerEndpointBuilder = new UriBuilder(); - providerEndpointBuilder.Scheme = Uri.UriSchemeHttp; - providerEndpointBuilder.Host = "localhost"; - providerEndpointBuilder.Port = context.Request.Url.Port; - providerEndpointBuilder.Path = ProviderPath; - Uri providerEndpoint = providerEndpointBuilder.Uri; - - if (context.Request.Url.AbsolutePath == ProviderPath) { - HttpRequestBase requestInfo = HttpRequestInfo.Create(context.Request); - this.ProcessRequest(requestInfo, context.Response); - } else if (context.Request.Url.AbsolutePath.StartsWith(UserIdentifierPath, StringComparison.Ordinal)) { - using (StreamWriter sw = new StreamWriter(outputStream)) { - context.Response.StatusCode = (int)HttpStatusCode.OK; - - string localId = null; // string.Format("http://localhost:{0}/user", context.Request.Url.Port); - string html = GenerateHtmlDiscoveryDocument(providerEndpoint, localId); - sw.WriteLine(html); - } - context.Response.OutputStream.Close(); - } else if (context.Request.Url == this.OPIdentifier) { - context.Response.ContentType = "application/xrds+xml"; - context.Response.StatusCode = (int)HttpStatusCode.OK; - App.Logger.Info("Discovery on OP Identifier detected."); - using (StreamWriter sw = new StreamWriter(outputStream)) { - sw.Write(GenerateXrdsOPIdentifierDocument(providerEndpoint, Enumerable.Empty<string>())); - } - context.Response.OutputStream.Close(); - } else { - context.Response.StatusCode = (int)HttpStatusCode.NotFound; - context.Response.OutputStream.Close(); - } - } - } -} diff --git a/samples/OpenIdOfflineProvider/HttpHost.cs b/samples/OpenIdOfflineProvider/HttpHost.cs deleted file mode 100644 index 3eb0884..0000000 --- a/samples/OpenIdOfflineProvider/HttpHost.cs +++ /dev/null @@ -1,139 +0,0 @@ -//----------------------------------------------------------------------- -// <copyright file="HttpHost.cs" company="Outercurve Foundation"> -// Copyright (c) Outercurve Foundation. All rights reserved. -// </copyright> -//----------------------------------------------------------------------- - -namespace DotNetOpenAuth.OpenIdOfflineProvider { - using System; - using System.Globalization; - using System.IO; - using System.Net; - using System.Threading; - using DotNetOpenAuth.Messaging; - using DotNetOpenAuth.OpenId.Provider; - using Validation; - - /// <summary> - /// An HTTP Listener that dispatches incoming requests for handling. - /// </summary> - internal class HttpHost : IDisposable { - /// <summary> - /// The HttpListener that waits for incoming requests. - /// </summary> - private readonly HttpListener listener; - - /// <summary> - /// The thread that listens for incoming HTTP requests and dispatches them - /// to the <see cref="handler"/>. - /// </summary> - private Thread listenerThread; - - /// <summary> - /// The handler for incoming HTTP requests. - /// </summary> - private RequestHandler handler; - - /// <summary> - /// Initializes a new instance of the <see cref="HttpHost"/> class. - /// </summary> - /// <param name="handler">The handler for incoming HTTP requests.</param> - private HttpHost(RequestHandler handler) { - Requires.NotNull(handler, "handler"); - - this.Port = 45235; - this.handler = handler; - Random r = new Random(); - tryAgain: - try { - this.listener = new HttpListener(); - this.listener.Prefixes.Add(string.Format(CultureInfo.InvariantCulture, "http://localhost:{0}/", this.Port)); - this.listener.Start(); - } catch (HttpListenerException ex) { - if (ex.Message.Contains("conflicts")) { - this.Port += r.Next(1, 20); - goto tryAgain; - } - throw; - } - - this.listenerThread = new Thread(this.ProcessRequests); - this.listenerThread.Start(); - } - - /// <summary> - /// The request handler delegate. - /// </summary> - /// <param name="context">Information on the incoming HTTP request.</param> - internal delegate void RequestHandler(HttpListenerContext context); - - /// <summary> - /// Gets the port that HTTP requests are being listened for on. - /// </summary> - public int Port { get; private set; } - - /// <summary> - /// Gets the base URI for all incoming web requests that will be received. - /// </summary> - public Uri BaseUri { - get { return new Uri("http://localhost:" + this.Port.ToString() + "/"); } - } - - /// <summary> - /// Creates the HTTP host. - /// </summary> - /// <param name="handler">The handler for incoming HTTP requests.</param> - /// <returns>The instantiated host.</returns> - public static HttpHost CreateHost(RequestHandler handler) { - Requires.NotNull(handler, "handler"); - - return new HttpHost(handler); - } - - #region IDisposable Members - - /// <summary> - /// Performs application-defined tasks associated with freeing, releasing, or resetting unmanaged resources. - /// </summary> - public void Dispose() { - this.Dispose(true); - GC.SuppressFinalize(this); - } - - /// <summary> - /// Releases unmanaged and - optionally - managed resources - /// </summary> - /// <param name="disposing"><c>true</c> to release both managed and unmanaged resources; <c>false</c> to release only unmanaged resources.</param> - protected virtual void Dispose(bool disposing) { - if (disposing) { - this.listener.Close(); - this.listenerThread.Join(1000); - this.listenerThread.Abort(); - } - } - - #endregion - - /// <summary> - /// The HTTP listener thread body. - /// </summary> - private void ProcessRequests() { - Assumes.True(this.listener != null); - - while (true) { - try { - HttpListenerContext context = this.listener.GetContext(); - this.handler(context); - } catch (HttpListenerException ex) { - if (this.listener.IsListening) { - App.Logger.Error("Unexpected exception.", ex); - } else { - // the listener is probably being shut down - App.Logger.Warn("HTTP listener is closing down.", ex); - break; - } - } - } - } - } -} diff --git a/samples/OpenIdOfflineProvider/MainWindow.xaml.cs b/samples/OpenIdOfflineProvider/MainWindow.xaml.cs index 30847d0..2297a2a 100644 --- a/samples/OpenIdOfflineProvider/MainWindow.xaml.cs +++ b/samples/OpenIdOfflineProvider/MainWindow.xaml.cs @@ -12,9 +12,16 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { using System.IO; using System.Linq; using System.Net; + using System.Net.Http; + using System.Net.Http.Headers; using System.Runtime.InteropServices; + using System.ServiceModel; using System.Text; + using System.Threading; + using System.Threading.Tasks; using System.Web; + using System.Web.Http.Routing; + using System.Web.Http.SelfHost; using System.Windows; using System.Windows.Controls; using System.Windows.Data; @@ -30,35 +37,40 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { using log4net; using log4net.Appender; using log4net.Core; + using Validation; + + using System.Web.Http; /// <summary> /// Interaction logic for MainWindow.xaml /// </summary> public partial class MainWindow : Window, IDisposable { /// <summary> - /// The OpenID Provider host object. + /// The logger the application may use. /// </summary> - private HostedProvider hostedProvider = new HostedProvider(); + private ILog logger = log4net.LogManager.GetLogger(typeof(MainWindow)); /// <summary> - /// The logger the application may use. + /// The HTTP listener that acts as the OpenID Provider socket. /// </summary> - private ILog logger = log4net.LogManager.GetLogger(typeof(MainWindow)); + private HttpSelfHostServer hostServer; /// <summary> /// Initializes a new instance of the <see cref="MainWindow"/> class. /// </summary> public MainWindow() { this.InitializeComponent(); - this.hostedProvider.ProcessRequest = this.ProcessRequest; TextWriterAppender boxLogger = log4net.LogManager.GetRepository().GetAppenders().OfType<TextWriterAppender>().FirstOrDefault(a => a.Name == "TextBoxAppender"); if (boxLogger != null) { boxLogger.Writer = new TextBoxTextWriter(this.logBox); } - this.startProvider(); + Instance = this; + this.StartProviderAsync(); } + internal static MainWindow Instance; + #region IDisposable Members /// <summary> @@ -74,12 +86,11 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { /// <param name="disposing"><c>true</c> to release both managed and unmanaged resources; <c>false</c> to release only unmanaged resources.</param> protected virtual void Dispose(bool disposing) { if (disposing) { - var host = this.hostedProvider as IDisposable; - if (host != null) { - host.Dispose(); + if (this.hostServer != null) { + this.hostServer.Dispose(); } - this.hostedProvider = null; + this.hostServer = null; } } @@ -90,80 +101,33 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { /// </summary> /// <param name="e">The <see cref="System.ComponentModel.CancelEventArgs"/> instance containing the event data.</param> protected override void OnClosing(System.ComponentModel.CancelEventArgs e) { - this.stopProvider(); + this.StopProviderAsync(); base.OnClosing(e); } /// <summary> - /// Processes an incoming request at the OpenID Provider endpoint. + /// Adds a set of HTTP headers to an <see cref="HttpResponse"/> instance, + /// taking care to set some headers to the appropriate properties of + /// <see cref="HttpResponse" /> /// </summary> - /// <param name="requestInfo">The request info.</param> - /// <param name="response">The response.</param> - private void ProcessRequest(HttpRequestBase requestInfo, HttpListenerResponse response) { - IRequest request = this.hostedProvider.Provider.GetRequest(requestInfo); - if (request == null) { - App.Logger.Error("A request came in that did not carry an OpenID message."); - response.ContentType = "text/html"; - response.StatusCode = (int)HttpStatusCode.BadRequest; - using (StreamWriter sw = new StreamWriter(response.OutputStream)) { - sw.WriteLine("<html><body>This is an OpenID Provider endpoint.</body></html>"); + /// <param name="headers">The headers to add.</param> + /// <param name="response">The <see cref="HttpListenerResponse"/> instance to set the appropriate values to.</param> + private static void ApplyHeadersToResponse(HttpResponseHeaders headers, HttpListenerResponse response) { + Requires.NotNull(headers, "headers"); + Requires.NotNull(response, "response"); + + foreach (var header in headers) { + switch (header.Key) { + case "Content-Type": + response.ContentType = header.Value.First(); + break; + + // Add more special cases here as necessary. + default: + response.AddHeader(header.Key, header.Value.First()); + break; } - return; } - - this.Dispatcher.Invoke((Action)delegate { - if (!request.IsResponseReady) { - var authRequest = request as IAuthenticationRequest; - if (authRequest != null) { - switch (this.checkidRequestList.SelectedIndex) { - case 0: - if (authRequest.IsDirectedIdentity) { - string userIdentityPageBase = this.hostedProvider.UserIdentityPageBase.AbsoluteUri; - if (this.capitalizedHostName.IsChecked.Value) { - userIdentityPageBase = (this.hostedProvider.UserIdentityPageBase.Scheme + Uri.SchemeDelimiter + this.hostedProvider.UserIdentityPageBase.Authority).ToUpperInvariant() + this.hostedProvider.UserIdentityPageBase.PathAndQuery; - } - string leafPath = "directedidentity"; - if (this.directedIdentityTrailingPeriodsCheckbox.IsChecked.Value) { - leafPath += "."; - } - authRequest.ClaimedIdentifier = Identifier.Parse(userIdentityPageBase + leafPath, true); - authRequest.LocalIdentifier = authRequest.ClaimedIdentifier; - } - authRequest.IsAuthenticated = true; - break; - case 1: - authRequest.IsAuthenticated = false; - break; - case 2: - IntPtr oldForegroundWindow = NativeMethods.GetForegroundWindow(); - bool stoleFocus = NativeMethods.SetForegroundWindow(this); - CheckIdWindow.ProcessAuthentication(this.hostedProvider, authRequest); - if (stoleFocus) { - NativeMethods.SetForegroundWindow(oldForegroundWindow); - } - break; - } - } - } - }); - - this.hostedProvider.Provider.PrepareResponse(request).Send(response); - } - - /// <summary> - /// Starts the provider. - /// </summary> - private void startProvider() { - this.hostedProvider.StartProvider(); - this.opIdentifierLabel.Content = this.hostedProvider.OPIdentifier; - } - - /// <summary> - /// Stops the provider. - /// </summary> - private void stopProvider() { - this.hostedProvider.StopProvider(); - this.opIdentifierLabel.Content = string.Empty; } /// <summary> @@ -187,5 +151,62 @@ namespace DotNetOpenAuth.OpenIdOfflineProvider { private void ClearLogButton_Click(object sender, RoutedEventArgs e) { this.logBox.Clear(); } + + /// <summary> + /// Starts the provider. + /// </summary> + private async Task StartProviderAsync() { + Exception exception = null; + try { + Verify.Operation(this.hostServer == null, "Server already started."); + + int port = 45235; + var baseUri = new UriBuilder("http", "localhost", port); + var configuration = new HttpSelfHostConfiguration(baseUri.Uri); + configuration.Routes.MapHttpRoute("default", "{controller}/{id}", new { controller = "Home", id = RouteParameter.Optional }); + try { + var hostServer = new HttpSelfHostServer(configuration); + await hostServer.OpenAsync(); + this.hostServer = hostServer; + } catch (AddressAccessDeniedException ex) { + // If this throws an exception, use an elevated command prompt and execute: + // netsh http add urlacl url=http://+:45235/ user=YOUR_USERNAME_HERE + string message = string.Format( + CultureInfo.CurrentCulture, + "Use an elevated command prompt and execute: \nnetsh http add urlacl url=http://+:{0}/ user={1}\\{2}", + port, + Environment.UserDomainName, + Environment.UserName); + throw new InvalidOperationException(message, ex); + } + + this.opIdentifierLabel.Content = baseUri.Uri.AbsoluteUri; + } catch (InvalidOperationException ex) { + exception = ex; + } + + if (exception != null) { + if (MessageBox.Show(exception.Message, "Configuration error", MessageBoxButton.OKCancel, MessageBoxImage.Error) + == MessageBoxResult.OK) { + await this.StartProviderAsync(); + return; + } else { + this.Close(); + } + } + } + + /// <summary> + /// Stops the provider. + /// </summary> + private async Task StopProviderAsync() { + if (this.hostServer != null) { + await this.hostServer.CloseAsync(); + this.hostServer.Dispose(); + this.hostServer = null; + } + + this.opIdentifierLabel.Content = string.Empty; + } } } diff --git a/samples/OpenIdOfflineProvider/OpenIdOfflineProvider.csproj b/samples/OpenIdOfflineProvider/OpenIdOfflineProvider.csproj index 56bc5b6..4f79942 100644 --- a/samples/OpenIdOfflineProvider/OpenIdOfflineProvider.csproj +++ b/samples/OpenIdOfflineProvider/OpenIdOfflineProvider.csproj @@ -42,6 +42,7 @@ <ApplicationVersion>1.0.0.%2a</ApplicationVersion> <UseApplicationTrust>false</UseApplicationTrust> <BootstrapperEnabled>true</BootstrapperEnabled> + <UltimateResourceFallbackLocation>UltimateResourceFallbackLocation.Satellite</UltimateResourceFallbackLocation> </PropertyGroup> <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> <DebugSymbols>true</DebugSymbols> @@ -60,15 +61,30 @@ <CodeAnalysisRuleSet>AllRules.ruleset</CodeAnalysisRuleSet> </PropertyGroup> <ItemGroup> - <Reference Include="log4net, Version=1.2.10.0, Culture=neutral, PublicKeyToken=1b44e1d426115821, processorArchitecture=MSIL"> + <Reference Include="log4net, Version=1.2.11.0, Culture=neutral, PublicKeyToken=669e0ddf0bb1aa2a, processorArchitecture=MSIL"> <SpecificVersion>False</SpecificVersion> - <HintPath>..\..\lib\log4net.dll</HintPath> + <HintPath>..\..\src\packages\log4net.2.0.0\lib\net40-full\log4net.dll</HintPath> + </Reference> + <Reference Include="Newtonsoft.Json"> + <HintPath>..\..\src\packages\Newtonsoft.Json.4.5.11\lib\net40\Newtonsoft.Json.dll</HintPath> </Reference> <Reference Include="System" /> <Reference Include="System.Core"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.Formatting, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.Client.4.0.20710.0\lib\net40\System.Net.Http.Formatting.dll</HintPath> + </Reference> + <Reference Include="System.Net.Http.WebRequest" /> + <Reference Include="System.ServiceModel" /> <Reference Include="System.Web" /> + <Reference Include="System.Web.Http, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.Core.4.0.20710.0\lib\net40\System.Web.Http.dll</HintPath> + </Reference> + <Reference Include="System.Web.Http.SelfHost, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebApi.SelfHost.4.0.20918.0\lib\net40\System.Web.Http.SelfHost.dll</HintPath> + </Reference> <Reference Include="System.Xml.Linq"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> @@ -80,9 +96,9 @@ <Reference Include="UIAutomationProvider"> <RequiredTargetFramework>3.0</RequiredTargetFramework> </Reference> - <Reference Include="Validation"> - <HintPath>..\..\src\packages\Validation.2.0.1.12362\lib\portable-windows8+net40+sl5+windowsphone8\Validation.dll</HintPath> - <Private>True</Private> + <Reference Include="Validation, Version=2.0.0.0, Culture=neutral, PublicKeyToken=2fc06f0d701809a7, processorArchitecture=MSIL"> + <SpecificVersion>False</SpecificVersion> + <HintPath>..\..\src\packages\Validation.2.0.2.13022\lib\portable-windows8+net40+sl5+windowsphone8\Validation.dll</HintPath> </Reference> <Reference Include="WindowsBase"> <RequiredTargetFramework>3.0</RequiredTargetFramework> @@ -101,20 +117,17 @@ <ApplicationDefinition Include="App.xaml"> <Generator>MSBuild:Compile</Generator> <SubType>Designer</SubType> - <Generator>MSBuild:Compile</Generator> - <SubType>Designer</SubType> </ApplicationDefinition> + <Compile Include="Controllers\HomeController.cs" /> + <Compile Include="Controllers\ProviderController.cs" /> + <Compile Include="Controllers\UserController.cs" /> <Page Include="CheckIdWindow.xaml"> <SubType>Designer</SubType> <Generator>MSBuild:Compile</Generator> - <Generator>MSBuild:Compile</Generator> - <SubType>Designer</SubType> </Page> <Page Include="MainWindow.xaml"> <Generator>MSBuild:Compile</Generator> <SubType>Designer</SubType> - <Generator>MSBuild:Compile</Generator> - <SubType>Designer</SubType> </Page> <Compile Include="App.xaml.cs"> <DependentUpon>App.xaml</DependentUpon> @@ -129,8 +142,6 @@ <Compile Include="CheckIdWindow.xaml.cs"> <DependentUpon>CheckIdWindow.xaml</DependentUpon> </Compile> - <Compile Include="HostedProvider.cs" /> - <Compile Include="HttpHost.cs" /> <Compile Include="NativeMethods.cs" /> <Compile Include="Properties\AssemblyInfo.cs"> <SubType>Code</SubType> diff --git a/samples/OpenIdOfflineProvider/packages.config b/samples/OpenIdOfflineProvider/packages.config index 58890d8..fd2ff83 100644 --- a/samples/OpenIdOfflineProvider/packages.config +++ b/samples/OpenIdOfflineProvider/packages.config @@ -1,4 +1,11 @@ <?xml version="1.0" encoding="utf-8"?> <packages> - <package id="Validation" version="2.0.1.12362" targetFramework="net45" /> + <package id="AspNetWebApi.SelfHost" version="4.0.20710.0" targetFramework="net45" /> + <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.Client" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.Core" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebApi.SelfHost" version="4.0.20918.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Newtonsoft.Json" version="4.5.11" targetFramework="net45" /> + <package id="Validation" version="2.0.2.13022" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OpenIdProviderMvc/Controllers/OpenIdController.cs b/samples/OpenIdProviderMvc/Controllers/OpenIdController.cs index bd6de1b..7828b5c 100644 --- a/samples/OpenIdProviderMvc/Controllers/OpenIdController.cs +++ b/samples/OpenIdProviderMvc/Controllers/OpenIdController.cs @@ -3,6 +3,7 @@ namespace OpenIdProviderMvc.Controllers { using System.Collections.Generic; using System.Linq; using System.Net; + using System.Threading.Tasks; using System.Web; using System.Web.Mvc; using System.Web.Mvc.Ajax; @@ -29,12 +30,13 @@ namespace OpenIdProviderMvc.Controllers { public IFormsAuthentication FormsAuth { get; private set; } [ValidateInput(false)] - public ActionResult Provider() { - IRequest request = OpenIdProvider.GetRequest(); + public async Task<ActionResult> Provider() { + IRequest request = await OpenIdProvider.GetRequestAsync(this.Request, this.Response.ClientDisconnectedToken); if (request != null) { // Some requests are automatically handled by DotNetOpenAuth. If this is one, go ahead and let it go. if (request.IsResponseReady) { - return OpenIdProvider.PrepareResponse(request).AsActionResult(); + var response = await OpenIdProvider.PrepareResponseAsync(request, this.Response.ClientDisconnectedToken); + return response.AsActionResult(); } // This is apparently one that the host (the web site itself) has to respond to. @@ -51,28 +53,28 @@ namespace OpenIdProviderMvc.Controllers { } } - return this.ProcessAuthRequest(); + return await this.ProcessAuthRequest(); } else { // No OpenID request was recognized. This may be a user that stumbled on the OP Endpoint. return this.View(); } } - public ActionResult ProcessAuthRequest() { + public async Task<ActionResult> ProcessAuthRequest() { if (ProviderEndpoint.PendingRequest == null) { return this.RedirectToAction("Index", "Home"); } // Try responding immediately if possible. - ActionResult response; - if (this.AutoRespondIfPossible(out response)) { + ActionResult response = await this.AutoRespondIfPossibleAsync(); + if (response != null) { return response; } // We can't respond immediately with a positive result. But if we still have to respond immediately... if (ProviderEndpoint.PendingRequest.Immediate) { // We can't stop to prompt the user -- we must just return a negative response. - return this.SendAssertion(); + return await this.SendAssertion(); } return this.RedirectToAction("AskUser"); @@ -83,15 +85,15 @@ namespace OpenIdProviderMvc.Controllers { /// </summary> /// <returns>The response for the user agent.</returns> [Authorize] - public ActionResult AskUser() { + public async Task<ActionResult> AskUser() { if (ProviderEndpoint.PendingRequest == null) { // Oops... precious little we can confirm without a pending OpenID request. return this.RedirectToAction("Index", "Home"); } // The user MAY have just logged in. Try again to respond automatically to the RP if appropriate. - ActionResult response; - if (this.AutoRespondIfPossible(out response)) { + ActionResult response = await this.AutoRespondIfPossibleAsync(); + if (response != null) { return response; } @@ -106,10 +108,9 @@ namespace OpenIdProviderMvc.Controllers { } [HttpPost, Authorize, ValidateAntiForgeryToken] - public ActionResult AskUserResponse(bool confirmed) { + public async Task<ActionResult> AskUserResponse(bool confirmed) { if (!ProviderEndpoint.PendingAuthenticationRequest.IsDirectedIdentity && - !this.UserControlsIdentifier(ProviderEndpoint.PendingAuthenticationRequest)) - { + !this.UserControlsIdentifier(ProviderEndpoint.PendingAuthenticationRequest)) { // The user shouldn't have gotten this far without controlling the identifier we'd send an assertion for. return new HttpStatusCodeResult((int)HttpStatusCode.BadRequest); } @@ -122,14 +123,14 @@ namespace OpenIdProviderMvc.Controllers { throw new InvalidOperationException("There's no pending authentication request!"); } - return this.SendAssertion(); + return await this.SendAssertion(); } /// <summary> /// Sends a positive or a negative assertion, based on how the pending request is currently marked. /// </summary> /// <returns>An MVC redirect result.</returns> - public ActionResult SendAssertion() { + public async Task<ActionResult> SendAssertion() { var pendingRequest = ProviderEndpoint.PendingRequest; var authReq = pendingRequest as IAuthenticationRequest; var anonReq = pendingRequest as IAnonymousRequest; @@ -188,17 +189,17 @@ namespace OpenIdProviderMvc.Controllers { } } - return OpenIdProvider.PrepareResponse(pendingRequest).AsActionResult(); + var response = await OpenIdProvider.PrepareResponseAsync(pendingRequest, this.Response.ClientDisconnectedToken); + return response.AsActionResult(); } /// <summary> /// Attempts to formulate an automatic response to the RP if the user's profile allows it. /// </summary> - /// <param name="response">Receives the ActionResult for the caller to return, or <c>null</c> if no automatic response can be made.</param> - /// <returns>A value indicating whether an automatic response is possible.</returns> - private bool AutoRespondIfPossible(out ActionResult response) { + /// <returns>The ActionResult for the caller to return, or <c>null</c> if no automatic response can be made.</returns> + private async Task<ActionResult> AutoRespondIfPossibleAsync() { // If the odds are good we can respond to this one immediately (without prompting the user)... - if (ProviderEndpoint.PendingRequest.IsReturnUrlDiscoverable(OpenIdProvider.Channel.WebRequestHandler) == RelyingPartyDiscoveryResult.Success + if (await ProviderEndpoint.PendingRequest.IsReturnUrlDiscoverableAsync(OpenIdProvider.Channel.HostFactories, this.Response.ClientDisconnectedToken) == RelyingPartyDiscoveryResult.Success && User.Identity.IsAuthenticated && this.HasUserAuthorizedAutoLogin(ProviderEndpoint.PendingRequest)) { // Is this is an identity authentication request? (as opposed to an anonymous request)... @@ -207,21 +208,18 @@ namespace OpenIdProviderMvc.Controllers { if (ProviderEndpoint.PendingAuthenticationRequest.IsDirectedIdentity || this.UserControlsIdentifier(ProviderEndpoint.PendingAuthenticationRequest)) { ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated = true; - response = this.SendAssertion(); - return true; + return await this.SendAssertion(); } } // If this is an anonymous request, we can respond to that too. if (ProviderEndpoint.PendingAnonymousRequest != null) { ProviderEndpoint.PendingAnonymousRequest.IsApproved = true; - response = this.SendAssertion(); - return true; + return await this.SendAssertion(); } } - response = null; - return false; + return null; } /// <summary> diff --git a/samples/OpenIdProviderMvc/OpenIdProviderMvc.csproj b/samples/OpenIdProviderMvc/OpenIdProviderMvc.csproj index 45686cd..2f64980 100644 --- a/samples/OpenIdProviderMvc/OpenIdProviderMvc.csproj +++ b/samples/OpenIdProviderMvc/OpenIdProviderMvc.csproj @@ -9,6 +9,7 @@ <IISExpressAnonymousAuthentication /> <IISExpressWindowsAuthentication /> <IISExpressUseClassicPipelineMode /> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> </PropertyGroup> <PropertyGroup> <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> @@ -45,23 +46,52 @@ <CodeAnalysisRuleSet>AllRules.ruleset</CodeAnalysisRuleSet> </PropertyGroup> <ItemGroup> + <Reference Include="Microsoft.Web.Infrastructure, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll</HintPath> + </Reference> <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web.DynamicData" /> <Reference Include="System.Web.Entity" /> <Reference Include="System.ComponentModel.DataAnnotations"> <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> <Reference Include="System.Web.Extensions" /> - <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> + <Reference Include="System.Web.Helpers, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.Helpers.dll</HintPath> + </Reference> <Reference Include="System.Web" /> <Reference Include="System.Web.ApplicationServices" Condition=" '$(TargetFrameworkVersion)' != 'v3.5' "> <RequiredTargetFramework>v4.0</RequiredTargetFramework> </Reference> <Reference Include="System.Web.Abstractions" /> + <Reference Include="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Mvc.4.0.20710.0\lib\net40\System.Web.Mvc.dll</HintPath> + </Reference> + <Reference Include="System.Web.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Razor.2.0.20715.0\lib\net40\System.Web.Razor.dll</HintPath> + </Reference> <Reference Include="System.Web.Routing" /> + <Reference Include="System.Web.WebPages, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Deployment, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Deployment.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Razor.dll</HintPath> + </Reference> <Reference Include="System.Xml" /> <Reference Include="System.Configuration" /> <Reference Include="System.Web.Services" /> @@ -143,6 +173,9 @@ <Name>DotNetOpenAuth.ApplicationBlock</Name> </ProjectReference> </ItemGroup> + <ItemGroup> + <Content Include="packages.config" /> + </ItemGroup> <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" Condition="false" /> @@ -172,4 +205,5 @@ </VisualStudio> </ProjectExtensions> <Import Project="$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))\EnlistmentInfo.targets" Condition=" '$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))' != '' " /> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> </Project>
\ No newline at end of file diff --git a/samples/OpenIdProviderMvc/Web.config b/samples/OpenIdProviderMvc/Web.config index fd8f45d..b689b41 100644 --- a/samples/OpenIdProviderMvc/Web.config +++ b/samples/OpenIdProviderMvc/Web.config @@ -56,9 +56,12 @@ <!-- Allow DotNetOpenAuth to publish usage statistics to library authors to improve the library. --> <reporting enabled="true" /> </dotNetOpenAuth> - <appSettings/> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this @@ -67,8 +70,7 @@ --> <compilation debug="true" targetFramework="4.0"> <assemblies> - <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> - <remove assembly="DotNetOpenAuth.Contracts"/> + <add assembly="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089"/> @@ -125,7 +127,7 @@ </namespaces> </pages> <httpHandlers> - <add verb="*" path="*.mvc" validate="false" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> + <add verb="*" path="*.mvc" validate="false" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> </httpHandlers> </system.web> <system.web.extensions/> @@ -139,17 +141,15 @@ <handlers> <remove name="MvcHttpHandler"/> <remove name="UrlRoutingHandler"/> - <add name="MvcHttpHandler" preCondition="integratedMode" verb="*" path="*.mvc" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> + <add name="MvcHttpHandler" preCondition="integratedMode" verb="*" path="*.mvc" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> </handlers> </system.webServer> <runtime> <legacyHMACWarning enabled="0"/> - <!-- When targeting ASP.NET MVC 3, this assemblyBinding makes MVC 1 and 2 references relink - to MVC 3 so libraries such as DotNetOpenAuth that compile against MVC 1 will work with it. --> <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> <dependentAssembly> <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35"/> - <bindingRedirect oldVersion="1.0.0.0-3.0.0.0" newVersion="3.0.0.0"/> + <bindingRedirect oldVersion="1.0.0.0-4.0.0.0" newVersion="4.0.0.0"/> </dependentAssembly> </assemblyBinding> </runtime> diff --git a/samples/OpenIdProviderMvc/packages.config b/samples/OpenIdProviderMvc/packages.config new file mode 100644 index 0000000..c527bd3 --- /dev/null +++ b/samples/OpenIdProviderMvc/packages.config @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="Microsoft.AspNet.Mvc" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Razor" version="2.0.20715.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebPages" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Web.Infrastructure" version="1.0.0.0" targetFramework="net45" /> +</packages>
\ No newline at end of file diff --git a/samples/OpenIdProviderWebForms/Code/OAuthHybrid.cs b/samples/OpenIdProviderWebForms/Code/OAuthHybrid.cs index 8e64bfb..f96e87e 100644 --- a/samples/OpenIdProviderWebForms/Code/OAuthHybrid.cs +++ b/samples/OpenIdProviderWebForms/Code/OAuthHybrid.cs @@ -37,8 +37,8 @@ namespace OpenIdProviderWebForms.Code { internal static ServiceProviderOpenIdProvider ServiceProvider { get; private set; } - internal static ServiceProviderDescription GetServiceDescription() { - return new ServiceProviderDescription { + internal static ServiceProviderHostDescription GetServiceDescription() { + return new ServiceProviderHostDescription { TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, }; } diff --git a/samples/OpenIdProviderWebForms/Code/Util.cs b/samples/OpenIdProviderWebForms/Code/Util.cs index deff447..5333124 100644 --- a/samples/OpenIdProviderWebForms/Code/Util.cs +++ b/samples/OpenIdProviderWebForms/Code/Util.cs @@ -6,11 +6,13 @@ namespace OpenIdProviderWebForms.Code { using System; + using System.Threading; + using System.Threading.Tasks; using System.Web; using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.Provider; - public class Util { + public static class Util { public static string ExtractUserName(Uri url) { return url.Segments[url.Segments.Length - 1]; } @@ -52,7 +54,7 @@ namespace OpenIdProviderWebForms.Code { // add extension responses here. } } else { - HttpContext.Current.Response.Redirect("~/decide.aspx", true); + HttpContext.Current.Response.Redirect("~/decide.aspx", false); } } @@ -68,8 +70,35 @@ namespace OpenIdProviderWebForms.Code { // These would typically be filled in from a user database } } else { - HttpContext.Current.Response.Redirect("~/decide.aspx", true); + HttpContext.Current.Response.Redirect("~/decide.aspx", false); } } + + internal static Task ToApm(this Task task, AsyncCallback callback, object state) { + if (task == null) { + throw new ArgumentNullException("task"); + } + + var tcs = new TaskCompletionSource<object>(state); + task.ContinueWith( + t => { + if (t.IsFaulted) { + tcs.TrySetException(t.Exception.InnerExceptions); + } else if (t.IsCanceled) { + tcs.TrySetCanceled(); + } else { + tcs.TrySetResult(null); + } + + if (callback != null) { + callback(tcs.Task); + } + }, + CancellationToken.None, + TaskContinuationOptions.None, + TaskScheduler.Default); + + return tcs.Task; + } } }
\ No newline at end of file diff --git a/samples/OpenIdProviderWebForms/Default.aspx b/samples/OpenIdProviderWebForms/Default.aspx index 4f9e4bc..dfa056c 100644 --- a/samples/OpenIdProviderWebForms/Default.aspx +++ b/samples/OpenIdProviderWebForms/Default.aspx @@ -1,5 +1,5 @@ <%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/Site.Master" CodeBehind="Default.aspx.cs" - Inherits="OpenIdProviderWebForms._default" %> + Inherits="OpenIdProviderWebForms._default" Async="true" %> <%@ Import Namespace="OpenIdProviderWebForms.Code" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.UI" Namespace="DotNetOpenAuth.OpenId" TagPrefix="openid" %> diff --git a/samples/OpenIdProviderWebForms/Default.aspx.cs b/samples/OpenIdProviderWebForms/Default.aspx.cs index 4843639..5d27251 100644 --- a/samples/OpenIdProviderWebForms/Default.aspx.cs +++ b/samples/OpenIdProviderWebForms/Default.aspx.cs @@ -1,6 +1,8 @@ namespace OpenIdProviderWebForms { using System; + using System.Threading.Tasks; using System.Web.Security; + using System.Web.UI; using System.Web.UI.WebControls; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId; @@ -12,32 +14,42 @@ /// </summary> public partial class _default : System.Web.UI.Page { protected void Page_Load(object sender, EventArgs e) { - if (Request.QueryString["rp"] != null) { - if (Page.User.Identity.IsAuthenticated) { - this.SendAssertion(Request.QueryString["rp"]); - } else { - FormsAuthentication.RedirectToLoginPage(); - } - } else { - TextBox relyingPartySite = (TextBox)this.loginView.FindControl("relyingPartySite"); - if (relyingPartySite != null) { - relyingPartySite.Focus(); - } - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (Request.QueryString["rp"] != null) { + if (Page.User.Identity.IsAuthenticated) { + await this.SendAssertionAsync(Request.QueryString["rp"]); + } else { + FormsAuthentication.RedirectToLoginPage(); + } + } else { + TextBox relyingPartySite = (TextBox)this.loginView.FindControl("relyingPartySite"); + if (relyingPartySite != null) { + relyingPartySite.Focus(); + } + } + })); } - protected void sendAssertionButton_Click(object sender, EventArgs e) { - TextBox relyingPartySite = (TextBox)this.loginView.FindControl("relyingPartySite"); - this.SendAssertion(relyingPartySite.Text); + protected async void sendAssertionButton_Click(object sender, EventArgs e) { + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + TextBox relyingPartySite = (TextBox)this.loginView.FindControl("relyingPartySite"); + await this.SendAssertionAsync(relyingPartySite.Text); + })); } - private void SendAssertion(string relyingPartyRealm) { + private async Task SendAssertionAsync(string relyingPartyRealm) { Uri providerEndpoint = new Uri(Request.Url, Page.ResolveUrl("~/server.aspx")); OpenIdProvider op = new OpenIdProvider(); try { // Send user input through identifier parser so we accept more free-form input. string rpSite = Identifier.Parse(relyingPartyRealm); - op.PrepareUnsolicitedAssertion(providerEndpoint, rpSite, Util.BuildIdentityUrl(), Util.BuildIdentityUrl()).Send(); + var response = await op.PrepareUnsolicitedAssertionAsync(providerEndpoint, rpSite, Util.BuildIdentityUrl(), Util.BuildIdentityUrl()); + await response.SendAsync(); + this.Context.Response.End(); } catch (ProtocolException ex) { Label errorLabel = (Label)this.loginView.FindControl("errorLabel"); errorLabel.Visible = true; diff --git a/samples/OpenIdProviderWebForms/OpenIdProviderWebForms.csproj b/samples/OpenIdProviderWebForms/OpenIdProviderWebForms.csproj index 23d73d9..1ff3f44 100644 --- a/samples/OpenIdProviderWebForms/OpenIdProviderWebForms.csproj +++ b/samples/OpenIdProviderWebForms/OpenIdProviderWebForms.csproj @@ -69,6 +69,8 @@ <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web" /> <Reference Include="System.Web.DynamicData" /> <Reference Include="System.Web.Entity" /> @@ -249,7 +251,7 @@ <VisualStudio> <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> <WebProjectProperties> - <UseIIS>True</UseIIS> + <UseIIS>False</UseIIS> <AutoAssignPort>False</AutoAssignPort> <DevelopmentServerPort>4860</DevelopmentServerPort> <DevelopmentServerVPath>/</DevelopmentServerVPath> diff --git a/samples/OpenIdProviderWebForms/ProfileFields.ascx.cs b/samples/OpenIdProviderWebForms/ProfileFields.ascx.cs index 6954aa6..e27f794 100644 --- a/samples/OpenIdProviderWebForms/ProfileFields.ascx.cs +++ b/samples/OpenIdProviderWebForms/ProfileFields.ascx.cs @@ -25,15 +25,15 @@ namespace OpenIdProviderWebForms { public DateTime? DateOfBirth { get { - try { - int day = Convert.ToInt32(this.dobDayDropdownlist.SelectedValue); - int month = Convert.ToInt32(this.dobMonthDropdownlist.SelectedValue); - int year = Convert.ToInt32(this.dobYearDropdownlist.SelectedValue); - DateTime newDate = new DateTime(year, month, day); + int day, month, year; + if (int.TryParse(this.dobDayDropdownlist.SelectedValue, out day) + && int.TryParse(this.dobMonthDropdownlist.SelectedValue, out month) + && int.TryParse(this.dobYearDropdownlist.SelectedValue, out year)) { + var newDate = new DateTime(year, month, day); return newDate; - } catch (Exception) { - return null; } + + return null; } set { diff --git a/samples/OpenIdProviderWebForms/Provider.ashx.cs b/samples/OpenIdProviderWebForms/Provider.ashx.cs index f8fa4a3..7022d80 100644 --- a/samples/OpenIdProviderWebForms/Provider.ashx.cs +++ b/samples/OpenIdProviderWebForms/Provider.ashx.cs @@ -1,7 +1,13 @@ namespace OpenIdProviderWebForms { + using System; + using System.Threading; + using System.Threading.Tasks; using System.Web; using System.Web.SessionState; + using DotNetOpenAuth.ApplicationBlock; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId.Provider; + using OpenIdProviderWebForms.Code; /// <summary> /// A fast OpenID message handler that responds to OpenID messages @@ -12,13 +18,14 @@ /// control to reduce the amount of source code in the web site. A typical Provider /// site will have EITHER this .ashx handler OR the .aspx page -- NOT both. /// </remarks> - public class Provider : IHttpHandler, IRequiresSessionState { - public bool IsReusable { + public class Provider : HttpAsyncHandlerBase, IRequiresSessionState { + public override bool IsReusable { get { return true; } } - public void ProcessRequest(HttpContext context) { - IRequest request = ProviderEndpoint.Provider.GetRequest(); + protected override async Task ProcessRequestAsync(HttpContext context) { + var providerEndpoint = new ProviderEndpoint(); + IRequest request = await providerEndpoint.Provider.GetRequestAsync(new HttpRequestWrapper(context.Request), context.Response.ClientDisconnectedToken); if (request != null) { // Some OpenID requests are automatable and can be responded to immediately. // But authentication requests cannot be responded to until something on @@ -51,10 +58,12 @@ // We DON'T use ProviderEndpoint.SendResponse because // that only sends responses to requests in PendingAuthenticationRequest, // but we don't set that for associate and other non-checkid requests. - ProviderEndpoint.Provider.Respond(request); + var response = await providerEndpoint.Provider.PrepareResponseAsync(request, context.Response.ClientDisconnectedToken); // Make sure that any PendingAuthenticationRequest that MAY be set is cleared. ProviderEndpoint.PendingRequest = null; + + await response.SendAsync(new HttpContextWrapper(context)); } } } diff --git a/samples/OpenIdProviderWebForms/Web.config b/samples/OpenIdProviderWebForms/Web.config index efed107..c028df1 100644 --- a/samples/OpenIdProviderWebForms/Web.config +++ b/samples/OpenIdProviderWebForms/Web.config @@ -58,20 +58,19 @@ <appSettings> <!-- Get your own Yubico API key here: https://upgrade.yubico.com/getapikey/ --> <add key="YubicoAPIKey" value="3961"/> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this affects performance, set this value to true only during development. --> - <compilation debug="true" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="true" targetFramework="4.0" /> <sessionState mode="InProc" cookieless="false"/> <membership defaultProvider="AspNetReadOnlyXmlMembershipProvider"> <providers> @@ -90,7 +89,7 @@ Medium: doesn't work unless originUrl=".*" or WebPermission.Connect is extended, and Google Apps doesn't work. Low: doesn't work because WebPermission.Connect is denied. --> - <trust level="Medium" originUrl=".*"/> + <trust level="Full" originUrl=".*"/> <pages controlRenderingCompatibilityVersion="3.5" clientIDMode="AutoID"/> </system.web> <location path="decide.aspx"> diff --git a/samples/OpenIdProviderWebForms/access_token.ashx.cs b/samples/OpenIdProviderWebForms/access_token.ashx.cs index 1e3d27c..8dccc3f 100644 --- a/samples/OpenIdProviderWebForms/access_token.ashx.cs +++ b/samples/OpenIdProviderWebForms/access_token.ashx.cs @@ -2,22 +2,31 @@ using System; using System.Collections.Generic; using System.Linq; + using System.Threading; + using System.Threading.Tasks; using System.Web; using System.Web.Services; + using DotNetOpenAuth.ApplicationBlock; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; using OpenIdProviderWebForms.Code; [WebService(Namespace = "http://tempuri.org/")] [WebServiceBinding(ConformsTo = WsiProfiles.BasicProfile1_1)] - public class access_token : IHttpHandler { - public bool IsReusable { + public class access_token : HttpAsyncHandlerBase { + public override bool IsReusable { get { return true; } } - public void ProcessRequest(HttpContext context) { - var request = OAuthHybrid.ServiceProvider.ReadAccessTokenRequest(); + protected override async Task ProcessRequestAsync(HttpContext context) { + var request = await OAuthHybrid.ServiceProvider.ReadAccessTokenRequestAsync( + new HttpRequestWrapper(context.Request), + context.Response.ClientDisconnectedToken); var response = OAuthHybrid.ServiceProvider.PrepareAccessTokenMessage(request); - OAuthHybrid.ServiceProvider.Channel.Respond(response); + var httpResponseMessage = await OAuthHybrid.ServiceProvider.Channel.PrepareResponseAsync( + response, + context.Response.ClientDisconnectedToken); + await httpResponseMessage.SendAsync(); } } } diff --git a/samples/OpenIdProviderWebForms/decide.aspx b/samples/OpenIdProviderWebForms/decide.aspx index d63364e..ddae8e7 100644 --- a/samples/OpenIdProviderWebForms/decide.aspx +++ b/samples/OpenIdProviderWebForms/decide.aspx @@ -1,5 +1,5 @@ <%@ Page Language="C#" AutoEventWireup="true" Inherits="OpenIdProviderWebForms.decide" - CodeBehind="decide.aspx.cs" MasterPageFile="~/Site.Master" %> + CodeBehind="decide.aspx.cs" MasterPageFile="~/Site.Master" Async="true" EnableSessionState="true" %> <%@ Register Src="ProfileFields.ascx" TagName="ProfileFields" TagPrefix="uc1" %> <asp:Content runat="server" ContentPlaceHolderID="Main"> diff --git a/samples/OpenIdProviderWebForms/decide.aspx.cs b/samples/OpenIdProviderWebForms/decide.aspx.cs index 8c8f927..00bdb6d 100644 --- a/samples/OpenIdProviderWebForms/decide.aspx.cs +++ b/samples/OpenIdProviderWebForms/decide.aspx.cs @@ -1,8 +1,10 @@ namespace OpenIdProviderWebForms { using System; using System.Diagnostics; + using System.Net; using System.Web.Security; using System.Web.UI; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId.Extensions.ProviderAuthenticationPolicy; using DotNetOpenAuth.OpenId.Extensions.SimpleRegistration; using DotNetOpenAuth.OpenId.Provider; @@ -13,102 +15,127 @@ namespace OpenIdProviderWebForms { /// </summary> public partial class decide : Page { protected void Page_Load(object src, EventArgs e) { - if (ProviderEndpoint.PendingRequest == null) { - Response.Redirect("~/"); - } - - this.relyingPartyVerificationResultLabel.Text = - ProviderEndpoint.PendingRequest.IsReturnUrlDiscoverable(ProviderEndpoint.Provider.Channel.WebRequestHandler) == RelyingPartyDiscoveryResult.Success ? "passed" : "failed"; + this.RegisterAsyncTask(new PageAsyncTask(async ct => { + if (ProviderEndpoint.PendingRequest == null) { + // Response.Redirect(string) throws ThreadInterruptedException, and "async void Page_Load" doesn't properly catch it. + this.Response.RedirectLocation = "/"; + this.Response.StatusCode = (int)HttpStatusCode.Redirect; + this.Context.ApplicationInstance.CompleteRequest(); + return; + } - this.realmLabel.Text = ProviderEndpoint.PendingRequest.Realm.ToString(); + this.relyingPartyVerificationResultLabel.Text = + await ProviderEndpoint.PendingRequest.IsReturnUrlDiscoverableAsync() == RelyingPartyDiscoveryResult.Success ? "passed" : "failed"; - var oauthRequest = OAuthHybrid.ServiceProvider.ReadAuthorizationRequest(ProviderEndpoint.PendingRequest); - if (oauthRequest != null) { - this.OAuthPanel.Visible = true; - } + this.realmLabel.Text = ProviderEndpoint.PendingRequest.Realm.ToString(); - if (ProviderEndpoint.PendingAuthenticationRequest != null) { - if (ProviderEndpoint.PendingAuthenticationRequest.IsDirectedIdentity) { - ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier = Code.Util.BuildIdentityUrl(); + var oauthRequest = OAuthHybrid.ServiceProvider.ReadAuthorizationRequest(ProviderEndpoint.PendingRequest); + if (oauthRequest != null) { + this.OAuthPanel.Visible = true; } - this.identityUrlLabel.Text = ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier.ToString(); - // check that the logged in user is the same as the user requesting authentication to the consumer. If not, then log them out. - if (!string.Equals(User.Identity.Name, Code.Util.ExtractUserName(ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier), StringComparison.OrdinalIgnoreCase)) { - FormsAuthentication.SignOut(); - Response.Redirect(Request.Url.AbsoluteUri); + if (ProviderEndpoint.PendingAuthenticationRequest != null) { + if (ProviderEndpoint.PendingAuthenticationRequest.IsDirectedIdentity) { + ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier = Code.Util.BuildIdentityUrl(); + } + this.identityUrlLabel.Text = ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier.ToString(); + + // check that the logged in user is the same as the user requesting authentication to the consumer. If not, then log them out. + if (!string.Equals(User.Identity.Name, Code.Util.ExtractUserName(ProviderEndpoint.PendingAuthenticationRequest.LocalIdentifier), StringComparison.OrdinalIgnoreCase)) { + FormsAuthentication.SignOut(); + Response.Redirect(Request.Url.AbsoluteUri); + } + } else { + this.identityUrlLabel.Text = "(not applicable)"; + this.siteRequestLabel.Text = "A site has asked for information about you."; } - } else { - this.identityUrlLabel.Text = "(not applicable)"; - this.siteRequestLabel.Text = "A site has asked for information about you."; - } - - // if simple registration fields were used, then prompt the user for them - var requestedFields = ProviderEndpoint.PendingRequest.GetExtension<ClaimsRequest>(); - if (requestedFields != null) { - this.profileFields.Visible = true; - this.profileFields.SetRequiredFieldsFromRequest(requestedFields); - if (!IsPostBack) { - var sregResponse = requestedFields.CreateResponse(); - - // We MAY not have an entry for this user if they used Yubikey to log in. - MembershipUser user = Membership.GetUser(); - if (user != null) { - sregResponse.Email = Membership.GetUser().Email; + + // if simple registration fields were used, then prompt the user for them + var requestedFields = ProviderEndpoint.PendingRequest.GetExtension<ClaimsRequest>(); + if (requestedFields != null) { + this.profileFields.Visible = true; + this.profileFields.SetRequiredFieldsFromRequest(requestedFields); + if (!IsPostBack) { + var sregResponse = requestedFields.CreateResponse(); + + // We MAY not have an entry for this user if they used Yubikey to log in. + MembershipUser user = Membership.GetUser(); + if (user != null) { + sregResponse.Email = Membership.GetUser().Email; + } + this.profileFields.SetOpenIdProfileFields(sregResponse); } - this.profileFields.SetOpenIdProfileFields(sregResponse); } - } + })); } protected void Yes_Click(object sender, EventArgs e) { - if (!Page.IsValid) { - return; - } - - if (this.OAuthPanel.Visible) { - string grantedScope = null; - if (this.oauthPermission.Checked) { - // This SIMPLE sample merely uses the realm as the consumerKey, - // but in a real app this will probably involve a database lookup to translate - // the realm to a known consumerKey. - grantedScope = string.Empty; // we don't scope individual access rights on this sample - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!Page.IsValid || ProviderEndpoint.PendingRequest == null) { + return; + } + + if (this.OAuthPanel.Visible) { + string grantedScope = null; + if (this.oauthPermission.Checked) { + // This SIMPLE sample merely uses the realm as the consumerKey, + // but in a real app this will probably involve a database lookup to translate + // the realm to a known consumerKey. + grantedScope = string.Empty; // we don't scope individual access rights on this sample + } + + OAuthHybrid.ServiceProvider.AttachAuthorizationResponse(ProviderEndpoint.PendingRequest, grantedScope); + } - OAuthHybrid.ServiceProvider.AttachAuthorizationResponse(ProviderEndpoint.PendingRequest, grantedScope); - } - - var sregRequest = ProviderEndpoint.PendingRequest.GetExtension<ClaimsRequest>(); - ClaimsResponse sregResponse = null; - if (sregRequest != null) { - sregResponse = this.profileFields.GetOpenIdProfileFields(sregRequest); - ProviderEndpoint.PendingRequest.AddResponseExtension(sregResponse); - } - var papeRequest = ProviderEndpoint.PendingRequest.GetExtension<PolicyRequest>(); - PolicyResponse papeResponse = null; - if (papeRequest != null) { - papeResponse = new PolicyResponse(); - papeResponse.NistAssuranceLevel = NistAssuranceLevel.InsufficientForLevel1; - ProviderEndpoint.PendingRequest.AddResponseExtension(papeResponse); - } - - if (ProviderEndpoint.PendingAuthenticationRequest != null) { - ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated = true; - } else { - ProviderEndpoint.PendingAnonymousRequest.IsApproved = true; - } - Debug.Assert(ProviderEndpoint.PendingRequest.IsResponseReady, "Setting authentication should be all that's necessary."); - ProviderEndpoint.SendResponse(); + var sregRequest = ProviderEndpoint.PendingRequest.GetExtension<ClaimsRequest>(); + ClaimsResponse sregResponse = null; + if (sregRequest != null) { + sregResponse = this.profileFields.GetOpenIdProfileFields(sregRequest); + ProviderEndpoint.PendingRequest.AddResponseExtension(sregResponse); + } + var papeRequest = ProviderEndpoint.PendingRequest.GetExtension<PolicyRequest>(); + PolicyResponse papeResponse = null; + if (papeRequest != null) { + papeResponse = new PolicyResponse(); + papeResponse.NistAssuranceLevel = NistAssuranceLevel.InsufficientForLevel1; + ProviderEndpoint.PendingRequest.AddResponseExtension(papeResponse); + } + + if (ProviderEndpoint.PendingAuthenticationRequest != null) { + ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated = true; + } else { + ProviderEndpoint.PendingAnonymousRequest.IsApproved = true; + } + Debug.Assert( + ProviderEndpoint.PendingRequest.IsResponseReady, "Setting authentication should be all that's necessary."); + + var provider = new ProviderEndpoint(); + var response = await provider.PrepareResponseAsync(); + await response.SendAsync(); + })); } protected void No_Click(object sender, EventArgs e) { - if (ProviderEndpoint.PendingAuthenticationRequest != null) { - ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated = false; - } else { - ProviderEndpoint.PendingAnonymousRequest.IsApproved = false; - } - Debug.Assert(ProviderEndpoint.PendingRequest.IsResponseReady, "Setting authentication should be all that's necessary."); - ProviderEndpoint.SendResponse(); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (ProviderEndpoint.PendingRequest == null) { + return; + } + + if (ProviderEndpoint.PendingAuthenticationRequest != null) { + ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated = false; + } else { + ProviderEndpoint.PendingAnonymousRequest.IsApproved = false; + } + Debug.Assert( + ProviderEndpoint.PendingRequest.IsResponseReady, "Setting authentication should be all that's necessary."); + var provider = new ProviderEndpoint(); + var response = await provider.PrepareResponseAsync(); + await response.SendAsync(); + })); } } }
\ No newline at end of file diff --git a/samples/OpenIdProviderWebForms/decide.aspx.designer.cs b/samples/OpenIdProviderWebForms/decide.aspx.designer.cs index 3aa6271..f40323c 100644 --- a/samples/OpenIdProviderWebForms/decide.aspx.designer.cs +++ b/samples/OpenIdProviderWebForms/decide.aspx.designer.cs @@ -1,10 +1,9 @@ //------------------------------------------------------------------------------ // <auto-generated> // This code was generated by a tool. -// Runtime Version:2.0.50727.4918 // // Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. +// the code is regenerated. // </auto-generated> //------------------------------------------------------------------------------ diff --git a/samples/OpenIdProviderWebForms/packages.config b/samples/OpenIdProviderWebForms/packages.config index 6562527..8e40260 100644 --- a/samples/OpenIdProviderWebForms/packages.config +++ b/samples/OpenIdProviderWebForms/packages.config @@ -1,4 +1,5 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OpenIdProviderWebForms/server.aspx b/samples/OpenIdProviderWebForms/server.aspx index 101aeee..946f044 100644 --- a/samples/OpenIdProviderWebForms/server.aspx +++ b/samples/OpenIdProviderWebForms/server.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" Inherits="OpenIdProviderWebForms.server" CodeBehind="server.aspx.cs" ValidateRequest="false" %> +<%@ Page Language="C#" AutoEventWireup="true" Inherits="OpenIdProviderWebForms.server" CodeBehind="server.aspx.cs" ValidateRequest="false" Async="true" EnableSessionState="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.Provider.UI" Namespace="DotNetOpenAuth.OpenId.Provider" TagPrefix="openid" %> <html> diff --git a/samples/OpenIdProviderWebForms/server.aspx.cs b/samples/OpenIdProviderWebForms/server.aspx.cs index 89e14f4..e613192 100644 --- a/samples/OpenIdProviderWebForms/server.aspx.cs +++ b/samples/OpenIdProviderWebForms/server.aspx.cs @@ -7,15 +7,27 @@ namespace OpenIdProviderWebForms { /// This page is responsible for handling all open-id compliant requests. /// </summary> public partial class server : System.Web.UI.Page { - protected void Page_Load(object src, System.EventArgs evt) { + protected void Page_Load(object src, EventArgs evt) { this.serverEndpointUrl.Text = Request.Url.ToString(); } protected void provider_AuthenticationChallenge(object sender, AuthenticationChallengeEventArgs e) { + // We store the request in the user's session so that + // redirects and user prompts can appear and eventually some page can decide + // to respond to the OpenID authentication request either affirmatively or + // negatively. + ProviderEndpoint.PendingRequest = e.Request; + Code.Util.ProcessAuthenticationChallenge(e.Request); } protected void provider_AnonymousRequest(object sender, AnonymousRequestEventArgs e) { + // We store the request in the user's session so that + // redirects and user prompts can appear and eventually some page can decide + // to respond to the OpenID authentication request either affirmatively or + // negatively. + ProviderEndpoint.PendingRequest = e.Request; + Code.Util.ProcessAnonymousRequest(e.Request); } } diff --git a/samples/OpenIdRelyingPartyMvc/Controllers/UserController.cs b/samples/OpenIdRelyingPartyMvc/Controllers/UserController.cs index 3ff405f..41a090f 100644 --- a/samples/OpenIdRelyingPartyMvc/Controllers/UserController.cs +++ b/samples/OpenIdRelyingPartyMvc/Controllers/UserController.cs @@ -2,6 +2,7 @@ using System; using System.Collections.Generic; using System.Linq; + using System.Threading.Tasks; using System.Web; using System.Web.Mvc; using System.Web.Security; @@ -31,14 +32,16 @@ } [ValidateInput(false)] - public ActionResult Authenticate(string returnUrl) { - var response = openid.GetResponse(); + public async Task<ActionResult> Authenticate(string returnUrl) { + var response = await openid.GetResponseAsync(this.Request, this.Response.ClientDisconnectedToken); if (response == null) { // Stage 2: user submitting Identifier Identifier id; if (Identifier.TryParse(Request.Form["openid_identifier"], out id)) { try { - return openid.CreateRequest(Request.Form["openid_identifier"]).RedirectingResponse.AsActionResult(); + var request = await openid.CreateRequestAsync(Request.Form["openid_identifier"]); + var redirectingResponse = await request.GetRedirectingResponseAsync(this.Response.ClientDisconnectedToken); + return redirectingResponse.AsActionResult(); } catch (ProtocolException ex) { ViewData["Message"] = ex.Message; return View("Login"); @@ -52,7 +55,8 @@ switch (response.Status) { case AuthenticationStatus.Authenticated: Session["FriendlyIdentifier"] = response.FriendlyIdentifierForDisplay; - FormsAuthentication.SetAuthCookie(response.ClaimedIdentifier, false); + var cookie = FormsAuthentication.GetAuthCookie(response.ClaimedIdentifier, false); + Response.SetCookie(cookie); if (!string.IsNullOrEmpty(returnUrl)) { return Redirect(returnUrl); } else { diff --git a/samples/OpenIdRelyingPartyMvc/OpenIdRelyingPartyMvc.csproj b/samples/OpenIdRelyingPartyMvc/OpenIdRelyingPartyMvc.csproj index e2ff559..8e3fb26 100644 --- a/samples/OpenIdRelyingPartyMvc/OpenIdRelyingPartyMvc.csproj +++ b/samples/OpenIdRelyingPartyMvc/OpenIdRelyingPartyMvc.csproj @@ -9,6 +9,7 @@ <IISExpressAnonymousAuthentication /> <IISExpressWindowsAuthentication /> <IISExpressUseClassicPipelineMode /> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> </PropertyGroup> <PropertyGroup> <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> @@ -45,10 +46,16 @@ <CodeAnalysisRuleSet>AllRules.ruleset</CodeAnalysisRuleSet> </PropertyGroup> <ItemGroup> + <Reference Include="Microsoft.Web.Infrastructure, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.Web.Infrastructure.1.0.0.0\lib\net40\Microsoft.Web.Infrastructure.dll</HintPath> + </Reference> <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web.ApplicationServices" /> <Reference Include="System.Web.DynamicData" /> <Reference Include="System.Web.Entity" /> @@ -56,10 +63,33 @@ <RequiredTargetFramework>3.5</RequiredTargetFramework> </Reference> <Reference Include="System.Web.Extensions" /> - <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> <Reference Include="System.Web" /> <Reference Include="System.Web.Abstractions" /> + <Reference Include="System.Web.Helpers, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.Helpers.dll</HintPath> + </Reference> + <Reference Include="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Mvc.4.0.20710.0\lib\net40\System.Web.Mvc.dll</HintPath> + </Reference> + <Reference Include="System.Web.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.Razor.2.0.20715.0\lib\net40\System.Web.Razor.dll</HintPath> + </Reference> <Reference Include="System.Web.Routing" /> + <Reference Include="System.Web.WebPages, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Deployment, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Deployment.dll</HintPath> + </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=2.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> + <Private>True</Private> + <HintPath>..\..\src\packages\Microsoft.AspNet.WebPages.2.0.20710.0\lib\net40\System.Web.WebPages.Razor.dll</HintPath> + </Reference> <Reference Include="System.Xml" /> <Reference Include="System.Configuration" /> <Reference Include="System.Web.Services" /> @@ -156,6 +186,9 @@ <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> </ItemGroup> + <ItemGroup> + <Content Include="packages.config" /> + </ItemGroup> <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" Condition="false" /> @@ -185,4 +218,5 @@ </VisualStudio> </ProjectExtensions> <Import Project="$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))\EnlistmentInfo.targets" Condition=" '$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))' != '' " /> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> </Project>
\ No newline at end of file diff --git a/samples/OpenIdRelyingPartyMvc/Web.config b/samples/OpenIdRelyingPartyMvc/Web.config index 67c1dd4..8e432b0 100644 --- a/samples/OpenIdRelyingPartyMvc/Web.config +++ b/samples/OpenIdRelyingPartyMvc/Web.config @@ -56,9 +56,12 @@ <reporting enabled="true" /> </dotNetOpenAuth> - <appSettings/> + <appSettings> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> + </appSettings> <connectionStrings/> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this @@ -67,8 +70,7 @@ --> <compilation debug="true" targetFramework="4.0"> <assemblies> - <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> - <remove assembly="DotNetOpenAuth.Contracts"/> + <add assembly="System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089"/> @@ -110,7 +112,7 @@ </namespaces> </pages> <httpHandlers> - <add verb="*" path="*.mvc" validate="false" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> + <add verb="*" path="*.mvc" validate="false" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> </httpHandlers> </system.web> <system.web.extensions/> @@ -124,19 +126,19 @@ <handlers> <remove name="MvcHttpHandler"/> <remove name="UrlRoutingHandler"/> - <add name="MvcHttpHandler" preCondition="integratedMode" verb="*" path="*.mvc" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> + <add name="MvcHttpHandler" preCondition="integratedMode" verb="*" path="*.mvc" type="System.Web.Mvc.MvcHttpHandler, System.Web.Mvc, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"/> </handlers> </system.webServer> <runtime> <legacyHMACWarning enabled="0" /> - <!-- When targeting ASP.NET MVC 3, this assemblyBinding makes MVC 1 and 2 references relink + <!-- When targeting ASP.NET MVC 4, this assemblyBinding makes MVC 1 and 2 references relink to MVC 3 so libraries such as DotNetOpenAuth that compile against MVC 1 will work with it. --> <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> <dependentAssembly> <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> - <bindingRedirect oldVersion="1.0.0.0-3.0.0.0" newVersion="3.0.0.0" /> + <bindingRedirect oldVersion="1.0.0.0-4.0.0.0" newVersion="4.0.0.0" /> </dependentAssembly> </assemblyBinding> </runtime> diff --git a/samples/OpenIdRelyingPartyMvc/packages.config b/samples/OpenIdRelyingPartyMvc/packages.config new file mode 100644 index 0000000..c527bd3 --- /dev/null +++ b/samples/OpenIdRelyingPartyMvc/packages.config @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="Microsoft.AspNet.Mvc" version="4.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.Razor" version="2.0.20715.0" targetFramework="net45" /> + <package id="Microsoft.AspNet.WebPages" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> + <package id="Microsoft.Web.Infrastructure" version="1.0.0.0" targetFramework="net45" /> +</packages>
\ No newline at end of file diff --git a/samples/OpenIdRelyingPartyWebForms/Code/State.cs b/samples/OpenIdRelyingPartyWebForms/Code/State.cs index c8147e5..c8cef80 100644 --- a/samples/OpenIdRelyingPartyWebForms/Code/State.cs +++ b/samples/OpenIdRelyingPartyWebForms/Code/State.cs @@ -1,5 +1,6 @@ namespace OpenIdRelyingPartyWebForms { using System.Web; + using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OpenId.Extensions.AttributeExchange; using DotNetOpenAuth.OpenId.Extensions.ProviderAuthenticationPolicy; using DotNetOpenAuth.OpenId.Extensions.SimpleRegistration; @@ -28,8 +29,8 @@ namespace OpenIdRelyingPartyWebForms { set { HttpContext.Current.Session["PapePolicies"] = value; } } - public static string GoogleAccessToken { - get { return HttpContext.Current.Session["GoogleAccessToken"] as string; } + public static AccessToken GoogleAccessToken { + get { return (AccessToken)(HttpContext.Current.Session["GoogleAccessToken"] ?? new AccessToken()); } set { HttpContext.Current.Session["GoogleAccessToken"] = value; } } @@ -38,7 +39,7 @@ namespace OpenIdRelyingPartyWebForms { FetchResponse = null; FriendlyLoginName = null; PapePolicies = null; - GoogleAccessToken = null; + GoogleAccessToken = new AccessToken(); } } }
\ No newline at end of file diff --git a/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx b/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx index 8c99efe..21b6a12 100644 --- a/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx +++ b/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx @@ -1,6 +1,6 @@ <%@ Page Language="C#" AutoEventWireup="true" CodeBehind="DetectGoogleSession.aspx.cs" Inherits="OpenIdRelyingPartyWebForms.DetectGoogleSession" ValidateRequest="false" - MasterPageFile="~/Site.Master" %> + MasterPageFile="~/Site.Master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> diff --git a/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx.cs b/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx.cs index d6cf2ac..909c4bc 100644 --- a/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/DetectGoogleSession.aspx.cs @@ -1,5 +1,8 @@ namespace OpenIdRelyingPartyWebForms { using System; + using System.Web; + using System.Web.UI; + using DotNetOpenAuth.ApplicationBlock.CustomExtensions; using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.Extensions.UI; @@ -11,37 +14,44 @@ private const string UIModeDetectSession = "x-has-session"; protected void Page_Load(object sender, EventArgs e) { - using (var openid = new OpenIdRelyingParty()) { - // In order to receive the UIRequest as a response, we must register a custom extension factory. - openid.ExtensionFactories.Add(new UIRequestAtRelyingPartyFactory()); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + using (var openid = new OpenIdRelyingParty()) { + // In order to receive the UIRequest as a response, we must register a custom extension factory. + openid.ExtensionFactories.Add(new UIRequestAtRelyingPartyFactory()); - var response = openid.GetResponse(); - if (response == null) { - // Submit an OpenID request which Google must reply to immediately. - // If the user hasn't established a trust relationship with this site yet, - // Google will not give us the user identity, but they will tell us whether the user - // at least has an active login session with them so we know whether to promote the - // "Log in with Google" button. - IAuthenticationRequest request = openid.CreateRequest("https://www.google.com/accounts/o8/id"); - request.AddExtension(new UIRequest { Mode = UIModeDetectSession }); - request.Mode = AuthenticationRequestMode.Immediate; - request.RedirectToProvider(); - } else { - if (response.Status == AuthenticationStatus.Authenticated) { - this.YouTrustUsLabel.Visible = true; - } else if (response.Status == AuthenticationStatus.SetupRequired) { - // Google refused to authenticate the user without user interaction. - // This is either because Google doesn't know who the user is yet, - // or because the user hasn't indicated to Google to trust this site. - // Google uniquely offers the RP a tip as to which of the above situations is true. - // Figure out which it is. In a real app, you might use this value to promote a - // Google login button on your site if you detect that a Google session exists. - var ext = response.GetUntrustedExtension<UIRequest>(); - this.YouAreLoggedInLabel.Visible = ext != null && ext.Mode == UIModeDetectSession; - this.YouAreNotLoggedInLabel.Visible = !this.YouAreLoggedInLabel.Visible; - } - } - } + var response = await openid.GetResponseAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (response == null) { + // Submit an OpenID request which Google must reply to immediately. + // If the user hasn't established a trust relationship with this site yet, + // Google will not give us the user identity, but they will tell us whether the user + // at least has an active login session with them so we know whether to promote the + // "Log in with Google" button. + IAuthenticationRequest request = + await + openid.CreateRequestAsync( + "https://www.google.com/accounts/o8/id", new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + request.AddExtension(new UIRequest { Mode = UIModeDetectSession }); + request.Mode = AuthenticationRequestMode.Immediate; + await request.RedirectToProviderAsync(new HttpContextWrapper(this.Context), Response.ClientDisconnectedToken); + } else { + if (response.Status == AuthenticationStatus.Authenticated) { + this.YouTrustUsLabel.Visible = true; + } else if (response.Status == AuthenticationStatus.SetupRequired) { + // Google refused to authenticate the user without user interaction. + // This is either because Google doesn't know who the user is yet, + // or because the user hasn't indicated to Google to trust this site. + // Google uniquely offers the RP a tip as to which of the above situations is true. + // Figure out which it is. In a real app, you might use this value to promote a + // Google login button on your site if you detect that a Google session exists. + var ext = response.GetUntrustedExtension<UIRequest>(); + this.YouAreLoggedInLabel.Visible = ext != null && ext.Mode == UIModeDetectSession; + this.YouAreNotLoggedInLabel.Visible = !this.YouAreLoggedInLabel.Visible; + } + } + } + })); } } }
\ No newline at end of file diff --git a/samples/OpenIdRelyingPartyWebForms/Global.asax.cs b/samples/OpenIdRelyingPartyWebForms/Global.asax.cs index 6283987..8460d49 100644 --- a/samples/OpenIdRelyingPartyWebForms/Global.asax.cs +++ b/samples/OpenIdRelyingPartyWebForms/Global.asax.cs @@ -18,7 +18,7 @@ get { var googleWebConsumer = (WebConsumerOpenIdRelyingParty)HttpContext.Current.Application["GoogleWebConsumer"]; if (googleWebConsumer == null) { - googleWebConsumer = new WebConsumerOpenIdRelyingParty(GoogleConsumer.ServiceDescription, GoogleTokenManager); + googleWebConsumer = new WebConsumerOpenIdRelyingParty { ServiceProvider = GoogleConsumer.ServiceDescription }; HttpContext.Current.Application["GoogleWebConsumer"] = googleWebConsumer; } @@ -26,36 +26,6 @@ } } - internal static InMemoryTokenManager GoogleTokenManager { - get { - var tokenManager = (InMemoryTokenManager)HttpContext.Current.Application["GoogleTokenManager"]; - if (tokenManager == null) { - string consumerKey = ConfigurationManager.AppSettings["googleConsumerKey"]; - string consumerSecret = ConfigurationManager.AppSettings["googleConsumerSecret"]; - if (!string.IsNullOrEmpty(consumerKey)) { - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - HttpContext.Current.Application["GoogleTokenManager"] = tokenManager; - } - } - - return tokenManager; - } - } - - internal static InMemoryTokenManager OwnSampleOPHybridTokenManager { - get { - var tokenManager = (InMemoryTokenManager)HttpContext.Current.Application["OwnSampleOPHybridTokenManager"]; - if (tokenManager == null) { - string consumerKey = new Uri(HttpContext.Current.Request.Url, HttpContext.Current.Request.ApplicationPath).AbsoluteUri; - string consumerSecret = "some crazy secret"; - tokenManager = new InMemoryTokenManager(consumerKey, consumerSecret); - HttpContext.Current.Application["OwnSampleOPHybridTokenManager"] = tokenManager; - } - - return tokenManager; - } - } - public static string ToString(NameValueCollection collection) { using (StringWriter sw = new StringWriter()) { foreach (string key in collection.Keys) { diff --git a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx index 7d5a54f..b8caa93 100644 --- a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx +++ b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx @@ -1,5 +1,5 @@ <%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="~/Site.Master" CodeBehind="DisplayGoogleContacts.aspx.cs" - Inherits="OpenIdRelyingPartyWebForms.MembersOnly.DisplayGoogleContacts" %> + Inherits="OpenIdRelyingPartyWebForms.MembersOnly.DisplayGoogleContacts" Async="true" %> <asp:Content ID="Content1" runat="server" ContentPlaceHolderID="Main"> <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> diff --git a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.cs b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.cs index c95fc7c..d06e2f6 100644 --- a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.cs @@ -3,6 +3,7 @@ using System.Linq; using System.Text; using System.Web; + using System.Web.UI; using System.Web.UI.WebControls; using System.Xml.Linq; using DotNetOpenAuth.ApplicationBlock; @@ -10,17 +11,25 @@ public partial class DisplayGoogleContacts : System.Web.UI.Page { protected void Page_Load(object sender, EventArgs e) { - if (!string.IsNullOrEmpty(State.GoogleAccessToken)) { - this.MultiView1.ActiveViewIndex = 1; - if (State.FetchResponse != null && State.FetchResponse.Attributes.Contains(WellKnownAttributes.Contact.Email)) { - this.emailLabel.Text = State.FetchResponse.Attributes[WellKnownAttributes.Contact.Email].Values[0]; - } else { - this.emailLabel.Text = "unavailable"; - } - this.claimedIdLabel.Text = this.User.Identity.Name; - var contactsDocument = GoogleConsumer.GetContacts(Global.GoogleWebConsumer, State.GoogleAccessToken, 25, 1); - this.RenderContacts(contactsDocument); - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!string.IsNullOrEmpty(State.GoogleAccessToken.Token)) { + this.MultiView1.ActiveViewIndex = 1; + if (State.FetchResponse != null && State.FetchResponse.Attributes.Contains(WellKnownAttributes.Contact.Email)) { + this.emailLabel.Text = State.FetchResponse.Attributes[WellKnownAttributes.Contact.Email].Values[0]; + } else { + this.emailLabel.Text = "unavailable"; + } + this.claimedIdLabel.Text = this.User.Identity.Name; + var google = new GoogleConsumer { + ConsumerKey = Global.GoogleWebConsumer.ConsumerKey, + ConsumerSecret = Global.GoogleWebConsumer.ConsumerSecret, + }; + var contactsDocument = await google.GetContactsAsync(State.GoogleAccessToken); + this.RenderContacts(contactsDocument); + } + })); } private void RenderContacts(XDocument contactsDocument) { diff --git a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.designer.cs b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.designer.cs index 5cc5894..9521781 100644 --- a/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.designer.cs +++ b/samples/OpenIdRelyingPartyWebForms/MembersOnly/DisplayGoogleContacts.aspx.designer.cs @@ -1,10 +1,9 @@ //------------------------------------------------------------------------------ // <auto-generated> // This code was generated by a tool. -// Runtime Version:2.0.50727.4918 // // Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. +// the code is regenerated. // </auto-generated> //------------------------------------------------------------------------------ diff --git a/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx b/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx index cec5f49..e9dcf5d 100644 --- a/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx +++ b/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="NoIdentityOpenId.aspx.cs" +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="NoIdentityOpenId.aspx.cs" Async="true" MasterPageFile="~/Site.Master" Inherits="OpenIdRelyingPartyWebForms.NoIdentityOpenId" %> <asp:Content runat="server" ContentPlaceHolderID="Main"> diff --git a/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx.cs b/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx.cs index ca12964..fcfa257 100644 --- a/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/NoIdentityOpenId.aspx.cs @@ -1,5 +1,8 @@ namespace OpenIdRelyingPartyWebForms { using System; + using System.Threading; + using System.Web; + using System.Web.UI; using System.Web.UI.WebControls; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId; @@ -7,10 +10,10 @@ using DotNetOpenAuth.OpenId.RelyingParty; public partial class NoIdentityOpenId : System.Web.UI.Page { - protected void Page_Load(object sender, EventArgs e) { + protected async void Page_Load(object sender, EventArgs e) { this.openIdBox.Focus(); using (OpenIdRelyingParty rp = new OpenIdRelyingParty()) { - IAuthenticationResponse response = rp.GetResponse(); + IAuthenticationResponse response = await rp.GetResponseAsync(new HttpRequestWrapper(this.Request), this.Response.ClientDisconnectedToken); if (response != null) { switch (response.Status) { case AuthenticationStatus.ExtensionsOnly: @@ -45,32 +48,39 @@ } protected void beginButton_Click(object sender, EventArgs e) { - if (!this.Page.IsValid) { - return; // don't login if custom validation failed. - } - try { - using (OpenIdRelyingParty rp = new OpenIdRelyingParty()) { - var request = rp.CreateRequest(this.openIdBox.Text); - request.IsExtensionOnly = true; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!this.Page.IsValid) { + return; // don't login if custom validation failed. + } + try { + using (OpenIdRelyingParty rp = new OpenIdRelyingParty()) { + var request = + await + rp.CreateRequestAsync(this.openIdBox.Text, new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + request.IsExtensionOnly = true; - // This is where you would add any OpenID extensions you wanted - // to include in the request. - request.AddExtension(new ClaimsRequest { - Email = DemandLevel.Request, - Country = DemandLevel.Request, - Gender = DemandLevel.Require, - PostalCode = DemandLevel.Require, - TimeZone = DemandLevel.Require, - }); + // This is where you would add any OpenID extensions you wanted + // to include in the request. + request.AddExtension( + new ClaimsRequest { + Email = DemandLevel.Request, + Country = DemandLevel.Request, + Gender = DemandLevel.Require, + PostalCode = DemandLevel.Require, + TimeZone = DemandLevel.Require, + }); - request.RedirectToProvider(); - } - } catch (ProtocolException ex) { - // The user probably entered an Identifier that - // was not a valid OpenID endpoint. - this.openidValidator.Text = ex.Message; - this.openidValidator.IsValid = false; - } + await request.RedirectToProviderAsync(new HttpContextWrapper(Context), Response.ClientDisconnectedToken); + } + } catch (ProtocolException ex) { + // The user probably entered an Identifier that + // was not a valid OpenID endpoint. + this.openidValidator.Text = ex.Message; + this.openidValidator.IsValid = false; + } + })); } protected void openidValidator_ServerValidate(object source, ServerValidateEventArgs args) { diff --git a/samples/OpenIdRelyingPartyWebForms/OpenIdRelyingPartyWebForms.csproj b/samples/OpenIdRelyingPartyWebForms/OpenIdRelyingPartyWebForms.csproj index cf12262..03675d2 100644 --- a/samples/OpenIdRelyingPartyWebForms/OpenIdRelyingPartyWebForms.csproj +++ b/samples/OpenIdRelyingPartyWebForms/OpenIdRelyingPartyWebForms.csproj @@ -72,6 +72,8 @@ <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web" /> <Reference Include="System.Web.ApplicationServices" /> <Reference Include="System.Web.DynamicData" /> @@ -100,9 +102,6 @@ </Content> </ItemGroup> <ItemGroup> - <Compile Include="..\DotNetOpenAuth.ApplicationBlock\InMemoryTokenManager.cs"> - <Link>Code\InMemoryTokenManager.cs</Link> - </Compile> <Compile Include="ajaxlogin.aspx.cs"> <DependentUpon>ajaxlogin.aspx</DependentUpon> <SubType>ASPXCodeBehind</SubType> diff --git a/samples/OpenIdRelyingPartyWebForms/Web.config b/samples/OpenIdRelyingPartyWebForms/Web.config index 479b285..f5fada9 100644 --- a/samples/OpenIdRelyingPartyWebForms/Web.config +++ b/samples/OpenIdRelyingPartyWebForms/Web.config @@ -66,14 +66,13 @@ <!-- Google sign-up: https://www.google.com/accounts/ManageDomains --> <add key="googleConsumerKey" value="demo.dotnetopenauth.net"/> <add key="googleConsumerSecret" value="5Yv1TfKm1551QrXZ9GpqepeD"/> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <system.web> <!--<sessionState cookieless="true" />--> - <compilation debug="true" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <httpRuntime targetFramework="4.5" /> + <compilation debug="true" targetFramework="4.0" /> <customErrors mode="RemoteOnly"/> <authentication mode="Forms"> <forms name="OpenIdRelyingPartySession"/> <!-- named cookie prevents conflicts with other samples --> @@ -85,7 +84,7 @@ Medium: doesn't work unless originUrl=".*" or WebPermission.Connect is extended, and Google Apps doesn't work. Low: doesn't work because WebPermission.Connect is denied. --> - <trust level="Medium" originUrl=".*"/> + <trust level="Full" originUrl=".*"/> <pages controlRenderingCompatibilityVersion="3.5" clientIDMode="AutoID"/> </system.web> diff --git a/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx b/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx index d2b3255..916fca3 100644 --- a/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx +++ b/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx @@ -1,5 +1,5 @@ <%@ Page Language="C#" AutoEventWireup="true" CodeBehind="ajaxlogin.aspx.cs" Inherits="OpenIdRelyingPartyWebForms.ajaxlogin" - ValidateRequest="false" MasterPageFile="~/Site.Master" %> + ValidateRequest="false" MasterPageFile="~/Site.Master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="openid" %> <asp:Content runat="server" ContentPlaceHolderID="head"> diff --git a/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx.cs b/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx.cs index f7d44d5..ebfece3 100644 --- a/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/ajaxlogin.aspx.cs @@ -1,5 +1,6 @@ namespace OpenIdRelyingPartyWebForms { using System; + using System.Web.UI; using System.Web.UI.WebControls; using DotNetOpenAuth.OpenId.Extensions.SimpleRegistration; using DotNetOpenAuth.OpenId.RelyingParty; @@ -30,17 +31,23 @@ } protected void submitButton_Click(object sender, EventArgs e) { - if (!Page.IsValid) { - return; - } - if (this.OpenIdAjaxTextBox1.AuthenticationResponse != null) { - if (this.OpenIdAjaxTextBox1.AuthenticationResponse.Status == AuthenticationStatus.Authenticated) { - // Save comment here! - this.multiView.ActiveViewIndex = 1; - } else { - this.multiView.ActiveViewIndex = 2; - } - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!Page.IsValid) { + return; + } + + var response = await this.OpenIdAjaxTextBox1.GetAuthenticationResponseAsync(Response.ClientDisconnectedToken); + if (response != null) { + if (response.Status == AuthenticationStatus.Authenticated) { + // Save comment here! + this.multiView.ActiveViewIndex = 1; + } else { + this.multiView.ActiveViewIndex = 2; + } + } + })); } protected void editComment_Click(object sender, EventArgs e) { diff --git a/samples/OpenIdRelyingPartyWebForms/login.aspx b/samples/OpenIdRelyingPartyWebForms/login.aspx index 17a230a..fc42b73 100644 --- a/samples/OpenIdRelyingPartyWebForms/login.aspx +++ b/samples/OpenIdRelyingPartyWebForms/login.aspx @@ -1,5 +1,5 @@ <%@ Page Language="C#" AutoEventWireup="True" CodeBehind="login.aspx.cs" Inherits="OpenIdRelyingPartyWebForms.login" - ValidateRequest="false" MasterPageFile="~/Site.Master" %> + ValidateRequest="false" MasterPageFile="~/Site.Master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> <%@ Register Assembly="DotNetOpenAuth.OpenId" Namespace="DotNetOpenAuth.OpenId.Extensions.SimpleRegistration" TagPrefix="sreg" %> diff --git a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx index 31c48fa..6c3f822 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx +++ b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx @@ -1,6 +1,6 @@ <%@ Page Language="C#" AutoEventWireup="True" CodeBehind="loginPlusOAuth.aspx.cs" Inherits="OpenIdRelyingPartyWebForms.loginPlusOAuth" ValidateRequest="false" - MasterPageFile="~/Site.Master" %> + MasterPageFile="~/Site.Master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> diff --git a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx.cs b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx.cs index d4e9885..ecfaf49 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuth.aspx.cs @@ -1,7 +1,12 @@ namespace OpenIdRelyingPartyWebForms { using System; + using System.Threading.Tasks; + using System.Web; using System.Web.Security; + using System.Web.UI; + using DotNetOpenAuth.ApplicationBlock; + using DotNetOpenAuth.OAuth; using DotNetOpenAuth.OAuth.Messages; using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.Extensions.AttributeExchange; @@ -12,40 +17,51 @@ private static readonly OpenIdRelyingParty relyingParty = new OpenIdRelyingParty(); protected void Page_Load(object sender, EventArgs e) { - if (!IsPostBack && string.Equals(Request.Url.Host, "localhost", StringComparison.OrdinalIgnoreCase)) { - // Disable the button since the scenario won't work under localhost, - // and this will help encourage the user to read the the text above the button. - this.beginButton.Enabled = false; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!IsPostBack && string.Equals(Request.Url.Host, "localhost", StringComparison.OrdinalIgnoreCase)) { + // Disable the button since the scenario won't work under localhost, + // and this will help encourage the user to read the the text above the button. + this.beginButton.Enabled = false; + } - IAuthenticationResponse authResponse = relyingParty.GetResponse(); - if (authResponse != null) { - switch (authResponse.Status) { - case AuthenticationStatus.Authenticated: - State.FetchResponse = authResponse.GetExtension<FetchResponse>(); - AuthorizedTokenResponse accessToken = Global.GoogleWebConsumer.ProcessUserAuthorization(authResponse); - if (accessToken != null) { - State.GoogleAccessToken = accessToken.AccessToken; - FormsAuthentication.SetAuthCookie(authResponse.ClaimedIdentifier, false); - Response.Redirect("~/MembersOnly/DisplayGoogleContacts.aspx"); - } else { - MultiView1.SetActiveView(AuthorizationDenied); + IAuthenticationResponse authResponse = + await relyingParty.GetResponseAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (authResponse != null) { + switch (authResponse.Status) { + case AuthenticationStatus.Authenticated: + State.FetchResponse = authResponse.GetExtension<FetchResponse>(); + AccessTokenResponse accessToken = + await Global.GoogleWebConsumer.ProcessUserAuthorizationAsync(authResponse, Response.ClientDisconnectedToken); + if (accessToken != null) { + State.GoogleAccessToken = accessToken.AccessToken; + FormsAuthentication.SetAuthCookie(authResponse.ClaimedIdentifier, false); + Response.Redirect("~/MembersOnly/DisplayGoogleContacts.aspx"); + } else { + MultiView1.SetActiveView(AuthorizationDenied); + } + break; + case AuthenticationStatus.Canceled: + case AuthenticationStatus.Failed: + default: + this.MultiView1.SetActiveView(this.AuthenticationFailed); + break; + } } - break; - case AuthenticationStatus.Canceled: - case AuthenticationStatus.Failed: - default: - this.MultiView1.SetActiveView(this.AuthenticationFailed); - break; - } - } + })); } protected void beginButton_Click(object sender, EventArgs e) { - this.GetGoogleRequest().RedirectToProvider(); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var request = await this.GetGoogleRequestAsync(); + await request.RedirectToProviderAsync(); + })); } - private IAuthenticationRequest GetGoogleRequest() { + private async Task<IAuthenticationRequest> GetGoogleRequestAsync() { // Google requires that the realm and consumer key be equal, // so we constrain the realm to match the realm in the web.config file. // This does mean that the return_to URL must also fall under the key, @@ -53,8 +69,8 @@ // that is properly registered with Google. // We will customize the realm to use http or https based on what the // return_to URL will be (which will be this page). - Realm realm = Request.Url.Scheme + Uri.SchemeDelimiter + Global.GoogleTokenManager.ConsumerKey + "/"; - IAuthenticationRequest authReq = relyingParty.CreateRequest(GoogleOPIdentifier, realm); + Realm realm = Request.Url.Scheme + Uri.SchemeDelimiter + (new GoogleConsumer()).ConsumerKey + "/"; + IAuthenticationRequest authReq = await relyingParty.CreateRequestAsync(GoogleOPIdentifier, realm, cancellationToken: Response.ClientDisconnectedToken); // Prepare the OAuth extension string scope = GoogleConsumer.GetScopeUri(GoogleConsumer.Applications.Contacts); diff --git a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx index 13ef590..4647939 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx +++ b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx @@ -1,6 +1,6 @@ <%@ Page Language="C#" AutoEventWireup="True" CodeBehind="loginPlusOAuthSampleOP.aspx.cs" Inherits="OpenIdRelyingPartyWebForms.loginPlusOAuthSampleOP" ValidateRequest="false" - MasterPageFile="~/Site.Master" %> + MasterPageFile="~/Site.Master" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> diff --git a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx.cs b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx.cs index 75a9616..0446c36 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/loginPlusOAuthSampleOP.aspx.cs @@ -1,6 +1,9 @@ namespace OpenIdRelyingPartyWebForms { using System; + using System.Web; using System.Web.Security; + using System.Web.UI; + using DotNetOpenAuth.ApplicationBlock; using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OAuth; @@ -15,48 +18,58 @@ } protected void beginButton_Click(object sender, EventArgs e) { - if (!Page.IsValid) { - return; - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!Page.IsValid) { + return; + } - this.identifierBox.LogOn(); + await this.identifierBox.LogOnAsync(Response.ClientDisconnectedToken); + })); } protected void identifierBox_LoggingIn(object sender, OpenIdEventArgs e) { - ServiceProviderDescription serviceDescription = new ServiceProviderDescription { - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - }; - - var consumer = new WebConsumerOpenIdRelyingParty(serviceDescription, Global.OwnSampleOPHybridTokenManager); + var consumer = CreateConsumer(); consumer.AttachAuthorizationRequest(e.Request, "http://tempuri.org/IDataApi/GetName"); } protected void identifierBox_LoggedIn(object sender, OpenIdEventArgs e) { - State.FetchResponse = e.Response.GetExtension<FetchResponse>(); - - ServiceProviderDescription serviceDescription = new ServiceProviderDescription { - AccessTokenEndpoint = new MessageReceivingEndpoint(new Uri(e.Response.Provider.Uri, "/access_token.ashx"), HttpDeliveryMethods.AuthorizationHeaderRequest | HttpDeliveryMethods.PostRequest), - TamperProtectionElements = new ITamperProtectionChannelBindingElement[] { new HmacSha1SigningBindingElement() }, - }; - var consumer = new WebConsumerOpenIdRelyingParty(serviceDescription, Global.OwnSampleOPHybridTokenManager); - - AuthorizedTokenResponse accessToken = consumer.ProcessUserAuthorization(e.Response); - if (accessToken != null) { - this.MultiView1.SetActiveView(this.AuthorizationGiven); - - // At this point, the access token would be somehow associated with the user - // account at the RP. - ////Database.Associate(e.Response.ClaimedIdentifier, accessToken.AccessToken); - } else { - this.MultiView1.SetActiveView(this.AuthorizationDenied); - } - - // Avoid the redirect - e.Cancel = true; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + State.FetchResponse = e.Response.GetExtension<FetchResponse>(); + + var serviceDescription = new ServiceProviderDescription { + TokenRequestEndpoint = new Uri(e.Response.Provider.Uri, "/access_token.ashx"), + }; + var consumer = CreateConsumer(); + consumer.ServiceProvider = serviceDescription; + AccessTokenResponse accessToken = await consumer.ProcessUserAuthorizationAsync(e.Response); + if (accessToken != null) { + this.MultiView1.SetActiveView(this.AuthorizationGiven); + + // At this point, the access token would be somehow associated with the user + // account at the RP. + ////Database.Associate(e.Response.ClaimedIdentifier, accessToken.AccessToken); + } else { + this.MultiView1.SetActiveView(this.AuthorizationDenied); + } + + // Avoid the redirect + e.Cancel = true; + })); } protected void identifierBox_Failed(object sender, OpenIdEventArgs e) { this.MultiView1.SetActiveView(this.AuthenticationFailed); } + + private static WebConsumerOpenIdRelyingParty CreateConsumer() { + var consumer = new WebConsumerOpenIdRelyingParty(); + consumer.ConsumerKey = new Uri(HttpContext.Current.Request.Url, HttpContext.Current.Request.ApplicationPath).AbsoluteUri; + consumer.ConsumerSecret = "some crazy secret"; + return consumer; + } } } diff --git a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx index a00eccd..3e8d631 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx +++ b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="loginProgrammatic.aspx.cs" +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="loginProgrammatic.aspx.cs" Async="true" Inherits="OpenIdRelyingPartyWebForms.loginProgrammatic" MasterPageFile="~/Site.Master" %> <asp:Content ID="Content1" runat="server" ContentPlaceHolderID="Main"> <h2>Login Page </h2> diff --git a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.cs b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.cs index ed11148..f47eae0 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.cs +++ b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.cs @@ -1,6 +1,7 @@ namespace OpenIdRelyingPartyWebForms { using System; using System.Net; + using System.Web; using System.Web.Security; using System.Web.UI; using System.Web.UI.WebControls; @@ -16,79 +17,91 @@ } protected void loginButton_Click(object sender, EventArgs e) { - if (!this.Page.IsValid) { - return; // don't login if custom validation failed. - } - try { - using (OpenIdRelyingParty openid = this.createRelyingParty()) { - IAuthenticationRequest request = openid.CreateRequest(this.openIdBox.Text); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + if (!this.Page.IsValid) { + return; // don't login if custom validation failed. + } + try { + using (OpenIdRelyingParty openid = this.createRelyingParty()) { + IAuthenticationRequest request = + await + openid.CreateRequestAsync( + this.openIdBox.Text, new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); - // This is where you would add any OpenID extensions you wanted - // to include in the authentication request. - request.AddExtension(new ClaimsRequest { - Country = DemandLevel.Request, - Email = DemandLevel.Request, - Gender = DemandLevel.Require, - PostalCode = DemandLevel.Require, - TimeZone = DemandLevel.Require, - }); + // This is where you would add any OpenID extensions you wanted + // to include in the authentication request. + request.AddExtension( + new ClaimsRequest { + Country = DemandLevel.Request, + Email = DemandLevel.Request, + Gender = DemandLevel.Require, + PostalCode = DemandLevel.Require, + TimeZone = DemandLevel.Require, + }); - // Send your visitor to their Provider for authentication. - request.RedirectToProvider(); - } - } catch (ProtocolException ex) { - // The user probably entered an Identifier that - // was not a valid OpenID endpoint. - this.openidValidator.Text = ex.Message; - this.openidValidator.IsValid = false; - } + // Send your visitor to their Provider for authentication. + await request.RedirectToProviderAsync(new HttpContextWrapper(Context), Response.ClientDisconnectedToken); + } + } catch (ProtocolException ex) { + // The user probably entered an Identifier that + // was not a valid OpenID endpoint. + this.openidValidator.Text = ex.Message; + this.openidValidator.IsValid = false; + } + })); } protected void Page_Load(object sender, EventArgs e) { - this.openIdBox.Focus(); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + this.openIdBox.Focus(); - // For debugging/testing, we allow remote clearing of all associations... - // NOT a good idea on a production site. - if (Request.QueryString["clearAssociations"] == "1") { - Application.Remove("DotNetOpenAuth.OpenId.RelyingParty.OpenIdRelyingParty.ApplicationStore"); + // For debugging/testing, we allow remote clearing of all associations... + // NOT a good idea on a production site. + if (Request.QueryString["clearAssociations"] == "1") { + Application.Remove("DotNetOpenAuth.OpenId.RelyingParty.OpenIdRelyingParty.ApplicationStore"); - // Force a redirect now to prevent the user from logging in while associations - // are constantly being cleared. - UriBuilder builder = new UriBuilder(Request.Url); - builder.Query = null; - Response.Redirect(builder.Uri.AbsoluteUri); - } + // Force a redirect now to prevent the user from logging in while associations + // are constantly being cleared. + UriBuilder builder = new UriBuilder(Request.Url); + builder.Query = null; + Response.Redirect(builder.Uri.AbsoluteUri); + } - OpenIdRelyingParty openid = this.createRelyingParty(); - var response = openid.GetResponse(); - if (response != null) { - switch (response.Status) { - case AuthenticationStatus.Authenticated: - // This is where you would look for any OpenID extension responses included - // in the authentication assertion. - var claimsResponse = response.GetExtension<ClaimsResponse>(); - State.ProfileFields = claimsResponse; + OpenIdRelyingParty openid = this.createRelyingParty(); + var response = await openid.GetResponseAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (response != null) { + switch (response.Status) { + case AuthenticationStatus.Authenticated: + // This is where you would look for any OpenID extension responses included + // in the authentication assertion. + var claimsResponse = response.GetExtension<ClaimsResponse>(); + State.ProfileFields = claimsResponse; - // Store off the "friendly" username to display -- NOT for username lookup - State.FriendlyLoginName = response.FriendlyIdentifierForDisplay; + // Store off the "friendly" username to display -- NOT for username lookup + State.FriendlyLoginName = response.FriendlyIdentifierForDisplay; - // Use FormsAuthentication to tell ASP.NET that the user is now logged in, - // with the OpenID Claimed Identifier as their username. - FormsAuthentication.RedirectFromLoginPage(response.ClaimedIdentifier, false); - break; - case AuthenticationStatus.Canceled: - this.loginCanceledLabel.Visible = true; - break; - case AuthenticationStatus.Failed: - this.loginFailedLabel.Visible = true; - break; + // Use FormsAuthentication to tell ASP.NET that the user is now logged in, + // with the OpenID Claimed Identifier as their username. + FormsAuthentication.RedirectFromLoginPage(response.ClaimedIdentifier, false); + break; + case AuthenticationStatus.Canceled: + this.loginCanceledLabel.Visible = true; + break; + case AuthenticationStatus.Failed: + this.loginFailedLabel.Visible = true; + break; - // We don't need to handle SetupRequired because we're not setting - // IAuthenticationRequest.Mode to immediate mode. - ////case AuthenticationStatus.SetupRequired: - //// break; - } - } + // We don't need to handle SetupRequired because we're not setting + // IAuthenticationRequest.Mode to immediate mode. + ////case AuthenticationStatus.SetupRequired: + //// break; + } + } + })); } private OpenIdRelyingParty createRelyingParty() { diff --git a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.designer.cs b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.designer.cs index 088e305..d180211 100644 --- a/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.designer.cs +++ b/samples/OpenIdRelyingPartyWebForms/loginProgrammatic.aspx.designer.cs @@ -1,10 +1,9 @@ //------------------------------------------------------------------------------ // <auto-generated> // This code was generated by a tool. -// Runtime Version:2.0.50727.4927 // // Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. +// the code is regenerated. // </auto-generated> //------------------------------------------------------------------------------ diff --git a/samples/OpenIdRelyingPartyWebForms/packages.config b/samples/OpenIdRelyingPartyWebForms/packages.config index 6562527..8e40260 100644 --- a/samples/OpenIdRelyingPartyWebForms/packages.config +++ b/samples/OpenIdRelyingPartyWebForms/packages.config @@ -1,4 +1,5 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OpenIdRelyingPartyWebFormsVB/Global.asax.vb b/samples/OpenIdRelyingPartyWebFormsVB/Global.asax.vb index 257e11a..97b0d51 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/Global.asax.vb +++ b/samples/OpenIdRelyingPartyWebFormsVB/Global.asax.vb @@ -4,7 +4,6 @@ Imports System.Configuration Imports System.IO Imports System.Text Imports System.Web -Imports DotNetOpenAuth.ApplicationBlock Imports OpenIdRelyingPartyWebFormsVB Public Class Global_asax diff --git a/samples/OpenIdRelyingPartyWebFormsVB/Login.aspx b/samples/OpenIdRelyingPartyWebFormsVB/Login.aspx index c28611e..25538e8 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/Login.aspx +++ b/samples/OpenIdRelyingPartyWebFormsVB/Login.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="vb" AutoEventWireup="false" CodeBehind="Login.aspx.vb" Inherits="OpenIdRelyingPartyWebFormsVB.Login" +<%@ Page Language="vb" AutoEventWireup="false" CodeBehind="Login.aspx.vb" Inherits="OpenIdRelyingPartyWebFormsVB.Login" Async="true" ValidateRequest="false" MasterPageFile="~/Site.Master" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.RelyingParty.UI" Namespace="DotNetOpenAuth.OpenId.RelyingParty" TagPrefix="rp" %> diff --git a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx index 7f1fa0e..becc9a0 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx +++ b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="vb" AutoEventWireup="true" CodeBehind="loginProgrammatic.aspx.vb" +<%@ Page Language="vb" AutoEventWireup="true" CodeBehind="loginProgrammatic.aspx.vb" Async="true" Inherits="OpenIdRelyingPartyWebFormsVB.LoginProgrammatic" MasterPageFile="~/Site.Master" %> <asp:Content ID="Content1" runat="server" ContentPlaceHolderID="Main"> <h2>Login Page </h2> diff --git a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.designer.vb b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.designer.vb index 907fcda..e747a88 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.designer.vb +++ b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.designer.vb @@ -1,10 +1,9 @@ '------------------------------------------------------------------------------ ' <auto-generated> ' This code was generated by a tool. -' Runtime Version:2.0.50727.4927 ' ' Changes to this file may cause incorrect behavior and will be lost if -' the code is regenerated. +' the code is regenerated. ' </auto-generated> '------------------------------------------------------------------------------ @@ -12,7 +11,6 @@ Option Strict On Option Explicit On - Partial Public Class LoginProgrammatic '''<summary> diff --git a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.vb b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.vb index 6cac182..b3c1620 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.vb +++ b/samples/OpenIdRelyingPartyWebFormsVB/LoginProgrammatic.aspx.vb @@ -1,4 +1,5 @@ Imports System.Net +Imports System.Threading Imports System.Web.Security Imports DotNetOpenAuth.Messaging Imports DotNetOpenAuth.OpenId @@ -15,13 +16,13 @@ Public Class LoginProgrammatic args.IsValid = Identifier.IsValid(args.Value) End Sub - Protected Sub loginButton_Click(ByVal sender As Object, ByVal e As EventArgs) + Protected Async Sub loginButton_Click(ByVal sender As Object, ByVal e As EventArgs) If Not Me.Page.IsValid Then Return ' don't login if custom validation failed. End If Try - Dim request As IAuthenticationRequest = relyingParty.CreateRequest(Me.openIdBox.Text) + Dim request As IAuthenticationRequest = Await relyingParty.CreateRequestAsync(Me.openIdBox.Text) ' This is where you would add any OpenID extensions you wanted ' to include in the authentication request. request.AddExtension(New ClaimsRequest() With { _ @@ -32,7 +33,7 @@ Public Class LoginProgrammatic .TimeZone = DemandLevel.Require _ }) ' Send your visitor to their Provider for authentication. - request.RedirectToProvider() + Await request.RedirectToProviderAsync() Catch ex As ProtocolException ' The user probably entered an Identifier that ' was not a valid OpenID endpoint. @@ -41,7 +42,7 @@ Public Class LoginProgrammatic End Try End Sub - Protected Sub Page_Load(ByVal sender As Object, ByVal e As EventArgs) Handles Me.Load + Protected Async Sub Page_Load(ByVal sender As Object, ByVal e As EventArgs) Handles Me.Load Me.openIdBox.Focus() ' For debugging/testing, we allow remote clearing of all associations... ' NOT a good idea on a production site. @@ -53,7 +54,7 @@ Public Class LoginProgrammatic builder.Query = Nothing Me.Response.Redirect(builder.Uri.AbsoluteUri) End If - Dim response As IAuthenticationResponse = relyingParty.GetResponse + Dim response As IAuthenticationResponse = Await relyingParty.GetResponseAsync(New HttpRequestWrapper(Request)) If response IsNot Nothing Then Select Case response.Status Case AuthenticationStatus.Authenticated diff --git a/samples/OpenIdRelyingPartyWebFormsVB/OpenIdRelyingPartyWebFormsVB.vbproj b/samples/OpenIdRelyingPartyWebFormsVB/OpenIdRelyingPartyWebFormsVB.vbproj index c044f4c..75d0490 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/OpenIdRelyingPartyWebFormsVB.vbproj +++ b/samples/OpenIdRelyingPartyWebFormsVB/OpenIdRelyingPartyWebFormsVB.vbproj @@ -64,6 +64,8 @@ <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web.ApplicationServices" /> <Reference Include="System.Web.DynamicData" /> <Reference Include="System.Web.Entity" /> @@ -216,10 +218,6 @@ <Project>{3896A32A-E876-4C23-B9B8-78E17D134CD3}</Project> <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> - <ProjectReference Include="..\DotNetOpenAuth.ApplicationBlock\DotNetOpenAuth.ApplicationBlock.csproj"> - <Project>{AA78D112-D889-414B-A7D4-467B34C7B663}</Project> - <Name>DotNetOpenAuth.ApplicationBlock</Name> - </ProjectReference> </ItemGroup> <ItemGroup> <Folder Include="App_Data\" /> diff --git a/samples/OpenIdRelyingPartyWebFormsVB/Web.config b/samples/OpenIdRelyingPartyWebFormsVB/Web.config index b849324..7f4fb2f 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/Web.config +++ b/samples/OpenIdRelyingPartyWebFormsVB/Web.config @@ -66,18 +66,16 @@ <!-- Google sign-up: https://www.google.com/accounts/ManageDomains --> <add key="googleConsumerKey" value="demo.dotnetopenauth.net"/> <add key="googleConsumerSecret" value="5Yv1TfKm1551QrXZ9GpqepeD"/> + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <system.web> + <httpRuntime targetFramework="4.5" /> <!--<sessionState cookieless="true" />--> - <compilation debug="true" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="true" targetFramework="4.5" /> <customErrors mode="RemoteOnly"/> <authentication mode="Forms"> - <forms name="OpenIdRelyingPartyVBSession"/> <!-- named cookie prevents conflicts with other samples --> + <forms name="OpenIdRelyingPartyVBSession" loginUrl="loginProgrammatic.aspx"/> <!-- named cookie prevents conflicts with other samples --> </authentication> <trace enabled="false" writeToDiagnosticsTrace="true" /> <!-- Trust level discussion: diff --git a/samples/OpenIdRelyingPartyWebFormsVB/packages.config b/samples/OpenIdRelyingPartyWebFormsVB/packages.config index 6562527..8e40260 100644 --- a/samples/OpenIdRelyingPartyWebFormsVB/packages.config +++ b/samples/OpenIdRelyingPartyWebFormsVB/packages.config @@ -1,4 +1,5 @@ <?xml version="1.0" encoding="utf-8"?> <packages> <package id="log4net" version="2.0.0" targetFramework="net45" /> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> </packages>
\ No newline at end of file diff --git a/samples/OpenIdWebRingSsoProvider/Code/Util.cs b/samples/OpenIdWebRingSsoProvider/Code/Util.cs index 5599b73..13ecf41 100644 --- a/samples/OpenIdWebRingSsoProvider/Code/Util.cs +++ b/samples/OpenIdWebRingSsoProvider/Code/Util.cs @@ -7,6 +7,8 @@ namespace OpenIdWebRingSsoProvider.Code { using System; using System.Configuration; + using System.Threading; + using System.Threading.Tasks; using System.Web; using DotNetOpenAuth.OpenId; using DotNetOpenAuth.OpenId.Extensions.AttributeExchange; @@ -50,9 +52,10 @@ namespace OpenIdWebRingSsoProvider.Code { return new Uri(HttpContext.Current.Request.Url, HttpContext.Current.Response.ApplyAppPathModifier("~/user.aspx/" + username)); } - internal static void ProcessAuthenticationChallenge(IAuthenticationRequest idrequest) { + internal static async Task ProcessAuthenticationChallengeAsync(IAuthenticationRequest idrequest, CancellationToken cancellationToken) { // Verify that RP discovery is successful. - if (idrequest.IsReturnUrlDiscoverable(ProviderEndpoint.Provider.Channel.WebRequestHandler) != RelyingPartyDiscoveryResult.Success) { + var providerEndpoint = new ProviderEndpoint(); + if (await idrequest.IsReturnUrlDiscoverableAsync(providerEndpoint.Provider.Channel.HostFactories, cancellationToken) != RelyingPartyDiscoveryResult.Success) { idrequest.IsAuthenticated = false; return; } diff --git a/samples/OpenIdWebRingSsoProvider/Default.aspx b/samples/OpenIdWebRingSsoProvider/Default.aspx index 5e392c5..d3c4e05 100644 --- a/samples/OpenIdWebRingSsoProvider/Default.aspx +++ b/samples/OpenIdWebRingSsoProvider/Default.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Default.aspx.cs" Inherits="OpenIdWebRingSsoProvider._Default" %> +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Default.aspx.cs" Inherits="OpenIdWebRingSsoProvider._Default" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.UI" Namespace="DotNetOpenAuth" TagPrefix="openid" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> diff --git a/samples/OpenIdWebRingSsoProvider/Default.aspx.cs b/samples/OpenIdWebRingSsoProvider/Default.aspx.cs index d7e5310..6a930bd 100644 --- a/samples/OpenIdWebRingSsoProvider/Default.aspx.cs +++ b/samples/OpenIdWebRingSsoProvider/Default.aspx.cs @@ -5,18 +5,28 @@ using System.Web; using System.Web.UI; using System.Web.UI.WebControls; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId.Provider; using OpenIdWebRingSsoProvider.Code; public partial class _Default : System.Web.UI.Page { protected void Page_Load(object sender, EventArgs e) { - // The user may have just completed a login. If they're logged in, see if we can complete the OpenID login. - if (User.Identity.IsAuthenticated && ProviderEndpoint.PendingAuthenticationRequest != null) { - Util.ProcessAuthenticationChallenge(ProviderEndpoint.PendingAuthenticationRequest); - if (ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated.HasValue) { - ProviderEndpoint.SendResponse(); - } - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + // The user may have just completed a login. If they're logged in, see if we can complete the OpenID login. + if (User.Identity.IsAuthenticated && ProviderEndpoint.PendingAuthenticationRequest != null) { + await + Util.ProcessAuthenticationChallengeAsync( + ProviderEndpoint.PendingAuthenticationRequest, Response.ClientDisconnectedToken); + if (ProviderEndpoint.PendingAuthenticationRequest.IsAuthenticated.HasValue) { + var providerEndpoint = new ProviderEndpoint(); + var responseMessage = await providerEndpoint.PrepareResponseAsync(this.Response.ClientDisconnectedToken); + await responseMessage.SendAsync(new HttpContextWrapper(this.Context), this.Response.ClientDisconnectedToken); + this.Context.Response.End(); + } + } + })); } } } diff --git a/samples/OpenIdWebRingSsoProvider/Login.aspx b/samples/OpenIdWebRingSsoProvider/Login.aspx index 336b8ad..3c0b4e6 100644 --- a/samples/OpenIdWebRingSsoProvider/Login.aspx +++ b/samples/OpenIdWebRingSsoProvider/Login.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Login.aspx.cs" Inherits="OpenIdWebRingSsoProvider.Login" %> +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Login.aspx.cs" Inherits="OpenIdWebRingSsoProvider.Login" Async="true" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> <html xmlns="http://www.w3.org/1999/xhtml"> diff --git a/samples/OpenIdWebRingSsoProvider/Login.aspx.cs b/samples/OpenIdWebRingSsoProvider/Login.aspx.cs index 584cff7..10e5aad 100644 --- a/samples/OpenIdWebRingSsoProvider/Login.aspx.cs +++ b/samples/OpenIdWebRingSsoProvider/Login.aspx.cs @@ -5,6 +5,7 @@ using System.Web; using System.Web.UI; using System.Web.UI.WebControls; + using DotNetOpenAuth.Messaging; using DotNetOpenAuth.OpenId.Provider; using OpenIdWebRingSsoProvider.Code; @@ -35,11 +36,18 @@ } protected void cancelButton_Click(object sender, EventArgs e) { - var req = ProviderEndpoint.PendingAuthenticationRequest; - if (req != null) { - req.IsAuthenticated = false; - ProviderEndpoint.SendResponse(); - } + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + var req = ProviderEndpoint.PendingAuthenticationRequest; + if (req != null) { + req.IsAuthenticated = false; + var providerEndpoint = new ProviderEndpoint(); + var response = await providerEndpoint.PrepareResponseAsync(Response.ClientDisconnectedToken); + await response.SendAsync(new HttpContextWrapper(this.Context), Response.ClientDisconnectedToken); + this.Context.Response.End(); + } + })); } } }
\ No newline at end of file diff --git a/samples/OpenIdWebRingSsoProvider/OpenIdWebRingSsoProvider.csproj b/samples/OpenIdWebRingSsoProvider/OpenIdWebRingSsoProvider.csproj index 69c73ed..25ab7ac 100644 --- a/samples/OpenIdWebRingSsoProvider/OpenIdWebRingSsoProvider.csproj +++ b/samples/OpenIdWebRingSsoProvider/OpenIdWebRingSsoProvider.csproj @@ -9,6 +9,7 @@ <IISExpressAnonymousAuthentication>disabled</IISExpressAnonymousAuthentication> <IISExpressWindowsAuthentication>disabled</IISExpressWindowsAuthentication> <IISExpressUseClassicPipelineMode>false</IISExpressUseClassicPipelineMode> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> </PropertyGroup> <PropertyGroup> <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> @@ -52,6 +53,8 @@ <Reference Include="System" /> <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web.DynamicData" /> <Reference Include="System.Web.Entity" /> <Reference Include="System.Drawing" /> @@ -136,6 +139,9 @@ <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> </ItemGroup> + <ItemGroup> + <Content Include="packages.config" /> + </ItemGroup> <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" Condition="false" /> @@ -165,4 +171,5 @@ </VisualStudio> </ProjectExtensions> <Import Project="$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))\EnlistmentInfo.targets" Condition=" '$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))' != '' " /> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> </Project>
\ No newline at end of file diff --git a/samples/OpenIdWebRingSsoProvider/Server.aspx b/samples/OpenIdWebRingSsoProvider/Server.aspx index 31373be..b0c0bdd 100644 --- a/samples/OpenIdWebRingSsoProvider/Server.aspx +++ b/samples/OpenIdWebRingSsoProvider/Server.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Server.aspx.cs" Inherits="OpenIdWebRingSsoProvider.Server" ValidateRequest="false" %> +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Server.aspx.cs" Inherits="OpenIdWebRingSsoProvider.Server" ValidateRequest="false" Async="true" %> <%@ Register Assembly="DotNetOpenAuth.OpenId.Provider.UI" Namespace="DotNetOpenAuth.OpenId.Provider" TagPrefix="openid" %> diff --git a/samples/OpenIdWebRingSsoProvider/Server.aspx.cs b/samples/OpenIdWebRingSsoProvider/Server.aspx.cs index 101e608..805e38f 100644 --- a/samples/OpenIdWebRingSsoProvider/Server.aspx.cs +++ b/samples/OpenIdWebRingSsoProvider/Server.aspx.cs @@ -13,7 +13,11 @@ } protected void providerEndpoint1_AuthenticationChallenge(object sender, AuthenticationChallengeEventArgs e) { - Util.ProcessAuthenticationChallenge(e.Request); + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + await Util.ProcessAuthenticationChallengeAsync(e.Request, ct); + })); } } } diff --git a/samples/OpenIdWebRingSsoProvider/Web.config b/samples/OpenIdWebRingSsoProvider/Web.config index 3304e97..901ba5f 100644 --- a/samples/OpenIdWebRingSsoProvider/Web.config +++ b/samples/OpenIdWebRingSsoProvider/Web.config @@ -57,21 +57,20 @@ <add key="whitelistedRealms" value="http://localhost:39165/;http://othertrustedrealm/"/> <!-- Set ImplicitAuth to true when using Windows auth, or false for FormsAuthentication --> <add key="ImplicitAuth" value="true"/> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <connectionStrings/> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this affects performance, set this value to true only during development. --> - <compilation debug="false" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - </compilation> + <compilation debug="false" targetFramework="4.0" /> <!-- this sample-only provider uses the hard-coded list of users in the App_Data\Users.xml file --> <membership defaultProvider="AspNetReadOnlyXmlMembershipProvider"> <providers> diff --git a/samples/OpenIdWebRingSsoProvider/packages.config b/samples/OpenIdWebRingSsoProvider/packages.config new file mode 100644 index 0000000..d8ffcb7 --- /dev/null +++ b/samples/OpenIdWebRingSsoProvider/packages.config @@ -0,0 +1,4 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> +</packages>
\ No newline at end of file diff --git a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx index 2e7df2e..e16cf79 100644 --- a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx +++ b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx @@ -1,4 +1,4 @@ -<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Login.aspx.cs" Inherits="OpenIdWebRingSsoRelyingParty.Login" %> +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Login.aspx.cs" Inherits="OpenIdWebRingSsoRelyingParty.Login" Async="true" %> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> <html xmlns="http://www.w3.org/1999/xhtml"> diff --git a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.cs b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.cs index 7f7f91e..d1b1413 100644 --- a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.cs +++ b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.cs @@ -22,71 +22,77 @@ } protected void Page_Load(object sender, EventArgs e) { - UriBuilder returnToBuilder = new UriBuilder(Request.Url); - returnToBuilder.Path = "/login.aspx"; - returnToBuilder.Query = null; - returnToBuilder.Fragment = null; - Uri returnTo = returnToBuilder.Uri; - returnToBuilder.Path = "/"; - Realm realm = returnToBuilder.Uri; + this.RegisterAsyncTask( + new PageAsyncTask( + async ct => { + UriBuilder returnToBuilder = new UriBuilder(Request.Url); + returnToBuilder.Path = "/login.aspx"; + returnToBuilder.Query = null; + returnToBuilder.Fragment = null; + Uri returnTo = returnToBuilder.Uri; + returnToBuilder.Path = "/"; + Realm realm = returnToBuilder.Uri; - var response = relyingParty.GetResponse(); - if (response == null) { - if (Request.QueryString["ReturnUrl"] != null && User.Identity.IsAuthenticated) { - // The user must have been directed here because he has insufficient - // permissions to access something. - this.MultiView1.ActiveViewIndex = 1; - } else { - // Because this is a sample of a controlled SSO environment, - // we don't ask the user which Provider to use... we just send - // them straight off to the one Provider we trust. - var request = relyingParty.CreateRequest( - ConfigurationManager.AppSettings["SsoProviderOPIdentifier"], - realm, - returnTo); - var fetchRequest = new FetchRequest(); - fetchRequest.Attributes.AddOptional(RolesAttribute); - request.AddExtension(fetchRequest); - request.RedirectToProvider(); - } - } else { - switch (response.Status) { - case AuthenticationStatus.Canceled: - this.errorLabel.Text = "Login canceled."; - break; - case AuthenticationStatus.Failed: - this.errorLabel.Text = HttpUtility.HtmlEncode(response.Exception.Message); - break; - case AuthenticationStatus.Authenticated: - IList<string> roles = null; - var fetchResponse = response.GetExtension<FetchResponse>(); - if (fetchResponse != null) { - if (fetchResponse.Attributes.Contains(RolesAttribute)) { - roles = fetchResponse.Attributes[RolesAttribute].Values; + var response = + await relyingParty.GetResponseAsync(new HttpRequestWrapper(Request), Response.ClientDisconnectedToken); + if (response == null) { + if (Request.QueryString["ReturnUrl"] != null && User.Identity.IsAuthenticated) { + // The user must have been directed here because he has insufficient + // permissions to access something. + this.MultiView1.ActiveViewIndex = 1; + } else { + // Because this is a sample of a controlled SSO environment, + // we don't ask the user which Provider to use... we just send + // them straight off to the one Provider we trust. + var request = + await + relyingParty.CreateRequestAsync( + ConfigurationManager.AppSettings["SsoProviderOPIdentifier"], realm, returnTo, Response.ClientDisconnectedToken); + var fetchRequest = new FetchRequest(); + fetchRequest.Attributes.AddOptional(RolesAttribute); + request.AddExtension(fetchRequest); + await request.RedirectToProviderAsync(new HttpContextWrapper(Context), Response.ClientDisconnectedToken); } - } - if (roles == null) { - roles = new List<string>(0); - } + } else { + switch (response.Status) { + case AuthenticationStatus.Canceled: + this.errorLabel.Text = "Login canceled."; + break; + case AuthenticationStatus.Failed: + this.errorLabel.Text = HttpUtility.HtmlEncode(response.Exception.Message); + break; + case AuthenticationStatus.Authenticated: + IList<string> roles = null; + var fetchResponse = response.GetExtension<FetchResponse>(); + if (fetchResponse != null) { + if (fetchResponse.Attributes.Contains(RolesAttribute)) { + roles = fetchResponse.Attributes[RolesAttribute].Values; + } + } + if (roles == null) { + roles = new List<string>(0); + } - // Apply the roles to this auth ticket - const int TimeoutInMinutes = 100; // TODO: look up the right value from the web.config file - var ticket = new FormsAuthenticationTicket( - 2, - response.ClaimedIdentifier, - DateTime.Now, - DateTime.Now.AddMinutes(TimeoutInMinutes), - false, // non-persistent, since login is automatic and we wanted updated roles - string.Join(";", roles.ToArray())); + // Apply the roles to this auth ticket + const int TimeoutInMinutes = 100; // TODO: look up the right value from the web.config file + var ticket = new FormsAuthenticationTicket( + 2, + response.ClaimedIdentifier, + DateTime.Now, + DateTime.Now.AddMinutes(TimeoutInMinutes), + false, + // non-persistent, since login is automatic and we wanted updated roles + string.Join(";", roles.ToArray())); - HttpCookie cookie = new HttpCookie(FormsAuthentication.FormsCookieName, FormsAuthentication.Encrypt(ticket)); - Response.SetCookie(cookie); - Response.Redirect(Request.QueryString["ReturnUrl"] ?? FormsAuthentication.DefaultUrl); - break; - default: - break; - } - } + HttpCookie cookie = new HttpCookie(FormsAuthentication.FormsCookieName, FormsAuthentication.Encrypt(ticket)); + Response.SetCookie(cookie); + Response.Redirect(Request.QueryString["ReturnUrl"] ?? FormsAuthentication.DefaultUrl); + break; + default: + break; + } + } + })); } protected void retryButton_Click(object sender, EventArgs e) { diff --git a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.designer.cs b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.designer.cs index 7ed2669..3e6bbf2 100644 --- a/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.designer.cs +++ b/samples/OpenIdWebRingSsoRelyingParty/Login.aspx.designer.cs @@ -1,10 +1,9 @@ //------------------------------------------------------------------------------ // <auto-generated> // This code was generated by a tool. -// Runtime Version:2.0.50727.4927 // // Changes to this file may cause incorrect behavior and will be lost if -// the code is regenerated. +// the code is regenerated. // </auto-generated> //------------------------------------------------------------------------------ diff --git a/samples/OpenIdWebRingSsoRelyingParty/OpenIdWebRingSsoRelyingParty.csproj b/samples/OpenIdWebRingSsoRelyingParty/OpenIdWebRingSsoRelyingParty.csproj index cd027b2..9eaeb65 100644 --- a/samples/OpenIdWebRingSsoRelyingParty/OpenIdWebRingSsoRelyingParty.csproj +++ b/samples/OpenIdWebRingSsoRelyingParty/OpenIdWebRingSsoRelyingParty.csproj @@ -9,6 +9,7 @@ <IISExpressAnonymousAuthentication /> <IISExpressWindowsAuthentication /> <IISExpressUseClassicPipelineMode /> + <SolutionDir Condition="$(SolutionDir) == '' Or $(SolutionDir) == '*Undefined*'">..\..\src\</SolutionDir> </PropertyGroup> <PropertyGroup> <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> @@ -53,6 +54,8 @@ <Reference Include="System.Data" /> <Reference Include="System.Data.DataSetExtensions" /> <Reference Include="System.Drawing" /> + <Reference Include="System.Net.Http" /> + <Reference Include="System.Net.Http.WebRequest" /> <Reference Include="System.Web" /> <Reference Include="System.Web.ApplicationServices" /> <Reference Include="System.Web.DynamicData" /> @@ -74,18 +77,21 @@ <ItemGroup> <Compile Include="Admin\Default.aspx.cs"> <DependentUpon>Default.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> </Compile> <Compile Include="Admin\Default.aspx.designer.cs"> <DependentUpon>Default.aspx</DependentUpon> </Compile> <Compile Include="Default.aspx.cs"> <DependentUpon>Default.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> </Compile> <Compile Include="Default.aspx.designer.cs"> <DependentUpon>Default.aspx</DependentUpon> </Compile> <Compile Include="Login.aspx.cs"> <DependentUpon>Login.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> </Compile> <Compile Include="Login.aspx.designer.cs"> <DependentUpon>Login.aspx</DependentUpon> @@ -118,6 +124,9 @@ <Name>DotNetOpenAuth.OpenId</Name> </ProjectReference> </ItemGroup> + <ItemGroup> + <Content Include="packages.config" /> + </ItemGroup> <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> <Import Project="$(VSToolsPath)\WebApplications\Microsoft.WebApplication.targets" Condition="'$(VSToolsPath)' != ''" /> <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" Condition="false" /> @@ -147,4 +156,5 @@ </VisualStudio> </ProjectExtensions> <Import Project="$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))\EnlistmentInfo.targets" Condition=" '$([MSBuild]::GetDirectoryNameOfFileAbove($(MSBuildProjectDirectory), EnlistmentInfo.targets))' != '' " /> + <Import Project="$(SolutionDir)\.nuget\nuget.targets" /> </Project>
\ No newline at end of file diff --git a/samples/OpenIdWebRingSsoRelyingParty/Web.config b/samples/OpenIdWebRingSsoRelyingParty/Web.config index b64f037..6b645c5 100644 --- a/samples/OpenIdWebRingSsoRelyingParty/Web.config +++ b/samples/OpenIdWebRingSsoRelyingParty/Web.config @@ -64,22 +64,20 @@ <appSettings> <add key="SsoProviderOPIdentifier" value="http://localhost:39167/" /> <add key="SsoProviderOPEndpoint" value="http://localhost:39167/server.aspx" /> + + <add key="ValidationSettings:UnobtrusiveValidationMode" value="None" /> </appSettings> <connectionStrings/> <system.web> + <httpRuntime targetFramework="4.5" /> <!-- Set compilation debug="true" to insert debugging symbols into the compiled page. Because this affects performance, set this value to true only during development. --> - <compilation debug="false" targetFramework="4.0"> - <assemblies> - <remove assembly="DotNetOpenAuth.Contracts"/> - </assemblies> - - </compilation> + <compilation debug="false" targetFramework="4.0" /> <!-- The <authentication> section enables configuration of the security authentication mode used by diff --git a/samples/OpenIdWebRingSsoRelyingParty/packages.config b/samples/OpenIdWebRingSsoRelyingParty/packages.config new file mode 100644 index 0000000..d8ffcb7 --- /dev/null +++ b/samples/OpenIdWebRingSsoRelyingParty/packages.config @@ -0,0 +1,4 @@ +<?xml version="1.0" encoding="utf-8"?> +<packages> + <package id="Microsoft.Net.Http" version="2.0.20710.0" targetFramework="net45" /> +</packages>
\ No newline at end of file |