diff options
author | Andrew Arnott <andrewarnott@gmail.com> | 2013-05-05 14:50:07 -0700 |
---|---|---|
committer | Andrew Arnott <andrewarnott@gmail.com> | 2013-05-05 14:50:07 -0700 |
commit | a1839a927b8e396c71496e6ec18bd91f107a860b (patch) | |
tree | 7b868007ada35c5da3b25188c9c88bf028bd4bd6 /samples/TestAzureAD/Scripts | |
parent | 7edb0a63ef796af300c670ce90df8e7670930a10 (diff) | |
parent | 789f14adf18e65ab416b60341bfbecc6577a1c37 (diff) | |
download | DotNetOpenAuth-a1839a927b8e396c71496e6ec18bd91f107a860b.zip DotNetOpenAuth-a1839a927b8e396c71496e6ec18bd91f107a860b.tar.gz DotNetOpenAuth-a1839a927b8e396c71496e6ec18bd91f107a860b.tar.bz2 |
Merge branch 'v4.3' of git://github.com/gbablani/DotNetOpenAuth into gbablani-v4.3
Diffstat (limited to 'samples/TestAzureAD/Scripts')
28 files changed, 28750 insertions, 0 deletions
diff --git a/samples/TestAzureAD/Scripts/WebForms/DetailsView.js b/samples/TestAzureAD/Scripts/WebForms/DetailsView.js new file mode 100644 index 0000000..a36a498 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/DetailsView.js @@ -0,0 +1,34 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/DetailsView.js +function DetailsView() { + this.pageIndex = null; + this.dataKeys = null; + this.createPropertyString = DetailsView_createPropertyString; + this.setStateField = DetailsView_setStateValue; + this.getHiddenFieldContents = DetailsView_getHiddenFieldContents; + this.stateField = null; + this.panelElement = null; + this.callback = null; +} +function DetailsView_createPropertyString() { + return createPropertyStringFromValues_DetailsView(this.pageIndex, this.dataKeys); +} +function DetailsView_setStateValue() { + this.stateField.value = this.createPropertyString(); +} +function DetailsView_OnCallback (result, context) { + var value = new String(result); + var valsArray = value.split("|"); + var innerHtml = valsArray[2]; + for (var i = 3; i < valsArray.length; i++) { + innerHtml += "|" + valsArray[i]; + } + context.panelElement.innerHTML = innerHtml; + context.stateField.value = createPropertyStringFromValues_DetailsView(valsArray[0], valsArray[1]); +} +function DetailsView_getHiddenFieldContents(arg) { + return arg + "|" + this.stateField.value; +} +function createPropertyStringFromValues_DetailsView(pageIndex, dataKeys) { + var value = new Array(pageIndex, dataKeys); + return value.join("|"); +} diff --git a/samples/TestAzureAD/Scripts/WebForms/Focus.js b/samples/TestAzureAD/Scripts/WebForms/Focus.js new file mode 100644 index 0000000..2de90df --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/Focus.js @@ -0,0 +1,93 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/Focus.js +function WebForm_FindFirstFocusableChild(control) { + if (!control || !(control.tagName)) { + return null; + } + var tagName = control.tagName.toLowerCase(); + if (tagName == "undefined") { + return null; + } + var children = control.childNodes; + if (children) { + for (var i = 0; i < children.length; i++) { + try { + if (WebForm_CanFocus(children[i])) { + return children[i]; + } + else { + var focused = WebForm_FindFirstFocusableChild(children[i]); + if (WebForm_CanFocus(focused)) { + return focused; + } + } + } catch (e) { + } + } + } + return null; +} +function WebForm_AutoFocus(focusId) { + var targetControl; + if (__nonMSDOMBrowser) { + targetControl = document.getElementById(focusId); + } + else { + targetControl = document.all[focusId]; + } + var focused = targetControl; + if (targetControl && (!WebForm_CanFocus(targetControl)) ) { + focused = WebForm_FindFirstFocusableChild(targetControl); + } + if (focused) { + try { + focused.focus(); + if (__nonMSDOMBrowser) { + focused.scrollIntoView(false); + } + if (window.__smartNav) { + window.__smartNav.ae = focused.id; + } + } + catch (e) { + } + } +} +function WebForm_CanFocus(element) { + if (!element || !(element.tagName)) return false; + var tagName = element.tagName.toLowerCase(); + return (!(element.disabled) && + (!(element.type) || element.type.toLowerCase() != "hidden") && + WebForm_IsFocusableTag(tagName) && + WebForm_IsInVisibleContainer(element) + ); +} +function WebForm_IsFocusableTag(tagName) { + return (tagName == "input" || + tagName == "textarea" || + tagName == "select" || + tagName == "button" || + tagName == "a"); +} +function WebForm_IsInVisibleContainer(ctrl) { + var current = ctrl; + while((typeof(current) != "undefined") && (current != null)) { + if (current.disabled || + ( typeof(current.style) != "undefined" && + ( ( typeof(current.style.display) != "undefined" && + current.style.display == "none") || + ( typeof(current.style.visibility) != "undefined" && + current.style.visibility == "hidden") ) ) ) { + return false; + } + if (typeof(current.parentNode) != "undefined" && + current.parentNode != null && + current.parentNode != current && + current.parentNode.tagName.toLowerCase() != "body") { + current = current.parentNode; + } + else { + return true; + } + } + return true; +} diff --git a/samples/TestAzureAD/Scripts/WebForms/GridView.js b/samples/TestAzureAD/Scripts/WebForms/GridView.js new file mode 100644 index 0000000..e24c2d7 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/GridView.js @@ -0,0 +1,36 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/GridView.js +function GridView() { + this.pageIndex = null; + this.sortExpression = null; + this.sortDirection = null; + this.dataKeys = null; + this.createPropertyString = GridView_createPropertyString; + this.setStateField = GridView_setStateValue; + this.getHiddenFieldContents = GridView_getHiddenFieldContents; + this.stateField = null; + this.panelElement = null; + this.callback = null; +} +function GridView_createPropertyString() { + return createPropertyStringFromValues_GridView(this.pageIndex, this.sortDirection, this.sortExpression, this.dataKeys); +} +function GridView_setStateValue() { + this.stateField.value = this.createPropertyString(); +} +function GridView_OnCallback (result, context) { + var value = new String(result); + var valsArray = value.split("|"); + var innerHtml = valsArray[4]; + for (var i = 5; i < valsArray.length; i++) { + innerHtml += "|" + valsArray[i]; + } + context.panelElement.innerHTML = innerHtml; + context.stateField.value = createPropertyStringFromValues_GridView(valsArray[0], valsArray[1], valsArray[2], valsArray[3]); +} +function GridView_getHiddenFieldContents(arg) { + return arg + "|" + this.stateField.value; +} +function createPropertyStringFromValues_GridView(pageIndex, sortDirection, sortExpression, dataKeys) { + var value = new Array(pageIndex, sortDirection, sortExpression, dataKeys); + return value.join("|"); +} diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjax.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjax.js new file mode 100644 index 0000000..884acce --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjax.js @@ -0,0 +1,7 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjax.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjax.js +Function.__typeName="Function";Function.__class=true;Function.createCallback=function(b,a){return function(){var e=arguments.length;if(e>0){var d=[];for(var c=0;c<e;c++)d[c]=arguments[c];d[e]=a;return b.apply(this,d)}return b.call(this,a)}};Function.createDelegate=function(a,b){return function(){return b.apply(a,arguments)}};Function.emptyFunction=Function.emptyMethod=function(){};Function.validateParameters=function(c,b,a){return Function._validateParams(c,b,a)};Function._validateParams=function(g,e,c){var a,d=e.length;c=c||typeof c==="undefined";a=Function._validateParameterCount(g,e,c);if(a){a.popStackFrame();return a}for(var b=0,i=g.length;b<i;b++){var f=e[Math.min(b,d-1)],h=f.name;if(f.parameterArray)h+="["+(b-d+1)+"]";else if(!c&&b>=d)break;a=Function._validateParameter(g[b],f,h);if(a){a.popStackFrame();return a}}return null};Function._validateParameterCount=function(j,d,i){var a,c,b=d.length,e=j.length;if(e<b){var f=b;for(a=0;a<b;a++){var g=d[a];if(g.optional||g.parameterArray)f--}if(e<f)c=true}else if(i&&e>b){c=true;for(a=0;a<b;a++)if(d[a].parameterArray){c=false;break}}if(c){var h=Error.parameterCount();h.popStackFrame();return h}return null};Function._validateParameter=function(c,a,h){var b,g=a.type,l=!!a.integer,k=!!a.domElement,m=!!a.mayBeNull;b=Function._validateParameterType(c,g,l,k,m,h);if(b){b.popStackFrame();return b}var e=a.elementType,f=!!a.elementMayBeNull;if(g===Array&&typeof c!=="undefined"&&c!==null&&(e||!f)){var j=!!a.elementInteger,i=!!a.elementDomElement;for(var d=0;d<c.length;d++){var n=c[d];b=Function._validateParameterType(n,e,j,i,f,h+"["+d+"]");if(b){b.popStackFrame();return b}}}return null};Function._validateParameterType=function(b,c,k,j,h,d){var a,g;if(typeof b==="undefined")if(h)return null;else{a=Error.argumentUndefined(d);a.popStackFrame();return a}if(b===null)if(h)return null;else{a=Error.argumentNull(d);a.popStackFrame();return a}if(c&&c.__enum){if(typeof b!=="number"){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(b%1===0){var e=c.prototype;if(!c.__flags||b===0){for(g in e)if(e[g]===b)return null}else{var i=b;for(g in e){var f=e[g];if(f===0)continue;if((f&b)===f)i-=f;if(i===0)return null}}}a=Error.argumentOutOfRange(d,b,String.format(Sys.Res.enumInvalidValue,b,c.getName()));a.popStackFrame();return a}if(j&&(!Sys._isDomElement(b)||b.nodeType===3)){a=Error.argument(d,Sys.Res.argumentDomElement);a.popStackFrame();return a}if(c&&!Sys._isInstanceOfType(c,b)){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(c===Number&&k)if(b%1!==0){a=Error.argumentOutOfRange(d,b,Sys.Res.argumentInteger);a.popStackFrame();return a}return null};Error.__typeName="Error";Error.__class=true;Error.create=function(d,b){var a=new Error(d);a.message=d;if(b)for(var c in b)a[c]=b[c];a.popStackFrame();return a};Error.argument=function(a,c){var b="Sys.ArgumentException: "+(c?c:Sys.Res.argument);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentException",paramName:a});d.popStackFrame();return d};Error.argumentNull=function(a,c){var b="Sys.ArgumentNullException: "+(c?c:Sys.Res.argumentNull);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentNullException",paramName:a});d.popStackFrame();return d};Error.argumentOutOfRange=function(c,a,d){var b="Sys.ArgumentOutOfRangeException: "+(d?d:Sys.Res.argumentOutOfRange);if(c)b+="\n"+String.format(Sys.Res.paramName,c);if(typeof a!=="undefined"&&a!==null)b+="\n"+String.format(Sys.Res.actualValue,a);var e=Error.create(b,{name:"Sys.ArgumentOutOfRangeException",paramName:c,actualValue:a});e.popStackFrame();return e};Error.argumentType=function(d,c,b,e){var a="Sys.ArgumentTypeException: ";if(e)a+=e;else if(c&&b)a+=String.format(Sys.Res.argumentTypeWithTypes,c.getName(),b.getName());else a+=Sys.Res.argumentType;if(d)a+="\n"+String.format(Sys.Res.paramName,d);var f=Error.create(a,{name:"Sys.ArgumentTypeException",paramName:d,actualType:c,expectedType:b});f.popStackFrame();return f};Error.argumentUndefined=function(a,c){var b="Sys.ArgumentUndefinedException: "+(c?c:Sys.Res.argumentUndefined);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentUndefinedException",paramName:a});d.popStackFrame();return d};Error.format=function(a){var c="Sys.FormatException: "+(a?a:Sys.Res.format),b=Error.create(c,{name:"Sys.FormatException"});b.popStackFrame();return b};Error.invalidOperation=function(a){var c="Sys.InvalidOperationException: "+(a?a:Sys.Res.invalidOperation),b=Error.create(c,{name:"Sys.InvalidOperationException"});b.popStackFrame();return b};Error.notImplemented=function(a){var c="Sys.NotImplementedException: "+(a?a:Sys.Res.notImplemented),b=Error.create(c,{name:"Sys.NotImplementedException"});b.popStackFrame();return b};Error.parameterCount=function(a){var c="Sys.ParameterCountException: "+(a?a:Sys.Res.parameterCount),b=Error.create(c,{name:"Sys.ParameterCountException"});b.popStackFrame();return b};Error.prototype.popStackFrame=function(){if(typeof this.stack==="undefined"||this.stack===null||typeof this.fileName==="undefined"||this.fileName===null||typeof this.lineNumber==="undefined"||this.lineNumber===null)return;var a=this.stack.split("\n"),c=a[0],e=this.fileName+":"+this.lineNumber;while(typeof c!=="undefined"&&c!==null&&c.indexOf(e)===-1){a.shift();c=a[0]}var d=a[1];if(typeof d==="undefined"||d===null)return;var b=d.match(/@(.*):(\d+)$/);if(typeof b==="undefined"||b===null)return;this.fileName=b[1];this.lineNumber=parseInt(b[2]);a.shift();this.stack=a.join("\n")};Object.__typeName="Object";Object.__class=true;Object.getType=function(b){var a=b.constructor;if(!a||typeof a!=="function"||!a.__typeName||a.__typeName==="Object")return Object;return a};Object.getTypeName=function(a){return Object.getType(a).getName()};String.__typeName="String";String.__class=true;String.prototype.endsWith=function(a){return this.substr(this.length-a.length)===a};String.prototype.startsWith=function(a){return this.substr(0,a.length)===a};String.prototype.trim=function(){return this.replace(/^\s+|\s+$/g,"")};String.prototype.trimEnd=function(){return this.replace(/\s+$/,"")};String.prototype.trimStart=function(){return this.replace(/^\s+/,"")};String.format=function(){return String._toFormattedString(false,arguments)};String._toFormattedString=function(l,j){var c="",e=j[0];for(var a=0;true;){var f=e.indexOf("{",a),d=e.indexOf("}",a);if(f<0&&d<0){c+=e.slice(a);break}if(d>0&&(d<f||f<0)){c+=e.slice(a,d+1);a=d+2;continue}c+=e.slice(a,f);a=f+1;if(e.charAt(a)==="{"){c+="{";a++;continue}if(d<0)break;var h=e.substring(a,d),g=h.indexOf(":"),k=parseInt(g<0?h:h.substring(0,g),10)+1,i=g<0?"":h.substring(g+1),b=j[k];if(typeof b==="undefined"||b===null)b="";if(b.toFormattedString)c+=b.toFormattedString(i);else if(l&&b.localeFormat)c+=b.localeFormat(i);else if(b.format)c+=b.format(i);else c+=b.toString();a=d+1}return c};Boolean.__typeName="Boolean";Boolean.__class=true;Boolean.parse=function(b){var a=b.trim().toLowerCase();if(a==="false")return false;if(a==="true")return true};Date.__typeName="Date";Date.__class=true;Number.__typeName="Number";Number.__class=true;RegExp.__typeName="RegExp";RegExp.__class=true;if(!window)this.window=this;window.Type=Function;Type.prototype.callBaseMethod=function(a,d,b){var c=Sys._getBaseMethod(this,a,d);if(!b)return c.apply(a);else return c.apply(a,b)};Type.prototype.getBaseMethod=function(a,b){return Sys._getBaseMethod(this,a,b)};Type.prototype.getBaseType=function(){return typeof this.__baseType==="undefined"?null:this.__baseType};Type.prototype.getInterfaces=function(){var a=[],b=this;while(b){var c=b.__interfaces;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Array.contains(a,e))a[a.length]=e}b=b.__baseType}return a};Type.prototype.getName=function(){return typeof this.__typeName==="undefined"?"":this.__typeName};Type.prototype.implementsInterface=function(d){this.resolveInheritance();var c=d.getName(),a=this.__interfaceCache;if(a){var e=a[c];if(typeof e!=="undefined")return e}else a=this.__interfaceCache={};var b=this;while(b){var f=b.__interfaces;if(f)if(Array.indexOf(f,d)!==-1)return a[c]=true;b=b.__baseType}return a[c]=false};Type.prototype.inheritsFrom=function(b){this.resolveInheritance();var a=this.__baseType;while(a){if(a===b)return true;a=a.__baseType}return false};Type.prototype.initializeBase=function(a,b){this.resolveInheritance();if(this.__baseType)if(!b)this.__baseType.apply(a);else this.__baseType.apply(a,b);return a};Type.prototype.isImplementedBy=function(a){if(typeof a==="undefined"||a===null)return false;var b=Object.getType(a);return !!(b.implementsInterface&&b.implementsInterface(this))};Type.prototype.isInstanceOfType=function(a){return Sys._isInstanceOfType(this,a)};Type.prototype.registerClass=function(c,b,d){this.prototype.constructor=this;this.__typeName=c;this.__class=true;if(b){this.__baseType=b;this.__basePrototypePending=true}Sys.__upperCaseTypes[c.toUpperCase()]=this;if(d){this.__interfaces=[];for(var a=2,f=arguments.length;a<f;a++){var e=arguments[a];this.__interfaces.push(e)}}return this};Type.prototype.registerInterface=function(a){Sys.__upperCaseTypes[a.toUpperCase()]=this;this.prototype.constructor=this;this.__typeName=a;this.__interface=true;return this};Type.prototype.resolveInheritance=function(){if(this.__basePrototypePending){var b=this.__baseType;b.resolveInheritance();for(var a in b.prototype){var c=b.prototype[a];if(!this.prototype[a])this.prototype[a]=c}delete this.__basePrototypePending}};Type.getRootNamespaces=function(){return Array.clone(Sys.__rootNamespaces)};Type.isClass=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__class};Type.isInterface=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__interface};Type.isNamespace=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__namespace};Type.parse=function(typeName,ns){var fn;if(ns){fn=Sys.__upperCaseTypes[ns.getName().toUpperCase()+"."+typeName.toUpperCase()];return fn||null}if(!typeName)return null;if(!Type.__htClasses)Type.__htClasses={};fn=Type.__htClasses[typeName];if(!fn){fn=eval(typeName);Type.__htClasses[typeName]=fn}return fn};Type.registerNamespace=function(e){var d=window,c=e.split(".");for(var b=0;b<c.length;b++){var f=c[b],a=d[f];if(!a)a=d[f]={};if(!a.__namespace){if(b===0&&e!=="Sys")Sys.__rootNamespaces[Sys.__rootNamespaces.length]=a;a.__namespace=true;a.__typeName=c.slice(0,b+1).join(".");a.getName=function(){return this.__typeName}}d=a}};Type._checkDependency=function(c,a){var d=Type._registerScript._scripts,b=d?!!d[c]:false;if(typeof a!=="undefined"&&!b)throw Error.invalidOperation(String.format(Sys.Res.requiredScriptReferenceNotIncluded,a,c));return b};Type._registerScript=function(a,c){var b=Type._registerScript._scripts;if(!b)Type._registerScript._scripts=b={};if(b[a])throw Error.invalidOperation(String.format(Sys.Res.scriptAlreadyLoaded,a));b[a]=true;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Type._checkDependency(e))throw Error.invalidOperation(String.format(Sys.Res.scriptDependencyNotFound,a,e))}};Type.registerNamespace("Sys");Sys.__upperCaseTypes={};Sys.__rootNamespaces=[Sys];Sys._isInstanceOfType=function(c,b){if(typeof b==="undefined"||b===null)return false;if(b instanceof c)return true;var a=Object.getType(b);return !!(a===c)||a.inheritsFrom&&a.inheritsFrom(c)||a.implementsInterface&&a.implementsInterface(c)};Sys._getBaseMethod=function(d,e,c){var b=d.getBaseType();if(b){var a=b.prototype[c];return a instanceof Function?a:null}return null};Sys._isDomElement=function(a){var c=false;if(typeof a.nodeType!=="number"){var b=a.ownerDocument||a.document||a;if(b!=a){var d=b.defaultView||b.parentWindow;c=d!=a}else c=typeof b.body==="undefined"}return !c};Array.__typeName="Array";Array.__class=true;Array.add=Array.enqueue=function(a,b){a[a.length]=b};Array.addRange=function(a,b){a.push.apply(a,b)};Array.clear=function(a){a.length=0};Array.clone=function(a){if(a.length===1)return [a[0]];else return Array.apply(null,a)};Array.contains=function(a,b){return Sys._indexOf(a,b)>=0};Array.dequeue=function(a){return a.shift()};Array.forEach=function(b,e,d){for(var a=0,f=b.length;a<f;a++){var c=b[a];if(typeof c!=="undefined")e.call(d,c,a,b)}};Array.indexOf=function(a,c,b){return Sys._indexOf(a,c,b)};Array.insert=function(a,b,c){a.splice(b,0,c)};Array.parse=function(value){if(!value)return [];return eval(value)};Array.remove=function(b,c){var a=Sys._indexOf(b,c);if(a>=0)b.splice(a,1);return a>=0};Array.removeAt=function(a,b){a.splice(b,1)};Sys._indexOf=function(d,e,a){if(typeof e==="undefined")return -1;var c=d.length;if(c!==0){a=a-0;if(isNaN(a))a=0;else{if(isFinite(a))a=a-a%1;if(a<0)a=Math.max(0,c+a)}for(var b=a;b<c;b++)if(typeof d[b]!=="undefined"&&d[b]===e)return b}return -1};Type._registerScript._scripts={"MicrosoftAjaxCore.js":true,"MicrosoftAjaxGlobalization.js":true,"MicrosoftAjaxSerialization.js":true,"MicrosoftAjaxComponentModel.js":true,"MicrosoftAjaxHistory.js":true,"MicrosoftAjaxNetwork.js":true,"MicrosoftAjaxWebServices.js":true};Sys.IDisposable=function(){};Sys.IDisposable.prototype={};Sys.IDisposable.registerInterface("Sys.IDisposable");Sys.StringBuilder=function(a){this._parts=typeof a!=="undefined"&&a!==null&&a!==""?[a.toString()]:[];this._value={};this._len=0};Sys.StringBuilder.prototype={append:function(a){this._parts[this._parts.length]=a},appendLine:function(a){this._parts[this._parts.length]=typeof a==="undefined"||a===null||a===""?"\r\n":a+"\r\n"},clear:function(){this._parts=[];this._value={};this._len=0},isEmpty:function(){if(this._parts.length===0)return true;return this.toString()===""},toString:function(a){a=a||"";var b=this._parts;if(this._len!==b.length){this._value={};this._len=b.length}var d=this._value;if(typeof d[a]==="undefined"){if(a!=="")for(var c=0;c<b.length;)if(typeof b[c]==="undefined"||b[c]===""||b[c]===null)b.splice(c,1);else c++;d[a]=this._parts.join(a)}return d[a]}};Sys.StringBuilder.registerClass("Sys.StringBuilder");Sys.Browser={};Sys.Browser.InternetExplorer={};Sys.Browser.Firefox={};Sys.Browser.Safari={};Sys.Browser.Opera={};Sys.Browser.agent=null;Sys.Browser.hasDebuggerStatement=false;Sys.Browser.name=navigator.appName;Sys.Browser.version=parseFloat(navigator.appVersion);Sys.Browser.documentMode=0;if(navigator.userAgent.indexOf(" MSIE ")>-1){Sys.Browser.agent=Sys.Browser.InternetExplorer;Sys.Browser.version=parseFloat(navigator.userAgent.match(/MSIE (\d+\.\d+)/)[1]);if(Sys.Browser.version>=8)if(document.documentMode>=7)Sys.Browser.documentMode=document.documentMode;Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" Firefox/")>-1){Sys.Browser.agent=Sys.Browser.Firefox;Sys.Browser.version=parseFloat(navigator.userAgent.match(/Firefox\/(\d+\.\d+)/)[1]);Sys.Browser.name="Firefox";Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" AppleWebKit/")>-1){Sys.Browser.agent=Sys.Browser.Safari;Sys.Browser.version=parseFloat(navigator.userAgent.match(/AppleWebKit\/(\d+(\.\d+)?)/)[1]);Sys.Browser.name="Safari"}else if(navigator.userAgent.indexOf("Opera/")>-1)Sys.Browser.agent=Sys.Browser.Opera;Sys.EventArgs=function(){};Sys.EventArgs.registerClass("Sys.EventArgs");Sys.EventArgs.Empty=new Sys.EventArgs;Sys.CancelEventArgs=function(){Sys.CancelEventArgs.initializeBase(this);this._cancel=false};Sys.CancelEventArgs.prototype={get_cancel:function(){return this._cancel},set_cancel:function(a){this._cancel=a}};Sys.CancelEventArgs.registerClass("Sys.CancelEventArgs",Sys.EventArgs);Type.registerNamespace("Sys.UI");Sys._Debug=function(){};Sys._Debug.prototype={_appendConsole:function(a){if(typeof Debug!=="undefined"&&Debug.writeln)Debug.writeln(a);if(window.console&&window.console.log)window.console.log(a);if(window.opera)window.opera.postError(a);if(window.debugService)window.debugService.trace(a)},_appendTrace:function(b){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value+=b+"\n"},assert:function(c,a,b){if(!c){a=b&&this.assert.caller?String.format(Sys.Res.assertFailedCaller,a,this.assert.caller):String.format(Sys.Res.assertFailed,a);if(confirm(String.format(Sys.Res.breakIntoDebugger,a)))this.fail(a)}},clearTrace:function(){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value=""},fail:function(message){this._appendConsole(message);if(Sys.Browser.hasDebuggerStatement)eval("debugger")},trace:function(a){this._appendConsole(a);this._appendTrace(a)},traceDump:function(a,b){var c=this._traceDump(a,b,true)},_traceDump:function(a,c,f,b,d){c=c?c:"traceDump";b=b?b:"";if(a===null){this.trace(b+c+": null");return}switch(typeof a){case "undefined":this.trace(b+c+": Undefined");break;case "number":case "string":case "boolean":this.trace(b+c+": "+a);break;default:if(Date.isInstanceOfType(a)||RegExp.isInstanceOfType(a)){this.trace(b+c+": "+a.toString());break}if(!d)d=[];else if(Array.contains(d,a)){this.trace(b+c+": ...");return}Array.add(d,a);if(a==window||a===document||window.HTMLElement&&a instanceof HTMLElement||typeof a.nodeName==="string"){var k=a.tagName?a.tagName:"DomElement";if(a.id)k+=" - "+a.id;this.trace(b+c+" {"+k+"}")}else{var i=Object.getTypeName(a);this.trace(b+c+(typeof i==="string"?" {"+i+"}":""));if(b===""||f){b+=" ";var e,j,l,g,h;if(Array.isInstanceOfType(a)){j=a.length;for(e=0;e<j;e++)this._traceDump(a[e],"["+e+"]",f,b,d)}else for(g in a){h=a[g];if(!Function.isInstanceOfType(h))this._traceDump(h,g,f,b,d)}}}Array.remove(d,a)}}};Sys._Debug.registerClass("Sys._Debug");Sys.Debug=new Sys._Debug;Sys.Debug.isDebug=false;function Sys$Enum$parse(c,e){var a,b,i;if(e){a=this.__lowerCaseValues;if(!a){this.__lowerCaseValues=a={};var g=this.prototype;for(var f in g)a[f.toLowerCase()]=g[f]}}else a=this.prototype;if(!this.__flags){i=e?c.toLowerCase():c;b=a[i.trim()];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c,this.__typeName));return b}else{var h=(e?c.toLowerCase():c).split(","),j=0;for(var d=h.length-1;d>=0;d--){var k=h[d].trim();b=a[k];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c.split(",")[d].trim(),this.__typeName));j|=b}return j}}function Sys$Enum$toString(c){if(typeof c==="undefined"||c===null)return this.__string;var d=this.prototype,a;if(!this.__flags||c===0){for(a in d)if(d[a]===c)return a}else{var b=this.__sortedValues;if(!b){b=[];for(a in d)b[b.length]={key:a,value:d[a]};b.sort(function(a,b){return a.value-b.value});this.__sortedValues=b}var e=[],g=c;for(a=b.length-1;a>=0;a--){var h=b[a],f=h.value;if(f===0)continue;if((f&c)===f){e[e.length]=h.key;g-=f;if(g===0)break}}if(e.length&&g===0)return e.reverse().join(", ")}return ""}Type.prototype.registerEnum=function(b,c){Sys.__upperCaseTypes[b.toUpperCase()]=this;for(var a in this.prototype)this[a]=this.prototype[a];this.__typeName=b;this.parse=Sys$Enum$parse;this.__string=this.toString();this.toString=Sys$Enum$toString;this.__flags=c;this.__enum=true};Type.isEnum=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__enum};Type.isFlags=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__flags};Sys.CollectionChange=function(e,a,c,b,d){this.action=e;if(a)if(!(a instanceof Array))a=[a];this.newItems=a||null;if(typeof c!=="number")c=-1;this.newStartingIndex=c;if(b)if(!(b instanceof Array))b=[b];this.oldItems=b||null;if(typeof d!=="number")d=-1;this.oldStartingIndex=d};Sys.CollectionChange.registerClass("Sys.CollectionChange");Sys.NotifyCollectionChangedAction=function(){throw Error.notImplemented()};Sys.NotifyCollectionChangedAction.prototype={add:0,remove:1,reset:2};Sys.NotifyCollectionChangedAction.registerEnum("Sys.NotifyCollectionChangedAction");Sys.NotifyCollectionChangedEventArgs=function(a){this._changes=a;Sys.NotifyCollectionChangedEventArgs.initializeBase(this)};Sys.NotifyCollectionChangedEventArgs.prototype={get_changes:function(){return this._changes||[]}};Sys.NotifyCollectionChangedEventArgs.registerClass("Sys.NotifyCollectionChangedEventArgs",Sys.EventArgs);Sys.Observer=function(){};Sys.Observer.registerClass("Sys.Observer");Sys.Observer.makeObservable=function(a){var c=a instanceof Array,b=Sys.Observer;if(a.setValue===b._observeMethods.setValue)return a;b._addMethods(a,b._observeMethods);if(c)b._addMethods(a,b._arrayMethods);return a};Sys.Observer._addMethods=function(c,b){for(var a in b)c[a]=b[a]};Sys.Observer._addEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._addHandler(a,b)};Sys.Observer.addEventHandler=function(c,a,b){Sys.Observer._addEventHandler(c,a,b)};Sys.Observer._removeEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._removeHandler(a,b)};Sys.Observer.removeEventHandler=function(c,a,b){Sys.Observer._removeEventHandler(c,a,b)};Sys.Observer.raiseEvent=function(b,e,d){var c=Sys.Observer._getContext(b);if(!c)return;var a=c.events.getHandler(e);if(a)a(b,d)};Sys.Observer.addPropertyChanged=function(b,a){Sys.Observer._addEventHandler(b,"propertyChanged",a)};Sys.Observer.removePropertyChanged=function(b,a){Sys.Observer._removeEventHandler(b,"propertyChanged",a)};Sys.Observer.beginUpdate=function(a){Sys.Observer._getContext(a,true).updating=true};Sys.Observer.endUpdate=function(b){var a=Sys.Observer._getContext(b);if(!a||!a.updating)return;a.updating=false;var d=a.dirty;a.dirty=false;if(d){if(b instanceof Array){var c=a.changes;a.changes=null;Sys.Observer.raiseCollectionChanged(b,c)}Sys.Observer.raisePropertyChanged(b,"")}};Sys.Observer.isUpdating=function(b){var a=Sys.Observer._getContext(b);return a?a.updating:false};Sys.Observer._setValue=function(a,j,g){var b,f,k=a,d=j.split(".");for(var i=0,m=d.length-1;i<m;i++){var l=d[i];b=a["get_"+l];if(typeof b==="function")a=b.call(a);else a=a[l];var n=typeof a;if(a===null||n==="undefined")throw Error.invalidOperation(String.format(Sys.Res.nullReferenceInPath,j))}var e,c=d[m];b=a["get_"+c];f=a["set_"+c];if(typeof b==="function")e=b.call(a);else e=a[c];if(typeof f==="function")f.call(a,g);else a[c]=g;if(e!==g){var h=Sys.Observer._getContext(k);if(h&&h.updating){h.dirty=true;return}Sys.Observer.raisePropertyChanged(k,d[0])}};Sys.Observer.setValue=function(b,a,c){Sys.Observer._setValue(b,a,c)};Sys.Observer.raisePropertyChanged=function(b,a){Sys.Observer.raiseEvent(b,"propertyChanged",new Sys.PropertyChangedEventArgs(a))};Sys.Observer.addCollectionChanged=function(b,a){Sys.Observer._addEventHandler(b,"collectionChanged",a)};Sys.Observer.removeCollectionChanged=function(b,a){Sys.Observer._removeEventHandler(b,"collectionChanged",a)};Sys.Observer._collectionChange=function(d,c){var a=Sys.Observer._getContext(d);if(a&&a.updating){a.dirty=true;var b=a.changes;if(!b)a.changes=b=[c];else b.push(c)}else{Sys.Observer.raiseCollectionChanged(d,[c]);Sys.Observer.raisePropertyChanged(d,"length")}};Sys.Observer.add=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[b],a.length);Array.add(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.addRange=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,b,a.length);Array.addRange(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.clear=function(a){var b=Array.clone(a);Array.clear(a);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.reset,null,-1,b,0))};Sys.Observer.insert=function(a,b,c){Array.insert(a,b,c);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[c],b))};Sys.Observer.remove=function(a,b){var c=Array.indexOf(a,b);if(c!==-1){Array.remove(a,b);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[b],c));return true}return false};Sys.Observer.removeAt=function(b,a){if(a>-1&&a<b.length){var c=b[a];Array.removeAt(b,a);Sys.Observer._collectionChange(b,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[c],a))}};Sys.Observer.raiseCollectionChanged=function(b,a){Sys.Observer.raiseEvent(b,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))};Sys.Observer._observeMethods={add_propertyChanged:function(a){Sys.Observer._addEventHandler(this,"propertyChanged",a)},remove_propertyChanged:function(a){Sys.Observer._removeEventHandler(this,"propertyChanged",a)},addEventHandler:function(a,b){Sys.Observer._addEventHandler(this,a,b)},removeEventHandler:function(a,b){Sys.Observer._removeEventHandler(this,a,b)},get_isUpdating:function(){return Sys.Observer.isUpdating(this)},beginUpdate:function(){Sys.Observer.beginUpdate(this)},endUpdate:function(){Sys.Observer.endUpdate(this)},setValue:function(b,a){Sys.Observer._setValue(this,b,a)},raiseEvent:function(b,a){Sys.Observer.raiseEvent(this,b,a)},raisePropertyChanged:function(a){Sys.Observer.raiseEvent(this,"propertyChanged",new Sys.PropertyChangedEventArgs(a))}};Sys.Observer._arrayMethods={add_collectionChanged:function(a){Sys.Observer._addEventHandler(this,"collectionChanged",a)},remove_collectionChanged:function(a){Sys.Observer._removeEventHandler(this,"collectionChanged",a)},add:function(a){Sys.Observer.add(this,a)},addRange:function(a){Sys.Observer.addRange(this,a)},clear:function(){Sys.Observer.clear(this)},insert:function(a,b){Sys.Observer.insert(this,a,b)},remove:function(a){return Sys.Observer.remove(this,a)},removeAt:function(a){Sys.Observer.removeAt(this,a)},raiseCollectionChanged:function(a){Sys.Observer.raiseEvent(this,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))}};Sys.Observer._getContext=function(b,c){var a=b._observerContext;if(a)return a();if(c)return (b._observerContext=Sys.Observer._createContext())();return null};Sys.Observer._createContext=function(){var a={events:new Sys.EventHandlerList};return function(){return a}};Date._appendPreOrPostMatch=function(e,b){var d=0,a=false;for(var c=0,g=e.length;c<g;c++){var f=e.charAt(c);switch(f){case "'":if(a)b.append("'");else d++;a=false;break;case "\\":if(a)b.append("\\");a=!a;break;default:b.append(f);a=false}}return d};Date._expandFormat=function(a,b){if(!b)b="F";var c=b.length;if(c===1)switch(b){case "d":return a.ShortDatePattern;case "D":return a.LongDatePattern;case "t":return a.ShortTimePattern;case "T":return a.LongTimePattern;case "f":return a.LongDatePattern+" "+a.ShortTimePattern;case "F":return a.FullDateTimePattern;case "M":case "m":return a.MonthDayPattern;case "s":return a.SortableDateTimePattern;case "Y":case "y":return a.YearMonthPattern;default:throw Error.format(Sys.Res.formatInvalidString)}else if(c===2&&b.charAt(0)==="%")b=b.charAt(1);return b};Date._expandYear=function(c,a){var d=new Date,e=Date._getEra(d);if(a<100){var b=Date._getEraYear(d,c,e);a+=b-b%100;if(a>c.Calendar.TwoDigitYearMax)a-=100}return a};Date._getEra=function(e,c){if(!c)return 0;var b,d=e.getTime();for(var a=0,f=c.length;a<f;a+=4){b=c[a+2];if(b===null||d>=b)return a}return 0};Date._getEraYear=function(d,b,e,c){var a=d.getFullYear();if(!c&&b.eras)a-=b.eras[e+3];return a};Date._getParseRegExp=function(b,e){if(!b._parseRegExp)b._parseRegExp={};else if(b._parseRegExp[e])return b._parseRegExp[e];var c=Date._expandFormat(b,e);c=c.replace(/([\^\$\.\*\+\?\|\[\]\(\)\{\}])/g,"\\\\$1");var a=new Sys.StringBuilder("^"),j=[],f=0,i=0,h=Date._getTokenRegExp(),d;while((d=h.exec(c))!==null){var l=c.slice(f,d.index);f=h.lastIndex;i+=Date._appendPreOrPostMatch(l,a);if(i%2===1){a.append(d[0]);continue}switch(d[0]){case "dddd":case "ddd":case "MMMM":case "MMM":case "gg":case "g":a.append("(\\D+)");break;case "tt":case "t":a.append("(\\D*)");break;case "yyyy":a.append("(\\d{4})");break;case "fff":a.append("(\\d{3})");break;case "ff":a.append("(\\d{2})");break;case "f":a.append("(\\d)");break;case "dd":case "d":case "MM":case "M":case "yy":case "y":case "HH":case "H":case "hh":case "h":case "mm":case "m":case "ss":case "s":a.append("(\\d\\d?)");break;case "zzz":a.append("([+-]?\\d\\d?:\\d{2})");break;case "zz":case "z":a.append("([+-]?\\d\\d?)");break;case "/":a.append("(\\"+b.DateSeparator+")")}Array.add(j,d[0])}Date._appendPreOrPostMatch(c.slice(f),a);a.append("$");var k=a.toString().replace(/\s+/g,"\\s+"),g={"regExp":k,"groups":j};b._parseRegExp[e]=g;return g};Date._getTokenRegExp=function(){return /\/|dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|y|hh|h|HH|H|mm|m|ss|s|tt|t|fff|ff|f|zzz|zz|z|gg|g/g};Date.parseLocale=function(a){return Date._parse(a,Sys.CultureInfo.CurrentCulture,arguments)};Date.parseInvariant=function(a){return Date._parse(a,Sys.CultureInfo.InvariantCulture,arguments)};Date._parse=function(h,d,i){var a,c,b,f,e,g=false;for(a=1,c=i.length;a<c;a++){f=i[a];if(f){g=true;b=Date._parseExact(h,f,d);if(b)return b}}if(!g){e=d._getDateTimeFormats();for(a=0,c=e.length;a<c;a++){b=Date._parseExact(h,e[a],d);if(b)return b}}return null};Date._parseExact=function(w,D,k){w=w.trim();var g=k.dateTimeFormat,A=Date._getParseRegExp(g,D),C=(new RegExp(A.regExp)).exec(w);if(C===null)return null;var B=A.groups,x=null,e=null,c=null,j=null,i=null,d=0,h,p=0,q=0,f=0,l=null,v=false;for(var s=0,E=B.length;s<E;s++){var a=C[s+1];if(a)switch(B[s]){case "dd":case "d":j=parseInt(a,10);if(j<1||j>31)return null;break;case "MMMM":c=k._getMonthIndex(a);if(c<0||c>11)return null;break;case "MMM":c=k._getAbbrMonthIndex(a);if(c<0||c>11)return null;break;case "M":case "MM":c=parseInt(a,10)-1;if(c<0||c>11)return null;break;case "y":case "yy":e=Date._expandYear(g,parseInt(a,10));if(e<0||e>9999)return null;break;case "yyyy":e=parseInt(a,10);if(e<0||e>9999)return null;break;case "h":case "hh":d=parseInt(a,10);if(d===12)d=0;if(d<0||d>11)return null;break;case "H":case "HH":d=parseInt(a,10);if(d<0||d>23)return null;break;case "m":case "mm":p=parseInt(a,10);if(p<0||p>59)return null;break;case "s":case "ss":q=parseInt(a,10);if(q<0||q>59)return null;break;case "tt":case "t":var z=a.toUpperCase();v=z===g.PMDesignator.toUpperCase();if(!v&&z!==g.AMDesignator.toUpperCase())return null;break;case "f":f=parseInt(a,10)*100;if(f<0||f>999)return null;break;case "ff":f=parseInt(a,10)*10;if(f<0||f>999)return null;break;case "fff":f=parseInt(a,10);if(f<0||f>999)return null;break;case "dddd":i=k._getDayIndex(a);if(i<0||i>6)return null;break;case "ddd":i=k._getAbbrDayIndex(a);if(i<0||i>6)return null;break;case "zzz":var u=a.split(/:/);if(u.length!==2)return null;h=parseInt(u[0],10);if(h<-12||h>13)return null;var m=parseInt(u[1],10);if(m<0||m>59)return null;l=h*60+(a.startsWith("-")?-m:m);break;case "z":case "zz":h=parseInt(a,10);if(h<-12||h>13)return null;l=h*60;break;case "g":case "gg":var o=a;if(!o||!g.eras)return null;o=o.toLowerCase().trim();for(var r=0,F=g.eras.length;r<F;r+=4)if(o===g.eras[r+1].toLowerCase()){x=r;break}if(x===null)return null}}var b=new Date,t,n=g.Calendar.convert;if(n)t=n.fromGregorian(b)[0];else t=b.getFullYear();if(e===null)e=t;else if(g.eras)e+=g.eras[(x||0)+3];if(c===null)c=0;if(j===null)j=1;if(n){b=n.toGregorian(e,c,j);if(b===null)return null}else{b.setFullYear(e,c,j);if(b.getDate()!==j)return null;if(i!==null&&b.getDay()!==i)return null}if(v&&d<12)d+=12;b.setHours(d,p,q,f);if(l!==null){var y=b.getMinutes()-(l+b.getTimezoneOffset());b.setHours(b.getHours()+parseInt(y/60,10),y%60)}return b};Date.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Date.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Date.prototype._toFormattedString=function(e,j){var b=j.dateTimeFormat,n=b.Calendar.convert;if(!e||!e.length||e==="i")if(j&&j.name.length)if(n)return this._toFormattedString(b.FullDateTimePattern,j);else{var r=new Date(this.getTime()),x=Date._getEra(this,b.eras);r.setFullYear(Date._getEraYear(this,b,x));return r.toLocaleString()}else return this.toString();var l=b.eras,k=e==="s";e=Date._expandFormat(b,e);var a=new Sys.StringBuilder,c;function d(a){if(a<10)return "0"+a;return a.toString()}function m(a){if(a<10)return "00"+a;if(a<100)return "0"+a;return a.toString()}function v(a){if(a<10)return "000"+a;else if(a<100)return "00"+a;else if(a<1000)return "0"+a;return a.toString()}var h,p,t=/([^d]|^)(d|dd)([^d]|$)/g;function s(){if(h||p)return h;h=t.test(e);p=true;return h}var q=0,o=Date._getTokenRegExp(),f;if(!k&&n)f=n.fromGregorian(this);for(;true;){var w=o.lastIndex,i=o.exec(e),u=e.slice(w,i?i.index:e.length);q+=Date._appendPreOrPostMatch(u,a);if(!i)break;if(q%2===1){a.append(i[0]);continue}function g(a,b){if(f)return f[b];switch(b){case 0:return a.getFullYear();case 1:return a.getMonth();case 2:return a.getDate()}}switch(i[0]){case "dddd":a.append(b.DayNames[this.getDay()]);break;case "ddd":a.append(b.AbbreviatedDayNames[this.getDay()]);break;case "dd":h=true;a.append(d(g(this,2)));break;case "d":h=true;a.append(g(this,2));break;case "MMMM":a.append(b.MonthGenitiveNames&&s()?b.MonthGenitiveNames[g(this,1)]:b.MonthNames[g(this,1)]);break;case "MMM":a.append(b.AbbreviatedMonthGenitiveNames&&s()?b.AbbreviatedMonthGenitiveNames[g(this,1)]:b.AbbreviatedMonthNames[g(this,1)]);break;case "MM":a.append(d(g(this,1)+1));break;case "M":a.append(g(this,1)+1);break;case "yyyy":a.append(v(f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k)));break;case "yy":a.append(d((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100));break;case "y":a.append((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100);break;case "hh":c=this.getHours()%12;if(c===0)c=12;a.append(d(c));break;case "h":c=this.getHours()%12;if(c===0)c=12;a.append(c);break;case "HH":a.append(d(this.getHours()));break;case "H":a.append(this.getHours());break;case "mm":a.append(d(this.getMinutes()));break;case "m":a.append(this.getMinutes());break;case "ss":a.append(d(this.getSeconds()));break;case "s":a.append(this.getSeconds());break;case "tt":a.append(this.getHours()<12?b.AMDesignator:b.PMDesignator);break;case "t":a.append((this.getHours()<12?b.AMDesignator:b.PMDesignator).charAt(0));break;case "f":a.append(m(this.getMilliseconds()).charAt(0));break;case "ff":a.append(m(this.getMilliseconds()).substr(0,2));break;case "fff":a.append(m(this.getMilliseconds()));break;case "z":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+Math.floor(Math.abs(c)));break;case "zz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c))));break;case "zzz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c)))+":"+d(Math.abs(this.getTimezoneOffset()%60)));break;case "g":case "gg":if(b.eras)a.append(b.eras[Date._getEra(this,l)+1]);break;case "/":a.append(b.DateSeparator)}}return a.toString()};String.localeFormat=function(){return String._toFormattedString(true,arguments)};Number.parseLocale=function(a){return Number._parse(a,Sys.CultureInfo.CurrentCulture)};Number.parseInvariant=function(a){return Number._parse(a,Sys.CultureInfo.InvariantCulture)};Number._parse=function(b,o){b=b.trim();if(b.match(/^[+-]?infinity$/i))return parseFloat(b);if(b.match(/^0x[a-f0-9]+$/i))return parseInt(b);var a=o.numberFormat,g=Number._parseNumberNegativePattern(b,a,a.NumberNegativePattern),h=g[0],e=g[1];if(h===""&&a.NumberNegativePattern!==1){g=Number._parseNumberNegativePattern(b,a,1);h=g[0];e=g[1]}if(h==="")h="+";var j,d,f=e.indexOf("e");if(f<0)f=e.indexOf("E");if(f<0){d=e;j=null}else{d=e.substr(0,f);j=e.substr(f+1)}var c,k,m=d.indexOf(a.NumberDecimalSeparator);if(m<0){c=d;k=null}else{c=d.substr(0,m);k=d.substr(m+a.NumberDecimalSeparator.length)}c=c.split(a.NumberGroupSeparator).join("");var n=a.NumberGroupSeparator.replace(/\u00A0/g," ");if(a.NumberGroupSeparator!==n)c=c.split(n).join("");var l=h+c;if(k!==null)l+="."+k;if(j!==null){var i=Number._parseNumberNegativePattern(j,a,1);if(i[0]==="")i[0]="+";l+="e"+i[0]+i[1]}if(l.match(/^[+-]?\d*\.?\d*(e[+-]?\d+)?$/))return parseFloat(l);return Number.NaN};Number._parseNumberNegativePattern=function(a,d,e){var b=d.NegativeSign,c=d.PositiveSign;switch(e){case 4:b=" "+b;c=" "+c;case 3:if(a.endsWith(b))return ["-",a.substr(0,a.length-b.length)];else if(a.endsWith(c))return ["+",a.substr(0,a.length-c.length)];break;case 2:b+=" ";c+=" ";case 1:if(a.startsWith(b))return ["-",a.substr(b.length)];else if(a.startsWith(c))return ["+",a.substr(c.length)];break;case 0:if(a.startsWith("(")&&a.endsWith(")"))return ["-",a.substr(1,a.length-2)]}return ["",a]};Number.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Number.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Number.prototype._toFormattedString=function(e,j){if(!e||e.length===0||e==="i")if(j&&j.name.length>0)return this.toLocaleString();else return this.toString();var o=["n %","n%","%n"],n=["-n %","-n%","-%n"],p=["(n)","-n","- n","n-","n -"],m=["$n","n$","$ n","n $"],l=["($n)","-$n","$-n","$n-","(n$)","-n$","n-$","n$-","-n $","-$ n","n $-","$ n-","$ -n","n- $","($ n)","(n $)"];function g(a,c,d){for(var b=a.length;b<c;b++)a=d?"0"+a:a+"0";return a}function i(j,i,l,n,p){var h=l[0],k=1,o=Math.pow(10,i),m=Math.round(j*o)/o;if(!isFinite(m))m=j;j=m;var b=j.toString(),a="",c,e=b.split(/e/i);b=e[0];c=e.length>1?parseInt(e[1]):0;e=b.split(".");b=e[0];a=e.length>1?e[1]:"";var q;if(c>0){a=g(a,c,false);b+=a.slice(0,c);a=a.substr(c)}else if(c<0){c=-c;b=g(b,c+1,true);a=b.slice(-c,b.length)+a;b=b.slice(0,-c)}if(i>0){if(a.length>i)a=a.slice(0,i);else a=g(a,i,false);a=p+a}else a="";var d=b.length-1,f="";while(d>=0){if(h===0||h>d)if(f.length>0)return b.slice(0,d+1)+n+f+a;else return b.slice(0,d+1)+a;if(f.length>0)f=b.slice(d-h+1,d+1)+n+f;else f=b.slice(d-h+1,d+1);d-=h;if(k<l.length){h=l[k];k++}}return b.slice(0,d+1)+n+f+a}var a=j.numberFormat,d=Math.abs(this);if(!e)e="D";var b=-1;if(e.length>1)b=parseInt(e.slice(1),10);var c;switch(e.charAt(0)){case "d":case "D":c="n";if(b!==-1)d=g(""+d,b,true);if(this<0)d=-d;break;case "c":case "C":if(this<0)c=l[a.CurrencyNegativePattern];else c=m[a.CurrencyPositivePattern];if(b===-1)b=a.CurrencyDecimalDigits;d=i(Math.abs(this),b,a.CurrencyGroupSizes,a.CurrencyGroupSeparator,a.CurrencyDecimalSeparator);break;case "n":case "N":if(this<0)c=p[a.NumberNegativePattern];else c="n";if(b===-1)b=a.NumberDecimalDigits;d=i(Math.abs(this),b,a.NumberGroupSizes,a.NumberGroupSeparator,a.NumberDecimalSeparator);break;case "p":case "P":if(this<0)c=n[a.PercentNegativePattern];else c=o[a.PercentPositivePattern];if(b===-1)b=a.PercentDecimalDigits;d=i(Math.abs(this)*100,b,a.PercentGroupSizes,a.PercentGroupSeparator,a.PercentDecimalSeparator);break;default:throw Error.format(Sys.Res.formatBadFormatSpecifier)}var k=/n|\$|-|%/g,f="";for(;true;){var q=k.lastIndex,h=k.exec(c);f+=c.slice(q,h?h.index:c.length);if(!h)break;switch(h[0]){case "n":f+=d;break;case "$":f+=a.CurrencySymbol;break;case "-":if(/[1-9]/.test(d))f+=a.NegativeSign;break;case "%":f+=a.PercentSymbol}}return f};Sys.CultureInfo=function(c,b,a){this.name=c;this.numberFormat=b;this.dateTimeFormat=a};Sys.CultureInfo.prototype={_getDateTimeFormats:function(){if(!this._dateTimeFormats){var a=this.dateTimeFormat;this._dateTimeFormats=[a.MonthDayPattern,a.YearMonthPattern,a.ShortDatePattern,a.ShortTimePattern,a.LongDatePattern,a.LongTimePattern,a.FullDateTimePattern,a.RFC1123Pattern,a.SortableDateTimePattern,a.UniversalSortableDateTimePattern]}return this._dateTimeFormats},_getIndex:function(c,d,e){var b=this._toUpper(c),a=Array.indexOf(d,b);if(a===-1)a=Array.indexOf(e,b);return a},_getMonthIndex:function(a){if(!this._upperMonths){this._upperMonths=this._toUpperArray(this.dateTimeFormat.MonthNames);this._upperMonthsGenitive=this._toUpperArray(this.dateTimeFormat.MonthGenitiveNames)}return this._getIndex(a,this._upperMonths,this._upperMonthsGenitive)},_getAbbrMonthIndex:function(a){if(!this._upperAbbrMonths){this._upperAbbrMonths=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthNames);this._upperAbbrMonthsGenitive=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthGenitiveNames)}return this._getIndex(a,this._upperAbbrMonths,this._upperAbbrMonthsGenitive)},_getDayIndex:function(a){if(!this._upperDays)this._upperDays=this._toUpperArray(this.dateTimeFormat.DayNames);return Array.indexOf(this._upperDays,this._toUpper(a))},_getAbbrDayIndex:function(a){if(!this._upperAbbrDays)this._upperAbbrDays=this._toUpperArray(this.dateTimeFormat.AbbreviatedDayNames);return Array.indexOf(this._upperAbbrDays,this._toUpper(a))},_toUpperArray:function(c){var b=[];for(var a=0,d=c.length;a<d;a++)b[a]=this._toUpper(c[a]);return b},_toUpper:function(a){return a.split("\u00a0").join(" ").toUpperCase()}};Sys.CultureInfo.registerClass("Sys.CultureInfo");Sys.CultureInfo._parse=function(a){var b=a.dateTimeFormat;if(b&&!b.eras)b.eras=a.eras;return new Sys.CultureInfo(a.name,a.numberFormat,b)};Sys.CultureInfo.InvariantCulture=Sys.CultureInfo._parse({"name":"","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":true,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"\u00a4","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":true},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, dd MMMM yyyy HH:mm:ss","LongDatePattern":"dddd, dd MMMM yyyy","LongTimePattern":"HH:mm:ss","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"MM/dd/yyyy","ShortTimePattern":"HH:mm","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"yyyy MMMM","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":true,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]});if(typeof __cultureInfo==="object"){Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse(__cultureInfo);delete __cultureInfo}else Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse({"name":"en-US","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":false,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"$","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":false},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, MMMM dd, yyyy h:mm:ss tt","LongDatePattern":"dddd, MMMM dd, yyyy","LongTimePattern":"h:mm:ss tt","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"M/d/yyyy","ShortTimePattern":"h:mm tt","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"MMMM, yyyy","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":false,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]});Type.registerNamespace("Sys.Serialization");Sys.Serialization.JavaScriptSerializer=function(){};Sys.Serialization.JavaScriptSerializer.registerClass("Sys.Serialization.JavaScriptSerializer");Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs=[];Sys.Serialization.JavaScriptSerializer._charsToEscape=[];Sys.Serialization.JavaScriptSerializer._dateRegEx=new RegExp('(^|[^\\\\])\\"\\\\/Date\\((-?[0-9]+)(?:[a-zA-Z]|(?:\\+|-)[0-9]{4})?\\)\\\\/\\"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars={};Sys.Serialization.JavaScriptSerializer._escapeRegEx=new RegExp('["\\\\\\x00-\\x1F]',"i");Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal=new RegExp('["\\\\\\x00-\\x1F]',"g");Sys.Serialization.JavaScriptSerializer._jsonRegEx=new RegExp("[^,:{}\\[\\]0-9.\\-+Eaeflnr-u \\n\\r\\t]","g");Sys.Serialization.JavaScriptSerializer._jsonStringRegEx=new RegExp('"(\\\\.|[^"\\\\])*"',"g");Sys.Serialization.JavaScriptSerializer._serverTypeFieldName="__type";Sys.Serialization.JavaScriptSerializer._init=function(){var c=["\\u0000","\\u0001","\\u0002","\\u0003","\\u0004","\\u0005","\\u0006","\\u0007","\\b","\\t","\\n","\\u000b","\\f","\\r","\\u000e","\\u000f","\\u0010","\\u0011","\\u0012","\\u0013","\\u0014","\\u0015","\\u0016","\\u0017","\\u0018","\\u0019","\\u001a","\\u001b","\\u001c","\\u001d","\\u001e","\\u001f"];Sys.Serialization.JavaScriptSerializer._charsToEscape[0]="\\";Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs["\\"]=new RegExp("\\\\","g");Sys.Serialization.JavaScriptSerializer._escapeChars["\\"]="\\\\";Sys.Serialization.JavaScriptSerializer._charsToEscape[1]='"';Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs['"']=new RegExp('"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars['"']='\\"';for(var a=0;a<32;a++){var b=String.fromCharCode(a);Sys.Serialization.JavaScriptSerializer._charsToEscape[a+2]=b;Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b]=new RegExp(b,"g");Sys.Serialization.JavaScriptSerializer._escapeChars[b]=c[a]}};Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder=function(b,a){a.append(b.toString())};Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder=function(a,b){if(isFinite(a))b.append(String(a));else throw Error.invalidOperation(Sys.Res.cannotSerializeNonFiniteNumbers)};Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder=function(a,c){c.append('"');if(Sys.Serialization.JavaScriptSerializer._escapeRegEx.test(a)){if(Sys.Serialization.JavaScriptSerializer._charsToEscape.length===0)Sys.Serialization.JavaScriptSerializer._init();if(a.length<128)a=a.replace(Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal,function(a){return Sys.Serialization.JavaScriptSerializer._escapeChars[a]});else for(var d=0;d<34;d++){var b=Sys.Serialization.JavaScriptSerializer._charsToEscape[d];if(a.indexOf(b)!==-1)if(Sys.Browser.agent===Sys.Browser.Opera||Sys.Browser.agent===Sys.Browser.FireFox)a=a.split(b).join(Sys.Serialization.JavaScriptSerializer._escapeChars[b]);else a=a.replace(Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b],Sys.Serialization.JavaScriptSerializer._escapeChars[b])}}c.append(a);c.append('"')};Sys.Serialization.JavaScriptSerializer._serializeWithBuilder=function(b,a,i,g){var c;switch(typeof b){case "object":if(b)if(Number.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);else if(Boolean.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);else if(String.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);else if(Array.isInstanceOfType(b)){a.append("[");for(c=0;c<b.length;++c){if(c>0)a.append(",");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b[c],a,false,g)}a.append("]")}else{if(Date.isInstanceOfType(b)){a.append('"\\/Date(');a.append(b.getTime());a.append(')\\/"');break}var d=[],f=0;for(var e in b){if(e.startsWith("$"))continue;if(e===Sys.Serialization.JavaScriptSerializer._serverTypeFieldName&&f!==0){d[f++]=d[0];d[0]=e}else d[f++]=e}if(i)d.sort();a.append("{");var j=false;for(c=0;c<f;c++){var h=b[d[c]];if(typeof h!=="undefined"&&typeof h!=="function"){if(j)a.append(",");else j=true;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(d[c],a,i,g);a.append(":");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(h,a,i,g)}}a.append("}")}else a.append("null");break;case "number":Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);break;case "string":Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);break;case "boolean":Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);break;default:a.append("null")}};Sys.Serialization.JavaScriptSerializer.serialize=function(b){var a=new Sys.StringBuilder;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b,a,false);return a.toString()};Sys.Serialization.JavaScriptSerializer.deserialize=function(data,secure){if(data.length===0)throw Error.argument("data",Sys.Res.cannotDeserializeEmptyString);try{var exp=data.replace(Sys.Serialization.JavaScriptSerializer._dateRegEx,"$1new Date($2)");if(secure&&Sys.Serialization.JavaScriptSerializer._jsonRegEx.test(exp.replace(Sys.Serialization.JavaScriptSerializer._jsonStringRegEx,"")))throw null;return eval("("+exp+")")}catch(a){throw Error.argument("data",Sys.Res.cannotDeserializeInvalidJson)}};Type.registerNamespace("Sys.UI");Sys.EventHandlerList=function(){this._list={}};Sys.EventHandlerList.prototype={_addHandler:function(b,a){Array.add(this._getEvent(b,true),a)},addHandler:function(b,a){this._addHandler(b,a)},_removeHandler:function(c,b){var a=this._getEvent(c);if(!a)return;Array.remove(a,b)},removeHandler:function(b,a){this._removeHandler(b,a)},getHandler:function(b){var a=this._getEvent(b);if(!a||a.length===0)return null;a=Array.clone(a);return function(c,d){for(var b=0,e=a.length;b<e;b++)a[b](c,d)}},_getEvent:function(a,b){if(!this._list[a]){if(!b)return null;this._list[a]=[]}return this._list[a]}};Sys.EventHandlerList.registerClass("Sys.EventHandlerList");Sys.CommandEventArgs=function(c,a,b){Sys.CommandEventArgs.initializeBase(this);this._commandName=c;this._commandArgument=a;this._commandSource=b};Sys.CommandEventArgs.prototype={_commandName:null,_commandArgument:null,_commandSource:null,get_commandName:function(){return this._commandName},get_commandArgument:function(){return this._commandArgument},get_commandSource:function(){return this._commandSource}};Sys.CommandEventArgs.registerClass("Sys.CommandEventArgs",Sys.CancelEventArgs);Sys.INotifyPropertyChange=function(){};Sys.INotifyPropertyChange.prototype={};Sys.INotifyPropertyChange.registerInterface("Sys.INotifyPropertyChange");Sys.PropertyChangedEventArgs=function(a){Sys.PropertyChangedEventArgs.initializeBase(this);this._propertyName=a};Sys.PropertyChangedEventArgs.prototype={get_propertyName:function(){return this._propertyName}};Sys.PropertyChangedEventArgs.registerClass("Sys.PropertyChangedEventArgs",Sys.EventArgs);Sys.INotifyDisposing=function(){};Sys.INotifyDisposing.prototype={};Sys.INotifyDisposing.registerInterface("Sys.INotifyDisposing");Sys.Component=function(){if(Sys.Application)Sys.Application.registerDisposableObject(this)};Sys.Component.prototype={_id:null,_initialized:false,_updating:false,get_events:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_id:function(){return this._id},set_id:function(a){this._id=a},get_isInitialized:function(){return this._initialized},get_isUpdating:function(){return this._updating},add_disposing:function(a){this.get_events().addHandler("disposing",a)},remove_disposing:function(a){this.get_events().removeHandler("disposing",a)},add_propertyChanged:function(a){this.get_events().addHandler("propertyChanged",a)},remove_propertyChanged:function(a){this.get_events().removeHandler("propertyChanged",a)},beginUpdate:function(){this._updating=true},dispose:function(){if(this._events){var a=this._events.getHandler("disposing");if(a)a(this,Sys.EventArgs.Empty)}delete this._events;Sys.Application.unregisterDisposableObject(this);Sys.Application.removeComponent(this)},endUpdate:function(){this._updating=false;if(!this._initialized)this.initialize();this.updated()},initialize:function(){this._initialized=true},raisePropertyChanged:function(b){if(!this._events)return;var a=this._events.getHandler("propertyChanged");if(a)a(this,new Sys.PropertyChangedEventArgs(b))},updated:function(){}};Sys.Component.registerClass("Sys.Component",null,Sys.IDisposable,Sys.INotifyPropertyChange,Sys.INotifyDisposing);function Sys$Component$_setProperties(a,i){var d,j=Object.getType(a),e=j===Object||j===Sys.UI.DomElement,h=Sys.Component.isInstanceOfType(a)&&!a.get_isUpdating();if(h)a.beginUpdate();for(var c in i){var b=i[c],f=e?null:a["get_"+c];if(e||typeof f!=="function"){var k=a[c];if(!b||typeof b!=="object"||e&&!k)a[c]=b;else Sys$Component$_setProperties(k,b)}else{var l=a["set_"+c];if(typeof l==="function")l.apply(a,[b]);else if(b instanceof Array){d=f.apply(a);for(var g=0,m=d.length,n=b.length;g<n;g++,m++)d[m]=b[g]}else if(typeof b==="object"&&Object.getType(b)===Object){d=f.apply(a);Sys$Component$_setProperties(d,b)}}}if(h)a.endUpdate()}function Sys$Component$_setReferences(c,b){for(var a in b){var e=c["set_"+a],d=$find(b[a]);e.apply(c,[d])}}var $create=Sys.Component.create=function(h,f,d,c,g){var a=g?new h(g):new h,b=Sys.Application,i=b.get_isCreatingComponents();a.beginUpdate();if(f)Sys$Component$_setProperties(a,f);if(d)for(var e in d)a["add_"+e](d[e]);if(a.get_id())b.addComponent(a);if(i){b._createdComponents[b._createdComponents.length]=a;if(c)b._addComponentToSecondPass(a,c);else a.endUpdate()}else{if(c)Sys$Component$_setReferences(a,c);a.endUpdate()}return a};Sys.UI.MouseButton=function(){throw Error.notImplemented()};Sys.UI.MouseButton.prototype={leftButton:0,middleButton:1,rightButton:2};Sys.UI.MouseButton.registerEnum("Sys.UI.MouseButton");Sys.UI.Key=function(){throw Error.notImplemented()};Sys.UI.Key.prototype={backspace:8,tab:9,enter:13,esc:27,space:32,pageUp:33,pageDown:34,end:35,home:36,left:37,up:38,right:39,down:40,del:127};Sys.UI.Key.registerEnum("Sys.UI.Key");Sys.UI.Point=function(a,b){this.rawX=a;this.rawY=b;this.x=Math.round(a);this.y=Math.round(b)};Sys.UI.Point.registerClass("Sys.UI.Point");Sys.UI.Bounds=function(c,d,b,a){this.x=c;this.y=d;this.height=a;this.width=b};Sys.UI.Bounds.registerClass("Sys.UI.Bounds");Sys.UI.DomEvent=function(e){var a=e,b=this.type=a.type.toLowerCase();this.rawEvent=a;this.altKey=a.altKey;if(typeof a.button!=="undefined")this.button=typeof a.which!=="undefined"?a.button:a.button===4?Sys.UI.MouseButton.middleButton:a.button===2?Sys.UI.MouseButton.rightButton:Sys.UI.MouseButton.leftButton;if(b==="keypress")this.charCode=a.charCode||a.keyCode;else if(a.keyCode&&a.keyCode===46)this.keyCode=127;else this.keyCode=a.keyCode;this.clientX=a.clientX;this.clientY=a.clientY;this.ctrlKey=a.ctrlKey;this.target=a.target?a.target:a.srcElement;if(!b.startsWith("key"))if(typeof a.offsetX!=="undefined"&&typeof a.offsetY!=="undefined"){this.offsetX=a.offsetX;this.offsetY=a.offsetY}else if(this.target&&this.target.nodeType!==3&&typeof a.clientX==="number"){var c=Sys.UI.DomElement.getLocation(this.target),d=Sys.UI.DomElement._getWindow(this.target);this.offsetX=(d.pageXOffset||0)+a.clientX-c.x;this.offsetY=(d.pageYOffset||0)+a.clientY-c.y}this.screenX=a.screenX;this.screenY=a.screenY;this.shiftKey=a.shiftKey};Sys.UI.DomEvent.prototype={preventDefault:function(){if(this.rawEvent.preventDefault)this.rawEvent.preventDefault();else if(window.event)this.rawEvent.returnValue=false},stopPropagation:function(){if(this.rawEvent.stopPropagation)this.rawEvent.stopPropagation();else if(window.event)this.rawEvent.cancelBubble=true}};Sys.UI.DomEvent.registerClass("Sys.UI.DomEvent");var $addHandler=Sys.UI.DomEvent.addHandler=function(a,d,e,g){if(!a._events)a._events={};var c=a._events[d];if(!c)a._events[d]=c=[];var b;if(a.addEventListener){b=function(b){return e.call(a,new Sys.UI.DomEvent(b))};a.addEventListener(d,b,false)}else if(a.attachEvent){b=function(){var b={};try{b=Sys.UI.DomElement._getWindow(a).event}catch(c){}return e.call(a,new Sys.UI.DomEvent(b))};a.attachEvent("on"+d,b)}c[c.length]={handler:e,browserHandler:b,autoRemove:g};if(g){var f=a.dispose;if(f!==Sys.UI.DomEvent._disposeHandlers){a.dispose=Sys.UI.DomEvent._disposeHandlers;if(typeof f!=="undefined")a._chainDispose=f}}},$addHandlers=Sys.UI.DomEvent.addHandlers=function(f,d,c,e){for(var b in d){var a=d[b];if(c)a=Function.createDelegate(c,a);$addHandler(f,b,a,e||false)}},$clearHandlers=Sys.UI.DomEvent.clearHandlers=function(a){Sys.UI.DomEvent._clearHandlers(a,false)};Sys.UI.DomEvent._clearHandlers=function(a,g){if(a._events){var e=a._events;for(var b in e){var d=e[b];for(var c=d.length-1;c>=0;c--){var f=d[c];if(!g||f.autoRemove)$removeHandler(a,b,f.handler)}}a._events=null}};Sys.UI.DomEvent._disposeHandlers=function(){Sys.UI.DomEvent._clearHandlers(this,true);var b=this._chainDispose,a=typeof b;if(a!=="undefined"){this.dispose=b;this._chainDispose=null;if(a==="function")this.dispose()}};var $removeHandler=Sys.UI.DomEvent.removeHandler=function(b,a,c){Sys.UI.DomEvent._removeHandler(b,a,c)};Sys.UI.DomEvent._removeHandler=function(a,e,f){var d=null,c=a._events[e];for(var b=0,g=c.length;b<g;b++)if(c[b].handler===f){d=c[b].browserHandler;break}if(a.removeEventListener)a.removeEventListener(e,d,false);else if(a.detachEvent)a.detachEvent("on"+e,d);c.splice(b,1)};Sys.UI.DomElement=function(){};Sys.UI.DomElement.registerClass("Sys.UI.DomElement");Sys.UI.DomElement.addCssClass=function(a,b){if(!Sys.UI.DomElement.containsCssClass(a,b))if(a.className==="")a.className=b;else a.className+=" "+b};Sys.UI.DomElement.containsCssClass=function(b,a){return Array.contains(b.className.split(" "),a)};Sys.UI.DomElement.getBounds=function(a){var b=Sys.UI.DomElement.getLocation(a);return new Sys.UI.Bounds(b.x,b.y,a.offsetWidth||0,a.offsetHeight||0)};var $get=Sys.UI.DomElement.getElementById=function(f,e){if(!e)return document.getElementById(f);if(e.getElementById)return e.getElementById(f);var c=[],d=e.childNodes;for(var b=0;b<d.length;b++){var a=d[b];if(a.nodeType==1)c[c.length]=a}while(c.length){a=c.shift();if(a.id==f)return a;d=a.childNodes;for(b=0;b<d.length;b++){a=d[b];if(a.nodeType==1)c[c.length]=a}}return null};if(document.documentElement.getBoundingClientRect)Sys.UI.DomElement.getLocation=function(a){if(a.self||a.nodeType===9||a===document.documentElement||a.parentNode===a.ownerDocument.documentElement)return new Sys.UI.Point(0,0);var f=a.getBoundingClientRect();if(!f)return new Sys.UI.Point(0,0);var e=a.ownerDocument.documentElement,h=a.ownerDocument.body,l,c=Math.round(f.left)+(e.scrollLeft||h.scrollLeft),d=Math.round(f.top)+(e.scrollTop||h.scrollTop);if(Sys.Browser.agent===Sys.Browser.InternetExplorer){try{var g=a.ownerDocument.parentWindow.frameElement||null;if(g){var i=g.frameBorder==="0"||g.frameBorder==="no"?2:0;c+=i;d+=i}}catch(m){}if(Sys.Browser.version===7&&!document.documentMode){var j=document.body,k=j.getBoundingClientRect(),b=(k.right-k.left)/j.clientWidth;b=Math.round(b*100);b=(b-b%5)/100;if(!isNaN(b)&&b!==1){c=Math.round(c/b);d=Math.round(d/b)}}if((document.documentMode||0)<8){c-=e.clientLeft;d-=e.clientTop}}return new Sys.UI.Point(c,d)};else if(Sys.Browser.agent===Sys.Browser.Safari)Sys.UI.DomElement.getLocation=function(c){if(c.window&&c.window===c||c.nodeType===9)return new Sys.UI.Point(0,0);var d=0,e=0,a,j=null,g=null,b;for(a=c;a;j=a,(g=b,a=a.offsetParent)){b=Sys.UI.DomElement._getCurrentStyle(a);var f=a.tagName?a.tagName.toUpperCase():null;if((a.offsetLeft||a.offsetTop)&&(f!=="BODY"||(!g||g.position!=="absolute"))){d+=a.offsetLeft;e+=a.offsetTop}if(j&&Sys.Browser.version>=3){d+=parseInt(b.borderLeftWidth);e+=parseInt(b.borderTopWidth)}}b=Sys.UI.DomElement._getCurrentStyle(c);var h=b?b.position:null;if(!h||h!=="absolute")for(a=c.parentNode;a;a=a.parentNode){f=a.tagName?a.tagName.toUpperCase():null;if(f!=="BODY"&&f!=="HTML"&&(a.scrollLeft||a.scrollTop)){d-=a.scrollLeft||0;e-=a.scrollTop||0}b=Sys.UI.DomElement._getCurrentStyle(a);var i=b?b.position:null;if(i&&i==="absolute")break}return new Sys.UI.Point(d,e)};else Sys.UI.DomElement.getLocation=function(d){if(d.window&&d.window===d||d.nodeType===9)return new Sys.UI.Point(0,0);var e=0,f=0,a,i=null,g=null,b=null;for(a=d;a;i=a,(g=b,a=a.offsetParent)){var c=a.tagName?a.tagName.toUpperCase():null;b=Sys.UI.DomElement._getCurrentStyle(a);if((a.offsetLeft||a.offsetTop)&&!(c==="BODY"&&(!g||g.position!=="absolute"))){e+=a.offsetLeft;f+=a.offsetTop}if(i!==null&&b){if(c!=="TABLE"&&c!=="TD"&&c!=="HTML"){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}if(c==="TABLE"&&(b.position==="relative"||b.position==="absolute")){e+=parseInt(b.marginLeft)||0;f+=parseInt(b.marginTop)||0}}}b=Sys.UI.DomElement._getCurrentStyle(d);var h=b?b.position:null;if(!h||h!=="absolute")for(a=d.parentNode;a;a=a.parentNode){c=a.tagName?a.tagName.toUpperCase():null;if(c!=="BODY"&&c!=="HTML"&&(a.scrollLeft||a.scrollTop)){e-=a.scrollLeft||0;f-=a.scrollTop||0;b=Sys.UI.DomElement._getCurrentStyle(a);if(b){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}}}return new Sys.UI.Point(e,f)};Sys.UI.DomElement.isDomElement=function(a){return Sys._isDomElement(a)};Sys.UI.DomElement.removeCssClass=function(d,c){var a=" "+d.className+" ",b=a.indexOf(" "+c+" ");if(b>=0)d.className=(a.substr(0,b)+" "+a.substring(b+c.length+1,a.length)).trim()};Sys.UI.DomElement.resolveElement=function(b,c){var a=b;if(!a)return null;if(typeof a==="string")a=Sys.UI.DomElement.getElementById(a,c);return a};Sys.UI.DomElement.raiseBubbleEvent=function(c,d){var b=c;while(b){var a=b.control;if(a&&a.onBubbleEvent&&a.raiseBubbleEvent){Sys.UI.DomElement._raiseBubbleEventFromControl(a,c,d);return}b=b.parentNode}};Sys.UI.DomElement._raiseBubbleEventFromControl=function(a,b,c){if(!a.onBubbleEvent(b,c))a._raiseBubbleEvent(b,c)};Sys.UI.DomElement.setLocation=function(b,c,d){var a=b.style;a.position="absolute";a.left=c+"px";a.top=d+"px"};Sys.UI.DomElement.toggleCssClass=function(b,a){if(Sys.UI.DomElement.containsCssClass(b,a))Sys.UI.DomElement.removeCssClass(b,a);else Sys.UI.DomElement.addCssClass(b,a)};Sys.UI.DomElement.getVisibilityMode=function(a){return a._visibilityMode===Sys.UI.VisibilityMode.hide?Sys.UI.VisibilityMode.hide:Sys.UI.VisibilityMode.collapse};Sys.UI.DomElement.setVisibilityMode=function(a,b){Sys.UI.DomElement._ensureOldDisplayMode(a);if(a._visibilityMode!==b){a._visibilityMode=b;if(Sys.UI.DomElement.getVisible(a)===false)if(a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none";a._visibilityMode=b}};Sys.UI.DomElement.getVisible=function(b){var a=b.currentStyle||Sys.UI.DomElement._getCurrentStyle(b);if(!a)return true;return a.visibility!=="hidden"&&a.display!=="none"};Sys.UI.DomElement.setVisible=function(a,b){if(b!==Sys.UI.DomElement.getVisible(a)){Sys.UI.DomElement._ensureOldDisplayMode(a);a.style.visibility=b?"visible":"hidden";if(b||a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none"}};Sys.UI.DomElement._ensureOldDisplayMode=function(a){if(!a._oldDisplayMode){var b=a.currentStyle||Sys.UI.DomElement._getCurrentStyle(a);a._oldDisplayMode=b?b.display:null;if(!a._oldDisplayMode||a._oldDisplayMode==="none")switch(a.tagName.toUpperCase()){case "DIV":case "P":case "ADDRESS":case "BLOCKQUOTE":case "BODY":case "COL":case "COLGROUP":case "DD":case "DL":case "DT":case "FIELDSET":case "FORM":case "H1":case "H2":case "H3":case "H4":case "H5":case "H6":case "HR":case "IFRAME":case "LEGEND":case "OL":case "PRE":case "TABLE":case "TD":case "TH":case "TR":case "UL":a._oldDisplayMode="block";break;case "LI":a._oldDisplayMode="list-item";break;default:a._oldDisplayMode="inline"}}};Sys.UI.DomElement._getWindow=function(a){var b=a.ownerDocument||a.document||a;return b.defaultView||b.parentWindow};Sys.UI.DomElement._getCurrentStyle=function(a){if(a.nodeType===3)return null;var c=Sys.UI.DomElement._getWindow(a);if(a.documentElement)a=a.documentElement;var b=c&&a!==c&&c.getComputedStyle?c.getComputedStyle(a,null):a.currentStyle||a.style;if(!b&&Sys.Browser.agent===Sys.Browser.Safari&&a.style){var g=a.style.display,f=a.style.position;a.style.position="absolute";a.style.display="block";var e=c.getComputedStyle(a,null);a.style.display=g;a.style.position=f;b={};for(var d in e)b[d]=e[d];b.display="none"}return b};Sys.IContainer=function(){};Sys.IContainer.prototype={};Sys.IContainer.registerInterface("Sys.IContainer");Sys.ApplicationLoadEventArgs=function(b,a){Sys.ApplicationLoadEventArgs.initializeBase(this);this._components=b;this._isPartialLoad=a};Sys.ApplicationLoadEventArgs.prototype={get_components:function(){return this._components},get_isPartialLoad:function(){return this._isPartialLoad}};Sys.ApplicationLoadEventArgs.registerClass("Sys.ApplicationLoadEventArgs",Sys.EventArgs);Sys._Application=function(){Sys._Application.initializeBase(this);this._disposableObjects=[];this._components={};this._createdComponents=[];this._secondPassComponents=[];this._unloadHandlerDelegate=Function.createDelegate(this,this._unloadHandler);Sys.UI.DomEvent.addHandler(window,"unload",this._unloadHandlerDelegate);this._domReady()};Sys._Application.prototype={_creatingComponents:false,_disposing:false,_deleteCount:0,get_isCreatingComponents:function(){return this._creatingComponents},get_isDisposing:function(){return this._disposing},add_init:function(a){if(this._initialized)a(this,Sys.EventArgs.Empty);else this.get_events().addHandler("init",a)},remove_init:function(a){this.get_events().removeHandler("init",a)},add_load:function(a){this.get_events().addHandler("load",a)},remove_load:function(a){this.get_events().removeHandler("load",a)},add_unload:function(a){this.get_events().addHandler("unload",a)},remove_unload:function(a){this.get_events().removeHandler("unload",a)},addComponent:function(a){this._components[a.get_id()]=a},beginCreateComponents:function(){this._creatingComponents=true},dispose:function(){if(!this._disposing){this._disposing=true;if(this._timerCookie){window.clearTimeout(this._timerCookie);delete this._timerCookie}if(this._endRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_endRequest(this._endRequestHandler);delete this._endRequestHandler}if(this._beginRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_beginRequest(this._beginRequestHandler);delete this._beginRequestHandler}if(window.pageUnload)window.pageUnload(this,Sys.EventArgs.Empty);var c=this.get_events().getHandler("unload");if(c)c(this,Sys.EventArgs.Empty);var b=Array.clone(this._disposableObjects);for(var a=0,f=b.length;a<f;a++){var d=b[a];if(typeof d!=="undefined")d.dispose()}Array.clear(this._disposableObjects);Sys.UI.DomEvent.removeHandler(window,"unload",this._unloadHandlerDelegate);if(Sys._ScriptLoader){var e=Sys._ScriptLoader.getInstance();if(e)e.dispose()}Sys._Application.callBaseMethod(this,"dispose")}},disposeElement:function(c,j){if(c.nodeType===1){var b,h=c.getElementsByTagName("*"),g=h.length,i=new Array(g);for(b=0;b<g;b++)i[b]=h[b];for(b=g-1;b>=0;b--){var d=i[b],f=d.dispose;if(f&&typeof f==="function")d.dispose();else{var e=d.control;if(e&&typeof e.dispose==="function")e.dispose()}var a=d._behaviors;if(a)this._disposeComponents(a);a=d._components;if(a){this._disposeComponents(a);d._components=null}}if(!j){var f=c.dispose;if(f&&typeof f==="function")c.dispose();else{var e=c.control;if(e&&typeof e.dispose==="function")e.dispose()}var a=c._behaviors;if(a)this._disposeComponents(a);a=c._components;if(a){this._disposeComponents(a);c._components=null}}}},endCreateComponents:function(){var b=this._secondPassComponents;for(var a=0,d=b.length;a<d;a++){var c=b[a].component;Sys$Component$_setReferences(c,b[a].references);c.endUpdate()}this._secondPassComponents=[];this._creatingComponents=false},findComponent:function(b,a){return a?Sys.IContainer.isInstanceOfType(a)?a.findComponent(b):a[b]||null:Sys.Application._components[b]||null},getComponents:function(){var a=[],b=this._components;for(var c in b)a[a.length]=b[c];return a},initialize:function(){if(!this.get_isInitialized()&&!this._disposing){Sys._Application.callBaseMethod(this,"initialize");this._raiseInit();if(this.get_stateString){if(Sys.WebForms&&Sys.WebForms.PageRequestManager){this._beginRequestHandler=Function.createDelegate(this,this._onPageRequestManagerBeginRequest);Sys.WebForms.PageRequestManager.getInstance().add_beginRequest(this._beginRequestHandler);this._endRequestHandler=Function.createDelegate(this,this._onPageRequestManagerEndRequest);Sys.WebForms.PageRequestManager.getInstance().add_endRequest(this._endRequestHandler)}var a=this.get_stateString();if(a!==this._currentEntry)this._navigate(a);else this._ensureHistory()}this.raiseLoad()}},notifyScriptLoaded:function(){},registerDisposableObject:function(b){if(!this._disposing){var a=this._disposableObjects,c=a.length;a[c]=b;b.__msdisposeindex=c}},raiseLoad:function(){var b=this.get_events().getHandler("load"),a=new Sys.ApplicationLoadEventArgs(Array.clone(this._createdComponents),!!this._loaded);this._loaded=true;if(b)b(this,a);if(window.pageLoad)window.pageLoad(this,a);this._createdComponents=[]},removeComponent:function(b){var a=b.get_id();if(a)delete this._components[a]},unregisterDisposableObject:function(a){if(!this._disposing){var e=a.__msdisposeindex;if(typeof e==="number"){var b=this._disposableObjects;delete b[e];delete a.__msdisposeindex;if(++this._deleteCount>1000){var c=[];for(var d=0,f=b.length;d<f;d++){a=b[d];if(typeof a!=="undefined"){a.__msdisposeindex=c.length;c.push(a)}}this._disposableObjects=c;this._deleteCount=0}}}},_addComponentToSecondPass:function(b,a){this._secondPassComponents[this._secondPassComponents.length]={component:b,references:a}},_disposeComponents:function(a){if(a)for(var b=a.length-1;b>=0;b--){var c=a[b];if(typeof c.dispose==="function")c.dispose()}},_domReady:function(){var a,g,f=this;function b(){f.initialize()}var c=function(){Sys.UI.DomEvent.removeHandler(window,"load",c);b()};Sys.UI.DomEvent.addHandler(window,"load",c);if(document.addEventListener)try{document.addEventListener("DOMContentLoaded",a=function(){document.removeEventListener("DOMContentLoaded",a,false);b()},false)}catch(h){}else if(document.attachEvent)if(window==window.top&&document.documentElement.doScroll){var e,d=document.createElement("div");a=function(){try{d.doScroll("left")}catch(c){e=window.setTimeout(a,0);return}d=null;b()};a()}else document.attachEvent("onreadystatechange",a=function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",a);b()}})},_raiseInit:function(){var a=this.get_events().getHandler("init");if(a){this.beginCreateComponents();a(this,Sys.EventArgs.Empty);this.endCreateComponents()}},_unloadHandler:function(){this.dispose()}};Sys._Application.registerClass("Sys._Application",Sys.Component,Sys.IContainer);Sys.Application=new Sys._Application;var $find=Sys.Application.findComponent;Sys.UI.Behavior=function(b){Sys.UI.Behavior.initializeBase(this);this._element=b;var a=b._behaviors;if(!a)b._behaviors=[this];else a[a.length]=this};Sys.UI.Behavior.prototype={_name:null,get_element:function(){return this._element},get_id:function(){var a=Sys.UI.Behavior.callBaseMethod(this,"get_id");if(a)return a;if(!this._element||!this._element.id)return "";return this._element.id+"$"+this.get_name()},get_name:function(){if(this._name)return this._name;var a=Object.getTypeName(this),b=a.lastIndexOf(".");if(b!==-1)a=a.substr(b+1);if(!this.get_isInitialized())this._name=a;return a},set_name:function(a){this._name=a},initialize:function(){Sys.UI.Behavior.callBaseMethod(this,"initialize");var a=this.get_name();if(a)this._element[a]=this},dispose:function(){Sys.UI.Behavior.callBaseMethod(this,"dispose");var a=this._element;if(a){var c=this.get_name();if(c)a[c]=null;var b=a._behaviors;Array.remove(b,this);if(b.length===0)a._behaviors=null;delete this._element}}};Sys.UI.Behavior.registerClass("Sys.UI.Behavior",Sys.Component);Sys.UI.Behavior.getBehaviorByName=function(b,c){var a=b[c];return a&&Sys.UI.Behavior.isInstanceOfType(a)?a:null};Sys.UI.Behavior.getBehaviors=function(a){if(!a._behaviors)return [];return Array.clone(a._behaviors)};Sys.UI.Behavior.getBehaviorsByType=function(d,e){var a=d._behaviors,c=[];if(a)for(var b=0,f=a.length;b<f;b++)if(e.isInstanceOfType(a[b]))c[c.length]=a[b];return c};Sys.UI.VisibilityMode=function(){throw Error.notImplemented()};Sys.UI.VisibilityMode.prototype={hide:0,collapse:1};Sys.UI.VisibilityMode.registerEnum("Sys.UI.VisibilityMode");Sys.UI.Control=function(a){Sys.UI.Control.initializeBase(this);this._element=a;a.control=this;var b=this.get_role();if(b)a.setAttribute("role",b)};Sys.UI.Control.prototype={_parent:null,_visibilityMode:Sys.UI.VisibilityMode.hide,get_element:function(){return this._element},get_id:function(){if(!this._element)return "";return this._element.id},set_id:function(){throw Error.invalidOperation(Sys.Res.cantSetId)},get_parent:function(){if(this._parent)return this._parent;if(!this._element)return null;var a=this._element.parentNode;while(a){if(a.control)return a.control;a=a.parentNode}return null},set_parent:function(a){this._parent=a},get_role:function(){return null},get_visibilityMode:function(){return Sys.UI.DomElement.getVisibilityMode(this._element)},set_visibilityMode:function(a){Sys.UI.DomElement.setVisibilityMode(this._element,a)},get_visible:function(){return Sys.UI.DomElement.getVisible(this._element)},set_visible:function(a){Sys.UI.DomElement.setVisible(this._element,a)},addCssClass:function(a){Sys.UI.DomElement.addCssClass(this._element,a)},dispose:function(){Sys.UI.Control.callBaseMethod(this,"dispose");if(this._element){this._element.control=null;delete this._element}if(this._parent)delete this._parent},onBubbleEvent:function(){return false},raiseBubbleEvent:function(a,b){this._raiseBubbleEvent(a,b)},_raiseBubbleEvent:function(b,c){var a=this.get_parent();while(a){if(a.onBubbleEvent(b,c))return;a=a.get_parent()}},removeCssClass:function(a){Sys.UI.DomElement.removeCssClass(this._element,a)},toggleCssClass:function(a){Sys.UI.DomElement.toggleCssClass(this._element,a)}};Sys.UI.Control.registerClass("Sys.UI.Control",Sys.Component);Sys.HistoryEventArgs=function(a){Sys.HistoryEventArgs.initializeBase(this);this._state=a};Sys.HistoryEventArgs.prototype={get_state:function(){return this._state}};Sys.HistoryEventArgs.registerClass("Sys.HistoryEventArgs",Sys.EventArgs);Sys.Application._appLoadHandler=null;Sys.Application._beginRequestHandler=null;Sys.Application._clientId=null;Sys.Application._currentEntry="";Sys.Application._endRequestHandler=null;Sys.Application._history=null;Sys.Application._enableHistory=false;Sys.Application._historyFrame=null;Sys.Application._historyInitialized=false;Sys.Application._historyPointIsNew=false;Sys.Application._ignoreTimer=false;Sys.Application._initialState=null;Sys.Application._state={};Sys.Application._timerCookie=0;Sys.Application._timerHandler=null;Sys.Application._uniqueId=null;Sys._Application.prototype.get_stateString=function(){var a=null;if(Sys.Browser.agent===Sys.Browser.Firefox){var c=window.location.href,b=c.indexOf("#");if(b!==-1)a=c.substring(b+1);else a="";return a}else a=window.location.hash;if(a.length>0&&a.charAt(0)==="#")a=a.substring(1);return a};Sys._Application.prototype.get_enableHistory=function(){return this._enableHistory};Sys._Application.prototype.set_enableHistory=function(a){this._enableHistory=a};Sys._Application.prototype.add_navigate=function(a){this.get_events().addHandler("navigate",a)};Sys._Application.prototype.remove_navigate=function(a){this.get_events().removeHandler("navigate",a)};Sys._Application.prototype.addHistoryPoint=function(c,f){this._ensureHistory();var b=this._state;for(var a in c){var d=c[a];if(d===null){if(typeof b[a]!=="undefined")delete b[a]}else b[a]=d}var e=this._serializeState(b);this._historyPointIsNew=true;this._setState(e,f);this._raiseNavigate()};Sys._Application.prototype.setServerId=function(a,b){this._clientId=a;this._uniqueId=b};Sys._Application.prototype.setServerState=function(a){this._ensureHistory();this._state.__s=a;this._updateHiddenField(a)};Sys._Application.prototype._deserializeState=function(a){var e={};a=a||"";var b=a.indexOf("&&");if(b!==-1&&b+2<a.length){e.__s=a.substr(b+2);a=a.substr(0,b)}var g=a.split("&");for(var f=0,j=g.length;f<j;f++){var d=g[f],c=d.indexOf("=");if(c!==-1&&c+1<d.length){var i=d.substr(0,c),h=d.substr(c+1);e[i]=decodeURIComponent(h)}}return e};Sys._Application.prototype._enableHistoryInScriptManager=function(){this._enableHistory=true};Sys._Application.prototype._ensureHistory=function(){if(!this._historyInitialized&&this._enableHistory){if(Sys.Browser.agent===Sys.Browser.InternetExplorer&&Sys.Browser.documentMode<8){this._historyFrame=document.getElementById("__historyFrame");this._ignoreIFrame=true}this._timerHandler=Function.createDelegate(this,this._onIdle);this._timerCookie=window.setTimeout(this._timerHandler,100);try{this._initialState=this._deserializeState(this.get_stateString())}catch(a){}this._historyInitialized=true}};Sys._Application.prototype._navigate=function(c){this._ensureHistory();var b=this._deserializeState(c);if(this._uniqueId){var d=this._state.__s||"",a=b.__s||"";if(a!==d){this._updateHiddenField(a);__doPostBack(this._uniqueId,a);this._state=b;return}}this._setState(c);this._state=b;this._raiseNavigate()};Sys._Application.prototype._onIdle=function(){delete this._timerCookie;var a=this.get_stateString();if(a!==this._currentEntry){if(!this._ignoreTimer){this._historyPointIsNew=false;this._navigate(a)}}else this._ignoreTimer=false;this._timerCookie=window.setTimeout(this._timerHandler,100)};Sys._Application.prototype._onIFrameLoad=function(a){this._ensureHistory();if(!this._ignoreIFrame){this._historyPointIsNew=false;this._navigate(a)}this._ignoreIFrame=false};Sys._Application.prototype._onPageRequestManagerBeginRequest=function(){this._ignoreTimer=true;this._originalTitle=document.title};Sys._Application.prototype._onPageRequestManagerEndRequest=function(g,f){var d=f.get_dataItems()[this._clientId],c=this._originalTitle;this._originalTitle=null;var b=document.getElementById("__EVENTTARGET");if(b&&b.value===this._uniqueId)b.value="";if(typeof d!=="undefined"){this.setServerState(d);this._historyPointIsNew=true}else this._ignoreTimer=false;var a=this._serializeState(this._state);if(a!==this._currentEntry){this._ignoreTimer=true;if(typeof c==="string"){if(Sys.Browser.agent!==Sys.Browser.InternetExplorer||Sys.Browser.version>7){var e=document.title;document.title=c;this._setState(a);document.title=e}else this._setState(a);this._raiseNavigate()}else{this._setState(a);this._raiseNavigate()}}};Sys._Application.prototype._raiseNavigate=function(){var d=this._historyPointIsNew,c=this.get_events().getHandler("navigate"),b={};for(var a in this._state)if(a!=="__s")b[a]=this._state[a];var e=new Sys.HistoryEventArgs(b);if(c)c(this,e);if(!d){var f;try{if(Sys.Browser.agent===Sys.Browser.Firefox&&window.location.hash&&(!window.frameElement||window.top.location.hash))Sys.Browser.version<3.5?window.history.go(0):(location.hash=this.get_stateString())}catch(g){}}};Sys._Application.prototype._serializeState=function(d){var b=[];for(var a in d){var e=d[a];if(a==="__s")var c=e;else b[b.length]=a+"="+encodeURIComponent(e)}return b.join("&")+(c?"&&"+c:"")};Sys._Application.prototype._setState=function(a,b){if(this._enableHistory){a=a||"";if(a!==this._currentEntry){if(window.theForm){var d=window.theForm.action,e=d.indexOf("#");window.theForm.action=(e!==-1?d.substring(0,e):d)+"#"+a}if(this._historyFrame&&this._historyPointIsNew){var f=document.createElement("div");f.appendChild(document.createTextNode(b||document.title));var g=f.innerHTML;this._ignoreIFrame=true;var c=this._historyFrame.contentWindow.document;c.open("javascript:'<html></html>'");c.write("<html><head><title>"+g+"</title><scri"+'pt type="text/javascript">parent.Sys.Application._onIFrameLoad('+Sys.Serialization.JavaScriptSerializer.serialize(a)+");</scri"+"pt></head><body></body></html>");c.close()}this._ignoreTimer=false;this._currentEntry=a;if(this._historyFrame||this._historyPointIsNew){var h=this.get_stateString();if(a!==h){window.location.hash=a;this._currentEntry=this.get_stateString();if(typeof b!=="undefined"&&b!==null)document.title=b}}this._historyPointIsNew=false}}};Sys._Application.prototype._updateHiddenField=function(b){if(this._clientId){var a=document.getElementById(this._clientId);if(a)a.value=b}};if(!window.XMLHttpRequest)window.XMLHttpRequest=function(){var b=["Msxml2.XMLHTTP.3.0","Msxml2.XMLHTTP"];for(var a=0,c=b.length;a<c;a++)try{return new ActiveXObject(b[a])}catch(d){}return null};Type.registerNamespace("Sys.Net");Sys.Net.WebRequestExecutor=function(){this._webRequest=null;this._resultObject=null};Sys.Net.WebRequestExecutor.prototype={get_webRequest:function(){return this._webRequest},_set_webRequest:function(a){this._webRequest=a},get_started:function(){throw Error.notImplemented()},get_responseAvailable:function(){throw Error.notImplemented()},get_timedOut:function(){throw Error.notImplemented()},get_aborted:function(){throw Error.notImplemented()},get_responseData:function(){throw Error.notImplemented()},get_statusCode:function(){throw Error.notImplemented()},get_statusText:function(){throw Error.notImplemented()},get_xml:function(){throw Error.notImplemented()},get_object:function(){if(!this._resultObject)this._resultObject=Sys.Serialization.JavaScriptSerializer.deserialize(this.get_responseData());return this._resultObject},executeRequest:function(){throw Error.notImplemented()},abort:function(){throw Error.notImplemented()},getResponseHeader:function(){throw Error.notImplemented()},getAllResponseHeaders:function(){throw Error.notImplemented()}};Sys.Net.WebRequestExecutor.registerClass("Sys.Net.WebRequestExecutor");Sys.Net.XMLDOM=function(d){if(!window.DOMParser){var c=["Msxml2.DOMDocument.3.0","Msxml2.DOMDocument"];for(var b=0,f=c.length;b<f;b++)try{var a=new ActiveXObject(c[b]);a.async=false;a.loadXML(d);a.setProperty("SelectionLanguage","XPath");return a}catch(g){}}else try{var e=new window.DOMParser;return e.parseFromString(d,"text/xml")}catch(g){}return null};Sys.Net.XMLHttpExecutor=function(){Sys.Net.XMLHttpExecutor.initializeBase(this);var a=this;this._xmlHttpRequest=null;this._webRequest=null;this._responseAvailable=false;this._timedOut=false;this._timer=null;this._aborted=false;this._started=false;this._onReadyStateChange=function(){if(a._xmlHttpRequest.readyState===4){try{if(typeof a._xmlHttpRequest.status==="undefined")return}catch(b){return}a._clearTimer();a._responseAvailable=true;try{a._webRequest.completed(Sys.EventArgs.Empty)}finally{if(a._xmlHttpRequest!=null){a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest=null}}}};this._clearTimer=function(){if(a._timer!=null){window.clearTimeout(a._timer);a._timer=null}};this._onTimeout=function(){if(!a._responseAvailable){a._clearTimer();a._timedOut=true;a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest.abort();a._webRequest.completed(Sys.EventArgs.Empty);a._xmlHttpRequest=null}}};Sys.Net.XMLHttpExecutor.prototype={get_timedOut:function(){return this._timedOut},get_started:function(){return this._started},get_responseAvailable:function(){return this._responseAvailable},get_aborted:function(){return this._aborted},executeRequest:function(){this._webRequest=this.get_webRequest();var c=this._webRequest.get_body(),a=this._webRequest.get_headers();this._xmlHttpRequest=new XMLHttpRequest;this._xmlHttpRequest.onreadystatechange=this._onReadyStateChange;var e=this._webRequest.get_httpVerb();this._xmlHttpRequest.open(e,this._webRequest.getResolvedUrl(),true);this._xmlHttpRequest.setRequestHeader("X-Requested-With","XMLHttpRequest");if(a)for(var b in a){var f=a[b];if(typeof f!=="function")this._xmlHttpRequest.setRequestHeader(b,f)}if(e.toLowerCase()==="post"){if(a===null||!a["Content-Type"])this._xmlHttpRequest.setRequestHeader("Content-Type","application/x-www-form-urlencoded; charset=utf-8");if(!c)c=""}var d=this._webRequest.get_timeout();if(d>0)this._timer=window.setTimeout(Function.createDelegate(this,this._onTimeout),d);this._xmlHttpRequest.send(c);this._started=true},getResponseHeader:function(b){var a;try{a=this._xmlHttpRequest.getResponseHeader(b)}catch(c){}if(!a)a="";return a},getAllResponseHeaders:function(){return this._xmlHttpRequest.getAllResponseHeaders()},get_responseData:function(){return this._xmlHttpRequest.responseText},get_statusCode:function(){var a=0;try{a=this._xmlHttpRequest.status}catch(b){}return a},get_statusText:function(){return this._xmlHttpRequest.statusText},get_xml:function(){var a=this._xmlHttpRequest.responseXML;if(!a||!a.documentElement){a=Sys.Net.XMLDOM(this._xmlHttpRequest.responseText);if(!a||!a.documentElement)return null}else if(navigator.userAgent.indexOf("MSIE")!==-1&&typeof a.setProperty!="undefined")a.setProperty("SelectionLanguage","XPath");if(a.documentElement.namespaceURI==="http://www.mozilla.org/newlayout/xml/parsererror.xml"&&a.documentElement.tagName==="parsererror")return null;if(a.documentElement.firstChild&&a.documentElement.firstChild.tagName==="parsererror")return null;return a},abort:function(){if(this._aborted||this._responseAvailable||this._timedOut)return;this._aborted=true;this._clearTimer();if(this._xmlHttpRequest&&!this._responseAvailable){this._xmlHttpRequest.onreadystatechange=Function.emptyMethod;this._xmlHttpRequest.abort();this._xmlHttpRequest=null;this._webRequest.completed(Sys.EventArgs.Empty)}}};Sys.Net.XMLHttpExecutor.registerClass("Sys.Net.XMLHttpExecutor",Sys.Net.WebRequestExecutor);Sys.Net._WebRequestManager=function(){this._defaultTimeout=0;this._defaultExecutorType="Sys.Net.XMLHttpExecutor"};Sys.Net._WebRequestManager.prototype={add_invokingRequest:function(a){this._get_eventHandlerList().addHandler("invokingRequest",a)},remove_invokingRequest:function(a){this._get_eventHandlerList().removeHandler("invokingRequest",a)},add_completedRequest:function(a){this._get_eventHandlerList().addHandler("completedRequest",a)},remove_completedRequest:function(a){this._get_eventHandlerList().removeHandler("completedRequest",a)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_defaultTimeout:function(){return this._defaultTimeout},set_defaultTimeout:function(a){this._defaultTimeout=a},get_defaultExecutorType:function(){return this._defaultExecutorType},set_defaultExecutorType:function(a){this._defaultExecutorType=a},executeRequest:function(webRequest){var executor=webRequest.get_executor();if(!executor){var failed=false;try{var executorType=eval(this._defaultExecutorType);executor=new executorType}catch(a){failed=true}webRequest.set_executor(executor)}if(executor.get_aborted())return;var evArgs=new Sys.Net.NetworkRequestEventArgs(webRequest),handler=this._get_eventHandlerList().getHandler("invokingRequest");if(handler)handler(this,evArgs);if(!evArgs.get_cancel())executor.executeRequest()}};Sys.Net._WebRequestManager.registerClass("Sys.Net._WebRequestManager");Sys.Net.WebRequestManager=new Sys.Net._WebRequestManager;Sys.Net.NetworkRequestEventArgs=function(a){Sys.Net.NetworkRequestEventArgs.initializeBase(this);this._webRequest=a};Sys.Net.NetworkRequestEventArgs.prototype={get_webRequest:function(){return this._webRequest}};Sys.Net.NetworkRequestEventArgs.registerClass("Sys.Net.NetworkRequestEventArgs",Sys.CancelEventArgs);Sys.Net.WebRequest=function(){this._url="";this._headers={};this._body=null;this._userContext=null;this._httpVerb=null;this._executor=null;this._invokeCalled=false;this._timeout=0};Sys.Net.WebRequest.prototype={add_completed:function(a){this._get_eventHandlerList().addHandler("completed",a)},remove_completed:function(a){this._get_eventHandlerList().removeHandler("completed",a)},completed:function(b){var a=Sys.Net.WebRequestManager._get_eventHandlerList().getHandler("completedRequest");if(a)a(this._executor,b);a=this._get_eventHandlerList().getHandler("completed");if(a)a(this._executor,b)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_url:function(){return this._url},set_url:function(a){this._url=a},get_headers:function(){return this._headers},get_httpVerb:function(){if(this._httpVerb===null){if(this._body===null)return "GET";return "POST"}return this._httpVerb},set_httpVerb:function(a){this._httpVerb=a},get_body:function(){return this._body},set_body:function(a){this._body=a},get_userContext:function(){return this._userContext},set_userContext:function(a){this._userContext=a},get_executor:function(){return this._executor},set_executor:function(a){this._executor=a;this._executor._set_webRequest(this)},get_timeout:function(){if(this._timeout===0)return Sys.Net.WebRequestManager.get_defaultTimeout();return this._timeout},set_timeout:function(a){this._timeout=a},getResolvedUrl:function(){return Sys.Net.WebRequest._resolveUrl(this._url)},invoke:function(){Sys.Net.WebRequestManager.executeRequest(this);this._invokeCalled=true}};Sys.Net.WebRequest._resolveUrl=function(b,a){if(b&&b.indexOf("://")!==-1)return b;if(!a||a.length===0){var d=document.getElementsByTagName("base")[0];if(d&&d.href&&d.href.length>0)a=d.href;else a=document.URL}var c=a.indexOf("?");if(c!==-1)a=a.substr(0,c);c=a.indexOf("#");if(c!==-1)a=a.substr(0,c);a=a.substr(0,a.lastIndexOf("/")+1);if(!b||b.length===0)return a;if(b.charAt(0)==="/"){var e=a.indexOf("://"),g=a.indexOf("/",e+3);return a.substr(0,g)+b}else{var f=a.lastIndexOf("/");return a.substr(0,f+1)+b}};Sys.Net.WebRequest._createQueryString=function(c,b,f){b=b||encodeURIComponent;var h=0,e,g,d,a=new Sys.StringBuilder;if(c)for(d in c){e=c[d];if(typeof e==="function")continue;g=Sys.Serialization.JavaScriptSerializer.serialize(e);if(h++)a.append("&");a.append(d);a.append("=");a.append(b(g))}if(f){if(h)a.append("&");a.append(f)}return a.toString()};Sys.Net.WebRequest._createUrl=function(a,b,c){if(!b&&!c)return a;var d=Sys.Net.WebRequest._createQueryString(b,null,c);return d.length?a+(a&&a.indexOf("?")>=0?"&":"?")+d:a};Sys.Net.WebRequest.registerClass("Sys.Net.WebRequest");Sys._ScriptLoaderTask=function(b,a){this._scriptElement=b;this._completedCallback=a};Sys._ScriptLoaderTask.prototype={get_scriptElement:function(){return this._scriptElement},dispose:function(){if(this._disposed)return;this._disposed=true;this._removeScriptElementHandlers();Sys._ScriptLoaderTask._clearScript(this._scriptElement);this._scriptElement=null},execute:function(){if(this._ensureReadyStateLoaded())this._executeInternal()},_executeInternal:function(){this._addScriptElementHandlers();document.getElementsByTagName("head")[0].appendChild(this._scriptElement)},_ensureReadyStateLoaded:function(){if(this._useReadyState()&&this._scriptElement.readyState!=="loaded"&&this._scriptElement.readyState!=="complete"){this._scriptDownloadDelegate=Function.createDelegate(this,this._executeInternal);$addHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);return false}return true},_addScriptElementHandlers:function(){if(this._scriptDownloadDelegate){$removeHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);this._scriptDownloadDelegate=null}this._scriptLoadDelegate=Function.createDelegate(this,this._scriptLoadHandler);if(this._useReadyState())$addHandler(this._scriptElement,"readystatechange",this._scriptLoadDelegate);else $addHandler(this._scriptElement,"load",this._scriptLoadDelegate);if(this._scriptElement.addEventListener){this._scriptErrorDelegate=Function.createDelegate(this,this._scriptErrorHandler);this._scriptElement.addEventListener("error",this._scriptErrorDelegate,false)}},_removeScriptElementHandlers:function(){if(this._scriptLoadDelegate){var a=this.get_scriptElement();if(this._scriptDownloadDelegate){$removeHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);this._scriptDownloadDelegate=null}if(this._useReadyState()&&this._scriptLoadDelegate)$removeHandler(a,"readystatechange",this._scriptLoadDelegate);else $removeHandler(a,"load",this._scriptLoadDelegate);if(this._scriptErrorDelegate){this._scriptElement.removeEventListener("error",this._scriptErrorDelegate,false);this._scriptErrorDelegate=null}this._scriptLoadDelegate=null}},_scriptErrorHandler:function(){if(this._disposed)return;this._completedCallback(this.get_scriptElement(),false)},_scriptLoadHandler:function(){if(this._disposed)return;var a=this.get_scriptElement();if(this._useReadyState()&&a.readyState!=="complete")return;this._completedCallback(a,true)},_useReadyState:function(){return Sys.Browser.agent===Sys.Browser.InternetExplorer&&(Sys.Browser.version<9||(document.documentMode||0)<9)}};Sys._ScriptLoaderTask.registerClass("Sys._ScriptLoaderTask",null,Sys.IDisposable);Sys._ScriptLoaderTask._clearScript=function(a){if(!Sys.Debug.isDebug&&a.parentNode)a.parentNode.removeChild(a)};Type.registerNamespace("Sys.Net");Sys.Net.WebServiceProxy=function(){};Sys.Net.WebServiceProxy.prototype={get_timeout:function(){return this._timeout||0},set_timeout:function(a){if(a<0)throw Error.argumentOutOfRange("value",a,Sys.Res.invalidTimeout);this._timeout=a},get_defaultUserContext:function(){return typeof this._userContext==="undefined"?null:this._userContext},set_defaultUserContext:function(a){this._userContext=a},get_defaultSucceededCallback:function(){return this._succeeded||null},set_defaultSucceededCallback:function(a){this._succeeded=a},get_defaultFailedCallback:function(){return this._failed||null},set_defaultFailedCallback:function(a){this._failed=a},get_enableJsonp:function(){return !!this._jsonp},set_enableJsonp:function(a){this._jsonp=a},get_path:function(){return this._path||null},set_path:function(a){this._path=a},get_jsonpCallbackParameter:function(){return this._callbackParameter||"callback"},set_jsonpCallbackParameter:function(a){this._callbackParameter=a},_invoke:function(d,e,g,f,c,b,a){c=c||this.get_defaultSucceededCallback();b=b||this.get_defaultFailedCallback();if(a===null||typeof a==="undefined")a=this.get_defaultUserContext();return Sys.Net.WebServiceProxy.invoke(d,e,g,f,c,b,a,this.get_timeout(),this.get_enableJsonp(),this.get_jsonpCallbackParameter())}};Sys.Net.WebServiceProxy.registerClass("Sys.Net.WebServiceProxy");Sys.Net.WebServiceProxy.invoke=function(q,a,m,l,j,b,g,e,w,p){var i=w!==false?Sys.Net.WebServiceProxy._xdomain.exec(q):null,c,n=i&&i.length===3&&(i[1]!==location.protocol||i[2]!==location.host);m=n||m;if(n){p=p||"callback";c="_jsonp"+Sys._jsonp++}if(!l)l={};var r=l;if(!m||!r)r={};var s,h,f=null,k,o=null,u=Sys.Net.WebRequest._createUrl(a?q+"/"+encodeURIComponent(a):q,r,n?p+"=Sys."+c:null);if(n){s=document.createElement("script");s.src=u;k=new Sys._ScriptLoaderTask(s,function(d,b){if(!b||c)t({Message:String.format(Sys.Res.webServiceFailedNoMsg,a)},-1)});function v(){if(f===null)return;f=null;h=new Sys.Net.WebServiceError(true,String.format(Sys.Res.webServiceTimedOut,a));k.dispose();delete Sys[c];if(b)b(h,g,a)}function t(d,e){if(f!==null){window.clearTimeout(f);f=null}k.dispose();delete Sys[c];c=null;if(typeof e!=="undefined"&&e!==200){if(b){h=new Sys.Net.WebServiceError(false,d.Message||String.format(Sys.Res.webServiceFailedNoMsg,a),d.StackTrace||null,d.ExceptionType||null,d);h._statusCode=e;b(h,g,a)}}else if(j)j(d,g,a)}Sys[c]=t;e=e||Sys.Net.WebRequestManager.get_defaultTimeout();if(e>0)f=window.setTimeout(v,e);k.execute();return null}var d=new Sys.Net.WebRequest;d.set_url(u);d.get_headers()["Content-Type"]="application/json; charset=utf-8";if(!m){o=Sys.Serialization.JavaScriptSerializer.serialize(l);if(o==="{}")o=""}d.set_body(o);d.add_completed(x);if(e&&e>0)d.set_timeout(e);d.invoke();function x(d){if(d.get_responseAvailable()){var f=d.get_statusCode(),c=null;try{var e=d.getResponseHeader("Content-Type");if(e.startsWith("application/json"))c=d.get_object();else if(e.startsWith("text/xml"))c=d.get_xml();else c=d.get_responseData()}catch(m){}var k=d.getResponseHeader("jsonerror"),h=k==="true";if(h){if(c)c=new Sys.Net.WebServiceError(false,c.Message,c.StackTrace,c.ExceptionType,c)}else if(e.startsWith("application/json"))c=!c||typeof c.d==="undefined"?c:c.d;if(f<200||f>=300||h){if(b){if(!c||!h)c=new Sys.Net.WebServiceError(false,String.format(Sys.Res.webServiceFailedNoMsg,a));c._statusCode=f;b(c,g,a)}}else if(j)j(c,g,a)}else{var i;if(d.get_timedOut())i=String.format(Sys.Res.webServiceTimedOut,a);else i=String.format(Sys.Res.webServiceFailedNoMsg,a);if(b)b(new Sys.Net.WebServiceError(d.get_timedOut(),i,"",""),g,a)}}return d};Sys.Net.WebServiceProxy._generateTypedConstructor=function(a){return function(b){if(b)for(var c in b)this[c]=b[c];this.__type=a}};Sys._jsonp=0;Sys.Net.WebServiceProxy._xdomain=/^\s*([a-zA-Z0-9\+\-\.]+\:)\/\/([^?#\/]+)/;Sys.Net.WebServiceError=function(d,e,c,a,b){this._timedOut=d;this._message=e;this._stackTrace=c;this._exceptionType=a;this._errorObject=b;this._statusCode=-1};Sys.Net.WebServiceError.prototype={get_timedOut:function(){return this._timedOut},get_statusCode:function(){return this._statusCode},get_message:function(){return this._message},get_stackTrace:function(){return this._stackTrace||""},get_exceptionType:function(){return this._exceptionType||""},get_errorObject:function(){return this._errorObject||null}};Sys.Net.WebServiceError.registerClass("Sys.Net.WebServiceError"); +Type.registerNamespace('Sys');Sys.Res={'argumentInteger':'Value must be an integer.','invokeCalledTwice':'Cannot call invoke more than once.','webServiceFailed':'The server method \'{0}\' failed with the following error: {1}','argumentType':'Object cannot be converted to the required type.','argumentNull':'Value cannot be null.','scriptAlreadyLoaded':'The script \'{0}\' has been referenced multiple times. If referencing Microsoft AJAX scripts explicitly, set the MicrosoftAjaxMode property of the ScriptManager to Explicit.','scriptDependencyNotFound':'The script \'{0}\' failed to load because it is dependent on script \'{1}\'.','formatBadFormatSpecifier':'Format specifier was invalid.','requiredScriptReferenceNotIncluded':'\'{0}\' requires that you have included a script reference to \'{1}\'.','webServiceFailedNoMsg':'The server method \'{0}\' failed.','argumentDomElement':'Value must be a DOM element.','invalidExecutorType':'Could not create a valid Sys.Net.WebRequestExecutor from: {0}.','cannotCallBeforeResponse':'Cannot call {0} when responseAvailable is false.','actualValue':'Actual value was {0}.','enumInvalidValue':'\'{0}\' is not a valid value for enum {1}.','scriptLoadFailed':'The script \'{0}\' could not be loaded.','parameterCount':'Parameter count mismatch.','cannotDeserializeEmptyString':'Cannot deserialize empty string.','formatInvalidString':'Input string was not in a correct format.','invalidTimeout':'Value must be greater than or equal to zero.','cannotAbortBeforeStart':'Cannot abort when executor has not started.','argument':'Value does not fall within the expected range.','cannotDeserializeInvalidJson':'Cannot deserialize. The data does not correspond to valid JSON.','invalidHttpVerb':'httpVerb cannot be set to an empty or null string.','nullWebRequest':'Cannot call executeRequest with a null webRequest.','eventHandlerInvalid':'Handler was not added through the Sys.UI.DomEvent.addHandler method.','cannotSerializeNonFiniteNumbers':'Cannot serialize non finite numbers.','argumentUndefined':'Value cannot be undefined.','webServiceInvalidReturnType':'The server method \'{0}\' returned an invalid type. Expected type: {1}','servicePathNotSet':'The path to the web service has not been set.','argumentTypeWithTypes':'Object of type \'{0}\' cannot be converted to type \'{1}\'.','cannotCallOnceStarted':'Cannot call {0} once started.','badBaseUrl1':'Base URL does not contain ://.','badBaseUrl2':'Base URL does not contain another /.','badBaseUrl3':'Cannot find last / in base URL.','setExecutorAfterActive':'Cannot set executor after it has become active.','paramName':'Parameter name: {0}','nullReferenceInPath':'Null reference while evaluating data path: \'{0}\'.','cannotCallOutsideHandler':'Cannot call {0} outside of a completed event handler.','cannotSerializeObjectWithCycle':'Cannot serialize object with cyclic reference within child properties.','format':'One of the identified items was in an invalid format.','assertFailedCaller':'Assertion Failed: {0}\r\nat {1}','argumentOutOfRange':'Specified argument was out of the range of valid values.','webServiceTimedOut':'The server method \'{0}\' timed out.','notImplemented':'The method or operation is not implemented.','assertFailed':'Assertion Failed: {0}','invalidOperation':'Operation is not valid due to the current state of the object.','breakIntoDebugger':'{0}\r\n\r\nBreak into debugger?'}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxApplicationServices.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxApplicationServices.js new file mode 100644 index 0000000..6410f84 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxApplicationServices.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxApplicationServices.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxApplicationServices.js +Type._registerScript("MicrosoftAjaxApplicationServices.js",["MicrosoftAjaxWebServices.js"]);Type.registerNamespace("Sys.Services");Sys.Services._ProfileService=function(){Sys.Services._ProfileService.initializeBase(this);this.properties={}};Sys.Services._ProfileService.DefaultWebServicePath="";Sys.Services._ProfileService.prototype={_defaultLoadCompletedCallback:null,_defaultSaveCompletedCallback:null,_path:"",_timeout:0,get_defaultLoadCompletedCallback:function(){return this._defaultLoadCompletedCallback},set_defaultLoadCompletedCallback:function(a){this._defaultLoadCompletedCallback=a},get_defaultSaveCompletedCallback:function(){return this._defaultSaveCompletedCallback},set_defaultSaveCompletedCallback:function(a){this._defaultSaveCompletedCallback=a},get_path:function(){return this._path||""},load:function(c,d,e,f){var b,a;if(!c){a="GetAllPropertiesForCurrentUser";b={authenticatedUserOnly:false}}else{a="GetPropertiesForCurrentUser";b={properties:this._clonePropertyNames(c),authenticatedUserOnly:false}}this._invoke(this._get_path(),a,false,b,Function.createDelegate(this,this._onLoadComplete),Function.createDelegate(this,this._onLoadFailed),[d,e,f])},save:function(d,b,c,e){var a=this._flattenProperties(d,this.properties);this._invoke(this._get_path(),"SetPropertiesForCurrentUser",false,{values:a.value,authenticatedUserOnly:false},Function.createDelegate(this,this._onSaveComplete),Function.createDelegate(this,this._onSaveFailed),[b,c,e,a.count])},_clonePropertyNames:function(e){var c=[],d={};for(var b=0;b<e.length;b++){var a=e[b];if(!d[a]){Array.add(c,a);d[a]=true}}return c},_flattenProperties:function(a,i,j){var b={},e,d,g=0;if(a&&a.length===0)return {value:b,count:0};for(var c in i){e=i[c];d=j?j+"."+c:c;if(Sys.Services.ProfileGroup.isInstanceOfType(e)){var k=this._flattenProperties(a,e,d),h=k.value;g+=k.count;for(var f in h){var l=h[f];b[f]=l}}else if(!a||Array.indexOf(a,d)!==-1){b[d]=e;g++}}return {value:b,count:g}},_get_path:function(){var a=this.get_path();if(!a.length)a=Sys.Services._ProfileService.DefaultWebServicePath;if(!a||!a.length)throw Error.invalidOperation(Sys.Res.servicePathNotSet);return a},_onLoadComplete:function(a,e,g){if(typeof a!=="object")throw Error.invalidOperation(String.format(Sys.Res.webServiceInvalidReturnType,g,"Object"));var c=this._unflattenProperties(a);for(var b in c)this.properties[b]=c[b];var d=e[0]||this.get_defaultLoadCompletedCallback()||this.get_defaultSucceededCallback();if(d){var f=e[2]||this.get_defaultUserContext();d(a.length,f,"Sys.Services.ProfileService.load")}},_onLoadFailed:function(d,b){var a=b[1]||this.get_defaultFailedCallback();if(a){var c=b[2]||this.get_defaultUserContext();a(d,c,"Sys.Services.ProfileService.load")}},_onSaveComplete:function(a,b,f){var c=b[3];if(a!==null)if(a instanceof Array)c-=a.length;else if(typeof a==="number")c=a;else throw Error.invalidOperation(String.format(Sys.Res.webServiceInvalidReturnType,f,"Array"));var d=b[0]||this.get_defaultSaveCompletedCallback()||this.get_defaultSucceededCallback();if(d){var e=b[2]||this.get_defaultUserContext();d(c,e,"Sys.Services.ProfileService.save")}},_onSaveFailed:function(d,b){var a=b[1]||this.get_defaultFailedCallback();if(a){var c=b[2]||this.get_defaultUserContext();a(d,c,"Sys.Services.ProfileService.save")}},_unflattenProperties:function(e){var c={},d,f,h=0;for(var a in e){h++;f=e[a];d=a.indexOf(".");if(d!==-1){var g=a.substr(0,d);a=a.substr(d+1);var b=c[g];if(!b||!Sys.Services.ProfileGroup.isInstanceOfType(b)){b=new Sys.Services.ProfileGroup;c[g]=b}b[a]=f}else c[a]=f}e.length=h;return c}};Sys.Services._ProfileService.registerClass("Sys.Services._ProfileService",Sys.Net.WebServiceProxy);Sys.Services.ProfileService=new Sys.Services._ProfileService;Sys.Services.ProfileGroup=function(a){if(a)for(var b in a)this[b]=a[b]};Sys.Services.ProfileGroup.registerClass("Sys.Services.ProfileGroup");Sys.Services._AuthenticationService=function(){Sys.Services._AuthenticationService.initializeBase(this)};Sys.Services._AuthenticationService.DefaultWebServicePath="";Sys.Services._AuthenticationService.prototype={_defaultLoginCompletedCallback:null,_defaultLogoutCompletedCallback:null,_path:"",_timeout:0,_authenticated:false,get_defaultLoginCompletedCallback:function(){return this._defaultLoginCompletedCallback},set_defaultLoginCompletedCallback:function(a){this._defaultLoginCompletedCallback=a},get_defaultLogoutCompletedCallback:function(){return this._defaultLogoutCompletedCallback},set_defaultLogoutCompletedCallback:function(a){this._defaultLogoutCompletedCallback=a},get_isLoggedIn:function(){return this._authenticated},get_path:function(){return this._path||""},login:function(c,b,a,h,f,d,e,g){this._invoke(this._get_path(),"Login",false,{userName:c,password:b,createPersistentCookie:a},Function.createDelegate(this,this._onLoginComplete),Function.createDelegate(this,this._onLoginFailed),[c,b,a,h,f,d,e,g])},logout:function(c,a,b,d){this._invoke(this._get_path(),"Logout",false,{},Function.createDelegate(this,this._onLogoutComplete),Function.createDelegate(this,this._onLogoutFailed),[c,a,b,d])},_get_path:function(){var a=this.get_path();if(!a.length)a=Sys.Services._AuthenticationService.DefaultWebServicePath;if(!a||!a.length)throw Error.invalidOperation(Sys.Res.servicePathNotSet);return a},_onLoginComplete:function(e,c,f){if(typeof e!=="boolean")throw Error.invalidOperation(String.format(Sys.Res.webServiceInvalidReturnType,f,"Boolean"));var b=c[4],d=c[7]||this.get_defaultUserContext(),a=c[5]||this.get_defaultLoginCompletedCallback()||this.get_defaultSucceededCallback();if(e){this._authenticated=true;if(a)a(true,d,"Sys.Services.AuthenticationService.login");if(typeof b!=="undefined"&&b!==null)window.location.href=b}else if(a)a(false,d,"Sys.Services.AuthenticationService.login")},_onLoginFailed:function(d,b){var a=b[6]||this.get_defaultFailedCallback();if(a){var c=b[7]||this.get_defaultUserContext();a(d,c,"Sys.Services.AuthenticationService.login")}},_onLogoutComplete:function(f,a,e){if(f!==null)throw Error.invalidOperation(String.format(Sys.Res.webServiceInvalidReturnType,e,"null"));var b=a[0],d=a[3]||this.get_defaultUserContext(),c=a[1]||this.get_defaultLogoutCompletedCallback()||this.get_defaultSucceededCallback();this._authenticated=false;if(c)c(null,d,"Sys.Services.AuthenticationService.logout");if(!b)window.location.reload();else window.location.href=b},_onLogoutFailed:function(c,b){var a=b[2]||this.get_defaultFailedCallback();if(a)a(c,b[3],"Sys.Services.AuthenticationService.logout")},_setAuthenticated:function(a){this._authenticated=a}};Sys.Services._AuthenticationService.registerClass("Sys.Services._AuthenticationService",Sys.Net.WebServiceProxy);Sys.Services.AuthenticationService=new Sys.Services._AuthenticationService;Sys.Services._RoleService=function(){Sys.Services._RoleService.initializeBase(this);this._roles=[]};Sys.Services._RoleService.DefaultWebServicePath="";Sys.Services._RoleService.prototype={_defaultLoadCompletedCallback:null,_rolesIndex:null,_timeout:0,_path:"",get_defaultLoadCompletedCallback:function(){return this._defaultLoadCompletedCallback},set_defaultLoadCompletedCallback:function(a){this._defaultLoadCompletedCallback=a},get_path:function(){return this._path||""},get_roles:function(){return Array.clone(this._roles)},isUserInRole:function(a){var b=this._get_rolesIndex()[a.trim().toLowerCase()];return !!b},load:function(a,b,c){Sys.Net.WebServiceProxy.invoke(this._get_path(),"GetRolesForCurrentUser",false,{},Function.createDelegate(this,this._onLoadComplete),Function.createDelegate(this,this._onLoadFailed),[a,b,c],this.get_timeout())},_get_path:function(){var a=this.get_path();if(!a||!a.length)a=Sys.Services._RoleService.DefaultWebServicePath;if(!a||!a.length)throw Error.invalidOperation(Sys.Res.servicePathNotSet);return a},_get_rolesIndex:function(){if(!this._rolesIndex){var b={};for(var a=0;a<this._roles.length;a++)b[this._roles[a].toLowerCase()]=true;this._rolesIndex=b}return this._rolesIndex},_onLoadComplete:function(a,c,f){if(a&&!(a instanceof Array))throw Error.invalidOperation(String.format(Sys.Res.webServiceInvalidReturnType,f,"Array"));this._roles=a;this._rolesIndex=null;var b=c[0]||this.get_defaultLoadCompletedCallback()||this.get_defaultSucceededCallback();if(b){var e=c[2]||this.get_defaultUserContext(),d=Array.clone(a);b(d,e,"Sys.Services.RoleService.load")}},_onLoadFailed:function(d,b){var a=b[1]||this.get_defaultFailedCallback();if(a){var c=b[2]||this.get_defaultUserContext();a(d,c,"Sys.Services.RoleService.load")}}};Sys.Services._RoleService.registerClass("Sys.Services._RoleService",Sys.Net.WebServiceProxy);Sys.Services.RoleService=new Sys.Services._RoleService; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxComponentModel.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxComponentModel.js new file mode 100644 index 0000000..0aa7c74 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxComponentModel.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxComponentModel.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxComponentModel.js +Type._registerScript("MicrosoftAjaxComponentModel.js",["MicrosoftAjaxCore.js"]);Type.registerNamespace("Sys.UI");Sys.CommandEventArgs=function(c,a,b){Sys.CommandEventArgs.initializeBase(this);this._commandName=c;this._commandArgument=a;this._commandSource=b};Sys.CommandEventArgs.prototype={_commandName:null,_commandArgument:null,_commandSource:null,get_commandName:function(){return this._commandName},get_commandArgument:function(){return this._commandArgument},get_commandSource:function(){return this._commandSource}};Sys.CommandEventArgs.registerClass("Sys.CommandEventArgs",Sys.CancelEventArgs);Sys.INotifyDisposing=function(){};Sys.INotifyDisposing.prototype={};Sys.INotifyDisposing.registerInterface("Sys.INotifyDisposing");Sys.Component=function(){if(Sys.Application)Sys.Application.registerDisposableObject(this)};Sys.Component.prototype={_id:null,_initialized:false,_updating:false,get_events:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_id:function(){return this._id},set_id:function(a){this._id=a},get_isInitialized:function(){return this._initialized},get_isUpdating:function(){return this._updating},add_disposing:function(a){this.get_events().addHandler("disposing",a)},remove_disposing:function(a){this.get_events().removeHandler("disposing",a)},add_propertyChanged:function(a){this.get_events().addHandler("propertyChanged",a)},remove_propertyChanged:function(a){this.get_events().removeHandler("propertyChanged",a)},beginUpdate:function(){this._updating=true},dispose:function(){if(this._events){var a=this._events.getHandler("disposing");if(a)a(this,Sys.EventArgs.Empty)}delete this._events;Sys.Application.unregisterDisposableObject(this);Sys.Application.removeComponent(this)},endUpdate:function(){this._updating=false;if(!this._initialized)this.initialize();this.updated()},initialize:function(){this._initialized=true},raisePropertyChanged:function(b){if(!this._events)return;var a=this._events.getHandler("propertyChanged");if(a)a(this,new Sys.PropertyChangedEventArgs(b))},updated:function(){}};Sys.Component.registerClass("Sys.Component",null,Sys.IDisposable,Sys.INotifyPropertyChange,Sys.INotifyDisposing);function Sys$Component$_setProperties(a,i){var d,j=Object.getType(a),e=j===Object||j===Sys.UI.DomElement,h=Sys.Component.isInstanceOfType(a)&&!a.get_isUpdating();if(h)a.beginUpdate();for(var c in i){var b=i[c],f=e?null:a["get_"+c];if(e||typeof f!=="function"){var k=a[c];if(!b||typeof b!=="object"||e&&!k)a[c]=b;else Sys$Component$_setProperties(k,b)}else{var l=a["set_"+c];if(typeof l==="function")l.apply(a,[b]);else if(b instanceof Array){d=f.apply(a);for(var g=0,m=d.length,n=b.length;g<n;g++,m++)d[m]=b[g]}else if(typeof b==="object"&&Object.getType(b)===Object){d=f.apply(a);Sys$Component$_setProperties(d,b)}}}if(h)a.endUpdate()}function Sys$Component$_setReferences(c,b){for(var a in b){var e=c["set_"+a],d=$find(b[a]);e.apply(c,[d])}}var $create=Sys.Component.create=function(h,f,d,c,g){var a=g?new h(g):new h,b=Sys.Application,i=b.get_isCreatingComponents();a.beginUpdate();if(f)Sys$Component$_setProperties(a,f);if(d)for(var e in d)a["add_"+e](d[e]);if(a.get_id())b.addComponent(a);if(i){b._createdComponents[b._createdComponents.length]=a;if(c)b._addComponentToSecondPass(a,c);else a.endUpdate()}else{if(c)Sys$Component$_setReferences(a,c);a.endUpdate()}return a};Sys.UI.MouseButton=function(){throw Error.notImplemented()};Sys.UI.MouseButton.prototype={leftButton:0,middleButton:1,rightButton:2};Sys.UI.MouseButton.registerEnum("Sys.UI.MouseButton");Sys.UI.Key=function(){throw Error.notImplemented()};Sys.UI.Key.prototype={backspace:8,tab:9,enter:13,esc:27,space:32,pageUp:33,pageDown:34,end:35,home:36,left:37,up:38,right:39,down:40,del:127};Sys.UI.Key.registerEnum("Sys.UI.Key");Sys.UI.Point=function(a,b){this.rawX=a;this.rawY=b;this.x=Math.round(a);this.y=Math.round(b)};Sys.UI.Point.registerClass("Sys.UI.Point");Sys.UI.Bounds=function(c,d,b,a){this.x=c;this.y=d;this.height=a;this.width=b};Sys.UI.Bounds.registerClass("Sys.UI.Bounds");Sys.UI.DomEvent=function(e){var a=e,b=this.type=a.type.toLowerCase();this.rawEvent=a;this.altKey=a.altKey;if(typeof a.button!=="undefined")this.button=typeof a.which!=="undefined"?a.button:a.button===4?Sys.UI.MouseButton.middleButton:a.button===2?Sys.UI.MouseButton.rightButton:Sys.UI.MouseButton.leftButton;if(b==="keypress")this.charCode=a.charCode||a.keyCode;else if(a.keyCode&&a.keyCode===46)this.keyCode=127;else this.keyCode=a.keyCode;this.clientX=a.clientX;this.clientY=a.clientY;this.ctrlKey=a.ctrlKey;this.target=a.target?a.target:a.srcElement;if(!b.startsWith("key"))if(typeof a.offsetX!=="undefined"&&typeof a.offsetY!=="undefined"){this.offsetX=a.offsetX;this.offsetY=a.offsetY}else if(this.target&&this.target.nodeType!==3&&typeof a.clientX==="number"){var c=Sys.UI.DomElement.getLocation(this.target),d=Sys.UI.DomElement._getWindow(this.target);this.offsetX=(d.pageXOffset||0)+a.clientX-c.x;this.offsetY=(d.pageYOffset||0)+a.clientY-c.y}this.screenX=a.screenX;this.screenY=a.screenY;this.shiftKey=a.shiftKey};Sys.UI.DomEvent.prototype={preventDefault:function(){if(this.rawEvent.preventDefault)this.rawEvent.preventDefault();else if(window.event)this.rawEvent.returnValue=false},stopPropagation:function(){if(this.rawEvent.stopPropagation)this.rawEvent.stopPropagation();else if(window.event)this.rawEvent.cancelBubble=true}};Sys.UI.DomEvent.registerClass("Sys.UI.DomEvent");var $addHandler=Sys.UI.DomEvent.addHandler=function(a,d,e,g){if(!a._events)a._events={};var c=a._events[d];if(!c)a._events[d]=c=[];var b;if(a.addEventListener){b=function(b){return e.call(a,new Sys.UI.DomEvent(b))};a.addEventListener(d,b,false)}else if(a.attachEvent){b=function(){var b={};try{b=Sys.UI.DomElement._getWindow(a).event}catch(c){}return e.call(a,new Sys.UI.DomEvent(b))};a.attachEvent("on"+d,b)}c[c.length]={handler:e,browserHandler:b,autoRemove:g};if(g){var f=a.dispose;if(f!==Sys.UI.DomEvent._disposeHandlers){a.dispose=Sys.UI.DomEvent._disposeHandlers;if(typeof f!=="undefined")a._chainDispose=f}}},$addHandlers=Sys.UI.DomEvent.addHandlers=function(f,d,c,e){for(var b in d){var a=d[b];if(c)a=Function.createDelegate(c,a);$addHandler(f,b,a,e||false)}},$clearHandlers=Sys.UI.DomEvent.clearHandlers=function(a){Sys.UI.DomEvent._clearHandlers(a,false)};Sys.UI.DomEvent._clearHandlers=function(a,g){if(a._events){var e=a._events;for(var b in e){var d=e[b];for(var c=d.length-1;c>=0;c--){var f=d[c];if(!g||f.autoRemove)$removeHandler(a,b,f.handler)}}a._events=null}};Sys.UI.DomEvent._disposeHandlers=function(){Sys.UI.DomEvent._clearHandlers(this,true);var b=this._chainDispose,a=typeof b;if(a!=="undefined"){this.dispose=b;this._chainDispose=null;if(a==="function")this.dispose()}};var $removeHandler=Sys.UI.DomEvent.removeHandler=function(b,a,c){Sys.UI.DomEvent._removeHandler(b,a,c)};Sys.UI.DomEvent._removeHandler=function(a,e,f){var d=null,c=a._events[e];for(var b=0,g=c.length;b<g;b++)if(c[b].handler===f){d=c[b].browserHandler;break}if(a.removeEventListener)a.removeEventListener(e,d,false);else if(a.detachEvent)a.detachEvent("on"+e,d);c.splice(b,1)};Sys.UI.DomElement=function(){};Sys.UI.DomElement.registerClass("Sys.UI.DomElement");Sys.UI.DomElement.addCssClass=function(a,b){if(!Sys.UI.DomElement.containsCssClass(a,b))if(a.className==="")a.className=b;else a.className+=" "+b};Sys.UI.DomElement.containsCssClass=function(b,a){return Array.contains(b.className.split(" "),a)};Sys.UI.DomElement.getBounds=function(a){var b=Sys.UI.DomElement.getLocation(a);return new Sys.UI.Bounds(b.x,b.y,a.offsetWidth||0,a.offsetHeight||0)};var $get=Sys.UI.DomElement.getElementById=function(f,e){if(!e)return document.getElementById(f);if(e.getElementById)return e.getElementById(f);var c=[],d=e.childNodes;for(var b=0;b<d.length;b++){var a=d[b];if(a.nodeType==1)c[c.length]=a}while(c.length){a=c.shift();if(a.id==f)return a;d=a.childNodes;for(b=0;b<d.length;b++){a=d[b];if(a.nodeType==1)c[c.length]=a}}return null};if(document.documentElement.getBoundingClientRect)Sys.UI.DomElement.getLocation=function(a){if(a.self||a.nodeType===9||a===document.documentElement||a.parentNode===a.ownerDocument.documentElement)return new Sys.UI.Point(0,0);var f=a.getBoundingClientRect();if(!f)return new Sys.UI.Point(0,0);var e=a.ownerDocument.documentElement,h=a.ownerDocument.body,l,c=Math.round(f.left)+(e.scrollLeft||h.scrollLeft),d=Math.round(f.top)+(e.scrollTop||h.scrollTop);if(Sys.Browser.agent===Sys.Browser.InternetExplorer){try{var g=a.ownerDocument.parentWindow.frameElement||null;if(g){var i=g.frameBorder==="0"||g.frameBorder==="no"?2:0;c+=i;d+=i}}catch(m){}if(Sys.Browser.version===7&&!document.documentMode){var j=document.body,k=j.getBoundingClientRect(),b=(k.right-k.left)/j.clientWidth;b=Math.round(b*100);b=(b-b%5)/100;if(!isNaN(b)&&b!==1){c=Math.round(c/b);d=Math.round(d/b)}}if((document.documentMode||0)<8){c-=e.clientLeft;d-=e.clientTop}}return new Sys.UI.Point(c,d)};else if(Sys.Browser.agent===Sys.Browser.Safari)Sys.UI.DomElement.getLocation=function(c){if(c.window&&c.window===c||c.nodeType===9)return new Sys.UI.Point(0,0);var d=0,e=0,a,j=null,g=null,b;for(a=c;a;j=a,(g=b,a=a.offsetParent)){b=Sys.UI.DomElement._getCurrentStyle(a);var f=a.tagName?a.tagName.toUpperCase():null;if((a.offsetLeft||a.offsetTop)&&(f!=="BODY"||(!g||g.position!=="absolute"))){d+=a.offsetLeft;e+=a.offsetTop}if(j&&Sys.Browser.version>=3){d+=parseInt(b.borderLeftWidth);e+=parseInt(b.borderTopWidth)}}b=Sys.UI.DomElement._getCurrentStyle(c);var h=b?b.position:null;if(!h||h!=="absolute")for(a=c.parentNode;a;a=a.parentNode){f=a.tagName?a.tagName.toUpperCase():null;if(f!=="BODY"&&f!=="HTML"&&(a.scrollLeft||a.scrollTop)){d-=a.scrollLeft||0;e-=a.scrollTop||0}b=Sys.UI.DomElement._getCurrentStyle(a);var i=b?b.position:null;if(i&&i==="absolute")break}return new Sys.UI.Point(d,e)};else Sys.UI.DomElement.getLocation=function(d){if(d.window&&d.window===d||d.nodeType===9)return new Sys.UI.Point(0,0);var e=0,f=0,a,i=null,g=null,b=null;for(a=d;a;i=a,(g=b,a=a.offsetParent)){var c=a.tagName?a.tagName.toUpperCase():null;b=Sys.UI.DomElement._getCurrentStyle(a);if((a.offsetLeft||a.offsetTop)&&!(c==="BODY"&&(!g||g.position!=="absolute"))){e+=a.offsetLeft;f+=a.offsetTop}if(i!==null&&b){if(c!=="TABLE"&&c!=="TD"&&c!=="HTML"){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}if(c==="TABLE"&&(b.position==="relative"||b.position==="absolute")){e+=parseInt(b.marginLeft)||0;f+=parseInt(b.marginTop)||0}}}b=Sys.UI.DomElement._getCurrentStyle(d);var h=b?b.position:null;if(!h||h!=="absolute")for(a=d.parentNode;a;a=a.parentNode){c=a.tagName?a.tagName.toUpperCase():null;if(c!=="BODY"&&c!=="HTML"&&(a.scrollLeft||a.scrollTop)){e-=a.scrollLeft||0;f-=a.scrollTop||0;b=Sys.UI.DomElement._getCurrentStyle(a);if(b){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}}}return new Sys.UI.Point(e,f)};Sys.UI.DomElement.isDomElement=function(a){return Sys._isDomElement(a)};Sys.UI.DomElement.removeCssClass=function(d,c){var a=" "+d.className+" ",b=a.indexOf(" "+c+" ");if(b>=0)d.className=(a.substr(0,b)+" "+a.substring(b+c.length+1,a.length)).trim()};Sys.UI.DomElement.resolveElement=function(b,c){var a=b;if(!a)return null;if(typeof a==="string")a=Sys.UI.DomElement.getElementById(a,c);return a};Sys.UI.DomElement.raiseBubbleEvent=function(c,d){var b=c;while(b){var a=b.control;if(a&&a.onBubbleEvent&&a.raiseBubbleEvent){Sys.UI.DomElement._raiseBubbleEventFromControl(a,c,d);return}b=b.parentNode}};Sys.UI.DomElement._raiseBubbleEventFromControl=function(a,b,c){if(!a.onBubbleEvent(b,c))a._raiseBubbleEvent(b,c)};Sys.UI.DomElement.setLocation=function(b,c,d){var a=b.style;a.position="absolute";a.left=c+"px";a.top=d+"px"};Sys.UI.DomElement.toggleCssClass=function(b,a){if(Sys.UI.DomElement.containsCssClass(b,a))Sys.UI.DomElement.removeCssClass(b,a);else Sys.UI.DomElement.addCssClass(b,a)};Sys.UI.DomElement.getVisibilityMode=function(a){return a._visibilityMode===Sys.UI.VisibilityMode.hide?Sys.UI.VisibilityMode.hide:Sys.UI.VisibilityMode.collapse};Sys.UI.DomElement.setVisibilityMode=function(a,b){Sys.UI.DomElement._ensureOldDisplayMode(a);if(a._visibilityMode!==b){a._visibilityMode=b;if(Sys.UI.DomElement.getVisible(a)===false)if(a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none";a._visibilityMode=b}};Sys.UI.DomElement.getVisible=function(b){var a=b.currentStyle||Sys.UI.DomElement._getCurrentStyle(b);if(!a)return true;return a.visibility!=="hidden"&&a.display!=="none"};Sys.UI.DomElement.setVisible=function(a,b){if(b!==Sys.UI.DomElement.getVisible(a)){Sys.UI.DomElement._ensureOldDisplayMode(a);a.style.visibility=b?"visible":"hidden";if(b||a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none"}};Sys.UI.DomElement._ensureOldDisplayMode=function(a){if(!a._oldDisplayMode){var b=a.currentStyle||Sys.UI.DomElement._getCurrentStyle(a);a._oldDisplayMode=b?b.display:null;if(!a._oldDisplayMode||a._oldDisplayMode==="none")switch(a.tagName.toUpperCase()){case "DIV":case "P":case "ADDRESS":case "BLOCKQUOTE":case "BODY":case "COL":case "COLGROUP":case "DD":case "DL":case "DT":case "FIELDSET":case "FORM":case "H1":case "H2":case "H3":case "H4":case "H5":case "H6":case "HR":case "IFRAME":case "LEGEND":case "OL":case "PRE":case "TABLE":case "TD":case "TH":case "TR":case "UL":a._oldDisplayMode="block";break;case "LI":a._oldDisplayMode="list-item";break;default:a._oldDisplayMode="inline"}}};Sys.UI.DomElement._getWindow=function(a){var b=a.ownerDocument||a.document||a;return b.defaultView||b.parentWindow};Sys.UI.DomElement._getCurrentStyle=function(a){if(a.nodeType===3)return null;var c=Sys.UI.DomElement._getWindow(a);if(a.documentElement)a=a.documentElement;var b=c&&a!==c&&c.getComputedStyle?c.getComputedStyle(a,null):a.currentStyle||a.style;if(!b&&Sys.Browser.agent===Sys.Browser.Safari&&a.style){var g=a.style.display,f=a.style.position;a.style.position="absolute";a.style.display="block";var e=c.getComputedStyle(a,null);a.style.display=g;a.style.position=f;b={};for(var d in e)b[d]=e[d];b.display="none"}return b};Sys.IContainer=function(){};Sys.IContainer.prototype={};Sys.IContainer.registerInterface("Sys.IContainer");Sys.ApplicationLoadEventArgs=function(b,a){Sys.ApplicationLoadEventArgs.initializeBase(this);this._components=b;this._isPartialLoad=a};Sys.ApplicationLoadEventArgs.prototype={get_components:function(){return this._components},get_isPartialLoad:function(){return this._isPartialLoad}};Sys.ApplicationLoadEventArgs.registerClass("Sys.ApplicationLoadEventArgs",Sys.EventArgs);Sys._Application=function(){Sys._Application.initializeBase(this);this._disposableObjects=[];this._components={};this._createdComponents=[];this._secondPassComponents=[];this._unloadHandlerDelegate=Function.createDelegate(this,this._unloadHandler);Sys.UI.DomEvent.addHandler(window,"unload",this._unloadHandlerDelegate);this._domReady()};Sys._Application.prototype={_creatingComponents:false,_disposing:false,_deleteCount:0,get_isCreatingComponents:function(){return this._creatingComponents},get_isDisposing:function(){return this._disposing},add_init:function(a){if(this._initialized)a(this,Sys.EventArgs.Empty);else this.get_events().addHandler("init",a)},remove_init:function(a){this.get_events().removeHandler("init",a)},add_load:function(a){this.get_events().addHandler("load",a)},remove_load:function(a){this.get_events().removeHandler("load",a)},add_unload:function(a){this.get_events().addHandler("unload",a)},remove_unload:function(a){this.get_events().removeHandler("unload",a)},addComponent:function(a){this._components[a.get_id()]=a},beginCreateComponents:function(){this._creatingComponents=true},dispose:function(){if(!this._disposing){this._disposing=true;if(this._timerCookie){window.clearTimeout(this._timerCookie);delete this._timerCookie}if(this._endRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_endRequest(this._endRequestHandler);delete this._endRequestHandler}if(this._beginRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_beginRequest(this._beginRequestHandler);delete this._beginRequestHandler}if(window.pageUnload)window.pageUnload(this,Sys.EventArgs.Empty);var c=this.get_events().getHandler("unload");if(c)c(this,Sys.EventArgs.Empty);var b=Array.clone(this._disposableObjects);for(var a=0,f=b.length;a<f;a++){var d=b[a];if(typeof d!=="undefined")d.dispose()}Array.clear(this._disposableObjects);Sys.UI.DomEvent.removeHandler(window,"unload",this._unloadHandlerDelegate);if(Sys._ScriptLoader){var e=Sys._ScriptLoader.getInstance();if(e)e.dispose()}Sys._Application.callBaseMethod(this,"dispose")}},disposeElement:function(c,j){if(c.nodeType===1){var b,h=c.getElementsByTagName("*"),g=h.length,i=new Array(g);for(b=0;b<g;b++)i[b]=h[b];for(b=g-1;b>=0;b--){var d=i[b],f=d.dispose;if(f&&typeof f==="function")d.dispose();else{var e=d.control;if(e&&typeof e.dispose==="function")e.dispose()}var a=d._behaviors;if(a)this._disposeComponents(a);a=d._components;if(a){this._disposeComponents(a);d._components=null}}if(!j){var f=c.dispose;if(f&&typeof f==="function")c.dispose();else{var e=c.control;if(e&&typeof e.dispose==="function")e.dispose()}var a=c._behaviors;if(a)this._disposeComponents(a);a=c._components;if(a){this._disposeComponents(a);c._components=null}}}},endCreateComponents:function(){var b=this._secondPassComponents;for(var a=0,d=b.length;a<d;a++){var c=b[a].component;Sys$Component$_setReferences(c,b[a].references);c.endUpdate()}this._secondPassComponents=[];this._creatingComponents=false},findComponent:function(b,a){return a?Sys.IContainer.isInstanceOfType(a)?a.findComponent(b):a[b]||null:Sys.Application._components[b]||null},getComponents:function(){var a=[],b=this._components;for(var c in b)a[a.length]=b[c];return a},initialize:function(){if(!this.get_isInitialized()&&!this._disposing){Sys._Application.callBaseMethod(this,"initialize");this._raiseInit();if(this.get_stateString){if(Sys.WebForms&&Sys.WebForms.PageRequestManager){this._beginRequestHandler=Function.createDelegate(this,this._onPageRequestManagerBeginRequest);Sys.WebForms.PageRequestManager.getInstance().add_beginRequest(this._beginRequestHandler);this._endRequestHandler=Function.createDelegate(this,this._onPageRequestManagerEndRequest);Sys.WebForms.PageRequestManager.getInstance().add_endRequest(this._endRequestHandler)}var a=this.get_stateString();if(a!==this._currentEntry)this._navigate(a);else this._ensureHistory()}this.raiseLoad()}},notifyScriptLoaded:function(){},registerDisposableObject:function(b){if(!this._disposing){var a=this._disposableObjects,c=a.length;a[c]=b;b.__msdisposeindex=c}},raiseLoad:function(){var b=this.get_events().getHandler("load"),a=new Sys.ApplicationLoadEventArgs(Array.clone(this._createdComponents),!!this._loaded);this._loaded=true;if(b)b(this,a);if(window.pageLoad)window.pageLoad(this,a);this._createdComponents=[]},removeComponent:function(b){var a=b.get_id();if(a)delete this._components[a]},unregisterDisposableObject:function(a){if(!this._disposing){var e=a.__msdisposeindex;if(typeof e==="number"){var b=this._disposableObjects;delete b[e];delete a.__msdisposeindex;if(++this._deleteCount>1000){var c=[];for(var d=0,f=b.length;d<f;d++){a=b[d];if(typeof a!=="undefined"){a.__msdisposeindex=c.length;c.push(a)}}this._disposableObjects=c;this._deleteCount=0}}}},_addComponentToSecondPass:function(b,a){this._secondPassComponents[this._secondPassComponents.length]={component:b,references:a}},_disposeComponents:function(a){if(a)for(var b=a.length-1;b>=0;b--){var c=a[b];if(typeof c.dispose==="function")c.dispose()}},_domReady:function(){var a,g,f=this;function b(){f.initialize()}var c=function(){Sys.UI.DomEvent.removeHandler(window,"load",c);b()};Sys.UI.DomEvent.addHandler(window,"load",c);if(document.addEventListener)try{document.addEventListener("DOMContentLoaded",a=function(){document.removeEventListener("DOMContentLoaded",a,false);b()},false)}catch(h){}else if(document.attachEvent)if(window==window.top&&document.documentElement.doScroll){var e,d=document.createElement("div");a=function(){try{d.doScroll("left")}catch(c){e=window.setTimeout(a,0);return}d=null;b()};a()}else document.attachEvent("onreadystatechange",a=function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",a);b()}})},_raiseInit:function(){var a=this.get_events().getHandler("init");if(a){this.beginCreateComponents();a(this,Sys.EventArgs.Empty);this.endCreateComponents()}},_unloadHandler:function(){this.dispose()}};Sys._Application.registerClass("Sys._Application",Sys.Component,Sys.IContainer);Sys.Application=new Sys._Application;var $find=Sys.Application.findComponent;Sys.UI.Behavior=function(b){Sys.UI.Behavior.initializeBase(this);this._element=b;var a=b._behaviors;if(!a)b._behaviors=[this];else a[a.length]=this};Sys.UI.Behavior.prototype={_name:null,get_element:function(){return this._element},get_id:function(){var a=Sys.UI.Behavior.callBaseMethod(this,"get_id");if(a)return a;if(!this._element||!this._element.id)return "";return this._element.id+"$"+this.get_name()},get_name:function(){if(this._name)return this._name;var a=Object.getTypeName(this),b=a.lastIndexOf(".");if(b!==-1)a=a.substr(b+1);if(!this.get_isInitialized())this._name=a;return a},set_name:function(a){this._name=a},initialize:function(){Sys.UI.Behavior.callBaseMethod(this,"initialize");var a=this.get_name();if(a)this._element[a]=this},dispose:function(){Sys.UI.Behavior.callBaseMethod(this,"dispose");var a=this._element;if(a){var c=this.get_name();if(c)a[c]=null;var b=a._behaviors;Array.remove(b,this);if(b.length===0)a._behaviors=null;delete this._element}}};Sys.UI.Behavior.registerClass("Sys.UI.Behavior",Sys.Component);Sys.UI.Behavior.getBehaviorByName=function(b,c){var a=b[c];return a&&Sys.UI.Behavior.isInstanceOfType(a)?a:null};Sys.UI.Behavior.getBehaviors=function(a){if(!a._behaviors)return [];return Array.clone(a._behaviors)};Sys.UI.Behavior.getBehaviorsByType=function(d,e){var a=d._behaviors,c=[];if(a)for(var b=0,f=a.length;b<f;b++)if(e.isInstanceOfType(a[b]))c[c.length]=a[b];return c};Sys.UI.VisibilityMode=function(){throw Error.notImplemented()};Sys.UI.VisibilityMode.prototype={hide:0,collapse:1};Sys.UI.VisibilityMode.registerEnum("Sys.UI.VisibilityMode");Sys.UI.Control=function(a){Sys.UI.Control.initializeBase(this);this._element=a;a.control=this;var b=this.get_role();if(b)a.setAttribute("role",b)};Sys.UI.Control.prototype={_parent:null,_visibilityMode:Sys.UI.VisibilityMode.hide,get_element:function(){return this._element},get_id:function(){if(!this._element)return "";return this._element.id},set_id:function(){throw Error.invalidOperation(Sys.Res.cantSetId)},get_parent:function(){if(this._parent)return this._parent;if(!this._element)return null;var a=this._element.parentNode;while(a){if(a.control)return a.control;a=a.parentNode}return null},set_parent:function(a){this._parent=a},get_role:function(){return null},get_visibilityMode:function(){return Sys.UI.DomElement.getVisibilityMode(this._element)},set_visibilityMode:function(a){Sys.UI.DomElement.setVisibilityMode(this._element,a)},get_visible:function(){return Sys.UI.DomElement.getVisible(this._element)},set_visible:function(a){Sys.UI.DomElement.setVisible(this._element,a)},addCssClass:function(a){Sys.UI.DomElement.addCssClass(this._element,a)},dispose:function(){Sys.UI.Control.callBaseMethod(this,"dispose");if(this._element){this._element.control=null;delete this._element}if(this._parent)delete this._parent},onBubbleEvent:function(){return false},raiseBubbleEvent:function(a,b){this._raiseBubbleEvent(a,b)},_raiseBubbleEvent:function(b,c){var a=this.get_parent();while(a){if(a.onBubbleEvent(b,c))return;a=a.get_parent()}},removeCssClass:function(a){Sys.UI.DomElement.removeCssClass(this._element,a)},toggleCssClass:function(a){Sys.UI.DomElement.toggleCssClass(this._element,a)}};Sys.UI.Control.registerClass("Sys.UI.Control",Sys.Component); diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxCore.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxCore.js new file mode 100644 index 0000000..16fd15b --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxCore.js @@ -0,0 +1,7 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxCore.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxCore.js +Function.__typeName="Function";Function.__class=true;Function.createCallback=function(b,a){return function(){var e=arguments.length;if(e>0){var d=[];for(var c=0;c<e;c++)d[c]=arguments[c];d[e]=a;return b.apply(this,d)}return b.call(this,a)}};Function.createDelegate=function(a,b){return function(){return b.apply(a,arguments)}};Function.emptyFunction=Function.emptyMethod=function(){};Function.validateParameters=function(c,b,a){return Function._validateParams(c,b,a)};Function._validateParams=function(g,e,c){var a,d=e.length;c=c||typeof c==="undefined";a=Function._validateParameterCount(g,e,c);if(a){a.popStackFrame();return a}for(var b=0,i=g.length;b<i;b++){var f=e[Math.min(b,d-1)],h=f.name;if(f.parameterArray)h+="["+(b-d+1)+"]";else if(!c&&b>=d)break;a=Function._validateParameter(g[b],f,h);if(a){a.popStackFrame();return a}}return null};Function._validateParameterCount=function(j,d,i){var a,c,b=d.length,e=j.length;if(e<b){var f=b;for(a=0;a<b;a++){var g=d[a];if(g.optional||g.parameterArray)f--}if(e<f)c=true}else if(i&&e>b){c=true;for(a=0;a<b;a++)if(d[a].parameterArray){c=false;break}}if(c){var h=Error.parameterCount();h.popStackFrame();return h}return null};Function._validateParameter=function(c,a,h){var b,g=a.type,l=!!a.integer,k=!!a.domElement,m=!!a.mayBeNull;b=Function._validateParameterType(c,g,l,k,m,h);if(b){b.popStackFrame();return b}var e=a.elementType,f=!!a.elementMayBeNull;if(g===Array&&typeof c!=="undefined"&&c!==null&&(e||!f)){var j=!!a.elementInteger,i=!!a.elementDomElement;for(var d=0;d<c.length;d++){var n=c[d];b=Function._validateParameterType(n,e,j,i,f,h+"["+d+"]");if(b){b.popStackFrame();return b}}}return null};Function._validateParameterType=function(b,c,k,j,h,d){var a,g;if(typeof b==="undefined")if(h)return null;else{a=Error.argumentUndefined(d);a.popStackFrame();return a}if(b===null)if(h)return null;else{a=Error.argumentNull(d);a.popStackFrame();return a}if(c&&c.__enum){if(typeof b!=="number"){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(b%1===0){var e=c.prototype;if(!c.__flags||b===0){for(g in e)if(e[g]===b)return null}else{var i=b;for(g in e){var f=e[g];if(f===0)continue;if((f&b)===f)i-=f;if(i===0)return null}}}a=Error.argumentOutOfRange(d,b,String.format(Sys.Res.enumInvalidValue,b,c.getName()));a.popStackFrame();return a}if(j&&(!Sys._isDomElement(b)||b.nodeType===3)){a=Error.argument(d,Sys.Res.argumentDomElement);a.popStackFrame();return a}if(c&&!Sys._isInstanceOfType(c,b)){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(c===Number&&k)if(b%1!==0){a=Error.argumentOutOfRange(d,b,Sys.Res.argumentInteger);a.popStackFrame();return a}return null};Error.__typeName="Error";Error.__class=true;Error.create=function(d,b){var a=new Error(d);a.message=d;if(b)for(var c in b)a[c]=b[c];a.popStackFrame();return a};Error.argument=function(a,c){var b="Sys.ArgumentException: "+(c?c:Sys.Res.argument);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentException",paramName:a});d.popStackFrame();return d};Error.argumentNull=function(a,c){var b="Sys.ArgumentNullException: "+(c?c:Sys.Res.argumentNull);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentNullException",paramName:a});d.popStackFrame();return d};Error.argumentOutOfRange=function(c,a,d){var b="Sys.ArgumentOutOfRangeException: "+(d?d:Sys.Res.argumentOutOfRange);if(c)b+="\n"+String.format(Sys.Res.paramName,c);if(typeof a!=="undefined"&&a!==null)b+="\n"+String.format(Sys.Res.actualValue,a);var e=Error.create(b,{name:"Sys.ArgumentOutOfRangeException",paramName:c,actualValue:a});e.popStackFrame();return e};Error.argumentType=function(d,c,b,e){var a="Sys.ArgumentTypeException: ";if(e)a+=e;else if(c&&b)a+=String.format(Sys.Res.argumentTypeWithTypes,c.getName(),b.getName());else a+=Sys.Res.argumentType;if(d)a+="\n"+String.format(Sys.Res.paramName,d);var f=Error.create(a,{name:"Sys.ArgumentTypeException",paramName:d,actualType:c,expectedType:b});f.popStackFrame();return f};Error.argumentUndefined=function(a,c){var b="Sys.ArgumentUndefinedException: "+(c?c:Sys.Res.argumentUndefined);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentUndefinedException",paramName:a});d.popStackFrame();return d};Error.format=function(a){var c="Sys.FormatException: "+(a?a:Sys.Res.format),b=Error.create(c,{name:"Sys.FormatException"});b.popStackFrame();return b};Error.invalidOperation=function(a){var c="Sys.InvalidOperationException: "+(a?a:Sys.Res.invalidOperation),b=Error.create(c,{name:"Sys.InvalidOperationException"});b.popStackFrame();return b};Error.notImplemented=function(a){var c="Sys.NotImplementedException: "+(a?a:Sys.Res.notImplemented),b=Error.create(c,{name:"Sys.NotImplementedException"});b.popStackFrame();return b};Error.parameterCount=function(a){var c="Sys.ParameterCountException: "+(a?a:Sys.Res.parameterCount),b=Error.create(c,{name:"Sys.ParameterCountException"});b.popStackFrame();return b};Error.prototype.popStackFrame=function(){if(typeof this.stack==="undefined"||this.stack===null||typeof this.fileName==="undefined"||this.fileName===null||typeof this.lineNumber==="undefined"||this.lineNumber===null)return;var a=this.stack.split("\n"),c=a[0],e=this.fileName+":"+this.lineNumber;while(typeof c!=="undefined"&&c!==null&&c.indexOf(e)===-1){a.shift();c=a[0]}var d=a[1];if(typeof d==="undefined"||d===null)return;var b=d.match(/@(.*):(\d+)$/);if(typeof b==="undefined"||b===null)return;this.fileName=b[1];this.lineNumber=parseInt(b[2]);a.shift();this.stack=a.join("\n")};Object.__typeName="Object";Object.__class=true;Object.getType=function(b){var a=b.constructor;if(!a||typeof a!=="function"||!a.__typeName||a.__typeName==="Object")return Object;return a};Object.getTypeName=function(a){return Object.getType(a).getName()};String.__typeName="String";String.__class=true;String.prototype.endsWith=function(a){return this.substr(this.length-a.length)===a};String.prototype.startsWith=function(a){return this.substr(0,a.length)===a};String.prototype.trim=function(){return this.replace(/^\s+|\s+$/g,"")};String.prototype.trimEnd=function(){return this.replace(/\s+$/,"")};String.prototype.trimStart=function(){return this.replace(/^\s+/,"")};String.format=function(){return String._toFormattedString(false,arguments)};String._toFormattedString=function(l,j){var c="",e=j[0];for(var a=0;true;){var f=e.indexOf("{",a),d=e.indexOf("}",a);if(f<0&&d<0){c+=e.slice(a);break}if(d>0&&(d<f||f<0)){c+=e.slice(a,d+1);a=d+2;continue}c+=e.slice(a,f);a=f+1;if(e.charAt(a)==="{"){c+="{";a++;continue}if(d<0)break;var h=e.substring(a,d),g=h.indexOf(":"),k=parseInt(g<0?h:h.substring(0,g),10)+1,i=g<0?"":h.substring(g+1),b=j[k];if(typeof b==="undefined"||b===null)b="";if(b.toFormattedString)c+=b.toFormattedString(i);else if(l&&b.localeFormat)c+=b.localeFormat(i);else if(b.format)c+=b.format(i);else c+=b.toString();a=d+1}return c};Boolean.__typeName="Boolean";Boolean.__class=true;Boolean.parse=function(b){var a=b.trim().toLowerCase();if(a==="false")return false;if(a==="true")return true};Date.__typeName="Date";Date.__class=true;Number.__typeName="Number";Number.__class=true;RegExp.__typeName="RegExp";RegExp.__class=true;if(!window)this.window=this;window.Type=Function;Type.prototype.callBaseMethod=function(a,d,b){var c=Sys._getBaseMethod(this,a,d);if(!b)return c.apply(a);else return c.apply(a,b)};Type.prototype.getBaseMethod=function(a,b){return Sys._getBaseMethod(this,a,b)};Type.prototype.getBaseType=function(){return typeof this.__baseType==="undefined"?null:this.__baseType};Type.prototype.getInterfaces=function(){var a=[],b=this;while(b){var c=b.__interfaces;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Array.contains(a,e))a[a.length]=e}b=b.__baseType}return a};Type.prototype.getName=function(){return typeof this.__typeName==="undefined"?"":this.__typeName};Type.prototype.implementsInterface=function(d){this.resolveInheritance();var c=d.getName(),a=this.__interfaceCache;if(a){var e=a[c];if(typeof e!=="undefined")return e}else a=this.__interfaceCache={};var b=this;while(b){var f=b.__interfaces;if(f)if(Array.indexOf(f,d)!==-1)return a[c]=true;b=b.__baseType}return a[c]=false};Type.prototype.inheritsFrom=function(b){this.resolveInheritance();var a=this.__baseType;while(a){if(a===b)return true;a=a.__baseType}return false};Type.prototype.initializeBase=function(a,b){this.resolveInheritance();if(this.__baseType)if(!b)this.__baseType.apply(a);else this.__baseType.apply(a,b);return a};Type.prototype.isImplementedBy=function(a){if(typeof a==="undefined"||a===null)return false;var b=Object.getType(a);return !!(b.implementsInterface&&b.implementsInterface(this))};Type.prototype.isInstanceOfType=function(a){return Sys._isInstanceOfType(this,a)};Type.prototype.registerClass=function(c,b,d){this.prototype.constructor=this;this.__typeName=c;this.__class=true;if(b){this.__baseType=b;this.__basePrototypePending=true}Sys.__upperCaseTypes[c.toUpperCase()]=this;if(d){this.__interfaces=[];for(var a=2,f=arguments.length;a<f;a++){var e=arguments[a];this.__interfaces.push(e)}}return this};Type.prototype.registerInterface=function(a){Sys.__upperCaseTypes[a.toUpperCase()]=this;this.prototype.constructor=this;this.__typeName=a;this.__interface=true;return this};Type.prototype.resolveInheritance=function(){if(this.__basePrototypePending){var b=this.__baseType;b.resolveInheritance();for(var a in b.prototype){var c=b.prototype[a];if(!this.prototype[a])this.prototype[a]=c}delete this.__basePrototypePending}};Type.getRootNamespaces=function(){return Array.clone(Sys.__rootNamespaces)};Type.isClass=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__class};Type.isInterface=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__interface};Type.isNamespace=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__namespace};Type.parse=function(typeName,ns){var fn;if(ns){fn=Sys.__upperCaseTypes[ns.getName().toUpperCase()+"."+typeName.toUpperCase()];return fn||null}if(!typeName)return null;if(!Type.__htClasses)Type.__htClasses={};fn=Type.__htClasses[typeName];if(!fn){fn=eval(typeName);Type.__htClasses[typeName]=fn}return fn};Type.registerNamespace=function(e){var d=window,c=e.split(".");for(var b=0;b<c.length;b++){var f=c[b],a=d[f];if(!a)a=d[f]={};if(!a.__namespace){if(b===0&&e!=="Sys")Sys.__rootNamespaces[Sys.__rootNamespaces.length]=a;a.__namespace=true;a.__typeName=c.slice(0,b+1).join(".");a.getName=function(){return this.__typeName}}d=a}};Type._checkDependency=function(c,a){var d=Type._registerScript._scripts,b=d?!!d[c]:false;if(typeof a!=="undefined"&&!b)throw Error.invalidOperation(String.format(Sys.Res.requiredScriptReferenceNotIncluded,a,c));return b};Type._registerScript=function(a,c){var b=Type._registerScript._scripts;if(!b)Type._registerScript._scripts=b={};if(b[a])throw Error.invalidOperation(String.format(Sys.Res.scriptAlreadyLoaded,a));b[a]=true;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Type._checkDependency(e))throw Error.invalidOperation(String.format(Sys.Res.scriptDependencyNotFound,a,e))}};Type.registerNamespace("Sys");Sys.__upperCaseTypes={};Sys.__rootNamespaces=[Sys];Sys._isInstanceOfType=function(c,b){if(typeof b==="undefined"||b===null)return false;if(b instanceof c)return true;var a=Object.getType(b);return !!(a===c)||a.inheritsFrom&&a.inheritsFrom(c)||a.implementsInterface&&a.implementsInterface(c)};Sys._getBaseMethod=function(d,e,c){var b=d.getBaseType();if(b){var a=b.prototype[c];return a instanceof Function?a:null}return null};Sys._isDomElement=function(a){var c=false;if(typeof a.nodeType!=="number"){var b=a.ownerDocument||a.document||a;if(b!=a){var d=b.defaultView||b.parentWindow;c=d!=a}else c=typeof b.body==="undefined"}return !c};Array.__typeName="Array";Array.__class=true;Array.add=Array.enqueue=function(a,b){a[a.length]=b};Array.addRange=function(a,b){a.push.apply(a,b)};Array.clear=function(a){a.length=0};Array.clone=function(a){if(a.length===1)return [a[0]];else return Array.apply(null,a)};Array.contains=function(a,b){return Sys._indexOf(a,b)>=0};Array.dequeue=function(a){return a.shift()};Array.forEach=function(b,e,d){for(var a=0,f=b.length;a<f;a++){var c=b[a];if(typeof c!=="undefined")e.call(d,c,a,b)}};Array.indexOf=function(a,c,b){return Sys._indexOf(a,c,b)};Array.insert=function(a,b,c){a.splice(b,0,c)};Array.parse=function(value){if(!value)return [];return eval(value)};Array.remove=function(b,c){var a=Sys._indexOf(b,c);if(a>=0)b.splice(a,1);return a>=0};Array.removeAt=function(a,b){a.splice(b,1)};Sys._indexOf=function(d,e,a){if(typeof e==="undefined")return -1;var c=d.length;if(c!==0){a=a-0;if(isNaN(a))a=0;else{if(isFinite(a))a=a-a%1;if(a<0)a=Math.max(0,c+a)}for(var b=a;b<c;b++)if(typeof d[b]!=="undefined"&&d[b]===e)return b}return -1};Type._registerScript("MicrosoftAjaxCore.js");Sys.IDisposable=function(){};Sys.IDisposable.prototype={};Sys.IDisposable.registerInterface("Sys.IDisposable");Sys.StringBuilder=function(a){this._parts=typeof a!=="undefined"&&a!==null&&a!==""?[a.toString()]:[];this._value={};this._len=0};Sys.StringBuilder.prototype={append:function(a){this._parts[this._parts.length]=a},appendLine:function(a){this._parts[this._parts.length]=typeof a==="undefined"||a===null||a===""?"\r\n":a+"\r\n"},clear:function(){this._parts=[];this._value={};this._len=0},isEmpty:function(){if(this._parts.length===0)return true;return this.toString()===""},toString:function(a){a=a||"";var b=this._parts;if(this._len!==b.length){this._value={};this._len=b.length}var d=this._value;if(typeof d[a]==="undefined"){if(a!=="")for(var c=0;c<b.length;)if(typeof b[c]==="undefined"||b[c]===""||b[c]===null)b.splice(c,1);else c++;d[a]=this._parts.join(a)}return d[a]}};Sys.StringBuilder.registerClass("Sys.StringBuilder");Sys.Browser={};Sys.Browser.InternetExplorer={};Sys.Browser.Firefox={};Sys.Browser.Safari={};Sys.Browser.Opera={};Sys.Browser.agent=null;Sys.Browser.hasDebuggerStatement=false;Sys.Browser.name=navigator.appName;Sys.Browser.version=parseFloat(navigator.appVersion);Sys.Browser.documentMode=0;if(navigator.userAgent.indexOf(" MSIE ")>-1){Sys.Browser.agent=Sys.Browser.InternetExplorer;Sys.Browser.version=parseFloat(navigator.userAgent.match(/MSIE (\d+\.\d+)/)[1]);if(Sys.Browser.version>=8)if(document.documentMode>=7)Sys.Browser.documentMode=document.documentMode;Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" Firefox/")>-1){Sys.Browser.agent=Sys.Browser.Firefox;Sys.Browser.version=parseFloat(navigator.userAgent.match(/Firefox\/(\d+\.\d+)/)[1]);Sys.Browser.name="Firefox";Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" AppleWebKit/")>-1){Sys.Browser.agent=Sys.Browser.Safari;Sys.Browser.version=parseFloat(navigator.userAgent.match(/AppleWebKit\/(\d+(\.\d+)?)/)[1]);Sys.Browser.name="Safari"}else if(navigator.userAgent.indexOf("Opera/")>-1)Sys.Browser.agent=Sys.Browser.Opera;Sys.EventArgs=function(){};Sys.EventArgs.registerClass("Sys.EventArgs");Sys.EventArgs.Empty=new Sys.EventArgs;Sys.CancelEventArgs=function(){Sys.CancelEventArgs.initializeBase(this);this._cancel=false};Sys.CancelEventArgs.prototype={get_cancel:function(){return this._cancel},set_cancel:function(a){this._cancel=a}};Sys.CancelEventArgs.registerClass("Sys.CancelEventArgs",Sys.EventArgs);Sys.EventHandlerList=function(){this._list={}};Sys.EventHandlerList.prototype={_addHandler:function(b,a){Array.add(this._getEvent(b,true),a)},addHandler:function(b,a){this._addHandler(b,a)},_removeHandler:function(c,b){var a=this._getEvent(c);if(!a)return;Array.remove(a,b)},removeHandler:function(b,a){this._removeHandler(b,a)},getHandler:function(b){var a=this._getEvent(b);if(!a||a.length===0)return null;a=Array.clone(a);return function(c,d){for(var b=0,e=a.length;b<e;b++)a[b](c,d)}},_getEvent:function(a,b){if(!this._list[a]){if(!b)return null;this._list[a]=[]}return this._list[a]}};Sys.EventHandlerList.registerClass("Sys.EventHandlerList");Type.registerNamespace("Sys.UI");Sys._Debug=function(){};Sys._Debug.prototype={_appendConsole:function(a){if(typeof Debug!=="undefined"&&Debug.writeln)Debug.writeln(a);if(window.console&&window.console.log)window.console.log(a);if(window.opera)window.opera.postError(a);if(window.debugService)window.debugService.trace(a)},_appendTrace:function(b){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value+=b+"\n"},assert:function(c,a,b){if(!c){a=b&&this.assert.caller?String.format(Sys.Res.assertFailedCaller,a,this.assert.caller):String.format(Sys.Res.assertFailed,a);if(confirm(String.format(Sys.Res.breakIntoDebugger,a)))this.fail(a)}},clearTrace:function(){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value=""},fail:function(message){this._appendConsole(message);if(Sys.Browser.hasDebuggerStatement)eval("debugger")},trace:function(a){this._appendConsole(a);this._appendTrace(a)},traceDump:function(a,b){var c=this._traceDump(a,b,true)},_traceDump:function(a,c,f,b,d){c=c?c:"traceDump";b=b?b:"";if(a===null){this.trace(b+c+": null");return}switch(typeof a){case "undefined":this.trace(b+c+": Undefined");break;case "number":case "string":case "boolean":this.trace(b+c+": "+a);break;default:if(Date.isInstanceOfType(a)||RegExp.isInstanceOfType(a)){this.trace(b+c+": "+a.toString());break}if(!d)d=[];else if(Array.contains(d,a)){this.trace(b+c+": ...");return}Array.add(d,a);if(a==window||a===document||window.HTMLElement&&a instanceof HTMLElement||typeof a.nodeName==="string"){var k=a.tagName?a.tagName:"DomElement";if(a.id)k+=" - "+a.id;this.trace(b+c+" {"+k+"}")}else{var i=Object.getTypeName(a);this.trace(b+c+(typeof i==="string"?" {"+i+"}":""));if(b===""||f){b+=" ";var e,j,l,g,h;if(Array.isInstanceOfType(a)){j=a.length;for(e=0;e<j;e++)this._traceDump(a[e],"["+e+"]",f,b,d)}else for(g in a){h=a[g];if(!Function.isInstanceOfType(h))this._traceDump(h,g,f,b,d)}}}Array.remove(d,a)}}};Sys._Debug.registerClass("Sys._Debug");Sys.Debug=new Sys._Debug;Sys.Debug.isDebug=false;function Sys$Enum$parse(c,e){var a,b,i;if(e){a=this.__lowerCaseValues;if(!a){this.__lowerCaseValues=a={};var g=this.prototype;for(var f in g)a[f.toLowerCase()]=g[f]}}else a=this.prototype;if(!this.__flags){i=e?c.toLowerCase():c;b=a[i.trim()];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c,this.__typeName));return b}else{var h=(e?c.toLowerCase():c).split(","),j=0;for(var d=h.length-1;d>=0;d--){var k=h[d].trim();b=a[k];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c.split(",")[d].trim(),this.__typeName));j|=b}return j}}function Sys$Enum$toString(c){if(typeof c==="undefined"||c===null)return this.__string;var d=this.prototype,a;if(!this.__flags||c===0){for(a in d)if(d[a]===c)return a}else{var b=this.__sortedValues;if(!b){b=[];for(a in d)b[b.length]={key:a,value:d[a]};b.sort(function(a,b){return a.value-b.value});this.__sortedValues=b}var e=[],g=c;for(a=b.length-1;a>=0;a--){var h=b[a],f=h.value;if(f===0)continue;if((f&c)===f){e[e.length]=h.key;g-=f;if(g===0)break}}if(e.length&&g===0)return e.reverse().join(", ")}return ""}Type.prototype.registerEnum=function(b,c){Sys.__upperCaseTypes[b.toUpperCase()]=this;for(var a in this.prototype)this[a]=this.prototype[a];this.__typeName=b;this.parse=Sys$Enum$parse;this.__string=this.toString();this.toString=Sys$Enum$toString;this.__flags=c;this.__enum=true};Type.isEnum=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__enum};Type.isFlags=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__flags};Sys.CollectionChange=function(e,a,c,b,d){this.action=e;if(a)if(!(a instanceof Array))a=[a];this.newItems=a||null;if(typeof c!=="number")c=-1;this.newStartingIndex=c;if(b)if(!(b instanceof Array))b=[b];this.oldItems=b||null;if(typeof d!=="number")d=-1;this.oldStartingIndex=d};Sys.CollectionChange.registerClass("Sys.CollectionChange");Sys.NotifyCollectionChangedAction=function(){throw Error.notImplemented()};Sys.NotifyCollectionChangedAction.prototype={add:0,remove:1,reset:2};Sys.NotifyCollectionChangedAction.registerEnum("Sys.NotifyCollectionChangedAction");Sys.NotifyCollectionChangedEventArgs=function(a){this._changes=a;Sys.NotifyCollectionChangedEventArgs.initializeBase(this)};Sys.NotifyCollectionChangedEventArgs.prototype={get_changes:function(){return this._changes||[]}};Sys.NotifyCollectionChangedEventArgs.registerClass("Sys.NotifyCollectionChangedEventArgs",Sys.EventArgs);Sys.INotifyPropertyChange=function(){};Sys.INotifyPropertyChange.prototype={};Sys.INotifyPropertyChange.registerInterface("Sys.INotifyPropertyChange");Sys.PropertyChangedEventArgs=function(a){Sys.PropertyChangedEventArgs.initializeBase(this);this._propertyName=a};Sys.PropertyChangedEventArgs.prototype={get_propertyName:function(){return this._propertyName}};Sys.PropertyChangedEventArgs.registerClass("Sys.PropertyChangedEventArgs",Sys.EventArgs);Sys.Observer=function(){};Sys.Observer.registerClass("Sys.Observer");Sys.Observer.makeObservable=function(a){var c=a instanceof Array,b=Sys.Observer;if(a.setValue===b._observeMethods.setValue)return a;b._addMethods(a,b._observeMethods);if(c)b._addMethods(a,b._arrayMethods);return a};Sys.Observer._addMethods=function(c,b){for(var a in b)c[a]=b[a]};Sys.Observer._addEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._addHandler(a,b)};Sys.Observer.addEventHandler=function(c,a,b){Sys.Observer._addEventHandler(c,a,b)};Sys.Observer._removeEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._removeHandler(a,b)};Sys.Observer.removeEventHandler=function(c,a,b){Sys.Observer._removeEventHandler(c,a,b)};Sys.Observer.raiseEvent=function(b,e,d){var c=Sys.Observer._getContext(b);if(!c)return;var a=c.events.getHandler(e);if(a)a(b,d)};Sys.Observer.addPropertyChanged=function(b,a){Sys.Observer._addEventHandler(b,"propertyChanged",a)};Sys.Observer.removePropertyChanged=function(b,a){Sys.Observer._removeEventHandler(b,"propertyChanged",a)};Sys.Observer.beginUpdate=function(a){Sys.Observer._getContext(a,true).updating=true};Sys.Observer.endUpdate=function(b){var a=Sys.Observer._getContext(b);if(!a||!a.updating)return;a.updating=false;var d=a.dirty;a.dirty=false;if(d){if(b instanceof Array){var c=a.changes;a.changes=null;Sys.Observer.raiseCollectionChanged(b,c)}Sys.Observer.raisePropertyChanged(b,"")}};Sys.Observer.isUpdating=function(b){var a=Sys.Observer._getContext(b);return a?a.updating:false};Sys.Observer._setValue=function(a,j,g){var b,f,k=a,d=j.split(".");for(var i=0,m=d.length-1;i<m;i++){var l=d[i];b=a["get_"+l];if(typeof b==="function")a=b.call(a);else a=a[l];var n=typeof a;if(a===null||n==="undefined")throw Error.invalidOperation(String.format(Sys.Res.nullReferenceInPath,j))}var e,c=d[m];b=a["get_"+c];f=a["set_"+c];if(typeof b==="function")e=b.call(a);else e=a[c];if(typeof f==="function")f.call(a,g);else a[c]=g;if(e!==g){var h=Sys.Observer._getContext(k);if(h&&h.updating){h.dirty=true;return}Sys.Observer.raisePropertyChanged(k,d[0])}};Sys.Observer.setValue=function(b,a,c){Sys.Observer._setValue(b,a,c)};Sys.Observer.raisePropertyChanged=function(b,a){Sys.Observer.raiseEvent(b,"propertyChanged",new Sys.PropertyChangedEventArgs(a))};Sys.Observer.addCollectionChanged=function(b,a){Sys.Observer._addEventHandler(b,"collectionChanged",a)};Sys.Observer.removeCollectionChanged=function(b,a){Sys.Observer._removeEventHandler(b,"collectionChanged",a)};Sys.Observer._collectionChange=function(d,c){var a=Sys.Observer._getContext(d);if(a&&a.updating){a.dirty=true;var b=a.changes;if(!b)a.changes=b=[c];else b.push(c)}else{Sys.Observer.raiseCollectionChanged(d,[c]);Sys.Observer.raisePropertyChanged(d,"length")}};Sys.Observer.add=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[b],a.length);Array.add(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.addRange=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,b,a.length);Array.addRange(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.clear=function(a){var b=Array.clone(a);Array.clear(a);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.reset,null,-1,b,0))};Sys.Observer.insert=function(a,b,c){Array.insert(a,b,c);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[c],b))};Sys.Observer.remove=function(a,b){var c=Array.indexOf(a,b);if(c!==-1){Array.remove(a,b);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[b],c));return true}return false};Sys.Observer.removeAt=function(b,a){if(a>-1&&a<b.length){var c=b[a];Array.removeAt(b,a);Sys.Observer._collectionChange(b,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[c],a))}};Sys.Observer.raiseCollectionChanged=function(b,a){Sys.Observer.raiseEvent(b,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))};Sys.Observer._observeMethods={add_propertyChanged:function(a){Sys.Observer._addEventHandler(this,"propertyChanged",a)},remove_propertyChanged:function(a){Sys.Observer._removeEventHandler(this,"propertyChanged",a)},addEventHandler:function(a,b){Sys.Observer._addEventHandler(this,a,b)},removeEventHandler:function(a,b){Sys.Observer._removeEventHandler(this,a,b)},get_isUpdating:function(){return Sys.Observer.isUpdating(this)},beginUpdate:function(){Sys.Observer.beginUpdate(this)},endUpdate:function(){Sys.Observer.endUpdate(this)},setValue:function(b,a){Sys.Observer._setValue(this,b,a)},raiseEvent:function(b,a){Sys.Observer.raiseEvent(this,b,a)},raisePropertyChanged:function(a){Sys.Observer.raiseEvent(this,"propertyChanged",new Sys.PropertyChangedEventArgs(a))}};Sys.Observer._arrayMethods={add_collectionChanged:function(a){Sys.Observer._addEventHandler(this,"collectionChanged",a)},remove_collectionChanged:function(a){Sys.Observer._removeEventHandler(this,"collectionChanged",a)},add:function(a){Sys.Observer.add(this,a)},addRange:function(a){Sys.Observer.addRange(this,a)},clear:function(){Sys.Observer.clear(this)},insert:function(a,b){Sys.Observer.insert(this,a,b)},remove:function(a){return Sys.Observer.remove(this,a)},removeAt:function(a){Sys.Observer.removeAt(this,a)},raiseCollectionChanged:function(a){Sys.Observer.raiseEvent(this,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))}};Sys.Observer._getContext=function(b,c){var a=b._observerContext;if(a)return a();if(c)return (b._observerContext=Sys.Observer._createContext())();return null};Sys.Observer._createContext=function(){var a={events:new Sys.EventHandlerList};return function(){return a}}; +Type.registerNamespace('Sys');Sys.Res={'argumentInteger':'Value must be an integer.','invokeCalledTwice':'Cannot call invoke more than once.','webServiceFailed':'The server method \'{0}\' failed with the following error: {1}','argumentType':'Object cannot be converted to the required type.','argumentNull':'Value cannot be null.','scriptAlreadyLoaded':'The script \'{0}\' has been referenced multiple times. If referencing Microsoft AJAX scripts explicitly, set the MicrosoftAjaxMode property of the ScriptManager to Explicit.','scriptDependencyNotFound':'The script \'{0}\' failed to load because it is dependent on script \'{1}\'.','formatBadFormatSpecifier':'Format specifier was invalid.','requiredScriptReferenceNotIncluded':'\'{0}\' requires that you have included a script reference to \'{1}\'.','webServiceFailedNoMsg':'The server method \'{0}\' failed.','argumentDomElement':'Value must be a DOM element.','invalidExecutorType':'Could not create a valid Sys.Net.WebRequestExecutor from: {0}.','cannotCallBeforeResponse':'Cannot call {0} when responseAvailable is false.','actualValue':'Actual value was {0}.','enumInvalidValue':'\'{0}\' is not a valid value for enum {1}.','scriptLoadFailed':'The script \'{0}\' could not be loaded.','parameterCount':'Parameter count mismatch.','cannotDeserializeEmptyString':'Cannot deserialize empty string.','formatInvalidString':'Input string was not in a correct format.','invalidTimeout':'Value must be greater than or equal to zero.','cannotAbortBeforeStart':'Cannot abort when executor has not started.','argument':'Value does not fall within the expected range.','cannotDeserializeInvalidJson':'Cannot deserialize. The data does not correspond to valid JSON.','invalidHttpVerb':'httpVerb cannot be set to an empty or null string.','nullWebRequest':'Cannot call executeRequest with a null webRequest.','eventHandlerInvalid':'Handler was not added through the Sys.UI.DomEvent.addHandler method.','cannotSerializeNonFiniteNumbers':'Cannot serialize non finite numbers.','argumentUndefined':'Value cannot be undefined.','webServiceInvalidReturnType':'The server method \'{0}\' returned an invalid type. Expected type: {1}','servicePathNotSet':'The path to the web service has not been set.','argumentTypeWithTypes':'Object of type \'{0}\' cannot be converted to type \'{1}\'.','cannotCallOnceStarted':'Cannot call {0} once started.','badBaseUrl1':'Base URL does not contain ://.','badBaseUrl2':'Base URL does not contain another /.','badBaseUrl3':'Cannot find last / in base URL.','setExecutorAfterActive':'Cannot set executor after it has become active.','paramName':'Parameter name: {0}','nullReferenceInPath':'Null reference while evaluating data path: \'{0}\'.','cannotCallOutsideHandler':'Cannot call {0} outside of a completed event handler.','cannotSerializeObjectWithCycle':'Cannot serialize object with cyclic reference within child properties.','format':'One of the identified items was in an invalid format.','assertFailedCaller':'Assertion Failed: {0}\r\nat {1}','argumentOutOfRange':'Specified argument was out of the range of valid values.','webServiceTimedOut':'The server method \'{0}\' timed out.','notImplemented':'The method or operation is not implemented.','assertFailed':'Assertion Failed: {0}','invalidOperation':'Operation is not valid due to the current state of the object.','breakIntoDebugger':'{0}\r\n\r\nBreak into debugger?'}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxGlobalization.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxGlobalization.js new file mode 100644 index 0000000..12b3756 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxGlobalization.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxGlobalization.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxGlobalization.js +Type._registerScript("MicrosoftAjaxGlobalization.js",["MicrosoftAjaxCore.js"]);Date._appendPreOrPostMatch=function(e,b){var d=0,a=false;for(var c=0,g=e.length;c<g;c++){var f=e.charAt(c);switch(f){case "'":if(a)b.append("'");else d++;a=false;break;case "\\":if(a)b.append("\\");a=!a;break;default:b.append(f);a=false}}return d};Date._expandFormat=function(a,b){if(!b)b="F";var c=b.length;if(c===1)switch(b){case "d":return a.ShortDatePattern;case "D":return a.LongDatePattern;case "t":return a.ShortTimePattern;case "T":return a.LongTimePattern;case "f":return a.LongDatePattern+" "+a.ShortTimePattern;case "F":return a.FullDateTimePattern;case "M":case "m":return a.MonthDayPattern;case "s":return a.SortableDateTimePattern;case "Y":case "y":return a.YearMonthPattern;default:throw Error.format(Sys.Res.formatInvalidString)}else if(c===2&&b.charAt(0)==="%")b=b.charAt(1);return b};Date._expandYear=function(c,a){var d=new Date,e=Date._getEra(d);if(a<100){var b=Date._getEraYear(d,c,e);a+=b-b%100;if(a>c.Calendar.TwoDigitYearMax)a-=100}return a};Date._getEra=function(e,c){if(!c)return 0;var b,d=e.getTime();for(var a=0,f=c.length;a<f;a+=4){b=c[a+2];if(b===null||d>=b)return a}return 0};Date._getEraYear=function(d,b,e,c){var a=d.getFullYear();if(!c&&b.eras)a-=b.eras[e+3];return a};Date._getParseRegExp=function(b,e){if(!b._parseRegExp)b._parseRegExp={};else if(b._parseRegExp[e])return b._parseRegExp[e];var c=Date._expandFormat(b,e);c=c.replace(/([\^\$\.\*\+\?\|\[\]\(\)\{\}])/g,"\\\\$1");var a=new Sys.StringBuilder("^"),j=[],f=0,i=0,h=Date._getTokenRegExp(),d;while((d=h.exec(c))!==null){var l=c.slice(f,d.index);f=h.lastIndex;i+=Date._appendPreOrPostMatch(l,a);if(i%2===1){a.append(d[0]);continue}switch(d[0]){case "dddd":case "ddd":case "MMMM":case "MMM":case "gg":case "g":a.append("(\\D+)");break;case "tt":case "t":a.append("(\\D*)");break;case "yyyy":a.append("(\\d{4})");break;case "fff":a.append("(\\d{3})");break;case "ff":a.append("(\\d{2})");break;case "f":a.append("(\\d)");break;case "dd":case "d":case "MM":case "M":case "yy":case "y":case "HH":case "H":case "hh":case "h":case "mm":case "m":case "ss":case "s":a.append("(\\d\\d?)");break;case "zzz":a.append("([+-]?\\d\\d?:\\d{2})");break;case "zz":case "z":a.append("([+-]?\\d\\d?)");break;case "/":a.append("(\\"+b.DateSeparator+")")}Array.add(j,d[0])}Date._appendPreOrPostMatch(c.slice(f),a);a.append("$");var k=a.toString().replace(/\s+/g,"\\s+"),g={"regExp":k,"groups":j};b._parseRegExp[e]=g;return g};Date._getTokenRegExp=function(){return /\/|dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|y|hh|h|HH|H|mm|m|ss|s|tt|t|fff|ff|f|zzz|zz|z|gg|g/g};Date.parseLocale=function(a){return Date._parse(a,Sys.CultureInfo.CurrentCulture,arguments)};Date.parseInvariant=function(a){return Date._parse(a,Sys.CultureInfo.InvariantCulture,arguments)};Date._parse=function(h,d,i){var a,c,b,f,e,g=false;for(a=1,c=i.length;a<c;a++){f=i[a];if(f){g=true;b=Date._parseExact(h,f,d);if(b)return b}}if(!g){e=d._getDateTimeFormats();for(a=0,c=e.length;a<c;a++){b=Date._parseExact(h,e[a],d);if(b)return b}}return null};Date._parseExact=function(w,D,k){w=w.trim();var g=k.dateTimeFormat,A=Date._getParseRegExp(g,D),C=(new RegExp(A.regExp)).exec(w);if(C===null)return null;var B=A.groups,x=null,e=null,c=null,j=null,i=null,d=0,h,p=0,q=0,f=0,l=null,v=false;for(var s=0,E=B.length;s<E;s++){var a=C[s+1];if(a)switch(B[s]){case "dd":case "d":j=parseInt(a,10);if(j<1||j>31)return null;break;case "MMMM":c=k._getMonthIndex(a);if(c<0||c>11)return null;break;case "MMM":c=k._getAbbrMonthIndex(a);if(c<0||c>11)return null;break;case "M":case "MM":c=parseInt(a,10)-1;if(c<0||c>11)return null;break;case "y":case "yy":e=Date._expandYear(g,parseInt(a,10));if(e<0||e>9999)return null;break;case "yyyy":e=parseInt(a,10);if(e<0||e>9999)return null;break;case "h":case "hh":d=parseInt(a,10);if(d===12)d=0;if(d<0||d>11)return null;break;case "H":case "HH":d=parseInt(a,10);if(d<0||d>23)return null;break;case "m":case "mm":p=parseInt(a,10);if(p<0||p>59)return null;break;case "s":case "ss":q=parseInt(a,10);if(q<0||q>59)return null;break;case "tt":case "t":var z=a.toUpperCase();v=z===g.PMDesignator.toUpperCase();if(!v&&z!==g.AMDesignator.toUpperCase())return null;break;case "f":f=parseInt(a,10)*100;if(f<0||f>999)return null;break;case "ff":f=parseInt(a,10)*10;if(f<0||f>999)return null;break;case "fff":f=parseInt(a,10);if(f<0||f>999)return null;break;case "dddd":i=k._getDayIndex(a);if(i<0||i>6)return null;break;case "ddd":i=k._getAbbrDayIndex(a);if(i<0||i>6)return null;break;case "zzz":var u=a.split(/:/);if(u.length!==2)return null;h=parseInt(u[0],10);if(h<-12||h>13)return null;var m=parseInt(u[1],10);if(m<0||m>59)return null;l=h*60+(a.startsWith("-")?-m:m);break;case "z":case "zz":h=parseInt(a,10);if(h<-12||h>13)return null;l=h*60;break;case "g":case "gg":var o=a;if(!o||!g.eras)return null;o=o.toLowerCase().trim();for(var r=0,F=g.eras.length;r<F;r+=4)if(o===g.eras[r+1].toLowerCase()){x=r;break}if(x===null)return null}}var b=new Date,t,n=g.Calendar.convert;if(n)t=n.fromGregorian(b)[0];else t=b.getFullYear();if(e===null)e=t;else if(g.eras)e+=g.eras[(x||0)+3];if(c===null)c=0;if(j===null)j=1;if(n){b=n.toGregorian(e,c,j);if(b===null)return null}else{b.setFullYear(e,c,j);if(b.getDate()!==j)return null;if(i!==null&&b.getDay()!==i)return null}if(v&&d<12)d+=12;b.setHours(d,p,q,f);if(l!==null){var y=b.getMinutes()-(l+b.getTimezoneOffset());b.setHours(b.getHours()+parseInt(y/60,10),y%60)}return b};Date.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Date.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Date.prototype._toFormattedString=function(e,j){var b=j.dateTimeFormat,n=b.Calendar.convert;if(!e||!e.length||e==="i")if(j&&j.name.length)if(n)return this._toFormattedString(b.FullDateTimePattern,j);else{var r=new Date(this.getTime()),x=Date._getEra(this,b.eras);r.setFullYear(Date._getEraYear(this,b,x));return r.toLocaleString()}else return this.toString();var l=b.eras,k=e==="s";e=Date._expandFormat(b,e);var a=new Sys.StringBuilder,c;function d(a){if(a<10)return "0"+a;return a.toString()}function m(a){if(a<10)return "00"+a;if(a<100)return "0"+a;return a.toString()}function v(a){if(a<10)return "000"+a;else if(a<100)return "00"+a;else if(a<1000)return "0"+a;return a.toString()}var h,p,t=/([^d]|^)(d|dd)([^d]|$)/g;function s(){if(h||p)return h;h=t.test(e);p=true;return h}var q=0,o=Date._getTokenRegExp(),f;if(!k&&n)f=n.fromGregorian(this);for(;true;){var w=o.lastIndex,i=o.exec(e),u=e.slice(w,i?i.index:e.length);q+=Date._appendPreOrPostMatch(u,a);if(!i)break;if(q%2===1){a.append(i[0]);continue}function g(a,b){if(f)return f[b];switch(b){case 0:return a.getFullYear();case 1:return a.getMonth();case 2:return a.getDate()}}switch(i[0]){case "dddd":a.append(b.DayNames[this.getDay()]);break;case "ddd":a.append(b.AbbreviatedDayNames[this.getDay()]);break;case "dd":h=true;a.append(d(g(this,2)));break;case "d":h=true;a.append(g(this,2));break;case "MMMM":a.append(b.MonthGenitiveNames&&s()?b.MonthGenitiveNames[g(this,1)]:b.MonthNames[g(this,1)]);break;case "MMM":a.append(b.AbbreviatedMonthGenitiveNames&&s()?b.AbbreviatedMonthGenitiveNames[g(this,1)]:b.AbbreviatedMonthNames[g(this,1)]);break;case "MM":a.append(d(g(this,1)+1));break;case "M":a.append(g(this,1)+1);break;case "yyyy":a.append(v(f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k)));break;case "yy":a.append(d((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100));break;case "y":a.append((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100);break;case "hh":c=this.getHours()%12;if(c===0)c=12;a.append(d(c));break;case "h":c=this.getHours()%12;if(c===0)c=12;a.append(c);break;case "HH":a.append(d(this.getHours()));break;case "H":a.append(this.getHours());break;case "mm":a.append(d(this.getMinutes()));break;case "m":a.append(this.getMinutes());break;case "ss":a.append(d(this.getSeconds()));break;case "s":a.append(this.getSeconds());break;case "tt":a.append(this.getHours()<12?b.AMDesignator:b.PMDesignator);break;case "t":a.append((this.getHours()<12?b.AMDesignator:b.PMDesignator).charAt(0));break;case "f":a.append(m(this.getMilliseconds()).charAt(0));break;case "ff":a.append(m(this.getMilliseconds()).substr(0,2));break;case "fff":a.append(m(this.getMilliseconds()));break;case "z":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+Math.floor(Math.abs(c)));break;case "zz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c))));break;case "zzz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c)))+":"+d(Math.abs(this.getTimezoneOffset()%60)));break;case "g":case "gg":if(b.eras)a.append(b.eras[Date._getEra(this,l)+1]);break;case "/":a.append(b.DateSeparator)}}return a.toString()};String.localeFormat=function(){return String._toFormattedString(true,arguments)};Number.parseLocale=function(a){return Number._parse(a,Sys.CultureInfo.CurrentCulture)};Number.parseInvariant=function(a){return Number._parse(a,Sys.CultureInfo.InvariantCulture)};Number._parse=function(b,o){b=b.trim();if(b.match(/^[+-]?infinity$/i))return parseFloat(b);if(b.match(/^0x[a-f0-9]+$/i))return parseInt(b);var a=o.numberFormat,g=Number._parseNumberNegativePattern(b,a,a.NumberNegativePattern),h=g[0],e=g[1];if(h===""&&a.NumberNegativePattern!==1){g=Number._parseNumberNegativePattern(b,a,1);h=g[0];e=g[1]}if(h==="")h="+";var j,d,f=e.indexOf("e");if(f<0)f=e.indexOf("E");if(f<0){d=e;j=null}else{d=e.substr(0,f);j=e.substr(f+1)}var c,k,m=d.indexOf(a.NumberDecimalSeparator);if(m<0){c=d;k=null}else{c=d.substr(0,m);k=d.substr(m+a.NumberDecimalSeparator.length)}c=c.split(a.NumberGroupSeparator).join("");var n=a.NumberGroupSeparator.replace(/\u00A0/g," ");if(a.NumberGroupSeparator!==n)c=c.split(n).join("");var l=h+c;if(k!==null)l+="."+k;if(j!==null){var i=Number._parseNumberNegativePattern(j,a,1);if(i[0]==="")i[0]="+";l+="e"+i[0]+i[1]}if(l.match(/^[+-]?\d*\.?\d*(e[+-]?\d+)?$/))return parseFloat(l);return Number.NaN};Number._parseNumberNegativePattern=function(a,d,e){var b=d.NegativeSign,c=d.PositiveSign;switch(e){case 4:b=" "+b;c=" "+c;case 3:if(a.endsWith(b))return ["-",a.substr(0,a.length-b.length)];else if(a.endsWith(c))return ["+",a.substr(0,a.length-c.length)];break;case 2:b+=" ";c+=" ";case 1:if(a.startsWith(b))return ["-",a.substr(b.length)];else if(a.startsWith(c))return ["+",a.substr(c.length)];break;case 0:if(a.startsWith("(")&&a.endsWith(")"))return ["-",a.substr(1,a.length-2)]}return ["",a]};Number.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Number.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Number.prototype._toFormattedString=function(e,j){if(!e||e.length===0||e==="i")if(j&&j.name.length>0)return this.toLocaleString();else return this.toString();var o=["n %","n%","%n"],n=["-n %","-n%","-%n"],p=["(n)","-n","- n","n-","n -"],m=["$n","n$","$ n","n $"],l=["($n)","-$n","$-n","$n-","(n$)","-n$","n-$","n$-","-n $","-$ n","n $-","$ n-","$ -n","n- $","($ n)","(n $)"];function g(a,c,d){for(var b=a.length;b<c;b++)a=d?"0"+a:a+"0";return a}function i(j,i,l,n,p){var h=l[0],k=1,o=Math.pow(10,i),m=Math.round(j*o)/o;if(!isFinite(m))m=j;j=m;var b=j.toString(),a="",c,e=b.split(/e/i);b=e[0];c=e.length>1?parseInt(e[1]):0;e=b.split(".");b=e[0];a=e.length>1?e[1]:"";var q;if(c>0){a=g(a,c,false);b+=a.slice(0,c);a=a.substr(c)}else if(c<0){c=-c;b=g(b,c+1,true);a=b.slice(-c,b.length)+a;b=b.slice(0,-c)}if(i>0){if(a.length>i)a=a.slice(0,i);else a=g(a,i,false);a=p+a}else a="";var d=b.length-1,f="";while(d>=0){if(h===0||h>d)if(f.length>0)return b.slice(0,d+1)+n+f+a;else return b.slice(0,d+1)+a;if(f.length>0)f=b.slice(d-h+1,d+1)+n+f;else f=b.slice(d-h+1,d+1);d-=h;if(k<l.length){h=l[k];k++}}return b.slice(0,d+1)+n+f+a}var a=j.numberFormat,d=Math.abs(this);if(!e)e="D";var b=-1;if(e.length>1)b=parseInt(e.slice(1),10);var c;switch(e.charAt(0)){case "d":case "D":c="n";if(b!==-1)d=g(""+d,b,true);if(this<0)d=-d;break;case "c":case "C":if(this<0)c=l[a.CurrencyNegativePattern];else c=m[a.CurrencyPositivePattern];if(b===-1)b=a.CurrencyDecimalDigits;d=i(Math.abs(this),b,a.CurrencyGroupSizes,a.CurrencyGroupSeparator,a.CurrencyDecimalSeparator);break;case "n":case "N":if(this<0)c=p[a.NumberNegativePattern];else c="n";if(b===-1)b=a.NumberDecimalDigits;d=i(Math.abs(this),b,a.NumberGroupSizes,a.NumberGroupSeparator,a.NumberDecimalSeparator);break;case "p":case "P":if(this<0)c=n[a.PercentNegativePattern];else c=o[a.PercentPositivePattern];if(b===-1)b=a.PercentDecimalDigits;d=i(Math.abs(this)*100,b,a.PercentGroupSizes,a.PercentGroupSeparator,a.PercentDecimalSeparator);break;default:throw Error.format(Sys.Res.formatBadFormatSpecifier)}var k=/n|\$|-|%/g,f="";for(;true;){var q=k.lastIndex,h=k.exec(c);f+=c.slice(q,h?h.index:c.length);if(!h)break;switch(h[0]){case "n":f+=d;break;case "$":f+=a.CurrencySymbol;break;case "-":if(/[1-9]/.test(d))f+=a.NegativeSign;break;case "%":f+=a.PercentSymbol}}return f};Sys.CultureInfo=function(c,b,a){this.name=c;this.numberFormat=b;this.dateTimeFormat=a};Sys.CultureInfo.prototype={_getDateTimeFormats:function(){if(!this._dateTimeFormats){var a=this.dateTimeFormat;this._dateTimeFormats=[a.MonthDayPattern,a.YearMonthPattern,a.ShortDatePattern,a.ShortTimePattern,a.LongDatePattern,a.LongTimePattern,a.FullDateTimePattern,a.RFC1123Pattern,a.SortableDateTimePattern,a.UniversalSortableDateTimePattern]}return this._dateTimeFormats},_getIndex:function(c,d,e){var b=this._toUpper(c),a=Array.indexOf(d,b);if(a===-1)a=Array.indexOf(e,b);return a},_getMonthIndex:function(a){if(!this._upperMonths){this._upperMonths=this._toUpperArray(this.dateTimeFormat.MonthNames);this._upperMonthsGenitive=this._toUpperArray(this.dateTimeFormat.MonthGenitiveNames)}return this._getIndex(a,this._upperMonths,this._upperMonthsGenitive)},_getAbbrMonthIndex:function(a){if(!this._upperAbbrMonths){this._upperAbbrMonths=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthNames);this._upperAbbrMonthsGenitive=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthGenitiveNames)}return this._getIndex(a,this._upperAbbrMonths,this._upperAbbrMonthsGenitive)},_getDayIndex:function(a){if(!this._upperDays)this._upperDays=this._toUpperArray(this.dateTimeFormat.DayNames);return Array.indexOf(this._upperDays,this._toUpper(a))},_getAbbrDayIndex:function(a){if(!this._upperAbbrDays)this._upperAbbrDays=this._toUpperArray(this.dateTimeFormat.AbbreviatedDayNames);return Array.indexOf(this._upperAbbrDays,this._toUpper(a))},_toUpperArray:function(c){var b=[];for(var a=0,d=c.length;a<d;a++)b[a]=this._toUpper(c[a]);return b},_toUpper:function(a){return a.split("\u00a0").join(" ").toUpperCase()}};Sys.CultureInfo.registerClass("Sys.CultureInfo");Sys.CultureInfo._parse=function(a){var b=a.dateTimeFormat;if(b&&!b.eras)b.eras=a.eras;return new Sys.CultureInfo(a.name,a.numberFormat,b)};Sys.CultureInfo.InvariantCulture=Sys.CultureInfo._parse({"name":"","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":true,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"\u00a4","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":true},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, dd MMMM yyyy HH:mm:ss","LongDatePattern":"dddd, dd MMMM yyyy","LongTimePattern":"HH:mm:ss","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"MM/dd/yyyy","ShortTimePattern":"HH:mm","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"yyyy MMMM","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":true,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]});if(typeof __cultureInfo==="object"){Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse(__cultureInfo);delete __cultureInfo}else Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse({"name":"en-US","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":false,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"$","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":false},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, MMMM dd, yyyy h:mm:ss tt","LongDatePattern":"dddd, MMMM dd, yyyy","LongTimePattern":"h:mm:ss tt","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"M/d/yyyy","ShortTimePattern":"h:mm tt","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"MMMM, yyyy","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":false,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]}); diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxHistory.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxHistory.js new file mode 100644 index 0000000..c5bf8c5 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxHistory.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxHistory.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxHistory.js +Type._registerScript("MicrosoftAjaxHistory.js",["MicrosoftAjaxComponentModel.js","MicrosoftAjaxSerialization.js"]);Sys.HistoryEventArgs=function(a){Sys.HistoryEventArgs.initializeBase(this);this._state=a};Sys.HistoryEventArgs.prototype={get_state:function(){return this._state}};Sys.HistoryEventArgs.registerClass("Sys.HistoryEventArgs",Sys.EventArgs);Sys.Application._appLoadHandler=null;Sys.Application._beginRequestHandler=null;Sys.Application._clientId=null;Sys.Application._currentEntry="";Sys.Application._endRequestHandler=null;Sys.Application._history=null;Sys.Application._enableHistory=false;Sys.Application._historyFrame=null;Sys.Application._historyInitialized=false;Sys.Application._historyPointIsNew=false;Sys.Application._ignoreTimer=false;Sys.Application._initialState=null;Sys.Application._state={};Sys.Application._timerCookie=0;Sys.Application._timerHandler=null;Sys.Application._uniqueId=null;Sys._Application.prototype.get_stateString=function(){var a=null;if(Sys.Browser.agent===Sys.Browser.Firefox){var c=window.location.href,b=c.indexOf("#");if(b!==-1)a=c.substring(b+1);else a="";return a}else a=window.location.hash;if(a.length>0&&a.charAt(0)==="#")a=a.substring(1);return a};Sys._Application.prototype.get_enableHistory=function(){return this._enableHistory};Sys._Application.prototype.set_enableHistory=function(a){this._enableHistory=a};Sys._Application.prototype.add_navigate=function(a){this.get_events().addHandler("navigate",a)};Sys._Application.prototype.remove_navigate=function(a){this.get_events().removeHandler("navigate",a)};Sys._Application.prototype.addHistoryPoint=function(c,f){this._ensureHistory();var b=this._state;for(var a in c){var d=c[a];if(d===null){if(typeof b[a]!=="undefined")delete b[a]}else b[a]=d}var e=this._serializeState(b);this._historyPointIsNew=true;this._setState(e,f);this._raiseNavigate()};Sys._Application.prototype.setServerId=function(a,b){this._clientId=a;this._uniqueId=b};Sys._Application.prototype.setServerState=function(a){this._ensureHistory();this._state.__s=a;this._updateHiddenField(a)};Sys._Application.prototype._deserializeState=function(a){var e={};a=a||"";var b=a.indexOf("&&");if(b!==-1&&b+2<a.length){e.__s=a.substr(b+2);a=a.substr(0,b)}var g=a.split("&");for(var f=0,j=g.length;f<j;f++){var d=g[f],c=d.indexOf("=");if(c!==-1&&c+1<d.length){var i=d.substr(0,c),h=d.substr(c+1);e[i]=decodeURIComponent(h)}}return e};Sys._Application.prototype._enableHistoryInScriptManager=function(){this._enableHistory=true};Sys._Application.prototype._ensureHistory=function(){if(!this._historyInitialized&&this._enableHistory){if(Sys.Browser.agent===Sys.Browser.InternetExplorer&&Sys.Browser.documentMode<8){this._historyFrame=document.getElementById("__historyFrame");this._ignoreIFrame=true}this._timerHandler=Function.createDelegate(this,this._onIdle);this._timerCookie=window.setTimeout(this._timerHandler,100);try{this._initialState=this._deserializeState(this.get_stateString())}catch(a){}this._historyInitialized=true}};Sys._Application.prototype._navigate=function(c){this._ensureHistory();var b=this._deserializeState(c);if(this._uniqueId){var d=this._state.__s||"",a=b.__s||"";if(a!==d){this._updateHiddenField(a);__doPostBack(this._uniqueId,a);this._state=b;return}}this._setState(c);this._state=b;this._raiseNavigate()};Sys._Application.prototype._onIdle=function(){delete this._timerCookie;var a=this.get_stateString();if(a!==this._currentEntry){if(!this._ignoreTimer){this._historyPointIsNew=false;this._navigate(a)}}else this._ignoreTimer=false;this._timerCookie=window.setTimeout(this._timerHandler,100)};Sys._Application.prototype._onIFrameLoad=function(a){this._ensureHistory();if(!this._ignoreIFrame){this._historyPointIsNew=false;this._navigate(a)}this._ignoreIFrame=false};Sys._Application.prototype._onPageRequestManagerBeginRequest=function(){this._ignoreTimer=true;this._originalTitle=document.title};Sys._Application.prototype._onPageRequestManagerEndRequest=function(g,f){var d=f.get_dataItems()[this._clientId],c=this._originalTitle;this._originalTitle=null;var b=document.getElementById("__EVENTTARGET");if(b&&b.value===this._uniqueId)b.value="";if(typeof d!=="undefined"){this.setServerState(d);this._historyPointIsNew=true}else this._ignoreTimer=false;var a=this._serializeState(this._state);if(a!==this._currentEntry){this._ignoreTimer=true;if(typeof c==="string"){if(Sys.Browser.agent!==Sys.Browser.InternetExplorer||Sys.Browser.version>7){var e=document.title;document.title=c;this._setState(a);document.title=e}else this._setState(a);this._raiseNavigate()}else{this._setState(a);this._raiseNavigate()}}};Sys._Application.prototype._raiseNavigate=function(){var d=this._historyPointIsNew,c=this.get_events().getHandler("navigate"),b={};for(var a in this._state)if(a!=="__s")b[a]=this._state[a];var e=new Sys.HistoryEventArgs(b);if(c)c(this,e);if(!d){var f;try{if(Sys.Browser.agent===Sys.Browser.Firefox&&window.location.hash&&(!window.frameElement||window.top.location.hash))Sys.Browser.version<3.5?window.history.go(0):(location.hash=this.get_stateString())}catch(g){}}};Sys._Application.prototype._serializeState=function(d){var b=[];for(var a in d){var e=d[a];if(a==="__s")var c=e;else b[b.length]=a+"="+encodeURIComponent(e)}return b.join("&")+(c?"&&"+c:"")};Sys._Application.prototype._setState=function(a,b){if(this._enableHistory){a=a||"";if(a!==this._currentEntry){if(window.theForm){var d=window.theForm.action,e=d.indexOf("#");window.theForm.action=(e!==-1?d.substring(0,e):d)+"#"+a}if(this._historyFrame&&this._historyPointIsNew){var f=document.createElement("div");f.appendChild(document.createTextNode(b||document.title));var g=f.innerHTML;this._ignoreIFrame=true;var c=this._historyFrame.contentWindow.document;c.open("javascript:'<html></html>'");c.write("<html><head><title>"+g+"</title><scri"+'pt type="text/javascript">parent.Sys.Application._onIFrameLoad('+Sys.Serialization.JavaScriptSerializer.serialize(a)+");</scri"+"pt></head><body></body></html>");c.close()}this._ignoreTimer=false;this._currentEntry=a;if(this._historyFrame||this._historyPointIsNew){var h=this.get_stateString();if(a!==h){window.location.hash=a;this._currentEntry=this.get_stateString();if(typeof b!=="undefined"&&b!==null)document.title=b}}this._historyPointIsNew=false}}};Sys._Application.prototype._updateHiddenField=function(b){if(this._clientId){var a=document.getElementById(this._clientId);if(a)a.value=b}}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxNetwork.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxNetwork.js new file mode 100644 index 0000000..b5ac8fb --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxNetwork.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxNetwork.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxNetwork.js +Type._registerScript("MicrosoftAjaxNetwork.js",["MicrosoftAjaxSerialization.js"]);if(!window.XMLHttpRequest)window.XMLHttpRequest=function(){var b=["Msxml2.XMLHTTP.3.0","Msxml2.XMLHTTP"];for(var a=0,c=b.length;a<c;a++)try{return new ActiveXObject(b[a])}catch(d){}return null};Type.registerNamespace("Sys.Net");Sys.Net.WebRequestExecutor=function(){this._webRequest=null;this._resultObject=null};Sys.Net.WebRequestExecutor.prototype={get_webRequest:function(){return this._webRequest},_set_webRequest:function(a){this._webRequest=a},get_started:function(){throw Error.notImplemented()},get_responseAvailable:function(){throw Error.notImplemented()},get_timedOut:function(){throw Error.notImplemented()},get_aborted:function(){throw Error.notImplemented()},get_responseData:function(){throw Error.notImplemented()},get_statusCode:function(){throw Error.notImplemented()},get_statusText:function(){throw Error.notImplemented()},get_xml:function(){throw Error.notImplemented()},get_object:function(){if(!this._resultObject)this._resultObject=Sys.Serialization.JavaScriptSerializer.deserialize(this.get_responseData());return this._resultObject},executeRequest:function(){throw Error.notImplemented()},abort:function(){throw Error.notImplemented()},getResponseHeader:function(){throw Error.notImplemented()},getAllResponseHeaders:function(){throw Error.notImplemented()}};Sys.Net.WebRequestExecutor.registerClass("Sys.Net.WebRequestExecutor");Sys.Net.XMLDOM=function(d){if(!window.DOMParser){var c=["Msxml2.DOMDocument.3.0","Msxml2.DOMDocument"];for(var b=0,f=c.length;b<f;b++)try{var a=new ActiveXObject(c[b]);a.async=false;a.loadXML(d);a.setProperty("SelectionLanguage","XPath");return a}catch(g){}}else try{var e=new window.DOMParser;return e.parseFromString(d,"text/xml")}catch(g){}return null};Sys.Net.XMLHttpExecutor=function(){Sys.Net.XMLHttpExecutor.initializeBase(this);var a=this;this._xmlHttpRequest=null;this._webRequest=null;this._responseAvailable=false;this._timedOut=false;this._timer=null;this._aborted=false;this._started=false;this._onReadyStateChange=function(){if(a._xmlHttpRequest.readyState===4){try{if(typeof a._xmlHttpRequest.status==="undefined")return}catch(b){return}a._clearTimer();a._responseAvailable=true;try{a._webRequest.completed(Sys.EventArgs.Empty)}finally{if(a._xmlHttpRequest!=null){a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest=null}}}};this._clearTimer=function(){if(a._timer!=null){window.clearTimeout(a._timer);a._timer=null}};this._onTimeout=function(){if(!a._responseAvailable){a._clearTimer();a._timedOut=true;a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest.abort();a._webRequest.completed(Sys.EventArgs.Empty);a._xmlHttpRequest=null}}};Sys.Net.XMLHttpExecutor.prototype={get_timedOut:function(){return this._timedOut},get_started:function(){return this._started},get_responseAvailable:function(){return this._responseAvailable},get_aborted:function(){return this._aborted},executeRequest:function(){this._webRequest=this.get_webRequest();var c=this._webRequest.get_body(),a=this._webRequest.get_headers();this._xmlHttpRequest=new XMLHttpRequest;this._xmlHttpRequest.onreadystatechange=this._onReadyStateChange;var e=this._webRequest.get_httpVerb();this._xmlHttpRequest.open(e,this._webRequest.getResolvedUrl(),true);this._xmlHttpRequest.setRequestHeader("X-Requested-With","XMLHttpRequest");if(a)for(var b in a){var f=a[b];if(typeof f!=="function")this._xmlHttpRequest.setRequestHeader(b,f)}if(e.toLowerCase()==="post"){if(a===null||!a["Content-Type"])this._xmlHttpRequest.setRequestHeader("Content-Type","application/x-www-form-urlencoded; charset=utf-8");if(!c)c=""}var d=this._webRequest.get_timeout();if(d>0)this._timer=window.setTimeout(Function.createDelegate(this,this._onTimeout),d);this._xmlHttpRequest.send(c);this._started=true},getResponseHeader:function(b){var a;try{a=this._xmlHttpRequest.getResponseHeader(b)}catch(c){}if(!a)a="";return a},getAllResponseHeaders:function(){return this._xmlHttpRequest.getAllResponseHeaders()},get_responseData:function(){return this._xmlHttpRequest.responseText},get_statusCode:function(){var a=0;try{a=this._xmlHttpRequest.status}catch(b){}return a},get_statusText:function(){return this._xmlHttpRequest.statusText},get_xml:function(){var a=this._xmlHttpRequest.responseXML;if(!a||!a.documentElement){a=Sys.Net.XMLDOM(this._xmlHttpRequest.responseText);if(!a||!a.documentElement)return null}else if(navigator.userAgent.indexOf("MSIE")!==-1&&typeof a.setProperty!="undefined")a.setProperty("SelectionLanguage","XPath");if(a.documentElement.namespaceURI==="http://www.mozilla.org/newlayout/xml/parsererror.xml"&&a.documentElement.tagName==="parsererror")return null;if(a.documentElement.firstChild&&a.documentElement.firstChild.tagName==="parsererror")return null;return a},abort:function(){if(this._aborted||this._responseAvailable||this._timedOut)return;this._aborted=true;this._clearTimer();if(this._xmlHttpRequest&&!this._responseAvailable){this._xmlHttpRequest.onreadystatechange=Function.emptyMethod;this._xmlHttpRequest.abort();this._xmlHttpRequest=null;this._webRequest.completed(Sys.EventArgs.Empty)}}};Sys.Net.XMLHttpExecutor.registerClass("Sys.Net.XMLHttpExecutor",Sys.Net.WebRequestExecutor);Sys.Net._WebRequestManager=function(){this._defaultTimeout=0;this._defaultExecutorType="Sys.Net.XMLHttpExecutor"};Sys.Net._WebRequestManager.prototype={add_invokingRequest:function(a){this._get_eventHandlerList().addHandler("invokingRequest",a)},remove_invokingRequest:function(a){this._get_eventHandlerList().removeHandler("invokingRequest",a)},add_completedRequest:function(a){this._get_eventHandlerList().addHandler("completedRequest",a)},remove_completedRequest:function(a){this._get_eventHandlerList().removeHandler("completedRequest",a)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_defaultTimeout:function(){return this._defaultTimeout},set_defaultTimeout:function(a){this._defaultTimeout=a},get_defaultExecutorType:function(){return this._defaultExecutorType},set_defaultExecutorType:function(a){this._defaultExecutorType=a},executeRequest:function(webRequest){var executor=webRequest.get_executor();if(!executor){var failed=false;try{var executorType=eval(this._defaultExecutorType);executor=new executorType}catch(a){failed=true}webRequest.set_executor(executor)}if(executor.get_aborted())return;var evArgs=new Sys.Net.NetworkRequestEventArgs(webRequest),handler=this._get_eventHandlerList().getHandler("invokingRequest");if(handler)handler(this,evArgs);if(!evArgs.get_cancel())executor.executeRequest()}};Sys.Net._WebRequestManager.registerClass("Sys.Net._WebRequestManager");Sys.Net.WebRequestManager=new Sys.Net._WebRequestManager;Sys.Net.NetworkRequestEventArgs=function(a){Sys.Net.NetworkRequestEventArgs.initializeBase(this);this._webRequest=a};Sys.Net.NetworkRequestEventArgs.prototype={get_webRequest:function(){return this._webRequest}};Sys.Net.NetworkRequestEventArgs.registerClass("Sys.Net.NetworkRequestEventArgs",Sys.CancelEventArgs);Sys.Net.WebRequest=function(){this._url="";this._headers={};this._body=null;this._userContext=null;this._httpVerb=null;this._executor=null;this._invokeCalled=false;this._timeout=0};Sys.Net.WebRequest.prototype={add_completed:function(a){this._get_eventHandlerList().addHandler("completed",a)},remove_completed:function(a){this._get_eventHandlerList().removeHandler("completed",a)},completed:function(b){var a=Sys.Net.WebRequestManager._get_eventHandlerList().getHandler("completedRequest");if(a)a(this._executor,b);a=this._get_eventHandlerList().getHandler("completed");if(a)a(this._executor,b)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_url:function(){return this._url},set_url:function(a){this._url=a},get_headers:function(){return this._headers},get_httpVerb:function(){if(this._httpVerb===null){if(this._body===null)return "GET";return "POST"}return this._httpVerb},set_httpVerb:function(a){this._httpVerb=a},get_body:function(){return this._body},set_body:function(a){this._body=a},get_userContext:function(){return this._userContext},set_userContext:function(a){this._userContext=a},get_executor:function(){return this._executor},set_executor:function(a){this._executor=a;this._executor._set_webRequest(this)},get_timeout:function(){if(this._timeout===0)return Sys.Net.WebRequestManager.get_defaultTimeout();return this._timeout},set_timeout:function(a){this._timeout=a},getResolvedUrl:function(){return Sys.Net.WebRequest._resolveUrl(this._url)},invoke:function(){Sys.Net.WebRequestManager.executeRequest(this);this._invokeCalled=true}};Sys.Net.WebRequest._resolveUrl=function(b,a){if(b&&b.indexOf("://")!==-1)return b;if(!a||a.length===0){var d=document.getElementsByTagName("base")[0];if(d&&d.href&&d.href.length>0)a=d.href;else a=document.URL}var c=a.indexOf("?");if(c!==-1)a=a.substr(0,c);c=a.indexOf("#");if(c!==-1)a=a.substr(0,c);a=a.substr(0,a.lastIndexOf("/")+1);if(!b||b.length===0)return a;if(b.charAt(0)==="/"){var e=a.indexOf("://"),g=a.indexOf("/",e+3);return a.substr(0,g)+b}else{var f=a.lastIndexOf("/");return a.substr(0,f+1)+b}};Sys.Net.WebRequest._createQueryString=function(c,b,f){b=b||encodeURIComponent;var h=0,e,g,d,a=new Sys.StringBuilder;if(c)for(d in c){e=c[d];if(typeof e==="function")continue;g=Sys.Serialization.JavaScriptSerializer.serialize(e);if(h++)a.append("&");a.append(d);a.append("=");a.append(b(g))}if(f){if(h)a.append("&");a.append(f)}return a.toString()};Sys.Net.WebRequest._createUrl=function(a,b,c){if(!b&&!c)return a;var d=Sys.Net.WebRequest._createQueryString(b,null,c);return d.length?a+(a&&a.indexOf("?")>=0?"&":"?")+d:a};Sys.Net.WebRequest.registerClass("Sys.Net.WebRequest");Sys._ScriptLoaderTask=function(b,a){this._scriptElement=b;this._completedCallback=a};Sys._ScriptLoaderTask.prototype={get_scriptElement:function(){return this._scriptElement},dispose:function(){if(this._disposed)return;this._disposed=true;this._removeScriptElementHandlers();Sys._ScriptLoaderTask._clearScript(this._scriptElement);this._scriptElement=null},execute:function(){if(this._ensureReadyStateLoaded())this._executeInternal()},_executeInternal:function(){this._addScriptElementHandlers();document.getElementsByTagName("head")[0].appendChild(this._scriptElement)},_ensureReadyStateLoaded:function(){if(this._useReadyState()&&this._scriptElement.readyState!=="loaded"&&this._scriptElement.readyState!=="complete"){this._scriptDownloadDelegate=Function.createDelegate(this,this._executeInternal);$addHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);return false}return true},_addScriptElementHandlers:function(){if(this._scriptDownloadDelegate){$removeHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);this._scriptDownloadDelegate=null}this._scriptLoadDelegate=Function.createDelegate(this,this._scriptLoadHandler);if(this._useReadyState())$addHandler(this._scriptElement,"readystatechange",this._scriptLoadDelegate);else $addHandler(this._scriptElement,"load",this._scriptLoadDelegate);if(this._scriptElement.addEventListener){this._scriptErrorDelegate=Function.createDelegate(this,this._scriptErrorHandler);this._scriptElement.addEventListener("error",this._scriptErrorDelegate,false)}},_removeScriptElementHandlers:function(){if(this._scriptLoadDelegate){var a=this.get_scriptElement();if(this._scriptDownloadDelegate){$removeHandler(this._scriptElement,"readystatechange",this._scriptDownloadDelegate);this._scriptDownloadDelegate=null}if(this._useReadyState()&&this._scriptLoadDelegate)$removeHandler(a,"readystatechange",this._scriptLoadDelegate);else $removeHandler(a,"load",this._scriptLoadDelegate);if(this._scriptErrorDelegate){this._scriptElement.removeEventListener("error",this._scriptErrorDelegate,false);this._scriptErrorDelegate=null}this._scriptLoadDelegate=null}},_scriptErrorHandler:function(){if(this._disposed)return;this._completedCallback(this.get_scriptElement(),false)},_scriptLoadHandler:function(){if(this._disposed)return;var a=this.get_scriptElement();if(this._useReadyState()&&a.readyState!=="complete")return;this._completedCallback(a,true)},_useReadyState:function(){return Sys.Browser.agent===Sys.Browser.InternetExplorer&&(Sys.Browser.version<9||(document.documentMode||0)<9)}};Sys._ScriptLoaderTask.registerClass("Sys._ScriptLoaderTask",null,Sys.IDisposable);Sys._ScriptLoaderTask._clearScript=function(a){if(!Sys.Debug.isDebug&&a.parentNode)a.parentNode.removeChild(a)}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxSerialization.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxSerialization.js new file mode 100644 index 0000000..f8f13d8 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxSerialization.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxSerialization.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxSerialization.js +Type._registerScript("MicrosoftAjaxSerialization.js",["MicrosoftAjaxCore.js"]);Type.registerNamespace("Sys.Serialization");Sys.Serialization.JavaScriptSerializer=function(){};Sys.Serialization.JavaScriptSerializer.registerClass("Sys.Serialization.JavaScriptSerializer");Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs=[];Sys.Serialization.JavaScriptSerializer._charsToEscape=[];Sys.Serialization.JavaScriptSerializer._dateRegEx=new RegExp('(^|[^\\\\])\\"\\\\/Date\\((-?[0-9]+)(?:[a-zA-Z]|(?:\\+|-)[0-9]{4})?\\)\\\\/\\"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars={};Sys.Serialization.JavaScriptSerializer._escapeRegEx=new RegExp('["\\\\\\x00-\\x1F]',"i");Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal=new RegExp('["\\\\\\x00-\\x1F]',"g");Sys.Serialization.JavaScriptSerializer._jsonRegEx=new RegExp("[^,:{}\\[\\]0-9.\\-+Eaeflnr-u \\n\\r\\t]","g");Sys.Serialization.JavaScriptSerializer._jsonStringRegEx=new RegExp('"(\\\\.|[^"\\\\])*"',"g");Sys.Serialization.JavaScriptSerializer._serverTypeFieldName="__type";Sys.Serialization.JavaScriptSerializer._init=function(){var c=["\\u0000","\\u0001","\\u0002","\\u0003","\\u0004","\\u0005","\\u0006","\\u0007","\\b","\\t","\\n","\\u000b","\\f","\\r","\\u000e","\\u000f","\\u0010","\\u0011","\\u0012","\\u0013","\\u0014","\\u0015","\\u0016","\\u0017","\\u0018","\\u0019","\\u001a","\\u001b","\\u001c","\\u001d","\\u001e","\\u001f"];Sys.Serialization.JavaScriptSerializer._charsToEscape[0]="\\";Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs["\\"]=new RegExp("\\\\","g");Sys.Serialization.JavaScriptSerializer._escapeChars["\\"]="\\\\";Sys.Serialization.JavaScriptSerializer._charsToEscape[1]='"';Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs['"']=new RegExp('"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars['"']='\\"';for(var a=0;a<32;a++){var b=String.fromCharCode(a);Sys.Serialization.JavaScriptSerializer._charsToEscape[a+2]=b;Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b]=new RegExp(b,"g");Sys.Serialization.JavaScriptSerializer._escapeChars[b]=c[a]}};Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder=function(b,a){a.append(b.toString())};Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder=function(a,b){if(isFinite(a))b.append(String(a));else throw Error.invalidOperation(Sys.Res.cannotSerializeNonFiniteNumbers)};Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder=function(a,c){c.append('"');if(Sys.Serialization.JavaScriptSerializer._escapeRegEx.test(a)){if(Sys.Serialization.JavaScriptSerializer._charsToEscape.length===0)Sys.Serialization.JavaScriptSerializer._init();if(a.length<128)a=a.replace(Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal,function(a){return Sys.Serialization.JavaScriptSerializer._escapeChars[a]});else for(var d=0;d<34;d++){var b=Sys.Serialization.JavaScriptSerializer._charsToEscape[d];if(a.indexOf(b)!==-1)if(Sys.Browser.agent===Sys.Browser.Opera||Sys.Browser.agent===Sys.Browser.FireFox)a=a.split(b).join(Sys.Serialization.JavaScriptSerializer._escapeChars[b]);else a=a.replace(Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b],Sys.Serialization.JavaScriptSerializer._escapeChars[b])}}c.append(a);c.append('"')};Sys.Serialization.JavaScriptSerializer._serializeWithBuilder=function(b,a,i,g){var c;switch(typeof b){case "object":if(b)if(Number.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);else if(Boolean.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);else if(String.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);else if(Array.isInstanceOfType(b)){a.append("[");for(c=0;c<b.length;++c){if(c>0)a.append(",");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b[c],a,false,g)}a.append("]")}else{if(Date.isInstanceOfType(b)){a.append('"\\/Date(');a.append(b.getTime());a.append(')\\/"');break}var d=[],f=0;for(var e in b){if(e.startsWith("$"))continue;if(e===Sys.Serialization.JavaScriptSerializer._serverTypeFieldName&&f!==0){d[f++]=d[0];d[0]=e}else d[f++]=e}if(i)d.sort();a.append("{");var j=false;for(c=0;c<f;c++){var h=b[d[c]];if(typeof h!=="undefined"&&typeof h!=="function"){if(j)a.append(",");else j=true;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(d[c],a,i,g);a.append(":");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(h,a,i,g)}}a.append("}")}else a.append("null");break;case "number":Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);break;case "string":Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);break;case "boolean":Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);break;default:a.append("null")}};Sys.Serialization.JavaScriptSerializer.serialize=function(b){var a=new Sys.StringBuilder;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b,a,false);return a.toString()};Sys.Serialization.JavaScriptSerializer.deserialize=function(data,secure){if(data.length===0)throw Error.argument("data",Sys.Res.cannotDeserializeEmptyString);try{var exp=data.replace(Sys.Serialization.JavaScriptSerializer._dateRegEx,"$1new Date($2)");if(secure&&Sys.Serialization.JavaScriptSerializer._jsonRegEx.test(exp.replace(Sys.Serialization.JavaScriptSerializer._jsonStringRegEx,"")))throw null;return eval("("+exp+")")}catch(a){throw Error.argument("data",Sys.Res.cannotDeserializeInvalidJson)}}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxTimer.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxTimer.js new file mode 100644 index 0000000..2c648c9 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxTimer.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxTimer.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxTimer.js +Type._registerScript("Timer.js",["MicrosoftAjaxComponentModel.js"]);Sys.UI._Timer=function(a){Sys.UI._Timer.initializeBase(this,[a]);this._interval=60000;this._enabled=true;this._postbackPending=false;this._raiseTickDelegate=null;this._endRequestHandlerDelegate=null;this._timer=null;this._pageRequestManager=null;this._uniqueID=null};Sys.UI._Timer.prototype={get_enabled:function(){return this._enabled},set_enabled:function(a){this._enabled=a},get_interval:function(){return this._interval},set_interval:function(a){this._interval=a},get_uniqueID:function(){return this._uniqueID},set_uniqueID:function(a){this._uniqueID=a},dispose:function(){this._stopTimer();if(this._pageRequestManager!==null)this._pageRequestManager.remove_endRequest(this._endRequestHandlerDelegate);Sys.UI._Timer.callBaseMethod(this,"dispose")},_doPostback:function(){__doPostBack(this.get_uniqueID(),"")},_handleEndRequest:function(c,b){var a=b.get_dataItems()[this.get_id()];if(a)this._update(a[0],a[1]);if(this._postbackPending===true&&this._pageRequestManager!==null&&this._pageRequestManager.get_isInAsyncPostBack()===false){this._postbackPending=false;this._doPostback()}},initialize:function(){Sys.UI._Timer.callBaseMethod(this,"initialize");this._raiseTickDelegate=Function.createDelegate(this,this._raiseTick);this._endRequestHandlerDelegate=Function.createDelegate(this,this._handleEndRequest);if(Sys.WebForms&&Sys.WebForms.PageRequestManager)this._pageRequestManager=Sys.WebForms.PageRequestManager.getInstance();if(this._pageRequestManager!==null)this._pageRequestManager.add_endRequest(this._endRequestHandlerDelegate);if(this.get_enabled())this._startTimer()},_raiseTick:function(){this._startTimer();if(this._pageRequestManager===null||!this._pageRequestManager.get_isInAsyncPostBack()){this._doPostback();this._postbackPending=false}else this._postbackPending=true},_startTimer:function(){this._timer=window.setTimeout(Function.createDelegate(this,this._raiseTick),this.get_interval())},_stopTimer:function(){if(this._timer!==null){window.clearTimeout(this._timer);this._timer=null}},_update:function(c,b){var a=!this.get_enabled(),d=this.get_interval()!==b;if(!a&&(!c||d)){this._stopTimer();a=true}this.set_enabled(c);this.set_interval(b);if(this.get_enabled()&&a)this._startTimer()}};Sys.UI._Timer.registerClass("Sys.UI._Timer",Sys.UI.Control); diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebForms.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebForms.js new file mode 100644 index 0000000..0f2e82f --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebForms.js @@ -0,0 +1,7 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxWebForms.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxWebForms.js +Type._registerScript("MicrosoftAjaxWebForms.js",["MicrosoftAjaxCore.js","MicrosoftAjaxSerialization.js","MicrosoftAjaxNetwork.js","MicrosoftAjaxComponentModel.js"]);Type.registerNamespace("Sys.WebForms");Sys.WebForms.BeginRequestEventArgs=function(c,b,a){Sys.WebForms.BeginRequestEventArgs.initializeBase(this);this._request=c;this._postBackElement=b;this._updatePanelsToUpdate=a};Sys.WebForms.BeginRequestEventArgs.prototype={get_postBackElement:function(){return this._postBackElement},get_request:function(){return this._request},get_updatePanelsToUpdate:function(){return this._updatePanelsToUpdate?Array.clone(this._updatePanelsToUpdate):[]}};Sys.WebForms.BeginRequestEventArgs.registerClass("Sys.WebForms.BeginRequestEventArgs",Sys.EventArgs);Sys.WebForms.EndRequestEventArgs=function(c,a,b){Sys.WebForms.EndRequestEventArgs.initializeBase(this);this._errorHandled=false;this._error=c;this._dataItems=a||{};this._response=b};Sys.WebForms.EndRequestEventArgs.prototype={get_dataItems:function(){return this._dataItems},get_error:function(){return this._error},get_errorHandled:function(){return this._errorHandled},set_errorHandled:function(a){this._errorHandled=a},get_response:function(){return this._response}};Sys.WebForms.EndRequestEventArgs.registerClass("Sys.WebForms.EndRequestEventArgs",Sys.EventArgs);Sys.WebForms.InitializeRequestEventArgs=function(c,b,a){Sys.WebForms.InitializeRequestEventArgs.initializeBase(this);this._request=c;this._postBackElement=b;this._updatePanelsToUpdate=a};Sys.WebForms.InitializeRequestEventArgs.prototype={get_postBackElement:function(){return this._postBackElement},get_request:function(){return this._request},get_updatePanelsToUpdate:function(){return this._updatePanelsToUpdate?Array.clone(this._updatePanelsToUpdate):[]},set_updatePanelsToUpdate:function(a){this._updated=true;this._updatePanelsToUpdate=a}};Sys.WebForms.InitializeRequestEventArgs.registerClass("Sys.WebForms.InitializeRequestEventArgs",Sys.CancelEventArgs);Sys.WebForms.PageLoadedEventArgs=function(b,a,c){Sys.WebForms.PageLoadedEventArgs.initializeBase(this);this._panelsUpdated=b;this._panelsCreated=a;this._dataItems=c||{}};Sys.WebForms.PageLoadedEventArgs.prototype={get_dataItems:function(){return this._dataItems},get_panelsCreated:function(){return this._panelsCreated},get_panelsUpdated:function(){return this._panelsUpdated}};Sys.WebForms.PageLoadedEventArgs.registerClass("Sys.WebForms.PageLoadedEventArgs",Sys.EventArgs);Sys.WebForms.PageLoadingEventArgs=function(b,a,c){Sys.WebForms.PageLoadingEventArgs.initializeBase(this);this._panelsUpdating=b;this._panelsDeleting=a;this._dataItems=c||{}};Sys.WebForms.PageLoadingEventArgs.prototype={get_dataItems:function(){return this._dataItems},get_panelsDeleting:function(){return this._panelsDeleting},get_panelsUpdating:function(){return this._panelsUpdating}};Sys.WebForms.PageLoadingEventArgs.registerClass("Sys.WebForms.PageLoadingEventArgs",Sys.EventArgs);Sys._ScriptLoader=function(){this._scriptsToLoad=null;this._sessions=[];this._scriptLoadedDelegate=Function.createDelegate(this,this._scriptLoadedHandler)};Sys._ScriptLoader.prototype={dispose:function(){this._stopSession();this._loading=false;if(this._events)delete this._events;this._sessions=null;this._currentSession=null;this._scriptLoadedDelegate=null},loadScripts:function(d,b,c,a){var e={allScriptsLoadedCallback:b,scriptLoadFailedCallback:c,scriptLoadTimeoutCallback:a,scriptsToLoad:this._scriptsToLoad,scriptTimeout:d};this._scriptsToLoad=null;this._sessions[this._sessions.length]=e;if(!this._loading)this._nextSession()},queueCustomScriptTag:function(a){if(!this._scriptsToLoad)this._scriptsToLoad=[];Array.add(this._scriptsToLoad,a)},queueScriptBlock:function(a){if(!this._scriptsToLoad)this._scriptsToLoad=[];Array.add(this._scriptsToLoad,{text:a})},queueScriptReference:function(a,b){if(!this._scriptsToLoad)this._scriptsToLoad=[];Array.add(this._scriptsToLoad,{src:a,fallback:b})},_createScriptElement:function(c){var a=document.createElement("script");a.type="text/javascript";for(var b in c)a[b]=c[b];return a},_loadScriptsInternal:function(){var c=this._currentSession;if(c.scriptsToLoad&&c.scriptsToLoad.length>0){var b=Array.dequeue(c.scriptsToLoad),f=this._scriptLoadedDelegate;if(b.fallback){var g=b.fallback;delete b.fallback;var d=this;f=function(b,a){a||function(){var a=d._createScriptElement({src:g});d._currentTask=new Sys._ScriptLoaderTask(a,d._scriptLoadedDelegate);d._currentTask.execute()}()}}var a=this._createScriptElement(b);if(a.text&&Sys.Browser.agent===Sys.Browser.Safari){a.innerHTML=a.text;delete a.text}if(typeof b.src==="string"){this._currentTask=new Sys._ScriptLoaderTask(a,f);this._currentTask.execute()}else{document.getElementsByTagName("head")[0].appendChild(a);Sys._ScriptLoaderTask._clearScript(a);this._loadScriptsInternal()}}else{this._stopSession();var e=c.allScriptsLoadedCallback;if(e)e(this);this._nextSession()}},_nextSession:function(){if(this._sessions.length===0){this._loading=false;this._currentSession=null;return}this._loading=true;var a=Array.dequeue(this._sessions);this._currentSession=a;if(a.scriptTimeout>0)this._timeoutCookie=window.setTimeout(Function.createDelegate(this,this._scriptLoadTimeoutHandler),a.scriptTimeout*1000);this._loadScriptsInternal()},_raiseError:function(){var b=this._currentSession.scriptLoadFailedCallback,a=this._currentTask.get_scriptElement();this._stopSession();if(b){b(this,a);this._nextSession()}else{this._loading=false;throw Sys._ScriptLoader._errorScriptLoadFailed(a.src)}},_scriptLoadedHandler:function(a,b){if(b){Array.add(Sys._ScriptLoader._getLoadedScripts(),a.src);this._currentTask.dispose();this._currentTask=null;this._loadScriptsInternal()}else this._raiseError()},_scriptLoadTimeoutHandler:function(){var a=this._currentSession.scriptLoadTimeoutCallback;this._stopSession();if(a)a(this);this._nextSession()},_stopSession:function(){if(this._timeoutCookie){window.clearTimeout(this._timeoutCookie);this._timeoutCookie=null}if(this._currentTask){this._currentTask.dispose();this._currentTask=null}}};Sys._ScriptLoader.registerClass("Sys._ScriptLoader",null,Sys.IDisposable);Sys._ScriptLoader.getInstance=function(){var a=Sys._ScriptLoader._activeInstance;if(!a)a=Sys._ScriptLoader._activeInstance=new Sys._ScriptLoader;return a};Sys._ScriptLoader.isScriptLoaded=function(b){var a=document.createElement("script");a.src=b;return Array.contains(Sys._ScriptLoader._getLoadedScripts(),a.src)};Sys._ScriptLoader.readLoadedScripts=function(){if(!Sys._ScriptLoader._referencedScripts){var c=Sys._ScriptLoader._referencedScripts=[],d=document.getElementsByTagName("script");for(var b=d.length-1;b>=0;b--){var e=d[b],a=e.src;if(a.length)if(!Array.contains(c,a))Array.add(c,a)}}};Sys._ScriptLoader._errorScriptLoadFailed=function(b){var a;a=Sys.Res.scriptLoadFailed;var d="Sys.ScriptLoadFailedException: "+String.format(a,b),c=Error.create(d,{name:"Sys.ScriptLoadFailedException","scriptUrl":b});c.popStackFrame();return c};Sys._ScriptLoader._getLoadedScripts=function(){if(!Sys._ScriptLoader._referencedScripts){Sys._ScriptLoader._referencedScripts=[];Sys._ScriptLoader.readLoadedScripts()}return Sys._ScriptLoader._referencedScripts};Sys.WebForms.PageRequestManager=function(){this._form=null;this._activeDefaultButton=null;this._activeDefaultButtonClicked=false;this._updatePanelIDs=null;this._updatePanelClientIDs=null;this._updatePanelHasChildrenAsTriggers=null;this._asyncPostBackControlIDs=null;this._asyncPostBackControlClientIDs=null;this._postBackControlIDs=null;this._postBackControlClientIDs=null;this._scriptManagerID=null;this._pageLoadedHandler=null;this._additionalInput=null;this._onsubmit=null;this._onSubmitStatements=[];this._originalDoPostBack=null;this._originalDoPostBackWithOptions=null;this._originalFireDefaultButton=null;this._originalDoCallback=null;this._isCrossPost=false;this._postBackSettings=null;this._request=null;this._onFormSubmitHandler=null;this._onFormElementClickHandler=null;this._onWindowUnloadHandler=null;this._asyncPostBackTimeout=null;this._controlIDToFocus=null;this._scrollPosition=null;this._processingRequest=false;this._scriptDisposes={};this._transientFields=["__VIEWSTATEENCRYPTED","__VIEWSTATEFIELDCOUNT"];this._textTypes=/^(text|password|hidden|search|tel|url|email|number|range|color|datetime|date|month|week|time|datetime-local)$/i};Sys.WebForms.PageRequestManager.prototype={_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_isInAsyncPostBack:function(){return this._request!==null},add_beginRequest:function(a){this._get_eventHandlerList().addHandler("beginRequest",a)},remove_beginRequest:function(a){this._get_eventHandlerList().removeHandler("beginRequest",a)},add_endRequest:function(a){this._get_eventHandlerList().addHandler("endRequest",a)},remove_endRequest:function(a){this._get_eventHandlerList().removeHandler("endRequest",a)},add_initializeRequest:function(a){this._get_eventHandlerList().addHandler("initializeRequest",a)},remove_initializeRequest:function(a){this._get_eventHandlerList().removeHandler("initializeRequest",a)},add_pageLoaded:function(a){this._get_eventHandlerList().addHandler("pageLoaded",a)},remove_pageLoaded:function(a){this._get_eventHandlerList().removeHandler("pageLoaded",a)},add_pageLoading:function(a){this._get_eventHandlerList().addHandler("pageLoading",a)},remove_pageLoading:function(a){this._get_eventHandlerList().removeHandler("pageLoading",a)},abortPostBack:function(){if(!this._processingRequest&&this._request){this._request.get_executor().abort();this._request=null}},beginAsyncPostBack:function(c,a,f,d,e){if(d&&typeof Page_ClientValidate==="function"&&!Page_ClientValidate(e||null))return;this._postBackSettings=this._createPostBackSettings(true,c,a);var b=this._form;b.__EVENTTARGET.value=a||"";b.__EVENTARGUMENT.value=f||"";this._isCrossPost=false;this._additionalInput=null;this._onFormSubmit()},_cancelPendingCallbacks:function(){for(var a=0,e=window.__pendingCallbacks.length;a<e;a++){var c=window.__pendingCallbacks[a];if(c){if(!c.async)window.__synchronousCallBackIndex=-1;window.__pendingCallbacks[a]=null;var d="__CALLBACKFRAME"+a,b=document.getElementById(d);if(b)b.parentNode.removeChild(b)}}},_commitControls:function(a,b){if(a){this._updatePanelIDs=a.updatePanelIDs;this._updatePanelClientIDs=a.updatePanelClientIDs;this._updatePanelHasChildrenAsTriggers=a.updatePanelHasChildrenAsTriggers;this._asyncPostBackControlIDs=a.asyncPostBackControlIDs;this._asyncPostBackControlClientIDs=a.asyncPostBackControlClientIDs;this._postBackControlIDs=a.postBackControlIDs;this._postBackControlClientIDs=a.postBackControlClientIDs}if(typeof b!=="undefined"&&b!==null)this._asyncPostBackTimeout=b*1000},_createHiddenField:function(c,d){var b,a=document.getElementById(c);if(a)if(!a._isContained)a.parentNode.removeChild(a);else b=a.parentNode;if(!b){b=document.createElement("span");b.style.cssText="display:none !important";this._form.appendChild(b)}b.innerHTML="<input type='hidden' />";a=b.childNodes[0];a._isContained=true;a.id=a.name=c;a.value=d},_createPageRequestManagerTimeoutError:function(){var b="Sys.WebForms.PageRequestManagerTimeoutException: "+Sys.WebForms.Res.PRM_TimeoutError,a=Error.create(b,{name:"Sys.WebForms.PageRequestManagerTimeoutException"});a.popStackFrame();return a},_createPageRequestManagerServerError:function(a,d){var c="Sys.WebForms.PageRequestManagerServerErrorException: "+(d||String.format(Sys.WebForms.Res.PRM_ServerError,a)),b=Error.create(c,{name:"Sys.WebForms.PageRequestManagerServerErrorException",httpStatusCode:a});b.popStackFrame();return b},_createPageRequestManagerParserError:function(b){var c="Sys.WebForms.PageRequestManagerParserErrorException: "+String.format(Sys.WebForms.Res.PRM_ParserError,b),a=Error.create(c,{name:"Sys.WebForms.PageRequestManagerParserErrorException"});a.popStackFrame();return a},_createPanelID:function(e,b){var c=b.asyncTarget,a=this._ensureUniqueIds(e||b.panelsToUpdate),d=a instanceof Array?a.join(","):a||this._scriptManagerID;if(c)d+="|"+c;return encodeURIComponent(this._scriptManagerID)+"="+encodeURIComponent(d)+"&"},_createPostBackSettings:function(d,a,c,b){return {async:d,asyncTarget:c,panelsToUpdate:a,sourceElement:b}},_convertToClientIDs:function(a,f,e,d){if(a)for(var b=0,h=a.length;b<h;b+=d?2:1){var c=a[b],g=(d?a[b+1]:"")||this._uniqueIDToClientID(c);Array.add(f,c);Array.add(e,g)}},dispose:function(){if(this._form){Sys.UI.DomEvent.removeHandler(this._form,"submit",this._onFormSubmitHandler);Sys.UI.DomEvent.removeHandler(this._form,"click",this._onFormElementClickHandler);Sys.UI.DomEvent.removeHandler(window,"unload",this._onWindowUnloadHandler);Sys.UI.DomEvent.removeHandler(window,"load",this._pageLoadedHandler)}if(this._originalDoPostBack){window.__doPostBack=this._originalDoPostBack;this._originalDoPostBack=null}if(this._originalDoPostBackWithOptions){window.WebForm_DoPostBackWithOptions=this._originalDoPostBackWithOptions;this._originalDoPostBackWithOptions=null}if(this._originalFireDefaultButton){window.WebForm_FireDefaultButton=this._originalFireDefaultButton;this._originalFireDefaultButton=null}if(this._originalDoCallback){window.WebForm_DoCallback=this._originalDoCallback;this._originalDoCallback=null}this._form=null;this._updatePanelIDs=null;this._updatePanelClientIDs=null;this._asyncPostBackControlIDs=null;this._asyncPostBackControlClientIDs=null;this._postBackControlIDs=null;this._postBackControlClientIDs=null;this._asyncPostBackTimeout=null;this._scrollPosition=null;this._activeElement=null},_doCallback:function(d,b,c,f,a,e){if(!this.get_isInAsyncPostBack())this._originalDoCallback(d,b,c,f,a,e)},_doPostBack:function(a,k){var f=window.event;if(!f){var d=arguments.callee?arguments.callee.caller:null;if(d){var j=30;while(d.arguments.callee.caller&&--j)d=d.arguments.callee.caller;f=j&&d.arguments.length?d.arguments[0]:null}}this._additionalInput=null;var h=this._form;if(a===null||typeof a==="undefined"||this._isCrossPost){this._postBackSettings=this._createPostBackSettings(false);this._isCrossPost=false}else{var c=this._masterPageUniqueID,l=this._uniqueIDToClientID(a),g=document.getElementById(l);if(!g&&c)if(a.indexOf(c+"$")===0)g=document.getElementById(l.substr(c.length+1));if(!g)if(Array.contains(this._asyncPostBackControlIDs,a))this._postBackSettings=this._createPostBackSettings(true,null,a);else if(Array.contains(this._postBackControlIDs,a))this._postBackSettings=this._createPostBackSettings(false);else{var e=this._findNearestElement(a);if(e)this._postBackSettings=this._getPostBackSettings(e,a);else{if(c){c+="$";if(a.indexOf(c)===0)e=this._findNearestElement(a.substr(c.length))}if(e)this._postBackSettings=this._getPostBackSettings(e,a);else{var b;try{b=f?f.target||f.srcElement:null}catch(n){}b=b||this._activeElement;var m=/__doPostBack\(|WebForm_DoPostBackWithOptions\(/;function i(b){b=b?b.toString():"";return m.test(b)&&b.indexOf("'"+a+"'")!==-1||b.indexOf('"'+a+'"')!==-1}if(b&&(b.name===a||i(b.href)||i(b.onclick)||i(b.onchange)))this._postBackSettings=this._getPostBackSettings(b,a);else this._postBackSettings=this._createPostBackSettings(false)}}}else this._postBackSettings=this._getPostBackSettings(g,a)}if(!this._postBackSettings.async){h.onsubmit=this._onsubmit;this._originalDoPostBack(a,k);h.onsubmit=null;return}h.__EVENTTARGET.value=a;h.__EVENTARGUMENT.value=k;this._onFormSubmit()},_doPostBackWithOptions:function(a){this._isCrossPost=a&&a.actionUrl;var d=true;if(a.validation)if(typeof Page_ClientValidate=="function")d=Page_ClientValidate(a.validationGroup);if(d){if(typeof a.actionUrl!="undefined"&&a.actionUrl!=null&&a.actionUrl.length>0)theForm.action=a.actionUrl;if(a.trackFocus){var c=theForm.elements["__LASTFOCUS"];if(typeof c!="undefined"&&c!=null)if(typeof document.activeElement=="undefined")c.value=a.eventTarget;else{var b=document.activeElement;if(typeof b!="undefined"&&b!=null)if(typeof b.id!="undefined"&&b.id!=null&&b.id.length>0)c.value=b.id;else if(typeof b.name!="undefined")c.value=b.name}}}if(a.clientSubmit)this._doPostBack(a.eventTarget,a.eventArgument)},_elementContains:function(b,a){while(a){if(a===b)return true;a=a.parentNode}return false},_endPostBack:function(a,d,f){if(this._request===d.get_webRequest()){this._processingRequest=false;this._additionalInput=null;this._request=null}var e=this._get_eventHandlerList().getHandler("endRequest"),b=false;if(e){var c=new Sys.WebForms.EndRequestEventArgs(a,f?f.dataItems:{},d);e(this,c);b=c.get_errorHandled()}if(a&&!b)throw a},_ensureUniqueIds:function(a){if(!a)return a;a=a instanceof Array?a:[a];var c=[];for(var b=0,f=a.length;b<f;b++){var e=a[b],d=Array.indexOf(this._updatePanelClientIDs,e);c.push(d>-1?this._updatePanelIDs[d]:e)}return c},_findNearestElement:function(a){while(a.length>0){var d=this._uniqueIDToClientID(a),c=document.getElementById(d);if(c)return c;var b=a.lastIndexOf("$");if(b===-1)return null;a=a.substring(0,b)}return null},_findText:function(b,a){var c=Math.max(0,a-20),d=Math.min(b.length,a+20);return b.substring(c,d)},_fireDefaultButton:function(a,d){if(a.keyCode===13){var c=a.srcElement||a.target;if(!c||c.tagName.toLowerCase()!=="textarea"){var b=document.getElementById(d);if(b&&typeof b.click!=="undefined"){this._activeDefaultButton=b;this._activeDefaultButtonClicked=false;try{b.click()}finally{this._activeDefaultButton=null}a.cancelBubble=true;if(typeof a.stopPropagation==="function")a.stopPropagation();return false}}}return true},_getPageLoadedEventArgs:function(n,c){var m=[],l=[],k=c?c.version4:false,d=c?c.updatePanelData:null,e,g,h,b;if(!d){e=this._updatePanelIDs;g=this._updatePanelClientIDs;h=null;b=null}else{e=d.updatePanelIDs;g=d.updatePanelClientIDs;h=d.childUpdatePanelIDs;b=d.panelsToRefreshIDs}var a,f,j,i;if(b)for(a=0,f=b.length;a<f;a+=k?2:1){j=b[a];i=(k?b[a+1]:"")||this._uniqueIDToClientID(j);Array.add(m,document.getElementById(i))}for(a=0,f=e.length;a<f;a++)if(n||Array.indexOf(h,e[a])!==-1)Array.add(l,document.getElementById(g[a]));return new Sys.WebForms.PageLoadedEventArgs(m,l,c?c.dataItems:{})},_getPageLoadingEventArgs:function(f){var j=[],i=[],c=f.updatePanelData,k=c.oldUpdatePanelIDs,l=c.oldUpdatePanelClientIDs,n=c.updatePanelIDs,m=c.childUpdatePanelIDs,d=c.panelsToRefreshIDs,a,e,b,g,h=f.version4;for(a=0,e=d.length;a<e;a+=h?2:1){b=d[a];g=(h?d[a+1]:"")||this._uniqueIDToClientID(b);Array.add(j,document.getElementById(g))}for(a=0,e=k.length;a<e;a++){b=k[a];if(Array.indexOf(d,b)===-1&&(Array.indexOf(n,b)===-1||Array.indexOf(m,b)>-1))Array.add(i,document.getElementById(l[a]))}return new Sys.WebForms.PageLoadingEventArgs(j,i,f.dataItems)},_getPostBackSettings:function(a,c){var d=a,b=null;while(a){if(a.id){if(!b&&Array.contains(this._asyncPostBackControlClientIDs,a.id))b=this._createPostBackSettings(true,null,c,d);else if(!b&&Array.contains(this._postBackControlClientIDs,a.id))return this._createPostBackSettings(false);else{var e=Array.indexOf(this._updatePanelClientIDs,a.id);if(e!==-1)if(this._updatePanelHasChildrenAsTriggers[e])return this._createPostBackSettings(true,[this._updatePanelIDs[e]],c,d);else return this._createPostBackSettings(true,null,c,d)}if(!b&&this._matchesParentIDInList(a.id,this._asyncPostBackControlClientIDs))b=this._createPostBackSettings(true,null,c,d);else if(!b&&this._matchesParentIDInList(a.id,this._postBackControlClientIDs))return this._createPostBackSettings(false)}a=a.parentNode}if(!b)return this._createPostBackSettings(false);else return b},_getScrollPosition:function(){var a=document.documentElement;if(a&&(this._validPosition(a.scrollLeft)||this._validPosition(a.scrollTop)))return {x:a.scrollLeft,y:a.scrollTop};else{a=document.body;if(a&&(this._validPosition(a.scrollLeft)||this._validPosition(a.scrollTop)))return {x:a.scrollLeft,y:a.scrollTop};else if(this._validPosition(window.pageXOffset)||this._validPosition(window.pageYOffset))return {x:window.pageXOffset,y:window.pageYOffset};else return {x:0,y:0}}},_initializeInternal:function(f,g,a,b,e,c,d){if(this._prmInitialized)throw Error.invalidOperation(Sys.WebForms.Res.PRM_CannotRegisterTwice);this._prmInitialized=true;this._masterPageUniqueID=d;this._scriptManagerID=f;this._form=Sys.UI.DomElement.resolveElement(g);this._onsubmit=this._form.onsubmit;this._form.onsubmit=null;this._onFormSubmitHandler=Function.createDelegate(this,this._onFormSubmit);this._onFormElementClickHandler=Function.createDelegate(this,this._onFormElementClick);this._onWindowUnloadHandler=Function.createDelegate(this,this._onWindowUnload);Sys.UI.DomEvent.addHandler(this._form,"submit",this._onFormSubmitHandler);Sys.UI.DomEvent.addHandler(this._form,"click",this._onFormElementClickHandler);Sys.UI.DomEvent.addHandler(window,"unload",this._onWindowUnloadHandler);this._originalDoPostBack=window.__doPostBack;if(this._originalDoPostBack)window.__doPostBack=Function.createDelegate(this,this._doPostBack);this._originalDoPostBackWithOptions=window.WebForm_DoPostBackWithOptions;if(this._originalDoPostBackWithOptions)window.WebForm_DoPostBackWithOptions=Function.createDelegate(this,this._doPostBackWithOptions);this._originalFireDefaultButton=window.WebForm_FireDefaultButton;if(this._originalFireDefaultButton)window.WebForm_FireDefaultButton=Function.createDelegate(this,this._fireDefaultButton);this._originalDoCallback=window.WebForm_DoCallback;if(this._originalDoCallback)window.WebForm_DoCallback=Function.createDelegate(this,this._doCallback);this._pageLoadedHandler=Function.createDelegate(this,this._pageLoadedInitialLoad);Sys.UI.DomEvent.addHandler(window,"load",this._pageLoadedHandler);if(a)this._updateControls(a,b,e,c,true)},_matchesParentIDInList:function(c,b){for(var a=0,d=b.length;a<d;a++)if(c.startsWith(b[a]+"_"))return true;return false},_onFormElementActive:function(a,d,e){if(a.disabled)return;this._activeElement=a;this._postBackSettings=this._getPostBackSettings(a,a.name);if(a.name){var b=a.tagName.toUpperCase();if(b==="INPUT"){var c=a.type;if(c==="submit")this._additionalInput=encodeURIComponent(a.name)+"="+encodeURIComponent(a.value);else if(c==="image")this._additionalInput=encodeURIComponent(a.name)+".x="+d+"&"+encodeURIComponent(a.name)+".y="+e}else if(b==="BUTTON"&&a.name.length!==0&&a.type==="submit")this._additionalInput=encodeURIComponent(a.name)+"="+encodeURIComponent(a.value)}},_onFormElementClick:function(a){this._activeDefaultButtonClicked=a.target===this._activeDefaultButton;this._onFormElementActive(a.target,a.offsetX,a.offsetY)},_onFormSubmit:function(i){var f,x,h=true,z=this._isCrossPost;this._isCrossPost=false;if(this._onsubmit)h=this._onsubmit();if(h)for(f=0,x=this._onSubmitStatements.length;f<x;f++)if(!this._onSubmitStatements[f]()){h=false;break}if(!h){if(i)i.preventDefault();return}var w=this._form;if(z)return;if(this._activeDefaultButton&&!this._activeDefaultButtonClicked)this._onFormElementActive(this._activeDefaultButton,0,0);if(!this._postBackSettings||!this._postBackSettings.async)return;var b=new Sys.StringBuilder,s=w.elements,B=s.length,t=this._createPanelID(null,this._postBackSettings);b.append(t);for(f=0;f<B;f++){var e=s[f],g=e.name;if(typeof g==="undefined"||g===null||g.length===0||g===this._scriptManagerID)continue;var n=e.tagName.toUpperCase();if(n==="INPUT"){var p=e.type;if(this._textTypes.test(p)||(p==="checkbox"||p==="radio")&&e.checked){b.append(encodeURIComponent(g));b.append("=");b.append(encodeURIComponent(e.value));b.append("&")}}else if(n==="SELECT"){var A=e.options.length;for(var q=0;q<A;q++){var u=e.options[q];if(u.selected){b.append(encodeURIComponent(g));b.append("=");b.append(encodeURIComponent(u.value));b.append("&")}}}else if(n==="TEXTAREA"){b.append(encodeURIComponent(g));b.append("=");b.append(encodeURIComponent(e.value));b.append("&")}}b.append("__ASYNCPOST=true&");if(this._additionalInput){b.append(this._additionalInput);this._additionalInput=null}var c=new Sys.Net.WebRequest,a=w.action;if(Sys.Browser.agent===Sys.Browser.InternetExplorer){var r=a.indexOf("#");if(r!==-1)a=a.substr(0,r);var o="",v="",m=a.indexOf("?");if(m!==-1){v=a.substr(m);a=a.substr(0,m)}if(/^https?\:\/\/.*$/gi.test(a)){var y=a.indexOf("//")+2,l=a.indexOf("/",y);if(l===-1){o=a;a=""}else{o=a.substr(0,l);a=a.substr(l)}}a=o+encodeURI(decodeURI(a))+v}c.set_url(a);c.get_headers()["X-MicrosoftAjax"]="Delta=true";c.get_headers()["Cache-Control"]="no-cache";c.set_timeout(this._asyncPostBackTimeout);c.add_completed(Function.createDelegate(this,this._onFormSubmitCompleted));c.set_body(b.toString());var j,d,k=this._get_eventHandlerList().getHandler("initializeRequest");if(k){j=this._postBackSettings.panelsToUpdate;d=new Sys.WebForms.InitializeRequestEventArgs(c,this._postBackSettings.sourceElement,j);k(this,d);h=!d.get_cancel()}if(!h){if(i)i.preventDefault();return}if(d&&d._updated){j=d.get_updatePanelsToUpdate();c.set_body(c.get_body().replace(t,this._createPanelID(j,this._postBackSettings)))}this._scrollPosition=this._getScrollPosition();this.abortPostBack();k=this._get_eventHandlerList().getHandler("beginRequest");if(k){d=new Sys.WebForms.BeginRequestEventArgs(c,this._postBackSettings.sourceElement,j||this._postBackSettings.panelsToUpdate);k(this,d)}if(this._originalDoCallback)this._cancelPendingCallbacks();this._request=c;this._processingRequest=false;c.invoke();if(i)i.preventDefault()},_onFormSubmitCompleted:function(c){this._processingRequest=true;if(c.get_timedOut()){this._endPostBack(this._createPageRequestManagerTimeoutError(),c,null);return}if(c.get_aborted()){this._endPostBack(null,c,null);return}if(!this._request||c.get_webRequest()!==this._request)return;if(c.get_statusCode()!==200){this._endPostBack(this._createPageRequestManagerServerError(c.get_statusCode()),c,null);return}var a=this._parseDelta(c);if(!a)return;var b,e;if(a.asyncPostBackControlIDsNode&&a.postBackControlIDsNode&&a.updatePanelIDsNode&&a.panelsToRefreshNode&&a.childUpdatePanelIDsNode){var r=this._updatePanelIDs,n=this._updatePanelClientIDs,i=a.childUpdatePanelIDsNode.content,p=i.length?i.split(","):[],m=this._splitNodeIntoArray(a.asyncPostBackControlIDsNode),o=this._splitNodeIntoArray(a.postBackControlIDsNode),q=this._splitNodeIntoArray(a.updatePanelIDsNode),g=this._splitNodeIntoArray(a.panelsToRefreshNode),h=a.version4;for(b=0,e=g.length;b<e;b+=h?2:1){var j=(h?g[b+1]:"")||this._uniqueIDToClientID(g[b]);if(!document.getElementById(j)){this._endPostBack(Error.invalidOperation(String.format(Sys.WebForms.Res.PRM_MissingPanel,j)),c,a);return}}var f=this._processUpdatePanelArrays(q,m,o,h);f.oldUpdatePanelIDs=r;f.oldUpdatePanelClientIDs=n;f.childUpdatePanelIDs=p;f.panelsToRefreshIDs=g;a.updatePanelData=f}a.dataItems={};var d;for(b=0,e=a.dataItemNodes.length;b<e;b++){d=a.dataItemNodes[b];a.dataItems[d.id]=d.content}for(b=0,e=a.dataItemJsonNodes.length;b<e;b++){d=a.dataItemJsonNodes[b];a.dataItems[d.id]=Sys.Serialization.JavaScriptSerializer.deserialize(d.content)}var l=this._get_eventHandlerList().getHandler("pageLoading");if(l)l(this,this._getPageLoadingEventArgs(a));Sys._ScriptLoader.readLoadedScripts();Sys.Application.beginCreateComponents();var k=Sys._ScriptLoader.getInstance();this._queueScripts(k,a.scriptBlockNodes,true,false);this._processingRequest=true;k.loadScripts(0,Function.createDelegate(this,Function.createCallback(this._scriptIncludesLoadComplete,a)),Function.createDelegate(this,Function.createCallback(this._scriptIncludesLoadFailed,a)),null)},_onWindowUnload:function(){this.dispose()},_pageLoaded:function(a,c){var b=this._get_eventHandlerList().getHandler("pageLoaded");if(b)b(this,this._getPageLoadedEventArgs(a,c));if(!a)Sys.Application.raiseLoad()},_pageLoadedInitialLoad:function(){this._pageLoaded(true,null)},_parseDelta:function(h){var c=h.get_responseData(),d,i,E,F,D,b=0,e=null,k=[];while(b<c.length){d=c.indexOf("|",b);if(d===-1){e=this._findText(c,b);break}i=parseInt(c.substring(b,d),10);if(i%1!==0){e=this._findText(c,b);break}b=d+1;d=c.indexOf("|",b);if(d===-1){e=this._findText(c,b);break}E=c.substring(b,d);b=d+1;d=c.indexOf("|",b);if(d===-1){e=this._findText(c,b);break}F=c.substring(b,d);b=d+1;if(b+i>=c.length){e=this._findText(c,c.length);break}D=c.substr(b,i);b+=i;if(c.charAt(b)!=="|"){e=this._findText(c,b);break}b++;Array.add(k,{type:E,id:F,content:D})}if(e){this._endPostBack(this._createPageRequestManagerParserError(String.format(Sys.WebForms.Res.PRM_ParserErrorDetails,e)),h,null);return null}var x=[],w=[],q=[],j=[],t=[],C=[],A=[],z=[],v=[],s=[],m,p,u,n,o,r,y,g;for(var l=0,G=k.length;l<G;l++){var a=k[l];switch(a.type){case "#":g=a;break;case "updatePanel":Array.add(x,a);break;case "hiddenField":Array.add(w,a);break;case "arrayDeclaration":Array.add(q,a);break;case "scriptBlock":Array.add(j,a);break;case "fallbackScript":j[j.length-1].fallback=a.id;case "scriptStartupBlock":Array.add(t,a);break;case "expando":Array.add(C,a);break;case "onSubmit":Array.add(A,a);break;case "asyncPostBackControlIDs":m=a;break;case "postBackControlIDs":p=a;break;case "updatePanelIDs":u=a;break;case "asyncPostBackTimeout":n=a;break;case "childUpdatePanelIDs":o=a;break;case "panelsToRefreshIDs":r=a;break;case "formAction":y=a;break;case "dataItem":Array.add(z,a);break;case "dataItemJson":Array.add(v,a);break;case "scriptDispose":Array.add(s,a);break;case "pageRedirect":if(g&&parseFloat(g.content)>=4)a.content=unescape(a.content);if(Sys.Browser.agent===Sys.Browser.InternetExplorer){var f=document.createElement("a");f.style.display="none";f.attachEvent("onclick",B);f.href=a.content;this._form.parentNode.insertBefore(f,this._form);f.click();f.detachEvent("onclick",B);this._form.parentNode.removeChild(f);function B(a){a.cancelBubble=true}}else window.location.href=a.content;return null;case "error":this._endPostBack(this._createPageRequestManagerServerError(Number.parseInvariant(a.id),a.content),h,null);return null;case "pageTitle":document.title=a.content;break;case "focus":this._controlIDToFocus=a.content;break;default:this._endPostBack(this._createPageRequestManagerParserError(String.format(Sys.WebForms.Res.PRM_UnknownToken,a.type)),h,null);return null}}return {version4:g?parseFloat(g.content)>=4:false,executor:h,updatePanelNodes:x,hiddenFieldNodes:w,arrayDeclarationNodes:q,scriptBlockNodes:j,scriptStartupNodes:t,expandoNodes:C,onSubmitNodes:A,dataItemNodes:z,dataItemJsonNodes:v,scriptDisposeNodes:s,asyncPostBackControlIDsNode:m,postBackControlIDsNode:p,updatePanelIDsNode:u,asyncPostBackTimeoutNode:n,childUpdatePanelIDsNode:o,panelsToRefreshNode:r,formActionNode:y}},_processUpdatePanelArrays:function(e,q,r,f){var d,c,b;if(e){var i=e.length,j=f?2:1;d=new Array(i/j);c=new Array(i/j);b=new Array(i/j);for(var g=0,h=0;g<i;g+=j,h++){var p,a=e[g],k=f?e[g+1]:"";p=a.charAt(0)==="t";a=a.substr(1);if(!k)k=this._uniqueIDToClientID(a);b[h]=p;d[h]=a;c[h]=k}}else{d=[];c=[];b=[]}var n=[],l=[];this._convertToClientIDs(q,n,l,f);var o=[],m=[];this._convertToClientIDs(r,o,m,f);return {updatePanelIDs:d,updatePanelClientIDs:c,updatePanelHasChildrenAsTriggers:b,asyncPostBackControlIDs:n,asyncPostBackControlClientIDs:l,postBackControlIDs:o,postBackControlClientIDs:m}},_queueScripts:function(scriptLoader,scriptBlockNodes,queueIncludes,queueBlocks){for(var i=0,l=scriptBlockNodes.length;i<l;i++){var scriptBlockType=scriptBlockNodes[i].id;switch(scriptBlockType){case "ScriptContentNoTags":if(!queueBlocks)continue;scriptLoader.queueScriptBlock(scriptBlockNodes[i].content);break;case "ScriptContentWithTags":var scriptTagAttributes;eval("scriptTagAttributes = "+scriptBlockNodes[i].content);if(scriptTagAttributes.src){if(!queueIncludes||Sys._ScriptLoader.isScriptLoaded(scriptTagAttributes.src))continue}else if(!queueBlocks)continue;scriptLoader.queueCustomScriptTag(scriptTagAttributes);break;case "ScriptPath":var script=scriptBlockNodes[i];if(!queueIncludes||Sys._ScriptLoader.isScriptLoaded(script.content))continue;scriptLoader.queueScriptReference(script.content,script.fallback)}}},_registerDisposeScript:function(a,b){if(!this._scriptDisposes[a])this._scriptDisposes[a]=[b];else Array.add(this._scriptDisposes[a],b)},_scriptIncludesLoadComplete:function(e,b){if(b.executor.get_webRequest()!==this._request)return;this._commitControls(b.updatePanelData,b.asyncPostBackTimeoutNode?b.asyncPostBackTimeoutNode.content:null);if(b.formActionNode)this._form.action=b.formActionNode.content;var a,d,c;for(a=0,d=b.updatePanelNodes.length;a<d;a++){c=b.updatePanelNodes[a];var j=document.getElementById(c.id);if(!j){this._endPostBack(Error.invalidOperation(String.format(Sys.WebForms.Res.PRM_MissingPanel,c.id)),b.executor,b);return}this._updatePanel(j,c.content)}for(a=0,d=b.scriptDisposeNodes.length;a<d;a++){c=b.scriptDisposeNodes[a];this._registerDisposeScript(c.id,c.content)}for(a=0,d=this._transientFields.length;a<d;a++){var g=document.getElementById(this._transientFields[a]);if(g){var k=g._isContained?g.parentNode:g;k.parentNode.removeChild(k)}}for(a=0,d=b.hiddenFieldNodes.length;a<d;a++){c=b.hiddenFieldNodes[a];this._createHiddenField(c.id,c.content)}if(b.scriptsFailed)throw Sys._ScriptLoader._errorScriptLoadFailed(b.scriptsFailed.src,b.scriptsFailed.multipleCallbacks);this._queueScripts(e,b.scriptBlockNodes,false,true);var i="";for(a=0,d=b.arrayDeclarationNodes.length;a<d;a++){c=b.arrayDeclarationNodes[a];i+="Sys.WebForms.PageRequestManager._addArrayElement('"+c.id+"', "+c.content+");\r\n"}var h="";for(a=0,d=b.expandoNodes.length;a<d;a++){c=b.expandoNodes[a];h+=c.id+" = "+c.content+"\r\n"}if(i.length)e.queueScriptBlock(i);if(h.length)e.queueScriptBlock(h);this._queueScripts(e,b.scriptStartupNodes,true,true);var f="";for(a=0,d=b.onSubmitNodes.length;a<d;a++){if(a===0)f="Array.add(Sys.WebForms.PageRequestManager.getInstance()._onSubmitStatements, function() {\r\n";f+=b.onSubmitNodes[a].content+"\r\n"}if(f.length){f+="\r\nreturn true;\r\n});\r\n";e.queueScriptBlock(f)}e.loadScripts(0,Function.createDelegate(this,Function.createCallback(this._scriptsLoadComplete,b)),null,null)},_scriptIncludesLoadFailed:function(d,c,b,a){a.scriptsFailed={src:c.src,multipleCallbacks:b};this._scriptIncludesLoadComplete(d,a)},_scriptsLoadComplete:function(f,c){var e=c.executor;if(window.__theFormPostData)window.__theFormPostData="";if(window.__theFormPostCollection)window.__theFormPostCollection=[];if(window.WebForm_InitCallback)window.WebForm_InitCallback();if(this._scrollPosition){if(window.scrollTo)window.scrollTo(this._scrollPosition.x,this._scrollPosition.y);this._scrollPosition=null}Sys.Application.endCreateComponents();this._pageLoaded(false,c);this._endPostBack(null,e,c);if(this._controlIDToFocus){var a,d;if(Sys.Browser.agent===Sys.Browser.InternetExplorer){var b=$get(this._controlIDToFocus);a=b;if(b&&!WebForm_CanFocus(b))a=WebForm_FindFirstFocusableChild(b);if(a&&typeof a.contentEditable!=="undefined"){d=a.contentEditable;a.contentEditable=false}else a=null}WebForm_AutoFocus(this._controlIDToFocus);if(a)a.contentEditable=d;this._controlIDToFocus=null}},_splitNodeIntoArray:function(b){var a=b.content,c=a.length?a.split(","):[];return c},_uniqueIDToClientID:function(a){return a.replace(/\$/g,"_")},_updateControls:function(d,a,c,b,e){this._commitControls(this._processUpdatePanelArrays(d,a,c,e),b)},_updatePanel:function(updatePanelElement,rendering){for(var updatePanelID in this._scriptDisposes)if(this._elementContains(updatePanelElement,document.getElementById(updatePanelID))){var disposeScripts=this._scriptDisposes[updatePanelID];for(var i=0,l=disposeScripts.length;i<l;i++)eval(disposeScripts[i]);delete this._scriptDisposes[updatePanelID]}Sys.Application.disposeElement(updatePanelElement,true);updatePanelElement.innerHTML=rendering},_validPosition:function(a){return typeof a!=="undefined"&&a!==null&&a!==0}};Sys.WebForms.PageRequestManager.getInstance=function(){var a=Sys.WebForms.PageRequestManager._instance;if(!a)a=Sys.WebForms.PageRequestManager._instance=new Sys.WebForms.PageRequestManager;return a};Sys.WebForms.PageRequestManager._addArrayElement=function(a){if(!window[a])window[a]=[];for(var b=1,c=arguments.length;b<c;b++)Array.add(window[a],arguments[b])};Sys.WebForms.PageRequestManager._initialize=function(){var a=Sys.WebForms.PageRequestManager.getInstance();a._initializeInternal.apply(a,arguments)};Sys.WebForms.PageRequestManager.registerClass("Sys.WebForms.PageRequestManager");Sys.UI._UpdateProgress=function(a){Sys.UI._UpdateProgress.initializeBase(this,[a]);this._displayAfter=500;this._dynamicLayout=true;this._associatedUpdatePanelId=null;this._beginRequestHandlerDelegate=null;this._startDelegate=null;this._endRequestHandlerDelegate=null;this._pageRequestManager=null;this._timerCookie=null};Sys.UI._UpdateProgress.prototype={get_displayAfter:function(){return this._displayAfter},set_displayAfter:function(a){this._displayAfter=a},get_dynamicLayout:function(){return this._dynamicLayout},set_dynamicLayout:function(a){this._dynamicLayout=a},get_associatedUpdatePanelId:function(){return this._associatedUpdatePanelId},set_associatedUpdatePanelId:function(a){this._associatedUpdatePanelId=a},get_role:function(){return "status"},_clearTimeout:function(){if(this._timerCookie){window.clearTimeout(this._timerCookie);this._timerCookie=null}},_getUniqueID:function(b){var a=Array.indexOf(this._pageRequestManager._updatePanelClientIDs,b);return a===-1?null:this._pageRequestManager._updatePanelIDs[a]},_handleBeginRequest:function(f,e){var b=e.get_postBackElement(),a=true,d=this._associatedUpdatePanelId;if(this._associatedUpdatePanelId){var c=e.get_updatePanelsToUpdate();if(c&&c.length)a=Array.contains(c,d)||Array.contains(c,this._getUniqueID(d));else a=false}while(!a&&b){if(b.id&&this._associatedUpdatePanelId===b.id)a=true;b=b.parentNode}if(a)this._timerCookie=window.setTimeout(this._startDelegate,this._displayAfter)},_startRequest:function(){if(this._pageRequestManager.get_isInAsyncPostBack()){var a=this.get_element();if(this._dynamicLayout)a.style.display="block";else a.style.visibility="visible";if(this.get_role()==="status")a.setAttribute("aria-hidden","false")}this._timerCookie=null},_handleEndRequest:function(){var a=this.get_element();if(this._dynamicLayout)a.style.display="none";else a.style.visibility="hidden";if(this.get_role()==="status")a.setAttribute("aria-hidden","true");this._clearTimeout()},dispose:function(){if(this._beginRequestHandlerDelegate!==null){this._pageRequestManager.remove_beginRequest(this._beginRequestHandlerDelegate);this._pageRequestManager.remove_endRequest(this._endRequestHandlerDelegate);this._beginRequestHandlerDelegate=null;this._endRequestHandlerDelegate=null}this._clearTimeout();Sys.UI._UpdateProgress.callBaseMethod(this,"dispose")},initialize:function(){Sys.UI._UpdateProgress.callBaseMethod(this,"initialize");if(this.get_role()==="status")this.get_element().setAttribute("aria-hidden","true");this._beginRequestHandlerDelegate=Function.createDelegate(this,this._handleBeginRequest);this._endRequestHandlerDelegate=Function.createDelegate(this,this._handleEndRequest);this._startDelegate=Function.createDelegate(this,this._startRequest);if(Sys.WebForms&&Sys.WebForms.PageRequestManager)this._pageRequestManager=Sys.WebForms.PageRequestManager.getInstance();if(this._pageRequestManager!==null){this._pageRequestManager.add_beginRequest(this._beginRequestHandlerDelegate);this._pageRequestManager.add_endRequest(this._endRequestHandlerDelegate)}}};Sys.UI._UpdateProgress.registerClass("Sys.UI._UpdateProgress",Sys.UI.Control); +Type.registerNamespace('Sys.WebForms');Sys.WebForms.Res={'PRM_UnknownToken':'Unknown token: \'{0}\'.','PRM_MissingPanel':'Could not find UpdatePanel with ID \'{0}\'. If it is being updated dynamically then it must be inside another UpdatePanel.','PRM_ServerError':'An unknown error occurred while processing the request on the server. The status code returned from the server was: {0}','PRM_ParserError':'The message received from the server could not be parsed. Common causes for this error are when the response is modified by calls to Response.Write(), response filters, HttpModules, or server trace is enabled.\r\nDetails: {0}','PRM_TimeoutError':'The server request timed out.','PRM_ParserErrorDetails':'Error parsing near \'{0}\'.','PRM_CannotRegisterTwice':'The PageRequestManager cannot be initialized more than once.'}; diff --git a/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebServices.js b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebServices.js new file mode 100644 index 0000000..16d25b3 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MSAjax/MicrosoftAjaxWebServices.js @@ -0,0 +1,6 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MicrosoftAjaxWebServices.js +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjaxWebServices.js +Type._registerScript("MicrosoftAjaxWebServices.js",["MicrosoftAjaxNetwork.js"]);Type.registerNamespace("Sys.Net");Sys.Net.WebServiceProxy=function(){};Sys.Net.WebServiceProxy.prototype={get_timeout:function(){return this._timeout||0},set_timeout:function(a){if(a<0)throw Error.argumentOutOfRange("value",a,Sys.Res.invalidTimeout);this._timeout=a},get_defaultUserContext:function(){return typeof this._userContext==="undefined"?null:this._userContext},set_defaultUserContext:function(a){this._userContext=a},get_defaultSucceededCallback:function(){return this._succeeded||null},set_defaultSucceededCallback:function(a){this._succeeded=a},get_defaultFailedCallback:function(){return this._failed||null},set_defaultFailedCallback:function(a){this._failed=a},get_enableJsonp:function(){return !!this._jsonp},set_enableJsonp:function(a){this._jsonp=a},get_path:function(){return this._path||null},set_path:function(a){this._path=a},get_jsonpCallbackParameter:function(){return this._callbackParameter||"callback"},set_jsonpCallbackParameter:function(a){this._callbackParameter=a},_invoke:function(d,e,g,f,c,b,a){c=c||this.get_defaultSucceededCallback();b=b||this.get_defaultFailedCallback();if(a===null||typeof a==="undefined")a=this.get_defaultUserContext();return Sys.Net.WebServiceProxy.invoke(d,e,g,f,c,b,a,this.get_timeout(),this.get_enableJsonp(),this.get_jsonpCallbackParameter())}};Sys.Net.WebServiceProxy.registerClass("Sys.Net.WebServiceProxy");Sys.Net.WebServiceProxy.invoke=function(q,a,m,l,j,b,g,e,w,p){var i=w!==false?Sys.Net.WebServiceProxy._xdomain.exec(q):null,c,n=i&&i.length===3&&(i[1]!==location.protocol||i[2]!==location.host);m=n||m;if(n){p=p||"callback";c="_jsonp"+Sys._jsonp++}if(!l)l={};var r=l;if(!m||!r)r={};var s,h,f=null,k,o=null,u=Sys.Net.WebRequest._createUrl(a?q+"/"+encodeURIComponent(a):q,r,n?p+"=Sys."+c:null);if(n){s=document.createElement("script");s.src=u;k=new Sys._ScriptLoaderTask(s,function(d,b){if(!b||c)t({Message:String.format(Sys.Res.webServiceFailedNoMsg,a)},-1)});function v(){if(f===null)return;f=null;h=new Sys.Net.WebServiceError(true,String.format(Sys.Res.webServiceTimedOut,a));k.dispose();delete Sys[c];if(b)b(h,g,a)}function t(d,e){if(f!==null){window.clearTimeout(f);f=null}k.dispose();delete Sys[c];c=null;if(typeof e!=="undefined"&&e!==200){if(b){h=new Sys.Net.WebServiceError(false,d.Message||String.format(Sys.Res.webServiceFailedNoMsg,a),d.StackTrace||null,d.ExceptionType||null,d);h._statusCode=e;b(h,g,a)}}else if(j)j(d,g,a)}Sys[c]=t;e=e||Sys.Net.WebRequestManager.get_defaultTimeout();if(e>0)f=window.setTimeout(v,e);k.execute();return null}var d=new Sys.Net.WebRequest;d.set_url(u);d.get_headers()["Content-Type"]="application/json; charset=utf-8";if(!m){o=Sys.Serialization.JavaScriptSerializer.serialize(l);if(o==="{}")o=""}d.set_body(o);d.add_completed(x);if(e&&e>0)d.set_timeout(e);d.invoke();function x(d){if(d.get_responseAvailable()){var f=d.get_statusCode(),c=null;try{var e=d.getResponseHeader("Content-Type");if(e.startsWith("application/json"))c=d.get_object();else if(e.startsWith("text/xml"))c=d.get_xml();else c=d.get_responseData()}catch(m){}var k=d.getResponseHeader("jsonerror"),h=k==="true";if(h){if(c)c=new Sys.Net.WebServiceError(false,c.Message,c.StackTrace,c.ExceptionType,c)}else if(e.startsWith("application/json"))c=!c||typeof c.d==="undefined"?c:c.d;if(f<200||f>=300||h){if(b){if(!c||!h)c=new Sys.Net.WebServiceError(false,String.format(Sys.Res.webServiceFailedNoMsg,a));c._statusCode=f;b(c,g,a)}}else if(j)j(c,g,a)}else{var i;if(d.get_timedOut())i=String.format(Sys.Res.webServiceTimedOut,a);else i=String.format(Sys.Res.webServiceFailedNoMsg,a);if(b)b(new Sys.Net.WebServiceError(d.get_timedOut(),i,"",""),g,a)}}return d};Sys.Net.WebServiceProxy._generateTypedConstructor=function(a){return function(b){if(b)for(var c in b)this[c]=b[c];this.__type=a}};Sys._jsonp=0;Sys.Net.WebServiceProxy._xdomain=/^\s*([a-zA-Z0-9\+\-\.]+\:)\/\/([^?#\/]+)/;Sys.Net.WebServiceError=function(d,e,c,a,b){this._timedOut=d;this._message=e;this._stackTrace=c;this._exceptionType=a;this._errorObject=b;this._statusCode=-1};Sys.Net.WebServiceError.prototype={get_timedOut:function(){return this._timedOut},get_statusCode:function(){return this._statusCode},get_message:function(){return this._message},get_stackTrace:function(){return this._stackTrace||""},get_exceptionType:function(){return this._exceptionType||""},get_errorObject:function(){return this._errorObject||null}};Sys.Net.WebServiceError.registerClass("Sys.Net.WebServiceError"); diff --git a/samples/TestAzureAD/Scripts/WebForms/Menu.js b/samples/TestAzureAD/Scripts/WebForms/Menu.js new file mode 100644 index 0000000..27a78fa --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/Menu.js @@ -0,0 +1,898 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/Menu.js +var __rootMenuItem; +var __menuInterval; +var __scrollPanel; +var __disappearAfter = 500; +function Menu_ClearInterval() { + if (__menuInterval) { + window.clearInterval(__menuInterval); + } +} +function Menu_Collapse(item) { + Menu_SetRoot(item); + if (__rootMenuItem) { + Menu_ClearInterval(); + if (__disappearAfter >= 0) { + __menuInterval = window.setInterval("Menu_HideItems()", __disappearAfter); + } + } +} +function Menu_Expand(item, horizontalOffset, verticalOffset, hideScrollers) { + Menu_ClearInterval(); + var tr = item.parentNode.parentNode.parentNode.parentNode.parentNode; + var horizontal = true; + if (!tr.id) { + horizontal = false; + tr = tr.parentNode; + } + var child = Menu_FindSubMenu(item); + if (child) { + var data = Menu_GetData(item); + if (!data) { + return null; + } + child.rel = tr.id; + child.x = horizontalOffset; + child.y = verticalOffset; + if (horizontal) child.pos = "bottom"; + PopOut_Show(child.id, hideScrollers, data); + } + Menu_SetRoot(item); + if (child) { + if (!document.body.__oldOnClick && document.body.onclick) { + document.body.__oldOnClick = document.body.onclick; + } + if (__rootMenuItem) { + document.body.onclick = Menu_HideItems; + } + } + Menu_ResetSiblings(tr); + return child; +} +function Menu_FindMenu(item) { + if (item && item.menu) return item.menu; + var tr = item.parentNode.parentNode.parentNode.parentNode.parentNode; + if (!tr.id) { + tr = tr.parentNode; + } + for (var i = tr.id.length - 1; i >= 0; i--) { + if (tr.id.charAt(i) < '0' || tr.id.charAt(i) > '9') { + var menu = WebForm_GetElementById(tr.id.substr(0, i)); + if (menu) { + item.menu = menu; + return menu; + } + } + } + return null; +} +function Menu_FindNext(item) { + var a = WebForm_GetElementByTagName(item, "A"); + var parent = Menu_FindParentContainer(item); + var first = null; + if (parent) { + var links = WebForm_GetElementsByTagName(parent, "A"); + var match = false; + for (var i = 0; i < links.length; i++) { + var link = links[i]; + if (Menu_IsSelectable(link)) { + if (Menu_FindParentContainer(link) == parent) { + if (match) { + return link; + } + else if (!first) { + first = link; + } + } + if (!match && link == a) { + match = true; + } + } + } + } + return first; +} +function Menu_FindParentContainer(item) { + if (item.menu_ParentContainerCache) return item.menu_ParentContainerCache; + var a = (item.tagName.toLowerCase() == "a") ? item : WebForm_GetElementByTagName(item, "A"); + var menu = Menu_FindMenu(a); + if (menu) { + var parent = item; + while (parent && parent.tagName && + parent.id != menu.id && + parent.tagName.toLowerCase() != "div") { + parent = parent.parentNode; + } + item.menu_ParentContainerCache = parent; + return parent; + } +} +function Menu_FindParentItem(item) { + var parentContainer = Menu_FindParentContainer(item); + var parentContainerID = parentContainer.id; + var len = parentContainerID.length; + if (parentContainerID && parentContainerID.substr(len - 5) == "Items") { + var parentItemID = parentContainerID.substr(0, len - 5); + return WebForm_GetElementById(parentItemID); + } + return null; +} +function Menu_FindPrevious(item) { + var a = WebForm_GetElementByTagName(item, "A"); + var parent = Menu_FindParentContainer(item); + var last = null; + if (parent) { + var links = WebForm_GetElementsByTagName(parent, "A"); + for (var i = 0; i < links.length; i++) { + var link = links[i]; + if (Menu_IsSelectable(link)) { + if (link == a && last) { + return last; + } + if (Menu_FindParentContainer(link) == parent) { + last = link; + } + } + } + } + return last; +} +function Menu_FindSubMenu(item) { + var tr = item.parentNode.parentNode.parentNode.parentNode.parentNode; + if (!tr.id) { + tr=tr.parentNode; + } + return WebForm_GetElementById(tr.id + "Items"); +} +function Menu_Focus(item) { + if (item && item.focus) { + var pos = WebForm_GetElementPosition(item); + var parentContainer = Menu_FindParentContainer(item); + if (!parentContainer.offset) { + parentContainer.offset = 0; + } + var posParent = WebForm_GetElementPosition(parentContainer); + var delta; + if (pos.y + pos.height > posParent.y + parentContainer.offset + parentContainer.clippedHeight) { + delta = pos.y + pos.height - posParent.y - parentContainer.offset - parentContainer.clippedHeight; + PopOut_Scroll(parentContainer, delta); + } + else if (pos.y < posParent.y + parentContainer.offset) { + delta = posParent.y + parentContainer.offset - pos.y; + PopOut_Scroll(parentContainer, -delta); + } + PopOut_HideScrollers(parentContainer); + item.focus(); + } +} +function Menu_GetData(item) { + if (!item.data) { + var a = (item.tagName.toLowerCase() == "a" ? item : WebForm_GetElementByTagName(item, "a")); + var menu = Menu_FindMenu(a); + try { + item.data = eval(menu.id + "_Data"); + } + catch(e) {} + } + return item.data; +} +function Menu_HideItems(items) { + if (document.body.__oldOnClick) { + document.body.onclick = document.body.__oldOnClick; + document.body.__oldOnClick = null; + } + Menu_ClearInterval(); + if (!items || ((typeof(items.tagName) == "undefined") && (items instanceof Event))) { + items = __rootMenuItem; + } + var table = items; + if ((typeof(table) == "undefined") || (table == null) || !table.tagName || (table.tagName.toLowerCase() != "table")) { + table = WebForm_GetElementByTagName(table, "TABLE"); + } + if ((typeof(table) == "undefined") || (table == null) || !table.tagName || (table.tagName.toLowerCase() != "table")) { + return; + } + var rows = table.rows ? table.rows : table.firstChild.rows; + var isVertical = false; + for (var r = 0; r < rows.length; r++) { + if (rows[r].id) { + isVertical = true; + break; + } + } + var i, child, nextLevel; + if (isVertical) { + for(i = 0; i < rows.length; i++) { + if (rows[i].id) { + child = WebForm_GetElementById(rows[i].id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + else if (rows[i].cells[0]) { + nextLevel = WebForm_GetElementByTagName(rows[i].cells[0], "TABLE"); + if (nextLevel) { + Menu_HideItems(nextLevel); + } + } + } + } + else if (rows[0]) { + for(i = 0; i < rows[0].cells.length; i++) { + if (rows[0].cells[i].id) { + child = WebForm_GetElementById(rows[0].cells[i].id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + else { + nextLevel = WebForm_GetElementByTagName(rows[0].cells[i], "TABLE"); + if (nextLevel) { + Menu_HideItems(rows[0].cells[i].firstChild); + } + } + } + } + if (items && items.id) { + PopOut_Hide(items.id); + } +} +function Menu_HoverDisabled(item) { + var node = (item.tagName.toLowerCase() == "td") ? + item: + item.cells[0]; + var data = Menu_GetData(item); + if (!data) return; + node = WebForm_GetElementByTagName(node, "table").rows[0].cells[0].childNodes[0]; + if (data.disappearAfter >= 200) { + __disappearAfter = data.disappearAfter; + } + Menu_Expand(node, data.horizontalOffset, data.verticalOffset); +} +function Menu_HoverDynamic(item) { + var node = (item.tagName.toLowerCase() == "td") ? + item: + item.cells[0]; + var data = Menu_GetData(item); + if (!data) return; + var nodeTable = WebForm_GetElementByTagName(node, "table"); + if (data.hoverClass) { + nodeTable.hoverClass = data.hoverClass; + WebForm_AppendToClassName(nodeTable, data.hoverClass); + } + node = nodeTable.rows[0].cells[0].childNodes[0]; + if (data.hoverHyperLinkClass) { + node.hoverHyperLinkClass = data.hoverHyperLinkClass; + WebForm_AppendToClassName(node, data.hoverHyperLinkClass); + } + if (data.disappearAfter >= 200) { + __disappearAfter = data.disappearAfter; + } + Menu_Expand(node, data.horizontalOffset, data.verticalOffset); +} +function Menu_HoverRoot(item) { + var node = (item.tagName.toLowerCase() == "td") ? + item: + item.cells[0]; + var data = Menu_GetData(item); + if (!data) { + return null; + } + var nodeTable = WebForm_GetElementByTagName(node, "table"); + if (data.staticHoverClass) { + nodeTable.hoverClass = data.staticHoverClass; + WebForm_AppendToClassName(nodeTable, data.staticHoverClass); + } + node = nodeTable.rows[0].cells[0].childNodes[0]; + if (data.staticHoverHyperLinkClass) { + node.hoverHyperLinkClass = data.staticHoverHyperLinkClass; + WebForm_AppendToClassName(node, data.staticHoverHyperLinkClass); + } + return node; +} +function Menu_HoverStatic(item) { + var node = Menu_HoverRoot(item); + var data = Menu_GetData(item); + if (!data) return; + __disappearAfter = data.disappearAfter; + Menu_Expand(node, data.horizontalOffset, data.verticalOffset); +} +function Menu_IsHorizontal(item) { + if (item) { + var a = ((item.tagName && (item.tagName.toLowerCase == "a")) ? item : WebForm_GetElementByTagName(item, "A")); + if (!a) { + return false; + } + var td = a.parentNode.parentNode.parentNode.parentNode.parentNode; + if (td.id) { + return true; + } + } + return false; +} +function Menu_IsSelectable(link) { + return (link && link.href) +} +function Menu_Key(item) { + var event; + if (window.event) { + event = window.event; + } + else { + event = item; + item = event.currentTarget; + } + var key = (event ? event.keyCode : -1); + var data = Menu_GetData(item); + if (!data) return; + var horizontal = Menu_IsHorizontal(item); + var a = WebForm_GetElementByTagName(item, "A"); + var nextItem, parentItem, previousItem; + if ((!horizontal && key == 38) || (horizontal && key == 37)) { + previousItem = Menu_FindPrevious(item); + while (previousItem && previousItem.disabled) { + previousItem = Menu_FindPrevious(previousItem); + } + if (previousItem) { + Menu_Focus(previousItem); + Menu_Expand(previousItem, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + if ((!horizontal && key == 40) || (horizontal && key == 39)) { + if (horizontal) { + var subMenu = Menu_FindSubMenu(a); + if (subMenu && subMenu.style && subMenu.style.visibility && + subMenu.style.visibility.toLowerCase() == "hidden") { + Menu_Expand(a, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + nextItem = Menu_FindNext(item); + while (nextItem && nextItem.disabled) { + nextItem = Menu_FindNext(nextItem); + } + if (nextItem) { + Menu_Focus(nextItem); + Menu_Expand(nextItem, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + if ((!horizontal && key == 39) || (horizontal && key == 40)) { + var children = Menu_Expand(a, data.horizontalOffset, data.verticalOffset, true); + if (children) { + var firstChild; + children = WebForm_GetElementsByTagName(children, "A"); + for (var i = 0; i < children.length; i++) { + if (!children[i].disabled && Menu_IsSelectable(children[i])) { + firstChild = children[i]; + break; + } + } + if (firstChild) { + Menu_Focus(firstChild); + Menu_Expand(firstChild, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + else { + parentItem = Menu_FindParentItem(item); + while (parentItem && !Menu_IsHorizontal(parentItem)) { + parentItem = Menu_FindParentItem(parentItem); + } + if (parentItem) { + nextItem = Menu_FindNext(parentItem); + while (nextItem && nextItem.disabled) { + nextItem = Menu_FindNext(nextItem); + } + if (nextItem) { + Menu_Focus(nextItem); + Menu_Expand(nextItem, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + } + } + if ((!horizontal && key == 37) || (horizontal && key == 38)) { + parentItem = Menu_FindParentItem(item); + if (parentItem) { + if (Menu_IsHorizontal(parentItem)) { + previousItem = Menu_FindPrevious(parentItem); + while (previousItem && previousItem.disabled) { + previousItem = Menu_FindPrevious(previousItem); + } + if (previousItem) { + Menu_Focus(previousItem); + Menu_Expand(previousItem, data.horizontalOffset, data.verticalOffset, true); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + var parentA = WebForm_GetElementByTagName(parentItem, "A"); + if (parentA) { + Menu_Focus(parentA); + } + Menu_ResetSiblings(parentItem); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } + } + if (key == 27) { + Menu_HideItems(); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return; + } +} +function Menu_ResetSiblings(item) { + var table = (item.tagName.toLowerCase() == "td") ? + item.parentNode.parentNode.parentNode : + item.parentNode.parentNode; + var isVertical = false; + for (var r = 0; r < table.rows.length; r++) { + if (table.rows[r].id) { + isVertical = true; + break; + } + } + var i, child, childNode; + if (isVertical) { + for(i = 0; i < table.rows.length; i++) { + childNode = table.rows[i]; + if (childNode != item) { + child = WebForm_GetElementById(childNode.id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + } + } + else { + for(i = 0; i < table.rows[0].cells.length; i++) { + childNode = table.rows[0].cells[i]; + if (childNode != item) { + child = WebForm_GetElementById(childNode.id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + } + } + Menu_ResetTopMenus(table, table, 0, true); +} +function Menu_ResetTopMenus(table, doNotReset, level, up) { + var i, child, childNode; + if (up && table.id == "") { + var parentTable = table.parentNode.parentNode.parentNode.parentNode; + if (parentTable.tagName.toLowerCase() == "table") { + Menu_ResetTopMenus(parentTable, doNotReset, level + 1, true); + } + } + else { + if (level == 0 && table != doNotReset) { + if (table.rows[0].id) { + for(i = 0; i < table.rows.length; i++) { + childNode = table.rows[i]; + child = WebForm_GetElementById(childNode.id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + } + else { + for(i = 0; i < table.rows[0].cells.length; i++) { + childNode = table.rows[0].cells[i]; + child = WebForm_GetElementById(childNode.id + "Items"); + if (child) { + Menu_HideItems(child); + } + } + } + } + else if (level > 0) { + for (i = 0; i < table.rows.length; i++) { + for (var j = 0; j < table.rows[i].cells.length; j++) { + var subTable = table.rows[i].cells[j].firstChild; + if (subTable && subTable.tagName.toLowerCase() == "table") { + Menu_ResetTopMenus(subTable, doNotReset, level - 1, false); + } + } + } + } + } +} +function Menu_RestoreInterval() { + if (__menuInterval && __rootMenuItem) { + Menu_ClearInterval(); + __menuInterval = window.setInterval("Menu_HideItems()", __disappearAfter); + } +} +function Menu_SetRoot(item) { + var newRoot = Menu_FindMenu(item); + if (newRoot) { + if (__rootMenuItem && __rootMenuItem != newRoot) { + Menu_HideItems(); + } + __rootMenuItem = newRoot; + } +} +function Menu_Unhover(item) { + var node = (item.tagName.toLowerCase() == "td") ? + item: + item.cells[0]; + var nodeTable = WebForm_GetElementByTagName(node, "table"); + if (nodeTable.hoverClass) { + WebForm_RemoveClassName(nodeTable, nodeTable.hoverClass); + } + node = nodeTable.rows[0].cells[0].childNodes[0]; + if (node.hoverHyperLinkClass) { + WebForm_RemoveClassName(node, node.hoverHyperLinkClass); + } + Menu_Collapse(node); +} +function PopOut_Clip(element, y, height) { + if (element && element.style) { + element.style.clip = "rect(" + y + "px auto " + (y + height) + "px auto)"; + element.style.overflow = "hidden"; + } +} +function PopOut_Down(scroller) { + Menu_ClearInterval(); + var panel; + if (scroller) { + panel = scroller.parentNode + } + else { + panel = __scrollPanel; + } + if (panel && ((panel.offset + panel.clippedHeight) < panel.physicalHeight)) { + PopOut_Scroll(panel, 2) + __scrollPanel = panel; + PopOut_ShowScrollers(panel); + PopOut_Stop(); + __scrollPanel.interval = window.setInterval("PopOut_Down()", 8); + } + else { + PopOut_ShowScrollers(panel); + } +} +function PopOut_Hide(panelId) { + var panel = WebForm_GetElementById(panelId); + if (panel && panel.tagName.toLowerCase() == "div") { + panel.style.visibility = "hidden"; + panel.style.display = "none"; + panel.offset = 0; + panel.scrollTop = 0; + var table = WebForm_GetElementByTagName(panel, "TABLE"); + if (table) { + WebForm_SetElementY(table, 0); + } + if (window.navigator && window.navigator.appName == "Microsoft Internet Explorer" && + !window.opera) { + var childFrameId = panel.id + "_MenuIFrame"; + var childFrame = WebForm_GetElementById(childFrameId); + if (childFrame) { + childFrame.style.display = "none"; + } + } + } +} +function PopOut_HideScrollers(panel) { + if (panel && panel.style) { + var up = WebForm_GetElementById(panel.id + "Up"); + var dn = WebForm_GetElementById(panel.id + "Dn"); + if (up) { + up.style.visibility = "hidden"; + up.style.display = "none"; + } + if (dn) { + dn.style.visibility = "hidden"; + dn.style.display = "none"; + } + } +} +function PopOut_Position(panel, hideScrollers) { + if (window.opera) { + panel.parentNode.removeChild(panel); + document.forms[0].appendChild(panel); + } + var rel = WebForm_GetElementById(panel.rel); + var relTable = WebForm_GetElementByTagName(rel, "TABLE"); + var relCoordinates = WebForm_GetElementPosition(relTable ? relTable : rel); + var panelCoordinates = WebForm_GetElementPosition(panel); + var panelHeight = ((typeof(panel.physicalHeight) != "undefined") && (panel.physicalHeight != null)) ? + panel.physicalHeight : + panelCoordinates.height; + panel.physicalHeight = panelHeight; + var panelParentCoordinates; + if (panel.offsetParent) { + panelParentCoordinates = WebForm_GetElementPosition(panel.offsetParent); + } + else { + panelParentCoordinates = new Object(); + panelParentCoordinates.x = 0; + panelParentCoordinates.y = 0; + } + var overflowElement = WebForm_GetElementById("__overFlowElement"); + if (!overflowElement) { + overflowElement = document.createElement("img"); + overflowElement.id="__overFlowElement"; + WebForm_SetElementWidth(overflowElement, 1); + document.body.appendChild(overflowElement); + } + WebForm_SetElementHeight(overflowElement, panelHeight + relCoordinates.y + parseInt(panel.y ? panel.y : 0)); + overflowElement.style.visibility = "visible"; + overflowElement.style.display = "inline"; + var clientHeight = 0; + var clientWidth = 0; + if (window.innerHeight) { + clientHeight = window.innerHeight; + clientWidth = window.innerWidth; + } + else if (document.documentElement && document.documentElement.clientHeight) { + clientHeight = document.documentElement.clientHeight; + clientWidth = document.documentElement.clientWidth; + } + else if (document.body && document.body.clientHeight) { + clientHeight = document.body.clientHeight; + clientWidth = document.body.clientWidth; + } + var scrollTop = 0; + var scrollLeft = 0; + if (typeof(window.pageYOffset) != "undefined") { + scrollTop = window.pageYOffset; + scrollLeft = window.pageXOffset; + } + else if (document.documentElement && (typeof(document.documentElement.scrollTop) != "undefined")) { + scrollTop = document.documentElement.scrollTop; + scrollLeft = document.documentElement.scrollLeft; + } + else if (document.body && (typeof(document.body.scrollTop) != "undefined")) { + scrollTop = document.body.scrollTop; + scrollLeft = document.body.scrollLeft; + } + overflowElement.style.visibility = "hidden"; + overflowElement.style.display = "none"; + var bottomWindowBorder = clientHeight + scrollTop; + var rightWindowBorder = clientWidth + scrollLeft; + var position = panel.pos; + if ((typeof(position) == "undefined") || (position == null) || (position == "")) { + position = (WebForm_GetElementDir(rel) == "rtl" ? "middleleft" : "middleright"); + } + position = position.toLowerCase(); + var y = relCoordinates.y + parseInt(panel.y ? panel.y : 0) - panelParentCoordinates.y; + var borderParent = (rel && rel.parentNode && rel.parentNode.parentNode && rel.parentNode.parentNode.parentNode + && rel.parentNode.parentNode.parentNode.tagName.toLowerCase() == "div") ? + rel.parentNode.parentNode.parentNode : null; + WebForm_SetElementY(panel, y); + PopOut_SetPanelHeight(panel, panelHeight, true); + var clip = false; + var overflow; + if (position.indexOf("top") != -1) { + y -= panelHeight; + WebForm_SetElementY(panel, y); + if (y < -panelParentCoordinates.y) { + y = -panelParentCoordinates.y; + WebForm_SetElementY(panel, y); + if (panelHeight > clientHeight - 2) { + clip = true; + PopOut_SetPanelHeight(panel, clientHeight - 2); + } + } + } + else { + if (position.indexOf("bottom") != -1) { + y += relCoordinates.height; + WebForm_SetElementY(panel, y); + } + overflow = y + panelParentCoordinates.y + panelHeight - bottomWindowBorder; + if (overflow > 0) { + y -= overflow; + WebForm_SetElementY(panel, y); + if (y < -panelParentCoordinates.y) { + y = 2 - panelParentCoordinates.y + scrollTop; + WebForm_SetElementY(panel, y); + clip = true; + PopOut_SetPanelHeight(panel, clientHeight - 2); + } + } + } + if (!clip) { + PopOut_SetPanelHeight(panel, panel.clippedHeight, true); + } + var panelParentOffsetY = 0; + if (panel.offsetParent) { + panelParentOffsetY = WebForm_GetElementPosition(panel.offsetParent).y; + } + var panelY = ((typeof(panel.originY) != "undefined") && (panel.originY != null)) ? + panel.originY : + y - panelParentOffsetY; + panel.originY = panelY; + if (!hideScrollers) { + PopOut_ShowScrollers(panel); + } + else { + PopOut_HideScrollers(panel); + } + var x = relCoordinates.x + parseInt(panel.x ? panel.x : 0) - panelParentCoordinates.x; + if (borderParent && borderParent.clientLeft) { + x += 2 * borderParent.clientLeft; + } + WebForm_SetElementX(panel, x); + if (position.indexOf("left") != -1) { + x -= panelCoordinates.width; + WebForm_SetElementX(panel, x); + if (x < -panelParentCoordinates.x) { + WebForm_SetElementX(panel, -panelParentCoordinates.x); + } + } + else { + if (position.indexOf("right") != -1) { + x += relCoordinates.width; + WebForm_SetElementX(panel, x); + } + overflow = x + panelParentCoordinates.x + panelCoordinates.width - rightWindowBorder; + if (overflow > 0) { + if (position.indexOf("bottom") == -1 && relCoordinates.x > panelCoordinates.width) { + x -= relCoordinates.width + panelCoordinates.width; + } + else { + x -= overflow; + } + WebForm_SetElementX(panel, x); + if (x < -panelParentCoordinates.x) { + WebForm_SetElementX(panel, -panelParentCoordinates.x); + } + } + } +} +function PopOut_Scroll(panel, offsetDelta) { + var table = WebForm_GetElementByTagName(panel, "TABLE"); + if (!table) return; + table.style.position = "relative"; + var tableY = (table.style.top ? parseInt(table.style.top) : 0); + panel.offset += offsetDelta; + WebForm_SetElementY(table, tableY - offsetDelta); +} +function PopOut_SetPanelHeight(element, height, doNotClip) { + if (element && element.style) { + var size = WebForm_GetElementPosition(element); + element.physicalWidth = size.width; + element.clippedHeight = height; + WebForm_SetElementHeight(element, height - (element.clientTop ? (2 * element.clientTop) : 0)); + if (doNotClip && element.style) { + element.style.clip = "rect(auto auto auto auto)"; + } + else { + PopOut_Clip(element, 0, height); + } + } +} +function PopOut_Show(panelId, hideScrollers, data) { + var panel = WebForm_GetElementById(panelId); + if (panel && panel.tagName.toLowerCase() == "div") { + panel.style.visibility = "visible"; + panel.style.display = "inline"; + if (!panel.offset || hideScrollers) { + panel.scrollTop = 0; + panel.offset = 0; + var table = WebForm_GetElementByTagName(panel, "TABLE"); + if (table) { + WebForm_SetElementY(table, 0); + } + } + PopOut_Position(panel, hideScrollers); + var z = 1; + var isIE = window.navigator && window.navigator.appName == "Microsoft Internet Explorer" && !window.opera; + if (isIE && data) { + var childFrameId = panel.id + "_MenuIFrame"; + var childFrame = WebForm_GetElementById(childFrameId); + var parent = panel.offsetParent; + if (!childFrame) { + childFrame = document.createElement("iframe"); + childFrame.id = childFrameId; + childFrame.src = (data.iframeUrl ? data.iframeUrl : "about:blank"); + childFrame.style.position = "absolute"; + childFrame.style.display = "none"; + childFrame.scrolling = "no"; + childFrame.frameBorder = "0"; + if (parent.tagName.toLowerCase() == "html") { + document.body.appendChild(childFrame); + } + else { + parent.appendChild(childFrame); + } + } + var pos = WebForm_GetElementPosition(panel); + var parentPos = WebForm_GetElementPosition(parent); + WebForm_SetElementX(childFrame, pos.x - parentPos.x); + WebForm_SetElementY(childFrame, pos.y - parentPos.y); + WebForm_SetElementWidth(childFrame, pos.width); + WebForm_SetElementHeight(childFrame, pos.height); + childFrame.style.display = "block"; + if (panel.currentStyle && panel.currentStyle.zIndex && panel.currentStyle.zIndex != "auto") { + z = panel.currentStyle.zIndex; + } + else if (panel.style.zIndex) { + z = panel.style.zIndex; + } + } + panel.style.zIndex = z; + } +} +function PopOut_ShowScrollers(panel) { + if (panel && panel.style) { + var up = WebForm_GetElementById(panel.id + "Up"); + var dn = WebForm_GetElementById(panel.id + "Dn"); + var cnt = 0; + if (up && dn) { + if (panel.offset && panel.offset > 0) { + up.style.visibility = "visible"; + up.style.display = "inline"; + cnt++; + if (panel.clientWidth) { + WebForm_SetElementWidth(up, panel.clientWidth + - (up.clientLeft ? (2 * up.clientLeft) : 0)); + } + WebForm_SetElementY(up, 0); + } + else { + up.style.visibility = "hidden"; + up.style.display = "none"; + } + if (panel.offset + panel.clippedHeight + 2 <= panel.physicalHeight) { + dn.style.visibility = "visible"; + dn.style.display = "inline"; + cnt++; + if (panel.clientWidth) { + WebForm_SetElementWidth(dn, panel.clientWidth + - (dn.clientLeft ? (2 * dn.clientLeft) : 0)); + } + WebForm_SetElementY(dn, panel.clippedHeight - WebForm_GetElementPosition(dn).height + - (panel.clientTop ? (2 * panel.clientTop) : 0)); + } + else { + dn.style.visibility = "hidden"; + dn.style.display = "none"; + } + if (cnt == 0) { + panel.style.clip = "rect(auto auto auto auto)"; + } + } + } +} +function PopOut_Stop() { + if (__scrollPanel && __scrollPanel.interval) { + window.clearInterval(__scrollPanel.interval); + } + Menu_RestoreInterval(); +} +function PopOut_Up(scroller) { + Menu_ClearInterval(); + var panel; + if (scroller) { + panel = scroller.parentNode + } + else { + panel = __scrollPanel; + } + if (panel && panel.offset && panel.offset > 0) { + PopOut_Scroll(panel, -2); + __scrollPanel = panel; + PopOut_ShowScrollers(panel); + PopOut_Stop(); + __scrollPanel.interval = window.setInterval("PopOut_Up()", 8); + } +} diff --git a/samples/TestAzureAD/Scripts/WebForms/MenuStandards.js b/samples/TestAzureAD/Scripts/WebForms/MenuStandards.js new file mode 100644 index 0000000..95decdd --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/MenuStandards.js @@ -0,0 +1,697 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/MenuStandards.js +if (!window.Sys) { window.Sys = {}; } +if (!Sys.WebForms) { Sys.WebForms = {}; } +Sys.WebForms.Menu = function(options) { + this.items = []; + this.depth = options.depth || 1; + this.parentMenuItem = options.parentMenuItem; + this.element = Sys.WebForms.Menu._domHelper.getElement(options.element); + if (this.element.tagName === 'DIV') { + var containerElement = this.element; + this.element = Sys.WebForms.Menu._domHelper.firstChild(containerElement); + this.element.tabIndex = options.tabIndex || 0; + options.element = containerElement; + options.menu = this; + this.container = new Sys.WebForms._MenuContainer(options); + Sys.WebForms.Menu._domHelper.setFloat(this.element, this.container.rightToLeft ? "right" : "left"); + } + else { + this.container = options.container; + this.keyMap = options.keyMap; + } + Sys.WebForms.Menu._elementObjectMapper.map(this.element, this); + if (this.parentMenuItem && this.parentMenuItem.parentMenu) { + this.parentMenu = this.parentMenuItem.parentMenu; + this.rootMenu = this.parentMenu.rootMenu; + if (!this.element.id) { + this.element.id = (this.container.element.id || 'menu') + ':submenu:' + Sys.WebForms.Menu._elementObjectMapper._computedId; + } + if (this.depth > this.container.staticDisplayLevels) { + this.displayMode = "dynamic"; + this.element.style.display = "none"; + this.element.style.position = "absolute"; + if (this.rootMenu && this.container.orientation === 'horizontal' && this.parentMenu.isStatic()) { + this.element.style.top = "100%"; + if (this.container.rightToLeft) { + this.element.style.right = "0px"; + } + else { + this.element.style.left = "0px"; + } + } + else { + this.element.style.top = "0px"; + if (this.container.rightToLeft) { + this.element.style.right = "100%"; + } + else { + this.element.style.left = "100%"; + } + } + if (this.container.rightToLeft) { + this.keyMap = Sys.WebForms.Menu._keyboardMapping.verticalRtl; + } + else { + this.keyMap = Sys.WebForms.Menu._keyboardMapping.vertical; + } + } + else { + this.displayMode = "static"; + this.element.style.display = "block"; + if (this.container.orientation === 'horizontal') { + Sys.WebForms.Menu._domHelper.setFloat(this.element, this.container.rightToLeft ? "right" : "left"); + } + } + } + Sys.WebForms.Menu._domHelper.appendCssClass(this.element, this.displayMode); + var children = this.element.childNodes; + var count = children.length; + for (var i = 0; i < count; i++) { + var node = children[i]; + if (node.nodeType !== 1) { + continue; + } + var topLevelMenuItem = null; + if (this.parentMenuItem) { + topLevelMenuItem = this.parentMenuItem.topLevelMenuItem; + } + var menuItem = new Sys.WebForms.MenuItem(this, node, topLevelMenuItem); + var previousMenuItem = this.items[this.items.length - 1]; + if (previousMenuItem) { + menuItem.previousSibling = previousMenuItem; + previousMenuItem.nextSibling = menuItem; + } + this.items[this.items.length] = menuItem; + } +}; +Sys.WebForms.Menu.prototype = { + blur: function() { if (this.container) this.container.blur(); }, + collapse: function() { + this.each(function(menuItem) { + menuItem.hover(false); + menuItem.blur(); + var childMenu = menuItem.childMenu; + if (childMenu) { + childMenu.collapse(); + } + }); + this.hide(); + }, + doDispose: function() { this.each(function(item) { item.doDispose(); }); }, + each: function(fn) { + var count = this.items.length; + for (var i = 0; i < count; i++) { + fn(this.items[i]); + } + }, + firstChild: function() { return this.items[0]; }, + focus: function() { if (this.container) this.container.focus(); }, + get_displayed: function() { return this.element.style.display !== 'none'; }, + get_focused: function() { + if (this.container) { + return this.container.focused; + } + return false; + }, + handleKeyPress: function(keyCode) { + if (this.keyMap.contains(keyCode)) { + if (this.container.focusedMenuItem) { + this.container.focusedMenuItem.navigate(keyCode); + return; + } + var firstChild = this.firstChild(); + if (firstChild) { + this.container.navigateTo(firstChild); + } + } + }, + hide: function() { + if (!this.get_displayed()) { + return; + } + this.each(function(item) { + if (item.childMenu) { + item.childMenu.hide(); + } + }); + if (!this.isRoot()) { + if (this.get_focused()) { + this.container.navigateTo(this.parentMenuItem); + } + this.element.style.display = 'none'; + } + }, + isRoot: function() { return this.rootMenu === this; }, + isStatic: function() { return this.displayMode === 'static'; }, + lastChild: function() { return this.items[this.items.length - 1]; }, + show: function() { this.element.style.display = 'block'; } +}; +if (Sys.WebForms.Menu.registerClass) { + Sys.WebForms.Menu.registerClass('Sys.WebForms.Menu'); +} +Sys.WebForms.MenuItem = function(parentMenu, listElement, topLevelMenuItem) { + this.keyMap = parentMenu.keyMap; + this.parentMenu = parentMenu; + this.container = parentMenu.container; + this.element = listElement; + this.topLevelMenuItem = topLevelMenuItem || this; + this._anchor = Sys.WebForms.Menu._domHelper.firstChild(listElement); + while (this._anchor && this._anchor.tagName !== 'A') { + this._anchor = Sys.WebForms.Menu._domHelper.nextSibling(this._anchor); + } + if (this._anchor) { + this._anchor.tabIndex = -1; + var subMenu = this._anchor; + while (subMenu && subMenu.tagName !== 'UL') { + subMenu = Sys.WebForms.Menu._domHelper.nextSibling(subMenu); + } + if (subMenu) { + this.childMenu = new Sys.WebForms.Menu({ element: subMenu, parentMenuItem: this, depth: parentMenu.depth + 1, container: this.container, keyMap: this.keyMap }); + if (!this.childMenu.isStatic()) { + Sys.WebForms.Menu._domHelper.appendCssClass(this.element, 'has-popup'); + Sys.WebForms.Menu._domHelper.appendAttributeValue(this.element, 'aria-haspopup', this.childMenu.element.id); + } + } + } + Sys.WebForms.Menu._elementObjectMapper.map(listElement, this); + Sys.WebForms.Menu._domHelper.appendAttributeValue(listElement, 'role', 'menuitem'); + Sys.WebForms.Menu._domHelper.appendCssClass(listElement, parentMenu.displayMode); + if (this._anchor) { + Sys.WebForms.Menu._domHelper.appendCssClass(this._anchor, parentMenu.displayMode); + } + this.element.style.position = "relative"; + if (this.parentMenu.depth == 1 && this.container.orientation == 'horizontal') { + Sys.WebForms.Menu._domHelper.setFloat(this.element, this.container.rightToLeft ? "right" : "left"); + } + if (!this.container.disabled) { + Sys.WebForms.Menu._domHelper.addEvent(this.element, 'mouseover', Sys.WebForms.MenuItem._onmouseover); + Sys.WebForms.Menu._domHelper.addEvent(this.element, 'mouseout', Sys.WebForms.MenuItem._onmouseout); + } +}; +Sys.WebForms.MenuItem.prototype = { + applyUp: function(fn, condition) { + condition = condition || function(menuItem) { return menuItem; }; + var menuItem = this; + var lastMenuItem = null; + while (condition(menuItem)) { + fn(menuItem); + lastMenuItem = menuItem; + menuItem = menuItem.parentMenu.parentMenuItem; + } + return lastMenuItem; + }, + blur: function() { this.setTabIndex(-1); }, + doDispose: function() { + Sys.WebForms.Menu._domHelper.removeEvent(this.element, 'mouseover', Sys.WebForms.MenuItem._onmouseover); + Sys.WebForms.Menu._domHelper.removeEvent(this.element, 'mouseout', Sys.WebForms.MenuItem._onmouseout); + if (this.childMenu) { + this.childMenu.doDispose(); + } + }, + focus: function() { + if (!this.parentMenu.get_displayed()) { + this.parentMenu.show(); + } + this.setTabIndex(0); + this.container.focused = true; + this._anchor.focus(); + }, + get_highlighted: function() { return /(^|\s)highlighted(\s|$)/.test(this._anchor.className); }, + getTabIndex: function() { return this._anchor.tabIndex; }, + highlight: function(highlighting) { + if (highlighting) { + this.applyUp(function(menuItem) { + menuItem.parentMenu.parentMenuItem.highlight(true); + }, + function(menuItem) { + return !menuItem.parentMenu.isStatic() && menuItem.parentMenu.parentMenuItem; + } + ); + Sys.WebForms.Menu._domHelper.appendCssClass(this._anchor, 'highlighted'); + } + else { + Sys.WebForms.Menu._domHelper.removeCssClass(this._anchor, 'highlighted'); + this.setTabIndex(-1); + } + }, + hover: function(hovering) { + if (hovering) { + var currentHoveredItem = this.container.hoveredMenuItem; + if (currentHoveredItem) { + currentHoveredItem.hover(false); + } + var currentFocusedItem = this.container.focusedMenuItem; + if (currentFocusedItem && currentFocusedItem !== this) { + currentFocusedItem.hover(false); + } + this.applyUp(function(menuItem) { + if (menuItem.childMenu && !menuItem.childMenu.get_displayed()) { + menuItem.childMenu.show(); + } + }); + this.container.hoveredMenuItem = this; + this.highlight(true); + } + else { + var menuItem = this; + while (menuItem) { + menuItem.highlight(false); + if (menuItem.childMenu) { + if (!menuItem.childMenu.isStatic()) { + menuItem.childMenu.hide(); + } + } + menuItem = menuItem.parentMenu.parentMenuItem; + } + } + }, + isSiblingOf: function(menuItem) { return menuItem.parentMenu === this.parentMenu; }, + mouseout: function() { + var menuItem = this, + id = this.container.pendingMouseoutId, + disappearAfter = this.container.disappearAfter; + if (id) { + window.clearTimeout(id); + } + if (disappearAfter > -1) { + this.container.pendingMouseoutId = + window.setTimeout(function() { menuItem.hover(false); }, disappearAfter); + } + }, + mouseover: function() { + var id = this.container.pendingMouseoutId; + if (id) { + window.clearTimeout(id); + this.container.pendingMouseoutId = null; + } + this.hover(true); + if (this.container.menu.get_focused()) { + this.container.navigateTo(this); + } + }, + navigate: function(keyCode) { + switch (this.keyMap[keyCode]) { + case this.keyMap.next: + this.navigateNext(); + break; + case this.keyMap.previous: + this.navigatePrevious(); + break; + case this.keyMap.child: + this.navigateChild(); + break; + case this.keyMap.parent: + this.navigateParent(); + break; + case this.keyMap.tab: + this.navigateOut(); + break; + } + }, + navigateChild: function() { + var subMenu = this.childMenu; + if (subMenu) { + var firstChild = subMenu.firstChild(); + if (firstChild) { + this.container.navigateTo(firstChild); + } + } + else { + if (this.container.orientation === 'horizontal') { + var nextItem = this.topLevelMenuItem.nextSibling || this.topLevelMenuItem.parentMenu.firstChild(); + if (nextItem == this.topLevelMenuItem) { + return; + } + this.topLevelMenuItem.childMenu.hide(); + this.container.navigateTo(nextItem); + if (nextItem.childMenu) { + this.container.navigateTo(nextItem.childMenu.firstChild()); + } + } + } + }, + navigateNext: function() { + if (this.childMenu) { + this.childMenu.hide(); + } + var nextMenuItem = this.nextSibling; + if (!nextMenuItem && this.parentMenu.isRoot()) { + nextMenuItem = this.parentMenu.parentMenuItem; + if (nextMenuItem) { + nextMenuItem = nextMenuItem.nextSibling; + } + } + if (!nextMenuItem) { + nextMenuItem = this.parentMenu.firstChild(); + } + if (nextMenuItem) { + this.container.navigateTo(nextMenuItem); + } + }, + navigateOut: function() { + this.parentMenu.blur(); + }, + navigateParent: function() { + var parentMenu = this.parentMenu, + horizontal = this.container.orientation === 'horizontal'; + if (!parentMenu) return; + if (horizontal && this.childMenu && parentMenu.isRoot()) { + this.navigateChild(); + return; + } + if (parentMenu.parentMenuItem && !parentMenu.isRoot()) { + if (horizontal && this.parentMenu.depth === 2) { + var previousItem = this.parentMenu.parentMenuItem.previousSibling; + if (!previousItem) { + previousItem = this.parentMenu.rootMenu.lastChild(); + } + this.topLevelMenuItem.childMenu.hide(); + this.container.navigateTo(previousItem); + if (previousItem.childMenu) { + this.container.navigateTo(previousItem.childMenu.firstChild()); + } + } + else { + this.parentMenu.hide(); + } + } + }, + navigatePrevious: function() { + if (this.childMenu) { + this.childMenu.hide(); + } + var previousMenuItem = this.previousSibling; + if (previousMenuItem) { + var childMenu = previousMenuItem.childMenu; + if (childMenu && childMenu.isRoot()) { + previousMenuItem = childMenu.lastChild(); + } + } + if (!previousMenuItem && this.parentMenu.isRoot()) { + previousMenuItem = this.parentMenu.parentMenuItem; + } + if (!previousMenuItem) { + previousMenuItem = this.parentMenu.lastChild(); + } + if (previousMenuItem) { + this.container.navigateTo(previousMenuItem); + } + }, + setTabIndex: function(index) { if (this._anchor) this._anchor.tabIndex = index; } +}; +Sys.WebForms.MenuItem._onmouseout = function(e) { + var menuItem = Sys.WebForms.Menu._elementObjectMapper.getMappedObject(this); + if (!menuItem) { + return; + } + menuItem.mouseout(); + Sys.WebForms.Menu._domHelper.cancelEvent(e); +}; +Sys.WebForms.MenuItem._onmouseover = function(e) { + var menuItem = Sys.WebForms.Menu._elementObjectMapper.getMappedObject(this); + if (!menuItem) { + return; + } + menuItem.mouseover(); + Sys.WebForms.Menu._domHelper.cancelEvent(e); +}; +Sys.WebForms.Menu._domHelper = { + addEvent: function(element, eventName, fn, useCapture) { + if (element.addEventListener) { + element.addEventListener(eventName, fn, !!useCapture); + } + else { + element['on' + eventName] = fn; + } + }, + appendAttributeValue: function(element, name, value) { + this.updateAttributeValue('append', element, name, value); + }, + appendCssClass: function(element, value) { + this.updateClassName('append', element, name, value); + }, + appendString: function(getString, setString, value) { + var currentValue = getString(); + if (!currentValue) { + setString(value); + return; + } + var regex = this._regexes.getRegex('(^| )' + value + '($| )'); + if (regex.test(currentValue)) { + return; + } + setString(currentValue + ' ' + value); + }, + cancelEvent: function(e) { + var event = e || window.event; + if (event) { + event.cancelBubble = true; + if (event.stopPropagation) { + event.stopPropagation(); + } + } + }, + contains: function(ancestor, descendant) { + for (; descendant && (descendant !== ancestor); descendant = descendant.parentNode) { } + return !!descendant; + }, + firstChild: function(element) { + var child = element.firstChild; + if (child && child.nodeType !== 1) { + child = this.nextSibling(child); + } + return child; + }, + getElement: function(elementOrId) { return typeof elementOrId === 'string' ? document.getElementById(elementOrId) : elementOrId; }, + getElementDirection: function(element) { + if (element) { + if (element.dir) { + return element.dir; + } + return this.getElementDirection(element.parentNode); + } + return "ltr"; + }, + getKeyCode: function(event) { return event.keyCode || event.charCode || 0; }, + insertAfter: function(element, elementToInsert) { + var next = element.nextSibling; + if (next) { + element.parentNode.insertBefore(elementToInsert, next); + } + else if (element.parentNode) { + element.parentNode.appendChild(elementToInsert); + } + }, + nextSibling: function(element) { + var sibling = element.nextSibling; + while (sibling) { + if (sibling.nodeType === 1) { + return sibling; + } + sibling = sibling.nextSibling; + } + }, + removeAttributeValue: function(element, name, value) { + this.updateAttributeValue('remove', element, name, value); + }, + removeCssClass: function(element, value) { + this.updateClassName('remove', element, name, value); + }, + removeEvent: function(element, eventName, fn, useCapture) { + if (element.removeEventListener) { + element.removeEventListener(eventName, fn, !!useCapture); + } + else if (element.detachEvent) { + element.detachEvent('on' + eventName, fn) + } + element['on' + eventName] = null; + }, + removeString: function(getString, setString, valueToRemove) { + var currentValue = getString(); + if (currentValue) { + var regex = this._regexes.getRegex('(\\s|\\b)' + valueToRemove + '$|\\b' + valueToRemove + '\\s+'); + setString(currentValue.replace(regex, '')); + } + }, + setFloat: function(element, direction) { + element.style.styleFloat = direction; + element.style.cssFloat = direction; + }, + updateAttributeValue: function(operation, element, name, value) { + this[operation + 'String']( + function() { + return element.getAttribute(name); + }, + function(newValue) { + element.setAttribute(name, newValue); + }, + value + ); + }, + updateClassName: function(operation, element, name, value) { + this[operation + 'String']( + function() { + return element.className; + }, + function(newValue) { + element.className = newValue; + }, + value + ); + }, + _regexes: { + getRegex: function(pattern) { + var regex = this[pattern]; + if (!regex) { + this[pattern] = regex = new RegExp(pattern); + } + return regex; + } + } +}; +Sys.WebForms.Menu._elementObjectMapper = { + _computedId: 0, + _mappings: {}, + _mappingIdName: 'Sys.WebForms.Menu.Mapping', + getMappedObject: function(element) { + var id = element[this._mappingIdName]; + if (id) { + return this._mappings[this._mappingIdName + ':' + id]; + } + }, + map: function(element, theObject) { + var mappedObject = element[this._mappingIdName]; + if (mappedObject === theObject) { + return; + } + var objectId = element[this._mappingIdName] || element.id || '%' + (++this._computedId); + element[this._mappingIdName] = objectId; + this._mappings[this._mappingIdName + ':' + objectId] = theObject; + theObject.mappingId = objectId; + } +}; +Sys.WebForms.Menu._keyboardMapping = new (function() { + var LEFT_ARROW = 37; + var UP_ARROW = 38; + var RIGHT_ARROW = 39; + var DOWN_ARROW = 40; + var TAB = 9; + var ESCAPE = 27; + this.vertical = { next: 0, previous: 1, child: 2, parent: 3, tab: 4 }; + this.vertical[DOWN_ARROW] = this.vertical.next; + this.vertical[UP_ARROW] = this.vertical.previous; + this.vertical[RIGHT_ARROW] = this.vertical.child; + this.vertical[LEFT_ARROW] = this.vertical.parent; + this.vertical[TAB] = this.vertical[ESCAPE] = this.vertical.tab; + this.verticalRtl = { next: 0, previous: 1, child: 2, parent: 3, tab: 4 }; + this.verticalRtl[DOWN_ARROW] = this.verticalRtl.next; + this.verticalRtl[UP_ARROW] = this.verticalRtl.previous; + this.verticalRtl[LEFT_ARROW] = this.verticalRtl.child; + this.verticalRtl[RIGHT_ARROW] = this.verticalRtl.parent; + this.verticalRtl[TAB] = this.verticalRtl[ESCAPE] = this.verticalRtl.tab; + this.horizontal = { next: 0, previous: 1, child: 2, parent: 3, tab: 4 }; + this.horizontal[RIGHT_ARROW] = this.horizontal.next; + this.horizontal[LEFT_ARROW] = this.horizontal.previous; + this.horizontal[DOWN_ARROW] = this.horizontal.child; + this.horizontal[UP_ARROW] = this.horizontal.parent; + this.horizontal[TAB] = this.horizontal[ESCAPE] = this.horizontal.tab; + this.horizontalRtl = { next: 0, previous: 1, child: 2, parent: 3, tab: 4 }; + this.horizontalRtl[RIGHT_ARROW] = this.horizontalRtl.previous; + this.horizontalRtl[LEFT_ARROW] = this.horizontalRtl.next; + this.horizontalRtl[DOWN_ARROW] = this.horizontalRtl.child; + this.horizontalRtl[UP_ARROW] = this.horizontalRtl.parent; + this.horizontalRtl[TAB] = this.horizontalRtl[ESCAPE] = this.horizontalRtl.tab; + this.horizontal.contains = this.horizontalRtl.contains = this.vertical.contains = this.verticalRtl.contains = function(keycode) { + return this[keycode] != null; + }; +})(); +Sys.WebForms._MenuContainer = function(options) { + this.focused = false; + this.disabled = options.disabled; + this.staticDisplayLevels = options.staticDisplayLevels || 1; + this.element = options.element; + this.orientation = options.orientation || 'vertical'; + this.disappearAfter = options.disappearAfter; + this.rightToLeft = Sys.WebForms.Menu._domHelper.getElementDirection(this.element) === 'rtl'; + Sys.WebForms.Menu._elementObjectMapper.map(this.element, this); + this.menu = options.menu; + this.menu.rootMenu = this.menu; + this.menu.displayMode = 'static'; + this.menu.element.style.position = 'relative'; + this.menu.element.style.width = 'auto'; + if (this.orientation === 'vertical') { + Sys.WebForms.Menu._domHelper.appendAttributeValue(this.menu.element, 'role', 'menu'); + if (this.rightToLeft) { + this.menu.keyMap = Sys.WebForms.Menu._keyboardMapping.verticalRtl; + } + else { + this.menu.keyMap = Sys.WebForms.Menu._keyboardMapping.vertical; + } + } + else { + Sys.WebForms.Menu._domHelper.appendAttributeValue(this.menu.element, 'role', 'menubar'); + if (this.rightToLeft) { + this.menu.keyMap = Sys.WebForms.Menu._keyboardMapping.horizontalRtl; + } + else { + this.menu.keyMap = Sys.WebForms.Menu._keyboardMapping.horizontal; + } + } + var floatBreak = document.createElement('div'); + floatBreak.style.clear = this.rightToLeft ? "right" : "left"; + this.element.appendChild(floatBreak); + Sys.WebForms.Menu._domHelper.setFloat(this.element, this.rightToLeft ? "right" : "left"); + Sys.WebForms.Menu._domHelper.insertAfter(this.element, floatBreak); + if (!this.disabled) { + Sys.WebForms.Menu._domHelper.addEvent(this.menu.element, 'focus', this._onfocus, true); + Sys.WebForms.Menu._domHelper.addEvent(this.menu.element, 'keydown', this._onkeydown); + var menuContainer = this; + this.element.dispose = function() { + if (menuContainer.element.dispose) { + menuContainer.element.dispose = null; + Sys.WebForms.Menu._domHelper.removeEvent(menuContainer.menu.element, 'focus', menuContainer._onfocus, true); + Sys.WebForms.Menu._domHelper.removeEvent(menuContainer.menu.element, 'keydown', menuContainer._onkeydown); + menuContainer.menu.doDispose(); + } + }; + Sys.WebForms.Menu._domHelper.addEvent(window, 'unload', function() { + if (menuContainer.element.dispose) { + menuContainer.element.dispose(); + } + }); + } +}; +Sys.WebForms._MenuContainer.prototype = { + blur: function() { + this.focused = false; + this.isBlurring = false; + this.menu.collapse(); + this.focusedMenuItem = null; + }, + focus: function(e) { this.focused = true; }, + navigateTo: function(menuItem) { + if (this.focusedMenuItem && this.focusedMenuItem !== this) { + this.focusedMenuItem.highlight(false); + } + menuItem.highlight(true); + menuItem.focus(); + this.focusedMenuItem = menuItem; + }, + _onfocus: function(e) { + var event = e || window.event; + if (event.srcElement && this) { + if (Sys.WebForms.Menu._domHelper.contains(this.element, event.srcElement)) { + if (!this.focused) { + this.focus(); + } + } + } + }, + _onkeydown: function(e) { + var thisMenu = Sys.WebForms.Menu._elementObjectMapper.getMappedObject(this); + var keyCode = Sys.WebForms.Menu._domHelper.getKeyCode(e || window.event); + if (thisMenu) { + thisMenu.handleKeyPress(keyCode); + } + } +}; diff --git a/samples/TestAzureAD/Scripts/WebForms/SmartNav.js b/samples/TestAzureAD/Scripts/WebForms/SmartNav.js new file mode 100644 index 0000000..e9e95d2 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/SmartNav.js @@ -0,0 +1,280 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/SmartNav.js +var snSrc; +if ((typeof(window.__smartNav) == "undefined") || (window.__smartNav == null)) +{ + window.__smartNav = new Object(); + window.__smartNav.update = function() + { + var sn = window.__smartNav; + var fd; + document.detachEvent("onstop", sn.stopHif); + sn.inPost = false; + try { fd = frames["__hifSmartNav"].document; } catch (e) {return;} + var fdr = fd.getElementsByTagName("asp_smartnav_rdir"); + if (fdr.length > 0) + { + if ((typeof(sn.sHif) == "undefined") || (sn.sHif == null)) + { + sn.sHif = document.createElement("IFRAME"); + sn.sHif.name = "__hifSmartNav"; + sn.sHif.style.display = "none"; + sn.sHif.src = snSrc; + } + try {window.location = fdr[0].url;} catch (e) {}; + return; + } + var fdurl = fd.location.href; + var index = fdurl.indexOf(snSrc); + if ((index != -1 && index == fdurl.length-snSrc.length) + || fdurl == "about:blank") + return; + var fdurlb = fdurl.split("?")[0]; + if (document.location.href.indexOf(fdurlb) < 0) + { + document.location.href=fdurl; + return; + } + sn._savedOnLoad = window.onload; + window.onload = null; + window.__smartNav.updateHelper(); + } + window.__smartNav.updateHelper = function() + { + if (document.readyState != "complete") + { + window.setTimeout(window.__smartNav.updateHelper, 25); + return; + } + window.__smartNav.loadNewContent(); + } + window.__smartNav.loadNewContent = function() + { + var sn = window.__smartNav; + var fd; + try { fd = frames["__hifSmartNav"].document; } catch (e) {return;} + if ((typeof(sn.sHif) != "undefined") && (sn.sHif != null)) + { + sn.sHif.removeNode(true); + sn.sHif = null; + } + var hdm = document.getElementsByTagName("head")[0]; + var hk = hdm.childNodes; + var tt = null; + var i; + for (i = hk.length - 1; i>= 0; i--) + { + if (hk[i].tagName == "TITLE") + { + tt = hk[i].outerHTML; + continue; + } + if (hk[i].tagName != "BASEFONT" || hk[i].innerHTML.length == 0) + hdm.removeChild(hdm.childNodes[i]); + } + var kids = fd.getElementsByTagName("head")[0].childNodes; + for (i = 0; i < kids.length; i++) + { + var tn = kids[i].tagName; + var k = document.createElement(tn); + k.id = kids[i].id; + k.mergeAttributes(kids[i]); + switch(tn) + { + case "TITLE": + if (tt == kids[i].outerHTML) + continue; + k.innerText = kids[i].text; + hdm.insertAdjacentElement("afterbegin", k); + continue; + case "BASEFONT" : + if (kids[i].innerHTML.length > 0) + continue; + break; + default: + var o = document.createElement("BODY"); + o.innerHTML = "<BODY>" + kids[i].outerHTML + "</BODY>"; + k = o.firstChild; + break; + } + if((typeof(k) != "undefined") && (k != null)) + hdm.appendChild(k); + } + document.body.clearAttributes(); + document.body.id = fd.body.id; + document.body.mergeAttributes(fd.body); + var newBodyLoad = fd.body.onload; + if ((typeof(newBodyLoad) != "undefined") && (newBodyLoad != null)) + document.body.onload = newBodyLoad; + else + document.body.onload = sn._savedOnLoad; + var s = "<BODY>" + fd.body.innerHTML + "</BODY>"; + if ((typeof(sn.hif) != "undefined") && (sn.hif != null)) + { + var hifP = sn.hif.parentElement; + if ((typeof(hifP) != "undefined") && (hifP != null)) + sn.sHif=hifP.removeChild(sn.hif); + } + document.body.innerHTML = s; + var sc = document.scripts; + for (i = 0; i < sc.length; i++) + { + sc[i].text = sc[i].text; + } + sn.hif = document.all("__hifSmartNav"); + if ((typeof(sn.hif) != "undefined") && (sn.hif != null)) + { + var hif = sn.hif; + sn.hifName = "__hifSmartNav" + (new Date()).getTime(); + frames["__hifSmartNav"].name = sn.hifName; + sn.hifDoc = hif.contentWindow.document; + if (sn.ie5) + hif.parentElement.removeChild(hif); + window.setTimeout(sn.restoreFocus,0); + } + if (typeof(window.onload) == "string") + { + try { eval(window.onload) } catch (e) {}; + } + else if ((typeof(window.onload) != "undefined") && (window.onload != null)) + { + try { window.onload() } catch (e) {}; + } + sn._savedOnLoad = null; + sn.attachForm(); + }; + window.__smartNav.restoreFocus = function() + { + if (window.__smartNav.inPost == true) return; + var curAe = document.activeElement; + var sAeId = window.__smartNav.ae; + if (((typeof(sAeId) == "undefined") || (sAeId == null)) || + (typeof(curAe) != "undefined") && (curAe != null) && (curAe.id == sAeId || curAe.name == sAeId)) + return; + var ae = document.all(sAeId); + if ((typeof(ae) == "undefined") || (ae == null)) return; + try { ae.focus(); } catch(e){}; + } + window.__smartNav.saveHistory = function() + { + if ((typeof(window.__smartNav.hif) != "undefined") && (window.__smartNav.hif != null)) + window.__smartNav.hif.removeNode(); + if ((typeof(window.__smartNav.sHif) != "undefined") && (window.__smartNav.sHif != null) + && (typeof(document.all[window.__smartNav.siHif]) != "undefined") + && (document.all[window.__smartNav.siHif] != null)) { + document.all[window.__smartNav.siHif].insertAdjacentElement( + "BeforeBegin", window.__smartNav.sHif); + } + } + window.__smartNav.stopHif = function() + { + document.detachEvent("onstop", window.__smartNav.stopHif); + var sn = window.__smartNav; + if (((typeof(sn.hifDoc) == "undefined") || (sn.hifDoc == null)) && + (typeof(sn.hif) != "undefined") && (sn.hif != null)) + { + try {sn.hifDoc = sn.hif.contentWindow.document;} + catch(e){sn.hifDoc=null} + } + if (sn.hifDoc != null) + { + try {sn.hifDoc.execCommand("stop");} catch (e){} + } + } + window.__smartNav.init = function() + { + var sn = window.__smartNav; + window.__smartNav.form.__smartNavPostBack.value = 'true'; + document.detachEvent("onstop", sn.stopHif); + document.attachEvent("onstop", sn.stopHif); + try { if (window.event.returnValue == false) return; } catch(e) {} + sn.inPost = true; + if ((typeof(document.activeElement) != "undefined") && (document.activeElement != null)) + { + var ae = document.activeElement.id; + if (ae.length == 0) + ae = document.activeElement.name; + sn.ae = ae; + } + else + sn.ae = null; + try {document.selection.empty();} catch (e) {} + if ((typeof(sn.hif) == "undefined") || (sn.hif == null)) + { + sn.hif = document.all("__hifSmartNav"); + sn.hifDoc = sn.hif.contentWindow.document; + } + if ((typeof(sn.hifDoc) != "undefined") && (sn.hifDoc != null)) + try {sn.hifDoc.designMode = "On";} catch(e){}; + if ((typeof(sn.hif.parentElement) == "undefined") || (sn.hif.parentElement == null)) + document.body.appendChild(sn.hif); + var hif = sn.hif; + hif.detachEvent("onload", sn.update); + hif.attachEvent("onload", sn.update); + window.__smartNav.fInit = true; + }; + window.__smartNav.submit = function() + { + window.__smartNav.fInit = false; + try { window.__smartNav.init(); } catch(e) {} + if (window.__smartNav.fInit) { + window.__smartNav.form._submit(); + } + }; + window.__smartNav.attachForm = function() + { + var cf = document.forms; + for (var i=0; i<cf.length; i++) + { + if ((typeof(cf[i].__smartNavEnabled) != "undefined") && (cf[i].__smartNavEnabled != null)) + { + window.__smartNav.form = cf[i]; + window.__smartNav.form.insertAdjacentHTML("beforeEnd", "<input type='hidden' name='__smartNavPostBack' value='false' />"); + break; + } + } + var snfm = window.__smartNav.form; + if ((typeof(snfm) == "undefined") || (snfm == null)) return false; + var sft = snfm.target; + if (sft.length != 0 && sft.indexOf("__hifSmartNav") != 0) return false; + var sfc = snfm.action.split("?")[0]; + var url = window.location.href.split("?")[0]; + if (url.charAt(url.length-1) != '/' && url.lastIndexOf(sfc) + sfc.length != url.length) return false; + if (snfm.__formAttached == true) return true; + snfm.__formAttached = true; + snfm.attachEvent("onsubmit", window.__smartNav.init); + snfm._submit = snfm.submit; + snfm.submit = window.__smartNav.submit; + snfm.target = window.__smartNav.hifName; + return true; + }; + window.__smartNav.hifName = "__hifSmartNav" + (new Date()).getTime(); + window.__smartNav.ie5 = navigator.appVersion.indexOf("MSIE 5") > 0; + var rc = window.__smartNav.attachForm(); + var hif = document.all("__hifSmartNav"); + if ((typeof(snSrc) == "undefined") || (snSrc == null)) { + if (typeof(window.dialogHeight) != "undefined") { + snSrc = "IEsmartnav1"; + hif.src = snSrc; + } else { + snSrc = hif.src; + } + } + if (rc) + { + var fsn = frames["__hifSmartNav"]; + fsn.name = window.__smartNav.hifName; + window.__smartNav.siHif = hif.sourceIndex; + try { + if (fsn.document.location != snSrc) + { + fsn.document.designMode = "On"; + hif.attachEvent("onload",window.__smartNav.update); + window.__smartNav.hif = hif; + } + } + catch (e) { window.__smartNav.hif = hif; } + window.attachEvent("onbeforeunload", window.__smartNav.saveHistory); + } + else + window.__smartNav = null; +} diff --git a/samples/TestAzureAD/Scripts/WebForms/TreeView.js b/samples/TestAzureAD/Scripts/WebForms/TreeView.js new file mode 100644 index 0000000..e49f260 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/TreeView.js @@ -0,0 +1,220 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/TreeView.js +function TreeView_HoverNode(data, node) { + if (!data) { + return; + } + node.hoverClass = data.hoverClass; + WebForm_AppendToClassName(node, data.hoverClass); + if (__nonMSDOMBrowser) { + node = node.childNodes[node.childNodes.length - 1]; + } + else { + node = node.children[node.children.length - 1]; + } + node.hoverHyperLinkClass = data.hoverHyperLinkClass; + WebForm_AppendToClassName(node, data.hoverHyperLinkClass); +} +function TreeView_GetNodeText(node) { + var trNode = WebForm_GetParentByTagName(node, "TR"); + var outerNodes; + if (trNode.childNodes[trNode.childNodes.length - 1].getElementsByTagName) { + outerNodes = trNode.childNodes[trNode.childNodes.length - 1].getElementsByTagName("A"); + if (!outerNodes || outerNodes.length == 0) { + outerNodes = trNode.childNodes[trNode.childNodes.length - 1].getElementsByTagName("SPAN"); + } + } + var textNode = (outerNodes && outerNodes.length > 0) ? + outerNodes[0].childNodes[0] : + trNode.childNodes[trNode.childNodes.length - 1].childNodes[0]; + return (textNode && textNode.nodeValue) ? textNode.nodeValue : ""; +} +function TreeView_PopulateNode(data, index, node, selectNode, selectImageNode, lineType, text, path, databound, datapath, parentIsLast) { + if (!data) { + return; + } + var context = new Object(); + context.data = data; + context.node = node; + context.selectNode = selectNode; + context.selectImageNode = selectImageNode; + context.lineType = lineType; + context.index = index; + context.isChecked = "f"; + var tr = WebForm_GetParentByTagName(node, "TR"); + if (tr) { + var checkbox = tr.getElementsByTagName("INPUT"); + if (checkbox && (checkbox.length > 0)) { + for (var i = 0; i < checkbox.length; i++) { + if (checkbox[i].type.toLowerCase() == "checkbox") { + if (checkbox[i].checked) { + context.isChecked = "t"; + } + break; + } + } + } + } + var param = index + "|" + data.lastIndex + "|" + databound + context.isChecked + parentIsLast + "|" + + text.length + "|" + text + datapath.length + "|" + datapath + path; + TreeView_PopulateNodeDoCallBack(context, param); +} +function TreeView_ProcessNodeData(result, context) { + var treeNode = context.node; + if (result.length > 0) { + var ci = result.indexOf("|", 0); + context.data.lastIndex = result.substring(0, ci); + ci = result.indexOf("|", ci + 1); + var newExpandState = result.substring(context.data.lastIndex.length + 1, ci); + context.data.expandState.value += newExpandState; + var chunk = result.substr(ci + 1); + var newChildren, table; + if (__nonMSDOMBrowser) { + var newDiv = document.createElement("div"); + newDiv.innerHTML = chunk; + table = WebForm_GetParentByTagName(treeNode, "TABLE"); + newChildren = null; + if ((typeof(table.nextSibling) == "undefined") || (table.nextSibling == null)) { + table.parentNode.insertBefore(newDiv.firstChild, table.nextSibling); + newChildren = table.previousSibling; + } + else { + table = table.nextSibling; + table.parentNode.insertBefore(newDiv.firstChild, table); + newChildren = table.previousSibling; + } + newChildren = document.getElementById(treeNode.id + "Nodes"); + } + else { + table = WebForm_GetParentByTagName(treeNode, "TABLE"); + table.insertAdjacentHTML("afterEnd", chunk); + newChildren = document.all[treeNode.id + "Nodes"]; + } + if ((typeof(newChildren) != "undefined") && (newChildren != null)) { + TreeView_ToggleNode(context.data, context.index, treeNode, context.lineType, newChildren); + treeNode.href = document.getElementById ? + "javascript:TreeView_ToggleNode(" + context.data.name + "," + context.index + ",document.getElementById('" + treeNode.id + "'),'" + context.lineType + "',document.getElementById('" + newChildren.id + "'))" : + "javascript:TreeView_ToggleNode(" + context.data.name + "," + context.index + "," + treeNode.id + ",'" + context.lineType + "'," + newChildren.id + ")"; + if ((typeof(context.selectNode) != "undefined") && (context.selectNode != null) && context.selectNode.href && + (context.selectNode.href.indexOf("javascript:TreeView_PopulateNode", 0) == 0)) { + context.selectNode.href = treeNode.href; + } + if ((typeof(context.selectImageNode) != "undefined") && (context.selectImageNode != null) && context.selectNode.href && + (context.selectImageNode.href.indexOf("javascript:TreeView_PopulateNode", 0) == 0)) { + context.selectImageNode.href = treeNode.href; + } + } + context.data.populateLog.value += context.index + ","; + } + else { + var img = treeNode.childNodes ? treeNode.childNodes[0] : treeNode.children[0]; + if ((typeof(img) != "undefined") && (img != null)) { + var lineType = context.lineType; + if (lineType == "l") { + img.src = context.data.images[13]; + } + else if (lineType == "t") { + img.src = context.data.images[10]; + } + else if (lineType == "-") { + img.src = context.data.images[16]; + } + else { + img.src = context.data.images[3]; + } + var pe; + if (__nonMSDOMBrowser) { + pe = treeNode.parentNode; + pe.insertBefore(img, treeNode); + pe.removeChild(treeNode); + } + else { + pe = treeNode.parentElement; + treeNode.style.visibility="hidden"; + treeNode.style.display="none"; + pe.insertAdjacentElement("afterBegin", img); + } + } + } +} +function TreeView_SelectNode(data, node, nodeId) { + if (!data) { + return; + } + if ((typeof(data.selectedClass) != "undefined") && (data.selectedClass != null)) { + var id = data.selectedNodeID.value; + if (id.length > 0) { + var selectedNode = document.getElementById(id); + if ((typeof(selectedNode) != "undefined") && (selectedNode != null)) { + WebForm_RemoveClassName(selectedNode, data.selectedHyperLinkClass); + selectedNode = WebForm_GetParentByTagName(selectedNode, "TD"); + WebForm_RemoveClassName(selectedNode, data.selectedClass); + } + } + WebForm_AppendToClassName(node, data.selectedHyperLinkClass); + node = WebForm_GetParentByTagName(node, "TD"); + WebForm_AppendToClassName(node, data.selectedClass) + } + data.selectedNodeID.value = nodeId; +} +function TreeView_ToggleNode(data, index, node, lineType, children) { + if (!data) { + return; + } + var img = node.childNodes[0]; + var newExpandState; + try { + if (children.style.display == "none") { + children.style.display = "block"; + newExpandState = "e"; + if ((typeof(img) != "undefined") && (img != null)) { + if (lineType == "l") { + img.src = data.images[15]; + } + else if (lineType == "t") { + img.src = data.images[12]; + } + else if (lineType == "-") { + img.src = data.images[18]; + } + else { + img.src = data.images[5]; + } + img.alt = data.collapseToolTip.replace(/\{0\}/, TreeView_GetNodeText(node)); + } + } + else { + children.style.display = "none"; + newExpandState = "c"; + if ((typeof(img) != "undefined") && (img != null)) { + if (lineType == "l") { + img.src = data.images[14]; + } + else if (lineType == "t") { + img.src = data.images[11]; + } + else if (lineType == "-") { + img.src = data.images[17]; + } + else { + img.src = data.images[4]; + } + img.alt = data.expandToolTip.replace(/\{0\}/, TreeView_GetNodeText(node)); + } + } + } + catch(e) {} + data.expandState.value = data.expandState.value.substring(0, index) + newExpandState + data.expandState.value.slice(index + 1); +} +function TreeView_UnhoverNode(node) { + if (!node.hoverClass) { + return; + } + WebForm_RemoveClassName(node, node.hoverClass); + if (__nonMSDOMBrowser) { + node = node.childNodes[node.childNodes.length - 1]; + } + else { + node = node.children[node.children.length - 1]; + } + WebForm_RemoveClassName(node, node.hoverHyperLinkClass); +} diff --git a/samples/TestAzureAD/Scripts/WebForms/WebForms.js b/samples/TestAzureAD/Scripts/WebForms/WebForms.js new file mode 100644 index 0000000..6992848 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/WebForms.js @@ -0,0 +1,567 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/WebForms.js +function WebForm_PostBackOptions(eventTarget, eventArgument, validation, validationGroup, actionUrl, trackFocus, clientSubmit) { + this.eventTarget = eventTarget; + this.eventArgument = eventArgument; + this.validation = validation; + this.validationGroup = validationGroup; + this.actionUrl = actionUrl; + this.trackFocus = trackFocus; + this.clientSubmit = clientSubmit; +} +function WebForm_DoPostBackWithOptions(options) { + var validationResult = true; + if (options.validation) { + if (typeof(Page_ClientValidate) == 'function') { + validationResult = Page_ClientValidate(options.validationGroup); + } + } + if (validationResult) { + if ((typeof(options.actionUrl) != "undefined") && (options.actionUrl != null) && (options.actionUrl.length > 0)) { + theForm.action = options.actionUrl; + } + if (options.trackFocus) { + var lastFocus = theForm.elements["__LASTFOCUS"]; + if ((typeof(lastFocus) != "undefined") && (lastFocus != null)) { + if (typeof(document.activeElement) == "undefined") { + lastFocus.value = options.eventTarget; + } + else { + var active = document.activeElement; + if ((typeof(active) != "undefined") && (active != null)) { + if ((typeof(active.id) != "undefined") && (active.id != null) && (active.id.length > 0)) { + lastFocus.value = active.id; + } + else if (typeof(active.name) != "undefined") { + lastFocus.value = active.name; + } + } + } + } + } + } + if (options.clientSubmit) { + __doPostBack(options.eventTarget, options.eventArgument); + } +} +var __pendingCallbacks = new Array(); +var __synchronousCallBackIndex = -1; +function WebForm_DoCallback(eventTarget, eventArgument, eventCallback, context, errorCallback, useAsync) { + var postData = __theFormPostData + + "__CALLBACKID=" + WebForm_EncodeCallback(eventTarget) + + "&__CALLBACKPARAM=" + WebForm_EncodeCallback(eventArgument); + if (theForm["__EVENTVALIDATION"]) { + postData += "&__EVENTVALIDATION=" + WebForm_EncodeCallback(theForm["__EVENTVALIDATION"].value); + } + var xmlRequest,e; + try { + xmlRequest = new XMLHttpRequest(); + } + catch(e) { + try { + xmlRequest = new ActiveXObject("Microsoft.XMLHTTP"); + } + catch(e) { + } + } + var setRequestHeaderMethodExists = true; + try { + setRequestHeaderMethodExists = (xmlRequest && xmlRequest.setRequestHeader); + } + catch(e) {} + var callback = new Object(); + callback.eventCallback = eventCallback; + callback.context = context; + callback.errorCallback = errorCallback; + callback.async = useAsync; + var callbackIndex = WebForm_FillFirstAvailableSlot(__pendingCallbacks, callback); + if (!useAsync) { + if (__synchronousCallBackIndex != -1) { + __pendingCallbacks[__synchronousCallBackIndex] = null; + } + __synchronousCallBackIndex = callbackIndex; + } + if (setRequestHeaderMethodExists) { + xmlRequest.onreadystatechange = WebForm_CallbackComplete; + callback.xmlRequest = xmlRequest; + // e.g. http: + var action = theForm.action || document.location.pathname, fragmentIndex = action.indexOf('#'); + if (fragmentIndex !== -1) { + action = action.substr(0, fragmentIndex); + } + if (!__nonMSDOMBrowser) { + var queryIndex = action.indexOf('?'); + if (queryIndex !== -1) { + var path = action.substr(0, queryIndex); + if (path.indexOf("%") === -1) { + action = encodeURI(path) + action.substr(queryIndex); + } + } + else if (action.indexOf("%") === -1) { + action = encodeURI(action); + } + } + xmlRequest.open("POST", action, true); + xmlRequest.setRequestHeader("Content-Type", "application/x-www-form-urlencoded; charset=utf-8"); + xmlRequest.send(postData); + return; + } + callback.xmlRequest = new Object(); + var callbackFrameID = "__CALLBACKFRAME" + callbackIndex; + var xmlRequestFrame = document.frames[callbackFrameID]; + if (!xmlRequestFrame) { + xmlRequestFrame = document.createElement("IFRAME"); + xmlRequestFrame.width = "1"; + xmlRequestFrame.height = "1"; + xmlRequestFrame.frameBorder = "0"; + xmlRequestFrame.id = callbackFrameID; + xmlRequestFrame.name = callbackFrameID; + xmlRequestFrame.style.position = "absolute"; + xmlRequestFrame.style.top = "-100px" + xmlRequestFrame.style.left = "-100px"; + try { + if (callBackFrameUrl) { + xmlRequestFrame.src = callBackFrameUrl; + } + } + catch(e) {} + document.body.appendChild(xmlRequestFrame); + } + var interval = window.setInterval(function() { + xmlRequestFrame = document.frames[callbackFrameID]; + if (xmlRequestFrame && xmlRequestFrame.document) { + window.clearInterval(interval); + xmlRequestFrame.document.write(""); + xmlRequestFrame.document.close(); + xmlRequestFrame.document.write('<html><body><form method="post"><input type="hidden" name="__CALLBACKLOADSCRIPT" value="t"></form></body></html>'); + xmlRequestFrame.document.close(); + xmlRequestFrame.document.forms[0].action = theForm.action; + var count = __theFormPostCollection.length; + var element; + for (var i = 0; i < count; i++) { + element = __theFormPostCollection[i]; + if (element) { + var fieldElement = xmlRequestFrame.document.createElement("INPUT"); + fieldElement.type = "hidden"; + fieldElement.name = element.name; + fieldElement.value = element.value; + xmlRequestFrame.document.forms[0].appendChild(fieldElement); + } + } + var callbackIdFieldElement = xmlRequestFrame.document.createElement("INPUT"); + callbackIdFieldElement.type = "hidden"; + callbackIdFieldElement.name = "__CALLBACKID"; + callbackIdFieldElement.value = eventTarget; + xmlRequestFrame.document.forms[0].appendChild(callbackIdFieldElement); + var callbackParamFieldElement = xmlRequestFrame.document.createElement("INPUT"); + callbackParamFieldElement.type = "hidden"; + callbackParamFieldElement.name = "__CALLBACKPARAM"; + callbackParamFieldElement.value = eventArgument; + xmlRequestFrame.document.forms[0].appendChild(callbackParamFieldElement); + if (theForm["__EVENTVALIDATION"]) { + var callbackValidationFieldElement = xmlRequestFrame.document.createElement("INPUT"); + callbackValidationFieldElement.type = "hidden"; + callbackValidationFieldElement.name = "__EVENTVALIDATION"; + callbackValidationFieldElement.value = theForm["__EVENTVALIDATION"].value; + xmlRequestFrame.document.forms[0].appendChild(callbackValidationFieldElement); + } + var callbackIndexFieldElement = xmlRequestFrame.document.createElement("INPUT"); + callbackIndexFieldElement.type = "hidden"; + callbackIndexFieldElement.name = "__CALLBACKINDEX"; + callbackIndexFieldElement.value = callbackIndex; + xmlRequestFrame.document.forms[0].appendChild(callbackIndexFieldElement); + xmlRequestFrame.document.forms[0].submit(); + } + }, 10); +} +function WebForm_CallbackComplete() { + for (var i = 0; i < __pendingCallbacks.length; i++) { + callbackObject = __pendingCallbacks[i]; + if (callbackObject && callbackObject.xmlRequest && (callbackObject.xmlRequest.readyState == 4)) { + if (!__pendingCallbacks[i].async) { + __synchronousCallBackIndex = -1; + } + __pendingCallbacks[i] = null; + var callbackFrameID = "__CALLBACKFRAME" + i; + var xmlRequestFrame = document.getElementById(callbackFrameID); + if (xmlRequestFrame) { + xmlRequestFrame.parentNode.removeChild(xmlRequestFrame); + } + WebForm_ExecuteCallback(callbackObject); + } + } +} +function WebForm_ExecuteCallback(callbackObject) { + var response = callbackObject.xmlRequest.responseText; + if (response.charAt(0) == "s") { + if ((typeof(callbackObject.eventCallback) != "undefined") && (callbackObject.eventCallback != null)) { + callbackObject.eventCallback(response.substring(1), callbackObject.context); + } + } + else if (response.charAt(0) == "e") { + if ((typeof(callbackObject.errorCallback) != "undefined") && (callbackObject.errorCallback != null)) { + callbackObject.errorCallback(response.substring(1), callbackObject.context); + } + } + else { + var separatorIndex = response.indexOf("|"); + if (separatorIndex != -1) { + var validationFieldLength = parseInt(response.substring(0, separatorIndex)); + if (!isNaN(validationFieldLength)) { + var validationField = response.substring(separatorIndex + 1, separatorIndex + validationFieldLength + 1); + if (validationField != "") { + var validationFieldElement = theForm["__EVENTVALIDATION"]; + if (!validationFieldElement) { + validationFieldElement = document.createElement("INPUT"); + validationFieldElement.type = "hidden"; + validationFieldElement.name = "__EVENTVALIDATION"; + theForm.appendChild(validationFieldElement); + } + validationFieldElement.value = validationField; + } + if ((typeof(callbackObject.eventCallback) != "undefined") && (callbackObject.eventCallback != null)) { + callbackObject.eventCallback(response.substring(separatorIndex + validationFieldLength + 1), callbackObject.context); + } + } + } + } +} +function WebForm_FillFirstAvailableSlot(array, element) { + var i; + for (i = 0; i < array.length; i++) { + if (!array[i]) break; + } + array[i] = element; + return i; +} +var __nonMSDOMBrowser = (window.navigator.appName.toLowerCase().indexOf('explorer') == -1); +var __theFormPostData = ""; +var __theFormPostCollection = new Array(); +var __callbackTextTypes = /^(text|password|hidden|search|tel|url|email|number|range|color|datetime|date|month|week|time|datetime-local)$/i; +function WebForm_InitCallback() { + var formElements = theForm.elements, + count = formElements.length, + element; + for (var i = 0; i < count; i++) { + element = formElements[i]; + var tagName = element.tagName.toLowerCase(); + if (tagName == "input") { + var type = element.type; + if ((__callbackTextTypes.test(type) || ((type == "checkbox" || type == "radio") && element.checked)) + && (element.id != "__EVENTVALIDATION")) { + WebForm_InitCallbackAddField(element.name, element.value); + } + } + else if (tagName == "select") { + var selectCount = element.options.length; + for (var j = 0; j < selectCount; j++) { + var selectChild = element.options[j]; + if (selectChild.selected == true) { + WebForm_InitCallbackAddField(element.name, element.value); + } + } + } + else if (tagName == "textarea") { + WebForm_InitCallbackAddField(element.name, element.value); + } + } +} +function WebForm_InitCallbackAddField(name, value) { + var nameValue = new Object(); + nameValue.name = name; + nameValue.value = value; + __theFormPostCollection[__theFormPostCollection.length] = nameValue; + __theFormPostData += WebForm_EncodeCallback(name) + "=" + WebForm_EncodeCallback(value) + "&"; +} +function WebForm_EncodeCallback(parameter) { + if (encodeURIComponent) { + return encodeURIComponent(parameter); + } + else { + return escape(parameter); + } +} +var __disabledControlArray = new Array(); +function WebForm_ReEnableControls() { + if (typeof(__enabledControlArray) == 'undefined') { + return false; + } + var disabledIndex = 0; + for (var i = 0; i < __enabledControlArray.length; i++) { + var c; + if (__nonMSDOMBrowser) { + c = document.getElementById(__enabledControlArray[i]); + } + else { + c = document.all[__enabledControlArray[i]]; + } + if ((typeof(c) != "undefined") && (c != null) && (c.disabled == true)) { + c.disabled = false; + __disabledControlArray[disabledIndex++] = c; + } + } + setTimeout("WebForm_ReDisableControls()", 0); + return true; +} +function WebForm_ReDisableControls() { + for (var i = 0; i < __disabledControlArray.length; i++) { + __disabledControlArray[i].disabled = true; + } +} +function WebForm_SimulateClick(element, event) { + var clickEvent; + if (element) { + if (element.click) { + element.click(); + } else { + clickEvent = document.createEvent("MouseEvents"); + clickEvent.initMouseEvent("click", true, true, window, 0, 0, 0, 0, 0, false, false, false, false, 0, null); + if (!element.dispatchEvent(clickEvent)) { + return true; + } + } + event.cancelBubble = true; + if (event.stopPropagation) { + event.stopPropagation(); + } + return false; + } + return true; +} +function WebForm_FireDefaultButton(event, target) { + if (event.keyCode == 13) { + var src = event.srcElement || event.target; + if (src && + ((src.tagName.toLowerCase() == "input") && + (src.type.toLowerCase() == "submit" || src.type.toLowerCase() == "button")) || + ((src.tagName.toLowerCase() == "a") && + (src.href != null) && (src.href != "")) || + (src.tagName.toLowerCase() == "textarea")) { + return true; + } + var defaultButton; + if (__nonMSDOMBrowser) { + defaultButton = document.getElementById(target); + } + else { + defaultButton = document.all[target]; + } + if (defaultButton) { + return WebForm_SimulateClick(defaultButton, event); + } + } + return true; +} +function WebForm_GetScrollX() { + if (__nonMSDOMBrowser) { + return window.pageXOffset; + } + else { + if (document.documentElement && document.documentElement.scrollLeft) { + return document.documentElement.scrollLeft; + } + else if (document.body) { + return document.body.scrollLeft; + } + } + return 0; +} +function WebForm_GetScrollY() { + if (__nonMSDOMBrowser) { + return window.pageYOffset; + } + else { + if (document.documentElement && document.documentElement.scrollTop) { + return document.documentElement.scrollTop; + } + else if (document.body) { + return document.body.scrollTop; + } + } + return 0; +} +function WebForm_SaveScrollPositionSubmit() { + if (__nonMSDOMBrowser) { + theForm.elements['__SCROLLPOSITIONY'].value = window.pageYOffset; + theForm.elements['__SCROLLPOSITIONX'].value = window.pageXOffset; + } + else { + theForm.__SCROLLPOSITIONX.value = WebForm_GetScrollX(); + theForm.__SCROLLPOSITIONY.value = WebForm_GetScrollY(); + } + if ((typeof(this.oldSubmit) != "undefined") && (this.oldSubmit != null)) { + return this.oldSubmit(); + } + return true; +} +function WebForm_SaveScrollPositionOnSubmit() { + theForm.__SCROLLPOSITIONX.value = WebForm_GetScrollX(); + theForm.__SCROLLPOSITIONY.value = WebForm_GetScrollY(); + if ((typeof(this.oldOnSubmit) != "undefined") && (this.oldOnSubmit != null)) { + return this.oldOnSubmit(); + } + return true; +} +function WebForm_RestoreScrollPosition() { + if (__nonMSDOMBrowser) { + window.scrollTo(theForm.elements['__SCROLLPOSITIONX'].value, theForm.elements['__SCROLLPOSITIONY'].value); + } + else { + window.scrollTo(theForm.__SCROLLPOSITIONX.value, theForm.__SCROLLPOSITIONY.value); + } + if ((typeof(theForm.oldOnLoad) != "undefined") && (theForm.oldOnLoad != null)) { + return theForm.oldOnLoad(); + } + return true; +} +function WebForm_TextBoxKeyHandler(event) { + if (event.keyCode == 13) { + var target; + if (__nonMSDOMBrowser) { + target = event.target; + } + else { + target = event.srcElement; + } + if ((typeof(target) != "undefined") && (target != null)) { + if (typeof(target.onchange) != "undefined") { + target.onchange(); + event.cancelBubble = true; + if (event.stopPropagation) event.stopPropagation(); + return false; + } + } + } + return true; +} +function WebForm_TrimString(value) { + return value.replace(/^\s+|\s+$/g, '') +} +function WebForm_AppendToClassName(element, className) { + var currentClassName = ' ' + WebForm_TrimString(element.className) + ' '; + className = WebForm_TrimString(className); + var index = currentClassName.indexOf(' ' + className + ' '); + if (index === -1) { + element.className = (element.className === '') ? className : element.className + ' ' + className; + } +} +function WebForm_RemoveClassName(element, className) { + var currentClassName = ' ' + WebForm_TrimString(element.className) + ' '; + className = WebForm_TrimString(className); + var index = currentClassName.indexOf(' ' + className + ' '); + if (index >= 0) { + element.className = WebForm_TrimString(currentClassName.substring(0, index) + ' ' + + currentClassName.substring(index + className.length + 1, currentClassName.length)); + } +} +function WebForm_GetElementById(elementId) { + if (document.getElementById) { + return document.getElementById(elementId); + } + else if (document.all) { + return document.all[elementId]; + } + else return null; +} +function WebForm_GetElementByTagName(element, tagName) { + var elements = WebForm_GetElementsByTagName(element, tagName); + if (elements && elements.length > 0) { + return elements[0]; + } + else return null; +} +function WebForm_GetElementsByTagName(element, tagName) { + if (element && tagName) { + if (element.getElementsByTagName) { + return element.getElementsByTagName(tagName); + } + if (element.all && element.all.tags) { + return element.all.tags(tagName); + } + } + return null; +} +function WebForm_GetElementDir(element) { + if (element) { + if (element.dir) { + return element.dir; + } + return WebForm_GetElementDir(element.parentNode); + } + return "ltr"; +} +function WebForm_GetElementPosition(element) { + var result = new Object(); + result.x = 0; + result.y = 0; + result.width = 0; + result.height = 0; + if (element.offsetParent) { + result.x = element.offsetLeft; + result.y = element.offsetTop; + var parent = element.offsetParent; + while (parent) { + result.x += parent.offsetLeft; + result.y += parent.offsetTop; + var parentTagName = parent.tagName.toLowerCase(); + if (parentTagName != "table" && + parentTagName != "body" && + parentTagName != "html" && + parentTagName != "div" && + parent.clientTop && + parent.clientLeft) { + result.x += parent.clientLeft; + result.y += parent.clientTop; + } + parent = parent.offsetParent; + } + } + else if (element.left && element.top) { + result.x = element.left; + result.y = element.top; + } + else { + if (element.x) { + result.x = element.x; + } + if (element.y) { + result.y = element.y; + } + } + if (element.offsetWidth && element.offsetHeight) { + result.width = element.offsetWidth; + result.height = element.offsetHeight; + } + else if (element.style && element.style.pixelWidth && element.style.pixelHeight) { + result.width = element.style.pixelWidth; + result.height = element.style.pixelHeight; + } + return result; +} +function WebForm_GetParentByTagName(element, tagName) { + var parent = element.parentNode; + var upperTagName = tagName.toUpperCase(); + while (parent && (parent.tagName.toUpperCase() != upperTagName)) { + parent = parent.parentNode ? parent.parentNode : parent.parentElement; + } + return parent; +} +function WebForm_SetElementHeight(element, height) { + if (element && element.style) { + element.style.height = height + "px"; + } +} +function WebForm_SetElementWidth(element, width) { + if (element && element.style) { + element.style.width = width + "px"; + } +} +function WebForm_SetElementX(element, x) { + if (element && element.style) { + element.style.left = x + "px"; + } +} +function WebForm_SetElementY(element, y) { + if (element && element.style) { + element.style.top = y + "px"; + } +}
\ No newline at end of file diff --git a/samples/TestAzureAD/Scripts/WebForms/WebParts.js b/samples/TestAzureAD/Scripts/WebForms/WebParts.js new file mode 100644 index 0000000..7a8d0ab --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/WebParts.js @@ -0,0 +1,647 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/WebParts.js +var __wpm = null; +function Point(x, y) { + this.x = x; + this.y = y; +} +function __wpTranslateOffset(x, y, offsetElement, relativeToElement, includeScroll) { + while ((typeof(offsetElement) != "undefined") && (offsetElement != null) && (offsetElement != relativeToElement)) { + x += offsetElement.offsetLeft; + y += offsetElement.offsetTop; + var tagName = offsetElement.tagName; + if ((tagName != "TABLE") && (tagName != "BODY")) { + x += offsetElement.clientLeft; + y += offsetElement.clientTop; + } + if (includeScroll && (tagName != "BODY")) { + x -= offsetElement.scrollLeft; + y -= offsetElement.scrollTop; + } + offsetElement = offsetElement.offsetParent; + } + return new Point(x, y); +} +function __wpGetPageEventLocation(event, includeScroll) { + if ((typeof(event) == "undefined") || (event == null)) { + event = window.event; + } + return __wpTranslateOffset(event.offsetX, event.offsetY, event.srcElement, null, includeScroll); +} +function __wpClearSelection() { + document.selection.empty(); +} +function WebPart(webPartElement, webPartTitleElement, zone, zoneIndex, allowZoneChange) { + this.webPartElement = webPartElement; + this.allowZoneChange = allowZoneChange; + this.zone = zone; + this.zoneIndex = zoneIndex; + this.title = ((typeof(webPartTitleElement) != "undefined") && (webPartTitleElement != null)) ? + webPartTitleElement.innerText : ""; + webPartElement.__webPart = this; + if ((typeof(webPartTitleElement) != "undefined") && (webPartTitleElement != null)) { + webPartTitleElement.style.cursor = "move"; + webPartTitleElement.attachEvent("onmousedown", WebPart_OnMouseDown); + webPartElement.attachEvent("ondragstart", WebPart_OnDragStart); + webPartElement.attachEvent("ondrag", WebPart_OnDrag); + webPartElement.attachEvent("ondragend", WebPart_OnDragEnd); + } + this.UpdatePosition = WebPart_UpdatePosition; + this.Dispose = WebPart_Dispose; +} +function WebPart_Dispose() { + this.webPartElement.__webPart = null +} +function WebPart_OnMouseDown() { + var currentEvent = window.event; + var draggedWebPart = WebPart_GetParentWebPartElement(currentEvent.srcElement); + if ((typeof(draggedWebPart) == "undefined") || (draggedWebPart == null)) { + return; + } + document.selection.empty(); + try { + __wpm.draggedWebPart = draggedWebPart; + __wpm.DragDrop(); + } + catch (e) { + __wpm.draggedWebPart = draggedWebPart; + window.setTimeout("__wpm.DragDrop()", 0); + } + currentEvent.returnValue = false; + currentEvent.cancelBubble = true; +} +function WebPart_OnDragStart() { + var currentEvent = window.event; + var webPartElement = currentEvent.srcElement; + if ((typeof(webPartElement.__webPart) == "undefined") || (webPartElement.__webPart == null)) { + currentEvent.returnValue = false; + currentEvent.cancelBubble = true; + return; + } + var dataObject = currentEvent.dataTransfer; + dataObject.effectAllowed = __wpm.InitiateWebPartDragDrop(webPartElement); +} +function WebPart_OnDrag() { + __wpm.ContinueWebPartDragDrop(); +} +function WebPart_OnDragEnd() { + __wpm.CompleteWebPartDragDrop(); +} +function WebPart_GetParentWebPartElement(containedElement) { + var elem = containedElement; + while ((typeof(elem.__webPart) == "undefined") || (elem.__webPart == null)) { + elem = elem.parentElement; + if ((typeof(elem) == "undefined") || (elem == null)) { + break; + } + } + return elem; +} +function WebPart_UpdatePosition() { + var location = __wpTranslateOffset(0, 0, this.webPartElement, null, false); + this.middleX = location.x + this.webPartElement.offsetWidth / 2; + this.middleY = location.y + this.webPartElement.offsetHeight / 2; +} +function Zone(zoneElement, zoneIndex, uniqueID, isVertical, allowLayoutChange, highlightColor) { + var webPartTable = null; + if (zoneElement.rows.length == 1) { + webPartTableContainer = zoneElement.rows[0].cells[0]; + } + else { + webPartTableContainer = zoneElement.rows[1].cells[0]; + } + var i; + for (i = 0; i < webPartTableContainer.childNodes.length; i++) { + var node = webPartTableContainer.childNodes[i]; + if (node.tagName == "TABLE") { + webPartTable = node; + break; + } + } + this.zoneElement = zoneElement; + this.zoneIndex = zoneIndex; + this.webParts = new Array(); + this.uniqueID = uniqueID; + this.isVertical = isVertical; + this.allowLayoutChange = allowLayoutChange; + this.allowDrop = false; + this.webPartTable = webPartTable; + this.highlightColor = highlightColor; + this.savedBorderColor = (webPartTable != null) ? webPartTable.style.borderColor : null; + this.dropCueElements = new Array(); + if (webPartTable != null) { + if (isVertical) { + for (i = 0; i < webPartTable.rows.length; i += 2) { + this.dropCueElements[i / 2] = webPartTable.rows[i].cells[0].childNodes[0]; + } + } + else { + for (i = 0; i < webPartTable.rows[0].cells.length; i += 2) { + this.dropCueElements[i / 2] = webPartTable.rows[0].cells[i].childNodes[0]; + } + } + } + this.AddWebPart = Zone_AddWebPart; + this.GetWebPartIndex = Zone_GetWebPartIndex; + this.ToggleDropCues = Zone_ToggleDropCues; + this.UpdatePosition = Zone_UpdatePosition; + this.Dispose = Zone_Dispose; + webPartTable.__zone = this; + webPartTable.attachEvent("ondragenter", Zone_OnDragEnter); + webPartTable.attachEvent("ondrop", Zone_OnDrop); +} +function Zone_Dispose() { + for (var i = 0; i < this.webParts.length; i++) { + this.webParts[i].Dispose(); + } + this.webPartTable.__zone = null; +} +function Zone_OnDragEnter() { + var handled = __wpm.ProcessWebPartDragEnter(); + var currentEvent = window.event; + if (handled) { + currentEvent.returnValue = false; + currentEvent.cancelBubble = true; + } +} +function Zone_OnDragOver() { + var handled = __wpm.ProcessWebPartDragOver(); + var currentEvent = window.event; + if (handled) { + currentEvent.returnValue = false; + currentEvent.cancelBubble = true; + } +} +function Zone_OnDrop() { + var handled = __wpm.ProcessWebPartDrop(); + var currentEvent = window.event; + if (handled) { + currentEvent.returnValue = false; + currentEvent.cancelBubble = true; + } +} +function Zone_GetParentZoneElement(containedElement) { + var elem = containedElement; + while ((typeof(elem.__zone) == "undefined") || (elem.__zone == null)) { + elem = elem.parentElement; + if ((typeof(elem) == "undefined") || (elem == null)) { + break; + } + } + return elem; +} +function Zone_AddWebPart(webPartElement, webPartTitleElement, allowZoneChange) { + var webPart = null; + var zoneIndex = this.webParts.length; + if (this.allowLayoutChange && __wpm.IsDragDropEnabled()) { + webPart = new WebPart(webPartElement, webPartTitleElement, this, zoneIndex, allowZoneChange); + } + else { + webPart = new WebPart(webPartElement, null, this, zoneIndex, allowZoneChange); + } + this.webParts[zoneIndex] = webPart; + return webPart; +} +function Zone_ToggleDropCues(show, index, ignoreOutline) { + if (ignoreOutline == false) { + this.webPartTable.style.borderColor = (show ? this.highlightColor : this.savedBorderColor); + } + if (index == -1) { + return; + } + var dropCue = this.dropCueElements[index]; + if (dropCue && dropCue.style) { + if (dropCue.style.height == "100%" && !dropCue.webPartZoneHorizontalCueResized) { + var oldParentHeight = dropCue.parentElement.clientHeight; + var realHeight = oldParentHeight - 10; + dropCue.style.height = realHeight + "px"; + var dropCueVerticalBar = dropCue.getElementsByTagName("DIV")[0]; + if (dropCueVerticalBar && dropCueVerticalBar.style) { + dropCueVerticalBar.style.height = dropCue.style.height; + var heightDiff = (dropCue.parentElement.clientHeight - oldParentHeight); + if (heightDiff) { + dropCue.style.height = (realHeight - heightDiff) + "px"; + dropCueVerticalBar.style.height = dropCue.style.height; + } + } + dropCue.webPartZoneHorizontalCueResized = true; + } + dropCue.style.visibility = (show ? "visible" : "hidden"); + } +} +function Zone_GetWebPartIndex(location) { + var x = location.x; + var y = location.y; + if ((x < this.webPartTableLeft) || (x > this.webPartTableRight) || + (y < this.webPartTableTop) || (y > this.webPartTableBottom)) { + return -1; + } + var vertical = this.isVertical; + var webParts = this.webParts; + var webPartsCount = webParts.length; + for (var i = 0; i < webPartsCount; i++) { + var webPart = webParts[i]; + if (vertical) { + if (y < webPart.middleY) { + return i; + } + } + else { + if (x < webPart.middleX) { + return i; + } + } + } + return webPartsCount; +} +function Zone_UpdatePosition() { + var topLeft = __wpTranslateOffset(0, 0, this.webPartTable, null, false); + this.webPartTableLeft = topLeft.x; + this.webPartTableTop = topLeft.y; + this.webPartTableRight = (this.webPartTable != null) ? topLeft.x + this.webPartTable.offsetWidth : topLeft.x; + this.webPartTableBottom = (this.webPartTable != null) ? topLeft.y + this.webPartTable.offsetHeight : topLeft.y; + for (var i = 0; i < this.webParts.length; i++) { + this.webParts[i].UpdatePosition(); + } +} +function WebPartDragState(webPartElement, effect) { + this.webPartElement = webPartElement; + this.dropZoneElement = null; + this.dropIndex = -1; + this.effect = effect; + this.dropped = false; +} +function WebPartMenu(menuLabelElement, menuDropDownElement, menuElement) { + this.menuLabelElement = menuLabelElement; + this.menuDropDownElement = menuDropDownElement; + this.menuElement = menuElement; + this.menuLabelElement.__menu = this; + this.menuLabelElement.attachEvent('onclick', WebPartMenu_OnClick); + this.menuLabelElement.attachEvent('onkeypress', WebPartMenu_OnKeyPress); + this.menuLabelElement.attachEvent('onmouseenter', WebPartMenu_OnMouseEnter); + this.menuLabelElement.attachEvent('onmouseleave', WebPartMenu_OnMouseLeave); + if ((typeof(this.menuDropDownElement) != "undefined") && (this.menuDropDownElement != null)) { + this.menuDropDownElement.__menu = this; + } + this.menuItemStyle = ""; + this.menuItemHoverStyle = ""; + this.popup = null; + this.hoverClassName = ""; + this.hoverColor = ""; + this.oldColor = this.menuLabelElement.style.color; + this.oldTextDecoration = this.menuLabelElement.style.textDecoration; + this.oldClassName = this.menuLabelElement.className; + this.Show = WebPartMenu_Show; + this.Hide = WebPartMenu_Hide; + this.Hover = WebPartMenu_Hover; + this.Unhover = WebPartMenu_Unhover; + this.Dispose = WebPartMenu_Dispose; + var menu = this; + this.disposeDelegate = function() { menu.Dispose(); }; + window.attachEvent('onunload', this.disposeDelegate); +} +function WebPartMenu_Dispose() { + this.menuLabelElement.__menu = null; + this.menuDropDownElement.__menu = null; + window.detachEvent('onunload', this.disposeDelegate); +} +function WebPartMenu_Show() { + if ((typeof(__wpm.menu) != "undefined") && (__wpm.menu != null)) { + __wpm.menu.Hide(); + } + var menuHTML = + "<html><head><style>" + + "a.menuItem, a.menuItem:Link { display: block; padding: 1px; text-decoration: none; " + this.itemStyle + " }" + + "a.menuItem:Hover { " + this.itemHoverStyle + " }" + + "</style><body scroll=\"no\" style=\"border: none; margin: 0; padding: 0;\" ondragstart=\"window.event.returnValue=false;\" onclick=\"popup.hide()\">" + + this.menuElement.innerHTML + + "</body></html>"; + var width = 16; + var height = 16; + this.popup = window.createPopup(); + __wpm.menu = this; + var popupDocument = this.popup.document; + popupDocument.write(menuHTML); + this.popup.show(0, 0, width, height); + var popupBody = popupDocument.body; + width = popupBody.scrollWidth; + height = popupBody.scrollHeight; + if (width < this.menuLabelElement.offsetWidth) { + width = this.menuLabelElement.offsetWidth + 16; + } + if (this.menuElement.innerHTML.indexOf("progid:DXImageTransform.Microsoft.Shadow") != -1) { + popupBody.style.paddingRight = "4px"; + } + popupBody.__wpm = __wpm; + popupBody.__wpmDeleteWarning = __wpmDeleteWarning; + popupBody.__wpmCloseProviderWarning = __wpmCloseProviderWarning; + popupBody.popup = this.popup; + this.popup.hide(); + this.popup.show(0, this.menuLabelElement.offsetHeight, width, height, this.menuLabelElement); +} +function WebPartMenu_Hide() { + if (__wpm.menu == this) { + __wpm.menu = null; + if ((typeof(this.popup) != "undefined") && (this.popup != null)) { + this.popup.hide(); + this.popup = null; + } + } +} +function WebPartMenu_Hover() { + if (this.labelHoverClassName != "") { + this.menuLabelElement.className = this.menuLabelElement.className + " " + this.labelHoverClassName; + } + if (this.labelHoverColor != "") { + this.menuLabelElement.style.color = this.labelHoverColor; + } +} +function WebPartMenu_Unhover() { + if (this.labelHoverClassName != "") { + this.menuLabelElement.style.textDecoration = this.oldTextDecoration; + this.menuLabelElement.className = this.oldClassName; + } + if (this.labelHoverColor != "") { + this.menuLabelElement.style.color = this.oldColor; + } +} +function WebPartMenu_OnClick() { + var menu = window.event.srcElement.__menu; + if ((typeof(menu) != "undefined") && (menu != null)) { + window.event.returnValue = false; + window.event.cancelBubble = true; + menu.Show(); + } +} +function WebPartMenu_OnKeyPress() { + if (window.event.keyCode == 13) { + var menu = window.event.srcElement.__menu; + if ((typeof(menu) != "undefined") && (menu != null)) { + window.event.returnValue = false; + window.event.cancelBubble = true; + menu.Show(); + } + } +} +function WebPartMenu_OnMouseEnter() { + var menu = window.event.srcElement.__menu; + if ((typeof(menu) != "undefined") && (menu != null)) { + menu.Hover(); + } +} +function WebPartMenu_OnMouseLeave() { + var menu = window.event.srcElement.__menu; + if ((typeof(menu) != "undefined") && (menu != null)) { + menu.Unhover(); + } +} +function WebPartManager() { + this.overlayContainerElement = null; + this.zones = new Array(); + this.dragState = null; + this.menu = null; + this.draggedWebPart = null; + this.AddZone = WebPartManager_AddZone; + this.IsDragDropEnabled = WebPartManager_IsDragDropEnabled; + this.DragDrop = WebPartManager_DragDrop; + this.InitiateWebPartDragDrop = WebPartManager_InitiateWebPartDragDrop; + this.CompleteWebPartDragDrop = WebPartManager_CompleteWebPartDragDrop; + this.ContinueWebPartDragDrop = WebPartManager_ContinueWebPartDragDrop; + this.ProcessWebPartDragEnter = WebPartManager_ProcessWebPartDragEnter; + this.ProcessWebPartDragOver = WebPartManager_ProcessWebPartDragOver; + this.ProcessWebPartDrop = WebPartManager_ProcessWebPartDrop; + this.ShowHelp = WebPartManager_ShowHelp; + this.ExportWebPart = WebPartManager_ExportWebPart; + this.Execute = WebPartManager_Execute; + this.SubmitPage = WebPartManager_SubmitPage; + this.UpdatePositions = WebPartManager_UpdatePositions; + window.attachEvent("onunload", WebPartManager_Dispose); +} +function WebPartManager_Dispose() { + for (var i = 0; i < __wpm.zones.length; i++) { + __wpm.zones[i].Dispose(); + } + window.detachEvent("onunload", WebPartManager_Dispose); +} +function WebPartManager_AddZone(zoneElement, uniqueID, isVertical, allowLayoutChange, highlightColor) { + var zoneIndex = this.zones.length; + var zone = new Zone(zoneElement, zoneIndex, uniqueID, isVertical, allowLayoutChange, highlightColor); + this.zones[zoneIndex] = zone; + return zone; +} +function WebPartManager_IsDragDropEnabled() { + return ((typeof(this.overlayContainerElement) != "undefined") && (this.overlayContainerElement != null)); +} +function WebPartManager_DragDrop() { + if ((typeof(this.draggedWebPart) != "undefined") && (this.draggedWebPart != null)) { + var tempWebPart = this.draggedWebPart; + this.draggedWebPart = null; + tempWebPart.dragDrop(); + window.setTimeout("__wpClearSelection()", 0); + } +} +function WebPartManager_InitiateWebPartDragDrop(webPartElement) { + var webPart = webPartElement.__webPart; + this.UpdatePositions(); + this.dragState = new WebPartDragState(webPartElement, "move"); + var location = __wpGetPageEventLocation(window.event, true); + var overlayContainerElement = this.overlayContainerElement; + overlayContainerElement.style.left = location.x - webPartElement.offsetWidth / 2; + overlayContainerElement.style.top = location.y + 4 + (webPartElement.clientTop ? webPartElement.clientTop : 0); + overlayContainerElement.style.display = "block"; + overlayContainerElement.style.width = webPartElement.offsetWidth; + overlayContainerElement.style.height = webPartElement.offsetHeight; + overlayContainerElement.appendChild(webPartElement.cloneNode(true)); + if (webPart.allowZoneChange == false) { + webPart.zone.allowDrop = true; + } + else { + for (var i = 0; i < __wpm.zones.length; i++) { + var zone = __wpm.zones[i]; + if (zone.allowLayoutChange) { + zone.allowDrop = true; + } + } + } + document.body.attachEvent("ondragover", Zone_OnDragOver); + return "move"; +} +function WebPartManager_CompleteWebPartDragDrop() { + var dragState = this.dragState; + this.dragState = null; + if ((typeof(dragState.dropZoneElement) != "undefined") && (dragState.dropZoneElement != null)) { + dragState.dropZoneElement.__zone.ToggleDropCues(false, dragState.dropIndex, false); + } + document.body.detachEvent("ondragover", Zone_OnDragOver); + for (var i = 0; i < __wpm.zones.length; i++) { + __wpm.zones[i].allowDrop = false; + } + this.overlayContainerElement.removeChild(this.overlayContainerElement.firstChild); + this.overlayContainerElement.style.display = "none"; + if ((typeof(dragState) != "undefined") && (dragState != null) && (dragState.dropped == true)) { + var currentZone = dragState.webPartElement.__webPart.zone; + var currentZoneIndex = dragState.webPartElement.__webPart.zoneIndex; + if ((currentZone != dragState.dropZoneElement.__zone) || + ((currentZoneIndex != dragState.dropIndex) && + (currentZoneIndex != (dragState.dropIndex - 1)))) { + var eventTarget = dragState.dropZoneElement.__zone.uniqueID; + var eventArgument = "Drag:" + dragState.webPartElement.id + ":" + dragState.dropIndex; + this.SubmitPage(eventTarget, eventArgument); + } + } +} +function WebPartManager_ContinueWebPartDragDrop() { + var dragState = this.dragState; + if ((typeof(dragState) != "undefined") && (dragState != null)) { + var style = this.overlayContainerElement.style; + var location = __wpGetPageEventLocation(window.event, true); + style.left = location.x - dragState.webPartElement.offsetWidth / 2; + style.top = location.y + 4 + (dragState.webPartElement.clientTop ? dragState.webPartElement.clientTop : 0); + } +} +function WebPartManager_Execute(script) { + if (this.menu) { + this.menu.Hide(); + } + var scriptReference = new Function(script); + return (scriptReference() != false); +} +function WebPartManager_ProcessWebPartDragEnter() { + var dragState = __wpm.dragState; + if ((typeof(dragState) != "undefined") && (dragState != null)) { + var currentEvent = window.event; + var newDropZoneElement = Zone_GetParentZoneElement(currentEvent.srcElement); + if ((typeof(newDropZoneElement.__zone) == "undefined") || (newDropZoneElement.__zone == null) || + (newDropZoneElement.__zone.allowDrop == false)) { + newDropZoneElement = null; + } + var newDropIndex = -1; + if ((typeof(newDropZoneElement) != "undefined") && (newDropZoneElement != null)) { + newDropIndex = newDropZoneElement.__zone.GetWebPartIndex(__wpGetPageEventLocation(currentEvent, false)); + if (newDropIndex == -1) { + newDropZoneElement = null; + } + } + if (dragState.dropZoneElement != newDropZoneElement) { + if ((typeof(dragState.dropZoneElement) != "undefined") && (dragState.dropZoneElement != null)) { + dragState.dropZoneElement.__zone.ToggleDropCues(false, dragState.dropIndex, false); + } + dragState.dropZoneElement = newDropZoneElement; + dragState.dropIndex = newDropIndex; + if ((typeof(newDropZoneElement) != "undefined") && (newDropZoneElement != null)) { + newDropZoneElement.__zone.ToggleDropCues(true, newDropIndex, false); + } + } + else if (dragState.dropIndex != newDropIndex) { + if (dragState.dropIndex != -1) { + dragState.dropZoneElement.__zone.ToggleDropCues(false, dragState.dropIndex, false); + } + dragState.dropIndex = newDropIndex; + if ((typeof(newDropZoneElement) != "undefined") && (newDropZoneElement != null)) { + newDropZoneElement.__zone.ToggleDropCues(true, newDropIndex, false); + } + } + if ((typeof(dragState.dropZoneElement) != "undefined") && (dragState.dropZoneElement != null)) { + currentEvent.dataTransfer.effectAllowed = dragState.effect; + } + return true; + } + return false; +} +function WebPartManager_ProcessWebPartDragOver() { + var dragState = __wpm.dragState; + var currentEvent = window.event; + var handled = false; + if ((typeof(dragState) != "undefined") && (dragState != null) && + (typeof(dragState.dropZoneElement) != "undefined") && (dragState.dropZoneElement != null)) { + var dropZoneElement = Zone_GetParentZoneElement(currentEvent.srcElement); + if ((typeof(dropZoneElement) != "undefined") && (dropZoneElement != null) && (dropZoneElement.__zone.allowDrop == false)) { + dropZoneElement = null; + } + if (((typeof(dropZoneElement) == "undefined") || (dropZoneElement == null)) && + (typeof(dragState.dropZoneElement) != "undefined") && (dragState.dropZoneElement != null)) { + dragState.dropZoneElement.__zone.ToggleDropCues(false, __wpm.dragState.dropIndex, false); + dragState.dropZoneElement = null; + dragState.dropIndex = -1; + } + else if ((typeof(dropZoneElement) != "undefined") && (dropZoneElement != null)) { + var location = __wpGetPageEventLocation(currentEvent, false); + var newDropIndex = dropZoneElement.__zone.GetWebPartIndex(location); + if (newDropIndex == -1) { + dropZoneElement = null; + } + if (dragState.dropZoneElement != dropZoneElement) { + if ((dragState.dropIndex != -1) || (typeof(dropZoneElement) == "undefined") || (dropZoneElement == null)) { + dragState.dropZoneElement.__zone.ToggleDropCues(false, __wpm.dragState.dropIndex, false); + } + dragState.dropZoneElement = dropZoneElement; + } + else { + dragState.dropZoneElement.__zone.ToggleDropCues(false, dragState.dropIndex, true); + } + dragState.dropIndex = newDropIndex; + if ((typeof(dropZoneElement) != "undefined") && (dropZoneElement != null)) { + dropZoneElement.__zone.ToggleDropCues(true, newDropIndex, false); + } + } + handled = true; + } + if ((typeof(dragState) == "undefined") || (dragState == null) || + (typeof(dragState.dropZoneElement) == "undefined") || (dragState.dropZoneElement == null)) { + currentEvent.dataTransfer.effectAllowed = "none"; + } + return handled; +} +function WebPartManager_ProcessWebPartDrop() { + var dragState = this.dragState; + if ((typeof(dragState) != "undefined") && (dragState != null)) { + var currentEvent = window.event; + var dropZoneElement = Zone_GetParentZoneElement(currentEvent.srcElement); + if ((typeof(dropZoneElement) != "undefined") && (dropZoneElement != null) && (dropZoneElement.__zone.allowDrop == false)) { + dropZoneElement = null; + } + if ((typeof(dropZoneElement) != "undefined") && (dropZoneElement != null) && (dragState.dropZoneElement == dropZoneElement)) { + dragState.dropped = true; + } + return true; + } + return false; +} +function WebPartManager_ShowHelp(helpUrl, helpMode) { + if ((typeof(this.menu) != "undefined") && (this.menu != null)) { + this.menu.Hide(); + } + if (helpMode == 0 || helpMode == 1) { + if (helpMode == 0) { + var dialogInfo = "edge: Sunken; center: yes; help: no; resizable: yes; status: no"; + window.showModalDialog(helpUrl, null, dialogInfo); + } + else { + window.open(helpUrl, null, "scrollbars=yes,resizable=yes,status=no,toolbar=no,menubar=no,location=no"); + } + } + else if (helpMode == 2) { + window.location = helpUrl; + } +} +function WebPartManager_ExportWebPart(exportUrl, warn, confirmOnly) { + if (warn == true && __wpmExportWarning.length > 0 && this.personalizationScopeShared != true) { + if (confirm(__wpmExportWarning) == false) { + return false; + } + } + if (confirmOnly == false) { + window.location = exportUrl; + } + return true; +} +function WebPartManager_UpdatePositions() { + for (var i = 0; i < this.zones.length; i++) { + this.zones[i].UpdatePosition(); + } +} +function WebPartManager_SubmitPage(eventTarget, eventArgument) { + if ((typeof(this.menu) != "undefined") && (this.menu != null)) { + this.menu.Hide(); + } + __doPostBack(eventTarget, eventArgument); +} diff --git a/samples/TestAzureAD/Scripts/WebForms/WebUIValidation.js b/samples/TestAzureAD/Scripts/WebForms/WebUIValidation.js new file mode 100644 index 0000000..a160ee8 --- /dev/null +++ b/samples/TestAzureAD/Scripts/WebForms/WebUIValidation.js @@ -0,0 +1,684 @@ +//CdnPath=http://ajax.aspnetcdn.com/ajax/4.5/6/WebUIValidation.js +var Page_ValidationVer = "125"; +var Page_IsValid = true; +var Page_BlockSubmit = false; +var Page_InvalidControlToBeFocused = null; +var Page_TextTypes = /^(text|password|file|search|tel|url|email|number|range|color|datetime|date|month|week|time|datetime-local)$/i; +function ValidatorUpdateDisplay(val) { + if (typeof(val.display) == "string") { + if (val.display == "None") { + return; + } + if (val.display == "Dynamic") { + val.style.display = val.isvalid ? "none" : "inline"; + return; + } + } + if ((navigator.userAgent.indexOf("Mac") > -1) && + (navigator.userAgent.indexOf("MSIE") > -1)) { + val.style.display = "inline"; + } + val.style.visibility = val.isvalid ? "hidden" : "visible"; +} +function ValidatorUpdateIsValid() { + Page_IsValid = AllValidatorsValid(Page_Validators); +} +function AllValidatorsValid(validators) { + if ((typeof(validators) != "undefined") && (validators != null)) { + var i; + for (i = 0; i < validators.length; i++) { + if (!validators[i].isvalid) { + return false; + } + } + } + return true; +} +function ValidatorHookupControlID(controlID, val) { + if (typeof(controlID) != "string") { + return; + } + var ctrl = document.getElementById(controlID); + if ((typeof(ctrl) != "undefined") && (ctrl != null)) { + ValidatorHookupControl(ctrl, val); + } + else { + val.isvalid = true; + val.enabled = false; + } +} +function ValidatorHookupControl(control, val) { + if (typeof(control.tagName) != "string") { + return; + } + if (control.tagName != "INPUT" && control.tagName != "TEXTAREA" && control.tagName != "SELECT") { + var i; + for (i = 0; i < control.childNodes.length; i++) { + ValidatorHookupControl(control.childNodes[i], val); + } + return; + } + else { + if (typeof(control.Validators) == "undefined") { + control.Validators = new Array; + var eventType; + if (control.type == "radio") { + eventType = "onclick"; + } else { + eventType = "onchange"; + if (typeof(val.focusOnError) == "string" && val.focusOnError == "t") { + ValidatorHookupEvent(control, "onblur", "ValidatedControlOnBlur(event); "); + } + } + ValidatorHookupEvent(control, eventType, "ValidatorOnChange(event); "); + if (Page_TextTypes.test(control.type)) { + ValidatorHookupEvent(control, "onkeypress", + "event = event || window.event; if (!ValidatedTextBoxOnKeyPress(event)) { event.cancelBubble = true; if (event.stopPropagation) event.stopPropagation(); return false; } "); + } + } + control.Validators[control.Validators.length] = val; + } +} +function ValidatorHookupEvent(control, eventType, functionPrefix) { + var ev = control[eventType]; + if (typeof(ev) == "function") { + ev = ev.toString(); + ev = ev.substring(ev.indexOf("{") + 1, ev.lastIndexOf("}")); + } + else { + ev = ""; + } + control[eventType] = new Function("event", functionPrefix + " " + ev); +} +function ValidatorGetValue(id) { + var control; + control = document.getElementById(id); + if (typeof(control.value) == "string") { + return control.value; + } + return ValidatorGetValueRecursive(control); +} +function ValidatorGetValueRecursive(control) +{ + if (typeof(control.value) == "string" && (control.type != "radio" || control.checked == true)) { + return control.value; + } + var i, val; + for (i = 0; i<control.childNodes.length; i++) { + val = ValidatorGetValueRecursive(control.childNodes[i]); + if (val != "") return val; + } + return ""; +} +function Page_ClientValidate(validationGroup) { + Page_InvalidControlToBeFocused = null; + if (typeof(Page_Validators) == "undefined") { + return true; + } + var i; + for (i = 0; i < Page_Validators.length; i++) { + ValidatorValidate(Page_Validators[i], validationGroup, null); + } + ValidatorUpdateIsValid(); + ValidationSummaryOnSubmit(validationGroup); + Page_BlockSubmit = !Page_IsValid; + return Page_IsValid; +} +function ValidatorCommonOnSubmit() { + Page_InvalidControlToBeFocused = null; + var result = !Page_BlockSubmit; + if ((typeof(window.event) != "undefined") && (window.event != null)) { + window.event.returnValue = result; + } + Page_BlockSubmit = false; + return result; +} +function ValidatorEnable(val, enable) { + val.enabled = (enable != false); + ValidatorValidate(val); + ValidatorUpdateIsValid(); +} +function ValidatorOnChange(event) { + event = event || window.event; + Page_InvalidControlToBeFocused = null; + var targetedControl; + if ((typeof(event.srcElement) != "undefined") && (event.srcElement != null)) { + targetedControl = event.srcElement; + } + else { + targetedControl = event.target; + } + var vals; + if (typeof(targetedControl.Validators) != "undefined") { + vals = targetedControl.Validators; + } + else { + if (targetedControl.tagName.toLowerCase() == "label") { + targetedControl = document.getElementById(targetedControl.htmlFor); + vals = targetedControl.Validators; + } + } + if (vals) { + for (var i = 0; i < vals.length; i++) { + ValidatorValidate(vals[i], null, event); + } + } + ValidatorUpdateIsValid(); +} +function ValidatedTextBoxOnKeyPress(event) { + event = event || window.event; + if (event.keyCode == 13) { + ValidatorOnChange(event); + var vals; + if ((typeof(event.srcElement) != "undefined") && (event.srcElement != null)) { + vals = event.srcElement.Validators; + } + else { + vals = event.target.Validators; + } + return AllValidatorsValid(vals); + } + return true; +} +function ValidatedControlOnBlur(event) { + event = event || window.event; + var control; + if ((typeof(event.srcElement) != "undefined") && (event.srcElement != null)) { + control = event.srcElement; + } + else { + control = event.target; + } + if ((typeof(control) != "undefined") && (control != null) && (Page_InvalidControlToBeFocused == control)) { + control.focus(); + Page_InvalidControlToBeFocused = null; + } +} +function ValidatorValidate(val, validationGroup, event) { + val.isvalid = true; + if ((typeof(val.enabled) == "undefined" || val.enabled != false) && IsValidationGroupMatch(val, validationGroup)) { + if (typeof(val.evaluationfunction) == "function") { + val.isvalid = val.evaluationfunction(val); + if (!val.isvalid && Page_InvalidControlToBeFocused == null && + typeof(val.focusOnError) == "string" && val.focusOnError == "t") { + ValidatorSetFocus(val, event); + } + } + } + ValidatorUpdateDisplay(val); +} +function ValidatorSetFocus(val, event) { + var ctrl; + if (typeof(val.controlhookup) == "string") { + var eventCtrl; + if ((typeof(event) != "undefined") && (event != null)) { + if ((typeof(event.srcElement) != "undefined") && (event.srcElement != null)) { + eventCtrl = event.srcElement; + } + else { + eventCtrl = event.target; + } + } + if ((typeof(eventCtrl) != "undefined") && (eventCtrl != null) && + (typeof(eventCtrl.id) == "string") && + (eventCtrl.id == val.controlhookup)) { + ctrl = eventCtrl; + } + } + if ((typeof(ctrl) == "undefined") || (ctrl == null)) { + ctrl = document.getElementById(val.controltovalidate); + } + if ((typeof(ctrl) != "undefined") && (ctrl != null) && + (ctrl.tagName.toLowerCase() != "table" || (typeof(event) == "undefined") || (event == null)) && + ((ctrl.tagName.toLowerCase() != "input") || (ctrl.type.toLowerCase() != "hidden")) && + (typeof(ctrl.disabled) == "undefined" || ctrl.disabled == null || ctrl.disabled == false) && + (typeof(ctrl.visible) == "undefined" || ctrl.visible == null || ctrl.visible != false) && + (IsInVisibleContainer(ctrl))) { + if ((ctrl.tagName.toLowerCase() == "table" && (typeof(__nonMSDOMBrowser) == "undefined" || __nonMSDOMBrowser)) || + (ctrl.tagName.toLowerCase() == "span")) { + var inputElements = ctrl.getElementsByTagName("input"); + var lastInputElement = inputElements[inputElements.length -1]; + if (lastInputElement != null) { + ctrl = lastInputElement; + } + } + if (typeof(ctrl.focus) != "undefined" && ctrl.focus != null) { + ctrl.focus(); + Page_InvalidControlToBeFocused = ctrl; + } + } +} +function IsInVisibleContainer(ctrl) { + if (typeof(ctrl.style) != "undefined" && + ( ( typeof(ctrl.style.display) != "undefined" && + ctrl.style.display == "none") || + ( typeof(ctrl.style.visibility) != "undefined" && + ctrl.style.visibility == "hidden") ) ) { + return false; + } + else if (typeof(ctrl.parentNode) != "undefined" && + ctrl.parentNode != null && + ctrl.parentNode != ctrl) { + return IsInVisibleContainer(ctrl.parentNode); + } + return true; +} +function IsValidationGroupMatch(control, validationGroup) { + if ((typeof(validationGroup) == "undefined") || (validationGroup == null)) { + return true; + } + var controlGroup = ""; + if (typeof(control.validationGroup) == "string") { + controlGroup = control.validationGroup; + } + return (controlGroup == validationGroup); +} +function ValidatorOnLoad() { + if (typeof(Page_Validators) == "undefined") + return; + var i, val; + for (i = 0; i < Page_Validators.length; i++) { + val = Page_Validators[i]; + if (typeof(val.evaluationfunction) == "string") { + eval("val.evaluationfunction = " + val.evaluationfunction + ";"); + } + if (typeof(val.isvalid) == "string") { + if (val.isvalid == "False") { + val.isvalid = false; + Page_IsValid = false; + } + else { + val.isvalid = true; + } + } else { + val.isvalid = true; + } + if (typeof(val.enabled) == "string") { + val.enabled = (val.enabled != "False"); + } + if (typeof(val.controltovalidate) == "string") { + ValidatorHookupControlID(val.controltovalidate, val); + } + if (typeof(val.controlhookup) == "string") { + ValidatorHookupControlID(val.controlhookup, val); + } + } + Page_ValidationActive = true; +} +function ValidatorConvert(op, dataType, val) { + function GetFullYear(year) { + var twoDigitCutoffYear = val.cutoffyear % 100; + var cutoffYearCentury = val.cutoffyear - twoDigitCutoffYear; + return ((year > twoDigitCutoffYear) ? (cutoffYearCentury - 100 + year) : (cutoffYearCentury + year)); + } + var num, cleanInput, m, exp; + if (dataType == "Integer") { + exp = /^\s*[-\+]?\d+\s*$/; + if (op.match(exp) == null) + return null; + num = parseInt(op, 10); + return (isNaN(num) ? null : num); + } + else if(dataType == "Double") { + exp = new RegExp("^\\s*([-\\+])?(\\d*)\\" + val.decimalchar + "?(\\d*)\\s*$"); + m = op.match(exp); + if (m == null) + return null; + if (m[2].length == 0 && m[3].length == 0) + return null; + cleanInput = (m[1] != null ? m[1] : "") + (m[2].length>0 ? m[2] : "0") + (m[3].length>0 ? "." + m[3] : ""); + num = parseFloat(cleanInput); + return (isNaN(num) ? null : num); + } + else if (dataType == "Currency") { + var hasDigits = (val.digits > 0); + var beginGroupSize, subsequentGroupSize; + var groupSizeNum = parseInt(val.groupsize, 10); + if (!isNaN(groupSizeNum) && groupSizeNum > 0) { + beginGroupSize = "{1," + groupSizeNum + "}"; + subsequentGroupSize = "{" + groupSizeNum + "}"; + } + else { + beginGroupSize = subsequentGroupSize = "+"; + } + exp = new RegExp("^\\s*([-\\+])?((\\d" + beginGroupSize + "(\\" + val.groupchar + "\\d" + subsequentGroupSize + ")+)|\\d*)" + + (hasDigits ? "\\" + val.decimalchar + "?(\\d{0," + val.digits + "})" : "") + + "\\s*$"); + m = op.match(exp); + if (m == null) + return null; + if (m[2].length == 0 && hasDigits && m[5].length == 0) + return null; + cleanInput = (m[1] != null ? m[1] : "") + m[2].replace(new RegExp("(\\" + val.groupchar + ")", "g"), "") + ((hasDigits && m[5].length > 0) ? "." + m[5] : ""); + num = parseFloat(cleanInput); + return (isNaN(num) ? null : num); + } + else if (dataType == "Date") { + var yearFirstExp = new RegExp("^\\s*((\\d{4})|(\\d{2}))([-/]|\\. ?)(\\d{1,2})\\4(\\d{1,2})\\.?\\s*$"); + m = op.match(yearFirstExp); + var day, month, year; + if (m != null && (((typeof(m[2]) != "undefined") && (m[2].length == 4)) || val.dateorder == "ymd")) { + day = m[6]; + month = m[5]; + year = (m[2].length == 4) ? m[2] : GetFullYear(parseInt(m[3], 10)); + } + else { + if (val.dateorder == "ymd"){ + return null; + } + var yearLastExp = new RegExp("^\\s*(\\d{1,2})([-/]|\\. ?)(\\d{1,2})(?:\\s|\\2)((\\d{4})|(\\d{2}))(?:\\s\u0433\\.|\\.)?\\s*$"); + m = op.match(yearLastExp); + if (m == null) { + return null; + } + if (val.dateorder == "mdy") { + day = m[3]; + month = m[1]; + } + else { + day = m[1]; + month = m[3]; + } + year = ((typeof(m[5]) != "undefined") && (m[5].length == 4)) ? m[5] : GetFullYear(parseInt(m[6], 10)); + } + month -= 1; + var date = new Date(year, month, day); + if (year < 100) { + date.setFullYear(year); + } + return (typeof(date) == "object" && year == date.getFullYear() && month == date.getMonth() && day == date.getDate()) ? date.valueOf() : null; + } + else { + return op.toString(); + } +} +function ValidatorCompare(operand1, operand2, operator, val) { + var dataType = val.type; + var op1, op2; + if ((op1 = ValidatorConvert(operand1, dataType, val)) == null) + return false; + if (operator == "DataTypeCheck") + return true; + if ((op2 = ValidatorConvert(operand2, dataType, val)) == null) + return true; + switch (operator) { + case "NotEqual": + return (op1 != op2); + case "GreaterThan": + return (op1 > op2); + case "GreaterThanEqual": + return (op1 >= op2); + case "LessThan": + return (op1 < op2); + case "LessThanEqual": + return (op1 <= op2); + default: + return (op1 == op2); + } +} +function CompareValidatorEvaluateIsValid(val) { + var value = ValidatorGetValue(val.controltovalidate); + if (ValidatorTrim(value).length == 0) + return true; + var compareTo = ""; + if ((typeof(val.controltocompare) != "string") || + (typeof(document.getElementById(val.controltocompare)) == "undefined") || + (null == document.getElementById(val.controltocompare))) { + if (typeof(val.valuetocompare) == "string") { + compareTo = val.valuetocompare; + } + } + else { + compareTo = ValidatorGetValue(val.controltocompare); + } + var operator = "Equal"; + if (typeof(val.operator) == "string") { + operator = val.operator; + } + return ValidatorCompare(value, compareTo, operator, val); +} +function CustomValidatorEvaluateIsValid(val) { + var value = ""; + if (typeof(val.controltovalidate) == "string") { + value = ValidatorGetValue(val.controltovalidate); + if ((ValidatorTrim(value).length == 0) && + ((typeof(val.validateemptytext) != "string") || (val.validateemptytext != "true"))) { + return true; + } + } + var args = { Value:value, IsValid:true }; + if (typeof(val.clientvalidationfunction) == "string") { + eval(val.clientvalidationfunction + "(val, args) ;"); + } + return args.IsValid; +} +function RegularExpressionValidatorEvaluateIsValid(val) { + var value = ValidatorGetValue(val.controltovalidate); + if (ValidatorTrim(value).length == 0) + return true; + var rx = new RegExp(val.validationexpression); + var matches = rx.exec(value); + return (matches != null && value == matches[0]); +} +function ValidatorTrim(s) { + var m = s.match(/^\s*(\S+(\s+\S+)*)\s*$/); + return (m == null) ? "" : m[1]; +} +function RequiredFieldValidatorEvaluateIsValid(val) { + return (ValidatorTrim(ValidatorGetValue(val.controltovalidate)) != ValidatorTrim(val.initialvalue)) +} +function RangeValidatorEvaluateIsValid(val) { + var value = ValidatorGetValue(val.controltovalidate); + if (ValidatorTrim(value).length == 0) + return true; + return (ValidatorCompare(value, val.minimumvalue, "GreaterThanEqual", val) && + ValidatorCompare(value, val.maximumvalue, "LessThanEqual", val)); +} +function ValidationSummaryOnSubmit(validationGroup) { + if (typeof(Page_ValidationSummaries) == "undefined") + return; + var summary, sums, s; + var headerSep, first, pre, post, end; + for (sums = 0; sums < Page_ValidationSummaries.length; sums++) { + summary = Page_ValidationSummaries[sums]; + if (!summary) continue; + summary.style.display = "none"; + if (!Page_IsValid && IsValidationGroupMatch(summary, validationGroup)) { + var i; + if (summary.showsummary != "False") { + summary.style.display = ""; + if (typeof(summary.displaymode) != "string") { + summary.displaymode = "BulletList"; + } + switch (summary.displaymode) { + case "List": + headerSep = "<br>"; + first = ""; + pre = ""; + post = "<br>"; + end = ""; + break; + case "BulletList": + default: + headerSep = ""; + first = "<ul>"; + pre = "<li>"; + post = "</li>"; + end = "</ul>"; + break; + case "SingleParagraph": + headerSep = " "; + first = ""; + pre = ""; + post = " "; + end = "<br>"; + break; + } + s = ""; + if (typeof(summary.headertext) == "string") { + s += summary.headertext + headerSep; + } + s += first; + for (i=0; i<Page_Validators.length; i++) { + if (!Page_Validators[i].isvalid && typeof(Page_Validators[i].errormessage) == "string") { + s += pre + Page_Validators[i].errormessage + post; + } + } + s += end; + summary.innerHTML = s; + window.scrollTo(0,0); + } + if (summary.showmessagebox == "True") { + s = ""; + if (typeof(summary.headertext) == "string") { + s += summary.headertext + "\r\n"; + } + var lastValIndex = Page_Validators.length - 1; + for (i=0; i<=lastValIndex; i++) { + if (!Page_Validators[i].isvalid && typeof(Page_Validators[i].errormessage) == "string") { + switch (summary.displaymode) { + case "List": + s += Page_Validators[i].errormessage; + if (i < lastValIndex) { + s += "\r\n"; + } + break; + case "BulletList": + default: + s += "- " + Page_Validators[i].errormessage; + if (i < lastValIndex) { + s += "\r\n"; + } + break; + case "SingleParagraph": + s += Page_Validators[i].errormessage + " "; + break; + } + } + } + alert(s); + } + } + } +} +if (window.jQuery) { + (function ($) { + var dataValidationAttribute = "data-val", + dataValidationSummaryAttribute = "data-valsummary", + normalizedAttributes = { validationgroup: "validationGroup", focusonerror: "focusOnError" }; + function getAttributesWithPrefix(element, prefix) { + var i, + attribute, + list = {}, + attributes = element.attributes, + length = attributes.length, + prefixLength = prefix.length; + prefix = prefix.toLowerCase(); + for (i = 0; i < length; i++) { + attribute = attributes[i]; + if (attribute.specified && attribute.name.substr(0, prefixLength).toLowerCase() === prefix) { + list[attribute.name.substr(prefixLength)] = attribute.value; + } + } + return list; + } + function normalizeKey(key) { + key = key.toLowerCase(); + return normalizedAttributes[key] === undefined ? key : normalizedAttributes[key]; + } + function addValidationExpando(element) { + var attributes = getAttributesWithPrefix(element, dataValidationAttribute + "-"); + $.each(attributes, function (key, value) { + element[normalizeKey(key)] = value; + }); + } + function dispose(element) { + var index = $.inArray(element, Page_Validators); + if (index >= 0) { + Page_Validators.splice(index, 1); + } + } + function addNormalizedAttribute(name, normalizedName) { + normalizedAttributes[name.toLowerCase()] = normalizedName; + } + function parseSpecificAttribute(selector, attribute, validatorsArray) { + return $(selector).find("[" + attribute + "='true']").each(function (index, element) { + addValidationExpando(element); + element.dispose = function () { dispose(element); element.dispose = null; }; + if ($.inArray(element, validatorsArray) === -1) { + validatorsArray.push(element); + } + }).length; + } + function parse(selector) { + var length = parseSpecificAttribute(selector, dataValidationAttribute, Page_Validators); + length += parseSpecificAttribute(selector, dataValidationSummaryAttribute, Page_ValidationSummaries); + return length; + } + function loadValidators() { + if (typeof (ValidatorOnLoad) === "function") { + ValidatorOnLoad(); + } + if (typeof (ValidatorOnSubmit) === "undefined") { + window.ValidatorOnSubmit = function () { + return Page_ValidationActive ? ValidatorCommonOnSubmit() : true; + }; + } + } + function registerUpdatePanel() { + if (window.Sys && Sys.WebForms && Sys.WebForms.PageRequestManager) { + var prm = Sys.WebForms.PageRequestManager.getInstance(), + postBackElement, endRequestHandler; + if (prm.get_isInAsyncPostBack()) { + endRequestHandler = function (sender, args) { + if (parse(document)) { + loadValidators(); + } + prm.remove_endRequest(endRequestHandler); + endRequestHandler = null; + }; + prm.add_endRequest(endRequestHandler); + } + prm.add_beginRequest(function (sender, args) { + postBackElement = args.get_postBackElement(); + }); + prm.add_pageLoaded(function (sender, args) { + var i, panels, valFound = 0; + if (typeof (postBackElement) === "undefined") { + return; + } + panels = args.get_panelsUpdated(); + for (i = 0; i < panels.length; i++) { + valFound += parse(panels[i]); + } + panels = args.get_panelsCreated(); + for (i = 0; i < panels.length; i++) { + valFound += parse(panels[i]); + } + if (valFound) { + loadValidators(); + } + }); + } + } + $(function () { + if (typeof (Page_Validators) === "undefined") { + window.Page_Validators = []; + } + if (typeof (Page_ValidationSummaries) === "undefined") { + window.Page_ValidationSummaries = []; + } + if (typeof (Page_ValidationActive) === "undefined") { + window.Page_ValidationActive = false; + } + $.WebFormValidator = { + addNormalizedAttribute: addNormalizedAttribute, + parse: parse + }; + if (parse(document)) { + loadValidators(); + } + registerUpdatePanel(); + }); + } (jQuery)); +}
\ No newline at end of file diff --git a/samples/TestAzureAD/Scripts/_references.js b/samples/TestAzureAD/Scripts/_references.js Binary files differnew file mode 100644 index 0000000..458c2d3 --- /dev/null +++ b/samples/TestAzureAD/Scripts/_references.js diff --git a/samples/TestAzureAD/Scripts/jquery-1.7.1.intellisense.js b/samples/TestAzureAD/Scripts/jquery-1.7.1.intellisense.js new file mode 100644 index 0000000..35a9a25 --- /dev/null +++ b/samples/TestAzureAD/Scripts/jquery-1.7.1.intellisense.js @@ -0,0 +1,2521 @@ +/*! + * Documentation Content + * Copyright (c) 2009 Packt Publishing, http://packtpub.com/ + * Copyright (c) 2012 jQuery Foundation, http://jquery.org/ + * + * This software consists of voluntary contributions made by many + * individuals. For exact contribution history, see the revision history + * and logs, available at http://github.com/jquery/api.jquery.com + * + * Permission is hereby granted, free of charge, to any person obtaining + * a copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, sublicense, and/or sell copies of the Software, and to + * permit persons to whom the Software is furnished to do so, subject to + * the following conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE + * LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION + * OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + * WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +*/ +intellisense.annotate(jQuery, { + 'ajax': function() { + /// <signature> + /// <summary>Perform an asynchronous HTTP (Ajax) request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="settings" type="Object">A set of key/value pairs that configure the Ajax request. All settings are optional. A default can be set for any option with $.ajaxSetup(). See jQuery.ajax( settings ) below for a complete list of all settings.</param> + /// <returns type="jqXHR" /> + /// </signature> + /// <signature> + /// <summary>Perform an asynchronous HTTP (Ajax) request.</summary> + /// <param name="settings" type="Object">A set of key/value pairs that configure the Ajax request. All settings are optional. A default can be set for any option with $.ajaxSetup().</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'ajaxPrefilter': function() { + /// <signature> + /// <summary>Handle custom Ajax options or modify existing options before each request is sent and before they are processed by $.ajax().</summary> + /// <param name="dataTypes" type="String">An optional string containing one or more space-separated dataTypes</param> + /// <param name="handler(options, originalOptions, jqXHR)" type="Function">A handler to set default values for future Ajax requests.</param> + /// </signature> + }, + 'ajaxSetup': function() { + /// <signature> + /// <summary>Set default values for future Ajax requests.</summary> + /// <param name="options" type="Object">A set of key/value pairs that configure the default Ajax request. All options are optional.</param> + /// </signature> + }, + 'boxModel': function() { + /// <summary>Deprecated in jQuery 1.3 (see jQuery.support). States if the current page, in the user's browser, is being rendered using the W3C CSS Box Model.</summary> + /// <returns type="Boolean" /> + }, + 'browser': function() { + /// <summary>Contains flags for the useragent, read from navigator.userAgent. We recommend against using this property; please try to use feature detection instead (see jQuery.support). jQuery.browser may be moved to a plugin in a future release of jQuery.</summary> + /// <returns type="Map" /> + }, + 'browser.version': function() { + /// <summary>The version number of the rendering engine for the user's browser.</summary> + /// <returns type="String" /> + }, + 'Callbacks': function() { + /// <signature> + /// <summary>A multi-purpose callbacks list object that provides a powerful way to manage callback lists.</summary> + /// <param name="flags" type="String">An optional list of space-separated flags that change how the callback list behaves.</param> + /// </signature> + }, + 'contains': function() { + /// <signature> + /// <summary>Check to see if a DOM element is within another DOM element.</summary> + /// <param name="container" type="Element">The DOM element that may contain the other element.</param> + /// <param name="contained" type="Element">The DOM element that may be contained by the other element.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'cssHooks': function() { + /// <summary>Hook directly into jQuery to override how particular CSS properties are retrieved or set, normalize CSS property naming, or create custom properties.</summary> + /// <returns type="Object" /> + }, + 'data': function() { + /// <signature> + /// <summary>Returns value at named data store for the element, as set by jQuery.data(element, name, value), or the full data store for the element.</summary> + /// <param name="element" type="Element">The DOM element to query for the data.</param> + /// <param name="key" type="String">Name of the data stored.</param> + /// <returns type="Object" /> + /// </signature> + /// <signature> + /// <summary>Returns value at named data store for the element, as set by jQuery.data(element, name, value), or the full data store for the element.</summary> + /// <param name="element" type="Element">The DOM element to query for the data.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'dequeue': function() { + /// <signature> + /// <summary>Execute the next function on the queue for the matched element.</summary> + /// <param name="element" type="Element">A DOM element from which to remove and execute a queued function.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'each': function() { + /// <signature> + /// <summary>A generic iterator function, which can be used to seamlessly iterate over both objects and arrays. Arrays and array-like objects with a length property (such as a function's arguments object) are iterated by numeric index, from 0 to length-1. Other objects are iterated via their named properties.</summary> + /// <param name="collection" type="Object">The object or array to iterate over.</param> + /// <param name="callback(indexInArray, valueOfElement)" type="Function">The function that will be executed on every object.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'error': function() { + /// <signature> + /// <summary>Takes a string and throws an exception containing it.</summary> + /// <param name="message" type="String">The message to send out.</param> + /// </signature> + }, + 'extend': function() { + /// <signature> + /// <summary>Merge the contents of two or more objects together into the first object.</summary> + /// <param name="target" type="Object">An object that will receive the new properties if additional objects are passed in or that will extend the jQuery namespace if it is the sole argument.</param> + /// <param name="object1" type="Object">An object containing additional properties to merge in.</param> + /// <param name="objectN" type="Object">Additional objects containing properties to merge in.</param> + /// <returns type="Object" /> + /// </signature> + /// <signature> + /// <summary>Merge the contents of two or more objects together into the first object.</summary> + /// <param name="deep" type="Boolean">If true, the merge becomes recursive (aka. deep copy).</param> + /// <param name="target" type="Object">The object to extend. It will receive the new properties.</param> + /// <param name="object1" type="Object">An object containing additional properties to merge in.</param> + /// <param name="objectN" type="Object">Additional objects containing properties to merge in.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'get': function() { + /// <signature> + /// <summary>Load data from the server using a HTTP GET request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="String">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <param name="dataType" type="String">The type of data expected from the server. Default: Intelligent Guess (xml, json, script, or html).</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'getJSON': function() { + /// <signature> + /// <summary>Load JSON-encoded data from the server using a GET HTTP request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="Object">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'getScript': function() { + /// <signature> + /// <summary>Load a JavaScript file from the server using a GET HTTP request, then execute it.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="success(script, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'globalEval': function() { + /// <signature> + /// <summary>Execute some JavaScript code globally.</summary> + /// <param name="code" type="String">The JavaScript code to execute.</param> + /// </signature> + }, + 'grep': function() { + /// <signature> + /// <summary>Finds the elements of an array which satisfy a filter function. The original array is not affected.</summary> + /// <param name="array" type="Array">The array to search through.</param> + /// <param name="function(elementOfArray, indexInArray)" type="Function">The function to process each item against. The first argument to the function is the item, and the second argument is the index. The function should return a Boolean value. this will be the global window object.</param> + /// <param name="invert" type="Boolean">If "invert" is false, or not provided, then the function returns an array consisting of all elements for which "callback" returns true. If "invert" is true, then the function returns an array consisting of all elements for which "callback" returns false.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'hasData': function() { + /// <signature> + /// <summary>Determine whether an element has any jQuery data associated with it.</summary> + /// <param name="element" type="Element">A DOM element to be checked for data.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'holdReady': function() { + /// <signature> + /// <summary>Holds or releases the execution of jQuery's ready event.</summary> + /// <param name="hold" type="Boolean">Indicates whether the ready hold is being requested or released</param> + /// </signature> + }, + 'inArray': function() { + /// <signature> + /// <summary>Search for a specified value within an array and return its index (or -1 if not found).</summary> + /// <param name="value" type="Object">The value to search for.</param> + /// <param name="array" type="Array">An array through which to search.</param> + /// <param name="fromIndex" type="Number">The index of the array at which to begin the search. The default is 0, which will search the whole array.</param> + /// <returns type="Number" /> + /// </signature> + }, + 'isArray': function() { + /// <signature> + /// <summary>Determine whether the argument is an array.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is an array.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isEmptyObject': function() { + /// <signature> + /// <summary>Check to see if an object is empty (contains no properties).</summary> + /// <param name="object" type="Object">The object that will be checked to see if it's empty.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isFunction': function() { + /// <signature> + /// <summary>Determine if the argument passed is a Javascript function object.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is a function.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isNumeric': function() { + /// <signature> + /// <summary>Determines whether its argument is a number.</summary> + /// <param name="value" type="Object">The value to be tested.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isPlainObject': function() { + /// <signature> + /// <summary>Check to see if an object is a plain object (created using "{}" or "new Object").</summary> + /// <param name="object" type="Object">The object that will be checked to see if it's a plain object.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'isWindow': function() { + /// <signature> + /// <summary>Determine whether the argument is a window.</summary> + /// <param name="obj" type="Object">Object to test whether or not it is a window.</param> + /// <returns type="boolean" /> + /// </signature> + }, + 'isXMLDoc': function() { + /// <signature> + /// <summary>Check to see if a DOM node is within an XML document (or is an XML document).</summary> + /// <param name="node" type="Element">The DOM node that will be checked to see if it's in an XML document.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'makeArray': function() { + /// <signature> + /// <summary>Convert an array-like object into a true JavaScript array.</summary> + /// <param name="obj" type="Object">Any object to turn into a native Array.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'map': function() { + /// <signature> + /// <summary>Translate all items in an array or object to new array of items.</summary> + /// <param name="array" type="Array">The Array to translate.</param> + /// <param name="callback(elementOfArray, indexInArray)" type="Function">The function to process each item against. The first argument to the function is the array item, the second argument is the index in array The function can return any value. Within the function, this refers to the global (window) object.</param> + /// <returns type="Array" /> + /// </signature> + /// <signature> + /// <summary>Translate all items in an array or object to new array of items.</summary> + /// <param name="arrayOrObject" type="Object">The Array or Object to translate.</param> + /// <param name="callback( value, indexOrKey )" type="Function">The function to process each item against. The first argument to the function is the value; the second argument is the index or key of the array or object property. The function can return any value to add to the array. A returned array will be flattened into the resulting array. Within the function, this refers to the global (window) object.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'merge': function() { + /// <signature> + /// <summary>Merge the contents of two arrays together into the first array.</summary> + /// <param name="first" type="Array">The first array to merge, the elements of second added.</param> + /// <param name="second" type="Array">The second array to merge into the first, unaltered.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'noConflict': function() { + /// <signature> + /// <summary>Relinquish jQuery's control of the $ variable.</summary> + /// <param name="removeAll" type="Boolean">A Boolean indicating whether to remove all jQuery variables from the global scope (including jQuery itself).</param> + /// <returns type="Object" /> + /// </signature> + }, + 'noop': function() { + /// <summary>An empty function.</summary> + /// <returns type="Function" /> + }, + 'now': function() { + /// <summary>Return a number representing the current time.</summary> + /// <returns type="Number" /> + }, + 'param': function() { + /// <signature> + /// <summary>Create a serialized representation of an array or object, suitable for use in a URL query string or Ajax request.</summary> + /// <param name="obj" type="Object">An array or object to serialize.</param> + /// <returns type="String" /> + /// </signature> + /// <signature> + /// <summary>Create a serialized representation of an array or object, suitable for use in a URL query string or Ajax request.</summary> + /// <param name="obj" type="Object">An array or object to serialize.</param> + /// <param name="traditional" type="Boolean">A Boolean indicating whether to perform a traditional "shallow" serialization.</param> + /// <returns type="String" /> + /// </signature> + }, + 'parseJSON': function() { + /// <signature> + /// <summary>Takes a well-formed JSON string and returns the resulting JavaScript object.</summary> + /// <param name="json" type="String">The JSON string to parse.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'parseXML': function() { + /// <signature> + /// <summary>Parses a string into an XML document.</summary> + /// <param name="data" type="String">a well-formed XML string to be parsed</param> + /// <returns type="XMLDocument" /> + /// </signature> + }, + 'post': function() { + /// <signature> + /// <summary>Load data from the server using a HTTP POST request.</summary> + /// <param name="url" type="String">A string containing the URL to which the request is sent.</param> + /// <param name="data" type="String">A map or string that is sent to the server with the request.</param> + /// <param name="success(data, textStatus, jqXHR)" type="Function">A callback function that is executed if the request succeeds.</param> + /// <param name="dataType" type="String">The type of data expected from the server. Default: Intelligent Guess (xml, json, script, text, html).</param> + /// <returns type="jqXHR" /> + /// </signature> + }, + 'proxy': function() { + /// <signature> + /// <summary>Takes a function and returns a new one that will always have a particular context.</summary> + /// <param name="function" type="Function">The function whose context will be changed.</param> + /// <param name="context" type="Object">The object to which the context (this) of the function should be set.</param> + /// <returns type="Function" /> + /// </signature> + /// <signature> + /// <summary>Takes a function and returns a new one that will always have a particular context.</summary> + /// <param name="context" type="Object">The object to which the context of the function should be set.</param> + /// <param name="name" type="String">The name of the function whose context will be changed (should be a property of the context object).</param> + /// <returns type="Function" /> + /// </signature> + }, + 'queue': function() { + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched element.</summary> + /// <param name="element" type="Element">A DOM element where the array of queued functions is attached.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="newQueue" type="Array">An array of functions to replace the current queue contents.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched element.</summary> + /// <param name="element" type="Element">A DOM element on which to add a queued function.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="callback()" type="Function">The new function to add to the queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeData': function() { + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="element" type="Element">A DOM element from which to remove data.</param> + /// <param name="name" type="String">A string naming the piece of data to remove.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'sub': function() { + /// <summary>Creates a new copy of jQuery whose properties and methods can be modified without affecting the original jQuery object.</summary> + /// <returns type="jQuery" /> + }, + 'support': function() { + /// <summary>A collection of properties that represent the presence of different browser features or bugs. Primarily intended for jQuery's internal use; specific properties may be removed when they are no longer needed internally to improve page startup performance.</summary> + /// <returns type="Object" /> + }, + 'trim': function() { + /// <signature> + /// <summary>Remove the whitespace from the beginning and end of a string.</summary> + /// <param name="str" type="String">The string to trim.</param> + /// <returns type="String" /> + /// </signature> + }, + 'type': function() { + /// <signature> + /// <summary>Determine the internal JavaScript [[Class]] of an object.</summary> + /// <param name="obj" type="Object">Object to get the internal JavaScript [[Class]] of.</param> + /// <returns type="String" /> + /// </signature> + }, + 'unique': function() { + /// <signature> + /// <summary>Sorts an array of DOM elements, in place, with the duplicates removed. Note that this only works on arrays of DOM elements, not strings or numbers.</summary> + /// <param name="array" type="Array">The Array of DOM elements.</param> + /// <returns type="Array" /> + /// </signature> + }, + 'when': function() { + /// <signature> + /// <summary>Provides a way to execute callback functions based on one or more objects, usually Deferred objects that represent asynchronous events.</summary> + /// <param name="deferreds" type="Deferred">One or more Deferred objects, or plain JavaScript objects.</param> + /// <returns type="Promise" /> + /// </signature> + }, +}); + +var _1228819969 = jQuery.Callbacks; +jQuery.Callbacks = function(flags) { +var _object = _1228819969(flags); +intellisense.annotate(_object, { + 'add': function() { + /// <signature> + /// <summary>Add a callback or a collection of callbacks to a callback list.</summary> + /// <param name="callbacks" type="Function">A function, or array of functions, that are to be added to the callback list.</param> + /// </signature> + }, + 'disable': function() { + /// <summary>Disable a callback list from doing anything more.</summary> + }, + 'empty': function() { + /// <summary>Remove all of the callbacks from a list.</summary> + }, + 'fire': function() { + /// <signature> + /// <summary>Call all of the callbacks with the given arguments</summary> + /// <param name="arguments" type="">The argument or list of arguments to pass back to the callback list.</param> + /// </signature> + }, + 'fired': function() { + /// <summary>Determine if the callbacks have already been called at least once.</summary> + /// <returns type="Boolean" /> + }, + 'fireWith': function() { + /// <signature> + /// <summary>Call all callbacks in a list with the given context and arguments.</summary> + /// <param name="context" type="">A reference to the context in which the callbacks in the list should be fired.</param> + /// <param name="args" type="">An argument, or array of arguments, to pass to the callbacks in the list.</param> + /// </signature> + }, + 'has': function() { + /// <signature> + /// <summary>Determine whether a supplied callback is in a list</summary> + /// <param name="callback" type="Function">The callback to search for.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'lock': function() { + /// <summary>Lock a callback list in its current state.</summary> + }, + 'locked': function() { + /// <summary>Determine if the callbacks list has been locked.</summary> + /// <returns type="Boolean" /> + }, + 'remove': function() { + /// <signature> + /// <summary>Remove a callback or a collection of callbacks from a callback list.</summary> + /// <param name="callbacks" type="Function">A function, or array of functions, that are to be removed from the callback list.</param> + /// </signature> + }, +}); + +return _object; +}; + +var _731531622 = jQuery.Deferred; +jQuery.Deferred = function(func) { +var _object = _731531622(func); +intellisense.annotate(_object, { + 'always': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is either resolved or rejected.</summary> + /// <param name="alwaysCallbacks" type="Function">A function, or array of functions, that is called when the Deferred is resolved or rejected.</param> + /// <param name="alwaysCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is resolved or rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'done': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, that are called when the Deferred is resolved.</param> + /// <param name="doneCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is resolved.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'fail': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is rejected.</summary> + /// <param name="failCallbacks" type="Function">A function, or array of functions, that are called when the Deferred is rejected.</param> + /// <param name="failCallbacks" type="Function">Optional additional functions, or arrays of functions, that are called when the Deferred is rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'isRejected': function() { + /// <summary>Determine whether a Deferred object has been rejected.</summary> + /// <returns type="Boolean" /> + }, + 'isResolved': function() { + /// <summary>Determine whether a Deferred object has been resolved.</summary> + /// <returns type="Boolean" /> + }, + 'notify': function() { + /// <signature> + /// <summary>Call the progressCallbacks on a Deferred object with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the progressCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'notifyWith': function() { + /// <signature> + /// <summary>Call the progressCallbacks on a Deferred object with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the progressCallbacks as the this object.</param> + /// <param name="args" type="Object">Optional arguments that are passed to the progressCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'pipe': function() { + /// <signature> + /// <summary>Utility method to filter and/or chain Deferreds.</summary> + /// <param name="doneFilter" type="Function">An optional function that is called when the Deferred is resolved.</param> + /// <param name="failFilter" type="Function">An optional function that is called when the Deferred is rejected.</param> + /// <returns type="Promise" /> + /// </signature> + /// <signature> + /// <summary>Utility method to filter and/or chain Deferreds.</summary> + /// <param name="doneFilter" type="Function">An optional function that is called when the Deferred is resolved.</param> + /// <param name="failFilter" type="Function">An optional function that is called when the Deferred is rejected.</param> + /// <param name="progressFilter" type="Function">An optional function that is called when progress notifications are sent to the Deferred.</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'progress': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object generates progress notifications.</summary> + /// <param name="progressCallbacks" type="Function">A function, or array of functions, that is called when the Deferred generates progress notifications.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'promise': function() { + /// <signature> + /// <summary>Return a Deferred's Promise object.</summary> + /// <param name="target" type="Object">Object onto which the promise methods have to be attached</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'reject': function() { + /// <signature> + /// <summary>Reject a Deferred object and call any failCallbacks with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the failCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'rejectWith': function() { + /// <signature> + /// <summary>Reject a Deferred object and call any failCallbacks with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the failCallbacks as the this object.</param> + /// <param name="args" type="Array">An optional array of arguments that are passed to the failCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'resolve': function() { + /// <signature> + /// <summary>Resolve a Deferred object and call any doneCallbacks with the given args.</summary> + /// <param name="args" type="Object">Optional arguments that are passed to the doneCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'resolveWith': function() { + /// <signature> + /// <summary>Resolve a Deferred object and call any doneCallbacks with the given context and args.</summary> + /// <param name="context" type="Object">Context passed to the doneCallbacks as the this object.</param> + /// <param name="args" type="Array">An optional array of arguments that are passed to the doneCallbacks.</param> + /// <returns type="Deferred" /> + /// </signature> + }, + 'state': function() { + /// <summary>Determine the current state of a Deferred object.</summary> + /// <returns type="String" /> + }, + 'then': function() { + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved or rejected.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, called when the Deferred is resolved.</param> + /// <param name="failCallbacks" type="Function">A function, or array of functions, called when the Deferred is rejected.</param> + /// <returns type="Deferred" /> + /// </signature> + /// <signature> + /// <summary>Add handlers to be called when the Deferred object is resolved or rejected.</summary> + /// <param name="doneCallbacks" type="Function">A function, or array of functions, called when the Deferred is resolved.</param> + /// <param name="failCallbacks" type="Function">A function, or array of functions, called when the Deferred is rejected.</param> + /// <param name="progressCallbacks" type="Function">A function, or array of functions, called when the Deferred notifies progress.</param> + /// <returns type="Deferred" /> + /// </signature> + }, +}); + +return _object; +}; + +intellisense.annotate(jQuery.Event.prototype, { + 'currentTarget': function() { + /// <summary>The current DOM element within the event bubbling phase.</summary> + /// <returns type="Element" /> + }, + 'data': function() { + /// <summary>An optional data map passed to an event method when the current executing handler is bound.</summary> + }, + 'delegateTarget': function() { + /// <summary>The element where the currently-called jQuery event handler was attached.</summary> + /// <returns type="Element" /> + }, + 'isDefaultPrevented': function() { + /// <summary>Returns whether event.preventDefault() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'isImmediatePropagationStopped': function() { + /// <summary>Returns whether event.stopImmediatePropagation() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'isPropagationStopped': function() { + /// <summary>Returns whether event.stopPropagation() was ever called on this event object.</summary> + /// <returns type="Boolean" /> + }, + 'namespace': function() { + /// <summary>The namespace specified when the event was triggered.</summary> + /// <returns type="String" /> + }, + 'pageX': function() { + /// <summary>The mouse position relative to the left edge of the document.</summary> + /// <returns type="Number" /> + }, + 'pageY': function() { + /// <summary>The mouse position relative to the top edge of the document.</summary> + /// <returns type="Number" /> + }, + 'preventDefault': function() { + /// <summary>If this method is called, the default action of the event will not be triggered.</summary> + }, + 'relatedTarget': function() { + /// <summary>The other DOM element involved in the event, if any.</summary> + /// <returns type="Element" /> + }, + 'result': function() { + /// <summary>The last value returned by an event handler that was triggered by this event, unless the value was undefined.</summary> + /// <returns type="Object" /> + }, + 'stopImmediatePropagation': function() { + /// <summary>Keeps the rest of the handlers from being executed and prevents the event from bubbling up the DOM tree.</summary> + }, + 'stopPropagation': function() { + /// <summary>Prevents the event from bubbling up the DOM tree, preventing any parent handlers from being notified of the event.</summary> + }, + 'target': function() { + /// <summary>The DOM element that initiated the event.</summary> + /// <returns type="Element" /> + }, + 'timeStamp': function() { + /// <summary>The difference in milliseconds between the time the browser created the event and January 1, 1970.</summary> + /// <returns type="Number" /> + }, + 'type': function() { + /// <summary>Describes the nature of the event.</summary> + /// <returns type="String" /> + }, + 'which': function() { + /// <summary>For key or mouse events, this property indicates the specific key or button that was pressed.</summary> + /// <returns type="Number" /> + }, +}); + +intellisense.annotate(jQuery.fn, { + 'add': function() { + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="selector" type="String">A string representing a selector expression to find additional elements to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="elements" type="Array">One or more elements to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="html" type="String">An HTML fragment to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="jQuery object" type="jQuery object ">An existing jQuery object to add to the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add elements to the set of matched elements.</summary> + /// <param name="selector" type="String">A string representing a selector expression to find additional elements to add to the set of matched elements.</param> + /// <param name="context" type="Element">The point in the document at which the selector should begin matching; similar to the context argument of the $(selector, context) method.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'addClass': function() { + /// <signature> + /// <summary>Adds the specified class(es) to each of the set of matched elements.</summary> + /// <param name="className" type="String">One or more class names to be added to the class attribute of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Adds the specified class(es) to each of the set of matched elements.</summary> + /// <param name="function(index, currentClass)" type="Function">A function returning one or more space-separated class names to be added to the existing class name(s). Receives the index position of the element in the set and the existing class name(s) as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'after': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, after each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">HTML string, DOM element, or jQuery object to insert after each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert after each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, after each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert after each element in the set of matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxComplete': function() { + /// <signature> + /// <summary>Register a handler to be called when Ajax requests complete. This is an Ajax Event.</summary> + /// <param name="handler(event, XMLHttpRequest, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxError': function() { + /// <signature> + /// <summary>Register a handler to be called when Ajax requests complete with an error. This is an Ajax Event.</summary> + /// <param name="handler(event, jqXHR, ajaxSettings, thrownError)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxSend': function() { + /// <signature> + /// <summary>Attach a function to be executed before an Ajax request is sent. This is an Ajax Event.</summary> + /// <param name="handler(event, jqXHR, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxStart': function() { + /// <signature> + /// <summary>Register a handler to be called when the first Ajax request begins. This is an Ajax Event.</summary> + /// <param name="handler()" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxStop': function() { + /// <signature> + /// <summary>Register a handler to be called when all Ajax requests have completed. This is an Ajax Event.</summary> + /// <param name="handler()" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'ajaxSuccess': function() { + /// <signature> + /// <summary>Attach a function to be executed whenever an Ajax request completes successfully. This is an Ajax Event.</summary> + /// <param name="handler(event, XMLHttpRequest, ajaxOptions)" type="Function">The function to be invoked.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'all': function() { + /// <summary>Selects all elements.</summary> + }, + 'andSelf': function() { + /// <summary>Add the previous set of elements on the stack to the current set.</summary> + /// <returns type="jQuery" /> + }, + 'animate': function() { + /// <signature> + /// <summary>Perform a custom animation of a set of CSS properties.</summary> + /// <param name="properties" type="Object">A map of CSS properties that the animation will move toward.</param> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="complete" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Perform a custom animation of a set of CSS properties.</summary> + /// <param name="properties" type="Object">A map of CSS properties that the animation will move toward.</param> + /// <param name="options" type="Object">A map of additional options to pass to the method. Supported keys: duration: A string or number determining how long the animation will run.easing: A string indicating which easing function to use for the transition.complete: A function to call once the animation is complete.step: A function to be called after each step of the animation.queue: A Boolean indicating whether to place the animation in the effects queue. If false, the animation will begin immediately. As of jQuery 1.7, the queue option can also accept a string, in which case the animation is added to the queue represented by that string.specialEasing: A map of one or more of the CSS properties defined by the properties argument and their corresponding easing functions (added 1.4).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'animated': function() { + /// <summary>Select all elements that are in the progress of an animation at the time the selector is run.</summary> + }, + 'append': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, to the end of each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">DOM element, HTML string, or jQuery object to insert at the end of each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert at the end of each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, to the end of each element in the set of matched elements.</summary> + /// <param name="function(index, html)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert at the end of each element in the set of matched elements. Receives the index position of the element in the set and the old HTML value of the element as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'appendTo': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements to the end of the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted at the end of the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'attr': function() { + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="attributeName" type="String">The name of the attribute to set.</param> + /// <param name="value" type="Number">A value to set for the attribute.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of attribute-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more attributes for the set of matched elements.</summary> + /// <param name="attributeName" type="String">The name of the attribute to set.</param> + /// <param name="function(index, attr)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old attribute value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'attributeContains': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value containing the a given substring.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeContainsPrefix': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value either equal to a given string or starting with that string followed by a hyphen (-).</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeContainsWord': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value containing a given word, delimited by spaces.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeEndsWith': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value ending exactly with a given string. The comparison is case sensitive.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeEquals': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value exactly equal to a certain value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeHas': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute, with any value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// </signature> + }, + 'attributeMultiple': function() { + /// <signature> + /// <summary>Matches elements that match all of the specified attribute filters.</summary> + /// <param name="attributeFilter1" type="String">An attribute filter.</param> + /// <param name="attributeFilter2" type="String">Another attribute filter, reducing the selection even more</param> + /// <param name="attributeFilterN" type="String">As many more attribute filters as necessary</param> + /// </signature> + }, + 'attributeNotEqual': function() { + /// <signature> + /// <summary>Select elements that either don't have the specified attribute, or do have the specified attribute but not with a certain value.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'attributeStartsWith': function() { + /// <signature> + /// <summary>Selects elements that have the specified attribute with a value beginning exactly with a given string.</summary> + /// <param name="attribute" type="String">An attribute name.</param> + /// <param name="value" type="String">An attribute value. Can be either an unquoted single word or a quoted string.</param> + /// </signature> + }, + 'before': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, before each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">HTML string, DOM element, or jQuery object to insert before each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert before each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, before each element in the set of matched elements.</summary> + /// <param name="function" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert before each element in the set of matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'bind': function() { + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="eventType" type="String">A string containing one or more DOM event types, such as "click" or "submit," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="eventType" type="String">A string containing one or more DOM event types, such as "click" or "submit," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="preventBubble" type="Boolean">Setting the third argument to false will attach a function that prevents the default action from occurring and stops the event from bubbling. The default is true.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements.</summary> + /// <param name="events" type="Object">A map of one or more DOM event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'blur': function() { + /// <signature> + /// <summary>Bind an event handler to the "blur" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "blur" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'button': function() { + /// <summary>Selects all button elements and elements of type button.</summary> + }, + 'change': function() { + /// <signature> + /// <summary>Bind an event handler to the "change" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "change" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'checkbox': function() { + /// <summary>Selects all elements of type checkbox.</summary> + }, + 'checked': function() { + /// <summary>Matches all elements that are checked.</summary> + }, + 'child': function() { + /// <signature> + /// <summary>Selects all direct child elements specified by "child" of elements specified by "parent".</summary> + /// <param name="parent" type="String">Any valid selector.</param> + /// <param name="child" type="String">A selector to filter the child elements.</param> + /// </signature> + }, + 'children': function() { + /// <signature> + /// <summary>Get the children of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'class': function() { + /// <signature> + /// <summary>Selects all elements with the given class.</summary> + /// <param name="class" type="String">A class to search for. An element can have multiple classes; only one of them must match.</param> + /// </signature> + }, + 'clearQueue': function() { + /// <signature> + /// <summary>Remove from the queue all items that have not yet been run.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'click': function() { + /// <signature> + /// <summary>Bind an event handler to the "click" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "click" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'clone': function() { + /// <signature> + /// <summary>Create a deep copy of the set of matched elements.</summary> + /// <param name="withDataAndEvents" type="Boolean">A Boolean indicating whether event handlers should be copied along with the elements. As of jQuery 1.4, element data will be copied as well.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Create a deep copy of the set of matched elements.</summary> + /// <param name="withDataAndEvents" type="Boolean">A Boolean indicating whether event handlers and data should be copied along with the elements. The default value is false. *In jQuery 1.5.0 the default value was incorrectly true; it was changed back to false in 1.5.1 and up.</param> + /// <param name="deepWithDataAndEvents" type="Boolean">A Boolean indicating whether event handlers and data for all children of the cloned element should be copied. By default its value matches the first argument's value (which defaults to false).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'closest': function() { + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <param name="context" type="Element">A DOM element within which a matching element may be found. If no context is passed in then the context of the jQuery set will be used instead.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="jQuery object" type="jQuery">A jQuery object to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the first element that matches the selector, beginning at the current element and progressing up through the DOM tree.</summary> + /// <param name="element" type="Element">An element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'contains': function() { + /// <signature> + /// <summary>Select all elements that contain the specified text.</summary> + /// <param name="text" type="String">A string of text to look for. It's case sensitive.</param> + /// </signature> + }, + 'contents': function() { + /// <summary>Get the children of each element in the set of matched elements, including text and comment nodes.</summary> + /// <returns type="jQuery" /> + }, + 'context': function() { + /// <summary>The DOM node context originally passed to jQuery(); if none was passed then context will likely be the document.</summary> + /// <returns type="Element" /> + }, + 'css': function() { + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">A CSS property name.</param> + /// <param name="value" type="Number">A value to set for the property.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">A CSS property name.</param> + /// <param name="function(index, value)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more CSS properties for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of property-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'data': function() { + /// <signature> + /// <summary>Store arbitrary data associated with the matched elements.</summary> + /// <param name="key" type="String">A string naming the piece of data to set.</param> + /// <param name="value" type="Object">The new data value; it can be any Javascript type including Array or Object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Store arbitrary data associated with the matched elements.</summary> + /// <param name="obj" type="Object">An object of key-value pairs of data to update.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'dblclick': function() { + /// <signature> + /// <summary>Bind an event handler to the "dblclick" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "dblclick" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'delay': function() { + /// <signature> + /// <summary>Set a timer to delay execution of subsequent items in the queue.</summary> + /// <param name="duration" type="Number">An integer indicating the number of milliseconds to delay execution of the next item in the queue.</param> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'delegate': function() { + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="eventType" type="String">A string containing one or more space-separated JavaScript event types, such as "click" or "keydown," or custom event names.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="eventType" type="String">A string containing one or more space-separated JavaScript event types, such as "click" or "keydown," or custom event names.</param> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to one or more events for all elements that match the selector, now or in the future, based on a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector to filter the elements that trigger the event.</param> + /// <param name="events" type="Object">A map of one or more event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'dequeue': function() { + /// <signature> + /// <summary>Execute the next function on the queue for the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'descendant': function() { + /// <signature> + /// <summary>Selects all elements that are descendants of a given ancestor.</summary> + /// <param name="ancestor" type="String">Any valid selector.</param> + /// <param name="descendant" type="String">A selector to filter the descendant elements.</param> + /// </signature> + }, + 'detach': function() { + /// <signature> + /// <summary>Remove the set of matched elements from the DOM.</summary> + /// <param name="selector" type="String">A selector expression that filters the set of matched elements to be removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'die': function() { + /// <signature> + /// <summary>Remove an event handler previously attached using .live() from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or keydown.</param> + /// <param name="handler" type="String">The function that is no longer to be executed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove an event handler previously attached using .live() from the elements.</summary> + /// <param name="eventTypes" type="Object">A map of one or more event types, such as click or keydown and their corresponding functions that are no longer to be executed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'disabled': function() { + /// <summary>Selects all elements that are disabled.</summary> + }, + 'each': function() { + /// <signature> + /// <summary>Iterate over a jQuery object, executing a function for each matched element.</summary> + /// <param name="function(index, Element)" type="Function">A function to execute for each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'element': function() { + /// <signature> + /// <summary>Selects all elements with the given tag name.</summary> + /// <param name="element" type="String">An element to search for. Refers to the tagName of DOM nodes.</param> + /// </signature> + }, + 'empty': function() { + /// <summary>Select all elements that have no children (including text nodes).</summary> + }, + 'enabled': function() { + /// <summary>Selects all elements that are enabled.</summary> + }, + 'end': function() { + /// <summary>End the most recent filtering operation in the current chain and return the set of matched elements to its previous state.</summary> + /// <returns type="jQuery" /> + }, + 'eq': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to the one at the specified index.</summary> + /// <param name="index" type="Number">An integer indicating the 0-based position of the element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to the one at the specified index.</summary> + /// <param name="-index" type="Number">An integer indicating the position of the element, counting backwards from the last element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'error': function() { + /// <signature> + /// <summary>Bind an event handler to the "error" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "error" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'even': function() { + /// <summary>Selects even elements, zero-indexed. See also odd.</summary> + }, + 'fadeIn': function() { + /// <signature> + /// <summary>Display the matched elements by fading them to opaque.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements by fading them to opaque.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeOut': function() { + /// <signature> + /// <summary>Hide the matched elements by fading them to transparent.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements by fading them to transparent.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeTo': function() { + /// <signature> + /// <summary>Adjust the opacity of the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="opacity" type="Number">A number between 0 and 1 denoting the target opacity.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Adjust the opacity of the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="opacity" type="Number">A number between 0 and 1 denoting the target opacity.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'fadeToggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements by animating their opacity.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'file': function() { + /// <summary>Selects all elements of type file.</summary> + }, + 'filter': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="function(index)" type="Function">A function used as a test for each element in the set. this is the current DOM element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="element" type="Element">An element to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that match the selector or pass the function's test.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'find': function() { + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="jQuery object" type="Object">A jQuery object to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the descendants of each element in the current set of matched elements, filtered by a selector, jQuery object, or element.</summary> + /// <param name="element" type="Element">An element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'first': function() { + /// <summary>Selects the first matched element.</summary> + }, + 'first-child': function() { + /// <summary>Selects all elements that are the first child of their parent.</summary> + }, + 'focus': function() { + /// <signature> + /// <summary>Bind an event handler to the "focus" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focus" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'focusin': function() { + /// <signature> + /// <summary>Bind an event handler to the "focusin" event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focusin" event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'focusout': function() { + /// <signature> + /// <summary>Bind an event handler to the "focusout" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "focusout" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'get': function() { + /// <signature> + /// <summary>Retrieve the DOM elements matched by the jQuery object.</summary> + /// <param name="index" type="Number">A zero-based integer indicating which element to retrieve.</param> + /// <returns type="Element, Array" /> + /// </signature> + }, + 'gt': function() { + /// <signature> + /// <summary>Select all elements at an index greater than index within the matched set.</summary> + /// <param name="index" type="Number">Zero-based index.</param> + /// </signature> + }, + 'has': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to those that have a descendant that matches the selector or DOM element.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Reduce the set of matched elements to those that have a descendant that matches the selector or DOM element.</summary> + /// <param name="contained" type="Element">A DOM element to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hasClass': function() { + /// <signature> + /// <summary>Determine whether any of the matched elements are assigned the given class.</summary> + /// <param name="className" type="String">The class name to search for.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'header': function() { + /// <summary>Selects all elements that are headers, like h1, h2, h3 and so on.</summary> + }, + 'height': function() { + /// <signature> + /// <summary>Set the CSS height of every matched element.</summary> + /// <param name="value" type="Number">An integer representing the number of pixels, or an integer with an optional unit of measure appended (as a string).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the CSS height of every matched element.</summary> + /// <param name="function(index, height)" type="Function">A function returning the height to set. Receives the index position of the element in the set and the old height as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hidden': function() { + /// <summary>Selects all elements that are hidden.</summary> + }, + 'hide': function() { + /// <signature> + /// <summary>Hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'hover': function() { + /// <signature> + /// <summary>Bind two handlers to the matched elements, to be executed when the mouse pointer enters and leaves the elements.</summary> + /// <param name="handlerIn(eventObject)" type="Function">A function to execute when the mouse pointer enters the element.</param> + /// <param name="handlerOut(eventObject)" type="Function">A function to execute when the mouse pointer leaves the element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'html': function() { + /// <signature> + /// <summary>Set the HTML contents of each element in the set of matched elements.</summary> + /// <param name="htmlString" type="String">A string of HTML to set as the content of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the HTML contents of each element in the set of matched elements.</summary> + /// <param name="function(index, oldhtml)" type="Function">A function returning the HTML content to set. Receives the index position of the element in the set and the old HTML value as arguments. jQuery empties the element before calling the function; use the oldhtml argument to reference the previous content. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'id': function() { + /// <signature> + /// <summary>Selects a single element with the given id attribute.</summary> + /// <param name="id" type="String">An ID to search for, specified via the id attribute of an element.</param> + /// </signature> + }, + 'image': function() { + /// <summary>Selects all elements of type image.</summary> + }, + 'index': function() { + /// <signature> + /// <summary>Search for a given element from among the matched elements.</summary> + /// <param name="selector" type="String">A selector representing a jQuery collection in which to look for an element.</param> + /// <returns type="Number" /> + /// </signature> + /// <signature> + /// <summary>Search for a given element from among the matched elements.</summary> + /// <param name="element" type="jQuery">The DOM element or first element within the jQuery object to look for.</param> + /// <returns type="Number" /> + /// </signature> + }, + 'init': function() { + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression</param> + /// <param name="context" type="jQuery">A DOM Element, Document, or jQuery to use as context</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="element" type="Element">A DOM element to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="object" type="Object">A plain object to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="elementArray" type="Array">An array containing a set of DOM elements to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to clone.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'innerHeight': function() { + /// <summary>Get the current computed height for the first element in the set of matched elements, including padding but not border.</summary> + /// <returns type="Integer" /> + }, + 'innerWidth': function() { + /// <summary>Get the current computed width for the first element in the set of matched elements, including padding but not border.</summary> + /// <returns type="Integer" /> + }, + 'input': function() { + /// <summary>Selects all input, textarea, select and button elements.</summary> + }, + 'insertAfter': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements after the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted after the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'insertBefore': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements before the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted before the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'is': function() { + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="function(index)" type="Function">A function used as a test for the set of elements. It accepts one argument, index, which is the element's index in the jQuery collection.Within the function, this refers to the current DOM element.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + /// <signature> + /// <summary>Check the current matched set of elements against a selector, element, or jQuery object and return true if at least one of these elements matches the given arguments.</summary> + /// <param name="element" type="Element">An element to match the current set of elements against.</param> + /// <returns type="Boolean" /> + /// </signature> + }, + 'jquery': function() { + /// <summary>A string containing the jQuery version number.</summary> + /// <returns type="String" /> + }, + 'keydown': function() { + /// <signature> + /// <summary>Bind an event handler to the "keydown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keydown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'keypress': function() { + /// <signature> + /// <summary>Bind an event handler to the "keypress" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keypress" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'keyup': function() { + /// <signature> + /// <summary>Bind an event handler to the "keyup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "keyup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'last': function() { + /// <summary>Selects the last matched element.</summary> + }, + 'last-child': function() { + /// <summary>Selects all elements that are the last child of their parent.</summary> + }, + 'length': function() { + /// <summary>The number of elements in the jQuery object.</summary> + /// <returns type="Number" /> + }, + 'live': function() { + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events" type="String">A string containing a JavaScript event type, such as "click" or "keydown." As of jQuery 1.4 the string can contain multiple, space-separated event types or custom event names.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events" type="String">A string containing a JavaScript event type, such as "click" or "keydown." As of jQuery 1.4 the string can contain multiple, space-separated event types or custom event names.</param> + /// <param name="data" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler for all elements which match the current selector, now and in the future.</summary> + /// <param name="events-map" type="Object">A map of one or more JavaScript event types and functions to execute for them.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'load': function() { + /// <signature> + /// <summary>Bind an event handler to the "load" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "load" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'lt': function() { + /// <signature> + /// <summary>Select all elements at an index less than index within the matched set.</summary> + /// <param name="index" type="Number">Zero-based index.</param> + /// </signature> + }, + 'map': function() { + /// <signature> + /// <summary>Pass each element in the current matched set through a function, producing a new jQuery object containing the return values.</summary> + /// <param name="callback(index, domElement)" type="Function">A function object that will be invoked for each element in the current set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mousedown': function() { + /// <signature> + /// <summary>Bind an event handler to the "mousedown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mousedown" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseenter': function() { + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse enters an element, or trigger that handler on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse enters an element, or trigger that handler on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseleave': function() { + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse leaves an element, or trigger that handler on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to be fired when the mouse leaves an element, or trigger that handler on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mousemove': function() { + /// <signature> + /// <summary>Bind an event handler to the "mousemove" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mousemove" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseout': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseout" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseout" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseover': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseover" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseover" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'mouseup': function() { + /// <signature> + /// <summary>Bind an event handler to the "mouseup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "mouseup" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'multiple': function() { + /// <signature> + /// <summary>Selects the combined results of all the specified selectors.</summary> + /// <param name="selector1" type="String">Any valid selector.</param> + /// <param name="selector2" type="String">Another valid selector.</param> + /// <param name="selectorN" type="String">As many more valid selectors as you like.</param> + /// </signature> + }, + 'next': function() { + /// <signature> + /// <summary>Get the immediately following sibling of each element in the set of matched elements. If a selector is provided, it retrieves the next sibling only if it matches that selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'next adjacent': function() { + /// <signature> + /// <summary>Selects all next elements matching "next" that are immediately preceded by a sibling "prev".</summary> + /// <param name="prev" type="String">Any valid selector.</param> + /// <param name="next" type="String">A selector to match the element that is next to the first selector.</param> + /// </signature> + }, + 'next siblings': function() { + /// <signature> + /// <summary>Selects all sibling elements that follow after the "prev" element, have the same parent, and match the filtering "siblings" selector.</summary> + /// <param name="prev" type="String">Any valid selector.</param> + /// <param name="siblings" type="String">A selector to filter elements that are the following siblings of the first selector.</param> + /// </signature> + }, + 'nextAll': function() { + /// <signature> + /// <summary>Get all following siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'nextUntil': function() { + /// <signature> + /// <summary>Get all following siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object passed.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching following sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get all following siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object passed.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching following sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'not': function() { + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="elements" type="Array">One or more DOM elements to remove from the matched set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A function used as a test for each element in the set. this is the current DOM element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove elements from the set of matched elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to match the current set of elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'nth-child': function() { + /// <signature> + /// <summary>Selects all elements that are the nth-child of their parent.</summary> + /// <param name="index" type="String">The index of each child to match, starting with 1, the string even or odd, or an equation ( eg. :nth-child(even), :nth-child(4n) )</param> + /// </signature> + }, + 'odd': function() { + /// <summary>Selects odd elements, zero-indexed. See also even.</summary> + }, + 'off': function() { + /// <signature> + /// <summary>Remove an event handler.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, or just namespaces, such as "click", "keydown.myPlugin", or ".myPlugin".</param> + /// <param name="selector" type="String">A selector which should match the one originally passed to .on() when attaching event handlers.</param> + /// <param name="handler(eventObject)" type="Function">A handler function previously attached for the event(s), or the special value false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove an event handler.</summary> + /// <param name="events-map" type="Object">A map where the string keys represent one or more space-separated event types and optional namespaces, and the values represent handler functions previously attached for the event(s).</param> + /// <param name="selector" type="String">A selector which should match the one originally passed to .on() when attaching event handlers.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'offset': function() { + /// <signature> + /// <summary>Set the current coordinates of every element in the set of matched elements, relative to the document.</summary> + /// <param name="coordinates" type="Object">An object containing the properties top and left, which are integers indicating the new top and left coordinates for the elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the current coordinates of every element in the set of matched elements, relative to the document.</summary> + /// <param name="function(index, coords)" type="Function">A function to return the coordinates to set. Receives the index of the element in the collection as the first argument and the current coordinates as the second argument. The function should return an object with the new top and left properties.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'offsetParent': function() { + /// <summary>Get the closest ancestor element that is positioned.</summary> + /// <returns type="jQuery" /> + }, + 'on': function() { + /// <signature> + /// <summary>Attach an event handler function for one or more events to the selected elements.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, such as "click" or "keydown.myPlugin".</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that trigger the event. If the selector is null or omitted, the event is always triggered when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event is triggered.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered. The value false is also allowed as a shorthand for a function that simply does return false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach an event handler function for one or more events to the selected elements.</summary> + /// <param name="events-map" type="Object">A map in which the string keys represent one or more space-separated event types and optional namespaces, and the values represent a handler function to be called for the event(s).</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that will call the handler. If the selector is null or omitted, the handler is always called when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event occurs.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'one': function() { + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events" type="String">A string containing one or more JavaScript event types, such as "click" or "submit," or custom event names.</param> + /// <param name="data" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events" type="String">One or more space-separated event types and optional namespaces, such as "click" or "keydown.myPlugin".</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that trigger the event. If the selector is null or omitted, the event is always triggered when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event is triggered.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered. The value false is also allowed as a shorthand for a function that simply does return false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Attach a handler to an event for the elements. The handler is executed at most once per element.</summary> + /// <param name="events-map" type="Object">A map in which the string keys represent one or more space-separated event types and optional namespaces, and the values represent a handler function to be called for the event(s).</param> + /// <param name="selector" type="String">A selector string to filter the descendants of the selected elements that will call the handler. If the selector is null or omitted, the handler is always called when it reaches the selected element.</param> + /// <param name="data" type="Anything">Data to be passed to the handler in event.data when an event occurs.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'only-child': function() { + /// <summary>Selects all elements that are the only child of their parent.</summary> + }, + 'outerHeight': function() { + /// <signature> + /// <summary>Get the current computed height for the first element in the set of matched elements, including padding, border, and optionally margin. Returns an integer (without "px") representation of the value or null if called on an empty set of elements.</summary> + /// <param name="includeMargin" type="Boolean">A Boolean indicating whether to include the element's margin in the calculation.</param> + /// <returns type="Integer" /> + /// </signature> + }, + 'outerWidth': function() { + /// <signature> + /// <summary>Get the current computed width for the first element in the set of matched elements, including padding and border.</summary> + /// <param name="includeMargin" type="Boolean">A Boolean indicating whether to include the element's margin in the calculation.</param> + /// <returns type="Integer" /> + /// </signature> + }, + 'parent': function() { + /// <signature> + /// <summary>Get the parent of each element in the current set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'parents': function() { + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'parentsUntil': function() { + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching ancestor elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get the ancestors of each element in the current set of matched elements, up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching ancestor elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'password': function() { + /// <summary>Selects all elements of type password.</summary> + }, + 'position': function() { + /// <summary>Get the current coordinates of the first element in the set of matched elements, relative to the offset parent.</summary> + /// <returns type="Object" /> + }, + 'prepend': function() { + /// <signature> + /// <summary>Insert content, specified by the parameter, to the beginning of each element in the set of matched elements.</summary> + /// <param name="content" type="jQuery">DOM element, array of elements, HTML string, or jQuery object to insert at the beginning of each element in the set of matched elements.</param> + /// <param name="content" type="jQuery">One or more additional DOM elements, arrays of elements, HTML strings, or jQuery objects to insert at the beginning of each element in the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Insert content, specified by the parameter, to the beginning of each element in the set of matched elements.</summary> + /// <param name="function(index, html)" type="Function">A function that returns an HTML string, DOM element(s), or jQuery object to insert at the beginning of each element in the set of matched elements. Receives the index position of the element in the set and the old HTML value of the element as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prependTo': function() { + /// <signature> + /// <summary>Insert every element in the set of matched elements to the beginning of the target.</summary> + /// <param name="target" type="jQuery">A selector, element, HTML string, or jQuery object; the matched set of elements will be inserted at the beginning of the element(s) specified by this parameter.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prev': function() { + /// <signature> + /// <summary>Get the immediately preceding sibling of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prevAll': function() { + /// <signature> + /// <summary>Get all preceding siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'prevUntil': function() { + /// <signature> + /// <summary>Get all preceding siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="selector" type="String">A string containing a selector expression to indicate where to stop matching preceding sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Get all preceding siblings of each element up to but not including the element matched by the selector, DOM node, or jQuery object.</summary> + /// <param name="element" type="Element">A DOM node or jQuery object indicating where to stop matching preceding sibling elements.</param> + /// <param name="filter" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'promise': function() { + /// <signature> + /// <summary>Return a Promise object to observe when all actions of a certain type bound to the collection, queued or not, have finished.</summary> + /// <param name="type" type="String">The type of queue that needs to be observed.</param> + /// <param name="target" type="Object">Object onto which the promise methods have to be attached</param> + /// <returns type="Promise" /> + /// </signature> + }, + 'prop': function() { + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <param name="value" type="Boolean">A value to set for the property.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="map" type="Object">A map of property-value pairs to set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set one or more properties for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <param name="function(index, oldPropertyValue)" type="Function">A function returning the value to set. Receives the index position of the element in the set and the old property value as arguments. Within the function, the keyword this refers to the current element.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'pushStack': function() { + /// <signature> + /// <summary>Add a collection of DOM elements onto the jQuery stack.</summary> + /// <param name="elements" type="Array">An array of elements to push onto the stack and make into a new jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add a collection of DOM elements onto the jQuery stack.</summary> + /// <param name="elements" type="Array">An array of elements to push onto the stack and make into a new jQuery object.</param> + /// <param name="name" type="String">The name of a jQuery method that generated the array of elements.</param> + /// <param name="arguments" type="Array">The arguments that were passed in to the jQuery method (for serialization).</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'queue': function() { + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="newQueue" type="Array">An array of functions to replace the current queue contents.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Manipulate the queue of functions to be executed on the matched elements.</summary> + /// <param name="queueName" type="String">A string containing the name of the queue. Defaults to fx, the standard effects queue.</param> + /// <param name="callback( next )" type="Function">The new function to add to the queue, with a function to call that will dequeue the next item.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'radio': function() { + /// <summary>Selects all elements of type radio.</summary> + }, + 'ready': function() { + /// <signature> + /// <summary>Specify a function to execute when the DOM is fully loaded.</summary> + /// <param name="handler" type="Function">A function to execute after the DOM is ready.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'remove': function() { + /// <signature> + /// <summary>Remove the set of matched elements from the DOM.</summary> + /// <param name="selector" type="String">A selector expression that filters the set of matched elements to be removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeAttr': function() { + /// <signature> + /// <summary>Remove an attribute from each element in the set of matched elements.</summary> + /// <param name="attributeName" type="String">An attribute to remove; as of version 1.7, it can be a space-separated list of attributes.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeClass': function() { + /// <signature> + /// <summary>Remove a single class, multiple classes, or all classes from each element in the set of matched elements.</summary> + /// <param name="className" type="String">One or more space-separated classes to be removed from the class attribute of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a single class, multiple classes, or all classes from each element in the set of matched elements.</summary> + /// <param name="function(index, class)" type="Function">A function returning one or more space-separated class names to be removed. Receives the index position of the element in the set and the old class value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeData': function() { + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="name" type="String">A string naming the piece of data to delete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-stored piece of data.</summary> + /// <param name="list" type="String">An array or space-separated string naming the pieces of data to delete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'removeProp': function() { + /// <signature> + /// <summary>Remove a property for the set of matched elements.</summary> + /// <param name="propertyName" type="String">The name of the property to set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'replaceAll': function() { + /// <signature> + /// <summary>Replace each target element with the set of matched elements.</summary> + /// <param name="target" type="String">A selector expression indicating which element(s) to replace.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'replaceWith': function() { + /// <signature> + /// <summary>Replace each element in the set of matched elements with the provided new content.</summary> + /// <param name="newContent" type="jQuery">The content to insert. May be an HTML string, DOM element, or jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Replace each element in the set of matched elements with the provided new content.</summary> + /// <param name="function" type="Function">A function that returns content with which to replace the set of matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'reset': function() { + /// <summary>Selects all elements of type reset.</summary> + }, + 'resize': function() { + /// <signature> + /// <summary>Bind an event handler to the "resize" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "resize" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scroll': function() { + /// <signature> + /// <summary>Bind an event handler to the "scroll" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "scroll" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scrollLeft': function() { + /// <signature> + /// <summary>Set the current horizontal position of the scroll bar for each of the set of matched elements.</summary> + /// <param name="value" type="Number">An integer indicating the new position to set the scroll bar to.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'scrollTop': function() { + /// <signature> + /// <summary>Set the current vertical position of the scroll bar for each of the set of matched elements.</summary> + /// <param name="value" type="Number">An integer indicating the new position to set the scroll bar to.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'select': function() { + /// <signature> + /// <summary>Bind an event handler to the "select" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "select" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'selected': function() { + /// <summary>Selects all elements that are selected.</summary> + }, + 'serialize': function() { + /// <summary>Encode a set of form elements as a string for submission.</summary> + /// <returns type="String" /> + }, + 'serializeArray': function() { + /// <summary>Encode a set of form elements as an array of names and values.</summary> + /// <returns type="Array" /> + }, + 'show': function() { + /// <signature> + /// <summary>Display the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'siblings': function() { + /// <signature> + /// <summary>Get the siblings of each element in the set of matched elements, optionally filtered by a selector.</summary> + /// <param name="selector" type="String">A string containing a selector expression to match elements against.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'size': function() { + /// <summary>Return the number of elements in the jQuery object.</summary> + /// <returns type="Number" /> + }, + 'slice': function() { + /// <signature> + /// <summary>Reduce the set of matched elements to a subset specified by a range of indices.</summary> + /// <param name="start" type="Number">An integer indicating the 0-based position at which the elements begin to be selected. If negative, it indicates an offset from the end of the set.</param> + /// <param name="end" type="Number">An integer indicating the 0-based position at which the elements stop being selected. If negative, it indicates an offset from the end of the set. If omitted, the range continues until the end of the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideDown': function() { + /// <signature> + /// <summary>Display the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideToggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'slideUp': function() { + /// <signature> + /// <summary>Hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Hide the matched elements with a sliding motion.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'stop': function() { + /// <signature> + /// <summary>Stop the currently-running animation on the matched elements.</summary> + /// <param name="clearQueue" type="Boolean">A Boolean indicating whether to remove queued animation as well. Defaults to false.</param> + /// <param name="jumpToEnd" type="Boolean">A Boolean indicating whether to complete the current animation immediately. Defaults to false.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Stop the currently-running animation on the matched elements.</summary> + /// <param name="queue" type="String">The name of the queue in which to stop animations.</param> + /// <param name="clearQueue" type="Boolean">A Boolean indicating whether to remove queued animation as well. Defaults to false.</param> + /// <param name="jumpToEnd" type="Boolean">A Boolean indicating whether to complete the current animation immediately. Defaults to false.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'submit': function() { + /// <signature> + /// <summary>Bind an event handler to the "submit" JavaScript event, or trigger that event on an element.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "submit" JavaScript event, or trigger that event on an element.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'text': function() { + /// <signature> + /// <summary>Set the content of each element in the set of matched elements to the specified text.</summary> + /// <param name="textString" type="String">A string of text to set as the content of each matched element.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the content of each element in the set of matched elements to the specified text.</summary> + /// <param name="function(index, text)" type="Function">A function returning the text content to set. Receives the index position of the element in the set and the old text value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'toArray': function() { + /// <summary>Retrieve all the DOM elements contained in the jQuery set, as an array.</summary> + /// <returns type="Array" /> + }, + 'toggle': function() { + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="duration" type="Number">A string or number determining how long the animation will run.</param> + /// <param name="easing" type="String">A string indicating which easing function to use for the transition.</param> + /// <param name="callback" type="Function">A function to call once the animation is complete.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Display or hide the matched elements.</summary> + /// <param name="showOrHide" type="Boolean">A Boolean indicating whether to show or hide the elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'toggleClass': function() { + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="className" type="String">One or more class names (separated by spaces) to be toggled for each element in the matched set.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="className" type="String">One or more class names (separated by spaces) to be toggled for each element in the matched set.</param> + /// <param name="switch" type="Boolean">A Boolean (not just truthy/falsy) value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="switch" type="Boolean">A boolean value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Add or remove one or more classes from each element in the set of matched elements, depending on either the class's presence or the value of the switch argument.</summary> + /// <param name="function(index, class, switch)" type="Function">A function that returns class names to be toggled in the class attribute of each element in the matched set. Receives the index position of the element in the set, the old class value, and the switch as arguments.</param> + /// <param name="switch" type="Boolean">A boolean value to determine whether the class should be added or removed.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'trigger': function() { + /// <signature> + /// <summary>Execute all handlers and behaviors attached to the matched elements for the given event type.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="extraParameters" type="Object">Additional parameters to pass along to the event handler.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Execute all handlers and behaviors attached to the matched elements for the given event type.</summary> + /// <param name="event" type="Event">A jQuery.Event object.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'triggerHandler': function() { + /// <signature> + /// <summary>Execute all handlers attached to an element for an event.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="extraParameters" type="Array">An array of additional parameters to pass along to the event handler.</param> + /// <returns type="Object" /> + /// </signature> + }, + 'unbind': function() { + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="handler(eventObject)" type="Function">The function that is to be no longer executed.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as click or submit.</param> + /// <param name="false" type="Boolean">Unbinds the corresponding 'return false' function that was bound using .bind( eventType, false ).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a previously-attached event handler from the elements.</summary> + /// <param name="event" type="Object">A JavaScript event object as passed to an event handler.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'undelegate': function() { + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as "click" or "keydown"</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="eventType" type="String">A string containing a JavaScript event type, such as "click" or "keydown"</param> + /// <param name="handler(eventObject)" type="Function">A function to execute at the time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="selector" type="String">A selector which will be used to filter the event results.</param> + /// <param name="events" type="Object">A map of one or more event types and previously bound functions to unbind from them.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Remove a handler from the event for all elements which match the current selector, based upon a specific set of root elements.</summary> + /// <param name="namespace" type="String">A string containing a namespace to unbind all events from.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'unload': function() { + /// <signature> + /// <summary>Bind an event handler to the "unload" JavaScript event.</summary> + /// <param name="handler(eventObject)" type="Function">A function to execute when the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Bind an event handler to the "unload" JavaScript event.</summary> + /// <param name="eventData" type="Object">A map of data that will be passed to the event handler.</param> + /// <param name="handler(eventObject)" type="Function">A function to execute each time the event is triggered.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'unwrap': function() { + /// <summary>Remove the parents of the set of matched elements from the DOM, leaving the matched elements in their place.</summary> + /// <returns type="jQuery" /> + }, + 'val': function() { + /// <signature> + /// <summary>Set the value of each element in the set of matched elements.</summary> + /// <param name="value" type="String">A string of text or an array of strings corresponding to the value of each matched element to set as selected/checked.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the value of each element in the set of matched elements.</summary> + /// <param name="function(index, value)" type="Function">A function returning the value to set. this is the current element. Receives the index position of the element in the set and the old value as arguments.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'visible': function() { + /// <summary>Selects all elements that are visible.</summary> + }, + 'width': function() { + /// <signature> + /// <summary>Set the CSS width of each element in the set of matched elements.</summary> + /// <param name="value" type="Number">An integer representing the number of pixels, or an integer along with an optional unit of measure appended (as a string).</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Set the CSS width of each element in the set of matched elements.</summary> + /// <param name="function(index, width)" type="Function">A function returning the width to set. Receives the index position of the element in the set and the old width as arguments. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrap': function() { + /// <signature> + /// <summary>Wrap an HTML structure around each element in the set of matched elements.</summary> + /// <param name="wrappingElement" type="jQuery">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Wrap an HTML structure around each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A callback function returning the HTML content or jQuery object to wrap around the matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrapAll': function() { + /// <signature> + /// <summary>Wrap an HTML structure around all elements in the set of matched elements.</summary> + /// <param name="wrappingElement" type="jQuery">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + }, + 'wrapInner': function() { + /// <signature> + /// <summary>Wrap an HTML structure around the content of each element in the set of matched elements.</summary> + /// <param name="wrappingElement" type="String">An HTML snippet, selector expression, jQuery object, or DOM element specifying the structure to wrap around the content of the matched elements.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Wrap an HTML structure around the content of each element in the set of matched elements.</summary> + /// <param name="function(index)" type="Function">A callback function which generates a structure to wrap around the content of the matched elements. Receives the index position of the element in the set as an argument. Within the function, this refers to the current element in the set.</param> + /// <returns type="jQuery" /> + /// </signature> + }, +}); + +intellisense.annotate(window, { + '$': function() { + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="selector" type="String">A string containing a selector expression</param> + /// <param name="context" type="jQuery">A DOM Element, Document, or jQuery to use as context</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="element" type="Element">A DOM element to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="object" type="Object">A plain object to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="elementArray" type="Array">An array containing a set of DOM elements to wrap in a jQuery object.</param> + /// <returns type="jQuery" /> + /// </signature> + /// <signature> + /// <summary>Accepts a string containing a CSS selector which is then used to match a set of elements.</summary> + /// <param name="jQuery object" type="Object">An existing jQuery object to clone.</param> + /// <returns type="jQuery" /> + /// </signature> + }, +}); + diff --git a/samples/TestAzureAD/Scripts/jquery-1.7.1.js b/samples/TestAzureAD/Scripts/jquery-1.7.1.js new file mode 100644 index 0000000..b4ec7f8 --- /dev/null +++ b/samples/TestAzureAD/Scripts/jquery-1.7.1.js @@ -0,0 +1,9266 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Released under the the MIT License. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT and BSD Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context ? context.ownerDocument || context : document ); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.7.1", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.add( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.fireWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).off( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery.Callbacks( "once memory" ); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array, i ) { + var len; + + if ( array ) { + if ( indexOf ) { + return indexOf.call( array, elem, i ); + } + + len = array.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in array && array[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return ( new Date() ).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +// String to Object flags format cache +var flagsCache = {}; + +// Convert String-formatted flags into Object-formatted ones and store in cache +function createFlags( flags ) { + var object = flagsCache[ flags ] = {}, + i, length; + flags = flags.split( /\s+/ ); + for ( i = 0, length = flags.length; i < length; i++ ) { + object[ flags[i] ] = true; + } + return object; +} + +/* + * Create a callback list using the following parameters: + * + * flags: an optional list of space-separated flags that will change how + * the callback list behaves + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible flags: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( flags ) { + + // Convert flags from String-formatted to Object-formatted + // (we check in cache first) + flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + + var // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = [], + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Add one or several callbacks to the list + add = function( args ) { + var i, + length, + elem, + type, + actual; + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + // Inspect recursively + add( elem ); + } else if ( type === "function" ) { + // Add if not in unique mode and callback is not in + if ( !flags.unique || !self.has( elem ) ) { + list.push( elem ); + } + } + } + }, + // Fire callbacks + fire = function( context, args ) { + args = args || []; + memory = !flags.memory || [ context, args ]; + firing = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { + memory = true; // Mark as halted + break; + } + } + firing = false; + if ( list ) { + if ( !flags.once ) { + if ( stack && stack.length ) { + memory = stack.shift(); + self.fireWith( memory[ 0 ], memory[ 1 ] ); + } + } else if ( memory === true ) { + self.disable(); + } else { + list = []; + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + var length = list.length; + add( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away, unless previous + // firing was halted (stopOnFalse) + } else if ( memory && memory !== true ) { + firingStart = length; + fire( memory[ 0 ], memory[ 1 ] ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + var args = arguments, + argIndex = 0, + argLength = args.length; + for ( ; argIndex < argLength ; argIndex++ ) { + for ( var i = 0; i < list.length; i++ ) { + if ( args[ argIndex ] === list[ i ] ) { + // Handle firingIndex and firingLength + if ( firing ) { + if ( i <= firingLength ) { + firingLength--; + if ( i <= firingIndex ) { + firingIndex--; + } + } + } + // Remove the element + list.splice( i--, 1 ); + // If we have some unicity property then + // we only need to do this once + if ( flags.unique ) { + break; + } + } + } + } + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + if ( list ) { + var i = 0, + length = list.length; + for ( ; i < length; i++ ) { + if ( fn === list[ i ] ) { + return true; + } + } + } + return false; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory || memory === true ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( stack ) { + if ( firing ) { + if ( !flags.once ) { + stack.push( [ context, args ] ); + } + } else if ( !( flags.once && memory ) ) { + fire( context, args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!memory; + } + }; + + return self; +}; + + + + +var // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + + Deferred: function( func ) { + var doneList = jQuery.Callbacks( "once memory" ), + failList = jQuery.Callbacks( "once memory" ), + progressList = jQuery.Callbacks( "memory" ), + state = "pending", + lists = { + resolve: doneList, + reject: failList, + notify: progressList + }, + promise = { + done: doneList.add, + fail: failList.add, + progress: progressList.add, + + state: function() { + return state; + }, + + // Deprecated + isResolved: doneList.fired, + isRejected: failList.fired, + + then: function( doneCallbacks, failCallbacks, progressCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); + return this; + }, + always: function() { + deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); + return this; + }, + pipe: function( fnDone, fnFail, fnProgress ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ], + progress: [ fnProgress, "notify" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + obj = promise; + } else { + for ( var key in promise ) { + obj[ key ] = promise[ key ]; + } + } + return obj; + } + }, + deferred = promise.promise({}), + key; + + for ( key in lists ) { + deferred[ key ] = lists[ key ].fire; + deferred[ key + "With" ] = lists[ key ].fireWith; + } + + // Handle state + deferred.done( function() { + state = "resolved"; + }, failList.disable, progressList.lock ).fail( function() { + state = "rejected"; + }, doneList.disable, progressList.lock ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = sliceDeferred.call( arguments, 0 ), + i = 0, + length = args.length, + pValues = new Array( length ), + count = length, + pCount = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(), + promise = deferred.promise(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( deferred, args ); + } + }; + } + function progressFunc( i ) { + return function( value ) { + pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + deferred.notifyWith( promise, pValues ); + }; + } + if ( length > 1 ) { + for ( ; i < length; i++ ) { + if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return promise; + } +}); + + + + +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + marginDiv, + fragment, + tds, + events, + eventName, + i, + isSupported, + div = document.createElement( "div" ), + documentElement = document.documentElement; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( window.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.style.width = "2px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + fragment.removeChild( div ); + + // Null elements to avoid leaks in IE + fragment = select = opt = marginDiv = div = input = null; + + // Run tests that need a body at doc ready + jQuery(function() { + var container, outer, inner, table, td, offsetSupport, + conMarginTop, ptlm, vb, style, html, + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + conMarginTop = 1; + ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;"; + vb = "visibility:hidden;border:0;"; + style = "style='" + ptlm + "border:5px solid #000;padding:0;'"; + html = "<div " + style + "><div></div></div>" + + "<table " + style + " cellpadding='0' cellspacing='0'>" + + "<tr><td></td></tr></table>"; + + container = document.createElement("div"); + container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Figure out if the W3C box model works as expected + div.innerHTML = ""; + div.style.width = div.style.paddingLeft = "1px"; + jQuery.boxModel = support.boxModel = div.offsetWidth === 2; + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.style.cssText = ptlm + vb; + div.innerHTML = html; + + outer = div.firstChild; + inner = outer.firstChild; + td = outer.nextSibling.firstChild.firstChild; + + offsetSupport = { + doesNotAddBorder: ( inner.offsetTop !== 5 ), + doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + }; + + inner.style.position = "fixed"; + inner.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); + inner.style.position = inner.style.top = ""; + + outer.style.overflow = "hidden"; + outer.style.position = "relative"; + + offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); + offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + + body.removeChild( container ); + div = container = null; + + jQuery.extend( support, offsetSupport ); + }); + + return support; +})(); + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var privateCache, thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, + isEvents = name === "events"; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + privateCache = thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Users should not attempt to inspect the internal events object using jQuery.data, + // it is undocumented and subject to change. But does anyone listen? No. + if ( isEvents && !thisCache[ name ] ) { + return privateCache.events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ internalKey ] : internalKey; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the cache and need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ internalKey ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + } else { + elem[ internalKey ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, attr, name, + data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { + attr = this[0].attributes; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + jQuery._data( this[0], "parsedAttrs", true ); + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var self = jQuery( this ), + args = [ parts[0], value ]; + + self.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + jQuery.isNumeric( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery._data( elem, deferDataKey ); + if ( defer && + ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && + ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery._data( elem, queueDataKey ) && + !jQuery._data( elem, markDataKey ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.fire(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = ( type || "fx" ) + "mark"; + jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); + if ( count ) { + jQuery._data( elem, key, count ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + var q; + if ( elem ) { + type = ( type || "fx" ) + "queue"; + q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = {}; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + jQuery._data( elem, type + ".run", hooks ); + fn.call( elem, function() { + jQuery.dequeue( elem, type ); + }, hooks ); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue " + type + ".run", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { + count++; + tmp.add( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + nodeHook, boolHook, fixSpecified; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = ( value || "" ).split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, l, + i = 0; + + if ( value && elem.nodeType === 1 ) { + attrNames = value.toLowerCase().split( rspace ); + l = attrNames.length; + + for ( ; i < l; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + + // See #9699 for explanation of this approach (setting first, then removal) + jQuery.attr( elem, name, "" ); + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) +jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.nodeValue = value + "" ); + } + }; + + // Apply the nodeHook to tabindex + jQuery.attrHooks.tabindex.set = nodeHook.set; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + + + + +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, + rhoverHack = /\bhover(\.\S+)?\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, + quickParse = function( selector ) { + var quick = rquickIs.exec( selector ); + if ( quick ) { + // 0 1 2 3 + // [ _, tag, id, class ] + quick[1] = ( quick[1] || "" ).toLowerCase(); + quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); + } + return quick; + }, + quickIs = function( elem, m ) { + var attrs = elem.attributes || {}; + return ( + (!m[1] || elem.nodeName.toLowerCase() === m[1]) && + (!m[2] || (attrs.id || {}).value === m[2]) && + (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) + ); + }, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, quick, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + quick: quickParse( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + t, tns, type, origType, namespaces, origCount, + j, events, special, handle, eventType, handleObj; + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, [ "events", "handle" ], true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var type = event.type || event, + namespaces = [], + cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + old = null; + for ( ; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old && old === elem.ownerDocument ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments, 0 ), + run_all = !event.exclusive && !event.namespace, + handlerQueue = [], + i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Determine handlers that should run if there are delegated events + // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this.ownerDocument || this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = ( + handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) + ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) + if ( event.metaKey === undefined ) { + event.metaKey = event.ctrlKey; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector, + ret; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !form._submit_attached ) { + jQuery.event.add( form, "submit._submit", function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + }); + form._submit_attached = true; + } + }); + // return undefined since we don't need an event listener + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + jQuery.event.simulate( "change", this, event, true ); + } + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + elem._change_attached = true; + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on.call( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + var handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( var type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + expando = "sizcache" + (Math.random() + '').replace('.', ''), + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rReturn = /\r\n/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context, seed ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set, seed ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set, i, len, match, type, left; + + if ( !expr ) { + return []; + } + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + type, found, item, filter, left, + i, pass, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + filter = Expr.filter[ type ]; + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + pass = not ^ found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Utility function for retreiving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var i, node, + nodeType = elem.nodeType, + ret = ""; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 ) { + // Use textContent || innerText for elements + if ( typeof elem.textContent === 'string' ) { + return elem.textContent; + } else if ( typeof elem.innerText === 'string' ) { + // Replace IE's carriage returns + return elem.innerText.replace( rReturn, '' ); + } else { + // Traverse it's children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + } else { + + // If no nodeType, this is expected to be an array + for ( i = 0; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + if ( node.nodeType !== 8 ) { + ret += getText( node ); + } + } + } + return ret; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var first, last, + doneName, parent, cache, + count, diff, + type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + first = match[2]; + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + doneName = match[0]; + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { + count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent[ expando ] = doneName; + } + + diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Sizzle.attr ? + Sizzle.attr( elem, name ) : + Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + !type && Sizzle.attr ? + result != null : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context, seed ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet, seed ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +Sizzle.selectors.attrMap = {}; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + POS.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array (deprecated as of jQuery 1.7) + if ( jQuery.isArray( selectors ) ) { + var level = 1; + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( i = 0; i < selectors.length; i++ ) { + + if ( jQuery( cur ).is( selectors[ i ] ) ) { + ret.push({ selector: selectors[ i ], elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} + + + + +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style)/i, + rnocache = /<(?:script|object|embed|option|style)/i, + rnoshimcache = new RegExp("<(?:" + nodeNames + ")", "i"), + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery.clean( arguments ); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery.clean(arguments) ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || ( l > 1 && i < lastIndex ) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc, + first = args[ 0 ]; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ first ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ first ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + var nodeName = ( elem.nodeName || "" ).toLowerCase(); + if ( nodeName === "input" ) { + fixDefaultChecked( elem ); + // Skip scripts, get other children + } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +// Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js +function shimCloneNode( elem ) { + var div = document.createElement( "div" ); + safeFragment.appendChild( div ); + + div.innerHTML = elem.outerHTML; + return div.firstChild; +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + // IE<=8 does not properly clone detached, unknown element nodes + clone = jQuery.support.html5Clone || !rnoshimcache.test( "<" + elem.nodeName ) ? + elem.cloneNode( true ) : + shimCloneNode( elem ); + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Append wrapper element to unknown element safe doc fragment + if ( context === document ) { + // Use the fragment we've already created for this document + safeFragment.appendChild( div ); + } else { + // Use a fragment created with the owner document + createSafeFragment( context ).appendChild( div ); + } + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, + cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^([\-+])=([\-+.\de]+)/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( (defaultView = elem.ownerDocument.defaultView) && + (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, uncomputed, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret === null && style && (uncomputed = style[ name ]) ) { + ret = uncomputed; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ( ret || 0 ); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight, + i = 0, + len = which.length; + + if ( val > 0 ) { + if ( extra !== "border" ) { + for ( ; i < len; i++ ) { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0; + } + } + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + for ( ; i < len; i++ ) { + val += parseFloat( jQuery.css( elem, "padding" + which[ i ] ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + which[ i ] + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + which[ i ] ) ) || 0; + } + } + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + var isSuccess, + success, + error, + statusText = nativeStatusText, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for ( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for ( key in s.converters ) { + if ( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if ( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for ( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback ); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css(elem, "display") === "none" ) { + jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + var elem, display, + i = 0, + j = this.length; + + for ( ; i < j; i++ ) { + elem = this[i]; + if ( elem.style ) { + display = jQuery.css( elem, "display" ); + + if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed( speed, easing, callback ); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + function doAnimation() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, e, + parts, start, end, unit, + method; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.zoom = 1; + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test( val ) ) { + + // Tracks whether to show or hide based on private + // data attached to the element + method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); + if ( method ) { + jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); + e[ method ](); + } else { + e[ val ](); + } + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ( (end || 1) / e.cur() ) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + } + + return optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + + stop: function( type, clearQueue, gotoEnd ) { + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var index, + hadTimers = false, + timers = jQuery.timers, + data = jQuery._data( this ); + + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + + function stopQueue( elem, data, index ) { + var hooks = data[ index ]; + jQuery.removeData( elem, index, true ); + hooks.stop( gotoEnd ); + } + + if ( type == null ) { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) { + stopQueue( this, data, index ); + } + } + } else if ( data[ index = type + ".run" ] && data[ index ].stop ){ + stopQueue( this, data, index ); + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + if ( gotoEnd ) { + + // force the next step to be the last + timers[ index ]( true ); + } else { + timers[ index ].saveState(); + } + hadTimers = true; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( !( gotoEnd && hadTimers ) ) { + jQuery.dequeue( this, type ); + } + }); + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx( "show", 1 ), + slideUp: genFx( "hide", 1 ), + slideToggle: genFx( "toggle", 1 ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ( ( -Math.cos( p*Math.PI ) / 2 ) + 0.5 ) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = fxNow || createFxNow(); + this.end = to; + this.now = this.start = from; + this.pos = this.state = 0; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + + function t( gotoEnd ) { + return self.step( gotoEnd ); + } + + t.queue = this.options.queue; + t.elem = this.elem; + t.saveState = function() { + if ( self.options.hide && jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { + jQuery._data( self.elem, "fxshow" + self.prop, self.start ); + } + }; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval( fx.tick, fx.interval ); + } + }, + + // Simple 'show' function + show: function() { + var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); + + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any flash of content + if ( dataShow !== undefined ) { + // This show is picking up where a previous hide or show left off + this.custom( this.cur(), dataShow ); + } else { + this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); + } + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom( this.cur(), 0 ); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var p, n, complete, + t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( p in options.animatedProperties ) { + if ( options.animatedProperties[ p ] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function( index, value ) { + elem.style[ "overflow" + value ] = options.overflow[ index ]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery( elem ).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[ p ] ); + jQuery.removeData( elem, "fxshow" + p, true ); + // Toggle data is no longer needed + jQuery.removeData( elem, "toggle" + p, true ); + } + } + + // Execute the complete function + // in the event that the complete function throws an exception + // we must ensure it won't be called twice. #5684 + + complete = options.complete; + if ( complete ) { + + options.complete = false; + complete.call( elem ); + } + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ( (this.end - this.start) * this.pos ); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +// Adds width/height step functions +// Do not set anything below 0 +jQuery.each([ "width", "height" ], function( i, prop ) { + jQuery.fx.step[ prop ] = function( fx ) { + jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit ); + }; +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + this[ type ]() : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + this[ type ]() : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ], + body = elem.document.body; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + body && body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNumeric( ret ) ? ret : orig; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + + + +})( window ); diff --git a/samples/TestAzureAD/Scripts/jquery-1.7.1.min.js b/samples/TestAzureAD/Scripts/jquery-1.7.1.min.js new file mode 100644 index 0000000..198b3ff --- /dev/null +++ b/samples/TestAzureAD/Scripts/jquery-1.7.1.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.7.1 jquery.com | jquery.org/license */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!ck[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){cl||(cl=c.createElement("iframe"),cl.frameBorder=cl.width=cl.height=0),b.appendChild(cl);if(!cm||!cl.createElement)cm=(cl.contentWindow||cl.contentDocument).document,cm.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),cm.close();d=cm.createElement(a),cm.body.appendChild(d),e=f.css(d,"display"),b.removeChild(cl)}ck[a]=e}return ck[a]}function cu(a,b){var c={};f.each(cq.concat.apply([],cq.slice(0,b)),function(){c[this]=a});return c}function ct(){cr=b}function cs(){setTimeout(ct,0);return cr=f.now()}function cj(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ci(){try{return new a.XMLHttpRequest}catch(b){}}function cc(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function cb(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function ca(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bE.test(a)?d(a,e):ca(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)ca(a+"["+e+"]",b[e],c,d);else d(a,b)}function b_(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bT,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bP),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bC(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bx:by,g=0,h=e.length;if(d>0){if(c!=="border")for(;g<h;g++)c||(d-=parseFloat(f.css(a,"padding"+e[g]))||0),c==="margin"?d+=parseFloat(f.css(a,c+e[g]))||0:d-=parseFloat(f.css(a,"border"+e[g]+"Width"))||0;return d+"px"}d=bz(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0;if(c)for(;g<h;g++)d+=parseFloat(f.css(a,"padding"+e[g]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+e[g]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+e[g]))||0);return d+"px"}function bp(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c+(i[c][d].namespace?".":"")+i[c][d].namespace,i[c][d],i[c][d].data)}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?parseFloat(d):j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?m(g):h==="function"&&(!a.unique||!o.has(g))&&c.push(g)},n=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,l=j||0,j=0,k=c.length;for(;c&&l<k;l++)if(c[l].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}i=!1,c&&(a.once?e===!0?o.disable():c=[]:d&&d.length&&(e=d.shift(),o.fireWith(e[0],e[1])))},o={add:function(){if(c){var a=c.length;m(arguments),i?k=c.length:e&&e!==!0&&(j=a,n(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){i&&f<=k&&(k--,f<=l&&l--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&o.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(i?a.once||d.push([b,c]):(!a.once||!e)&&n(b,c));return this},fire:function(){o.fireWith(this,arguments);return this},fired:function(){return!!e}};return o};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p,q=c.createElement("div"),r=c.documentElement;q.setAttribute("className","t"),q.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=q.getElementsByTagName("*"),e=q.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=q.getElementsByTagName("input")[0],b={leadingWhitespace:q.firstChild.nodeType===3,tbody:!q.getElementsByTagName("tbody").length,htmlSerialize:!!q.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:q.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete q.test}catch(s){b.deleteExpando=!1}!q.addEventListener&&q.attachEvent&&q.fireEvent&&(q.attachEvent("onclick",function(){b.noCloneEvent=!1}),q.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),q.appendChild(i),k=c.createDocumentFragment(),k.appendChild(q.lastChild),b.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,k.removeChild(i),k.appendChild(q),q.innerHTML="",a.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",q.style.width="2px",q.appendChild(j),b.reliableMarginRight=(parseInt((a.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0);if(q.attachEvent)for(o in{submit:1,change:1,focusin:1})n="on"+o,p=n in q,p||(q.setAttribute(n,"return;"),p=typeof q[n]=="function"),b[o+"Bubbles"]=p;k.removeChild(q),k=g=h=j=q=i=null,f(function(){var a,d,e,g,h,i,j,k,m,n,o,r=c.getElementsByTagName("body")[0];!r||(j=1,k="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;",m="visibility:hidden;border:0;",n="style='"+k+"border:5px solid #000;padding:0;'",o="<div "+n+"><div></div></div>"+"<table "+n+" cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",a=c.createElement("div"),a.style.cssText=m+"width:0;height:0;position:static;top:0;margin-top:"+j+"px",r.insertBefore(a,r.firstChild),q=c.createElement("div"),a.appendChild(q),q.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",l=q.getElementsByTagName("td"),p=l[0].offsetHeight===0,l[0].style.display="",l[1].style.display="none",b.reliableHiddenOffsets=p&&l[0].offsetHeight===0,q.innerHTML="",q.style.width=q.style.paddingLeft="1px",f.boxModel=b.boxModel=q.offsetWidth===2,typeof q.style.zoom!="undefined"&&(q.style.display="inline",q.style.zoom=1,b.inlineBlockNeedsLayout=q.offsetWidth===2,q.style.display="",q.innerHTML="<div style='width:4px;'></div>",b.shrinkWrapBlocks=q.offsetWidth!==2),q.style.cssText=k+m,q.innerHTML=o,d=q.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,i={doesNotAddBorder:e.offsetTop!==5,doesAddBorderForTableAndCells:h.offsetTop===5},e.style.position="fixed",e.style.top="20px",i.fixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",i.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,i.doesNotIncludeMarginInBodyOffset=r.offsetTop!==j,r.removeChild(a),q=a=null,f.extend(b,i))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h=null;if(typeof a=="undefined"){if(this.length){h=f.data(this[0]);if(this[0].nodeType===1&&!f._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var i=0,j=e.length;i<j;i++)g=e[i].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),l(this[0],g,h[g]));f._data(this[0],"parsedAttrs",!0)}}return h}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split("."),d[1]=d[1]?"."+d[1]:"";if(c===b){h=this.triggerHandler("getData"+d[1]+"!",[d[0]]),h===b&&this.length&&(h=f.data(this[0],a),h=l(this[0],a,h));return h===b&&d[1]?this.data(d[0]):h}return this.each(function(){var b=f(this),e=[d[0],c];b.triggerHandler("setData"+d[1]+"!",e),f.data(this,a,c),b.triggerHandler("changeData"+d[1]+"!",e)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise()}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.nodeName.toLowerCase()]||f.valHooks[g.type];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;h<g;h++)e=d[h],e&&(c=f.propFix[e]||e,f.attr(a,e,""),a.removeAttribute(v?e:c),u.test(e)&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/\bhover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")}; +f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=[],j,k,l,m,n,o,p,q,r,s,t;g[0]=c,c.delegateTarget=this;if(e&&!c.target.disabled&&(!c.button||c.type!=="click")){m=f(this),m.context=this.ownerDocument||this;for(l=c.target;l!=this;l=l.parentNode||this){o={},q=[],m[0]=l;for(j=0;j<e;j++)r=d[j],s=r.selector,o[s]===b&&(o[s]=r.quick?H(l,r.quick):m.is(s)),o[s]&&q.push(r);q.length&&i.push({elem:l,matches:q})}}d.length>e&&i.push({elem:this,matches:d.slice(e)});for(j=0;j<i.length&&!c.isPropagationStopped();j++){p=i[j],c.currentTarget=p.elem;for(k=0;k<p.matches.length&&!c.isImmediatePropagationStopped();k++){r=p.matches[k];if(h||!c.namespace&&!r.namespace||c.namespace_re&&c.namespace_re.test(r.namespace))c.data=r.data,c.handleObj=r,n=((f.event.special[r.origType]||{}).handle||r.handler).apply(p.elem,g),n!==b&&(c.result=n,n===!1&&(c.preventDefault(),c.stopPropagation()))}}return c.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0)}),d._submit_attached=!0)})},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on.call(this,a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.type+"."+e.namespace:e.type,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.POS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function() +{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bp)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||!bc.test("<"+a.nodeName)?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1></$2>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");b===c?bh.appendChild(o):U(b).appendChild(o),o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bn(k[i]);else bn(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bq=/alpha\([^)]*\)/i,br=/opacity=([^)]*)/,bs=/([A-Z]|^ms)/g,bt=/^-?\d+(?:px)?$/i,bu=/^-?\d/,bv=/^([\-+])=([\-+.\de]+)/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bv.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bC(a,b,d);f.swap(a,bw,function(){e=bC(a,b,d)});return e}},set:function(a,b){if(!bt.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return br.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bq,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bq.test(g)?g.replace(bq,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,b){var c,d,e;b=b.replace(bs,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b)));return c}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f===null&&g&&(e=g[b])&&(f=e),!bt.test(f)&&bu.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f||0,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bD=/%20/g,bE=/\[\]$/,bF=/\r?\n/g,bG=/#.*$/,bH=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bI=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bJ=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bK=/^(?:GET|HEAD)$/,bL=/^\/\//,bM=/\?/,bN=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cv(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cn.test(h)?(o=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),o?(f._data(this,"toggle"+i,o==="show"?"hide":"show"),j[o]()):j[h]()):(k=co.exec(h),l=j.cur(),k?(m=parseFloat(k[2]),n=k[3]||(f.cssNumber[i]?"":"px"),n!=="px"&&(f.style(this,i,(m||1)+n),l=(m||1)/j.cur()*l,f.style(this,i,l+n)),k[1]&&(m=(k[1]==="-="?-1:1)*m+l),j.custom(l,m,n)):j.custom(l,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cr||cs(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){e.options.hide&&f._data(e.elem,"fxshow"+e.prop)===b&&f._data(e.elem,"fxshow"+e.prop,e.start)},h()&&f.timers.push(h)&&!cp&&(cp=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cr||cs(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cp),cp=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(["width","height"],function(a,b){f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.support.fixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.support.fixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
\ No newline at end of file diff --git a/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.js b/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.js new file mode 100644 index 0000000..3ce1541 --- /dev/null +++ b/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.js @@ -0,0 +1,11464 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ + +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.20", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.20" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.20" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.20" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.20" +}); + +})(jQuery); + +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.20" +}); + +})(jQuery); + +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.20", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + element.wrap(wrapper); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); + +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); + +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); + +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.20", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); + +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); + +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.20" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.20"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.20", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.20" +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.20" +}); + +}(jQuery)); + +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.20" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.min.js b/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.min.js new file mode 100644 index 0000000..e1d2668 --- /dev/null +++ b/samples/TestAzureAD/Scripts/jquery-ui-1.8.20.min.js @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.8.20 - 2012-04-30 +* https://github.com/jquery/jquery-ui +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js, jquery.effects.blind.js, jquery.effects.bounce.js, jquery.effects.clip.js, jquery.effects.drop.js, jquery.effects.explode.js, jquery.effects.fade.js, jquery.effects.fold.js, jquery.effects.highlight.js, jquery.effects.pulsate.js, jquery.effects.scale.js, jquery.effects.shake.js, jquery.effects.slide.js, jquery.effects.transfer.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.tabs.js +* Copyright (c) 2012 AUTHORS.txt; Licensed MIT */ +(function(a,b){function c(b,c){var e=b.nodeName.toLowerCase();if("area"===e){var f=b.parentNode,g=f.name,h;return!b.href||!g||f.nodeName.toLowerCase()!=="map"?!1:(h=a("img[usemap=#"+g+"]")[0],!!h&&d(h))}return(/input|select|textarea|button|object/.test(e)?!b.disabled:"a"==e?b.href||c:c)&&d(b)}function d(b){return!a(b).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(a.ui.version)return;a.extend(a.ui,{version:"1.8.20",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}}),a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(b,c){return typeof b=="number"?this.each(function(){var d=this;setTimeout(function(){a(d).focus(),c&&c.call(d)},b)}):this._focus.apply(this,arguments)},scrollParent:function(){var b;return a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?b=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):b=this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0),/fixed/.test(this.css("position"))||!b.length?a(document):b},zIndex:function(c){if(c!==b)return this.css("zIndex",c);if(this.length){var d=a(this[0]),e,f;while(d.length&&d[0]!==document){e=d.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){f=parseInt(d.css("zIndex"),10);if(!isNaN(f)&&f!==0)return f}d=d.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a.each(["Width","Height"],function(c,d){function h(b,c,d,f){return a.each(e,function(){c-=parseFloat(a.curCSS(b,"padding"+this,!0))||0,d&&(c-=parseFloat(a.curCSS(b,"border"+this+"Width",!0))||0),f&&(c-=parseFloat(a.curCSS(b,"margin"+this,!0))||0)}),c}var e=d==="Width"?["Left","Right"]:["Top","Bottom"],f=d.toLowerCase(),g={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+d]=function(c){return c===b?g["inner"+d].call(this):this.each(function(){a(this).css(f,h(this,c)+"px")})},a.fn["outer"+d]=function(b,c){return typeof b!="number"?g["outer"+d].call(this,b):this.each(function(){a(this).css(f,h(this,b,!0,c)+"px")})}}),a.extend(a.expr[":"],{data:function(b,c,d){return!!a.data(b,d[3])},focusable:function(b){return c(b,!isNaN(a.attr(b,"tabindex")))},tabbable:function(b){var d=a.attr(b,"tabindex"),e=isNaN(d);return(e||d>=0)&&c(b,!e)}}),a(function(){var b=document.body,c=b.appendChild(c=document.createElement("div"));c.offsetHeight,a.extend(c.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=c.offsetHeight===100,a.support.selectstart="onselectstart"in c,b.removeChild(c).style.display="none"}),a.extend(a.ui,{plugin:{add:function(b,c,d){var e=a.ui[b].prototype;for(var f in d)e.plugins[f]=e.plugins[f]||[],e.plugins[f].push([c,d[f]])},call:function(a,b,c){var d=a.plugins[b];if(!d||!a.element[0].parentNode)return;for(var e=0;e<d.length;e++)a.options[d[e][0]]&&d[e][1].apply(a.element,c)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(b,c){if(a(b).css("overflow")==="hidden")return!1;var d=c&&c==="left"?"scrollLeft":"scrollTop",e=!1;return b[d]>0?!0:(b[d]=1,e=b[d]>0,b[d]=0,e)},isOverAxis:function(a,b,c){return a>b&&a<b+c},isOver:function(b,c,d,e,f,g){return a.ui.isOverAxis(b,d,f)&&a.ui.isOverAxis(c,e,g)}})})(jQuery),function(a,b){if(a.cleanData){var c=a.cleanData;a.cleanData=function(b){for(var d=0,e;(e=b[d])!=null;d++)try{a(e).triggerHandler("remove")}catch(f){}c(b)}}else{var d=a.fn.remove;a.fn.remove=function(b,c){return this.each(function(){return c||(!b||a.filter(b,[this]).length)&&a("*",this).add([this]).each(function(){try{a(this).triggerHandler("remove")}catch(b){}}),d.call(a(this),b,c)})}}a.widget=function(b,c,d){var e=b.split(".")[0],f;b=b.split(".")[1],f=e+"-"+b,d||(d=c,c=a.Widget),a.expr[":"][f]=function(c){return!!a.data(c,b)},a[e]=a[e]||{},a[e][b]=function(a,b){arguments.length&&this._createWidget(a,b)};var g=new c;g.options=a.extend(!0,{},g.options),a[e][b].prototype=a.extend(!0,g,{namespace:e,widgetName:b,widgetEventPrefix:a[e][b].prototype.widgetEventPrefix||b,widgetBaseClass:f},d),a.widget.bridge(b,a[e][b])},a.widget.bridge=function(c,d){a.fn[c]=function(e){var f=typeof e=="string",g=Array.prototype.slice.call(arguments,1),h=this;return e=!f&&g.length?a.extend.apply(null,[!0,e].concat(g)):e,f&&e.charAt(0)==="_"?h:(f?this.each(function(){var d=a.data(this,c),f=d&&a.isFunction(d[e])?d[e].apply(d,g):d;if(f!==d&&f!==b)return h=f,!1}):this.each(function(){var b=a.data(this,c);b?b.option(e||{})._init():a.data(this,c,new d(e,this))}),h)}},a.Widget=function(a,b){arguments.length&&this._createWidget(a,b)},a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:!1},_createWidget:function(b,c){a.data(c,this.widgetName,this),this.element=a(c),this.options=a.extend(!0,{},this.options,this._getCreateOptions(),b);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()}),this._create(),this._trigger("create"),this._init()},_getCreateOptions:function(){return a.metadata&&a.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName),this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled "+"ui-state-disabled")},widget:function(){return this.element},option:function(c,d){var e=c;if(arguments.length===0)return a.extend({},this.options);if(typeof c=="string"){if(d===b)return this.options[c];e={},e[c]=d}return this._setOptions(e),this},_setOptions:function(b){var c=this;return a.each(b,function(a,b){c._setOption(a,b)}),this},_setOption:function(a,b){return this.options[a]=b,a==="disabled"&&this.widget()[b?"addClass":"removeClass"](this.widgetBaseClass+"-disabled"+" "+"ui-state-disabled").attr("aria-disabled",b),this},enable:function(){return this._setOption("disabled",!1)},disable:function(){return this._setOption("disabled",!0)},_trigger:function(b,c,d){var e,f,g=this.options[b];d=d||{},c=a.Event(c),c.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase(),c.target=this.element[0],f=c.originalEvent;if(f)for(e in f)e in c||(c[e]=f[e]);return this.element.trigger(c,d),!(a.isFunction(g)&&g.call(this.element[0],c,d)===!1||c.isDefaultPrevented())}}}(jQuery),function(a,b){var c=!1;a(document).mouseup(function(a){c=!1}),a.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var b=this;this.element.bind("mousedown."+this.widgetName,function(a){return b._mouseDown(a)}).bind("click."+this.widgetName,function(c){if(!0===a.data(c.target,b.widgetName+".preventClickEvent"))return a.removeData(c.target,b.widgetName+".preventClickEvent"),c.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.unbind("."+this.widgetName),a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(b){if(c)return;this._mouseStarted&&this._mouseUp(b),this._mouseDownEvent=b;var d=this,e=b.which==1,f=typeof this.options.cancel=="string"&&b.target.nodeName?a(b.target).closest(this.options.cancel).length:!1;if(!e||f||!this._mouseCapture(b))return!0;this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){d.mouseDelayMet=!0},this.options.delay));if(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)){this._mouseStarted=this._mouseStart(b)!==!1;if(!this._mouseStarted)return b.preventDefault(),!0}return!0===a.data(b.target,this.widgetName+".preventClickEvent")&&a.removeData(b.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(a){return d._mouseMove(a)},this._mouseUpDelegate=function(a){return d._mouseUp(a)},a(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate),b.preventDefault(),c=!0,!0},_mouseMove:function(b){return!a.browser.msie||document.documentMode>=9||!!b.button?this._mouseStarted?(this._mouseDrag(b),b.preventDefault()):(this._mouseDistanceMet(b)&&this._mouseDelayMet(b)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,b)!==!1,this._mouseStarted?this._mouseDrag(b):this._mouseUp(b)),!this._mouseStarted):this._mouseUp(b)},_mouseUp:function(b){return a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,b.target==this._mouseDownEvent.target&&a.data(b.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(b)),!1},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(a){return this.mouseDelayMet},_mouseStart:function(a){},_mouseDrag:function(a){},_mouseStop:function(a){},_mouseCapture:function(a){return!0}})}(jQuery),function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},destroy:function(){if(!this.element.data("draggable"))return;return this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options;return this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(b),this.handle?(c.iframeFix&&a(c.iframeFix===!0?"iframe":c.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(a(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(b){var c=this.options;return this.helper=this._createHelper(b),this._cacheHelperProportions(),a.ui.ddmanager&&(a.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt),c.containment&&this._setContainment(),this._trigger("start",b)===!1?(this._clear(),!1):(this._cacheHelperProportions(),a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.helper.addClass("ui-draggable-dragging"),this._mouseDrag(b,!0),a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,b),!0)},_mouseDrag:function(b,c){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute");if(!c){var d=this._uiHash();if(this._trigger("drag",b,d)===!1)return this._mouseUp({}),!1;this.position=d.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),!1},_mouseStop:function(b){var c=!1;a.ui.ddmanager&&!this.options.dropBehaviour&&(c=a.ui.ddmanager.drop(this,b)),this.dropped&&(c=this.dropped,this.dropped=!1);var d=this.element[0],e=!1;while(d&&(d=d.parentNode))d==document&&(e=!0);if(!e&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===!0||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",b)!==!1&&f._clear()})}else this._trigger("stop",b)!==!1&&this._clear();return!1},_mouseUp:function(b){return this.options.iframeFix===!0&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,b),a.ui.mouse.prototype._mouseUp.call(this,b)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?!0:!1;return a(this.options.handle,this.element).find("*").andSelf().each(function(){this==b.target&&(c=!0)}),c},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo),d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute"),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[b.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,b.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(b.containment=="document"?0:a(window).scrollLeft())+a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b.containment=="document"?0:a(window).scrollTop())+(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)&&b.containment.constructor!=Array){var c=a(b.containment),d=c[0];if(!d)return;var e=c.offset(),f=a(d).css("overflow")!="hidden";this.containment=[(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),(f?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=c}else b.containment.constructor==Array&&(this.containment=b.containment)},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName),f=b.pageX,g=b.pageY;if(this.originalPosition){var h;if(this.containment){if(this.relative_container){var i=this.relative_container.offset();h=[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]}else h=this.containment;b.pageX-this.offset.click.left<h[0]&&(f=h[0]+this.offset.click.left),b.pageY-this.offset.click.top<h[1]&&(g=h[1]+this.offset.click.top),b.pageX-this.offset.click.left>h[2]&&(f=h[2]+this.offset.click.left),b.pageY-this.offset.click.top>h[3]&&(g=h[3]+this.offset.click.top)}if(c.grid){var j=c.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;g=h?j-this.offset.click.top<h[1]||j-this.offset.click.top>h[3]?j-this.offset.click.top<h[1]?j+c.grid[1]:j-c.grid[1]:j:j;var k=c.grid[0]?this.originalPageX+Math.round((f-this.originalPageX)/c.grid[0])*c.grid[0]:this.originalPageX;f=h?k-this.offset.click.left<h[0]||k-this.offset.click.left>h[2]?k-this.offset.click.left<h[0]?k+c.grid[0]:k-c.grid[0]:k:k}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:d.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:d.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"),this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1},_trigger:function(b,c,d){return d=d||this._uiHash(),a.ui.plugin.call(this,b,[c,d]),b=="drag"&&(this.positionAbs=this._convertPositionTo("absolute")),a.Widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(a){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),a.extend(a.ui.draggable,{version:"1.8.20"}),a.ui.plugin.add("draggable","connectToSortable",{start:function(b,c){var d=a(this).data("draggable"),e=d.options,f=a.extend({},c,{item:d.element});d.sortables=[],a(e.connectToSortable).each(function(){var c=a.data(this,"sortable");c&&!c.options.disabled&&(d.sortables.push({instance:c,shouldRevert:c.options.revert}),c.refreshPositions(),c._trigger("activate",b,f))})},stop:function(b,c){var d=a(this).data("draggable"),e=a.extend({},c,{item:d.element});a.each(d.sortables,function(){this.instance.isOver?(this.instance.isOver=0,d.cancelHelperRemoval=!0,this.instance.cancelHelperRemoval=!1,this.shouldRevert&&(this.instance.options.revert=!0),this.instance._mouseStop(b),this.instance.options.helper=this.instance.options._helper,d.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})):(this.instance.cancelHelperRemoval=!1,this.instance._trigger("deactivate",b,e))})},drag:function(b,c){var d=a(this).data("draggable"),e=this,f=function(b){var c=this.offset.click.top,d=this.offset.click.left,e=this.positionAbs.top,f=this.positionAbs.left,g=b.height,h=b.width,i=b.top,j=b.left;return a.ui.isOver(e+c,f+d,i,j,g,h)};a.each(d.sortables,function(f){this.instance.positionAbs=d.positionAbs,this.instance.helperProportions=d.helperProportions,this.instance.offset.click=d.offset.click,this.instance._intersectsWith(this.instance.containerCache)?(this.instance.isOver||(this.instance.isOver=1,this.instance.currentItem=a(e).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",!0),this.instance.options._helper=this.instance.options.helper,this.instance.options.helper=function(){return c.helper[0]},b.target=this.instance.currentItem[0],this.instance._mouseCapture(b,!0),this.instance._mouseStart(b,!0,!0),this.instance.offset.click.top=d.offset.click.top,this.instance.offset.click.left=d.offset.click.left,this.instance.offset.parent.left-=d.offset.parent.left-this.instance.offset.parent.left,this.instance.offset.parent.top-=d.offset.parent.top-this.instance.offset.parent.top,d._trigger("toSortable",b),d.dropped=this.instance.element,d.currentItem=d.element,this.instance.fromOutside=d),this.instance.currentItem&&this.instance._mouseDrag(b)):this.instance.isOver&&(this.instance.isOver=0,this.instance.cancelHelperRemoval=!0,this.instance.options.revert=!1,this.instance._trigger("out",b,this.instance._uiHash(this.instance)),this.instance._mouseStop(b,!0),this.instance.options.helper=this.instance.options._helper,this.instance.currentItem.remove(),this.instance.placeholder&&this.instance.placeholder.remove(),d._trigger("fromSortable",b),d.dropped=!1)})}}),a.ui.plugin.add("draggable","cursor",{start:function(b,c){var d=a("body"),e=a(this).data("draggable").options;d.css("cursor")&&(e._cursor=d.css("cursor")),d.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;d._cursor&&a("body").css("cursor",d._cursor)}}),a.ui.plugin.add("draggable","opacity",{start:function(b,c){var d=a(c.helper),e=a(this).data("draggable").options;d.css("opacity")&&(e._opacity=d.css("opacity")),d.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;d._opacity&&a(c.helper).css("opacity",d._opacity)}}),a.ui.plugin.add("draggable","scroll",{start:function(b,c){var d=a(this).data("draggable");d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"&&(d.overflowOffset=d.scrollParent.offset())},drag:function(b,c){var d=a(this).data("draggable"),e=d.options,f=!1;if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"){if(!e.axis||e.axis!="x")d.overflowOffset.top+d.scrollParent[0].offsetHeight-b.pageY<e.scrollSensitivity?d.scrollParent[0].scrollTop=f=d.scrollParent[0].scrollTop+e.scrollSpeed:b.pageY-d.overflowOffset.top<e.scrollSensitivity&&(d.scrollParent[0].scrollTop=f=d.scrollParent[0].scrollTop-e.scrollSpeed);if(!e.axis||e.axis!="y")d.overflowOffset.left+d.scrollParent[0].offsetWidth-b.pageX<e.scrollSensitivity?d.scrollParent[0].scrollLeft=f=d.scrollParent[0].scrollLeft+e.scrollSpeed:b.pageX-d.overflowOffset.left<e.scrollSensitivity&&(d.scrollParent[0].scrollLeft=f=d.scrollParent[0].scrollLeft-e.scrollSpeed)}else{if(!e.axis||e.axis!="x")b.pageY-a(document).scrollTop()<e.scrollSensitivity?f=a(document).scrollTop(a(document).scrollTop()-e.scrollSpeed):a(window).height()-(b.pageY-a(document).scrollTop())<e.scrollSensitivity&&(f=a(document).scrollTop(a(document).scrollTop()+e.scrollSpeed));if(!e.axis||e.axis!="y")b.pageX-a(document).scrollLeft()<e.scrollSensitivity?f=a(document).scrollLeft(a(document).scrollLeft()-e.scrollSpeed):a(window).width()-(b.pageX-a(document).scrollLeft())<e.scrollSensitivity&&(f=a(document).scrollLeft(a(document).scrollLeft()+e.scrollSpeed))}f!==!1&&a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(d,b)}}),a.ui.plugin.add("draggable","snap",{start:function(b,c){var d=a(this).data("draggable"),e=d.options;d.snapElements=[],a(e.snap.constructor!=String?e.snap.items||":data(draggable)":e.snap).each(function(){var b=a(this),c=b.offset();this!=d.element[0]&&d.snapElements.push({item:this,width:b.outerWidth(),height:b.outerHeight(),top:c.top,left:c.left})})},drag:function(b,c){var d=a(this).data("draggable"),e=d.options,f=e.snapTolerance,g=c.offset.left,h=g+d.helperProportions.width,i=c.offset.top,j=i+d.helperProportions.height;for(var k=d.snapElements.length-1;k>=0;k--){var l=d.snapElements[k].left,m=l+d.snapElements[k].width,n=d.snapElements[k].top,o=n+d.snapElements[k].height;if(!(l-f<g&&g<m+f&&n-f<i&&i<o+f||l-f<g&&g<m+f&&n-f<j&&j<o+f||l-f<h&&h<m+f&&n-f<i&&i<o+f||l-f<h&&h<m+f&&n-f<j&&j<o+f)){d.snapElements[k].snapping&&d.options.snap.release&&d.options.snap.release.call(d.element,b,a.extend(d._uiHash(),{snapItem:d.snapElements[k].item})),d.snapElements[k].snapping=!1;continue}if(e.snapMode!="inner"){var p=Math.abs(n-j)<=f,q=Math.abs(o-i)<=f,r=Math.abs(l-h)<=f,s=Math.abs(m-g)<=f;p&&(c.position.top=d._convertPositionTo("relative",{top:n-d.helperProportions.height,left:0}).top-d.margins.top),q&&(c.position.top=d._convertPositionTo("relative",{top:o,left:0}).top-d.margins.top),r&&(c.position.left=d._convertPositionTo("relative",{top:0,left:l-d.helperProportions.width}).left-d.margins.left),s&&(c.position.left=d._convertPositionTo("relative",{top:0,left:m}).left-d.margins.left)}var t=p||q||r||s;if(e.snapMode!="outer"){var p=Math.abs(n-i)<=f,q=Math.abs(o-j)<=f,r=Math.abs(l-g)<=f,s=Math.abs(m-h)<=f;p&&(c.position.top=d._convertPositionTo("relative",{top:n,left:0}).top-d.margins.top),q&&(c.position.top=d._convertPositionTo("relative",{top:o-d.helperProportions.height,left:0}).top-d.margins.top),r&&(c.position.left=d._convertPositionTo("relative",{top:0,left:l}).left-d.margins.left),s&&(c.position.left=d._convertPositionTo("relative",{top:0,left:m-d.helperProportions.width}).left-d.margins.left)}!d.snapElements[k].snapping&&(p||q||r||s||t)&&d.options.snap.snap&&d.options.snap.snap.call(d.element,b,a.extend(d._uiHash(),{snapItem:d.snapElements[k].item})),d.snapElements[k].snapping=p||q||r||s||t}}}),a.ui.plugin.add("draggable","stack",{start:function(b,c){var d=a(this).data("draggable").options,e=a.makeArray(a(d.stack)).sort(function(b,c){return(parseInt(a(b).css("zIndex"),10)||0)-(parseInt(a(c).css("zIndex"),10)||0)});if(!e.length)return;var f=parseInt(e[0].style.zIndex)||0;a(e).each(function(a){this.style.zIndex=f+a}),this[0].style.zIndex=f+e.length}}),a.ui.plugin.add("draggable","zIndex",{start:function(b,c){var d=a(c.helper),e=a(this).data("draggable").options;d.css("zIndex")&&(e._zIndex=d.css("zIndex")),d.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;d._zIndex&&a(c.helper).css("zIndex",d._zIndex)}})}(jQuery),function(a,b){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:!1,addClasses:!0,greedy:!1,hoverClass:!1,scope:"default",tolerance:"intersect"},_create:function(){var b=this.options,c=b.accept;this.isover=0,this.isout=1,this.accept=a.isFunction(c)?c:function(a){return a.is(c)},this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight},a.ui.ddmanager.droppables[b.scope]=a.ui.ddmanager.droppables[b.scope]||[],a.ui.ddmanager.droppables[b.scope].push(this),b.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){var b=a.ui.ddmanager.droppables[this.options.scope];for(var c=0;c<b.length;c++)b[c]==this&&b.splice(c,1);return this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable"),this},_setOption:function(b,c){b=="accept"&&(this.accept=a.isFunction(c)?c:function(a){return a.is(c)}),a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(b){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.addClass(this.options.activeClass),c&&this._trigger("activate",b,this.ui(c))},_deactivate:function(b){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass),c&&this._trigger("deactivate",b,this.ui(c))},_over:function(b){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return;this.accept.call(this.element[0],c.currentItem||c.element)&&(this.options.hoverClass&&this.element.addClass(this.options.hoverClass),this._trigger("over",b,this.ui(c)))},_out:function(b){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return;this.accept.call(this.element[0],c.currentItem||c.element)&&(this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("out",b,this.ui(c)))},_drop:function(b,c){var d=c||a.ui.ddmanager.current;if(!d||(d.currentItem||d.element)[0]==this.element[0])return!1;var e=!1;return this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var b=a.data(this,"droppable");if(b.options.greedy&&!b.options.disabled&&b.options.scope==d.options.scope&&b.accept.call(b.element[0],d.currentItem||d.element)&&a.ui.intersect(d,a.extend(b,{offset:b.element.offset()}),b.options.tolerance))return e=!0,!1}),e?!1:this.accept.call(this.element[0],d.currentItem||d.element)?(this.options.activeClass&&this.element.removeClass(this.options.activeClass),this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("drop",b,this.ui(d)),this.element):!1},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}}),a.extend(a.ui.droppable,{version:"1.8.20"}),a.ui.intersect=function(b,c,d){if(!c.offset)return!1;var e=(b.positionAbs||b.position.absolute).left,f=e+b.helperProportions.width,g=(b.positionAbs||b.position.absolute).top,h=g+b.helperProportions.height,i=c.offset.left,j=i+c.proportions.width,k=c.offset.top,l=k+c.proportions.height;switch(d){case"fit":return i<=e&&f<=j&&k<=g&&h<=l;case"intersect":return i<e+b.helperProportions.width/2&&f-b.helperProportions.width/2<j&&k<g+b.helperProportions.height/2&&h-b.helperProportions.height/2<l;case"pointer":var m=(b.positionAbs||b.position.absolute).left+(b.clickOffset||b.offset.click).left,n=(b.positionAbs||b.position.absolute).top+(b.clickOffset||b.offset.click).top,o=a.ui.isOver(n,m,k,i,c.proportions.height,c.proportions.width);return o;case"touch":return(g>=k&&g<=l||h>=k&&h<=l||g<k&&h>l)&&(e>=i&&e<=j||f>=i&&f<=j||e<i&&f>j);default:return!1}},a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(b,c){var d=a.ui.ddmanager.droppables[b.options.scope]||[],e=c?c.type:null,f=(b.currentItem||b.element).find(":data(droppable)").andSelf();g:for(var h=0;h<d.length;h++){if(d[h].options.disabled||b&&!d[h].accept.call(d[h].element[0],b.currentItem||b.element))continue;for(var i=0;i<f.length;i++)if(f[i]==d[h].element[0]){d[h].proportions.height=0;continue g}d[h].visible=d[h].element.css("display")!="none";if(!d[h].visible)continue;e=="mousedown"&&d[h]._activate.call(d[h],c),d[h].offset=d[h].element.offset(),d[h].proportions={width:d[h].element[0].offsetWidth,height:d[h].element[0].offsetHeight}}},drop:function(b,c){var d=!1;return a.each(a.ui.ddmanager.droppables[b.options.scope]||[],function(){if(!this.options)return;!this.options.disabled&&this.visible&&a.ui.intersect(b,this,this.options.tolerance)&&(d=this._drop.call(this,c)||d),!this.options.disabled&&this.visible&&this.accept.call(this.element[0],b.currentItem||b.element)&&(this.isout=1,this.isover=0,this._deactivate.call(this,c))}),d},dragStart:function(b,c){b.element.parents(":not(body,html)").bind("scroll.droppable",function(){b.options.refreshPositions||a.ui.ddmanager.prepareOffsets(b,c)})},drag:function(b,c){b.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(b,c),a.each(a.ui.ddmanager.droppables[b.options.scope]||[],function(){if(this.options.disabled||this.greedyChild||!this.visible)return;var d=a.ui.intersect(b,this,this.options.tolerance),e=!d&&this.isover==1?"isout":d&&this.isover==0?"isover":null;if(!e)return;var f;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");g.length&&(f=a.data(g[0],"droppable"),f.greedyChild=e=="isover"?1:0)}f&&e=="isover"&&(f.isover=0,f.isout=1,f._out.call(f,c)),this[e]=1,this[e=="isout"?"isover":"isout"]=0,this[e=="isover"?"_over":"_out"].call(this,c),f&&e=="isout"&&(f.isout=0,f.isover=1,f._over.call(f,c))})},dragStop:function(b,c){b.element.parents(":not(body,html)").unbind("scroll.droppable"),b.options.refreshPositions||a.ui.ddmanager.prepareOffsets(b,c)}}}(jQuery),function(a,b){a.widget("ui.resizable",a.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1e3},_create:function(){var b=this,c=this.options;this.element.addClass("ui-resizable"),a.extend(this,{_aspectRatio:!!c.aspectRatio,aspectRatio:c.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:c.helper||c.ghost||c.animate?c.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)&&(this.element.wrap(a('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=c.handles||(a(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var d=this.handles.split(",");this.handles={};for(var e=0;e<d.length;e++){var f=a.trim(d[e]),g="ui-resizable-"+f,h=a('<div class="ui-resizable-handle '+g+'"></div>');h.css({zIndex:c.zIndex}),"se"==f&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[f]=".ui-resizable-"+f,this.element.append(h)}}this._renderAxis=function(b){b=b||this.element;for(var c in this.handles){this.handles[c].constructor==String&&(this.handles[c]=a(this.handles[c],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var d=a(this.handles[c],this.element),e=0;e=/sw|ne|nw|se|n|s/.test(c)?d.outerHeight():d.outerWidth();var f=["padding",/ne|nw|n/.test(c)?"Top":/se|sw|s/.test(c)?"Bottom":/^e$/.test(c)?"Right":"Left"].join("");b.css(f,e),this._proportionallyResize()}if(!a(this.handles[c]).length)continue}},this._renderAxis(this.element),this._handles=a(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!b.resizing){if(this.className)var a=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=a&&a[1]?a[1]:"se"}}),c.autoHide&&(this._handles.hide(),a(this.element).addClass("ui-resizable-autohide").hover(function(){if(c.disabled)return;a(this).removeClass("ui-resizable-autohide"),b._handles.show()},function(){if(c.disabled)return;b.resizing||(a(this).addClass("ui-resizable-autohide"),b._handles.hide())})),this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(b){a(b).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var c=this.element;c.after(this.originalElement.css({position:c.css("position"),width:c.outerWidth(),height:c.outerHeight(),top:c.css("top"),left:c.css("left")})).remove()}return this.originalElement.css("resize",this.originalResizeStyle),b(this.originalElement),this},_mouseCapture:function(b){var c=!1;for(var d in this.handles)a(this.handles[d])[0]==b.target&&(c=!0);return!this.options.disabled&&c},_mouseStart:function(b){var d=this.options,e=this.element.position(),f=this.element;this.resizing=!0,this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()},(f.is(".ui-draggable")||/absolute/.test(f.css("position")))&&f.css({position:"absolute",top:e.top,left:e.left}),this._renderProxy();var g=c(this.helper.css("left")),h=c(this.helper.css("top"));d.containment&&(g+=a(d.containment).scrollLeft()||0,h+=a(d.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:g,top:h},this.size=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalSize=this._helper?{width:f.outerWidth(),height:f.outerHeight()}:{width:f.width(),height:f.height()},this.originalPosition={left:g,top:h},this.sizeDiff={width:f.outerWidth()-f.width(),height:f.outerHeight()-f.height()},this.originalMousePosition={left:b.pageX,top:b.pageY},this.aspectRatio=typeof d.aspectRatio=="number"?d.aspectRatio:this.originalSize.width/this.originalSize.height||1;var i=a(".ui-resizable-"+this.axis).css("cursor");return a("body").css("cursor",i=="auto"?this.axis+"-resize":i),f.addClass("ui-resizable-resizing"),this._propagate("start",b),!0},_mouseDrag:function(b){var c=this.helper,d=this.options,e={},f=this,g=this.originalMousePosition,h=this.axis,i=b.pageX-g.left||0,j=b.pageY-g.top||0,k=this._change[h];if(!k)return!1;var l=k.apply(this,[b,i,j]),m=a.browser.msie&&a.browser.version<7,n=this.sizeDiff;this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)l=this._updateRatio(l,b);return l=this._respectSize(l,b),this._propagate("resize",b),c.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",b,this.ui()),!1},_mouseStop:function(b){this.resizing=!1;var c=this.options,d=this;if(this._helper){var e=this._proportionallyResizeElements,f=e.length&&/textarea/i.test(e[0].nodeName),g=f&&a.ui.hasScroll(e[0],"left")?0:d.sizeDiff.height,h=f?0:d.sizeDiff.width,i={width:d.helper.width()-h,height:d.helper.height()-g},j=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,k=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;c.animate||this.element.css(a.extend(i,{top:k,left:j})),d.helper.height(d.size.height),d.helper.width(d.size.width),this._helper&&!c.animate&&this._proportionallyResize()}return a("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",b),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(a){var b=this.options,c,e,f,g,h;h={minWidth:d(b.minWidth)?b.minWidth:0,maxWidth:d(b.maxWidth)?b.maxWidth:Infinity,minHeight:d(b.minHeight)?b.minHeight:0,maxHeight:d(b.maxHeight)?b.maxHeight:Infinity};if(this._aspectRatio||a)c=h.minHeight*this.aspectRatio,f=h.minWidth/this.aspectRatio,e=h.maxHeight*this.aspectRatio,g=h.maxWidth/this.aspectRatio,c>h.minWidth&&(h.minWidth=c),f>h.minHeight&&(h.minHeight=f),e<h.maxWidth&&(h.maxWidth=e),g<h.maxHeight&&(h.maxHeight=g);this._vBoundaries=h},_updateCache:function(a){var b=this.options;this.offset=this.helper.offset(),d(a.left)&&(this.position.left=a.left),d(a.top)&&(this.position.top=a.top),d(a.height)&&(this.size.height=a.height),d(a.width)&&(this.size.width=a.width)},_updateRatio:function(a,b){var c=this.options,e=this.position,f=this.size,g=this.axis;return d(a.height)?a.width=a.height*this.aspectRatio:d(a.width)&&(a.height=a.width/this.aspectRatio),g=="sw"&&(a.left=e.left+(f.width-a.width),a.top=null),g=="nw"&&(a.top=e.top+(f.height-a.height),a.left=e.left+(f.width-a.width)),a},_respectSize:function(a,b){var c=this.helper,e=this._vBoundaries,f=this._aspectRatio||b.shiftKey,g=this.axis,h=d(a.width)&&e.maxWidth&&e.maxWidth<a.width,i=d(a.height)&&e.maxHeight&&e.maxHeight<a.height,j=d(a.width)&&e.minWidth&&e.minWidth>a.width,k=d(a.height)&&e.minHeight&&e.minHeight>a.height;j&&(a.width=e.minWidth),k&&(a.height=e.minHeight),h&&(a.width=e.maxWidth),i&&(a.height=e.maxHeight);var l=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height,n=/sw|nw|w/.test(g),o=/nw|ne|n/.test(g);j&&n&&(a.left=l-e.minWidth),h&&n&&(a.left=l-e.maxWidth),k&&o&&(a.top=m-e.minHeight),i&&o&&(a.top=m-e.maxHeight);var p=!a.width&&!a.height;return p&&!a.left&&a.top?a.top=null:p&&!a.top&&a.left&&(a.left=null),a},_proportionallyResize:function(){var b=this.options;if(!this._proportionallyResizeElements.length)return;var c=this.helper||this.element;for(var d=0;d<this._proportionallyResizeElements.length;d++){var e=this._proportionallyResizeElements[d];if(!this.borderDif){var f=[e.css("borderTopWidth"),e.css("borderRightWidth"),e.css("borderBottomWidth"),e.css("borderLeftWidth")],g=[e.css("paddingTop"),e.css("paddingRight"),e.css("paddingBottom"),e.css("paddingLeft")];this.borderDif=a.map(f,function(a,b){var c=parseInt(a,10)||0,d=parseInt(g[b],10)||0;return c+d})}if(!a.browser.msie||!a(c).is(":hidden")&&!a(c).parents(":hidden").length)e.css({height:c.height()-this.borderDif[0]-this.borderDif[2]||0,width:c.width()-this.borderDif[1]-this.borderDif[3]||0});else continue}},_renderProxy:function(){var b=this.element,c=this.options;this.elementOffset=b.offset();if(this._helper){this.helper=this.helper||a('<div style="overflow:hidden;"></div>');var d=a.browser.msie&&a.browser.version<7,e=d?1:0,f=d?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++c.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(a,b,c){return{width:this.originalSize.width+b}},w:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{left:f.left+b,width:e.width-b}},n:function(a,b,c){var d=this.options,e=this.originalSize,f=this.originalPosition;return{top:f.top+c,height:e.height-c}},s:function(a,b,c){return{height:this.originalSize.height+c}},se:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},sw:function(b,c,d){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,c,d]))},ne:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,c,d]))},nw:function(b,c,d){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,c,d]))}},_propagate:function(b,c){a.ui.plugin.call(this,b,[c,this.ui()]),b!="resize"&&this._trigger(b,c,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),a.extend(a.ui.resizable,{version:"1.8.20"}),a.ui.plugin.add("resizable","alsoResize",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=function(b){a(b).each(function(){var b=a(this);b.data("resizable-alsoresize",{width:parseInt(b.width(),10),height:parseInt(b.height(),10),left:parseInt(b.css("left"),10),top:parseInt(b.css("top"),10)})})};typeof e.alsoResize=="object"&&!e.alsoResize.parentNode?e.alsoResize.length?(e.alsoResize=e.alsoResize[0],f(e.alsoResize)):a.each(e.alsoResize,function(a){f(a)}):f(e.alsoResize)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.originalSize,g=d.originalPosition,h={height:d.size.height-f.height||0,width:d.size.width-f.width||0,top:d.position.top-g.top||0,left:d.position.left-g.left||0},i=function(b,d){a(b).each(function(){var b=a(this),e=a(this).data("resizable-alsoresize"),f={},g=d&&d.length?d:b.parents(c.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(g,function(a,b){var c=(e[b]||0)+(h[b]||0);c&&c>=0&&(f[b]=c||null)}),b.css(f)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?a.each(e.alsoResize,function(a,b){i(a,b)}):i(e.alsoResize)},stop:function(b,c){a(this).removeData("resizable-alsoresize")}}),a.ui.plugin.add("resizable","animate",{stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d._proportionallyResizeElements,g=f.length&&/textarea/i.test(f[0].nodeName),h=g&&a.ui.hasScroll(f[0],"left")?0:d.sizeDiff.height,i=g?0:d.sizeDiff.width,j={width:d.size.width-i,height:d.size.height-h},k=parseInt(d.element.css("left"),10)+(d.position.left-d.originalPosition.left)||null,l=parseInt(d.element.css("top"),10)+(d.position.top-d.originalPosition.top)||null;d.element.animate(a.extend(j,l&&k?{top:l,left:k}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var c={width:parseInt(d.element.css("width"),10),height:parseInt(d.element.css("height"),10),top:parseInt(d.element.css("top"),10),left:parseInt(d.element.css("left"),10)};f&&f.length&&a(f[0]).css({width:c.width,height:c.height}),d._updateCache(c),d._propagate("resize",b)}})}}),a.ui.plugin.add("resizable","containment",{start:function(b,d){var e=a(this).data("resizable"),f=e.options,g=e.element,h=f.containment,i=h instanceof a?h.get(0):/parent/.test(h)?g.parent().get(0):h;if(!i)return;e.containerElement=a(i);if(/document/.test(h)||h==document)e.containerOffset={left:0,top:0},e.containerPosition={left:0,top:0},e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight};else{var j=a(i),k=[];a(["Top","Right","Left","Bottom"]).each(function(a,b){k[a]=c(j.css("padding"+b))}),e.containerOffset=j.offset(),e.containerPosition=j.position(),e.containerSize={height:j.innerHeight()-k[3],width:j.innerWidth()-k[1]};var l=e.containerOffset,m=e.containerSize.height,n=e.containerSize.width,o=a.ui.hasScroll(i,"left")?i.scrollWidth:n,p=a.ui.hasScroll(i)?i.scrollHeight:m;e.parentData={element:i,left:l.left,top:l.top,width:o,height:p}}},resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.containerSize,g=d.containerOffset,h=d.size,i=d.position,j=d._aspectRatio||b.shiftKey,k={top:0,left:0},l=d.containerElement;l[0]!=document&&/static/.test(l.css("position"))&&(k=g),i.left<(d._helper?g.left:0)&&(d.size.width=d.size.width+(d._helper?d.position.left-g.left:d.position.left-k.left),j&&(d.size.height=d.size.width/d.aspectRatio),d.position.left=e.helper?g.left:0),i.top<(d._helper?g.top:0)&&(d.size.height=d.size.height+(d._helper?d.position.top-g.top:d.position.top),j&&(d.size.width=d.size.height*d.aspectRatio),d.position.top=d._helper?g.top:0),d.offset.left=d.parentData.left+d.position.left,d.offset.top=d.parentData.top+d.position.top;var m=Math.abs((d._helper?d.offset.left-k.left:d.offset.left-k.left)+d.sizeDiff.width),n=Math.abs((d._helper?d.offset.top-k.top:d.offset.top-g.top)+d.sizeDiff.height),o=d.containerElement.get(0)==d.element.parent().get(0),p=/relative|absolute/.test(d.containerElement.css("position"));o&&p&&(m-=d.parentData.left),m+d.size.width>=d.parentData.width&&(d.size.width=d.parentData.width-m,j&&(d.size.height=d.size.width/d.aspectRatio)),n+d.size.height>=d.parentData.height&&(d.size.height=d.parentData.height-n,j&&(d.size.width=d.size.height*d.aspectRatio))},stop:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.position,g=d.containerOffset,h=d.containerPosition,i=d.containerElement,j=a(d.helper),k=j.offset(),l=j.outerWidth()-d.sizeDiff.width,m=j.outerHeight()-d.sizeDiff.height;d._helper&&!e.animate&&/relative/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m}),d._helper&&!e.animate&&/static/.test(i.css("position"))&&a(this).css({left:k.left-h.left-g.left,width:l,height:m})}}),a.ui.plugin.add("resizable","ghost",{start:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size;d.ghost=d.originalElement.clone(),d.ghost.css({opacity:.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:""),d.ghost.appendTo(d.helper)},resize:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})},stop:function(b,c){var d=a(this).data("resizable"),e=d.options;d.ghost&&d.helper&&d.helper.get(0).removeChild(d.ghost.get(0))}}),a.ui.plugin.add("resizable","grid",{resize:function(b,c){var d=a(this).data("resizable"),e=d.options,f=d.size,g=d.originalSize,h=d.originalPosition,i=d.axis,j=e._aspectRatio||b.shiftKey;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var k=Math.round((f.width-g.width)/(e.grid[0]||1))*(e.grid[0]||1),l=Math.round((f.height-g.height)/(e.grid[1]||1))*(e.grid[1]||1);/^(se|s|e)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l):/^(ne)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l):/^(sw)$/.test(i)?(d.size.width=g.width+k,d.size.height=g.height+l,d.position.left=h.left-k):(d.size.width=g.width+k,d.size.height=g.height+l,d.position.top=h.top-l,d.position.left=h.left-k)}});var c=function(a){return parseInt(a,10)||0},d=function(a){return!isNaN(parseInt(a,10))}}(jQuery),function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var b=this;this.element.addClass("ui-selectable"),this.dragged=!1;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]),c.addClass("ui-selectee"),c.each(function(){var b=a(this),c=b.offset();a.data(this,"selectable-item",{element:this,$element:b,left:c.left,top:c.top,right:c.left+b.outerWidth(),bottom:c.top+b.outerHeight(),startselected:!1,selected:b.hasClass("ui-selected"),selecting:b.hasClass("ui-selecting"),unselecting:b.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=c.addClass("ui-selectee"),this._mouseInit(),this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){return this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable"),this._mouseDestroy(),this},_mouseStart:function(b){var c=this;this.opos=[b.pageX,b.pageY];if(this.options.disabled)return;var d=this.options;this.selectees=a(d.filter,this.element[0]),this._trigger("start",b),a(d.appendTo).append(this.helper),this.helper.css({left:b.clientX,top:b.clientY,width:0,height:0}),d.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var d=a.data(this,"selectable-item");d.startselected=!0,!b.metaKey&&!b.ctrlKey&&(d.$element.removeClass("ui-selected"),d.selected=!1,d.$element.addClass("ui-unselecting"),d.unselecting=!0,c._trigger("unselecting",b,{unselecting:d.element}))}),a(b.target).parents().andSelf().each(function(){var d=a.data(this,"selectable-item");if(d){var e=!b.metaKey&&!b.ctrlKey||!d.$element.hasClass("ui-selected");return d.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),d.unselecting=!e,d.selecting=e,d.selected=e,e?c._trigger("selecting",b,{selecting:d.element}):c._trigger("unselecting",b,{unselecting:d.element}),!1}})},_mouseDrag:function(b){var c=this;this.dragged=!0;if(this.options.disabled)return;var d=this.options,e=this.opos[0],f=this.opos[1],g=b.pageX,h=b.pageY;if(e>g){var i=g;g=e,e=i}if(f>h){var i=h;h=f,f=i}return this.helper.css({left:e,top:f,width:g-e,height:h-f}),this.selectees.each(function(){var i=a.data(this,"selectable-item");if(!i||i.element==c.element[0])return;var j=!1;d.tolerance=="touch"?j=!(i.left>g||i.right<e||i.top>h||i.bottom<f):d.tolerance=="fit"&&(j=i.left>e&&i.right<g&&i.top>f&&i.bottom<h),j?(i.selected&&(i.$element.removeClass("ui-selected"),i.selected=!1),i.unselecting&&(i.$element.removeClass("ui-unselecting"),i.unselecting=!1),i.selecting||(i.$element.addClass("ui-selecting"),i.selecting=!0,c._trigger("selecting",b,{selecting:i.element}))):(i.selecting&&((b.metaKey||b.ctrlKey)&&i.startselected?(i.$element.removeClass("ui-selecting"),i.selecting=!1,i.$element.addClass("ui-selected"),i.selected=!0):(i.$element.removeClass("ui-selecting"),i.selecting=!1,i.startselected&&(i.$element.addClass("ui-unselecting"),i.unselecting=!0),c._trigger("unselecting",b,{unselecting:i.element}))),i.selected&&!b.metaKey&&!b.ctrlKey&&!i.startselected&&(i.$element.removeClass("ui-selected"),i.selected=!1,i.$element.addClass("ui-unselecting"),i.unselecting=!0,c._trigger("unselecting",b,{unselecting:i.element})))}),!1},_mouseStop:function(b){var c=this;this.dragged=!1;var d=this.options;return a(".ui-unselecting",this.element[0]).each(function(){var d=a.data(this,"selectable-item");d.$element.removeClass("ui-unselecting"),d.unselecting=!1,d.startselected=!1,c._trigger("unselected",b,{unselected:d.element})}),a(".ui-selecting",this.element[0]).each(function(){var d=a.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected"),d.selecting=!1,d.selected=!0,d.startselected=!0,c._trigger("selected",b,{selected:d.element})}),this._trigger("stop",b),this.helper.remove(),!1}}),a.extend(a.ui.selectable,{version:"1.8.20"})}(jQuery),function(a,b){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var a=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},destroy:function(){a.Widget.prototype.destroy.call(this),this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--)this.items[b].item.removeData(this.widgetName+"-item");return this},_setOption:function(b,c){b==="disabled"?(this.options[b]=c,this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")):a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(b,c){var d=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(b);var e=null,f=this,g=a(b.target).parents().each(function(){if(a.data(this,d.widgetName+"-item")==f)return e=a(this),!1});a.data(b.target,d.widgetName+"-item")==f&&(e=a(b.target));if(!e)return!1;if(this.options.handle&&!c){var h=!1;a(this.options.handle,e).find("*").andSelf().each(function(){this==b.target&&(h=!0)});if(!h)return!1}return this.currentItem=e,this._removeCurrentsFromItems(),!0},_mouseStart:function(b,c,d){var e=this.options,f=this;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(b),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this._generatePosition(b),this.originalPageX=b.pageX,this.originalPageY=b.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),e.containment&&this._setContainment(),e.cursor&&(a("body").css("cursor")&&(this._storedCursor=a("body").css("cursor")),a("body").css("cursor",e.cursor)),e.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",e.opacity)),e.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",e.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",b,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!d)for(var g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",b,f._uiHash(this));return a.ui.ddmanager&&(a.ui.ddmanager.current=this),a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(b),!0},_mouseDrag:function(b){this.position=this._generatePosition(b),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var c=this.options,d=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-b.pageY<c.scrollSensitivity?this.scrollParent[0].scrollTop=d=this.scrollParent[0].scrollTop+c.scrollSpeed:b.pageY-this.overflowOffset.top<c.scrollSensitivity&&(this.scrollParent[0].scrollTop=d=this.scrollParent[0].scrollTop-c.scrollSpeed),this.overflowOffset.left+this.scrollParent[0].offsetWidth-b.pageX<c.scrollSensitivity?this.scrollParent[0].scrollLeft=d=this.scrollParent[0].scrollLeft+c.scrollSpeed:b.pageX-this.overflowOffset.left<c.scrollSensitivity&&(this.scrollParent[0].scrollLeft=d=this.scrollParent[0].scrollLeft-c.scrollSpeed)):(b.pageY-a(document).scrollTop()<c.scrollSensitivity?d=a(document).scrollTop(a(document).scrollTop()-c.scrollSpeed):a(window).height()-(b.pageY-a(document).scrollTop())<c.scrollSensitivity&&(d=a(document).scrollTop(a(document).scrollTop()+c.scrollSpeed)),b.pageX-a(document).scrollLeft()<c.scrollSensitivity?d=a(document).scrollLeft(a(document).scrollLeft()-c.scrollSpeed):a(window).width()-(b.pageX-a(document).scrollLeft())<c.scrollSensitivity&&(d=a(document).scrollLeft(a(document).scrollLeft()+c.scrollSpeed))),d!==!1&&a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,b)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(var e=this.items.length-1;e>=0;e--){var f=this.items[e],g=f.item[0],h=this._intersectsWithPointer(f);if(!h)continue;if(g!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],g):!0)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(b,f);else break;this._trigger("change",b,this._uiHash());break}}return this._contactContainers(b),a.ui.ddmanager&&a.ui.ddmanager.drag(this,b),this._trigger("sort",b,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(b,c){if(!b)return;a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,b);if(this.options.revert){var d=this,e=d.placeholder.offset();d.reverting=!0,a(this.helper).animate({left:e.left-this.offset.parent.left-d.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-d.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){d._clear(b)})}else this._clear(b,c);return!1},cancel:function(){var b=this;if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("deactivate",null,b._uiHash(this)),this.containers[c].containerCache.over&&(this.containers[c]._trigger("out",null,b._uiHash(this)),this.containers[c].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),a.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},a(c).each(function(){var c=(a(b.item||this).attr(b.attribute||"id")||"").match(b.expression||/(.+)[-=_](.+)/);c&&d.push((b.key||c[1]+"[]")+"="+(b.key&&b.expression?c[1]:c[2]))}),!d.length&&b.key&&d.push(b.key+"="),d.join("&")},toArray:function(b){var c=this._getItemsAsjQuery(b&&b.connected),d=[];return b=b||{},c.each(function(){d.push(a(b.item||this).attr(b.attribute||"id")||"")}),d},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,d=this.positionAbs.top,e=d+this.helperProportions.height,f=a.left,g=f+a.width,h=a.top,i=h+a.height,j=this.offset.click.top,k=this.offset.click.left,l=d+j>h&&d+j<i&&b+k>f&&b+k<g;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?l:f<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<g&&h<d+this.helperProportions.height/2&&e-this.helperProportions.height/2<i},_intersectsWithPointer:function(b){var c=this.options.axis==="x"||a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,b.top,b.height),d=this.options.axis==="y"||a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,b.left,b.width),e=c&&d,f=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();return e?this.floating?g&&g=="right"||f=="down"?2:1:f&&(f=="down"?2:1):!1},_intersectsWithSides:function(b){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,b.top+b.height/2,b.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,b.left+b.width/2,b.width),e=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();return this.floating&&f?f=="right"&&d||f=="left"&&!d:e&&(e=="down"&&c||e=="up"&&!c)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){return this._refreshItems(a),this.refreshPositions(),this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(b){var c=this,d=[],e=[],f=this._connectWith();if(f&&b)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&e.push([a.isFunction(j.options.items)?j.options.items.call(j.element):a(j.options.items,j.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),j])}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var g=e.length-1;g>=0;g--)e[g][0].each(function(){d.push(this)});return a(d)},_removeCurrentsFromItems:function(){var a=this.currentItem.find(":data("+this.widgetName+"-item)");for(var b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(b){this.items=[],this.containers=[this];var c=this.items,d=this,e=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],b,{item:this.currentItem}):a(this.options.items,this.element),this]],f=this._connectWith();if(f&&this.ready)for(var g=f.length-1;g>=0;g--){var h=a(f[g]);for(var i=h.length-1;i>=0;i--){var j=a.data(h[i],this.widgetName);j&&j!=this&&!j.options.disabled&&(e.push([a.isFunction(j.options.items)?j.options.items.call(j.element[0],b,{item:this.currentItem}):a(j.options.items,j.element),j]),this.containers.push(j))}}for(var g=e.length-1;g>=0;g--){var k=e[g][1],l=e[g][0];for(var i=0,m=l.length;i<m;i++){var n=a(l[i]);n.data(this.widgetName+"-item",k),c.push({item:n,instance:k,width:0,height:0,left:0,top:0})}}},refreshPositions:function(b){this.offsetParent&&this.helper&&(this.offset.parent=this._getParentOffset());for(var c=this.items.length-1;c>=0;c--){var d=this.items[c];if(d.instance!=this.currentContainer&&this.currentContainer&&d.item[0]!=this.currentItem[0])continue;var e=this.options.toleranceElement?a(this.options.toleranceElement,d.item):d.item;b||(d.width=e.outerWidth(),d.height=e.outerHeight());var f=e.offset();d.left=f.left,d.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var c=this.containers.length-1;c>=0;c--){var f=this.containers[c].element.offset();this.containers[c].containerCache.left=f.left,this.containers[c].containerCache.top=f.top,this.containers[c].containerCache.width=this.containers[c].element.outerWidth(),this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(b){var c=b||this,d=c.options;if(!d.placeholder||d.placeholder.constructor==String){var e=d.placeholder;d.placeholder={element:function(){var b=a(document.createElement(c.currentItem[0].nodeName)).addClass(e||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return e||(b.style.visibility="hidden"),b},update:function(a,b){if(e&&!d.forcePlaceholderSize)return;b.height()||b.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10)),b.width()||b.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}c.placeholder=a(d.placeholder.element.call(c.element,c.currentItem)),c.currentItem.after(c.placeholder),d.placeholder.update(c,c.placeholder)},_contactContainers:function(b){var c=null,d=null;for(var e=this.containers.length-1;e>=0;e--){if(a.ui.contains(this.currentItem[0],this.containers[e].element[0]))continue;if(this._intersectsWith(this.containers[e].containerCache)){if(c&&a.ui.contains(this.containers[e].element[0],c.element[0]))continue;c=this.containers[e],d=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",b,this._uiHash(this)),this.containers[e].containerCache.over=0)}if(!c)return;if(this.containers.length===1)this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1;else if(this.currentContainer!=this.containers[d]){var f=1e4,g=null,h=this.positionAbs[this.containers[d].floating?"left":"top"];for(var i=this.items.length-1;i>=0;i--){if(!a.ui.contains(this.containers[d].element[0],this.items[i].item[0]))continue;var j=this.items[i][this.containers[d].floating?"left":"top"];Math.abs(j-h)<f&&(f=Math.abs(j-h),g=this.items[i])}if(!g&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[d],g?this._rearrange(b,g,null,!0):this._rearrange(b,null,this.containers[d].element,!0),this._trigger("change",b,this._uiHash()),this.containers[d]._trigger("change",b,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[d]._trigger("over",b,this._uiHash(this)),this.containers[d].containerCache.over=1}},_createHelper:function(b){var c=this.options,d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[b,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;return d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]),d[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(d[0].style.width==""||c.forceHelperSize)&&d.width(this.currentItem.width()),(d[0].style.height==""||c.forceHelperSize)&&d.height(this.currentItem.height()),d},_adjustOffsetFromHelper:function(b){typeof b=="string"&&(b=b.split(" ")),a.isArray(b)&&(b={left:+b[0],top:+b[1]||0}),"left"in b&&(this.offset.click.left=b.left+this.margins.left),"right"in b&&(this.offset.click.left=this.helperProportions.width-b.right+this.margins.left),"top"in b&&(this.offset.click.top=b.top+this.margins.top),"bottom"in b&&(this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])&&(b.left+=this.scrollParent.scrollLeft(),b.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)b={top:0,left:0};return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var b=this.options;b.containment=="parent"&&(b.containment=this.helper[0].parentNode);if(b.containment=="document"||b.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(b.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(b.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(b.containment)){var c=a(b.containment)[0],d=a(b.containment).offset(),e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(b,c){c||(c=this.position);var d=b=="absolute"?1:-1,e=this.options,f=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(b){var c=this.options,d=this.cssPosition=="absolute"&&(this.scrollParent[0]==document||!a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(d[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var f=b.pageX,g=b.pageY;if(this.originalPosition){this.containment&&(b.pageX-this.offset.click.left<this.containment[0]&&(f=this.containment[0]+this.offset.click.left),b.pageY-this.offset.click.top<this.containment[1]&&(g=this.containment[1]+this.offset.click.top),b.pageX-this.offset.click.left>this.containment[2]&&(f=this.containment[2]+this.offset.click.left),b.pageY-this.offset.click.top>this.containment[3]&&(g=this.containment[3]+this.offset.click.top));if(c.grid){var h=this.originalPageY+Math.round((g-this.originalPageY)/c.grid[1])*c.grid[1];g=this.containment?h-this.offset.click.top<this.containment[1]||h-this.offset.click.top>this.containment[3]?h-this.offset.click.top<this.containment[1]?h+c.grid[1]:h-c.grid[1]:h:h;var i=this.originalPageX+Math.round((f-this.originalPageX)/c.grid[0])*c.grid[0];f=this.containment?i-this.offset.click.left<this.containment[0]||i-this.offset.click.left>this.containment[2]?i-this.offset.click.left<this.containment[0]?i+c.grid[0]:i-c.grid[0]:i:i}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:d.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:d.scrollLeft())}},_rearrange:function(a,b,c,d){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling),this.counter=this.counter?++this.counter:1;var e=this,f=this.counter;window.setTimeout(function(){f==e.counter&&e.refreshPositions(!d)},0)},_clear:function(b,c){this.reverting=!1;var d=[],e=this;!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem),this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var f in this._storedCSS)if(this._storedCSS[f]=="auto"||this._storedCSS[f]=="static")this._storedCSS[f]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!c&&d.push(function(a){this._trigger("receive",a,this._uiHash(this.fromOutside))}),(this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!c&&d.push(function(a){this._trigger("update",a,this._uiHash())});if(!a.ui.contains(this.element[0],this.currentItem[0])){c||d.push(function(a){this._trigger("remove",a,this._uiHash())});for(var f=this.containers.length-1;f>=0;f--)a.ui.contains(this.containers[f].element[0],this.currentItem[0])&&!c&&(d.push(function(a){return function(b){a._trigger("receive",b,this._uiHash(this))}}.call(this,this.containers[f])),d.push(function(a){return function(b){a._trigger("update",b,this._uiHash(this))}}.call(this,this.containers[f])))}for(var f=this.containers.length-1;f>=0;f--)c||d.push(function(a){return function(b){a._trigger("deactivate",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over&&(d.push(function(a){return function(b){a._trigger("out",b,this._uiHash(this))}}.call(this,this.containers[f])),this.containers[f].containerCache.over=0);this._storedCursor&&a("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",b,this._uiHash());for(var f=0;f<d.length;f++)d[f].call(this,b);this._trigger("stop",b,this._uiHash())}return!1}c||this._trigger("beforeStop",b,this._uiHash()),this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.helper[0]!=this.currentItem[0]&&this.helper.remove(),this.helper=null;if(!c){for(var f=0;f<d.length;f++)d[f].call(this,b);this._trigger("stop",b,this._uiHash())}return this.fromOutside=!1,!0},_trigger:function(){a.Widget.prototype._trigger.apply(this,arguments)===!1&&this.cancel()},_uiHash:function(b){var c=b||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:b?b.element:null}}}),a.extend(a.ui.sortable,{version:"1.8.20"})}(jQuery),jQuery.effects||function(a,b){function c(b){var c;return b&&b.constructor==Array&&b.length==3?b:(c=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(b))?[parseInt(c[1],10),parseInt(c[2],10),parseInt(c[3],10)]:(c=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(b))?[parseFloat(c[1])*2.55,parseFloat(c[2])*2.55,parseFloat(c[3])*2.55]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(b))?[parseInt(c[1],16),parseInt(c[2],16),parseInt(c[3],16)]:(c=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(b))?[parseInt(c[1]+c[1],16),parseInt(c[2]+c[2],16),parseInt(c[3]+c[3],16)]:(c=/rgba\(0, 0, 0, 0\)/.exec(b))?e.transparent:e[a.trim(b).toLowerCase()]}function d(b,d){var e;do{e=a.curCSS(b,d);if(e!=""&&e!="transparent"||a.nodeName(b,"body"))break;d="backgroundColor"}while(b=b.parentNode);return c(e)}function h(){var a=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,b={},c,d;if(a&&a.length&&a[0]&&a[a[0]]){var e=a.length;while(e--)c=a[e],typeof a[c]=="string"&&(d=c.replace(/\-(\w)/g,function(a,b){return b.toUpperCase()}),b[d]=a[c])}else for(c in a)typeof a[c]=="string"&&(b[c]=a[c]);return b}function i(b){var c,d;for(c in b)d=b[c],(d==null||a.isFunction(d)||c in g||/scrollbar/.test(c)||!/color/i.test(c)&&isNaN(parseFloat(d)))&&delete b[c];return b}function j(a,b){var c={_:0},d;for(d in b)a[d]!=b[d]&&(c[d]=b[d]);return c}function k(b,c,d,e){typeof b=="object"&&(e=c,d=null,c=b,b=c.effect),a.isFunction(c)&&(e=c,d=null,c={});if(typeof c=="number"||a.fx.speeds[c])e=d,d=c,c={};return a.isFunction(d)&&(e=d,d=null),c=c||{},d=d||c.duration,d=a.fx.off?0:typeof d=="number"?d:d in a.fx.speeds?a.fx.speeds[d]:a.fx.speeds._default,e=e||c.complete,[b,c,d,e]}function l(b){return!b||typeof b=="number"||a.fx.speeds[b]?!0:typeof b=="string"&&!a.effects[b]?!0:!1}a.effects={},a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(b,e){a.fx.step[e]=function(a){a.colorInit||(a.start=d(a.elem,e),a.end=c(a.end),a.colorInit=!0),a.elem.style[e]="rgb("+Math.max(Math.min(parseInt(a.pos*(a.end[0]-a.start[0])+a.start[0],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[1]-a.start[1])+a.start[1],10),255),0)+","+Math.max(Math.min(parseInt(a.pos*(a.end[2]-a.start[2])+a.start[2],10),255),0)+")"}});var e={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},f=["add","remove","toggle"],g={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(b,c,d,e){return a.isFunction(d)&&(e=d,d=null),this.queue(function(){var g=a(this),k=g.attr("style")||" ",l=i(h.call(this)),m,n=g.attr("class")||"";a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),m=i(h.call(this)),g.attr("class",n),g.animate(j(l,m),{queue:!1,duration:c,easing:d,complete:function(){a.each(f,function(a,c){b[c]&&g[c+"Class"](b[c])}),typeof g.attr("style")=="object"?(g.attr("style").cssText="",g.attr("style").cssText=k):g.attr("style",k),e&&e.apply(this,arguments),a.dequeue(this)}})})},a.fn.extend({_addClass:a.fn.addClass,addClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{add:b},c,d,e]):this._addClass(b)},_removeClass:a.fn.removeClass,removeClass:function(b,c,d,e){return c?a.effects.animateClass.apply(this,[{remove:b},c,d,e]):this._removeClass(b)},_toggleClass:a.fn.toggleClass,toggleClass:function(c,d,e,f,g){return typeof d=="boolean"||d===b?e?a.effects.animateClass.apply(this,[d?{add:c}:{remove:c},e,f,g]):this._toggleClass(c,d):a.effects.animateClass.apply(this,[{toggle:c},d,e,f])},switchClass:function(b,c,d,e,f){return a.effects.animateClass.apply(this,[{add:c,remove:b},d,e,f])}}),a.extend(a.effects,{version:"1.8.20",save:function(a,b){for(var c=0;c<b.length;c++)b[c]!==null&&a.data("ec.storage."+b[c],a[0].style[b[c]])},restore:function(a,b){for(var c=0;c<b.length;c++)b[c]!==null&&a.css(b[c],a.data("ec.storage."+b[c]))},setMode:function(a,b){return b=="toggle"&&(b=a.is(":hidden")?"show":"hide"),b},getBaseline:function(a,b){var c,d;switch(a[0]){case"top":c=0;break;case"middle":c=.5;break;case"bottom":c=1;break;default:c=a[0]/b.height}switch(a[1]){case"left":d=0;break;case"center":d=.5;break;case"right":d=1;break;default:d=a[1]/b.width}return{x:d,y:c}},createWrapper:function(b){if(b.parent().is(".ui-effects-wrapper"))return b.parent();var c={width:b.outerWidth(!0),height:b.outerHeight(!0),"float":b.css("float")},d=a("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e=document.activeElement;return b.wrap(d),(b[0]===e||a.contains(b[0],e))&&a(e).focus(),d=b.parent(),b.css("position")=="static"?(d.css({position:"relative"}),b.css({position:"relative"})):(a.extend(c,{position:b.css("position"),zIndex:b.css("z-index")}),a.each(["top","left","bottom","right"],function(a,d){c[d]=b.css(d),isNaN(parseInt(c[d],10))&&(c[d]="auto")}),b.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),d.css(c).show()},removeWrapper:function(b){var c,d=document.activeElement;return b.parent().is(".ui-effects-wrapper")?(c=b.parent().replaceWith(b),(b[0]===d||a.contains(b[0],d))&&a(d).focus(),c):b},setTransition:function(b,c,d,e){return e=e||{},a.each(c,function(a,c){var f=b.cssUnit(c);f[0]>0&&(e[c]=f[0]*d+f[1])}),e}}),a.fn.extend({effect:function(b,c,d,e){var f=k.apply(this,arguments),g={options:f[1],duration:f[2],callback:f[3]},h=g.options.mode,i=a.effects[b];return a.fx.off||!i?h?this[h](g.duration,g.callback):this.each(function(){g.callback&&g.callback.call(this)}):i.call(this,g)},_show:a.fn.show,show:function(a){if(l(a))return this._show.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="show",this.effect.apply(this,b)},_hide:a.fn.hide,hide:function(a){if(l(a))return this._hide.apply(this,arguments);var b=k.apply(this,arguments);return b[1].mode="hide",this.effect.apply(this,b)},__toggle:a.fn.toggle,toggle:function(b){if(l(b)||typeof b=="boolean"||a.isFunction(b))return this.__toggle.apply(this,arguments);var c=k.apply(this,arguments);return c[1].mode="toggle",this.effect.apply(this,c)},cssUnit:function(b){var c=this.css(b),d=[];return a.each(["em","px","%","pt"],function(a,b){c.indexOf(b)>0&&(d=[parseFloat(c),b])}),d}}),a.easing.jswing=a.easing.swing,a.extend(a.easing,{def:"easeOutQuad",swing:function(b,c,d,e,f){return a.easing[a.easing.def](b,c,d,e,f)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return b==0?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return b==0?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e)==1)return c+d;g||(g=e*.3);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin((b*e-f)*2*Math.PI/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(b==0)return c;if((b/=e/2)==2)return c+d;g||(g=e*.3*1.5);if(h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return b<1?-0.5*h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g)+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*2*Math.PI/g)*.5+d+c},easeInBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),e*(c/=f)*c*((g+1)*c-g)+d},easeOutBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),e*((c=c/f-1)*c*((g+1)*c+g)+1)+d},easeInOutBack:function(a,c,d,e,f,g){return g==b&&(g=1.70158),(c/=f/2)<1?e/2*c*c*(((g*=1.525)+1)*c-g)+d:e/2*((c-=2)*c*(((g*=1.525)+1)*c+g)+2)+d},easeInBounce:function(b,c,d,e,f){return e-a.easing.easeOutBounce(b,f-c,0,e,f)+d},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*7.5625*b*b+c:b<2/2.75?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:b<2.5/2.75?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(b,c,d,e,f){return c<f/2?a.easing.easeInBounce(b,c*2,0,e,f)*.5+d:a.easing.easeOutBounce(b,c*2-f,0,e,f)*.5+e*.5+d}})}(jQuery),function(a,b){a.effects.blind=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=f=="vertical"?"height":"width",i=f=="vertical"?g.height():g.width();e=="show"&&g.css(h,0);var j={};j[h]=e=="show"?i:0,g.animate(j,b.duration,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.bounce=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"up",g=b.options.distance||20,h=b.options.times||5,i=b.duration||250;/show|hide/.test(e)&&d.push("opacity"),a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",g=b.options.distance||(j=="top"?c.outerHeight({margin:!0})/3:c.outerWidth({margin:!0})/3);e=="show"&&c.css("opacity",0).css(j,k=="pos"?-g:g),e=="hide"&&(g=g/(h*2)),e!="hide"&&h--;if(e=="show"){var l={opacity:1};l[j]=(k=="pos"?"+=":"-=")+g,c.animate(l,i/2,b.options.easing),g=g/2,h--}for(var m=0;m<h;m++){var n={},p={};n[j]=(k=="pos"?"-=":"+=")+g,p[j]=(k=="pos"?"+=":"-=")+g,c.animate(n,i/2,b.options.easing).animate(p,i/2,b.options.easing),g=e=="hide"?g*2:g/2}if(e=="hide"){var l={opacity:0};l[j]=(k=="pos"?"-=":"+=")+g,c.animate(l,i/2,b.options.easing,function(){c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)})}else{var n={},p={};n[j]=(k=="pos"?"-=":"+=")+g,p[j]=(k=="pos"?"+=":"-=")+g,c.animate(n,i/2,b.options.easing).animate(p,i/2,b.options.easing,function(){a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)})}c.queue("fx",function(){c.dequeue()}),c.dequeue()})}}(jQuery),function(a,b){a.effects.clip=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","height","width"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"vertical";a.effects.save(c,d),c.show();var g=a.effects.createWrapper(c).css({overflow:"hidden"}),h=c[0].tagName=="IMG"?g:c,i={size:f=="vertical"?"height":"width",position:f=="vertical"?"top":"left"},j=f=="vertical"?h.height():h.width();e=="show"&&(h.css(i.size,0),h.css(i.position,j/2));var k={};k[i.size]=e=="show"?j:0,k[i.position]=e=="show"?0:j/2,h.animate(k,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.drop=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","opacity"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.direction||"left";a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var g=f=="up"||f=="down"?"top":"left",h=f=="up"||f=="left"?"pos":"neg",i=b.options.distance||(g=="top"?c.outerHeight({margin:!0})/2:c.outerWidth({margin:!0})/2);e=="show"&&c.css("opacity",0).css(g,h=="pos"?-i:i);var j={opacity:e=="show"?1:0};j[g]=(e=="show"?h=="pos"?"+=":"-=":h=="pos"?"-=":"+=")+i,c.animate(j,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.explode=function(b){return this.queue(function(){var c=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3,d=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?a(this).is(":visible")?"hide":"show":b.options.mode;var e=a(this).show().css("visibility","hidden"),f=e.offset();f.top-=parseInt(e.css("marginTop"),10)||0,f.left-=parseInt(e.css("marginLeft"),10)||0;var g=e.outerWidth(!0),h=e.outerHeight(!0);for(var i=0;i<c;i++)for(var j=0;j<d;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(g/d),top:-i*(h/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/d,height:h/c,left:f.left+j*(g/d)+(b.options.mode=="show"?(j-Math.floor(d/2))*(g/d):0),top:f.top+i*(h/c)+(b.options.mode=="show"?(i-Math.floor(c/2))*(h/c):0),opacity:b.options.mode=="show"?0:1}).animate({left:f.left+j*(g/d)+(b.options.mode=="show"?0:(j-Math.floor(d/2))*(g/d)),top:f.top+i*(h/c)+(b.options.mode=="show"?0:(i-Math.floor(c/2))*(h/c)),opacity:b.options.mode=="show"?1:0},b.duration||500);setTimeout(function(){b.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide(),b.callback&&b.callback.apply(e[0]),e.dequeue(),a("div.ui-effects-explode").remove()},b.duration||500)})}}(jQuery),function(a,b){a.effects.fade=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide");c.animate({opacity:d},{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.fold=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"hide"),f=b.options.size||15,g=!!b.options.horizFirst,h=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(c,d),c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),j=e=="show"!=g,k=j?["width","height"]:["height","width"],l=j?[i.width(),i.height()]:[i.height(),i.width()],m=/([0-9]+)%/.exec(f);m&&(f=parseInt(m[1],10)/100*l[e=="hide"?0:1]),e=="show"&&i.css(g?{height:0,width:f}:{height:f,width:0});var n={},p={};n[k[0]]=e=="show"?l[0]:f,p[k[1]]=e=="show"?l[1]:0,i.animate(n,h,b.options.easing).animate(p,h,b.options.easing,function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.effects.highlight=function(b){return this.queue(function(){var c=a(this),d=["backgroundImage","backgroundColor","opacity"],e=a.effects.setMode(c,b.options.mode||"show"),f={backgroundColor:c.css("backgroundColor")};e=="hide"&&(f.opacity=0),a.effects.save(c,d),c.show().css({backgroundImage:"none",backgroundColor:b.options.color||"#ffff99"}).animate(f,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),e=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.pulsate=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"show"),e=(b.options.times||5)*2-1,f=b.duration?b.duration/2:a.fx.speeds._default/2,g=c.is(":visible"),h=0;g||(c.css("opacity",0).show(),h=1),(d=="hide"&&g||d=="show"&&!g)&&e--;for(var i=0;i<e;i++)c.animate({opacity:h},f,b.options.easing),h=(h+1)%2;c.animate({opacity:h},f,b.options.easing,function(){h==0&&c.hide(),b.callback&&b.callback.apply(this,arguments)}),c.queue("fx",function(){c.dequeue()}).dequeue()})}}(jQuery),function(a,b){a.effects.puff=function(b){return this.queue(function(){var c=a(this),d=a.effects.setMode(c,b.options.mode||"hide"),e=parseInt(b.options.percent,10)||150,f=e/100,g={height:c.height(),width:c.width()};a.extend(b.options,{fade:!0,mode:d,percent:d=="hide"?e:100,from:d=="hide"?g:{height:g.height*f,width:g.width*f}}),c.effect("scale",b.options,b.duration,b.callback),c.dequeue()})},a.effects.scale=function(b){return this.queue(function(){var c=a(this),d=a.extend(!0,{},b.options),e=a.effects.setMode(c,b.options.mode||"effect"),f=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:e=="hide"?0:100),g=b.options.direction||"both",h=b.options.origin;e!="effect"&&(d.origin=h||["middle","center"],d.restore=!0);var i={height:c.height(),width:c.width()};c.from=b.options.from||(e=="show"?{height:0,width:0}:i);var j={y:g!="horizontal"?f/100:1,x:g!="vertical"?f/100:1};c.to={height:i.height*j.y,width:i.width*j.x},b.options.fade&&(e=="show"&&(c.from.opacity=0,c.to.opacity=1),e=="hide"&&(c.from.opacity=1,c.to.opacity=0)),d.from=c.from,d.to=c.to,d.mode=e,c.effect("size",d,b.duration,b.callback),c.dequeue()})},a.effects.size=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right","width","height","overflow","opacity"],e=["position","top","bottom","left","right","overflow","opacity"],f=["width","height","overflow"],g=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],j=a.effects.setMode(c,b.options.mode||"effect"),k=b.options.restore||!1,l=b.options.scale||"both",m=b.options.origin,n={height:c.height(),width:c.width()};c.from=b.options.from||n,c.to=b.options.to||n;if(m){var p=a.effects.getBaseline(m,n);c.from.top=(n.height-c.from.height)*p.y,c.from.left=(n.width-c.from.width)*p.x,c.to.top=(n.height-c.to.height)*p.y,c.to.left=(n.width-c.to.width)*p.x}var q={from:{y:c.from.height/n.height,x:c.from.width/n.width},to:{y:c.to.height/n.height,x:c.to.width/n.width}};if(l=="box"||l=="both")q.from.y!=q.to.y&&(d=d.concat(h),c.from=a.effects.setTransition(c,h,q.from.y,c.from),c.to=a.effects.setTransition(c,h,q.to.y,c.to)),q.from.x!=q.to.x&&(d=d.concat(i),c.from=a.effects.setTransition(c,i,q.from.x,c.from),c.to=a.effects.setTransition(c,i,q.to.x,c.to));(l=="content"||l=="both")&&q.from.y!=q.to.y&&(d=d.concat(g),c.from=a.effects.setTransition(c,g,q.from.y,c.from),c.to=a.effects.setTransition(c,g,q.to.y,c.to)),a.effects.save(c,k?d:e),c.show(),a.effects.createWrapper(c),c.css("overflow","hidden").css(c.from);if(l=="content"||l=="both")h=h.concat(["marginTop","marginBottom"]).concat(g),i=i.concat(["marginLeft","marginRight"]),f=d.concat(h).concat(i),c.find("*[width]").each(function(){var c=a(this);k&&a.effects.save(c,f);var d={height:c.height(),width:c.width()};c.from={height:d.height*q.from.y,width:d.width*q.from.x},c.to={height:d.height*q.to.y,width:d.width*q.to.x},q.from.y!=q.to.y&&(c.from=a.effects.setTransition(c,h,q.from.y,c.from),c.to=a.effects.setTransition(c,h,q.to.y,c.to)),q.from.x!=q.to.x&&(c.from=a.effects.setTransition(c,i,q.from.x,c.from),c.to=a.effects.setTransition(c,i,q.to.x,c.to)),c.css(c.from),c.animate(c.to,b.duration,b.options.easing,function(){k&&a.effects.restore(c,f)})});c.animate(c.to,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){c.to.opacity===0&&c.css("opacity",c.from.opacity),j=="hide"&&c.hide(),a.effects.restore(c,k?d:e),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.shake=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"effect"),f=b.options.direction||"left",g=b.options.distance||20,h=b.options.times||3,i=b.duration||b.options.duration||140;a.effects.save(c,d),c.show(),a.effects.createWrapper(c);var j=f=="up"||f=="down"?"top":"left",k=f=="up"||f=="left"?"pos":"neg",l={},m={},n={};l[j]=(k=="pos"?"-=":"+=")+g,m[j]=(k=="pos"?"+=":"-=")+g*2,n[j]=(k=="pos"?"-=":"+=")+g*2,c.animate(l,i,b.options.easing);for(var p=1;p<h;p++)c.animate(m,i,b.options.easing).animate(n,i,b.options.easing);c.animate(m,i,b.options.easing).animate(l,i/2,b.options.easing,function(){a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments)}),c.queue("fx",function(){c.dequeue()}),c.dequeue()})}}(jQuery),function(a,b){a.effects.slide=function(b){return this.queue(function(){var c=a(this),d=["position","top","bottom","left","right"],e=a.effects.setMode(c,b.options.mode||"show"),f=b.options.direction||"left";a.effects.save(c,d),c.show(),a.effects.createWrapper(c).css({overflow:"hidden"});var g=f=="up"||f=="down"?"top":"left",h=f=="up"||f=="left"?"pos":"neg",i=b.options.distance||(g=="top"?c.outerHeight({margin:!0}):c.outerWidth({margin:!0}));e=="show"&&c.css(g,h=="pos"?isNaN(i)?"-"+i:-i:i);var j={};j[g]=(e=="show"?h=="pos"?"+=":"-=":h=="pos"?"-=":"+=")+i,c.animate(j,{queue:!1,duration:b.duration,easing:b.options.easing,complete:function(){e=="hide"&&c.hide(),a.effects.restore(c,d),a.effects.removeWrapper(c),b.callback&&b.callback.apply(this,arguments),c.dequeue()}})})}}(jQuery),function(a,b){a.effects.transfer=function(b){return this.queue(function(){var c=a(this),d=a(b.options.to),e=d.offset(),f={top:e.top,left:e.left,height:d.innerHeight(),width:d.innerWidth()},g=c.offset(),h=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(b.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,b.duration,b.options.easing,function(){h.remove(),b.callback&&b.callback.apply(c[0],arguments),c.dequeue()})})}}(jQuery),function(a,b){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:!0,clearStyle:!1,collapsible:!1,event:"click",fillSpace:!1,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var b=this,c=b.options;b.running=0,b.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"),b.headers=b.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(c.disabled)return;a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(c.disabled)return;a(this).removeClass("ui-state-focus")}),b.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(c.navigation){var d=b.element.find("a").filter(c.navigationFilter).eq(0);if(d.length){var e=d.closest(".ui-accordion-header");e.length?b.active=e:b.active=d.closest(".ui-accordion-content").prev()}}b.active=b._findActive(b.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"),b.active.next().addClass("ui-accordion-content-active"),b._createIcons(),b.resize(),b.element.attr("role","tablist"),b.headers.attr("role","tab").bind("keydown.accordion",function(a){return b._keydown(a)}).next().attr("role","tabpanel"),b.headers.not(b.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide(),b.active.length?b.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):b.headers.eq(0).attr("tabIndex",0),a.browser.safari||b.headers.find("a").attr("tabIndex",-1),c.event&&b.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(a){b._clickHandler.call(b,a,this),a.preventDefault()})},_createIcons:function(){var b=this.options;b.icons&&(a("<span></span>").addClass("ui-icon "+b.icons.header).prependTo(this.headers),this.active.children(".ui-icon").toggleClass(b.icons.header).toggleClass(b.icons.headerSelected),this.element.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.children(".ui-icon").remove(),this.element.removeClass("ui-accordion-icons")},destroy:function(){var b=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"),this.headers.find("a").removeAttr("tabIndex"),this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");return(b.autoHeight||b.fillHeight)&&c.css("height",""),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b=="active"&&this.activate(c),b=="icons"&&(this._destroyIcons(),c&&this._createIcons()),b=="disabled"&&this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(b){if(this.options.disabled||b.altKey||b.ctrlKey)return;var c=a.ui.keyCode,d=this.headers.length,e=this.headers.index(b.target),f=!1;switch(b.keyCode){case c.RIGHT:case c.DOWN:f=this.headers[(e+1)%d];break;case c.LEFT:case c.UP:f=this.headers[(e-1+d)%d];break;case c.SPACE:case c.ENTER:this._clickHandler({target:b.target},b.target),b.preventDefault()}return f?(a(b.target).attr("tabIndex",-1),a(f).attr("tabIndex",0),f.focus(),!1):!0},resize:function(){var b=this.options,c;if(b.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height(),a.browser.msie&&this.element.parent().css("overflow",d),this.headers.each(function(){c-=a(this).outerHeight(!0)}),this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else b.autoHeight&&(c=0,this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c));return this},activate:function(a){this.options.active=a;var b=this._findActive(a)[0];return this._clickHandler({target:b},b),this},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===!1?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,c){var d=this.options;if(d.disabled)return;if(!b.target){if(!d.collapsible)return;this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),f={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:e},g=this.active=a([]);this._toggle(g,e,f);return}var h=a(b.currentTarget||c),i=h[0]===this.active[0];d.active=d.collapsible&&i?!1:this.headers.index(h);if(this.running||!d.collapsible&&i)return;var j=this.active,g=h.next(),e=this.active.next(),f={options:d,newHeader:i&&d.collapsible?a([]):h,oldHeader:this.active,newContent:i&&d.collapsible?a([]):g,oldContent:e},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=i?a([]):h,this._toggle(g,e,f,i,k),j.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header),i||(h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected),h.next().addClass("ui-accordion-content-active"));return},_toggle:function(b,c,d,e,f){var g=this,h=g.options;g.toShow=b,g.toHide=c,g.data=d;var i=function(){if(!g)return;return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data),g.running=c.size()===0?b.size():c.size();if(h.animated){var j={};h.collapsible&&e?j={toShow:a([]),toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace}:j={toShow:b,toHide:c,complete:i,down:f,autoHeight:h.autoHeight||h.fillSpace},h.proxied||(h.proxied=h.animated),h.proxiedDuration||(h.proxiedDuration=h.duration),h.animated=a.isFunction(h.proxied)?h.proxied(j):h.proxied,h.duration=a.isFunction(h.proxiedDuration)?h.proxiedDuration(j):h.proxiedDuration;var k=a.ui.accordion.animations,l=h.duration,m=h.animated;m&&!k[m]&&!a.easing[m]&&(m="slide"),k[m]||(k[m]=function(a){this.slide(a,{easing:m,duration:l||700})}),k[m](j)}else h.collapsible&&e?b.toggle():(c.hide(),b.show()),i(!0);c.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur(),b.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(this.running)return;this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""}),this.toHide.removeClass("ui-accordion-content-active"),this.toHide.length&&(this.toHide.parent()[0].className=this.toHide.parent()[0].className),this._trigger("change",null,this.data)}}),a.extend(a.ui.accordion,{version:"1.8.20",animations:{slide:function(b,c){b=a.extend({easing:"swing",duration:300},b,c);if(!b.toHide.size()){b.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},b);return}if(!b.toShow.size()){b.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},b);return}var d=b.toShow.css("overflow"),e=0,f={},g={},h=["height","paddingTop","paddingBottom"],i,j=b.toShow;i=j[0].style.width,j.width(j.parent().width()-parseFloat(j.css("paddingLeft"))-parseFloat(j.css("paddingRight"))-(parseFloat(j.css("borderLeftWidth"))||0)-(parseFloat(j.css("borderRightWidth"))||0)),a.each(h,function(c,d){g[d]="hide";var e=(""+a.css(b.toShow[0],d)).match(/^([\d+-.]+)(.*)$/);f[d]={value:e[1],unit:e[2]||"px"}}),b.toShow.css({height:0,overflow:"hidden"}).show(),b.toHide.filter(":hidden").each(b.complete).end().filter(":visible").animate(g,{step:function(a,c){c.prop=="height"&&(e=c.end-c.start===0?0:(c.now-c.start)/(c.end-c.start)),b.toShow[0].style[c.prop]=e*f[c.prop].value+f[c.prop].unit},duration:b.duration,easing:b.easing,complete:function(){b.autoHeight||b.toShow.css("height",""),b.toShow.css({width:i,overflow:d}),b.complete()}})},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1e3:200})}}})}(jQuery),function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var b=this,c=this.element[0].ownerDocument,d;this.isMultiLine=this.element.is("textarea"),this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(b.options.disabled||b.element.propAttr("readOnly"))return;d=!1;var e=a.ui.keyCode;switch(c.keyCode){case e.PAGE_UP:b._move("previousPage",c);break;case e.PAGE_DOWN:b._move("nextPage",c);break;case e.UP:b._keyEvent("previous",c);break;case e.DOWN:b._keyEvent("next",c);break;case e.ENTER:case e.NUMPAD_ENTER:b.menu.active&&(d=!0,c.preventDefault());case e.TAB:if(!b.menu.active)return;b.menu.select(c);break;case e.ESCAPE:b.element.val(b.term),b.close(c);break;default:clearTimeout(b.searching),b.searching=setTimeout(function(){b.term!=b.element.val()&&(b.selectedItem=null,b.search(null,c))},b.options.delay)}}).bind("keypress.autocomplete",function(a){d&&(d=!1,a.preventDefault())}).bind("focus.autocomplete",function(){if(b.options.disabled)return;b.selectedItem=null,b.previous=b.element.val()}).bind("blur.autocomplete",function(a){if(b.options.disabled)return;clearTimeout(b.searching),b.closing=setTimeout(function(){b.close(a),b._change(a)},150)}),this._initSource(),this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",c)[0]).mousedown(function(c){var d=b.menu.element[0];a(c.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(c){c.target!==b.element[0]&&c.target!==d&&!a.ui.contains(d,c.target)&&b.close()})},1),setTimeout(function(){clearTimeout(b.closing)},13)}).menu({focus:function(a,c){var d=c.item.data("item.autocomplete");!1!==b._trigger("focus",a,{item:d})&&/^key/.test(a.originalEvent.type)&&b.element.val(d.value)},selected:function(a,d){var e=d.item.data("item.autocomplete"),f=b.previous;b.element[0]!==c.activeElement&&(b.element.focus(),b.previous=f,setTimeout(function(){b.previous=f,b.selectedItem=e},1)),!1!==b._trigger("select",a,{item:e})&&b.element.val(e.value),b.term=b.element.val(),b.close(a),b.selectedItem=e},blur:function(a,c){b.menu.element.is(":visible")&&b.element.val()!==b.term&&b.element.val(b.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"),a.fn.bgiframe&&this.menu.element.bgiframe(),b.beforeunloadHandler=function(){b.element.removeAttr("autocomplete")},a(window).bind("beforeunload",b.beforeunloadHandler)},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"),this.menu.element.remove(),a(window).unbind("beforeunload",this.beforeunloadHandler),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments),b==="source"&&this._initSource(),b==="appendTo"&&this.menu.element.appendTo(a(c||"body",this.element[0].ownerDocument)[0]),b==="disabled"&&c&&this.xhr&&this.xhr.abort()},_initSource:function(){var b=this,c,d;a.isArray(this.options.source)?(c=this.options.source,this.source=function(b,d){d(a.ui.autocomplete.filter(c,b.term))}):typeof this.options.source=="string"?(d=this.options.source,this.source=function(c,e){b.xhr&&b.xhr.abort(),b.xhr=a.ajax({url:d,data:c,dataType:"json",success:function(a,b){e(a)},error:function(){e([])}})}):this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val(),this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)===!1)return;return this._search(a)},_search:function(a){this.pending++,this.element.addClass("ui-autocomplete-loading"),this.source({term:a},this._response())},_response:function(){var a=this,b=++c;return function(d){b===c&&a.__response(d),a.pending--,a.pending||a.element.removeClass("ui-autocomplete-loading")}},__response:function(a){!this.options.disabled&&a&&a.length?(a=this._normalize(a),this._suggest(a),this._trigger("open")):this.close()},close:function(a){clearTimeout(this.closing),this.menu.element.is(":visible")&&(this.menu.element.hide(),this.menu.deactivate(),this._trigger("close",a))},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(b){return b.length&&b[0].label&&b[0].value?b:a.map(b,function(b){return typeof b=="string"?{label:b,value:b}:a.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(b){var c=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(c,b),this.menu.deactivate(),this.menu.refresh(),c.show(),this._resizeMenu(),c.position(a.extend({of:this.element},this.options.position)),this.options.autoFocus&&this.menu.next(new a.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth()+1,this.element.outerWidth()))},_renderMenu:function(b,c){var d=this;a.each(c,function(a,c){d._renderItem(b,c)})},_renderItem:function(b,c){return a("<li></li>").data("item.autocomplete",c).append(a("<a></a>").text(c.label)).appendTo(b)},_move:function(a,b){if(!this.menu.element.is(":visible")){this.search(null,b);return}if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term),this.menu.deactivate();return}this.menu[a](b)},widget:function(){return this.menu.element},_keyEvent:function(a,b){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(a,b),b.preventDefault()}}),a.extend(a.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(b,c){var d=new RegExp(a.ui.autocomplete.escapeRegex(c),"i");return a.grep(b,function(a){return d.test(a.label||a.value||a)})}})}(jQuery),function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length)return;c.preventDefault(),b.select(c)}),this.refresh()},refresh:function(){var b=this,c=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");c.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(c){b.activate(c,a(this).parent())}).mouseleave(function(){b.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.scrollTop(),e=this.element.height();c<0?this.element.scrollTop(d+c):c>=e&&this.element.scrollTop(d+c-e+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end(),this._trigger("focus",a,{item:b})},deactivate:function(){if(!this.active)return;this.active.children("a").removeClass("ui-state-hover").removeAttr("id"),this._trigger("blur"),this.active=null},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(!this.active){this.activate(c,this.element.children(b));return}var d=this.active[a+"All"](".ui-menu-item").eq(0);d.length?this.activate(c,d):this.activate(c,this.element.children(b))},nextPage:function(b){if(this.hasScroll()){if(!this.active||this.last()){this.activate(b,this.element.children(".ui-menu-item:first"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c-d+a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:last")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(b){if(this.hasScroll()){if(!this.active||this.first()){this.activate(b,this.element.children(".ui-menu-item:last"));return}var c=this.active.offset().top,d=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var b=a(this).offset().top-c+d-a(this).height();return b<10&&b>-10});e.length||(e=this.element.children(".ui-menu-item:first")),this.activate(b,e)}else this.activate(b,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[a.fn.prop?"prop":"attr"]("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})}(jQuery),function(a,b){var c,d,e,f,g="ui-button ui-widget ui-state-default ui-corner-all",h="ui-state-hover ui-state-active ",i="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",j=function(){var b=a(this).find(":ui-button");setTimeout(function(){b.button("refresh")},1)},k=function(b){var c=b.name,d=b.form,e=a([]);return c&&(d?e=a(d).find("[name='"+c+"']"):e=a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form})),e};a.widget("ui.button",{options:{disabled:null,text:!0,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",j),typeof this.options.disabled!="boolean"?this.options.disabled=!!this.element.propAttr("disabled"):this.element.propAttr("disabled",this.options.disabled),this._determineButtonType(),this.hasTitle=!!this.buttonElement.attr("title");var b=this,h=this.options,i=this.type==="checkbox"||this.type==="radio",l="ui-state-hover"+(i?"":" ui-state-active"),m="ui-state-focus";h.label===null&&(h.label=this.buttonElement.html()),this.buttonElement.addClass(g).attr("role","button").bind("mouseenter.button",function(){if(h.disabled)return;a(this).addClass("ui-state-hover"),this===c&&a(this).addClass("ui-state-active")}).bind("mouseleave.button",function(){if(h.disabled)return;a(this).removeClass(l)}).bind("click.button",function(a){h.disabled&&(a.preventDefault(),a.stopImmediatePropagation())}),this.element.bind("focus.button",function(){b.buttonElement.addClass(m)}).bind("blur.button",function(){b.buttonElement.removeClass(m)}),i&&(this.element.bind("change.button",function(){if(f)return;b.refresh()}),this.buttonElement.bind("mousedown.button",function(a){if(h.disabled)return;f=!1,d=a.pageX,e=a.pageY}).bind("mouseup.button",function(a){if(h.disabled)return;if(d!==a.pageX||e!==a.pageY)f=!0})),this.type==="checkbox"?this.buttonElement.bind("click.button",function(){if(h.disabled||f)return!1;a(this).toggleClass("ui-state-active"),b.buttonElement.attr("aria-pressed",b.element[0].checked)}):this.type==="radio"?this.buttonElement.bind("click.button",function(){if(h.disabled||f)return!1;a(this).addClass("ui-state-active"),b.buttonElement.attr("aria-pressed","true");var c=b.element[0];k(c).not(c).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")}):(this.buttonElement.bind("mousedown.button",function(){if(h.disabled)return!1;a(this).addClass("ui-state-active"),c=this,a(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(h.disabled)return!1;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(b){if(h.disabled)return!1;(b.keyCode==a.ui.keyCode.SPACE||b.keyCode==a.ui.keyCode.ENTER)&&a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")}),this.buttonElement.is("a")&&this.buttonElement.keyup(function(b){b.keyCode===a.ui.keyCode.SPACE&&a(this).click()})),this._setOption("disabled",h.disabled),this._resetButton()},_determineButtonType:function(){this.element.is(":checkbox")?this.type="checkbox":this.element.is(":radio")?this.type="radio":this.element.is("input")?this.type="input":this.type="button";if(this.type==="checkbox"||this.type==="radio"){var a=this.element.parents().filter(":last"),b="label[for='"+this.element.attr("id")+"']";this.buttonElement=a.find(b),this.buttonElement.length||(a=a.length?a.siblings():this.element.siblings(),this.buttonElement=a.filter(b),this.buttonElement.length||(this.buttonElement=a.find(b))),this.element.addClass("ui-helper-hidden-accessible");var c=this.element.is(":checked");c&&this.buttonElement.addClass("ui-state-active"),this.buttonElement.attr("aria-pressed",c)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible"),this.buttonElement.removeClass(g+" "+h+" "+i).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()),this.hasTitle||this.buttonElement.removeAttr("title"),a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled"){c?this.element.propAttr("disabled",!0):this.element.propAttr("disabled",!1);return}this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b),this.type==="radio"?k(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed","true"):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")}):this.type==="checkbox"&&(this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false"))},_resetButton:function(){if(this.type==="input"){this.options.label&&this.element.val(this.options.label);return}var b=this.buttonElement.removeClass(i),c=a("<span></span>",this.element[0].ownerDocument).addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary,f=[];d.primary||d.secondary?(this.options.text&&f.push("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary")),d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>"),d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>"),this.options.text||(f.push(e?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||b.attr("title",c))):f.push("ui-button-text-only"),b.addClass(f.join(" "))}}),a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c),a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(b?"ui-corner-left":"ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"),a.Widget.prototype.destroy.call(this)}})}(jQuery),function($,undefined){function Datepicker(){this.debug=!1,this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},$.extend(this._defaults,this.regional[""]),this.dpDiv=bindHover($('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function bindHover(a){var b="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return a.bind("mouseout",function(a){var c=$(a.target).closest(b);if(!c.length)return;c.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(c){var d=$(c.target).closest(b);if($.datepicker._isDisabledDatepicker(instActive.inline?a.parent()[0]:instActive.input[0])||!d.length)return;d.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),d.addClass("ui-state-hover"),d.hasClass("ui-datepicker-prev")&&d.addClass("ui-datepicker-prev-hover"),d.hasClass("ui-datepicker-next")&&d.addClass("ui-datepicker-next-hover")})}function extendRemove(a,b){$.extend(a,b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}function isArray(a){return a&&($.browser.safari&&typeof a=="object"&&a.length||a.constructor&&a.constructor.toString().match(/\Array\(\)/))}$.extend($.ui,{datepicker:{version:"1.8.20"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){return extendRemove(this._defaults,a||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(a,b){var c=a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:c,input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:b?bindHover($('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')):this.dpDiv}},_connectDatepicker:function(a,b){var c=$(a);b.append=$([]),b.trigger=$([]);if(c.hasClass(this.markerClassName))return;this._attachments(c,b),c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),this._autoSize(b),$.data(a,PROP_NAME,b),b.settings.disabled&&this._disableDatepicker(a)},_attachments:function(a,b){var c=this._get(b,"appendText"),d=this._get(b,"isRTL");b.append&&b.append.remove(),c&&(b.append=$('<span class="'+this._appendClass+'">'+c+"</span>"),a[d?"before":"after"](b.append)),a.unbind("focus",this._showDatepicker),b.trigger&&b.trigger.remove();var e=this._get(b,"showOn");(e=="focus"||e=="both")&&a.focus(this._showDatepicker);if(e=="button"||e=="both"){var f=this._get(b,"buttonText"),g=this._get(b,"buttonImage");b.trigger=$(this._get(b,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:g,alt:f,title:f}):$('<button type="button"></button>').addClass(this._triggerClass).html(g==""?f:$("<img/>").attr({src:g,alt:f,title:f}))),a[d?"before":"after"](b.trigger),b.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==a[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=a[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(a[0])):$.datepicker._showDatepicker(a[0]),!1})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var d=function(a){var b=0,c=0;for(var d=0;d<a.length;d++)a[d].length>b&&(b=a[d].length,c=d);return c};b.setMonth(d(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort"))),b.setDate(d(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=$(a);if(c.hasClass(this.markerClassName))return;c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(a,c,d){b.settings[c]=d}).bind("getData.datepicker",function(a,c){return this._get(b,c)}),$.data(a,PROP_NAME,b),this._setDate(b,this._getDefaultDate(b),!0),this._updateDatepicker(b),this._updateAlternate(b),b.settings.disabled&&this._disableDatepicker(a),b.dpDiv.css("display","block")},_dialogDatepicker:function(a,b,c,d,e){var f=this._dialogInst;if(!f){this.uuid+=1;var g="dp"+this.uuid;this._dialogInput=$('<input type="text" id="'+g+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),f=this._dialogInst=this._newInst(this._dialogInput,!1),f.settings={},$.data(this._dialogInput[0],PROP_NAME,f)}extendRemove(f.settings,d||{}),b=b&&b.constructor==Date?this._formatDate(f,b):b,this._dialogInput.val(b),this._pos=e?e.length?e:[e.pageX,e.pageY]:null;if(!this._pos){var h=document.documentElement.clientWidth,i=document.documentElement.clientHeight,j=document.documentElement.scrollLeft||document.body.scrollLeft,k=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[h/2-100+j,i/2-150+k]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),f.settings.onSelect=c,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,f),this},_destroyDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();$.removeData(a,PROP_NAME),d=="input"?(c.append.remove(),c.trigger.remove(),b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(d=="div"||d=="span")&&b.removeClass(this.markerClassName).empty()},_enableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!1,c.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().removeClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b})},_disableDatepicker:function(a){var b=$(a),c=$.data(a,PROP_NAME);if(!b.hasClass(this.markerClassName))return;var d=a.nodeName.toLowerCase();if(d=="input")a.disabled=!0,c.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(d=="div"||d=="span"){var e=b.children("."+this._inlineClass);e.children().addClass("ui-state-disabled"),e.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=$.map(this._disabledInputs,function(b){return b==a?null:b}),this._disabledInputs[this._disabledInputs.length]=a},_isDisabledDatepicker:function(a){if(!a)return!1;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return!0;return!1},_getInst:function(a){try{return $.data(a,PROP_NAME)}catch(b){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(a,b,c){var d=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?$.extend({},$.datepicker._defaults):d?b=="all"?$.extend({},d.settings):this._get(d,b):null;var e=b||{};typeof b=="string"&&(e={},e[b]=c);if(d){this._curInst==d&&this._hideDatepicker();var f=this._getDateDatepicker(a,!0),g=this._getMinMaxDate(d,"min"),h=this._getMinMaxDate(d,"max");extendRemove(d.settings,e),g!==null&&e.dateFormat!==undefined&&e.minDate===undefined&&(d.settings.minDate=this._formatDate(d,g)),h!==null&&e.dateFormat!==undefined&&e.maxDate===undefined&&(d.settings.maxDate=this._formatDate(d,h)),this._attachments($(a),d),this._autoSize(d),this._setDate(d,f),this._updateAlternate(d),this._updateDatepicker(d)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){var b=this._getInst(a);b&&this._updateDatepicker(b)},_setDateDatepicker:function(a,b){var c=this._getInst(a);c&&(this._setDate(c,b),this._updateDatepicker(c),this._updateAlternate(c))},_getDateDatepicker:function(a,b){var c=this._getInst(a);return c&&!c.inline&&this._setDateFromField(c,b),c?this._getDate(c):null},_doKeyDown:function(a){var b=$.datepicker._getInst(a.target),c=!0,d=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=!0;if($.datepicker._datepickerShowing)switch(a.keyCode){case 9:$.datepicker._hideDatepicker(),c=!1;break;case 13:var e=$("td."+$.datepicker._dayOverClass+":not(."+$.datepicker._currentClass+")",b.dpDiv);e[0]&&$.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,e[0]);var f=$.datepicker._get(b,"onSelect");if(f){var g=$.datepicker._formatDate(b);f.apply(b.input?b.input[0]:null,[g,b])}else $.datepicker._hideDatepicker();return!1;case 27:$.datepicker._hideDatepicker();break;case 33:$.datepicker._adjustDate(a.target,a.ctrlKey?-$.datepicker._get(b,"stepBigMonths"):-$.datepicker._get(b,"stepMonths"),"M");break;case 34:$.datepicker._adjustDate(a.target,a.ctrlKey?+$.datepicker._get(b,"stepBigMonths"):+$.datepicker._get(b,"stepMonths"),"M");break;case 35:(a.ctrlKey||a.metaKey)&&$.datepicker._clearDate(a.target),c=a.ctrlKey||a.metaKey;break;case 36:(a.ctrlKey||a.metaKey)&&$.datepicker._gotoToday(a.target),c=a.ctrlKey||a.metaKey;break;case 37:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,d?1:-1,"D"),c=a.ctrlKey||a.metaKey,a.originalEvent.altKey&&$.datepicker._adjustDate(a.target,a.ctrlKey?-$.datepicker._get(b,"stepBigMonths"):-$.datepicker._get(b,"stepMonths"),"M");break;case 38:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,-7,"D"),c=a.ctrlKey||a.metaKey;break;case 39:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,d?-1:1,"D"),c=a.ctrlKey||a.metaKey,a.originalEvent.altKey&&$.datepicker._adjustDate(a.target,a.ctrlKey?+$.datepicker._get(b,"stepBigMonths"):+$.datepicker._get(b,"stepMonths"),"M");break;case 40:(a.ctrlKey||a.metaKey)&&$.datepicker._adjustDate(a.target,7,"D"),c=a.ctrlKey||a.metaKey;break;default:c=!1}else a.keyCode==36&&a.ctrlKey?$.datepicker._showDatepicker(this):c=!1;c&&(a.preventDefault(),a.stopPropagation())},_doKeyPress:function(a){var b=$.datepicker._getInst(a.target);if($.datepicker._get(b,"constrainInput")){var c=$.datepicker._possibleChars($.datepicker._get(b,"dateFormat")),d=String.fromCharCode(a.charCode==undefined?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||d<" "||!c||c.indexOf(d)>-1}},_doKeyUp:function(a){var b=$.datepicker._getInst(a.target);if(b.input.val()!=b.lastVal)try{var c=$.datepicker.parseDate($.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,$.datepicker._getFormatConfig(b));c&&($.datepicker._setDateFromField(b),$.datepicker._updateAlternate(b),$.datepicker._updateDatepicker(b))}catch(d){$.datepicker.log(d)}return!0},_showDatepicker:function(a){a=a.target||a,a.nodeName.toLowerCase()!="input"&&(a=$("input",a.parentNode)[0]);if($.datepicker._isDisabledDatepicker(a)||$.datepicker._lastInput==a)return;var b=$.datepicker._getInst(a);$.datepicker._curInst&&$.datepicker._curInst!=b&&($.datepicker._curInst.dpDiv.stop(!0,!0),b&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var c=$.datepicker._get(b,"beforeShow"),d=c?c.apply(a,[a,b]):{};if(d===!1)return;extendRemove(b.settings,d),b.lastVal=null,$.datepicker._lastInput=a,$.datepicker._setDateFromField(b),$.datepicker._inDialog&&(a.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(a),$.datepicker._pos[1]+=a.offsetHeight);var e=!1;$(a).parents().each(function(){return e|=$(this).css("position")=="fixed",!e}),e&&$.browser.opera&&($.datepicker._pos[0]-=document.documentElement.scrollLeft,$.datepicker._pos[1]-=document.documentElement.scrollTop);var f={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,b.dpDiv.empty(),b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(b),f=$.datepicker._checkOffset(b,f,e),b.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":e?"fixed":"absolute",display:"none",left:f.left+"px",top:f.top+"px"});if(!b.inline){var g=$.datepicker._get(b,"showAnim"),h=$.datepicker._get(b,"duration"),i=function(){var a=b.dpDiv.find("iframe.ui-datepicker-cover");if(!!a.length){var c=$.datepicker._getBorders(b.dpDiv);a.css({left:-c[0],top:-c[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex($(a).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&$.effects[g]?b.dpDiv.show(g,$.datepicker._get(b,"showOptions"),h,i):b.dpDiv[g||"show"](g?h:null,i),(!g||!h)&&i(),b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus(),$.datepicker._curInst=b}},_updateDatepicker:function(a){var b=this;b.maxRows=4;var c=$.datepicker._getBorders(a.dpDiv);instActive=a,a.dpDiv.empty().append(this._generateHTML(a));var d=a.dpDiv.find("iframe.ui-datepicker-cover");!d.length||d.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}),a.dpDiv.find("."+this._dayOverClass+" a").mouseover();var e=this._getNumberOfMonths(a),f=e[1],g=17;a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),f>1&&a.dpDiv.addClass("ui-datepicker-multi-"+f).css("width",g*f+"em"),a.dpDiv[(e[0]!=1||e[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),a==$.datepicker._curInst&&$.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var h=a.yearshtml;setTimeout(function(){h===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml),h=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(a){return{thin:1,medium:2,thick:3}[a]||a};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var d=a.dpDiv.outerWidth(),e=a.dpDiv.outerHeight(),f=a.input?a.input.outerWidth():0,g=a.input?a.input.outerHeight():0,h=document.documentElement.clientWidth+$(document).scrollLeft(),i=document.documentElement.clientHeight+$(document).scrollTop();return b.left-=this._get(a,"isRTL")?d-f:0,b.left-=c&&b.left==a.input.offset().left?$(document).scrollLeft():0,b.top-=c&&b.top==a.input.offset().top+g?$(document).scrollTop():0,b.left-=Math.min(b.left,b.left+d>h&&h>d?Math.abs(b.left+d-h):0),b.top-=Math.min(b.top,b.top+e>i&&i>e?Math.abs(e+g):0),b},_findPos:function(a){var b=this._getInst(a),c=this._get(b,"isRTL");while(a&&(a.type=="hidden"||a.nodeType!=1||$.expr.filters.hidden(a)))a=a[c?"previousSibling":"nextSibling"];var d=$(a).offset();return[d.left,d.top]},_hideDatepicker:function(a){var b=this._curInst;if(!b||a&&b!=$.data(a,PROP_NAME))return;if(this._datepickerShowing){var c=this._get(b,"showAnim"),d=this._get(b,"duration"),e=function(){$.datepicker._tidyDialog(b)};$.effects&&$.effects[c]?b.dpDiv.hide(c,$.datepicker._get(b,"showOptions"),d,e):b.dpDiv[c=="slideDown"?"slideUp":c=="fadeIn"?"fadeOut":"hide"](c?d:null,e),c||e(),this._datepickerShowing=!1;var f=this._get(b,"onClose");f&&f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(!$.datepicker._curInst)return;var b=$(a.target),c=$.datepicker._getInst(b[0]);(b[0].id!=$.datepicker._mainDivId&&b.parents("#"+$.datepicker._mainDivId).length==0&&!b.hasClass($.datepicker.markerClassName)&&!b.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||b.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=c)&&$.datepicker._hideDatepicker()},_adjustDate:function(a,b,c){var d=$(a),e=this._getInst(d[0]);if(this._isDisabledDatepicker(d[0]))return;this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c),this._updateDatepicker(e)},_gotoToday:function(a){var b=$(a),c=this._getInst(b[0]);if(this._get(c,"gotoCurrent")&&c.currentDay)c.selectedDay=c.currentDay,c.drawMonth=c.selectedMonth=c.currentMonth,c.drawYear=c.selectedYear=c.currentYear;else{var d=new Date;c.selectedDay=d.getDate(),c.drawMonth=c.selectedMonth=d.getMonth(),c.drawYear=c.selectedYear=d.getFullYear()}this._notifyChange(c),this._adjustDate(b)},_selectMonthYear:function(a,b,c){var d=$(a),e=this._getInst(d[0]);e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10),this._notifyChange(e),this._adjustDate(d)},_selectDay:function(a,b,c,d){var e=$(a);if($(d).hasClass(this._unselectableClass)||this._isDisabledDatepicker(e[0]))return;var f=this._getInst(e[0]);f.selectedDay=f.currentDay=$("a",d).html(),f.selectedMonth=f.currentMonth=b,f.selectedYear=f.currentYear=c,this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))},_clearDate:function(a){var b=$(a),c=this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(a,b){var c=$(a),d=this._getInst(c[0]);b=b!=null?b:this._formatDate(d),d.input&&d.input.val(b),this._updateAlternate(d);var e=this._get(d,"onSelect");e?e.apply(d.input?d.input[0]:null,[b,d]):d.input&&d.input.trigger("change"),d.inline?this._updateDatepicker(d):(this._hideDatepicker(),this._lastInput=d.input[0],typeof d.input[0]!="object"&&d.input.focus(),this._lastInput=null)},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),d=this._getDate(a),e=this.formatDate(c,d,this._getFormatConfig(a));$(b).each(function(){$(this).val(e)})}},noWeekends:function(a){var b=a.getDay();return[b>0&&b<6,""]},iso8601Week:function(a){var b=new Date(a.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var c=b.getTime();return b.setMonth(0),b.setDate(1),Math.floor(Math.round((c-b)/864e5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var d=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,g=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,h=(c?c.monthNames:null)||this._defaults.monthNames,i=-1,j=-1,k=-1,l=-1,m=!1,n=function(b){var c=s+1<a.length&&a.charAt(s+1)==b;return c&&s++,c},o=function(a){var c=n(a),d=a=="@"?14:a=="!"?20:a=="y"&&c?4:a=="o"?3:2,e=new RegExp("^\\d{1,"+d+"}"),f=b.substring(r).match(e);if(!f)throw"Missing number at position "+r;return r+=f[0].length,parseInt(f[0],10)},p=function(a,c,d){var e=$.map(n(a)?d:c,function(a,b){return[[b,a]]}).sort(function(a,b){return-(a[1].length-b[1].length)}),f=-1;$.each(e,function(a,c){var d=c[1];if(b.substr(r,d.length).toLowerCase()==d.toLowerCase())return f=c[0],r+=d.length,!1});if(f!=-1)return f+1;throw"Unknown name at position "+r},q=function(){if(b.charAt(r)!=a.charAt(s))throw"Unexpected literal at position "+r;r++},r=0;for(var s=0;s<a.length;s++)if(m)a.charAt(s)=="'"&&!n("'")?m=!1:q();else switch(a.charAt(s)){case"d":k=o("d");break;case"D":p("D",e,f);break;case"o":l=o("o");break;case"m":j=o("m");break;case"M":j=p("M",g,h);break;case"y":i=o("y");break;case"@":var t=new Date(o("@"));i=t.getFullYear(),j=t.getMonth()+1,k=t.getDate();break;case"!":var t=new Date((o("!")-this._ticksTo1970)/1e4);i=t.getFullYear(),j=t.getMonth()+1,k=t.getDate();break;case"'":n("'")?q():m=!0;break;default:q()}if(r<b.length)throw"Extra/unparsed characters found in date: "+b.substring(r);i==-1?i=(new Date).getFullYear():i<100&&(i+=(new Date).getFullYear()-(new Date).getFullYear()%100+(i<=d?0:-100));if(l>-1){j=1,k=l;do{var u=this._getDaysInMonth(i,j-1);if(k<=u)break;j++,k-=u}while(!0)}var t=this._daylightSavingAdjust(new Date(i,j-1,k));if(t.getFullYear()!=i||t.getMonth()+1!=j||t.getDate()!=k)throw"Invalid date";return t},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(a,b,c){if(!b)return"";var d=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,e=(c?c.dayNames:null)||this._defaults.dayNames,f=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,h=function(b){var c=m+1<a.length&&a.charAt(m+1)==b;return c&&m++,c},i=function(a,b,c){var d=""+b;if(h(a))while(d.length<c)d="0"+d;return d},j=function(a,b,c,d){return h(a)?d[b]:c[b]},k="",l=!1;if(b)for(var m=0;m<a.length;m++)if(l)a.charAt(m)=="'"&&!h("'")?l=!1:k+=a.charAt(m);else switch(a.charAt(m)){case"d":k+=i("d",b.getDate(),2);break;case"D":k+=j("D",b.getDay(),d,e);break;case"o":k+=i("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864e5),3);break;case"m":k+=i("m",b.getMonth()+1,2);break;case"M":k+=j("M",b.getMonth(),f,g);break;case"y":k+=h("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case"@":k+=b.getTime();break;case"!":k+=b.getTime()*1e4+this._ticksTo1970;break;case"'":h("'")?k+="'":l=!0;break;default:k+=a.charAt(m)}return k},_possibleChars:function(a){var b="",c=!1,d=function(b){var c=e+1<a.length&&a.charAt(e+1)==b;return c&&e++,c};for(var e=0;e<a.length;e++)if(c)a.charAt(e)=="'"&&!d("'")?c=!1:b+=a.charAt(e);else switch(a.charAt(e)){case"d":case"m":case"y":case"@":b+="0123456789";break;case"D":case"M":return null;case"'":d("'")?b+="'":c=!0;break;default:b+=a.charAt(e)}return b},_get:function(a,b){return a.settings[b]!==undefined?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()==a.lastVal)return;var c=this._get(a,"dateFormat"),d=a.lastVal=a.input?a.input.val():null,e,f;e=f=this._getDefaultDate(a);var g=this._getFormatConfig(a);try{e=this.parseDate(c,d,g)||f}catch(h){this.log(h),d=b?"":d}a.selectedDay=e.getDate(),a.drawMonth=a.selectedMonth=e.getMonth(),a.drawYear=a.selectedYear=e.getFullYear(),a.currentDay=d?e.getDate():0,a.currentMonth=d?e.getMonth():0,a.currentYear=d?e.getFullYear():0,this._adjustInstDate(a)},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var d=function(a){var b=new Date;return b.setDate(b.getDate()+a),b},e=function(b){try{return $.datepicker.parseDate($.datepicker._get(a,"dateFormat"),b,$.datepicker._getFormatConfig(a))}catch(c){}var d=(b.toLowerCase().match(/^c/)?$.datepicker._getDate(a):null)||new Date,e=d.getFullYear(),f=d.getMonth(),g=d.getDate(),h=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,i=h.exec(b);while(i){switch(i[2]||"d"){case"d":case"D":g+=parseInt(i[1],10);break;case"w":case"W":g+=parseInt(i[1],10)*7;break;case"m":case"M":f+=parseInt(i[1],10),g=Math.min(g,$.datepicker._getDaysInMonth(e,f));break;case"y":case"Y":e+=parseInt(i[1],10),g=Math.min(g,$.datepicker._getDaysInMonth(e,f))}i=h.exec(b)}return new Date(e,f,g)},f=b==null||b===""?c:typeof b=="string"?e(b):typeof b=="number"?isNaN(b)?c:d(b):new Date(b.getTime());return f=f&&f.toString()=="Invalid Date"?c:f,f&&(f.setHours(0),f.setMinutes(0),f.setSeconds(0),f.setMilliseconds(0)),this._daylightSavingAdjust(f)},_daylightSavingAdjust:function(a){return a?(a.setHours(a.getHours()>12?a.getHours()+2:0),a):null},_setDate:function(a,b,c){var d=!b,e=a.selectedMonth,f=a.selectedYear,g=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=g.getDate(),a.drawMonth=a.selectedMonth=a.currentMonth=g.getMonth(),a.drawYear=a.selectedYear=a.currentYear=g.getFullYear(),(e!=a.selectedMonth||f!=a.selectedYear)&&!c&&this._notifyChange(a),this._adjustInstDate(a),a.input&&a.input.val(d?"":this._formatDate(a))},_getDate:function(a){var b=!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return b},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),d=this._get(a,"showButtonPanel"),e=this._get(a,"hideIfNoPrevNext"),f=this._get(a,"navigationAsDateFormat"),g=this._getNumberOfMonths(a),h=this._get(a,"showCurrentAtPos"),i=this._get(a,"stepMonths"),j=g[0]!=1||g[1]!=1,k=this._daylightSavingAdjust(a.currentDay?new Date(a.currentYear,a.currentMonth,a.currentDay):new Date(9999,9,9)),l=this._getMinMaxDate(a,"min"),m=this._getMinMaxDate(a,"max"),n=a.drawMonth-h,o=a.drawYear;n<0&&(n+=12,o--);if(m){var p=this._daylightSavingAdjust(new Date(m.getFullYear(),m.getMonth()-g[0]*g[1]+1,m.getDate()));p=l&&p<l?l:p;while(this._daylightSavingAdjust(new Date(o,n,1))>p)n--,n<0&&(n=11,o--)}a.drawMonth=n,a.drawYear=o;var q=this._get(a,"prevText");q=f?this.formatDate(q,this._daylightSavingAdjust(new Date(o,n-i,1)),this._getFormatConfig(a)):q;var r=this._canAdjustMonth(a,-1,o,n)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+a.id+"', -"+i+", 'M');\""+' title="'+q+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+q+"</span></a>":e?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+q+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+q+"</span></a>",s=this._get(a,"nextText");s=f?this.formatDate(s,this._daylightSavingAdjust(new Date(o,n+i,1)),this._getFormatConfig(a)):s;var t=this._canAdjustMonth(a,1,o,n)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+a.id+"', +"+i+", 'M');\""+' title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>":e?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>",u=this._get(a,"currentText"),v=this._get(a,"gotoCurrent")&&a.currentDay?k:b;u=f?this.formatDate(u,v,this._getFormatConfig(a)):u;var w=a.inline?"":'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+dpuuid+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>",x=d?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?w:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._gotoToday('#"+a.id+"');\""+">"+u+"</button>":"")+(c?"":w)+"</div>":"",y=parseInt(this._get(a,"firstDay"),10);y=isNaN(y)?0:y;var z=this._get(a,"showWeek"),A=this._get(a,"dayNames"),B=this._get(a,"dayNamesShort"),C=this._get(a,"dayNamesMin"),D=this._get(a,"monthNames"),E=this._get(a,"monthNamesShort"),F=this._get(a,"beforeShowDay"),G=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths"),I=this._get(a,"calculateWeek")||this.iso8601Week,J=this._getDefaultDate(a),K="";for(var L=0;L<g[0];L++){var M="";this.maxRows=4;for(var N=0;N<g[1];N++){var O=this._daylightSavingAdjust(new Date(o,n,a.selectedDay)),P=" ui-corner-all",Q="";if(j){Q+='<div class="ui-datepicker-group';if(g[1]>1)switch(N){case 0:Q+=" ui-datepicker-group-first",P=" ui-corner-"+(c?"right":"left");break;case g[1]-1:Q+=" ui-datepicker-group-last",P=" ui-corner-"+(c?"left":"right");break;default:Q+=" ui-datepicker-group-middle",P=""}Q+='">'}Q+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+P+'">'+(/all|left/.test(P)&&L==0?c?t:r:"")+(/all|right/.test(P)&&L==0?c?r:t:"")+this._generateMonthYearHeader(a,n,o,l,m,L>0||N>0,D,E)+'</div><table class="ui-datepicker-calendar"><thead>'+"<tr>";var R=z?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(var S=0;S<7;S++){var T=(S+y)%7;R+="<th"+((S+y+6)%7>=5?' class="ui-datepicker-week-end"':"")+">"+'<span title="'+A[T]+'">'+C[T]+"</span></th>"}Q+=R+"</tr></thead><tbody>";var U=this._getDaysInMonth(o,n);o==a.selectedYear&&n==a.selectedMonth&&(a.selectedDay=Math.min(a.selectedDay,U));var V=(this._getFirstDayOfMonth(o,n)-y+7)%7,W=Math.ceil((V+U)/7),X=j?this.maxRows>W?this.maxRows:W:W;this.maxRows=X;var Y=this._daylightSavingAdjust(new Date(o,n,1-V));for(var Z=0;Z<X;Z++){Q+="<tr>";var _=z?'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(Y)+"</td>":"";for(var S=0;S<7;S++){var ba=F?F.apply(a.input?a.input[0]:null,[Y]):[!0,""],bb=Y.getMonth()!=n,bc=bb&&!H||!ba[0]||l&&Y<l||m&&Y>m;_+='<td class="'+((S+y+6)%7>=5?" ui-datepicker-week-end":"")+(bb?" ui-datepicker-other-month":"")+(Y.getTime()==O.getTime()&&n==a.selectedMonth&&a._keyEvent||J.getTime()==Y.getTime()&&J.getTime()==O.getTime()?" "+this._dayOverClass:"")+(bc?" "+this._unselectableClass+" ui-state-disabled":"")+(bb&&!G?"":" "+ba[1]+(Y.getTime()==k.getTime()?" "+this._currentClass:"")+(Y.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!bb||G)&&ba[2]?' title="'+ba[2]+'"':"")+(bc?"":' onclick="DP_jQuery_'+dpuuid+".datepicker._selectDay('#"+a.id+"',"+Y.getMonth()+","+Y.getFullYear()+', this);return false;"')+">"+(bb&&!G?" ":bc?'<span class="ui-state-default">'+Y.getDate()+"</span>":'<a class="ui-state-default'+(Y.getTime()==b.getTime()?" ui-state-highlight":"")+(Y.getTime()==k.getTime()?" ui-state-active":"")+(bb?" ui-priority-secondary":"")+'" href="#">'+Y.getDate()+"</a>")+"</td>",Y.setDate(Y.getDate()+1),Y=this._daylightSavingAdjust(Y)}Q+=_+"</tr>"}n++,n>11&&(n=0,o++),Q+="</tbody></table>"+(j?"</div>"+(g[0]>0&&N==g[1]-1?'<div class="ui-datepicker-row-break"></div>':""):""),M+=Q}K+=M}return K+=x+($.browser.msie&&parseInt($.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':""),a._keyEvent=!1,K},_generateMonthYearHeader:function(a,b,c,d,e,f,g,h){var i=this._get(a,"changeMonth"),j=this._get(a,"changeYear"),k=this._get(a,"showMonthAfterYear"),l='<div class="ui-datepicker-title">',m="";if(f||!i)m+='<span class="ui-datepicker-month">'+g[b]+"</span>";else{var n=d&&d.getFullYear()==c,o=e&&e.getFullYear()==c;m+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" "+">";for(var p=0;p<12;p++)(!n||p>=d.getMonth())&&(!o||p<=e.getMonth())&&(m+='<option value="'+p+'"'+(p==b?' selected="selected"':"")+">"+h[p]+"</option>");m+="</select>"}k||(l+=m+(f||!i||!j?" ":""));if(!a.yearshtml){a.yearshtml="";if(f||!j)l+='<span class="ui-datepicker-year">'+c+"</span>";else{var q=this._get(a,"yearRange").split(":"),r=(new Date).getFullYear(),s=function(a){var b=a.match(/c[+-].*/)?c+parseInt(a.substring(1),10):a.match(/[+-].*/)?r+parseInt(a,10):parseInt(a,10);return isNaN(b)?r:b},t=s(q[0]),u=Math.max(t,s(q[1]||""));t=d?Math.max(t,d.getFullYear()):t,u=e?Math.min(u,e.getFullYear()):u,a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" "+">";for(;t<=u;t++)a.yearshtml+='<option value="'+t+'"'+(t==c?' selected="selected"':"")+">"+t+"</option>";a.yearshtml+="</select>",l+=a.yearshtml,a.yearshtml=null}}return l+=this._get(a,"yearSuffix"),k&&(l+=(f||!i||!j?" ":"")+m),l+="</div>",l},_adjustInstDate:function(a,b,c){var d=a.drawYear+(c=="Y"?b:0),e=a.drawMonth+(c=="M"?b:0),f=Math.min(a.selectedDay,this._getDaysInMonth(d,e))+(c=="D"?b:0),g=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(d,e,f)));a.selectedDay=g.getDate(),a.drawMonth=a.selectedMonth=g.getMonth(),a.drawYear=a.selectedYear=g.getFullYear(),(c=="M"||c=="Y")&&this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max"),e=c&&b<c?c:b;return e=d&&e>d?d:e,e},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");b&&b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){var b=this._get(a,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,d){var e=this._getNumberOfMonths(a),f=this._daylightSavingAdjust(new Date(c,d+(b<0?b:e[0]*e[1]),1));return b<0&&f.setDate(this._getDaysInMonth(f.getFullYear(),f.getMonth())),this._isInRange(a,f)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min"),d=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!d||b.getTime()<=d.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");return b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10),{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,d){b||(a.currentDay=a.selectedDay,a.currentMonth=a.selectedMonth,a.currentYear=a.selectedYear);var e=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(d,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),e,this._getFormatConfig(a))}}),$.fn.datepicker=function(a){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv),$.datepicker.initialized=!0);var b=Array.prototype.slice.call(arguments,1);return typeof a!="string"||a!="isDisabled"&&a!="getDate"&&a!="widget"?a=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b)):this.each(function(){typeof a=="string"?$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this].concat(b)):$.datepicker._attachDatepicker(this,a)}):$.datepicker["_"+a+"Datepicker"].apply($.datepicker,[this[0]].concat(b))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.8.20",window["DP_jQuery_"+dpuuid]=$}(jQuery),function(a,b){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",d={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},e={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},f=a.attrFn||{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0,click:!0};a.widget("ui.dialog",{options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",collision:"fit",using:function(b){var c=a(this).css(b).offset().top;c<0&&a(this).css("top",b.top-c)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.options.title=this.options.title||this.originalTitle;var b=this,d=b.options,e=d.title||" ",f=a.ui.dialog.getTitleId(b.element),g=(b.uiDialog=a("<div></div>")).appendTo(document.body).hide().addClass(c+d.dialogClass).css({zIndex:d.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(c){d.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(a){b.moveToTop(!1,a)}),h=b.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g),i=(b.uiDialogTitlebar=a("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),j=a('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){j.addClass("ui-state-hover")},function(){j.removeClass("ui-state-hover")}).focus(function(){j.addClass("ui-state-focus")}).blur(function(){j.removeClass("ui-state-focus")}).click(function(a){return b.close(a),!1}).appendTo(i),k=(b.uiDialogTitlebarCloseText=a("<span></span>")).addClass("ui-icon ui-icon-closethick").text(d.closeText).appendTo(j),l=a("<span></span>").addClass("ui-dialog-title").attr("id",f).html(e).prependTo(i);a.isFunction(d.beforeclose)&&!a.isFunction(d.beforeClose)&&(d.beforeClose=d.beforeclose),i.find("*").add(i).disableSelection(),d.draggable&&a.fn.draggable&&b._makeDraggable(),d.resizable&&a.fn.resizable&&b._makeResizable(),b._createButtons(d.buttons),b._isOpen=!1,a.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;return a.overlay&&a.overlay.destroy(),a.uiDialog.hide(),a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),a.uiDialog.remove(),a.originalTitle&&a.element.attr("title",a.originalTitle),a},widget:function(){return this.uiDialog},close:function(b){var c=this,d,e;if(!1===c._trigger("beforeClose",b))return;return c.overlay&&c.overlay.destroy(),c.uiDialog.unbind("keypress.ui-dialog"),c._isOpen=!1,c.options.hide?c.uiDialog.hide(c.options.hide,function(){c._trigger("close",b)}):(c.uiDialog.hide(),c._trigger("close",b)),a.ui.dialog.overlay.resize(),c.options.modal&&(d=0,a(".ui-dialog").each(function(){this!==c.uiDialog[0]&&(e=a(this).css("z-index"),isNaN(e)||(d=Math.max(d,e)))}),a.ui.dialog.maxZ=d),c},isOpen:function(){return this._isOpen},moveToTop:function(b,c){var d=this,e=d.options,f;return e.modal&&!b||!e.stack&&!e.modal?d._trigger("focus",c):(e.zIndex>a.ui.dialog.maxZ&&(a.ui.dialog.maxZ=e.zIndex),d.overlay&&(a.ui.dialog.maxZ+=1,d.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)),f={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()},a.ui.dialog.maxZ+=1,d.uiDialog.css("z-index",a.ui.dialog.maxZ),d.element.attr(f),d._trigger("focus",c),d)},open:function(){if(this._isOpen)return;var b=this,c=b.options,d=b.uiDialog;return b.overlay=c.modal?new a.ui.dialog.overlay(b):null,b._size(),b._position(c.position),d.show(c.show),b.moveToTop(!0),c.modal&&d.bind("keydown.ui-dialog",function(b){if(b.keyCode!==a.ui.keyCode.TAB)return;var c=a(":tabbable",this),d=c.filter(":first"),e=c.filter(":last");if(b.target===e[0]&&!b.shiftKey)return d.focus(1),!1;if(b.target===d[0]&&b.shiftKey)return e.focus(1),!1}),a(b.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus(),b._isOpen=!0,b._trigger("open"),b},_createButtons:function(b){var c=this,d=!1,e=a("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=a("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);c.uiDialog.find(".ui-dialog-buttonpane").remove(),typeof b=="object"&&b!==null&&a.each(b,function(){return!(d=!0)}),d&&(a.each(b,function(b,d){d=a.isFunction(d)?{click:d,text:b}:d;var e=a('<button type="button"></button>').click(function(){d.click.apply(c.element[0],arguments)}).appendTo(g);a.each(d,function(a,b){if(a==="click")return;a in f?e[a](b):e.attr(a,b)}),a.fn.button&&e.button()}),e.appendTo(c.uiDialog))},_makeDraggable:function(){function f(a){return{position:a.position,offset:a.offset}}var b=this,c=b.options,d=a(document),e;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(d,g){e=c.height==="auto"?"auto":a(this).height(),a(this).height(a(this).height()).addClass("ui-dialog-dragging"),b._trigger("dragStart",d,f(g))},drag:function(a,c){b._trigger("drag",a,f(c))},stop:function(g,h){c.position=[h.position.left-d.scrollLeft(),h.position.top-d.scrollTop()],a(this).removeClass("ui-dialog-dragging").height(e),b._trigger("dragStop",g,f(h)),a.ui.dialog.overlay.resize()}})},_makeResizable:function(c){function h(a){return{originalPosition:a.originalPosition,originalSize:a.originalSize,position:a.position,size:a.size}}c=c===b?this.options.resizable:c;var d=this,e=d.options,f=d.uiDialog.css("position"),g=typeof c=="string"?c:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:g,start:function(b,c){a(this).addClass("ui-dialog-resizing"),d._trigger("resizeStart",b,h(c))},resize:function(a,b){d._trigger("resize",a,h(b))},stop:function(b,c){a(this).removeClass("ui-dialog-resizing"),e.height=a(this).height(),e.width=a(this).width(),d._trigger("resizeStop",b,h(c)),a.ui.dialog.overlay.resize()}}).css("position",f).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(b){var c=[],d=[0,0],e;if(b){if(typeof b=="string"||typeof b=="object"&&"0"in b)c=b.split?b.split(" "):[b[0],b[1]],c.length===1&&(c[1]=c[0]),a.each(["left","top"],function(a,b){+c[a]===c[a]&&(d[a]=c[a],c[a]=b)}),b={my:c.join(" "),at:c.join(" "),offset:d.join(" ")};b=a.extend({},a.ui.dialog.prototype.options.position,b)}else b=a.ui.dialog.prototype.options.position;e=this.uiDialog.is(":visible"),e||this.uiDialog.show(),this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},b)),e||this.uiDialog.hide()},_setOptions:function(b){var c=this,f={},g=!1;a.each(b,function(a,b){c._setOption(a,b),a in d&&(g=!0),a in e&&(f[a]=b)}),g&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",f)},_setOption:function(b,d){var e=this,f=e.uiDialog;switch(b){case"beforeclose":b="beforeClose";break;case"buttons":e._createButtons(d);break;case"closeText":e.uiDialogTitlebarCloseText.text(""+d);break;case"dialogClass":f.removeClass(e.options.dialogClass).addClass(c+d);break;case"disabled":d?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case"draggable":var g=f.is(":data(draggable)");g&&!d&&f.draggable("destroy"),!g&&d&&e._makeDraggable();break;case"position":e._position(d);break;case"resizable":var h=f.is(":data(resizable)");h&&!d&&f.resizable("destroy"),h&&typeof d=="string"&&f.resizable("option","handles",d),!h&&d!==!1&&e._makeResizable(d);break;case"title":a(".ui-dialog-title",e.uiDialogTitlebar).html(""+(d||" "))}a.Widget.prototype._setOption.apply(e,arguments)},_size:function(){var b=this.options,c,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),b.minWidth>b.width&&(b.width=b.minWidth),c=this.uiDialog.css({height:"auto",width:b.width}).height(),d=Math.max(0,b.minHeight-c);if(b.height==="auto")if(a.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();var f=this.element.css("height","auto").height();e||this.uiDialog.hide(),this.element.height(Math.max(f,d))}else this.element.height(Math.max(b.height-c,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),a.extend(a.ui.dialog,{version:"1.8.20",uuid:0,maxZ:0,getTitleId:function(a){var b=a.attr("id");return b||(this.uuid+=1,b=this.uuid),"ui-dialog-title-"+b},overlay:function(b){this.$el=a.ui.dialog.overlay.create(b)}}),a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(b){this.instances.length===0&&(setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()<a.ui.dialog.overlay.maxZ)return!1})},1),a(document).bind("keydown.dialog-overlay",function(c){b.options.closeOnEscape&&!c.isDefaultPrevented()&&c.keyCode&&c.keyCode===a.ui.keyCode.ESCAPE&&(b.close(c),c.preventDefault())}),a(window).bind("resize.dialog-overlay",a.ui.dialog.overlay.resize));var c=(this.oldInstances.pop()||a("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});return a.fn.bgiframe&&c.bgiframe(),this.instances.push(c),c},destroy:function(b){var c=a.inArray(b,this.instances);c!=-1&&this.oldInstances.push(this.instances.splice(c,1)[0]),this.instances.length===0&&a([document,window]).unbind(".dialog-overlay"),b.remove();var d=0;a.each(this.instances,function(){d=Math.max(d,this.css("z-index"))}),this.maxZ=d},height:function(){var b,c;return a.browser.msie&&a.browser.version<7?(b=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),b<c?a(window).height()+"px":b+"px"):a(document).height()+"px"},width:function(){var b,c;return a.browser.msie?(b=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth),c=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth),b<c?a(window).width()+"px":b+"px"):a(document).width()+"px"},resize:function(){var b=a([]);a.each(a.ui.dialog.overlay.instances,function(){b=b.add(this)}),b.css({width:0,height:0}).css({width:a.ui.dialog.overlay.width(),height:a.ui.dialog.overlay.height()})}}),a.extend(a.ui.dialog.overlay.prototype,{destroy:function(){a.ui.dialog.overlay.destroy(this.$el)}})}(jQuery),function(a,b){a.ui=a.ui||{};var c=/left|center|right/,d=/top|center|bottom/,e="center",f={},g=a.fn.position,h=a.fn.offset;a.fn.position=function(b){if(!b||!b.of)return g.apply(this,arguments);b=a.extend({},b);var h=a(b.of),i=h[0],j=(b.collision||"flip").split(" "),k=b.offset?b.offset.split(" "):[0,0],l,m,n;return i.nodeType===9?(l=h.width(),m=h.height(),n={top:0,left:0}):i.setTimeout?(l=h.width(),m=h.height(),n={top:h.scrollTop(),left:h.scrollLeft()}):i.preventDefault?(b.at="left top",l=m=0,n={top:b.of.pageY,left:b.of.pageX}):(l=h.outerWidth(),m=h.outerHeight(),n=h.offset()),a.each(["my","at"],function(){var a=(b[this]||"").split(" ");a.length===1&&(a=c.test(a[0])?a.concat([e]):d.test(a[0])?[e].concat(a):[e,e]),a[0]=c.test(a[0])?a[0]:e,a[1]=d.test(a[1])?a[1]:e,b[this]=a}),j.length===1&&(j[1]=j[0]),k[0]=parseInt(k[0],10)||0,k.length===1&&(k[1]=k[0]),k[1]=parseInt(k[1],10)||0,b.at[0]==="right"?n.left+=l:b.at[0]===e&&(n.left+=l/2),b.at[1]==="bottom"?n.top+=m:b.at[1]===e&&(n.top+=m/2),n.left+=k[0],n.top+=k[1],this.each(function(){var c=a(this),d=c.outerWidth(),g=c.outerHeight(),h=parseInt(a.curCSS(this,"marginLeft",!0))||0,i=parseInt(a.curCSS(this,"marginTop",!0))||0,o=d+h+(parseInt(a.curCSS(this,"marginRight",!0))||0),p=g+i+(parseInt(a.curCSS(this,"marginBottom",!0))||0),q=a.extend({},n),r;b.my[0]==="right"?q.left-=d:b.my[0]===e&&(q.left-=d/2),b.my[1]==="bottom"?q.top-=g:b.my[1]===e&&(q.top-=g/2),f.fractions||(q.left=Math.round(q.left),q.top=Math.round(q.top)),r={left:q.left-h,top:q.top-i},a.each(["left","top"],function(c,e){a.ui.position[j[c]]&&a.ui.position[j[c]][e](q,{targetWidth:l,targetHeight:m,elemWidth:d,elemHeight:g,collisionPosition:r,collisionWidth:o,collisionHeight:p,offset:k,my:b.my,at:b.at})}),a.fn.bgiframe&&c.bgiframe(),c.offset(a.extend(q,{using:b.using}))})},a.ui.position={fit:{left:function(b,c){var d=a(window),e=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft();b.left=e>0?b.left-e:Math.max(b.left-c.collisionPosition.left,b.left)},top:function(b,c){var d=a(window),e=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop();b.top=e>0?b.top-e:Math.max(b.top-c.collisionPosition.top,b.top)}},flip:{left:function(b,c){if(c.at[0]===e)return;var d=a(window),f=c.collisionPosition.left+c.collisionWidth-d.width()-d.scrollLeft(),g=c.my[0]==="left"?-c.elemWidth:c.my[0]==="right"?c.elemWidth:0,h=c.at[0]==="left"?c.targetWidth:-c.targetWidth,i=-2*c.offset[0];b.left+=c.collisionPosition.left<0?g+h+i:f>0?g+h+i:0},top:function(b,c){if(c.at[1]===e)return;var d=a(window),f=c.collisionPosition.top+c.collisionHeight-d.height()-d.scrollTop(),g=c.my[1]==="top"?-c.elemHeight:c.my[1]==="bottom"?c.elemHeight:0,h=c.at[1]==="top"?c.targetHeight:-c.targetHeight,i=-2*c.offset[1];b.top+=c.collisionPosition.top<0?g+h+i:f>0?g+h+i:0}}},a.offset.setOffset||(a.offset.setOffset=function(b,c){/static/.test(a.curCSS(b,"position"))&&(b.style.position="relative");var d=a(b),e=d.offset(),f=parseInt(a.curCSS(b,"top",!0),10)||0,g=parseInt(a.curCSS(b,"left",!0),10)||0,h={top:c.top-e.top+f,left:c.left-e.left+g};"using"in c?c.using.call(b,h):d.css(h)},a.fn.offset=function(b){var c=this[0];return!c||!c.ownerDocument?null:b?this.each(function(){a.offset.setOffset(this,b)}):h.call(this)}),function(){var b=document.getElementsByTagName("body")[0],c=document.createElement("div"),d,e,g,h,i;d=document.createElement(b?"div":"body"),g={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},b&&a.extend(g,{position:"absolute",left:"-1000px",top:"-1000px"});for(var j in g)d.style[j]=g[j];d.appendChild(c),e=b||document.documentElement,e.insertBefore(d,e.firstChild),c.style.cssText="position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;",h=a(c).offset(function(a,b){return b}).offset(),d.innerHTML="",e.removeChild(d),i=h.top+h.left+(b?2e3:0),f.fractions=i>21&&i<22}()}(jQuery),function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove(),a.Widget.prototype.destroy.apply(this,arguments)},value:function(a){return a===b?this._value():(this._setOption("value",a),this)},_setOption:function(b,c){b==="value"&&(this.options.value=c,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;return typeof a!="number"&&(a=0),Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var a=this.value(),b=this._percentage();this.oldValue!==a&&(this.oldValue=a,this._trigger("change")),this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(b.toFixed(0)+"%"),this.element.attr("aria-valuenow",a)}}),a.extend(a.ui.progressbar,{version:"1.8.20"})}(jQuery),function(a,b){var c=5;a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:!1,distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null},_create:function(){var b=this,d=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f="<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",g=d.values&&d.values.length||1,h=[];this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget"+" ui-widget-content"+" ui-corner-all"+(d.disabled?" ui-slider-disabled ui-disabled":"")),this.range=a([]),d.range&&(d.range===!0&&(d.values||(d.values=[this._valueMin(),this._valueMin()]),d.values.length&&d.values.length!==2&&(d.values=[d.values[0],d.values[0]])),this.range=a("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(d.range==="min"||d.range==="max"?" ui-slider-range-"+d.range:"")));for(var i=e.length;i<g;i+=1)h.push(f);this.handles=e.add(a(h.join("")).appendTo(b.element)),this.handle=this.handles.eq(0),this.handles.add(this.range).filter("a").click(function(a){a.preventDefault()}).hover(function(){d.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){d.disabled?a(this).blur():(a(".ui-slider .ui-state-focus").removeClass("ui-state-focus"),a(this).addClass("ui-state-focus"))}).blur(function(){a(this).removeClass("ui-state-focus")}),this.handles.each(function(b){a(this).data("index.ui-slider-handle",b)}),this.handles.keydown(function(d){var e=a(this).data("index.ui-slider-handle"),f,g,h,i;if(b.options.disabled)return;switch(d.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:d.preventDefault();if(!b._keySliding){b._keySliding=!0,a(this).addClass("ui-state-active"),f=b._start(d,e);if(f===!1)return}}i=b.options.step,b.options.values&&b.options.values.length?g=h=b.values(e):g=h=b.value();switch(d.keyCode){case a.ui.keyCode.HOME:h=b._valueMin();break;case a.ui.keyCode.END:h=b._valueMax();break;case a.ui.keyCode.PAGE_UP:h=b._trimAlignValue(g+(b._valueMax()-b._valueMin())/c);break;case a.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(g-(b._valueMax()-b._valueMin())/c);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g===b._valueMax())return;h=b._trimAlignValue(g+i);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g===b._valueMin())return;h=b._trimAlignValue(g-i)}b._slide(d,e,h)}).keyup(function(c){var d=a(this).data("index.ui-slider-handle");b._keySliding&&(b._keySliding=!1,b._stop(c,d),b._change(c,d),a(this).removeClass("ui-state-active"))}),this._refreshValue(),this._animateOff=!1},destroy:function(){return this.handles.remove(),this.range.remove(),this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"),this._mouseDestroy(),this},_mouseCapture:function(b){var c=this.options,d,e,f,g,h,i,j,k,l;return c.disabled?!1:(this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()},this.elementOffset=this.element.offset(),d={x:b.pageX,y:b.pageY},e=this._normValueFromMouse(d),f=this._valueMax()-this._valueMin()+1,h=this,this.handles.each(function(b){var c=Math.abs(e-h.values(b));f>c&&(f=c,g=a(this),i=b)}),c.range===!0&&this.values(1)===c.min&&(i+=1,g=a(this.handles[i])),j=this._start(b,i),j===!1?!1:(this._mouseSliding=!0,h._handleIndex=i,g.addClass("ui-state-active").focus(),k=g.offset(),l=!a(b.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:b.pageX-k.left-g.width()/2,top:b.pageY-k.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(b,i,e),this._animateOff=!0,!0))},_mouseStart:function(a){return!0},_mouseDrag:function(a){var b={x:a.pageX,y:a.pageY},c=this._normValueFromMouse(b);return this._slide(a,this._handleIndex,c),!1},_mouseStop:function(a){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(a,this._handleIndex),this._change(a,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b,c,d,e,f;return this.orientation==="horizontal"?(b=this.elementSize.width,c=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(b=this.elementSize.height,c=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),d=c/b,d>1&&(d=1),d<0&&(d=0),this.orientation==="vertical"&&(d=1-d),e=this._valueMax()-this._valueMin(),f=this._valueMin()+d*e,this._trimAlignValue(f)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};return this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("start",a,c)},_slide:function(a,b,c){var d,e,f;this.options.values&&this.options.values.length?(d=this.values(b?0:1),this.options.values.length===2&&this.options.range===!0&&(b===0&&c>d||b===1&&c<d)&&(c=d),c!==this.values(b)&&(e=this.values(),e[b]=c,f=this._trigger("slide",a,{handle:this.handles[b],value:c,values:e}),d=this.values(b?0:1),f!==!1&&this.values(b,c,!0))):c!==this.value()&&(f=this._trigger("slide",a,{handle:this.handles[b],value:c}),f!==!1&&this.value(c))},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};this.options.values&&this.options.values.length&&(c.value=this.values(b),c.values=this.values()),this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=this._trimAlignValue(a),this._refreshValue(),this._change(null,0);return}return this._value()},values:function(b,c){var d,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(c),this._refreshValue(),this._change(null,b);return}if(!arguments.length)return this._values();if(!a.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(b):this.value();d=this.options.values,e=arguments[0];for(f=0;f<d.length;f+=1)d[f]=this._trimAlignValue(e[f]),this._change(null,f);this._refreshValue()},_setOption:function(b,c){var d,e=0;a.isArray(this.options.values)&&(e=this.options.values.length),a.Widget.prototype._setOption.apply(this,arguments);switch(b){case"disabled":c?(this.handles.filter(".ui-state-focus").blur(),this.handles.removeClass("ui-state-hover"),this.handles.propAttr("disabled",!0),this.element.addClass("ui-disabled")):(this.handles.propAttr("disabled",!1),this.element.removeClass("ui-disabled"));break;case"orientation":this._detectOrientation(),this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation),this._refreshValue();break;case"value":this._animateOff=!0,this._refreshValue(),this._change(null,0),this._animateOff=!1;break;case"values":this._animateOff=!0,this._refreshValue();for(d=0;d<e;d+=1)this._change(null,d);this._animateOff=!1}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a),a},_values:function(a){var b,c,d;if(arguments.length)return b=this.options.values[a],b=this._trimAlignValue(b),b;c=this.options.values.slice();for(d=0;d<c.length;d+=1)c[d]=this._trimAlignValue(c[d]);return c},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b,d=a-c;return Math.abs(c)*2>=b&&(d+=c>0?b:-b),parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,c=this.options,d=this,e=this._animateOff?!1:c.animate,f,g={},h,i,j,k;this.options.values&&this.options.values.length?this.handles.each(function(b,i){f=(d.values(b)-d._valueMin())/(d._valueMax()-d._valueMin())*100,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",a(this).stop(1,1)[e?"animate":"css"](g,c.animate),d.options.range===!0&&(d.orientation==="horizontal"?(b===0&&d.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({width:f-h+"%"},{queue:!1,duration:c.animate})):(b===0&&d.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},c.animate),b===1&&d.range[e?"animate":"css"]({height:f-h+"%"},{queue:!1,duration:c.animate}))),h=f}):(i=this.value(),j=this._valueMin(),k=this._valueMax(),f=k!==j?(i-j)/(k-j)*100:0,g[d.orientation==="horizontal"?"left":"bottom"]=f+"%",this.handle.stop(1,1)[e?"animate":"css"](g,c.animate),b==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},c.animate),b==="max"&&this.orientation==="horizontal"&&this.range[e?"animate":"css"]({width:100-f+"%"},{queue:!1,duration:c.animate}),b==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},c.animate),b==="max"&&this.orientation==="vertical"&&this.range[e?"animate":"css"]({height:100-f+"%"},{queue:!1,duration:c.animate}))}}),a.extend(a.ui.slider,{version:"1.8.20"})}(jQuery),function(a,b){function e(){return++c}function f(){return++d}var c=0,d=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:!1,cookie:null,collapsible:!1,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(!0)},_setOption:function(a,b){if(a=="selected"){if(this.options.collapsible&&b==this.options.selected)return;this.select(b)}else this.options[a]=b,this._tabify()},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(a,b){return{tab:a,panel:b,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function m(b,c){b.css("display",""),!a.support.opacity&&c.opacity&&b[0].style.removeAttribute("filter")}var d=this,e=this.options,f=/^#.+/;this.list=this.element.find("ol,ul").eq(0),this.lis=a(" > li:has(a[href])",this.list),this.anchors=this.lis.map(function(){return a("a",this)[0]}),this.panels=a([]),this.anchors.each(function(b,c){var g=a(c).attr("href"),h=g.split("#")[0],i;h&&(h===location.toString().split("#")[0]||(i=a("base")[0])&&h===i.href)&&(g=c.hash,c.href=g);if(f.test(g))d.panels=d.panels.add(d.element.find(d._sanitizeSelector(g)));else if(g&&g!=="#"){a.data(c,"href.tabs",g),a.data(c,"load.tabs",g.replace(/#.*$/,""));var j=d._tabId(c);c.href="#"+j;var k=d.element.find("#"+j);k.length||(k=a(e.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(d.panels[b-1]||d.list),k.data("destroy.tabs",!0)),d.panels=d.panels.add(k)}else e.disabled.push(b)}),c?(this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"),this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.lis.addClass("ui-state-default ui-corner-top"),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom"),e.selected===b?(location.hash&&this.anchors.each(function(a,b){if(b.hash==location.hash)return e.selected=a,!1}),typeof e.selected!="number"&&e.cookie&&(e.selected=parseInt(d._cookie(),10)),typeof e.selected!="number"&&this.lis.filter(".ui-tabs-selected").length&&(e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))),e.selected=e.selected||(this.lis.length?0:-1)):e.selected===null&&(e.selected=-1),e.selected=e.selected>=0&&this.anchors[e.selected]||e.selected<0?e.selected:0,e.disabled=a.unique(e.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(a,b){return d.lis.index(a)}))).sort(),a.inArray(e.selected,e.disabled)!=-1&&e.disabled.splice(a.inArray(e.selected,e.disabled),1),this.panels.addClass("ui-tabs-hide"),this.lis.removeClass("ui-tabs-selected ui-state-active"),e.selected>=0&&this.anchors.length&&(d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash)).removeClass("ui-tabs-hide"),this.lis.eq(e.selected).addClass("ui-tabs-selected ui-state-active"),d.element.queue("tabs",function(){d._trigger("show",null,d._ui(d.anchors[e.selected],d.element.find(d._sanitizeSelector(d.anchors[e.selected].hash))[0]))}),this.load(e.selected)),a(window).bind("unload",function(){d.lis.add(d.anchors).unbind(".tabs"),d.lis=d.anchors=d.panels=null})):e.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")),this.element[e.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible"),e.cookie&&this._cookie(e.selected,e.cookie);for(var g=0,h;h=this.lis[g];g++)a(h)[a.inArray(g,e.disabled)!=-1&&!a(h).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");e.cache===!1&&this.anchors.removeData("cache.tabs"),this.lis.add(this.anchors).unbind(".tabs");if(e.event!=="mouseover"){var i=function(a,b){b.is(":not(.ui-state-disabled)")&&b.addClass("ui-state-"+a)},j=function(a,b){b.removeClass("ui-state-"+a)};this.lis.bind("mouseover.tabs",function(){i("hover",a(this))}),this.lis.bind("mouseout.tabs",function(){j("hover",a(this))}),this.anchors.bind("focus.tabs",function(){i("focus",a(this).closest("li"))}),this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var k,l;e.fx&&(a.isArray(e.fx)?(k=e.fx[0],l=e.fx[1]):k=l=e.fx);var n=l?function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.hide().removeClass("ui-tabs-hide").animate(l,l.duration||"normal",function(){m(c,l),d._trigger("show",null,d._ui(b,c[0]))})}:function(b,c){a(b).closest("li").addClass("ui-tabs-selected ui-state-active"),c.removeClass("ui-tabs-hide"),d._trigger("show",null,d._ui(b,c[0]))},o=k?function(a,b){b.animate(k,k.duration||"normal",function(){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),m(b,k),d.element.dequeue("tabs")})}:function(a,b,c){d.lis.removeClass("ui-tabs-selected ui-state-active"),b.addClass("ui-tabs-hide"),d.element.dequeue("tabs")};this.anchors.bind(e.event+".tabs",function(){var b=this,c=a(b).closest("li"),f=d.panels.filter(":not(.ui-tabs-hide)"),g=d.element.find(d._sanitizeSelector(b.hash));if(c.hasClass("ui-tabs-selected")&&!e.collapsible||c.hasClass("ui-state-disabled")||c.hasClass("ui-state-processing")||d.panels.filter(":animated").length||d._trigger("select",null,d._ui(this,g[0]))===!1)return this.blur(),!1;e.selected=d.anchors.index(this),d.abort();if(e.collapsible){if(c.hasClass("ui-tabs-selected"))return e.selected=-1,e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){o(b,f)}).dequeue("tabs"),this.blur(),!1;if(!f.length)return e.cookie&&d._cookie(e.selected,e.cookie),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this)),this.blur(),!1}e.cookie&&d._cookie(e.selected,e.cookie);if(g.length)f.length&&d.element.queue("tabs",function(){o(b,f)}),d.element.queue("tabs",function(){n(b,g)}),d.load(d.anchors.index(this));else throw"jQuery UI Tabs: Mismatching fragment identifier.";a.browser.msie&&this.blur()}),this.anchors.bind("click.tabs",function(){return!1})},_getIndex:function(a){return typeof a=="string"&&(a=this.anchors.index(this.anchors.filter("[href$='"+a+"']"))),a},destroy:function(){var b=this.options;return this.abort(),this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs"),this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all"),this.anchors.each(function(){var b=a.data(this,"href.tabs");b&&(this.href=b);var c=a(this).unbind(".tabs");a.each(["href","load","cache"],function(a,b){c.removeData(b+".tabs")})}),this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}),b.cookie&&this._cookie(null,b.cookie),this},add:function(c,d,e){e===b&&(e=this.anchors.length);var f=this,g=this.options,h=a(g.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,d)),i=c.indexOf("#")?this._tabId(a("a",h)[0]):c.replace("#","");h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",!0);var j=f.element.find("#"+i);return j.length||(j=a(g.panelTemplate).attr("id",i).data("destroy.tabs",!0)),j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide"),e>=this.lis.length?(h.appendTo(this.list),j.appendTo(this.list[0].parentNode)):(h.insertBefore(this.lis[e]),j.insertBefore(this.panels[e])),g.disabled=a.map(g.disabled,function(a,b){return a>=e?++a:a}),this._tabify(),this.anchors.length==1&&(g.selected=0,h.addClass("ui-tabs-selected ui-state-active"),j.removeClass("ui-tabs-hide"),this.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[0],f.panels[0]))}),this.load(0)),this._trigger("add",null,this._ui(this.anchors[e],this.panels[e])),this},remove:function(b){b=this._getIndex(b);var c=this.options,d=this.lis.eq(b).remove(),e=this.panels.eq(b).remove();return d.hasClass("ui-tabs-selected")&&this.anchors.length>1&&this.select(b+(b+1<this.anchors.length?1:-1)),c.disabled=a.map(a.grep(c.disabled,function(a,c){return a!=b}),function(a,c){return a>=b?--a:a}),this._tabify(),this._trigger("remove",null,this._ui(d.find("a")[0],e[0])),this},enable:function(b){b=this._getIndex(b);var c=this.options;if(a.inArray(b,c.disabled)==-1)return;return this.lis.eq(b).removeClass("ui-state-disabled"),c.disabled=a.grep(c.disabled,function(a,c){return a!=b}),this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b])),this},disable:function(a){a=this._getIndex(a);var b=this,c=this.options;return a!=c.selected&&(this.lis.eq(a).addClass("ui-state-disabled"),c.disabled.push(a),c.disabled.sort(),this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))),this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;return this.anchors.eq(a).trigger(this.options.event+".tabs"),this},load:function(b){b=this._getIndex(b);var c=this,d=this.options,e=this.anchors.eq(b)[0],f=a.data(e,"load.tabs");this.abort();if(!f||this.element.queue("tabs").length!==0&&a.data(e,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(b).addClass("ui-state-processing");if(d.spinner){var g=a("span",e);g.data("label.tabs",g.html()).html(d.spinner)}return this.xhr=a.ajax(a.extend({},d.ajaxOptions,{url:f,success:function(f,g){c.element.find(c._sanitizeSelector(e.hash)).html(f),c._cleanup(),d.cache&&a.data(e,"cache.tabs",!0),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.success(f,g)}catch(h){}},error:function(a,f,g){c._cleanup(),c._trigger("load",null,c._ui(c.anchors[b],c.panels[b]));try{d.ajaxOptions.error(a,f,b,e)}catch(g){}}})),c.element.dequeue("tabs"),this},abort:function(){return this.element.queue([]),this.panels.stop(!1,!0),this.element.queue("tabs",this.element.queue("tabs").splice(-2,2)),this.xhr&&(this.xhr.abort(),delete this.xhr),this._cleanup(),this},url:function(a,b){return this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",b),this},length:function(){return this.anchors.length}}),a.extend(a.ui.tabs,{version:"1.8.20"}),a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(a,b){var c=this,d=this.options,e=c._rotate||(c._rotate=function(b){clearTimeout(c.rotation),c.rotation=setTimeout(function(){var a=d.selected;c.select(++a<c.anchors.length?a:0)},a),b&&b.stopPropagation()}),f=c._unrotate||(c._unrotate=b?function(a){e()}:function(a){a.clientX&&c.rotate(null)});return a?(this.element.bind("tabsshow",e),this.anchors.bind(d.event+".tabs",f),e()):(clearTimeout(c.rotation),this.element.unbind("tabsshow",e),this.anchors.unbind(d.event+".tabs",f),delete this._rotate,delete this._unrotate),this}})}(jQuery);
\ No newline at end of file diff --git a/samples/TestAzureAD/Scripts/modernizr-2.5.3.js b/samples/TestAzureAD/Scripts/modernizr-2.5.3.js new file mode 100644 index 0000000..c1a6a9a --- /dev/null +++ b/samples/TestAzureAD/Scripts/modernizr-2.5.3.js @@ -0,0 +1,1265 @@ +/*! + * Modernizr v2.5.3 + * www.modernizr.com + * + * Copyright (c) Faruk Ates, Paul Irish, Alex Sexton + * Available under the BSD and MIT licenses: www.modernizr.com/license/ + */ + +/* + * Modernizr tests which native CSS3 and HTML5 features are available in + * the current UA and makes the results available to you in two ways: + * as properties on a global Modernizr object, and as classes on the + * <html> element. This information allows you to progressively enhance + * your pages with a granular level of control over the experience. + * + * Modernizr has an optional (not included) conditional resource loader + * called Modernizr.load(), based on Yepnope.js (yepnopejs.com). + * To get a build that includes Modernizr.load(), as well as choosing + * which tests to include, go to www.modernizr.com/download/ + * + * Authors Faruk Ates, Paul Irish, Alex Sexton + * Contributors Ryan Seddon, Ben Alman + */ + +window.Modernizr = (function( window, document, undefined ) { + + var version = '2.5.3', + + Modernizr = {}, + + // option for enabling the HTML classes to be added + enableClasses = true, + + docElement = document.documentElement, + + /** + * Create our "modernizr" element that we do most feature tests on. + */ + mod = 'modernizr', + modElem = document.createElement(mod), + mStyle = modElem.style, + + /** + * Create the input element for various Web Forms feature tests. + */ + inputElem = document.createElement('input'), + + smile = ':)', + + toString = {}.toString, + + // List of property values to set for css tests. See ticket #21 + prefixes = ' -webkit- -moz- -o- -ms- '.split(' '), + + // Following spec is to expose vendor-specific style properties as: + // elem.style.WebkitBorderRadius + // and the following would be incorrect: + // elem.style.webkitBorderRadius + + // Webkit ghosts their properties in lowercase but Opera & Moz do not. + // Microsoft uses a lowercase `ms` instead of the correct `Ms` in IE8+ + // erik.eae.net/archives/2008/03/10/21.48.10/ + + // More here: github.com/Modernizr/Modernizr/issues/issue/21 + omPrefixes = 'Webkit Moz O ms', + + cssomPrefixes = omPrefixes.split(' '), + + domPrefixes = omPrefixes.toLowerCase().split(' '), + + ns = {'svg': 'http://www.w3.org/2000/svg'}, + + tests = {}, + inputs = {}, + attrs = {}, + + classes = [], + + slice = classes.slice, + + featureName, // used in testing loop + + + // Inject element with style element and some CSS rules + injectElementWithStyles = function( rule, callback, nodes, testnames ) { + + var style, ret, node, + div = document.createElement('div'), + // After page load injecting a fake body doesn't work so check if body exists + body = document.body, + // IE6 and 7 won't return offsetWidth or offsetHeight unless it's in the body element, so we fake it. + fakeBody = body ? body : document.createElement('body'); + + if ( parseInt(nodes, 10) ) { + // In order not to give false positives we create a node for each test + // This also allows the method to scale for unspecified uses + while ( nodes-- ) { + node = document.createElement('div'); + node.id = testnames ? testnames[nodes] : mod + (nodes + 1); + div.appendChild(node); + } + } + + // <style> elements in IE6-9 are considered 'NoScope' elements and therefore will be removed + // when injected with innerHTML. To get around this you need to prepend the 'NoScope' element + // with a 'scoped' element, in our case the soft-hyphen entity as it won't mess with our measurements. + // msdn.microsoft.com/en-us/library/ms533897%28VS.85%29.aspx + // Documents served as xml will throw if using ­ so use xml friendly encoded version. See issue #277 + style = ['­','<style>', rule, '</style>'].join(''); + div.id = mod; + // IE6 will false positive on some tests due to the style element inside the test div somehow interfering offsetHeight, so insert it into body or fakebody. + // Opera will act all quirky when injecting elements in documentElement when page is served as xml, needs fakebody too. #270 + fakeBody.innerHTML += style; + fakeBody.appendChild(div); + if(!body){ + //avoid crashing IE8, if background image is used + fakeBody.style.background = ""; + docElement.appendChild(fakeBody); + } + + ret = callback(div, rule); + // If this is done after page load we don't want to remove the body so check if body exists + !body ? fakeBody.parentNode.removeChild(fakeBody) : div.parentNode.removeChild(div); + + return !!ret; + + }, + + + // adapted from matchMedia polyfill + // by Scott Jehl and Paul Irish + // gist.github.com/786768 + testMediaQuery = function( mq ) { + + var matchMedia = window.matchMedia || window.msMatchMedia; + if ( matchMedia ) { + return matchMedia(mq).matches; + } + + var bool; + + injectElementWithStyles('@media ' + mq + ' { #' + mod + ' { position: absolute; } }', function( node ) { + bool = (window.getComputedStyle ? + getComputedStyle(node, null) : + node.currentStyle)['position'] == 'absolute'; + }); + + return bool; + + }, + + + /** + * isEventSupported determines if a given element supports the given event + * function from yura.thinkweb2.com/isEventSupported/ + */ + isEventSupported = (function() { + + var TAGNAMES = { + 'select': 'input', 'change': 'input', + 'submit': 'form', 'reset': 'form', + 'error': 'img', 'load': 'img', 'abort': 'img' + }; + + function isEventSupported( eventName, element ) { + + element = element || document.createElement(TAGNAMES[eventName] || 'div'); + eventName = 'on' + eventName; + + // When using `setAttribute`, IE skips "unload", WebKit skips "unload" and "resize", whereas `in` "catches" those + var isSupported = eventName in element; + + if ( !isSupported ) { + // If it has no `setAttribute` (i.e. doesn't implement Node interface), try generic element + if ( !element.setAttribute ) { + element = document.createElement('div'); + } + if ( element.setAttribute && element.removeAttribute ) { + element.setAttribute(eventName, ''); + isSupported = is(element[eventName], 'function'); + + // If property was created, "remove it" (by setting value to `undefined`) + if ( !is(element[eventName], 'undefined') ) { + element[eventName] = undefined; + } + element.removeAttribute(eventName); + } + } + + element = null; + return isSupported; + } + return isEventSupported; + })(); + + // hasOwnProperty shim by kangax needed for Safari 2.0 support + var _hasOwnProperty = ({}).hasOwnProperty, hasOwnProperty; + if ( !is(_hasOwnProperty, 'undefined') && !is(_hasOwnProperty.call, 'undefined') ) { + hasOwnProperty = function (object, property) { + return _hasOwnProperty.call(object, property); + }; + } + else { + hasOwnProperty = function (object, property) { /* yes, this can give false positives/negatives, but most of the time we don't care about those */ + return ((property in object) && is(object.constructor.prototype[property], 'undefined')); + }; + } + + // Taken from ES5-shim https://github.com/kriskowal/es5-shim/blob/master/es5-shim.js + // ES-5 15.3.4.5 + // http://es5.github.com/#x15.3.4.5 + + if (!Function.prototype.bind) { + + Function.prototype.bind = function bind(that) { + + var target = this; + + if (typeof target != "function") { + throw new TypeError(); + } + + var args = slice.call(arguments, 1), + bound = function () { + + if (this instanceof bound) { + + var F = function(){}; + F.prototype = target.prototype; + var self = new F; + + var result = target.apply( + self, + args.concat(slice.call(arguments)) + ); + if (Object(result) === result) { + return result; + } + return self; + + } else { + + return target.apply( + that, + args.concat(slice.call(arguments)) + ); + + } + + }; + + return bound; + }; + } + + /** + * setCss applies given styles to the Modernizr DOM node. + */ + function setCss( str ) { + mStyle.cssText = str; + } + + /** + * setCssAll extrapolates all vendor-specific css strings. + */ + function setCssAll( str1, str2 ) { + return setCss(prefixes.join(str1 + ';') + ( str2 || '' )); + } + + /** + * is returns a boolean for if typeof obj is exactly type. + */ + function is( obj, type ) { + return typeof obj === type; + } + + /** + * contains returns a boolean for if substr is found within str. + */ + function contains( str, substr ) { + return !!~('' + str).indexOf(substr); + } + + /** + * testProps is a generic CSS / DOM property test; if a browser supports + * a certain property, it won't return undefined for it. + * A supported CSS property returns empty string when its not yet set. + */ + function testProps( props, prefixed ) { + for ( var i in props ) { + if ( mStyle[ props[i] ] !== undefined ) { + return prefixed == 'pfx' ? props[i] : true; + } + } + return false; + } + + /** + * testDOMProps is a generic DOM property test; if a browser supports + * a certain property, it won't return undefined for it. + */ + function testDOMProps( props, obj, elem ) { + for ( var i in props ) { + var item = obj[props[i]]; + if ( item !== undefined) { + + // return the property name as a string + if (elem === false) return props[i]; + + // let's bind a function + if (is(item, 'function')){ + // default to autobind unless override + return item.bind(elem || obj); + } + + // return the unbound function or obj or value + return item; + } + } + return false; + } + + /** + * testPropsAll tests a list of DOM properties we want to check against. + * We specify literally ALL possible (known and/or likely) properties on + * the element including the non-vendor prefixed one, for forward- + * compatibility. + */ + function testPropsAll( prop, prefixed, elem ) { + + var ucProp = prop.charAt(0).toUpperCase() + prop.substr(1), + props = (prop + ' ' + cssomPrefixes.join(ucProp + ' ') + ucProp).split(' '); + + // did they call .prefixed('boxSizing') or are we just testing a prop? + if(is(prefixed, "string") || is(prefixed, "undefined")) { + return testProps(props, prefixed); + + // otherwise, they called .prefixed('requestAnimationFrame', window[, elem]) + } else { + props = (prop + ' ' + (domPrefixes).join(ucProp + ' ') + ucProp).split(' '); + return testDOMProps(props, prefixed, elem); + } + } + + /** + * testBundle tests a list of CSS features that require element and style injection. + * By bundling them together we can reduce the need to touch the DOM multiple times. + */ + /*>>testBundle*/ + var testBundle = (function( styles, tests ) { + var style = styles.join(''), + len = tests.length; + + injectElementWithStyles(style, function( node, rule ) { + var style = document.styleSheets[document.styleSheets.length - 1], + // IE8 will bork if you create a custom build that excludes both fontface and generatedcontent tests. + // So we check for cssRules and that there is a rule available + // More here: github.com/Modernizr/Modernizr/issues/288 & github.com/Modernizr/Modernizr/issues/293 + cssText = style ? (style.cssRules && style.cssRules[0] ? style.cssRules[0].cssText : style.cssText || '') : '', + children = node.childNodes, hash = {}; + + while ( len-- ) { + hash[children[len].id] = children[len]; + } + + /*>>touch*/ Modernizr['touch'] = ('ontouchstart' in window) || window.DocumentTouch && document instanceof DocumentTouch || (hash['touch'] && hash['touch'].offsetTop) === 9; /*>>touch*/ + /*>>csstransforms3d*/ Modernizr['csstransforms3d'] = (hash['csstransforms3d'] && hash['csstransforms3d'].offsetLeft) === 9 && hash['csstransforms3d'].offsetHeight === 3; /*>>csstransforms3d*/ + /*>>generatedcontent*/Modernizr['generatedcontent'] = (hash['generatedcontent'] && hash['generatedcontent'].offsetHeight) >= 1; /*>>generatedcontent*/ + /*>>fontface*/ Modernizr['fontface'] = /src/i.test(cssText) && + cssText.indexOf(rule.split(' ')[0]) === 0; /*>>fontface*/ + }, len, tests); + + })([ + // Pass in styles to be injected into document + /*>>fontface*/ '@font-face {font-family:"font";src:url("https://")}' /*>>fontface*/ + + /*>>touch*/ ,['@media (',prefixes.join('touch-enabled),('),mod,')', + '{#touch{top:9px;position:absolute}}'].join('') /*>>touch*/ + + /*>>csstransforms3d*/ ,['@media (',prefixes.join('transform-3d),('),mod,')', + '{#csstransforms3d{left:9px;position:absolute;height:3px;}}'].join('')/*>>csstransforms3d*/ + + /*>>generatedcontent*/,['#generatedcontent:after{content:"',smile,'";visibility:hidden}'].join('') /*>>generatedcontent*/ + ], + [ + /*>>fontface*/ 'fontface' /*>>fontface*/ + /*>>touch*/ ,'touch' /*>>touch*/ + /*>>csstransforms3d*/ ,'csstransforms3d' /*>>csstransforms3d*/ + /*>>generatedcontent*/,'generatedcontent' /*>>generatedcontent*/ + + ]);/*>>testBundle*/ + + + /** + * Tests + * ----- + */ + + // The *new* flexbox + // dev.w3.org/csswg/css3-flexbox + + tests['flexbox'] = function() { + return testPropsAll('flexOrder'); + }; + + // The *old* flexbox + // www.w3.org/TR/2009/WD-css3-flexbox-20090723/ + + tests['flexbox-legacy'] = function() { + return testPropsAll('boxDirection'); + }; + + // On the S60 and BB Storm, getContext exists, but always returns undefined + // so we actually have to call getContext() to verify + // github.com/Modernizr/Modernizr/issues/issue/97/ + + tests['canvas'] = function() { + var elem = document.createElement('canvas'); + return !!(elem.getContext && elem.getContext('2d')); + }; + + tests['canvastext'] = function() { + return !!(Modernizr['canvas'] && is(document.createElement('canvas').getContext('2d').fillText, 'function')); + }; + + // this test initiates a new webgl context. + // webk.it/70117 is tracking a legit feature detect proposal + + tests['webgl'] = function() { + try { + var canvas = document.createElement('canvas'), + ret; + ret = !!(window.WebGLRenderingContext && (canvas.getContext('experimental-webgl') || canvas.getContext('webgl'))); + canvas = undefined; + } catch (e){ + ret = false; + } + return ret; + }; + + /* + * The Modernizr.touch test only indicates if the browser supports + * touch events, which does not necessarily reflect a touchscreen + * device, as evidenced by tablets running Windows 7 or, alas, + * the Palm Pre / WebOS (touch) phones. + * + * Additionally, Chrome (desktop) used to lie about its support on this, + * but that has since been rectified: crbug.com/36415 + * + * We also test for Firefox 4 Multitouch Support. + * + * For more info, see: modernizr.github.com/Modernizr/touch.html + */ + + tests['touch'] = function() { + return Modernizr['touch']; + }; + + /** + * geolocation tests for the new Geolocation API specification. + * This test is a standards compliant-only test; for more complete + * testing, including a Google Gears fallback, please see: + * code.google.com/p/geo-location-javascript/ + * or view a fallback solution using google's geo API: + * gist.github.com/366184 + */ + tests['geolocation'] = function() { + return !!navigator.geolocation; + }; + + // Per 1.6: + // This used to be Modernizr.crosswindowmessaging but the longer + // name has been deprecated in favor of a shorter and property-matching one. + // The old API is still available in 1.6, but as of 2.0 will throw a warning, + // and in the first release thereafter disappear entirely. + tests['postmessage'] = function() { + return !!window.postMessage; + }; + + + // Chrome incognito mode used to throw an exception when using openDatabase + // It doesn't anymore. + tests['websqldatabase'] = function() { + return !!window.openDatabase; + }; + + // Vendors had inconsistent prefixing with the experimental Indexed DB: + // - Webkit's implementation is accessible through webkitIndexedDB + // - Firefox shipped moz_indexedDB before FF4b9, but since then has been mozIndexedDB + // For speed, we don't test the legacy (and beta-only) indexedDB + tests['indexedDB'] = function() { + return !!testPropsAll("indexedDB",window); + }; + + // documentMode logic from YUI to filter out IE8 Compat Mode + // which false positives. + tests['hashchange'] = function() { + return isEventSupported('hashchange', window) && (document.documentMode === undefined || document.documentMode > 7); + }; + + // Per 1.6: + // This used to be Modernizr.historymanagement but the longer + // name has been deprecated in favor of a shorter and property-matching one. + // The old API is still available in 1.6, but as of 2.0 will throw a warning, + // and in the first release thereafter disappear entirely. + tests['history'] = function() { + return !!(window.history && history.pushState); + }; + + tests['draganddrop'] = function() { + var div = document.createElement('div'); + return ('draggable' in div) || ('ondragstart' in div && 'ondrop' in div); + }; + + // FIXME: Once FF10 is sunsetted, we can drop prefixed MozWebSocket + // bugzil.la/695635 + tests['websockets'] = function() { + for ( var i = -1, len = cssomPrefixes.length; ++i < len; ){ + if ( window[cssomPrefixes[i] + 'WebSocket'] ){ + return true; + } + } + return 'WebSocket' in window; + }; + + + // css-tricks.com/rgba-browser-support/ + tests['rgba'] = function() { + // Set an rgba() color and check the returned value + + setCss('background-color:rgba(150,255,150,.5)'); + + return contains(mStyle.backgroundColor, 'rgba'); + }; + + tests['hsla'] = function() { + // Same as rgba(), in fact, browsers re-map hsla() to rgba() internally, + // except IE9 who retains it as hsla + + setCss('background-color:hsla(120,40%,100%,.5)'); + + return contains(mStyle.backgroundColor, 'rgba') || contains(mStyle.backgroundColor, 'hsla'); + }; + + tests['multiplebgs'] = function() { + // Setting multiple images AND a color on the background shorthand property + // and then querying the style.background property value for the number of + // occurrences of "url(" is a reliable method for detecting ACTUAL support for this! + + setCss('background:url(https://),url(https://),red url(https://)'); + + // If the UA supports multiple backgrounds, there should be three occurrences + // of the string "url(" in the return value for elemStyle.background + + return /(url\s*\(.*?){3}/.test(mStyle.background); + }; + + + // In testing support for a given CSS property, it's legit to test: + // `elem.style[styleName] !== undefined` + // If the property is supported it will return an empty string, + // if unsupported it will return undefined. + + // We'll take advantage of this quick test and skip setting a style + // on our modernizr element, but instead just testing undefined vs + // empty string. + + + tests['backgroundsize'] = function() { + return testPropsAll('backgroundSize'); + }; + + tests['borderimage'] = function() { + return testPropsAll('borderImage'); + }; + + + // Super comprehensive table about all the unique implementations of + // border-radius: muddledramblings.com/table-of-css3-border-radius-compliance + + tests['borderradius'] = function() { + return testPropsAll('borderRadius'); + }; + + // WebOS unfortunately false positives on this test. + tests['boxshadow'] = function() { + return testPropsAll('boxShadow'); + }; + + // FF3.0 will false positive on this test + tests['textshadow'] = function() { + return document.createElement('div').style.textShadow === ''; + }; + + + tests['opacity'] = function() { + // Browsers that actually have CSS Opacity implemented have done so + // according to spec, which means their return values are within the + // range of [0.0,1.0] - including the leading zero. + + setCssAll('opacity:.55'); + + // The non-literal . in this regex is intentional: + // German Chrome returns this value as 0,55 + // github.com/Modernizr/Modernizr/issues/#issue/59/comment/516632 + return /^0.55$/.test(mStyle.opacity); + }; + + + // Note, Android < 4 will pass this test, but can only animate + // a single property at a time + // daneden.me/2011/12/putting-up-with-androids-bullshit/ + tests['cssanimations'] = function() { + return testPropsAll('animationName'); + }; + + + tests['csscolumns'] = function() { + return testPropsAll('columnCount'); + }; + + + tests['cssgradients'] = function() { + /** + * For CSS Gradients syntax, please see: + * webkit.org/blog/175/introducing-css-gradients/ + * developer.mozilla.org/en/CSS/-moz-linear-gradient + * developer.mozilla.org/en/CSS/-moz-radial-gradient + * dev.w3.org/csswg/css3-images/#gradients- + */ + + var str1 = 'background-image:', + str2 = 'gradient(linear,left top,right bottom,from(#9f9),to(white));', + str3 = 'linear-gradient(left top,#9f9, white);'; + + setCss( + // legacy webkit syntax (FIXME: remove when syntax not in use anymore) + (str1 + '-webkit- '.split(' ').join(str2 + str1) + // standard syntax // trailing 'background-image:' + + prefixes.join(str3 + str1)).slice(0, -str1.length) + ); + + return contains(mStyle.backgroundImage, 'gradient'); + }; + + + tests['cssreflections'] = function() { + return testPropsAll('boxReflect'); + }; + + + tests['csstransforms'] = function() { + return !!testPropsAll('transform'); + }; + + + tests['csstransforms3d'] = function() { + + var ret = !!testPropsAll('perspective'); + + // Webkit's 3D transforms are passed off to the browser's own graphics renderer. + // It works fine in Safari on Leopard and Snow Leopard, but not in Chrome in + // some conditions. As a result, Webkit typically recognizes the syntax but + // will sometimes throw a false positive, thus we must do a more thorough check: + if ( ret && 'webkitPerspective' in docElement.style ) { + + // Webkit allows this media query to succeed only if the feature is enabled. + // `@media (transform-3d),(-o-transform-3d),(-moz-transform-3d),(-ms-transform-3d),(-webkit-transform-3d),(modernizr){ ... }` + ret = Modernizr['csstransforms3d']; + } + return ret; + }; + + + tests['csstransitions'] = function() { + return testPropsAll('transition'); + }; + + + /*>>fontface*/ + // @font-face detection routine by Diego Perini + // javascript.nwbox.com/CSSSupport/ + + // false positives in WebOS: github.com/Modernizr/Modernizr/issues/342 + tests['fontface'] = function() { + return Modernizr['fontface']; + }; + /*>>fontface*/ + + // CSS generated content detection + tests['generatedcontent'] = function() { + return Modernizr['generatedcontent']; + }; + + + + // These tests evaluate support of the video/audio elements, as well as + // testing what types of content they support. + // + // We're using the Boolean constructor here, so that we can extend the value + // e.g. Modernizr.video // true + // Modernizr.video.ogg // 'probably' + // + // Codec values from : github.com/NielsLeenheer/html5test/blob/9106a8/index.html#L845 + // thx to NielsLeenheer and zcorpan + + // Note: in some older browsers, "no" was a return value instead of empty string. + // It was live in FF3.5.0 and 3.5.1, but fixed in 3.5.2 + // It was also live in Safari 4.0.0 - 4.0.4, but fixed in 4.0.5 + + tests['video'] = function() { + var elem = document.createElement('video'), + bool = false; + + // IE9 Running on Windows Server SKU can cause an exception to be thrown, bug #224 + try { + if ( bool = !!elem.canPlayType ) { + bool = new Boolean(bool); + bool.ogg = elem.canPlayType('video/ogg; codecs="theora"') .replace(/^no$/,''); + + bool.h264 = elem.canPlayType('video/mp4; codecs="avc1.42E01E"') .replace(/^no$/,''); + + bool.webm = elem.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,''); + } + + } catch(e) { } + + return bool; + }; + + tests['audio'] = function() { + var elem = document.createElement('audio'), + bool = false; + + try { + if ( bool = !!elem.canPlayType ) { + bool = new Boolean(bool); + bool.ogg = elem.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,''); + bool.mp3 = elem.canPlayType('audio/mpeg;') .replace(/^no$/,''); + + // Mimetypes accepted: + // developer.mozilla.org/En/Media_formats_supported_by_the_audio_and_video_elements + // bit.ly/iphoneoscodecs + bool.wav = elem.canPlayType('audio/wav; codecs="1"') .replace(/^no$/,''); + bool.m4a = ( elem.canPlayType('audio/x-m4a;') || + elem.canPlayType('audio/aac;')) .replace(/^no$/,''); + } + } catch(e) { } + + return bool; + }; + + + // In FF4, if disabled, window.localStorage should === null. + + // Normally, we could not test that directly and need to do a + // `('localStorage' in window) && ` test first because otherwise Firefox will + // throw bugzil.la/365772 if cookies are disabled + + // Also in iOS5 Private Browsing mode, attepting to use localStorage.setItem + // will throw the exception: + // QUOTA_EXCEEDED_ERRROR DOM Exception 22. + // Peculiarly, getItem and removeItem calls do not throw. + + // Because we are forced to try/catch this, we'll go aggressive. + + // Just FWIW: IE8 Compat mode supports these features completely: + // www.quirksmode.org/dom/html5.html + // But IE8 doesn't support either with local files + + tests['localstorage'] = function() { + try { + localStorage.setItem(mod, mod); + localStorage.removeItem(mod); + return true; + } catch(e) { + return false; + } + }; + + tests['sessionstorage'] = function() { + try { + sessionStorage.setItem(mod, mod); + sessionStorage.removeItem(mod); + return true; + } catch(e) { + return false; + } + }; + + + tests['webworkers'] = function() { + return !!window.Worker; + }; + + + tests['applicationcache'] = function() { + return !!window.applicationCache; + }; + + + // Thanks to Erik Dahlstrom + tests['svg'] = function() { + return !!document.createElementNS && !!document.createElementNS(ns.svg, 'svg').createSVGRect; + }; + + // specifically for SVG inline in HTML, not within XHTML + // test page: paulirish.com/demo/inline-svg + tests['inlinesvg'] = function() { + var div = document.createElement('div'); + div.innerHTML = '<svg/>'; + return (div.firstChild && div.firstChild.namespaceURI) == ns.svg; + }; + + // SVG SMIL animation + tests['smil'] = function() { + return !!document.createElementNS && /SVGAnimate/.test(toString.call(document.createElementNS(ns.svg, 'animate'))); + }; + + // This test is only for clip paths in SVG proper, not clip paths on HTML content + // demo: srufaculty.sru.edu/david.dailey/svg/newstuff/clipPath4.svg + + // However read the comments to dig into applying SVG clippaths to HTML content here: + // github.com/Modernizr/Modernizr/issues/213#issuecomment-1149491 + tests['svgclippaths'] = function() { + return !!document.createElementNS && /SVGClipPath/.test(toString.call(document.createElementNS(ns.svg, 'clipPath'))); + }; + + // input features and input types go directly onto the ret object, bypassing the tests loop. + // Hold this guy to execute in a moment. + function webforms() { + // Run through HTML5's new input attributes to see if the UA understands any. + // We're using f which is the <input> element created early on + // Mike Taylr has created a comprehensive resource for testing these attributes + // when applied to all input types: + // miketaylr.com/code/input-type-attr.html + // spec: www.whatwg.org/specs/web-apps/current-work/multipage/the-input-element.html#input-type-attr-summary + + // Only input placeholder is tested while textarea's placeholder is not. + // Currently Safari 4 and Opera 11 have support only for the input placeholder + // Both tests are available in feature-detects/forms-placeholder.js + Modernizr['input'] = (function( props ) { + for ( var i = 0, len = props.length; i < len; i++ ) { + attrs[ props[i] ] = !!(props[i] in inputElem); + } + if (attrs.list){ + // safari false positive's on datalist: webk.it/74252 + // see also github.com/Modernizr/Modernizr/issues/146 + attrs.list = !!(document.createElement('datalist') && window.HTMLDataListElement); + } + return attrs; + })('autocomplete autofocus list placeholder max min multiple pattern required step'.split(' ')); + + // Run through HTML5's new input types to see if the UA understands any. + // This is put behind the tests runloop because it doesn't return a + // true/false like all the other tests; instead, it returns an object + // containing each input type with its corresponding true/false value + + // Big thanks to @miketaylr for the html5 forms expertise. miketaylr.com/ + Modernizr['inputtypes'] = (function(props) { + + for ( var i = 0, bool, inputElemType, defaultView, len = props.length; i < len; i++ ) { + + inputElem.setAttribute('type', inputElemType = props[i]); + bool = inputElem.type !== 'text'; + + // We first check to see if the type we give it sticks.. + // If the type does, we feed it a textual value, which shouldn't be valid. + // If the value doesn't stick, we know there's input sanitization which infers a custom UI + if ( bool ) { + + inputElem.value = smile; + inputElem.style.cssText = 'position:absolute;visibility:hidden;'; + + if ( /^range$/.test(inputElemType) && inputElem.style.WebkitAppearance !== undefined ) { + + docElement.appendChild(inputElem); + defaultView = document.defaultView; + + // Safari 2-4 allows the smiley as a value, despite making a slider + bool = defaultView.getComputedStyle && + defaultView.getComputedStyle(inputElem, null).WebkitAppearance !== 'textfield' && + // Mobile android web browser has false positive, so must + // check the height to see if the widget is actually there. + (inputElem.offsetHeight !== 0); + + docElement.removeChild(inputElem); + + } else if ( /^(search|tel)$/.test(inputElemType) ){ + // Spec doesnt define any special parsing or detectable UI + // behaviors so we pass these through as true + + // Interestingly, opera fails the earlier test, so it doesn't + // even make it here. + + } else if ( /^(url|email)$/.test(inputElemType) ) { + // Real url and email support comes with prebaked validation. + bool = inputElem.checkValidity && inputElem.checkValidity() === false; + + } else if ( /^color$/.test(inputElemType) ) { + // chuck into DOM and force reflow for Opera bug in 11.00 + // github.com/Modernizr/Modernizr/issues#issue/159 + docElement.appendChild(inputElem); + docElement.offsetWidth; + bool = inputElem.value != smile; + docElement.removeChild(inputElem); + + } else { + // If the upgraded input compontent rejects the :) text, we got a winner + bool = inputElem.value != smile; + } + } + + inputs[ props[i] ] = !!bool; + } + return inputs; + })('search tel url email datetime date month week time datetime-local number range color'.split(' ')); + } + + + // End of test definitions + // ----------------------- + + + + // Run through all tests and detect their support in the current UA. + // todo: hypothetically we could be doing an array of tests and use a basic loop here. + for ( var feature in tests ) { + if ( hasOwnProperty(tests, feature) ) { + // run the test, throw the return value into the Modernizr, + // then based on that boolean, define an appropriate className + // and push it into an array of classes we'll join later. + featureName = feature.toLowerCase(); + Modernizr[featureName] = tests[feature](); + + classes.push((Modernizr[featureName] ? '' : 'no-') + featureName); + } + } + + // input tests need to run. + Modernizr.input || webforms(); + + + /** + * addTest allows the user to define their own feature tests + * the result will be added onto the Modernizr object, + * as well as an appropriate className set on the html element + * + * @param feature - String naming the feature + * @param test - Function returning true if feature is supported, false if not + */ + Modernizr.addTest = function ( feature, test ) { + if ( typeof feature == 'object' ) { + for ( var key in feature ) { + if ( hasOwnProperty( feature, key ) ) { + Modernizr.addTest( key, feature[ key ] ); + } + } + } else { + + feature = feature.toLowerCase(); + + if ( Modernizr[feature] !== undefined ) { + // we're going to quit if you're trying to overwrite an existing test + // if we were to allow it, we'd do this: + // var re = new RegExp("\\b(no-)?" + feature + "\\b"); + // docElement.className = docElement.className.replace( re, '' ); + // but, no rly, stuff 'em. + return Modernizr; + } + + test = typeof test == 'function' ? test() : test; + + docElement.className += ' ' + (test ? '' : 'no-') + feature; + Modernizr[feature] = test; + + } + + return Modernizr; // allow chaining. + }; + + + // Reset modElem.cssText to nothing to reduce memory footprint. + setCss(''); + modElem = inputElem = null; + + //>>BEGIN IEPP + // Enable HTML 5 elements for styling in IE & add HTML5 css + /*! HTML5 Shiv v3.4 | @afarkas @jdalton @jon_neal @rem | MIT/GPL2 Licensed */ + ;(function(window, document) { + + /** Preset options */ + var options = window.html5 || {}; + + /** Used to skip problem elements */ + var reSkip = /^<|^(?:button|form|map|select|textarea)$/i; + + /** Detect whether the browser supports default html5 styles */ + var supportsHtml5Styles; + + /** Detect whether the browser supports unknown elements */ + var supportsUnknownElements; + + (function() { + var a = document.createElement('a'); + + a.innerHTML = '<xyz></xyz>'; + + //if the hidden property is implemented we can assume, that the browser supports HTML5 Styles + supportsHtml5Styles = ('hidden' in a); + supportsUnknownElements = a.childNodes.length == 1 || (function() { + // assign a false positive if unable to shiv + try { + (document.createElement)('a'); + } catch(e) { + return true; + } + var frag = document.createDocumentFragment(); + return ( + typeof frag.cloneNode == 'undefined' || + typeof frag.createDocumentFragment == 'undefined' || + typeof frag.createElement == 'undefined' + ); + }()); + + }()); + + /*--------------------------------------------------------------------------*/ + + /** + * Creates a style sheet with the given CSS text and adds it to the document. + * @private + * @param {Document} ownerDocument The document. + * @param {String} cssText The CSS text. + * @returns {StyleSheet} The style element. + */ + function addStyleSheet(ownerDocument, cssText) { + var p = ownerDocument.createElement('p'), + parent = ownerDocument.getElementsByTagName('head')[0] || ownerDocument.documentElement; + + p.innerHTML = 'x<style>' + cssText + '</style>'; + return parent.insertBefore(p.lastChild, parent.firstChild); + } + + /** + * Returns the value of `html5.elements` as an array. + * @private + * @returns {Array} An array of shived element node names. + */ + function getElements() { + var elements = html5.elements; + return typeof elements == 'string' ? elements.split(' ') : elements; + } + + /** + * Shivs the `createElement` and `createDocumentFragment` methods of the document. + * @private + * @param {Document|DocumentFragment} ownerDocument The document. + */ + function shivMethods(ownerDocument) { + var cache = {}, + docCreateElement = ownerDocument.createElement, + docCreateFragment = ownerDocument.createDocumentFragment, + frag = docCreateFragment(); + + ownerDocument.createElement = function(nodeName) { + // Avoid adding some elements to fragments in IE < 9 because + // * Attributes like `name` or `type` cannot be set/changed once an element + // is inserted into a document/fragment + // * Link elements with `src` attributes that are inaccessible, as with + // a 403 response, will cause the tab/window to crash + // * Script elements appended to fragments will execute when their `src` + // or `text` property is set + var node = (cache[nodeName] || (cache[nodeName] = docCreateElement(nodeName))).cloneNode(); + return html5.shivMethods && node.canHaveChildren && !reSkip.test(nodeName) ? frag.appendChild(node) : node; + }; + + ownerDocument.createDocumentFragment = Function('h,f', 'return function(){' + + 'var n=f.cloneNode(),c=n.createElement;' + + 'h.shivMethods&&(' + + // unroll the `createElement` calls + getElements().join().replace(/\w+/g, function(nodeName) { + cache[nodeName] = docCreateElement(nodeName); + frag.createElement(nodeName); + return 'c("' + nodeName + '")'; + }) + + ');return n}' + )(html5, frag); + } + + /*--------------------------------------------------------------------------*/ + + /** + * Shivs the given document. + * @memberOf html5 + * @param {Document} ownerDocument The document to shiv. + * @returns {Document} The shived document. + */ + function shivDocument(ownerDocument) { + var shived; + if (ownerDocument.documentShived) { + return ownerDocument; + } + if (html5.shivCSS && !supportsHtml5Styles) { + shived = !!addStyleSheet(ownerDocument, + // corrects block display not defined in IE6/7/8/9 + 'article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block}' + + // corrects audio display not defined in IE6/7/8/9 + 'audio{display:none}' + + // corrects canvas and video display not defined in IE6/7/8/9 + 'canvas,video{display:inline-block;*display:inline;*zoom:1}' + + // corrects 'hidden' attribute and audio[controls] display not present in IE7/8/9 + '[hidden]{display:none}audio[controls]{display:inline-block;*display:inline;*zoom:1}' + + // adds styling not present in IE6/7/8/9 + 'mark{background:#FF0;color:#000}' + ); + } + if (!supportsUnknownElements) { + shived = !shivMethods(ownerDocument); + } + if (shived) { + ownerDocument.documentShived = shived; + } + return ownerDocument; + } + + /*--------------------------------------------------------------------------*/ + + /** + * The `html5` object is exposed so that more elements can be shived and + * existing shiving can be detected on iframes. + * @type Object + * @example + * + * // options can be changed before the script is included + * html5 = { 'elements': 'mark section', 'shivCSS': false, 'shivMethods': false }; + */ + var html5 = { + + /** + * An array or space separated string of node names of the elements to shiv. + * @memberOf html5 + * @type Array|String + */ + 'elements': options.elements || 'abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video', + + /** + * A flag to indicate that the HTML5 style sheet should be inserted. + * @memberOf html5 + * @type Boolean + */ + 'shivCSS': !(options.shivCSS === false), + + /** + * A flag to indicate that the document's `createElement` and `createDocumentFragment` + * methods should be overwritten. + * @memberOf html5 + * @type Boolean + */ + 'shivMethods': !(options.shivMethods === false), + + /** + * A string to describe the type of `html5` object ("default" or "default print"). + * @memberOf html5 + * @type String + */ + 'type': 'default', + + // shivs the document according to the specified `html5` object options + 'shivDocument': shivDocument + }; + + /*--------------------------------------------------------------------------*/ + + // expose html5 + window.html5 = html5; + + // shiv the document + shivDocument(document); + + }(this, document)); + + //>>END IEPP + + // Assign private properties to the return object with prefix + Modernizr._version = version; + + // expose these for the plugin API. Look in the source for how to join() them against your input + Modernizr._prefixes = prefixes; + Modernizr._domPrefixes = domPrefixes; + Modernizr._cssomPrefixes = cssomPrefixes; + + // Modernizr.mq tests a given media query, live against the current state of the window + // A few important notes: + // * If a browser does not support media queries at all (eg. oldIE) the mq() will always return false + // * A max-width or orientation query will be evaluated against the current state, which may change later. + // * You must specify values. Eg. If you are testing support for the min-width media query use: + // Modernizr.mq('(min-width:0)') + // usage: + // Modernizr.mq('only screen and (max-width:768)') + Modernizr.mq = testMediaQuery; + + // Modernizr.hasEvent() detects support for a given event, with an optional element to test on + // Modernizr.hasEvent('gesturestart', elem) + Modernizr.hasEvent = isEventSupported; + + // Modernizr.testProp() investigates whether a given style property is recognized + // Note that the property names must be provided in the camelCase variant. + // Modernizr.testProp('pointerEvents') + Modernizr.testProp = function(prop){ + return testProps([prop]); + }; + + // Modernizr.testAllProps() investigates whether a given style property, + // or any of its vendor-prefixed variants, is recognized + // Note that the property names must be provided in the camelCase variant. + // Modernizr.testAllProps('boxSizing') + Modernizr.testAllProps = testPropsAll; + + + + // Modernizr.testStyles() allows you to add custom styles to the document and test an element afterwards + // Modernizr.testStyles('#modernizr { position:absolute }', function(elem, rule){ ... }) + Modernizr.testStyles = injectElementWithStyles; + + + // Modernizr.prefixed() returns the prefixed or nonprefixed property name variant of your input + // Modernizr.prefixed('boxSizing') // 'MozBoxSizing' + + // Properties must be passed as dom-style camelcase, rather than `box-sizing` hypentated style. + // Return values will also be the camelCase variant, if you need to translate that to hypenated style use: + // + // str.replace(/([A-Z])/g, function(str,m1){ return '-' + m1.toLowerCase(); }).replace(/^ms-/,'-ms-'); + + // If you're trying to ascertain which transition end event to bind to, you might do something like... + // + // var transEndEventNames = { + // 'WebkitTransition' : 'webkitTransitionEnd', + // 'MozTransition' : 'transitionend', + // 'OTransition' : 'oTransitionEnd', + // 'msTransition' : 'MsTransitionEnd', + // 'transition' : 'transitionend' + // }, + // transEndEventName = transEndEventNames[ Modernizr.prefixed('transition') ]; + + Modernizr.prefixed = function(prop, obj, elem){ + if(!obj) { + return testPropsAll(prop, 'pfx'); + } else { + // Testing DOM property e.g. Modernizr.prefixed('requestAnimationFrame', window) // 'mozRequestAnimationFrame' + return testPropsAll(prop, obj, elem); + } + }; + + + + // Remove "no-js" class from <html> element, if it exists: + docElement.className = docElement.className.replace(/(^|\s)no-js(\s|$)/, '$1$2') + + + // Add the new classes to the <html> element. + (enableClasses ? ' js ' + classes.join(' ') : ''); + + return Modernizr; + +})(this, this.document); |