Move gitbook source code to es6 (linted)

67 files changed, 2947 insertions, 0 deletions

diff --git a/packages/gitbook/src/output/__tests__/createMock.js b/packages/gitbook/src/output/__tests__/createMock.js
new file mode 100644
index 0000000..09b93da
--- /dev/null
+++ b/packages/gitbook/src/output/__tests__/createMock.js
@@ -0,0 +1,38 @@
+const Immutable = require('immutable');
+
+const Output = require('../../models/output');
+const Book = require('../../models/book');
+const parseBook = require('../../parse/parseBook');
+const createMockFS = require('../../fs/mock');
+const preparePlugins = require('../preparePlugins');
+
+/**
+ * Create an output using a generator
+ *
+ * FOR TESTING PURPOSE ONLY
+ *
+ * @param {Generator} generator
+ * @param {Map<String:String|Map>} files
+ * @return {Promise<Output>}
+ */
+function createMockOutput(generator, files, options) {
+    const fs = createMockFS(files);
+    let book = Book.createForFS(fs);
+    const state = generator.State ? generator.State({}) : Immutable.Map();
+
+    book = book.setLogLevel('disabled');
+    options = generator.Options(options);
+
+    return parseBook(book)
+    .then(function(resultBook) {
+        return new Output({
+            book:      resultBook,
+            options,
+            state,
+            generator: generator.name
+        });
+    })
+    .then(preparePlugins);
+}
+
+module.exports = createMockOutput;
diff --git a/packages/gitbook/src/output/__tests__/ebook.js b/packages/gitbook/src/output/__tests__/ebook.js
new file mode 100644
index 0000000..425ab6b
--- /dev/null
+++ b/packages/gitbook/src/output/__tests__/ebook.js
@@ -0,0 +1,16 @@
+const generateMock = require('./generateMock');
+const EbookGenerator = require('../ebook');
+
+describe('EbookGenerator', function() {
+
+    it('should generate a SUMMARY.html', function() {
+        return generateMock(EbookGenerator, {
+            'README.md': 'Hello World'
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('SUMMARY.html');
+            expect(folder).toHaveFile('index.html');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/__tests__/generateMock.js b/packages/gitbook/src/output/__tests__/generateMock.js
new file mode 100644
index 0000000..a0be244
--- /dev/null
+++ b/packages/gitbook/src/output/__tests__/generateMock.js
@@ -0,0 +1,40 @@
+const tmp = require('tmp');
+
+const Book = require('../../models/book');
+const createMockFS = require('../../fs/mock');
+const parseBook = require('../../parse/parseBook');
+const generateBook = require('../generateBook');
+
+/**
+ * Generate a book using a generator
+ * And returns the path to the output dir.
+ *
+ * FOR TESTING PURPOSE ONLY
+ *
+ * @param {Generator}
+ * @param {Map<String:String|Map>} files
+ * @return {Promise<String>}
+ */
+function generateMock(Generator, files) {
+    const fs = createMockFS(files);
+    let book = Book.createForFS(fs);
+    let dir;
+
+    try {
+        dir = tmp.dirSync();
+    } catch (err) {
+        throw err;
+    }
+
+    book = book.setLogLevel('disabled');
+
+    return parseBook(book)
+    .then(function(resultBook) {
+        return generateBook(Generator, resultBook, {
+            root: dir.name
+        });
+    })
+    .thenResolve(dir.name);
+}
+
+module.exports = generateMock;
diff --git a/packages/gitbook/src/output/__tests__/json.js b/packages/gitbook/src/output/__tests__/json.js
new file mode 100644
index 0000000..d4992ec
--- /dev/null
+++ b/packages/gitbook/src/output/__tests__/json.js
@@ -0,0 +1,46 @@
+const generateMock = require('./generateMock');
+const JSONGenerator = require('../json');
+
+describe('JSONGenerator', function() {
+
+    it('should generate a README.json', function() {
+        return generateMock(JSONGenerator, {
+            'README.md': 'Hello World'
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('README.json');
+        });
+    });
+
+    it('should generate a json file for each articles', function() {
+        return generateMock(JSONGenerator, {
+            'README.md': 'Hello World',
+            'SUMMARY.md': '# Summary\n\n* [Page](test/page.md)',
+            'test': {
+                'page.md': 'Hello 2'
+            }
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('README.json');
+            expect(folder).toHaveFile('test/page.json');
+        });
+    });
+
+    it('should generate a multilingual book', function() {
+        return generateMock(JSONGenerator, {
+            'LANGS.md': '# Languages\n\n* [en](en)\n* [fr](fr)',
+            'en': {
+                'README.md': 'Hello'
+            },
+            'fr': {
+                'README.md': 'Bonjour'
+            }
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('en/README.json');
+            expect(folder).toHaveFile('fr/README.json');
+            expect(folder).toHaveFile('README.json');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/__tests__/website.js b/packages/gitbook/src/output/__tests__/website.js
new file mode 100644
index 0000000..d39842f
--- /dev/null
+++ b/packages/gitbook/src/output/__tests__/website.js
@@ -0,0 +1,144 @@
+const fs = require('fs');
+const generateMock = require('./generateMock');
+const WebsiteGenerator = require('../website');
+
+describe('WebsiteGenerator', function() {
+
+    it('should generate an index.html', function() {
+        return generateMock(WebsiteGenerator, {
+            'README.md': 'Hello World'
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('index.html');
+        });
+    });
+
+    describe('Glossary', function() {
+        let folder;
+
+        before(function() {
+            return generateMock(WebsiteGenerator, {
+                'README.md': 'Hello World',
+                'SUMMARY.md': '* [Deep](folder/page.md)',
+                'folder': {
+                    'page.md': 'Hello World'
+                },
+                'GLOSSARY.md': '# Glossary\n\n## Hello\n\nHello World'
+            })
+            .then(function(_folder) {
+                folder = _folder;
+            });
+        });
+
+        it('should generate a GLOSSARY.html', function() {
+            expect(folder).toHaveFile('GLOSSARY.html');
+        });
+
+        it('should correctly resolve glossary links in README', function() {
+            const html = fs.readFileSync(folder + '/index.html', 'utf8');
+            expect(html).toHaveDOMElement('.page-inner a[href="GLOSSARY.html#hello"]');
+        });
+
+        it('should correctly resolve glossary links in directory', function() {
+            const html = fs.readFileSync(folder + '/folder/page.html', 'utf8');
+            expect(html).toHaveDOMElement('.page-inner a[href="../GLOSSARY.html#hello"]');
+        });
+
+        it('should accept a custom glossary file', function() {
+            return generateMock(WebsiteGenerator, {
+                'README.md': 'Hello World',
+                'book.json': '{ "structure": { "glossary": "custom.md" } }',
+                'custom.md': '# Glossary\n\n## Hello\n\nHello World'
+            })
+            .then(function(folder) {
+                expect(folder).toHaveFile('custom.html');
+                expect(folder).toNotHaveFile('GLOSSARY.html');
+
+                const html = fs.readFileSync(folder + '/index.html', 'utf8');
+                expect(html).toHaveDOMElement('.page-inner a[href="custom.html#hello"]');
+            });
+        });
+    });
+
+
+    it('should copy asset files', function() {
+        return generateMock(WebsiteGenerator, {
+            'README.md': 'Hello World',
+            'myJsFile.js': 'var a = "test";',
+            'folder': {
+                'AnotherAssetFile.md': '# Even md'
+            }
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('index.html');
+            expect(folder).toHaveFile('myJsFile.js');
+            expect(folder).toHaveFile('folder/AnotherAssetFile.md');
+        });
+    });
+
+    it('should generate an index.html for AsciiDoc', function() {
+        return generateMock(WebsiteGenerator, {
+            'README.adoc': 'Hello World'
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('index.html');
+        });
+    });
+
+    it('should generate an HTML file for each articles', function() {
+        return generateMock(WebsiteGenerator, {
+            'README.md': 'Hello World',
+            'SUMMARY.md': '# Summary\n\n* [Page](test/page.md)',
+            'test': {
+                'page.md': 'Hello 2'
+            }
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('index.html');
+            expect(folder).toHaveFile('test/page.html');
+        });
+    });
+
+    it('should not generate file if entry file doesn\'t exist', function() {
+        return generateMock(WebsiteGenerator, {
+            'README.md': 'Hello World',
+            'SUMMARY.md': '# Summary\n\n* [Page 1](page.md)\n* [Page 2](test/page.md)',
+            'test': {
+                'page.md': 'Hello 2'
+            }
+        })
+        .then(function(folder) {
+            expect(folder).toHaveFile('index.html');
+            expect(folder).toNotHaveFile('page.html');
+            expect(folder).toHaveFile('test/page.html');
+        });
+    });
+
+    it('should generate a multilingual book', function() {
+        return generateMock(WebsiteGenerator, {
+            'LANGS.md': '# Languages\n\n* [en](en)\n* [fr](fr)',
+            'en': {
+                'README.md': 'Hello'
+            },
+            'fr': {
+                'README.md': 'Bonjour'
+            }
+        })
+        .then(function(folder) {
+            // It should generate languages
+            expect(folder).toHaveFile('en/index.html');
+            expect(folder).toHaveFile('fr/index.html');
+
+            // Should not copy languages as assets
+            expect(folder).toNotHaveFile('en/README.md');
+            expect(folder).toNotHaveFile('fr/README.md');
+
+            // Should copy assets only once
+            expect(folder).toHaveFile('gitbook/style.css');
+            expect(folder).toNotHaveFile('en/gitbook/style.css');
+
+            expect(folder).toHaveFile('index.html');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/callHook.js b/packages/gitbook/src/output/callHook.js
new file mode 100644
index 0000000..2180102
--- /dev/null
+++ b/packages/gitbook/src/output/callHook.js
@@ -0,0 +1,60 @@
+const Promise = require('../utils/promise');
+const timing = require('../utils/timing');
+const Api = require('../api');
+
+function defaultGetArgument() {
+    return undefined;
+}
+
+function defaultHandleResult(output, result) {
+    return output;
+}
+
+/**
+    Call a "global" hook for an output
+
+    @param {String} name
+    @param {Function(Output) -> Mixed} getArgument
+    @param {Function(Output, result) -> Output} handleResult
+    @param {Output} output
+    @return {Promise<Output>}
+*/
+function callHook(name, getArgument, handleResult, output) {
+    getArgument = getArgument || defaultGetArgument;
+    handleResult = handleResult || defaultHandleResult;
+
+    const logger = output.getLogger();
+    const plugins = output.getPlugins();
+
+    logger.debug.ln('calling hook "' + name + '"');
+
+    // Create the JS context for plugins
+    const context = Api.encodeGlobal(output);
+
+    return timing.measure(
+        'call.hook.' + name,
+
+        // Get the arguments
+        Promise(getArgument(output))
+
+        // Call the hooks in serie
+        .then(function(arg) {
+            return Promise.reduce(plugins, function(prev, plugin) {
+                const hook = plugin.getHook(name);
+                if (!hook) {
+                    return prev;
+                }
+
+                return hook.call(context, prev);
+            }, arg);
+        })
+
+        // Handle final result
+        .then(function(result) {
+            output = Api.decodeGlobal(output, context);
+            return handleResult(output, result);
+        })
+    );
+}
+
+module.exports = callHook;
diff --git a/packages/gitbook/src/output/callPageHook.js b/packages/gitbook/src/output/callPageHook.js
new file mode 100644
index 0000000..af249c9
--- /dev/null
+++ b/packages/gitbook/src/output/callPageHook.js
@@ -0,0 +1,28 @@
+const Api = require('../api');
+const callHook = require('./callHook');
+
+/**
+    Call a hook for a specific page
+
+    @param {String} name
+    @param {Output} output
+    @param {Page} page
+    @return {Promise<Page>}
+*/
+function callPageHook(name, output, page) {
+    return callHook(
+        name,
+
+        function(out) {
+            return Api.encodePage(out, page);
+        },
+
+        function(out, result) {
+            return Api.decodePage(out, page, result);
+        },
+
+        output
+    );
+}
+
+module.exports = callPageHook;
diff --git a/packages/gitbook/src/output/createTemplateEngine.js b/packages/gitbook/src/output/createTemplateEngine.js
new file mode 100644
index 0000000..03e7d84
--- /dev/null
+++ b/packages/gitbook/src/output/createTemplateEngine.js
@@ -0,0 +1,45 @@
+const Templating = require('../templating');
+const TemplateEngine = require('../models/templateEngine');
+
+const Api = require('../api');
+const Plugins = require('../plugins');
+
+const defaultBlocks = require('../constants/defaultBlocks');
+const defaultFilters = require('../constants/defaultFilters');
+
+/**
+    Create template engine for an output.
+    It adds default filters/blocks, then add the ones from plugins
+
+    @param {Output} output
+    @return {TemplateEngine}
+*/
+function createTemplateEngine(output) {
+    const plugins = output.getPlugins();
+    const book = output.getBook();
+    const rootFolder = book.getContentRoot();
+    const logger = book.getLogger();
+
+    let filters = Plugins.listFilters(plugins);
+    let blocks = Plugins.listBlocks(plugins);
+
+    // Extend with default
+    blocks = defaultBlocks.merge(blocks);
+    filters = defaultFilters.merge(filters);
+
+    // Create loader
+    const transformFn = Templating.replaceShortcuts.bind(null, blocks);
+    const loader = new Templating.ConrefsLoader(rootFolder, transformFn, logger);
+
+    // Create API context
+    const context = Api.encodeGlobal(output);
+
+    return new TemplateEngine({
+        filters,
+        blocks,
+        loader,
+        context
+    });
+}
+
+module.exports = createTemplateEngine;
diff --git a/packages/gitbook/src/output/ebook/getConvertOptions.js b/packages/gitbook/src/output/ebook/getConvertOptions.js
new file mode 100644
index 0000000..b37c68e
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/getConvertOptions.js
@@ -0,0 +1,73 @@
+const extend = require('extend');
+
+const Promise = require('../../utils/promise');
+const getPDFTemplate = require('./getPDFTemplate');
+const getCoverPath = require('./getCoverPath');
+
+/**
+    Generate options for ebook-convert
+
+    @param {Output}
+    @return {Promise<Object>}
+*/
+function getConvertOptions(output) {
+    const options = output.getOptions();
+    const format = options.get('format');
+
+    const book = output.getBook();
+    const config = book.getConfig();
+
+    return Promise()
+    .then(function() {
+        const coverPath = getCoverPath(output);
+        let options = {
+            '--cover':                      coverPath,
+            '--title':                      config.getValue('title'),
+            '--comments':                   config.getValue('description'),
+            '--isbn':                       config.getValue('isbn'),
+            '--authors':                    config.getValue('author'),
+            '--language':                   book.getLanguage() || config.getValue('language'),
+            '--book-producer':              'GitBook',
+            '--publisher':                  'GitBook',
+            '--chapter':                    'descendant-or-self::*[contains(concat(\' \', normalize-space(@class), \' \'), \' book-chapter \')]',
+            '--level1-toc':                 'descendant-or-self::*[contains(concat(\' \', normalize-space(@class), \' \'), \' book-chapter-1 \')]',
+            '--level2-toc':                 'descendant-or-self::*[contains(concat(\' \', normalize-space(@class), \' \'), \' book-chapter-2 \')]',
+            '--level3-toc':                 'descendant-or-self::*[contains(concat(\' \', normalize-space(@class), \' \'), \' book-chapter-3 \')]',
+            '--max-levels':                 '1',
+            '--no-chapters-in-toc':         true,
+            '--breadth-first':              true,
+            '--dont-split-on-page-breaks':  format === 'epub' ? true : undefined
+        };
+
+        if (format !== 'pdf') {
+            return options;
+        }
+
+        return Promise.all([
+            getPDFTemplate(output, 'header'),
+            getPDFTemplate(output, 'footer')
+        ])
+        .spread(function(headerTpl, footerTpl) {
+            const pdfOptions = config.getValue('pdf').toJS();
+
+            return options = extend(options, {
+                '--chapter-mark':           String(pdfOptions.chapterMark),
+                '--page-breaks-before':     String(pdfOptions.pageBreaksBefore),
+                '--margin-left':            String(pdfOptions.margin.left),
+                '--margin-right':           String(pdfOptions.margin.right),
+                '--margin-top':             String(pdfOptions.margin.top),
+                '--margin-bottom':          String(pdfOptions.margin.bottom),
+                '--pdf-default-font-size':  String(pdfOptions.fontSize),
+                '--pdf-mono-font-size':     String(pdfOptions.fontSize),
+                '--paper-size':             String(pdfOptions.paperSize),
+                '--pdf-page-numbers':       Boolean(pdfOptions.pageNumbers),
+                '--pdf-sans-family':        String(pdfOptions.fontFamily),
+                '--pdf-header-template':    headerTpl,
+                '--pdf-footer-template':    footerTpl
+            });
+        });
+    });
+}
+
+
+module.exports = getConvertOptions;
diff --git a/packages/gitbook/src/output/ebook/getCoverPath.js b/packages/gitbook/src/output/ebook/getCoverPath.js
new file mode 100644
index 0000000..cf18c8d
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/getCoverPath.js
@@ -0,0 +1,30 @@
+const path = require('path');
+const fs = require('../../utils/fs');
+
+/**
+    Resolve path to cover file to use
+
+    @param {Output}
+    @return {String}
+*/
+function getCoverPath(output) {
+    const outputRoot = output.getRoot();
+    const book = output.getBook();
+    const config = book.getConfig();
+    const coverName = config.getValue('cover', 'cover.jpg');
+
+    // Resolve to absolute
+    let cover = fs.pickFile(outputRoot, coverName);
+    if (cover) {
+        return cover;
+    }
+
+    // Multilingual? try parent folder
+    if (book.isLanguageBook()) {
+        cover = fs.pickFile(path.join(outputRoot, '..'), coverName);
+    }
+
+    return cover;
+}
+
+module.exports = getCoverPath;
diff --git a/packages/gitbook/src/output/ebook/getPDFTemplate.js b/packages/gitbook/src/output/ebook/getPDFTemplate.js
new file mode 100644
index 0000000..c0faed3
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/getPDFTemplate.js
@@ -0,0 +1,41 @@
+const juice = require('juice');
+
+const WebsiteGenerator = require('../website');
+const JSONUtils = require('../../json');
+const Templating = require('../../templating');
+const Promise = require('../../utils/promise');
+
+
+/**
+    Generate PDF header/footer templates
+
+    @param {Output} output
+    @param {String} type
+    @return {String}
+*/
+function getPDFTemplate(output, type) {
+    const filePath = 'pdf_' + type + '.html';
+    const outputRoot = output.getRoot();
+    const engine = WebsiteGenerator.createTemplateEngine(output, filePath);
+
+    // Generate context
+    const context = JSONUtils.encodeOutput(output);
+    context.page = {
+        num: '_PAGENUM_',
+        title: '_SECTION_'
+    };
+
+    // Render the theme
+    return Templating.renderFile(engine, 'ebook/' + filePath, context)
+
+    // Inline css and assets
+    .then(function(tplOut) {
+        return Promise.nfcall(juice.juiceResources, tplOut.getContent(), {
+            webResources: {
+                relativeTo: outputRoot
+            }
+        });
+    });
+}
+
+module.exports = getPDFTemplate;
diff --git a/packages/gitbook/src/output/ebook/index.js b/packages/gitbook/src/output/ebook/index.js
new file mode 100644
index 0000000..c5c07c2
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/index.js
@@ -0,0 +1,9 @@
+const extend = require('extend');
+const WebsiteGenerator = require('../website');
+
+module.exports = extend({}, WebsiteGenerator, {
+    name: 'ebook',
+    Options: require('./options'),
+    onPage: require('./onPage'),
+    onFinish: require('./onFinish')
+});
diff --git a/packages/gitbook/src/output/ebook/onFinish.js b/packages/gitbook/src/output/ebook/onFinish.js
new file mode 100644
index 0000000..adff798
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/onFinish.js
@@ -0,0 +1,91 @@
+const path = require('path');
+
+const WebsiteGenerator = require('../website');
+const JSONUtils = require('../../json');
+const Templating = require('../../templating');
+const Promise = require('../../utils/promise');
+const error = require('../../utils/error');
+const command = require('../../utils/command');
+const writeFile = require('../helper/writeFile');
+
+const getConvertOptions = require('./getConvertOptions');
+const SUMMARY_FILE = 'SUMMARY.html';
+
+/**
+    Write the SUMMARY.html
+
+    @param {Output}
+    @return {Output}
+*/
+function writeSummary(output) {
+    const options = output.getOptions();
+    const prefix = options.get('prefix');
+
+    const filePath = SUMMARY_FILE;
+    const engine = WebsiteGenerator.createTemplateEngine(output, filePath);
+    const context = JSONUtils.encodeOutput(output);
+
+    // Render the theme
+    return Templating.renderFile(engine, prefix + '/summary.html', context)
+
+    // Write it to the disk
+    .then(function(tplOut) {
+        return writeFile(output, filePath, tplOut.getContent());
+    });
+}
+
+/**
+    Generate the ebook file as "index.pdf"
+
+    @param {Output}
+    @return {Output}
+*/
+function runEbookConvert(output) {
+    const logger = output.getLogger();
+    const options = output.getOptions();
+    const format = options.get('format');
+    const outputFolder = output.getRoot();
+
+    if (!format) {
+        return Promise(output);
+    }
+
+    return getConvertOptions(output)
+    .then(function(options) {
+        const cmd = [
+            'ebook-convert',
+            path.resolve(outputFolder, SUMMARY_FILE),
+            path.resolve(outputFolder, 'index.' + format),
+            command.optionsToShellArgs(options)
+        ].join(' ');
+
+        return command.exec(cmd)
+        .progress(function(data) {
+            logger.debug(data);
+        })
+        .fail(function(err) {
+            if (err.code == 127) {
+                throw error.RequireInstallError({
+                    cmd: 'ebook-convert',
+                    install: 'Install it from Calibre: https://calibre-ebook.com'
+                });
+            }
+
+            throw error.EbookError(err);
+        });
+    })
+    .thenResolve(output);
+}
+
+/**
+    Finish the generation, generates the SUMMARY.html
+
+    @param {Output}
+    @return {Output}
+*/
+function onFinish(output) {
+    return writeSummary(output)
+    .then(runEbookConvert);
+}
+
+module.exports = onFinish;
diff --git a/packages/gitbook/src/output/ebook/onPage.js b/packages/gitbook/src/output/ebook/onPage.js
new file mode 100644
index 0000000..520d296
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/onPage.js
@@ -0,0 +1,24 @@
+const WebsiteGenerator = require('../website');
+const Modifiers = require('../modifiers');
+
+/**
+    Write a page for ebook output
+
+    @param {Output} output
+    @param {Output}
+*/
+function onPage(output, page) {
+    const options = output.getOptions();
+
+    // Inline assets
+    return Modifiers.modifyHTML(page, [
+        Modifiers.inlineAssets(options.get('root'), page.getFile().getPath())
+    ])
+
+    // Write page using website generator
+    .then(function(resultPage) {
+        return WebsiteGenerator.onPage(output, resultPage);
+    });
+}
+
+module.exports = onPage;
diff --git a/packages/gitbook/src/output/ebook/options.js b/packages/gitbook/src/output/ebook/options.js
new file mode 100644
index 0000000..4156fac
--- /dev/null
+++ b/packages/gitbook/src/output/ebook/options.js
@@ -0,0 +1,17 @@
+const Immutable = require('immutable');
+
+const Options = Immutable.Record({
+    // Root folder for the output
+    root:               String(),
+
+    // Prefix for generation
+    prefix:             String('ebook'),
+
+    // Format to generate using ebook-convert
+    format:             String(),
+
+    // Force use of absolute urls ("index.html" instead of "/")
+    directoryIndex:     Boolean(false)
+});
+
+module.exports = Options;
diff --git a/packages/gitbook/src/output/generateAssets.js b/packages/gitbook/src/output/generateAssets.js
new file mode 100644
index 0000000..2129553
--- /dev/null
+++ b/packages/gitbook/src/output/generateAssets.js
@@ -0,0 +1,26 @@
+const Promise = require('../utils/promise');
+
+/**
+    Output all assets using a generator
+
+    @param {Generator} generator
+    @param {Output} output
+    @return {Promise<Output>}
+*/
+function generateAssets(generator, output) {
+    const assets = output.getAssets();
+    const logger = output.getLogger();
+
+    // Is generator ignoring assets?
+    if (!generator.onAsset) {
+        return Promise(output);
+    }
+
+    return Promise.reduce(assets, function(out, assetFile) {
+        logger.debug.ln('copy asset "' + assetFile + '"');
+
+        return generator.onAsset(out, assetFile);
+    }, output);
+}
+
+module.exports = generateAssets;
diff --git a/packages/gitbook/src/output/generateBook.js b/packages/gitbook/src/output/generateBook.js
new file mode 100644
index 0000000..ea8c78e
--- /dev/null
+++ b/packages/gitbook/src/output/generateBook.js
@@ -0,0 +1,193 @@
+const path = require('path');
+const Immutable = require('immutable');
+
+const Output = require('../models/output');
+const Promise = require('../utils/promise');
+const fs = require('../utils/fs');
+
+const callHook = require('./callHook');
+const preparePlugins = require('./preparePlugins');
+const preparePages = require('./preparePages');
+const prepareAssets = require('./prepareAssets');
+const generateAssets = require('./generateAssets');
+const generatePages = require('./generatePages');
+
+/**
+ * Process an output to generate the book
+ *
+ * @param {Generator} generator
+ * @param {Output} output
+ * @return {Promise<Output>}
+ */
+function processOutput(generator, startOutput) {
+    return Promise(startOutput)
+    .then(preparePlugins)
+    .then(preparePages)
+    .then(prepareAssets)
+
+    .then(
+        callHook.bind(null,
+            'config',
+            function(output) {
+                const book = output.getBook();
+                const config = book.getConfig();
+                const values = config.getValues();
+
+                return values.toJS();
+            },
+            function(output, result) {
+                let book = output.getBook();
+                let config = book.getConfig();
+
+                config = config.updateValues(result);
+                book = book.set('config', config);
+                return output.set('book', book);
+            }
+        )
+    )
+
+    .then(
+        callHook.bind(null,
+            'init',
+            function(output) {
+                return {};
+            },
+            function(output) {
+                return output;
+            }
+        )
+    )
+
+    .then(function(output) {
+        if (!generator.onInit) {
+            return output;
+        }
+
+        return generator.onInit(output);
+    })
+
+    .then(generateAssets.bind(null, generator))
+    .then(generatePages.bind(null, generator))
+
+    .tap(function(output) {
+        const book = output.getBook();
+
+        if (!book.isMultilingual()) {
+            return;
+        }
+
+        const logger = book.getLogger();
+        const books = book.getBooks();
+        const outputRoot = output.getRoot();
+        const plugins = output.getPlugins();
+        const state = output.getState();
+        const options = output.getOptions();
+
+        return Promise.forEach(books, function(langBook) {
+            // Inherits plugins list, options and state
+            const langOptions = options.set('root', path.join(outputRoot, langBook.getLanguage()));
+            const langOutput = new Output({
+                book:       langBook,
+                options:    langOptions,
+                state,
+                generator:  generator.name,
+                plugins
+            });
+
+            logger.info.ln('');
+            logger.info.ln('generating language "' + langBook.getLanguage() + '"');
+            return processOutput(generator, langOutput);
+        });
+    })
+
+    .then(callHook.bind(null,
+        'finish:before',
+            function(output) {
+                return {};
+            },
+            function(output) {
+                return output;
+            }
+        )
+    )
+
+    .then(function(output) {
+        if (!generator.onFinish) {
+            return output;
+        }
+
+        return generator.onFinish(output);
+    })
+
+    .then(callHook.bind(null,
+        'finish',
+            function(output) {
+                return {};
+            },
+            function(output) {
+                return output;
+            }
+        )
+    );
+}
+
+/**
+ * Generate a book using a generator.
+ *
+ * The overall process is:
+ *     1. List and load plugins for this book
+ *     2. Call hook "config"
+ *     3. Call hook "init"
+ *     4. Initialize generator
+ *     5. List all assets and pages
+ *     6. Copy all assets to output
+ *     7. Generate all pages
+ *     8. Call hook "finish:before"
+ *     9. Finish generation
+ *     10. Call hook "finish"
+ *
+ *
+ * @param {Generator} generator
+ * @param {Book} book
+ * @param {Object} options
+ * @return {Promise<Output>}
+ */
+function generateBook(generator, book, options) {
+    options = generator.Options(options);
+    const state = generator.State ? generator.State({}) : Immutable.Map();
+    const start = Date.now();
+
+    return Promise(
+        new Output({
+            book,
+            options,
+            state,
+            generator: generator.name
+        })
+    )
+
+    // Cleanup output folder
+    .then(function(output) {
+        const logger = output.getLogger();
+        const rootFolder = output.getRoot();
+
+        logger.debug.ln('cleanup folder "' + rootFolder + '"');
+        return fs.ensureFolder(rootFolder)
+            .thenResolve(output);
+    })
+
+    .then(processOutput.bind(null, generator))
+
+    // Log duration and end message
+    .then(function(output) {
+        const logger = output.getLogger();
+        const end = Date.now();
+        const duration = (end - start) / 1000;
+
+        logger.info.ok('generation finished with success in ' + duration.toFixed(1) + 's !');
+
+        return output;
+    });
+}
+
+module.exports = generateBook;
diff --git a/packages/gitbook/src/output/generatePage.js b/packages/gitbook/src/output/generatePage.js
new file mode 100644
index 0000000..0fc99a3
--- /dev/null
+++ b/packages/gitbook/src/output/generatePage.js
@@ -0,0 +1,79 @@
+const path = require('path');
+
+const Promise = require('../utils/promise');
+const error = require('../utils/error');
+const timing = require('../utils/timing');
+
+const Templating = require('../templating');
+const JSONUtils = require('../json');
+const createTemplateEngine = require('./createTemplateEngine');
+const callPageHook = require('./callPageHook');
+
+/**
+ * Prepare and generate HTML for a page
+ *
+ * @param {Output} output
+ * @param {Page} page
+ * @return {Promise<Page>}
+ */
+function generatePage(output, page) {
+    const book = output.getBook();
+    const engine = createTemplateEngine(output);
+
+    return timing.measure(
+        'page.generate',
+        Promise(page)
+        .then(function(resultPage) {
+            const file = resultPage.getFile();
+            const filePath = file.getPath();
+            const parser = file.getParser();
+            const context = JSONUtils.encodeOutputWithPage(output, resultPage);
+
+            if (!parser) {
+                return Promise.reject(error.FileNotParsableError({
+                    filename: filePath
+                }));
+            }
+
+            // Call hook "page:before"
+            return callPageHook('page:before', output, resultPage)
+
+            // Escape code blocks with raw tags
+            .then(function(currentPage) {
+                return parser.preparePage(currentPage.getContent());
+            })
+
+            // Render templating syntax
+            .then(function(content) {
+                const absoluteFilePath = path.join(book.getContentRoot(), filePath);
+                return Templating.render(engine, absoluteFilePath, content, context);
+            })
+
+            .then(function(output) {
+                const content = output.getContent();
+
+                return parser.parsePage(content)
+                .then(function(result) {
+                    return output.setContent(result.content);
+                });
+            })
+
+            // Post processing for templating syntax
+            .then(function(output) {
+                return Templating.postRender(engine, output);
+            })
+
+            // Return new page
+            .then(function(content) {
+                return resultPage.set('content', content);
+            })
+
+            // Call final hook
+            .then(function(currentPage) {
+                return callPageHook('page', output, currentPage);
+            });
+        })
+    );
+}
+
+module.exports = generatePage;
diff --git a/packages/gitbook/src/output/generatePages.js b/packages/gitbook/src/output/generatePages.js
new file mode 100644
index 0000000..21b6610
--- /dev/null
+++ b/packages/gitbook/src/output/generatePages.js
@@ -0,0 +1,36 @@
+const Promise = require('../utils/promise');
+const generatePage = require('./generatePage');
+
+/**
+    Output all pages using a generator
+
+    @param {Generator} generator
+    @param {Output} output
+    @return {Promise<Output>}
+*/
+function generatePages(generator, output) {
+    const pages = output.getPages();
+    const logger = output.getLogger();
+
+    // Is generator ignoring assets?
+    if (!generator.onPage) {
+        return Promise(output);
+    }
+
+    return Promise.reduce(pages, function(out, page) {
+        const file = page.getFile();
+
+        logger.debug.ln('generate page "' + file.getPath() + '"');
+
+        return generatePage(out, page)
+        .then(function(resultPage) {
+            return generator.onPage(out, resultPage);
+        })
+        .fail(function(err) {
+            logger.error.ln('error while generating page "' + file.getPath() + '":');
+            throw err;
+        });
+    }, output);
+}
+
+module.exports = generatePages;
diff --git a/packages/gitbook/src/output/getModifiers.js b/packages/gitbook/src/output/getModifiers.js
new file mode 100644
index 0000000..df32fcb
--- /dev/null
+++ b/packages/gitbook/src/output/getModifiers.js
@@ -0,0 +1,73 @@
+const Modifiers = require('./modifiers');
+const resolveFileToURL = require('./helper/resolveFileToURL');
+const Api = require('../api');
+const Plugins = require('../plugins');
+const Promise = require('../utils/promise');
+const defaultBlocks = require('../constants/defaultBlocks');
+const fileToOutput = require('./helper/fileToOutput');
+
+const CODEBLOCK = 'code';
+
+/**
+ * Return default modifier to prepare a page for
+ * rendering.
+ *
+ * @return {Array<Modifier>}
+ */
+function getModifiers(output, page) {
+    const book = output.getBook();
+    const plugins = output.getPlugins();
+    const glossary = book.getGlossary();
+    const file = page.getFile();
+
+    // Glossary entries
+    const entries = glossary.getEntries();
+    const glossaryFile = glossary.getFile();
+    const glossaryFilename = fileToOutput(output, glossaryFile.getPath());
+
+    // Current file path
+    const currentFilePath = file.getPath();
+
+    // Get TemplateBlock for highlighting
+    const blocks = Plugins.listBlocks(plugins);
+    const code = blocks.get(CODEBLOCK) || defaultBlocks.get(CODEBLOCK);
+
+    // Current context
+    const context = Api.encodeGlobal(output);
+
+    return [
+        // Normalize IDs on headings
+        Modifiers.addHeadingId,
+
+        // Annotate text with glossary entries
+        Modifiers.annotateText.bind(null, entries, glossaryFilename),
+
+        // Resolve images
+        Modifiers.resolveImages.bind(null, currentFilePath),
+
+        // Resolve links (.md -> .html)
+        Modifiers.resolveLinks.bind(null,
+            currentFilePath,
+            resolveFileToURL.bind(null, output)
+        ),
+
+        // Highlight code blocks using "code" block
+        Modifiers.highlightCode.bind(null, function(lang, source) {
+            return Promise(code.applyBlock({
+                body: source,
+                kwargs: {
+                    language: lang
+                }
+            }, context))
+            .then(function(result) {
+                if (result.html === false) {
+                    return { text: result.body };
+                } else {
+                    return { html: result.body };
+                }
+            });
+        })
+    ];
+}
+
+module.exports = getModifiers;
diff --git a/packages/gitbook/src/output/helper/fileToOutput.js b/packages/gitbook/src/output/helper/fileToOutput.js
new file mode 100644
index 0000000..a514854
--- /dev/null
+++ b/packages/gitbook/src/output/helper/fileToOutput.js
@@ -0,0 +1,32 @@
+const path = require('path');
+
+const PathUtils = require('../../utils/path');
+const LocationUtils = require('../../utils/location');
+
+const OUTPUT_EXTENSION = '.html';
+
+/**
+ * Convert a filePath (absolute) to a filename for output
+ *
+ * @param {Output} output
+ * @param {String} filePath
+ * @return {String}
+ */
+function fileToOutput(output, filePath) {
+    const book = output.getBook();
+    const readme = book.getReadme();
+    const fileReadme = readme.getFile();
+
+    if (
+        path.basename(filePath, path.extname(filePath)) == 'README' ||
+        (fileReadme.exists() && filePath == fileReadme.getPath())
+    ) {
+        filePath = path.join(path.dirname(filePath), 'index' + OUTPUT_EXTENSION);
+    } else {
+        filePath = PathUtils.setExtension(filePath, OUTPUT_EXTENSION);
+    }
+
+    return LocationUtils.normalize(filePath);
+}
+
+module.exports = fileToOutput;
diff --git a/packages/gitbook/src/output/helper/fileToURL.js b/packages/gitbook/src/output/helper/fileToURL.js
new file mode 100644
index 0000000..a42bca6
--- /dev/null
+++ b/packages/gitbook/src/output/helper/fileToURL.js
@@ -0,0 +1,31 @@
+const path = require('path');
+const LocationUtils = require('../../utils/location');
+
+const fileToOutput = require('./fileToOutput');
+
+/**
+    Convert a filePath (absolute) to an url (without hostname).
+    It returns an absolute path.
+
+    "README.md" -> "/"
+    "test/hello.md" -> "test/hello.html"
+    "test/README.md" -> "test/"
+
+    @param {Output} output
+    @param {String} filePath
+    @return {String}
+*/
+function fileToURL(output, filePath) {
+    const options = output.getOptions();
+    const directoryIndex = options.get('directoryIndex');
+
+    filePath = fileToOutput(output, filePath);
+
+    if (directoryIndex && path.basename(filePath) == 'index.html') {
+        filePath = path.dirname(filePath) + '/';
+    }
+
+    return LocationUtils.normalize(filePath);
+}
+
+module.exports = fileToURL;
diff --git a/packages/gitbook/src/output/helper/index.js b/packages/gitbook/src/output/helper/index.js
new file mode 100644
index 0000000..f8bc109
--- /dev/null
+++ b/packages/gitbook/src/output/helper/index.js
@@ -0,0 +1,2 @@
+
+module.exports = {};
diff --git a/packages/gitbook/src/output/helper/resolveFileToURL.js b/packages/gitbook/src/output/helper/resolveFileToURL.js
new file mode 100644
index 0000000..907cfdd
--- /dev/null
+++ b/packages/gitbook/src/output/helper/resolveFileToURL.js
@@ -0,0 +1,26 @@
+const LocationUtils = require('../../utils/location');
+
+const fileToURL = require('./fileToURL');
+
+/**
+ * Resolve an absolute path (extracted from a link)
+ *
+ * @param {Output} output
+ * @param {String} filePath
+ * @return {String}
+ */
+function resolveFileToURL(output, filePath) {
+    // Convert /test.png -> test.png
+    filePath = LocationUtils.toAbsolute(filePath, '', '');
+
+    const page = output.getPage(filePath);
+
+    // if file is a page, return correct .html url
+    if (page) {
+        filePath = fileToURL(output, filePath);
+    }
+
+    return LocationUtils.normalize(filePath);
+}
+
+module.exports = resolveFileToURL;
diff --git a/packages/gitbook/src/output/helper/writeFile.js b/packages/gitbook/src/output/helper/writeFile.js
new file mode 100644
index 0000000..01a8e68
--- /dev/null
+++ b/packages/gitbook/src/output/helper/writeFile.js
@@ -0,0 +1,23 @@
+const path = require('path');
+const fs = require('../../utils/fs');
+
+/**
+    Write a file to the output folder
+
+    @param {Output} output
+    @param {String} filePath
+    @param {Buffer|String} content
+    @return {Promise}
+*/
+function writeFile(output, filePath, content) {
+    const rootFolder = output.getRoot();
+    filePath = path.join(rootFolder, filePath);
+
+    return fs.ensureFile(filePath)
+    .then(function() {
+        return fs.writeFile(filePath, content);
+    })
+    .thenResolve(output);
+}
+
+module.exports = writeFile;
diff --git a/packages/gitbook/src/output/index.js b/packages/gitbook/src/output/index.js
new file mode 100644
index 0000000..574b3df
--- /dev/null
+++ b/packages/gitbook/src/output/index.js
@@ -0,0 +1,24 @@
+const Immutable = require('immutable');
+
+const generators = Immutable.List([
+    require('./json'),
+    require('./website'),
+    require('./ebook')
+]);
+
+/**
+    Return a specific generator by its name
+
+    @param {String}
+    @return {Generator}
+*/
+function getGenerator(name) {
+    return generators.find(function(generator) {
+        return generator.name == name;
+    });
+}
+
+module.exports = {
+    generate:           require('./generateBook'),
+    getGenerator
+};
diff --git a/packages/gitbook/src/output/json/index.js b/packages/gitbook/src/output/json/index.js
new file mode 100644
index 0000000..361da06
--- /dev/null
+++ b/packages/gitbook/src/output/json/index.js
@@ -0,0 +1,7 @@
+
+module.exports = {
+    name:       'json',
+    Options:    require('./options'),
+    onPage:     require('./onPage'),
+    onFinish:   require('./onFinish')
+};
diff --git a/packages/gitbook/src/output/json/onFinish.js b/packages/gitbook/src/output/json/onFinish.js
new file mode 100644
index 0000000..b05057a
--- /dev/null
+++ b/packages/gitbook/src/output/json/onFinish.js
@@ -0,0 +1,47 @@
+const path = require('path');
+
+const Promise = require('../../utils/promise');
+const fs = require('../../utils/fs');
+const JSONUtils = require('../../json');
+
+/**
+    Finish the generation
+
+    @param {Output}
+    @return {Output}
+*/
+function onFinish(output) {
+    const book = output.getBook();
+    const outputRoot = output.getRoot();
+
+    if (!book.isMultilingual()) {
+        return Promise(output);
+    }
+
+    // Get main language
+    const languages = book.getLanguages();
+    const mainLanguage = languages.getDefaultLanguage();
+
+    // Read the main JSON
+    return fs.readFile(path.resolve(outputRoot, mainLanguage.getID(), 'README.json'), 'utf8')
+
+    // Extend the JSON
+    .then(function(content) {
+        const json = JSON.parse(content);
+
+        json.languages = JSONUtils.encodeLanguages(languages);
+
+        return json;
+    })
+
+    .then(function(json) {
+        return fs.writeFile(
+            path.resolve(outputRoot, 'README.json'),
+            JSON.stringify(json, null, 4)
+        );
+    })
+
+    .thenResolve(output);
+}
+
+module.exports = onFinish;
diff --git a/packages/gitbook/src/output/json/onPage.js b/packages/gitbook/src/output/json/onPage.js
new file mode 100644
index 0000000..8bee711
--- /dev/null
+++ b/packages/gitbook/src/output/json/onPage.js
@@ -0,0 +1,43 @@
+const JSONUtils = require('../../json');
+const PathUtils = require('../../utils/path');
+const Modifiers = require('../modifiers');
+const writeFile = require('../helper/writeFile');
+const getModifiers = require('../getModifiers');
+
+const JSON_VERSION = '3';
+
+/**
+ * Write a page as a json file
+ *
+ * @param {Output} output
+ * @param {Page} page
+ */
+function onPage(output, page) {
+    const file = page.getFile();
+    const readme = output.getBook().getReadme().getFile();
+
+    return Modifiers.modifyHTML(page, getModifiers(output, page))
+    .then(function(resultPage) {
+        // Generate the JSON
+        const json = JSONUtils.encodeBookWithPage(output.getBook(), resultPage);
+
+        // Delete some private properties
+        delete json.config;
+
+        // Specify JSON output version
+        json.version = JSON_VERSION;
+
+        // File path in the output folder
+        let filePath = file.getPath() == readme.getPath() ? 'README.json' : file.getPath();
+        filePath = PathUtils.setExtension(filePath, '.json');
+
+        // Write it to the disk
+        return writeFile(
+            output,
+            filePath,
+            JSON.stringify(json, null, 4)
+        );
+    });
+}
+
+module.exports = onPage;
diff --git a/packages/gitbook/src/output/json/options.js b/packages/gitbook/src/output/json/options.js
new file mode 100644
index 0000000..2a9de0e
--- /dev/null
+++ b/packages/gitbook/src/output/json/options.js
@@ -0,0 +1,8 @@
+const Immutable = require('immutable');
+
+const Options = Immutable.Record({
+    // Root folder for the output
+    root:       String()
+});
+
+module.exports = Options;
diff --git a/packages/gitbook/src/output/modifiers/__tests__/addHeadingId.js b/packages/gitbook/src/output/modifiers/__tests__/addHeadingId.js
new file mode 100644
index 0000000..4d77e75
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/addHeadingId.js
@@ -0,0 +1,25 @@
+const cheerio = require('cheerio');
+const addHeadingId = require('../addHeadingId');
+
+describe('addHeadingId', function() {
+    it('should add an ID if none', function() {
+        const $ = cheerio.load('<h1>Hello World</h1><h2>Cool !!</h2>');
+
+        return addHeadingId($)
+        .then(function() {
+            const html = $.html();
+            expect(html).toBe('<h1 id="hello-world">Hello World</h1><h2 id="cool-">Cool !!</h2>');
+        });
+    });
+
+    it('should not change existing IDs', function() {
+        const $ = cheerio.load('<h1 id="awesome">Hello World</h1>');
+
+        return addHeadingId($)
+        .then(function() {
+            const html = $.html();
+            expect(html).toBe('<h1 id="awesome">Hello World</h1>');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/annotateText.js b/packages/gitbook/src/output/modifiers/__tests__/annotateText.js
new file mode 100644
index 0000000..28a5cc5
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/annotateText.js
@@ -0,0 +1,45 @@
+const Immutable = require('immutable');
+const cheerio = require('cheerio');
+const GlossaryEntry = require('../../../models/glossaryEntry');
+const annotateText = require('../annotateText');
+
+describe('annotateText', function() {
+    const entries = Immutable.List([
+        GlossaryEntry({ name: 'Word' }),
+        GlossaryEntry({ name: 'Multiple Words' })
+    ]);
+
+    it('should annotate text', function() {
+        const $ = cheerio.load('<p>This is a word, and multiple words</p>');
+
+        annotateText(entries, 'GLOSSARY.md', $);
+
+        const links = $('a');
+        expect(links.length).toBe(2);
+
+        const word = $(links.get(0));
+        expect(word.attr('href')).toBe('/GLOSSARY.md#word');
+        expect(word.text()).toBe('word');
+        expect(word.hasClass('glossary-term')).toBeTruthy();
+
+        const words = $(links.get(1));
+        expect(words.attr('href')).toBe('/GLOSSARY.md#multiple-words');
+        expect(words.text()).toBe('multiple words');
+        expect(words.hasClass('glossary-term')).toBeTruthy();
+    });
+
+    it('should not annotate scripts', function() {
+        const $ = cheerio.load('<script>This is a word, and multiple words</script>');
+
+        annotateText(entries, 'GLOSSARY.md', $);
+        expect($('a').length).toBe(0);
+    });
+
+    it('should not annotate when has class "no-glossary"', function() {
+        const $ = cheerio.load('<p class="no-glossary">This is a word, and multiple words</p>');
+
+        annotateText(entries, 'GLOSSARY.md', $);
+        expect($('a').length).toBe(0);
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/fetchRemoteImages.js b/packages/gitbook/src/output/modifiers/__tests__/fetchRemoteImages.js
new file mode 100644
index 0000000..9145cae
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/fetchRemoteImages.js
@@ -0,0 +1,39 @@
+const cheerio = require('cheerio');
+const tmp = require('tmp');
+const path = require('path');
+
+const URL = 'https://upload.wikimedia.org/wikipedia/commons/thumb/4/47/PNG_transparency_demonstration_1.png/280px-PNG_transparency_demonstration_1.png';
+
+describe('fetchRemoteImages', function() {
+    let dir;
+    const fetchRemoteImages = require('../fetchRemoteImages');
+
+    beforeEach(function() {
+        dir = tmp.dirSync();
+    });
+
+    it('should download image file', function() {
+        const $ = cheerio.load('<img src="' + URL + '" />');
+
+        return fetchRemoteImages(dir.name, 'index.html', $)
+        .then(function() {
+            const $img = $('img');
+            const src = $img.attr('src');
+
+            expect(dir.name).toHaveFile(src);
+        });
+    });
+
+    it('should download image file and replace with relative path', function() {
+        const $ = cheerio.load('<img src="' + URL + '" />');
+
+        return fetchRemoteImages(dir.name, 'test/index.html', $)
+        .then(function() {
+            const $img = $('img');
+            const src = $img.attr('src');
+
+            expect(dir.name).toHaveFile(path.join('test', src));
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/highlightCode.js b/packages/gitbook/src/output/modifiers/__tests__/highlightCode.js
new file mode 100644
index 0000000..d93417b
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/highlightCode.js
@@ -0,0 +1,59 @@
+const cheerio = require('cheerio');
+const Promise = require('../../../utils/promise');
+const highlightCode = require('../highlightCode');
+
+describe('highlightCode', function() {
+    function doHighlight(lang, code) {
+        return {
+            text: '' + (lang || '') + '$' + code
+        };
+    }
+
+    function doHighlightAsync(lang, code) {
+        return Promise()
+        .then(function() {
+            return doHighlight(lang, code);
+        });
+    }
+
+    it('should call it for normal code element', function() {
+        const $ = cheerio.load('<p>This is a <code>test</code></p>');
+
+        return highlightCode(doHighlight, $)
+        .then(function() {
+            const $code = $('code');
+            expect($code.text()).toBe('$test');
+        });
+    });
+
+    it('should call it for markdown code block', function() {
+        const $ = cheerio.load('<pre><code class="lang-js">test</code></pre>');
+
+        return highlightCode(doHighlight, $)
+        .then(function() {
+            const $code = $('code');
+            expect($code.text()).toBe('js$test');
+        });
+    });
+
+    it('should call it for asciidoc code block', function() {
+        const $ = cheerio.load('<pre><code class="language-python">test</code></pre>');
+
+        return highlightCode(doHighlight, $)
+        .then(function() {
+            const $code = $('code');
+            expect($code.text()).toBe('python$test');
+        });
+    });
+
+    it('should accept async highlighter', function() {
+        const $ = cheerio.load('<pre><code class="language-python">test</code></pre>');
+
+        return highlightCode(doHighlightAsync, $)
+        .then(function() {
+            const $code = $('code');
+            expect($code.text()).toBe('python$test');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/inlinePng.js b/packages/gitbook/src/output/modifiers/__tests__/inlinePng.js
new file mode 100644
index 0000000..fd031b0
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/inlinePng.js
@@ -0,0 +1,24 @@
+const cheerio = require('cheerio');
+const tmp = require('tmp');
+const inlinePng = require('../inlinePng');
+
+describe('inlinePng', function() {
+    let dir;
+
+    beforeEach(function() {
+        dir = tmp.dirSync();
+    });
+
+    it('should write an inline PNG using data URI as a file', function() {
+        const $ = cheerio.load('<img alt="GitBook Logo 20x20" src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABQAAAAUEAYAAADdGcFOAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAACXBIWXMAAAsTAAALEwEAmpwYAAABWWlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iWE1QIENvcmUgNS40LjAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp0aWZmPSJodHRwOi8vbnMuYWRvYmUuY29tL3RpZmYvMS4wLyI+CiAgICAgICAgIDx0aWZmOk9yaWVudGF0aW9uPjE8L3RpZmY6T3JpZW50YXRpb24+CiAgICAgIDwvcmRmOkRlc2NyaXB0aW9uPgogICA8L3JkZjpSREY+CjwveDp4bXBtZXRhPgpMwidZAAAF+klEQVRIDY3Wf5CVVR3H8c9z791fyI9dQwdQ4TTI7wEWnQZZAa/mJE4Z0OaKUuN1KoaykZxUGGHay+iIVFMoEYrUPhDCKEKW2ChT8dA0RCSxWi6EW3sYYpcfxq5C+4O9957O+7m7O/qHQ9/XzH1+nHuec57z8wkWTsKw0y6N/LxXN6KzTnEUHi8eP/l3YStSU/MdsYvBbGh8six2YXcbcgc++QkfTQkWz/81KtqDA0hlUoWnsX+5uxe5X365BB9my2bjrHNHccLk16BpS9CExjcmXMDbD6wehdyEjxbjz1uK1zn9qga6dcfnMLXeXY/qjuQqTF4W1MKke8ZgeNhjMCxMPIWSd4OF78C55CFI/1kF6WwXpMqjkAZ/CKniNDrCsmU4lE1YbPlgR2x7R39FF23D4mq3A1+Z35PGTNs1E1XhxcGQOh6HNPwXkK56BVJhOaRg/pvoHXNxHFw410B25EYE2RMvI0i/twFJvXcrFObykEa+DmnQGLwYqR0l2a6JqItaj8C/4E2QxtZCofkC8tF1t8HZc/fAZaLnIF2xEsoEtW1w7vBSSFtfhDTnCki9cSi81Ain1uko2Ld+Dmf2rkUq0/5t+PYbFtPQdkjzNiAXTWtDEF49FgkzJInAVPwNyhzcDOmrdZCm/Rn+ebWtcPs+/U24hmg2XL0rRkPPELh9R8fDtXR2oC/VuZbGaci79Ajkb6lZgfyYtyzy/X9s6T/pO/ZfN/RdNxxIwTWM2wbX8KVmuIaEqmKm6zEondwGpd0SyOy5DrJ//TFkX9kMhd3XQHbEVCSsm4OECV5HIv2p15CwfWPSntoHRbv2Q1HzSvSlSqZwATIuBxk/zZBOBbdB+u9hSKU3Q7pwAjInZkFm6U8hu7MSMqe/Dqn8fUj5GVCmpxK+4N/F1LMa0p5eSOPqIPP7NGSunAI/+R6GnzQzIBt8A1LC/QZ+6HwLst1rITv0n5CtXgSZ78yFTNkR+FdeDZneJkip3fAtsQ5Scilkek7CH9dAmjIWvkK7IXXOh6/IzZDNPQdZXR1TQmdjKv0ZfEu0YKDpNflpyG5aDtnRv8VAuu3dBV+huyBbvgdS97tQNLQc0mfugKy5Cb4BipPIXvsUpK5N8Mvao/Bd3QDZRH9Rrtj3Cl6FHwPFMLmNkKrj8BnHoT+XX6f2wl+XxFS4Ab7C72Dgf7bi+5DpTkNm8kQMpCs/BzIlz8LfPxnzLdh3EjwMX4GX4Ju4GNb9A1L7k/D3J8b6kv2LFCtmCmcgUzoJsr2z4MfwFsh87xikZefg188fYaAhpPUxm3ge/vFnYkoED0HqeQiyJYcwkNGWnoNv6s9C1p1Bf/389VYoCjohW7UfMms3wXdpBv7+FEiPLIHs4DIMNERUNhbSpY3wk6QOsqlCDVx2xCrInMpBmfNPQOnzKxBkkrugdOl9GKigSZZCUWIm/GqwDtLUI5D+WAOlb9wKP0YvQLbjZSjsaYaL/n0/FA3fDtnCGihK5UYjCK+ZDr+TDIKLdm2Fs1UOzo76F5wO74XSZj0S6d7RCMLkCshcXALZxaWQRjXDZQ62oRAdCeG/Ju5HELX2QFH3C0hkRy6GovyfwF58AoVbguOxyB2H7/I34Gf11yANnQSp7Vr4MbQH0vg7kbNNp5AM3UrIVDchnz56B1Jm573wW9gZSFVPwO/hefg5FsIvN09CchtQCIOFw/F5U8ii3CZn4cqo7C8YlXEPYkx9cacZl00+iwnprrtwVdj1Q/gXmAs/pu6LZc9XQOGgSvh19n2cDZN341g2EcfxTEGwH/RewqlMsUfbbWIGLjUG+j/j9nokD1beiOvLS5dhjr30Gu6ZnivgdtM/6VJvY1+6pBHbH+h9CX84vfMxNJtisYVFlys+WNCIZJNmIsjohlhNSQC3f8R55H+y/hjkN8GPR9ndCLJxT4/3n0Px51ay8XQnNrYfDJHf//Fc0oMrEZSeeQGJ7+Z+gKCgLbHNWgXnB9FlYt5JaN38JIINC95EakjtAqQeuUx21c5B6tEFf0fSfbEFQf28Z6D6y+X/H0jf40QQJhYwAAAAAElFTkSuQmCC"/>');
+
+        return inlinePng(dir.name, 'index.html', $)
+        .then(function() {
+            const $img = $('img');
+            const src = $img.attr('src');
+
+            expect(dir.name).toHaveFile(src);
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/resolveLinks.js b/packages/gitbook/src/output/modifiers/__tests__/resolveLinks.js
new file mode 100644
index 0000000..167af5d
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/resolveLinks.js
@@ -0,0 +1,104 @@
+const path = require('path');
+const cheerio = require('cheerio');
+const resolveLinks = require('../resolveLinks');
+
+describe('resolveLinks', function() {
+    function resolveFileBasic(href) {
+        return 'fakeDir/' + href;
+    }
+
+    function resolveFileCustom(href) {
+        if (path.extname(href) == '.md') {
+            return href.slice(0, -3) + '.html';
+        }
+
+        return href;
+    }
+
+    describe('Absolute path', function() {
+        const TEST = '<p>This is a <a href="/test/cool.md"></a></p>';
+
+        it('should resolve path starting by "/" in root directory', function() {
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('hello.md', resolveFileBasic, $)
+            .then(function() {
+                const link = $('a');
+                expect(link.attr('href')).toBe('fakeDir/test/cool.md');
+            });
+        });
+
+        it('should resolve path starting by "/" in child directory', function() {
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('afolder/hello.md', resolveFileBasic, $)
+            .then(function() {
+                const link = $('a');
+                expect(link.attr('href')).toBe('../fakeDir/test/cool.md');
+            });
+        });
+    });
+
+    describe('Anchor', function() {
+        it('should prevent anchors in resolution', function() {
+            const TEST = '<p>This is a <a href="test/cool.md#an-anchor"></a></p>';
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('hello.md', resolveFileCustom, $)
+            .then(function() {
+                const link = $('a');
+                expect(link.attr('href')).toBe('test/cool.html#an-anchor');
+            });
+        });
+
+        it('should ignore pure anchor links', function() {
+            const TEST = '<p>This is a <a href="#an-anchor"></a></p>';
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('hello.md', resolveFileCustom, $)
+            .then(function() {
+                const link = $('a');
+                expect(link.attr('href')).toBe('#an-anchor');
+            });
+        });
+    });
+
+    describe('Custom Resolver', function() {
+        const TEST = '<p>This is a <a href="/test/cool.md"></a> <a href="afile.png"></a></p>';
+
+        it('should resolve path correctly for absolute path', function() {
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('hello.md', resolveFileCustom, $)
+            .then(function() {
+                const link = $('a').first();
+                expect(link.attr('href')).toBe('test/cool.html');
+            });
+        });
+
+        it('should resolve path correctly for absolute path (2)', function() {
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('afodler/hello.md', resolveFileCustom, $)
+            .then(function() {
+                const link = $('a').first();
+                expect(link.attr('href')).toBe('../test/cool.html');
+            });
+        });
+    });
+
+    describe('External link', function() {
+        const TEST = '<p>This is a <a href="http://www.github.com">external link</a></p>';
+
+        it('should have target="_blank" attribute', function() {
+            const $ = cheerio.load(TEST);
+
+            return resolveLinks('hello.md', resolveFileBasic, $)
+            .then(function() {
+                const link = $('a');
+                expect(link.attr('target')).toBe('_blank');
+            });
+        });
+    });
+
+});
diff --git a/packages/gitbook/src/output/modifiers/__tests__/svgToImg.js b/packages/gitbook/src/output/modifiers/__tests__/svgToImg.js
new file mode 100644
index 0000000..4bdab59
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/svgToImg.js
@@ -0,0 +1,24 @@
+const cheerio = require('cheerio');
+const tmp = require('tmp');
+
+describe('svgToImg', function() {
+    let dir;
+    const svgToImg = require('../svgToImg');
+
+    beforeEach(function() {
+        dir = tmp.dirSync();
+    });
+
+    it('should write svg as a file', function() {
+        const $ = cheerio.load('<svg xmlns="http://www.w3.org/2000/svg" width="200" height="100" version="1.1"><rect width="200" height="100" stroke="black" stroke-width="6" fill="green"/></svg>');
+
+        return svgToImg(dir.name, 'index.html', $)
+        .then(function() {
+            const $img = $('img');
+            const src = $img.attr('src');
+
+            expect(dir.name).toHaveFile(src);
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/__tests__/svgToPng.js b/packages/gitbook/src/output/modifiers/__tests__/svgToPng.js
new file mode 100644
index 0000000..0a12938
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/__tests__/svgToPng.js
@@ -0,0 +1,32 @@
+const cheerio = require('cheerio');
+const tmp = require('tmp');
+const path = require('path');
+
+const svgToImg = require('../svgToImg');
+const svgToPng = require('../svgToPng');
+
+describe('svgToPng', function() {
+    let dir;
+
+    beforeEach(function() {
+        dir = tmp.dirSync();
+    });
+
+    it('should write svg as png file', function() {
+        const $ = cheerio.load('<svg xmlns="http://www.w3.org/2000/svg" width="200" height="100" version="1.1"><rect width="200" height="100" stroke="black" stroke-width="6" fill="green"/></svg>');
+        const fileName = 'index.html';
+
+        return svgToImg(dir.name, fileName, $)
+        .then(function() {
+            return svgToPng(dir.name, fileName, $);
+        })
+        .then(function() {
+            const $img = $('img');
+            const src = $img.attr('src');
+
+            expect(dir.name).toHaveFile(src);
+            expect(path.extname(src)).toBe('.png');
+        });
+    });
+});
+
diff --git a/packages/gitbook/src/output/modifiers/addHeadingId.js b/packages/gitbook/src/output/modifiers/addHeadingId.js
new file mode 100644
index 0000000..e5bab3e
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/addHeadingId.js
@@ -0,0 +1,23 @@
+const slug = require('github-slugid');
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Add ID to an heading
+
+    @param {HTMLElement} heading
+*/
+function addId(heading) {
+    if (heading.attr('id')) return;
+    heading.attr('id', slug(heading.text()));
+}
+
+/**
+    Add ID to all headings
+
+    @param {HTMLDom} $
+*/
+function addHeadingId($) {
+    return editHTMLElement($, 'h1,h2,h3,h4,h5,h6', addId);
+}
+
+module.exports = addHeadingId;
diff --git a/packages/gitbook/src/output/modifiers/annotateText.js b/packages/gitbook/src/output/modifiers/annotateText.js
new file mode 100644
index 0000000..36ee4e9
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/annotateText.js
@@ -0,0 +1,91 @@
+const escape = require('escape-html');
+
+// Selector to ignore
+const ANNOTATION_IGNORE = '.no-glossary,code,pre,a,script,h1,h2,h3,h4,h5,h6';
+
+function pregQuote(str) {
+    return (str + '').replace(/([\\\.\+\*\?\[\^\]\$\(\)\{\}\=\!\<\>\|\:])/g, '\\$1');
+}
+
+function replaceText($, el, search, replace, text_only) {
+    return $(el).each(function() {
+        let node = this.firstChild, val, new_val;
+        // Elements to be removed at the end.
+        const remove = [];
+
+        // Only continue if firstChild exists.
+        if (node) {
+
+            // Loop over all childNodes.
+            while (node) {
+
+                // Only process text nodes.
+                if (node.nodeType === 3) {
+
+                    // The original node value.
+                    val = node.nodeValue;
+
+                    // The new value.
+                    new_val = val.replace(search, replace);
+
+                    // Only replace text if the new value is actually different!
+                    if (new_val !== val) {
+
+                        if (!text_only && /</.test(new_val)) {
+                            // The new value contains HTML, set it in a slower but far more
+                            // robust way.
+                            $(node).before(new_val);
+
+                            // Don't remove the node yet, or the loop will lose its place.
+                            remove.push(node);
+                        } else {
+                            // The new value contains no HTML, so it can be set in this
+                            // very fast, simple way.
+                            node.nodeValue = new_val;
+                        }
+                    }
+                }
+
+                node = node.nextSibling;
+            }
+        }
+
+        // Time to remove those elements!
+        if (remove.length) $(remove).remove();
+    });
+}
+
+/**
+ * Annotate text using a list of GlossaryEntry
+ *
+ * @param {List<GlossaryEntry>}
+ * @param {String} glossaryFilePath
+ * @param {HTMLDom} $
+ */
+function annotateText(entries, glossaryFilePath, $) {
+    entries.forEach(function(entry) {
+        const entryId     = entry.getID();
+        const name        = entry.getName();
+        const description = entry.getDescription();
+        const searchRegex = new RegExp('\\b(' + pregQuote(name.toLowerCase()) + ')\\b' , 'gi');
+
+        $('*').each(function() {
+            const $this = $(this);
+
+            if (
+                $this.is(ANNOTATION_IGNORE) ||
+                $this.parents(ANNOTATION_IGNORE).length > 0
+            ) return;
+
+            replaceText($, this, searchRegex, function(match) {
+                return '<a href="/' + glossaryFilePath + '#' + entryId + '" '
+                    + 'class="glossary-term" title="' + escape(description) + '">'
+                    + match
+                    + '</a>';
+            });
+        });
+
+    });
+}
+
+module.exports = annotateText;
diff --git a/packages/gitbook/src/output/modifiers/editHTMLElement.js b/packages/gitbook/src/output/modifiers/editHTMLElement.js
new file mode 100644
index 0000000..d0d2b19
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/editHTMLElement.js
@@ -0,0 +1,15 @@
+const Promise = require('../../utils/promise');
+
+/**
+    Edit all elements matching a selector
+*/
+function editHTMLElement($, selector, fn) {
+    const $elements = $(selector);
+
+    return Promise.forEach($elements, function(el) {
+        const $el = $(el);
+        return fn($el);
+    });
+}
+
+module.exports = editHTMLElement;
diff --git a/packages/gitbook/src/output/modifiers/fetchRemoteImages.js b/packages/gitbook/src/output/modifiers/fetchRemoteImages.js
new file mode 100644
index 0000000..1732247
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/fetchRemoteImages.js
@@ -0,0 +1,44 @@
+const path = require('path');
+const crc = require('crc');
+
+const editHTMLElement = require('./editHTMLElement');
+const fs = require('../../utils/fs');
+const LocationUtils = require('../../utils/location');
+
+/**
+    Fetch all remote images
+
+    @param {String} rootFolder
+    @param {String} currentFile
+    @param {HTMLDom} $
+    @return {Promise}
+*/
+function fetchRemoteImages(rootFolder, currentFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'img', function($img) {
+        let src = $img.attr('src');
+        const extension = path.extname(src);
+
+        if (!LocationUtils.isExternal(src)) {
+            return;
+        }
+
+        // We avoid generating twice the same PNG
+        const hash = crc.crc32(src).toString(16);
+        const fileName = hash + extension;
+        const filePath = path.join(rootFolder, fileName);
+
+        return fs.assertFile(filePath, function() {
+            return fs.download(src, filePath);
+        })
+        .then(function() {
+            // Convert to relative
+            src = LocationUtils.relative(currentDirectory, fileName);
+
+            $img.replaceWith('<img src="' + src + '" />');
+        });
+    });
+}
+
+module.exports = fetchRemoteImages;
diff --git a/packages/gitbook/src/output/modifiers/highlightCode.js b/packages/gitbook/src/output/modifiers/highlightCode.js
new file mode 100644
index 0000000..622432d
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/highlightCode.js
@@ -0,0 +1,58 @@
+const is = require('is');
+const Immutable = require('immutable');
+
+const Promise = require('../../utils/promise');
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Return language for a code blocks from a list of class names
+
+    @param {Array<String>}
+    @return {String}
+*/
+function getLanguageForClass(classNames) {
+    return Immutable.List(classNames)
+        .map(function(cl) {
+            // Markdown
+            if (cl.search('lang-') === 0) {
+                return cl.slice('lang-'.length);
+            }
+
+            // Asciidoc
+            if (cl.search('language-') === 0) {
+                return cl.slice('language-'.length);
+            }
+
+            return null;
+        })
+        .find(function(cl) {
+            return Boolean(cl);
+        });
+}
+
+
+/**
+    Highlight all code elements
+
+    @param {Function(lang, body) -> String} highlight
+    @param {HTMLDom} $
+    @return {Promise}
+*/
+function highlightCode(highlight, $) {
+    return editHTMLElement($, 'code', function($code) {
+        const classNames = ($code.attr('class') || '').split(' ');
+        const lang = getLanguageForClass(classNames);
+        const source = $code.text();
+
+        return Promise(highlight(lang, source))
+        .then(function(r) {
+            if (is.string(r.html)) {
+                $code.html(r.html);
+            } else {
+                $code.text(r.text);
+            }
+        });
+    });
+}
+
+module.exports = highlightCode;
diff --git a/packages/gitbook/src/output/modifiers/index.js b/packages/gitbook/src/output/modifiers/index.js
new file mode 100644
index 0000000..f1daa2b
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/index.js
@@ -0,0 +1,15 @@
+
+module.exports = {
+    modifyHTML:         require('./modifyHTML'),
+    inlineAssets:       require('./inlineAssets'),
+
+    // HTML transformations
+    addHeadingId:       require('./addHeadingId'),
+    svgToImg:           require('./svgToImg'),
+    fetchRemoteImages:  require('./fetchRemoteImages'),
+    svgToPng:           require('./svgToPng'),
+    resolveLinks:       require('./resolveLinks'),
+    resolveImages:      require('./resolveImages'),
+    annotateText:       require('./annotateText'),
+    highlightCode:      require('./highlightCode')
+};
diff --git a/packages/gitbook/src/output/modifiers/inlineAssets.js b/packages/gitbook/src/output/modifiers/inlineAssets.js
new file mode 100644
index 0000000..1ed4344
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/inlineAssets.js
@@ -0,0 +1,29 @@
+const svgToImg = require('./svgToImg');
+const svgToPng = require('./svgToPng');
+const inlinePng = require('./inlinePng');
+const resolveImages = require('./resolveImages');
+const fetchRemoteImages = require('./fetchRemoteImages');
+
+const Promise = require('../../utils/promise');
+
+/**
+    Inline all assets in a page
+
+    @param {String} rootFolder
+*/
+function inlineAssets(rootFolder, currentFile) {
+    return function($) {
+        return Promise()
+
+        // Resolving images and fetching external images should be
+        // done before svg conversion
+        .then(resolveImages.bind(null, currentFile, $))
+        .then(fetchRemoteImages.bind(null, rootFolder, currentFile, $))
+
+        .then(svgToImg.bind(null, rootFolder, currentFile, $))
+        .then(svgToPng.bind(null, rootFolder, currentFile, $))
+        .then(inlinePng.bind(null, rootFolder, currentFile, $));
+    };
+}
+
+module.exports = inlineAssets;
diff --git a/packages/gitbook/src/output/modifiers/inlinePng.js b/packages/gitbook/src/output/modifiers/inlinePng.js
new file mode 100644
index 0000000..218aaa2
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/inlinePng.js
@@ -0,0 +1,47 @@
+const crc = require('crc');
+const path = require('path');
+
+const imagesUtil = require('../../utils/images');
+const fs = require('../../utils/fs');
+const LocationUtils = require('../../utils/location');
+
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Convert all inline PNG images to PNG file
+
+    @param {String} rootFolder
+    @param {HTMLDom} $
+    @return {Promise}
+*/
+function inlinePng(rootFolder, currentFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'img', function($img) {
+        const src = $img.attr('src');
+        if (!LocationUtils.isDataURI(src)) {
+            return;
+        }
+
+        // We avoid generating twice the same PNG
+        const hash = crc.crc32(src).toString(16);
+        let fileName = hash + '.png';
+
+        // Result file path
+        const filePath = path.join(rootFolder, fileName);
+
+        return fs.assertFile(filePath, function() {
+            return imagesUtil.convertInlinePNG(src, filePath);
+        })
+        .then(function() {
+            // Convert filename to a relative filename
+            fileName = LocationUtils.relative(currentDirectory, fileName);
+
+            // Replace src
+            $img.attr('src', fileName);
+        });
+    });
+}
+
+
+module.exports = inlinePng;
diff --git a/packages/gitbook/src/output/modifiers/modifyHTML.js b/packages/gitbook/src/output/modifiers/modifyHTML.js
new file mode 100644
index 0000000..00177fc
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/modifyHTML.js
@@ -0,0 +1,25 @@
+const cheerio = require('cheerio');
+const Promise = require('../../utils/promise');
+
+/**
+    Apply a list of operations to a page and
+    output the new page.
+
+    @param {Page}
+    @param {List|Array<Transformation>}
+    @return {Promise<Page>}
+*/
+function modifyHTML(page, operations) {
+    const html = page.getContent();
+    const $ = cheerio.load(html);
+
+    return Promise.forEach(operations, function(op) {
+        return op($);
+    })
+    .then(function() {
+        const resultHTML = $.html();
+        return page.set('content', resultHTML);
+    });
+}
+
+module.exports = modifyHTML;
diff --git a/packages/gitbook/src/output/modifiers/resolveImages.js b/packages/gitbook/src/output/modifiers/resolveImages.js
new file mode 100644
index 0000000..339ddeb
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/resolveImages.js
@@ -0,0 +1,33 @@
+const path = require('path');
+
+const LocationUtils = require('../../utils/location');
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Resolve all HTML images:
+        - /test.png in hello -> ../test.html
+
+    @param {String} currentFile
+    @param {HTMLDom} $
+*/
+function resolveImages(currentFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'img', function($img) {
+        let src = $img.attr('src');
+
+        if (LocationUtils.isExternal(src) || LocationUtils.isDataURI(src)) {
+            return;
+        }
+
+        // Calcul absolute path for this
+        src = LocationUtils.toAbsolute(src, currentDirectory, '.');
+
+        // Convert back to relative
+        src = LocationUtils.relative(currentDirectory, src);
+
+        $img.attr('src', src);
+    });
+}
+
+module.exports = resolveImages;
diff --git a/packages/gitbook/src/output/modifiers/resolveLinks.js b/packages/gitbook/src/output/modifiers/resolveLinks.js
new file mode 100644
index 0000000..8b15315
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/resolveLinks.js
@@ -0,0 +1,53 @@
+const path = require('path');
+const url = require('url');
+
+const LocationUtils = require('../../utils/location');
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Resolve all HTML links:
+        - /test.md in hello -> ../test.html
+
+    @param {String} currentFile
+    @param {Function(String) -> String} resolveFile
+    @param {HTMLDom} $
+*/
+function resolveLinks(currentFile, resolveFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'a', function($a) {
+        let href = $a.attr('href');
+
+        // Don't change a tag without href
+        if (!href) {
+            return;
+        }
+
+        if (LocationUtils.isExternal(href)) {
+            $a.attr('target', '_blank');
+            return;
+        }
+
+        // Split anchor
+        const parsed = url.parse(href);
+        href = parsed.pathname || '';
+
+        if (href) {
+            // Calcul absolute path for this
+            href = LocationUtils.toAbsolute(href, currentDirectory, '.');
+
+            // Resolve file
+            href = resolveFile(href);
+
+            // Convert back to relative
+            href = LocationUtils.relative(currentDirectory, href);
+        }
+
+        // Add back anchor
+        href = href + (parsed.hash || '');
+
+        $a.attr('href', href);
+    });
+}
+
+module.exports = resolveLinks;
diff --git a/packages/gitbook/src/output/modifiers/svgToImg.js b/packages/gitbook/src/output/modifiers/svgToImg.js
new file mode 100644
index 0000000..ac37d07
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/svgToImg.js
@@ -0,0 +1,56 @@
+const path = require('path');
+const crc = require('crc');
+const domSerializer = require('dom-serializer');
+
+const editHTMLElement = require('./editHTMLElement');
+const fs = require('../../utils/fs');
+const LocationUtils = require('../../utils/location');
+
+/**
+    Render a cheerio DOM as html
+
+    @param {HTMLDom} $
+    @param {HTMLElement} dom
+    @param {Object}
+    @return {String}
+*/
+function renderDOM($, dom, options) {
+    if (!dom && $._root && $._root.children) {
+        dom = $._root.children;
+    }
+    options = options || dom.options || $._options;
+    return domSerializer(dom, options);
+}
+
+/**
+    Replace SVG tag by IMG
+
+    @param {String} baseFolder
+    @param {HTMLDom} $
+*/
+function svgToImg(baseFolder, currentFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'svg', function($svg) {
+        const content = '<?xml version="1.0" encoding="UTF-8"?>' +
+            renderDOM($, $svg);
+
+        // We avoid generating twice the same PNG
+        const hash = crc.crc32(content).toString(16);
+        const fileName = hash + '.svg';
+        const filePath = path.join(baseFolder, fileName);
+
+        // Write the svg to the file
+        return fs.assertFile(filePath, function() {
+            return fs.writeFile(filePath, content, 'utf8');
+        })
+
+        // Return as image
+        .then(function() {
+            const src = LocationUtils.relative(currentDirectory, fileName);
+            $svg.replaceWith('<img src="' + src + '" />');
+        });
+    });
+}
+
+module.exports = svgToImg;
diff --git a/packages/gitbook/src/output/modifiers/svgToPng.js b/packages/gitbook/src/output/modifiers/svgToPng.js
new file mode 100644
index 0000000..ad3f31f
--- /dev/null
+++ b/packages/gitbook/src/output/modifiers/svgToPng.js
@@ -0,0 +1,53 @@
+const crc = require('crc');
+const path = require('path');
+
+const imagesUtil = require('../../utils/images');
+const fs = require('../../utils/fs');
+const LocationUtils = require('../../utils/location');
+
+const editHTMLElement = require('./editHTMLElement');
+
+/**
+    Convert all SVG images to PNG
+
+    @param {String} rootFolder
+    @param {HTMLDom} $
+    @return {Promise}
+*/
+function svgToPng(rootFolder, currentFile, $) {
+    const currentDirectory = path.dirname(currentFile);
+
+    return editHTMLElement($, 'img', function($img) {
+        let src = $img.attr('src');
+        if (path.extname(src) !== '.svg') {
+            return;
+        }
+
+        // Calcul absolute path for this
+        src = LocationUtils.toAbsolute(src, currentDirectory, '.');
+
+        // We avoid generating twice the same PNG
+        const hash = crc.crc32(src).toString(16);
+        let fileName = hash + '.png';
+
+        // Input file path
+        const inputPath = path.join(rootFolder, src);
+
+        // Result file path
+        const filePath = path.join(rootFolder, fileName);
+
+        return fs.assertFile(filePath, function() {
+            return imagesUtil.convertSVGToPNG(inputPath, filePath);
+        })
+        .then(function() {
+            // Convert filename to a relative filename
+            fileName = LocationUtils.relative(currentDirectory, fileName);
+
+            // Replace src
+            $img.attr('src', fileName);
+        });
+    });
+}
+
+
+module.exports = svgToPng;
diff --git a/packages/gitbook/src/output/prepareAssets.js b/packages/gitbook/src/output/prepareAssets.js
new file mode 100644
index 0000000..6694a74
--- /dev/null
+++ b/packages/gitbook/src/output/prepareAssets.js
@@ -0,0 +1,22 @@
+const Parse = require('../parse');
+
+/**
+    List all assets in the book
+
+    @param {Output}
+    @return {Promise<Output>}
+*/
+function prepareAssets(output) {
+    const book = output.getBook();
+    const pages = output.getPages();
+    const logger = output.getLogger();
+
+    return Parse.listAssets(book, pages)
+    .then(function(assets) {
+        logger.info.ln('found', assets.size, 'asset files');
+
+        return output.set('assets', assets);
+    });
+}
+
+module.exports = prepareAssets;
diff --git a/packages/gitbook/src/output/preparePages.js b/packages/gitbook/src/output/preparePages.js
new file mode 100644
index 0000000..e65367e
--- /dev/null
+++ b/packages/gitbook/src/output/preparePages.js
@@ -0,0 +1,26 @@
+const Parse = require('../parse');
+const Promise = require('../utils/promise');
+
+/**
+    List and prepare all pages
+
+    @param {Output}
+    @return {Promise<Output>}
+*/
+function preparePages(output) {
+    const book = output.getBook();
+    const logger = book.getLogger();
+
+    if (book.isMultilingual()) {
+        return Promise(output);
+    }
+
+    return Parse.parsePagesList(book)
+    .then(function(pages) {
+        logger.info.ln('found', pages.size, 'pages');
+
+        return output.set('pages', pages);
+    });
+}
+
+module.exports = preparePages;
diff --git a/packages/gitbook/src/output/preparePlugins.js b/packages/gitbook/src/output/preparePlugins.js
new file mode 100644
index 0000000..c84bade
--- /dev/null
+++ b/packages/gitbook/src/output/preparePlugins.js
@@ -0,0 +1,36 @@
+const Plugins = require('../plugins');
+const Promise = require('../utils/promise');
+
+/**
+ * Load and setup plugins
+ *
+ * @param {Output}
+ * @return {Promise<Output>}
+ */
+function preparePlugins(output) {
+    const book = output.getBook();
+
+    return Promise()
+
+    // Only load plugins for main book
+    .then(function() {
+        if (book.isLanguageBook()) {
+            return output.getPlugins();
+        } else {
+            return Plugins.loadForBook(book);
+        }
+    })
+
+    // Update book's configuration using the plugins
+    .then(function(plugins) {
+        return Plugins.validateConfig(book, plugins)
+        .then(function(newBook) {
+            return output.merge({
+                book: newBook,
+                plugins
+            });
+        });
+    });
+}
+
+module.exports = preparePlugins;
diff --git a/packages/gitbook/src/output/website/__tests__/i18n.js b/packages/gitbook/src/output/website/__tests__/i18n.js
new file mode 100644
index 0000000..24f01f3
--- /dev/null
+++ b/packages/gitbook/src/output/website/__tests__/i18n.js
@@ -0,0 +1,38 @@
+const createMockOutput = require('../../__tests__/createMock');
+const prepareI18n = require('../prepareI18n');
+const createTemplateEngine = require('../createTemplateEngine');
+
+const WebsiteGenerator = require('../');
+
+describe('i18n', function() {
+    it('should correctly use english as default language', function() {
+        return createMockOutput(WebsiteGenerator, {
+            'README.md': 'Hello World'
+        })
+        .then(function(output) {
+            return prepareI18n(output);
+        })
+        .then(function(output) {
+            const engine = createTemplateEngine(output, 'README.md');
+            const t = engine.getFilters().get('t');
+
+            expect(t('SUMMARY_INTRODUCTION')).toEqual('Introduction');
+        });
+    });
+
+    it('should correctly use language from book.json', function() {
+        return createMockOutput(WebsiteGenerator, {
+            'README.md': 'Hello World',
+            'book.json': JSON.stringify({ language: 'fr' })
+        })
+        .then(function(output) {
+            return prepareI18n(output);
+        })
+        .then(function(output) {
+            const engine = createTemplateEngine(output, 'README.md');
+            const t = engine.getFilters().get('t');
+
+            expect(t('GITBOOK_LINK')).toEqual('Publié avec GitBook');
+        });
+    });
+});
diff --git a/packages/gitbook/src/output/website/copyPluginAssets.js b/packages/gitbook/src/output/website/copyPluginAssets.js
new file mode 100644
index 0000000..315804a
--- /dev/null
+++ b/packages/gitbook/src/output/website/copyPluginAssets.js
@@ -0,0 +1,117 @@
+const path = require('path');
+
+const ASSET_FOLDER = require('../../constants/pluginAssetsFolder');
+const Promise = require('../../utils/promise');
+const fs = require('../../utils/fs');
+
+/**
+    Copy all assets from plugins.
+    Assets are files stored in "_assets"
+    nd resources declared in the plugin itself.
+
+    @param {Output}
+    @return {Promise}
+*/
+function copyPluginAssets(output) {
+    const book = output.getBook();
+
+    // Don't copy plugins assets for language book
+    // It'll be resolved to the parent folder
+    if (book.isLanguageBook()) {
+        return Promise(output);
+    }
+
+    const plugins = output.getPlugins()
+
+        // We reverse the order of plugins to copy
+        // so that first plugins can replace assets from other plugins.
+        .reverse();
+
+    return Promise.forEach(plugins, function(plugin) {
+        return copyAssets(output, plugin)
+        .then(function() {
+            return copyResources(output, plugin);
+        });
+    })
+    .thenResolve(output);
+}
+
+/**
+    Copy assets from a plugin
+
+    @param {Plugin}
+    @return {Promise}
+*/
+function copyAssets(output, plugin) {
+    const logger = output.getLogger();
+    const pluginRoot = plugin.getPath();
+    const options = output.getOptions();
+
+    const outputRoot = options.get('root');
+    const assetOutputFolder = path.join(outputRoot, 'gitbook');
+    const prefix = options.get('prefix');
+
+    const assetFolder = path.join(pluginRoot, ASSET_FOLDER, prefix);
+
+    if (!fs.existsSync(assetFolder)) {
+        return Promise();
+    }
+
+    logger.debug.ln('copy assets from theme', assetFolder);
+    return fs.copyDir(
+        assetFolder,
+        assetOutputFolder,
+        {
+            deleteFirst: false,
+            overwrite: true,
+            confirm: true
+        }
+    );
+}
+
+/**
+    Copy resources from a plugin
+
+    @param {Plugin}
+    @return {Promise}
+*/
+function copyResources(output, plugin) {
+    const logger = output.getLogger();
+
+    const options    = output.getOptions();
+    const outputRoot = options.get('root');
+
+    const state = output.getState();
+    const resources = state.getResources();
+
+    const pluginRoot      = plugin.getPath();
+    const pluginResources = resources.get(plugin.getName());
+
+    let assetsFolder = pluginResources.get('assets');
+    const assetOutputFolder = path.join(outputRoot, 'gitbook', plugin.getNpmID());
+
+    if (!assetsFolder) {
+        return Promise();
+    }
+
+    // Resolve assets folder
+    assetsFolder = path.resolve(pluginRoot, assetsFolder);
+    if (!fs.existsSync(assetsFolder)) {
+        logger.warn.ln('assets folder for plugin "' + plugin.getName() + '" doesn\'t exist');
+        return Promise();
+    }
+
+    logger.debug.ln('copy resources from plugin', assetsFolder);
+
+    return fs.copyDir(
+        assetsFolder,
+        assetOutputFolder,
+        {
+            deleteFirst: false,
+            overwrite: true,
+            confirm: true
+        }
+    );
+}
+
+module.exports = copyPluginAssets;
diff --git a/packages/gitbook/src/output/website/createTemplateEngine.js b/packages/gitbook/src/output/website/createTemplateEngine.js
new file mode 100644
index 0000000..42a0bea
--- /dev/null
+++ b/packages/gitbook/src/output/website/createTemplateEngine.js
@@ -0,0 +1,152 @@
+const path = require('path');
+const nunjucks = require('nunjucks');
+const DoExtension = require('nunjucks-do')(nunjucks);
+
+const Api = require('../../api');
+const deprecate = require('../../api/deprecate');
+const JSONUtils = require('../../json');
+const LocationUtils = require('../../utils/location');
+const fs = require('../../utils/fs');
+const PathUtils = require('../../utils/path');
+const TemplateEngine = require('../../models/templateEngine');
+const templatesFolder = require('../../constants/templatesFolder');
+const defaultFilters = require('../../constants/defaultFilters');
+const Templating = require('../../templating');
+const listSearchPaths = require('./listSearchPaths');
+
+const fileToURL = require('../helper/fileToURL');
+const resolveFileToURL = require('../helper/resolveFileToURL');
+
+/**
+ * Directory for a theme with the templates
+ */
+function templateFolder(dir) {
+    return path.join(dir, templatesFolder);
+}
+
+/**
+ * Create templating engine to render themes
+ *
+ * @param {Output} output
+ * @param {String} currentFile
+ * @return {TemplateEngine}
+ */
+function createTemplateEngine(output, currentFile) {
+    const book = output.getBook();
+    const state = output.getState();
+    const i18n = state.getI18n();
+    const config = book.getConfig();
+    const summary = book.getSummary();
+    const outputFolder = output.getRoot();
+
+    // Search paths for templates
+    const searchPaths = listSearchPaths(output);
+    const tplSearchPaths = searchPaths.map(templateFolder);
+
+    // Create loader
+    const loader = new Templating.ThemesLoader(tplSearchPaths);
+
+    // Get languages
+    const language = config.getValue('language');
+
+    // Create API context
+    const context = Api.encodeGlobal(output);
+
+
+    /**
+     * Check if a file exists
+     * @param {String} fileName
+     * @return {Boolean}
+     */
+    function fileExists(fileName) {
+        if (!fileName) {
+            return false;
+        }
+
+        const filePath = PathUtils.resolveInRoot(outputFolder, fileName);
+        return fs.existsSync(filePath);
+    }
+
+    /**
+     * Return an article by its path
+     * @param {String} filePath
+     * @return {Object|undefined}
+     */
+    function getArticleByPath(filePath) {
+        const article = summary.getByPath(filePath);
+        if (!article) return undefined;
+
+        return JSONUtils.encodeSummaryArticle(article);
+    }
+
+    /**
+     * Return a page by its path
+     * @param {String} filePath
+     * @return {Object|undefined}
+     */
+    function getPageByPath(filePath) {
+        const page = output.getPage(filePath);
+        if (!page) return undefined;
+
+        return JSONUtils.encodePage(page, summary);
+    }
+
+    return TemplateEngine.create({
+        loader,
+
+        context,
+
+        globals: {
+            getArticleByPath,
+            getPageByPath,
+            fileExists
+        },
+
+        filters: defaultFilters.merge({
+
+            /**
+             * Translate a sentence
+             */
+            t: function t(s) {
+                return i18n.t(language, s);
+            },
+
+            /**
+             * Resolve an absolute file path into a
+             * relative path.
+             * it also resolve pages
+             */
+            resolveFile(filePath) {
+                filePath = resolveFileToURL(output, filePath);
+                return LocationUtils.relativeForFile(currentFile, filePath);
+            },
+
+            resolveAsset(filePath) {
+                filePath = LocationUtils.toAbsolute(filePath, '', '');
+                filePath = path.join('gitbook', filePath);
+                filePath = LocationUtils.relativeForFile(currentFile, filePath);
+
+                // Use assets from parent if language book
+                if (book.isLanguageBook()) {
+                    filePath = path.join('../', filePath);
+                }
+
+                return LocationUtils.normalize(filePath);
+            },
+
+
+            fileExists: deprecate.method(book, 'fileExists', fileExists, 'Filter "fileExists" is deprecated, use "fileExists(filename)" '),
+            getArticleByPath: deprecate.method(book, 'getArticleByPath', fileExists, 'Filter "getArticleByPath" is deprecated, use "getArticleByPath(filename)" '),
+
+            contentURL(filePath) {
+                return fileToURL(output, filePath);
+            }
+        }),
+
+        extensions: {
+            'DoExtension': new DoExtension()
+        }
+    });
+}
+
+module.exports = createTemplateEngine;
diff --git a/packages/gitbook/src/output/website/index.js b/packages/gitbook/src/output/website/index.js
new file mode 100644
index 0000000..7818a28
--- /dev/null
+++ b/packages/gitbook/src/output/website/index.js
@@ -0,0 +1,11 @@
+
+module.exports = {
+    name:                       'website',
+    State:                      require('./state'),
+    Options:                    require('./options'),
+    onInit:                     require('./onInit'),
+    onFinish:                   require('./onFinish'),
+    onPage:                     require('./onPage'),
+    onAsset:                    require('./onAsset'),
+    createTemplateEngine:       require('./createTemplateEngine')
+};
diff --git a/packages/gitbook/src/output/website/listSearchPaths.js b/packages/gitbook/src/output/website/listSearchPaths.js
new file mode 100644
index 0000000..c07dade
--- /dev/null
+++ b/packages/gitbook/src/output/website/listSearchPaths.js
@@ -0,0 +1,23 @@
+
+/**
+    List search paths for templates / i18n, etc
+
+    @param {Output} output
+    @return {List<String>}
+*/
+function listSearchPaths(output) {
+    const book = output.getBook();
+    const plugins = output.getPlugins();
+
+    const searchPaths = plugins
+        .valueSeq()
+        .map(function(plugin) {
+            return plugin.getPath();
+        })
+        .toList();
+
+    return searchPaths.unshift(book.getContentRoot());
+}
+
+
+module.exports = listSearchPaths;
diff --git a/packages/gitbook/src/output/website/onAsset.js b/packages/gitbook/src/output/website/onAsset.js
new file mode 100644
index 0000000..b996375
--- /dev/null
+++ b/packages/gitbook/src/output/website/onAsset.js
@@ -0,0 +1,28 @@
+const path = require('path');
+const fs = require('../../utils/fs');
+
+/**
+    Copy an asset to the output folder
+
+    @param {Output} output
+    @param {Page} page
+*/
+function onAsset(output, asset) {
+    const book = output.getBook();
+    const options = output.getOptions();
+    const bookFS = book.getContentFS();
+
+    const outputFolder = options.get('root');
+    const outputPath = path.resolve(outputFolder, asset);
+
+    return fs.ensureFile(outputPath)
+    .then(function() {
+        return bookFS.readAsStream(asset)
+        .then(function(stream) {
+            return fs.writeStream(outputPath, stream);
+        });
+    })
+    .thenResolve(output);
+}
+
+module.exports = onAsset;
diff --git a/packages/gitbook/src/output/website/onFinish.js b/packages/gitbook/src/output/website/onFinish.js
new file mode 100644
index 0000000..b032c90
--- /dev/null
+++ b/packages/gitbook/src/output/website/onFinish.js
@@ -0,0 +1,35 @@
+const Promise = require('../../utils/promise');
+const JSONUtils = require('../../json');
+const Templating = require('../../templating');
+const writeFile = require('../helper/writeFile');
+const createTemplateEngine = require('./createTemplateEngine');
+
+/**
+    Finish the generation, write the languages index
+
+    @param {Output}
+    @return {Output}
+*/
+function onFinish(output) {
+    const book = output.getBook();
+    const options = output.getOptions();
+    const prefix = options.get('prefix');
+
+    if (!book.isMultilingual()) {
+        return Promise(output);
+    }
+
+    const filePath = 'index.html';
+    const engine = createTemplateEngine(output, filePath);
+    const context = JSONUtils.encodeOutput(output);
+
+    // Render the theme
+    return Templating.renderFile(engine, prefix + '/languages.html', context)
+
+    // Write it to the disk
+    .then(function(tplOut) {
+        return writeFile(output, filePath, tplOut.getContent());
+    });
+}
+
+module.exports = onFinish;
diff --git a/packages/gitbook/src/output/website/onInit.js b/packages/gitbook/src/output/website/onInit.js
new file mode 100644
index 0000000..3f6d26e
--- /dev/null
+++ b/packages/gitbook/src/output/website/onInit.js
@@ -0,0 +1,20 @@
+const Promise = require('../../utils/promise');
+
+const copyPluginAssets = require('./copyPluginAssets');
+const prepareI18n = require('./prepareI18n');
+const prepareResources = require('./prepareResources');
+
+/**
+    Initialize the generator
+
+    @param {Output}
+    @return {Output}
+*/
+function onInit(output) {
+    return Promise(output)
+    .then(prepareI18n)
+    .then(prepareResources)
+    .then(copyPluginAssets);
+}
+
+module.exports = onInit;
diff --git a/packages/gitbook/src/output/website/onPage.js b/packages/gitbook/src/output/website/onPage.js
new file mode 100644
index 0000000..3b40536
--- /dev/null
+++ b/packages/gitbook/src/output/website/onPage.js
@@ -0,0 +1,76 @@
+const path = require('path');
+const omit = require('omit-keys');
+
+const Templating = require('../../templating');
+const Plugins = require('../../plugins');
+const JSONUtils = require('../../json');
+const LocationUtils = require('../../utils/location');
+const Modifiers = require('../modifiers');
+const writeFile = require('../helper/writeFile');
+const getModifiers = require('../getModifiers');
+const createTemplateEngine = require('./createTemplateEngine');
+const fileToOutput = require('../helper/fileToOutput');
+
+/**
+ * Write a page as a json file
+ *
+ * @param {Output} output
+ * @param {Page} page
+ */
+function onPage(output, page) {
+    const options   = output.getOptions();
+    const prefix    = options.get('prefix');
+
+    const file      = page.getFile();
+
+    const book      = output.getBook();
+    const plugins   = output.getPlugins();
+    const state     = output.getState();
+    const resources = state.getResources();
+
+    const engine = createTemplateEngine(output, page.getPath());
+
+    // Output file path
+    const filePath = fileToOutput(output, file.getPath());
+
+    // Calcul relative path to the root
+    const outputDirName = path.dirname(filePath);
+    const basePath = LocationUtils.normalize(path.relative(outputDirName, './'));
+
+    return Modifiers.modifyHTML(page, getModifiers(output, page))
+    .then(function(resultPage) {
+        // Generate the context
+        const context = JSONUtils.encodeOutputWithPage(output, resultPage);
+        context.plugins = {
+            resources: Plugins.listResources(plugins, resources).toJS()
+        };
+
+        context.template = {
+            getJSContext() {
+                return {
+                    page: omit(context.page, 'content'),
+                    config: context.config,
+                    file: context.file,
+                    gitbook: context.gitbook,
+                    basePath,
+                    book: {
+                        language: book.getLanguage()
+                    }
+                };
+            }
+        };
+
+        // We should probabbly move it to "template" or a "site" namespace
+        context.basePath = basePath;
+
+        // Render the theme
+        return Templating.renderFile(engine, prefix + '/page.html', context)
+
+        // Write it to the disk
+        .then(function(tplOut) {
+            return writeFile(output, filePath, tplOut.getContent());
+        });
+    });
+}
+
+module.exports = onPage;
diff --git a/packages/gitbook/src/output/website/options.js b/packages/gitbook/src/output/website/options.js
new file mode 100644
index 0000000..43314df
--- /dev/null
+++ b/packages/gitbook/src/output/website/options.js
@@ -0,0 +1,14 @@
+const Immutable = require('immutable');
+
+const Options = Immutable.Record({
+    // Root folder for the output
+    root:               String(),
+
+    // Prefix for generation
+    prefix:             String('website'),
+
+    // Use directory index url instead of "index.html"
+    directoryIndex:     Boolean(true)
+});
+
+module.exports = Options;
diff --git a/packages/gitbook/src/output/website/prepareI18n.js b/packages/gitbook/src/output/website/prepareI18n.js
new file mode 100644
index 0000000..b02ef77
--- /dev/null
+++ b/packages/gitbook/src/output/website/prepareI18n.js
@@ -0,0 +1,30 @@
+const path = require('path');
+
+const fs = require('../../utils/fs');
+const Promise = require('../../utils/promise');
+const listSearchPaths = require('./listSearchPaths');
+
+/**
+ * Prepare i18n, load translations from plugins and book
+ *
+ * @param {Output}
+ * @return {Promise<Output>}
+ */
+function prepareI18n(output) {
+    const state = output.getState();
+    const i18n = state.getI18n();
+    const searchPaths = listSearchPaths(output);
+
+    searchPaths
+        .reverse()
+        .forEach(function(searchPath) {
+            const i18nRoot = path.resolve(searchPath, '_i18n');
+
+            if (!fs.existsSync(i18nRoot)) return;
+            i18n.load(i18nRoot);
+        });
+
+    return Promise(output);
+}
+
+module.exports = prepareI18n;
diff --git a/packages/gitbook/src/output/website/prepareResources.js b/packages/gitbook/src/output/website/prepareResources.js
new file mode 100644
index 0000000..e93f45f
--- /dev/null
+++ b/packages/gitbook/src/output/website/prepareResources.js
@@ -0,0 +1,54 @@
+const is        = require('is');
+const Immutable = require('immutable');
+const Promise   = require('../../utils/promise');
+
+const Api              = require('../../api');
+
+/**
+    Prepare plugins resources, add all output corresponding type resources
+
+    @param {Output}
+    @return {Promise<Output>}
+*/
+function prepareResources(output) {
+    const plugins = output.getPlugins();
+    const options = output.getOptions();
+    const type    = options.get('prefix');
+    let state   = output.getState();
+    const context = Api.encodeGlobal(output);
+
+    let result = Immutable.Map();
+
+    return Promise.forEach(plugins, function(plugin) {
+        const pluginResources = plugin.getResources(type);
+
+        return Promise()
+        .then(function() {
+            // Apply resources if is a function
+            if (is.fn(pluginResources)) {
+                return Promise()
+                .then(pluginResources.bind(context));
+            }
+            else {
+                return pluginResources;
+            }
+        })
+        .then(function(resources) {
+            result = result.set(plugin.getName(), Immutable.Map(resources));
+        });
+    })
+    .then(function() {
+        // Set output resources
+        state = state.merge({
+            resources: result
+        });
+
+        output = output.merge({
+            state
+        });
+
+        return output;
+    });
+}
+
+module.exports = prepareResources;
diff --git a/packages/gitbook/src/output/website/state.js b/packages/gitbook/src/output/website/state.js
new file mode 100644
index 0000000..813b850
--- /dev/null
+++ b/packages/gitbook/src/output/website/state.js
@@ -0,0 +1,19 @@
+const I18n = require('i18n-t');
+const Immutable = require('immutable');
+
+const GeneratorState = Immutable.Record({
+    i18n:       I18n(),
+
+    // List of plugins' resources
+    resources:  Immutable.Map()
+});
+
+GeneratorState.prototype.getI18n = function() {
+    return this.get('i18n');
+};
+
+GeneratorState.prototype.getResources = function() {
+    return this.get('resources');
+};
+
+module.exports = GeneratorState;