diff options
Diffstat (limited to 'projecttemplates')
88 files changed, 12332 insertions, 0 deletions
diff --git a/projecttemplates/Settings.StyleCop b/projecttemplates/Settings.StyleCop new file mode 100644 index 0000000..f6b59ac --- /dev/null +++ b/projecttemplates/Settings.StyleCop @@ -0,0 +1,44 @@ +<StyleCopSettings Version="4.3"> + <Analyzers> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.DocumentationRules"> + <Rules> + <Rule Name="FileMustHaveHeader"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementsMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PartialElementsMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.MaintainabilityRules"> + <Rules> + <Rule Name="FieldsMustBePrivate"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.NamingRules"> + <Rules> + <Rule Name="ElementMustBeginWithUpperCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + </Analyzers> +</StyleCopSettings>
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master new file mode 100644 index 0000000..c50b73c --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master @@ -0,0 +1,7 @@ +<%@ Master Language="C#" AutoEventWireup="true" CodeBehind="Admin.master.cs" Inherits="WebFormsRelyingParty.Admin.Admin" + MasterPageFile="~/Site.Master" %> + +<asp:Content ContentPlaceHolderID="Body" runat="server"> + <asp:ContentPlaceHolder ID="Body" runat="server"> + </asp:ContentPlaceHolder> +</asp:Content> diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.cs b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.cs new file mode 100644 index 0000000..85f7608 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.cs @@ -0,0 +1,19 @@ +//----------------------------------------------------------------------- +// <copyright file="Admin.Master.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty.Admin { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + + public partial class Admin : System.Web.UI.MasterPage { + protected void Page_Load(object sender, EventArgs e) { + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.designer.cs b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.designer.cs new file mode 100644 index 0000000..fa5ccb9 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Admin.Master.designer.cs @@ -0,0 +1,25 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty.Admin { + + + public partial class Admin { + + /// <summary> + /// Body control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.ContentPlaceHolder Body; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Admin/CreateDatabase.sql b/projecttemplates/WebFormsRelyingParty/Admin/CreateDatabase.sql new file mode 100644 index 0000000..99ac9db --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/CreateDatabase.sql @@ -0,0 +1,128 @@ +/****** Object: Table [dbo].[User] Script Date: 10/08/2009 18:10:17 ******/ +SET ANSI_NULLS ON +GO +SET QUOTED_IDENTIFIER ON +GO +CREATE TABLE [dbo].[User]( + [Id] [int] IDENTITY(1,1) NOT NULL, + [FirstName] [nvarchar](50) NULL, + [LastName] [nvarchar](50) NULL, + [EmailAddress] [nvarchar](100) NULL, + CONSTRAINT [PK_User] PRIMARY KEY CLUSTERED +( + [Id] ASC +)WITH (PAD_INDEX = OFF, STATISTICS_NORECOMPUTE = OFF, IGNORE_DUP_KEY = OFF, ALLOW_ROW_LOCKS = ON, ALLOW_PAGE_LOCKS = ON) ON [PRIMARY] +) ON [PRIMARY] +GO +/****** Object: Table [dbo].[Role] Script Date: 10/08/2009 18:10:17 ******/ +SET ANSI_NULLS ON +GO +SET QUOTED_IDENTIFIER ON +GO +CREATE TABLE [dbo].[Role]( + [Id] [int] IDENTITY(1,1) NOT NULL, + [Name] [nvarchar](50) NOT NULL, + CONSTRAINT [PK_Role] PRIMARY KEY CLUSTERED +( + [Id] ASC +)WITH (PAD_INDEX = OFF, STATISTICS_NORECOMPUTE = OFF, IGNORE_DUP_KEY = OFF, ALLOW_ROW_LOCKS = ON, ALLOW_PAGE_LOCKS = ON) ON [PRIMARY] +) ON [PRIMARY] +GO +/****** Object: Table [dbo].[UserRole] Script Date: 10/08/2009 18:10:17 ******/ +SET ANSI_NULLS ON +GO +SET QUOTED_IDENTIFIER ON +GO +CREATE TABLE [dbo].[UserRole]( + [UserId] [int] NOT NULL, + [RoleId] [int] NOT NULL, + CONSTRAINT [PK_UserRole] PRIMARY KEY CLUSTERED +( + [UserId] ASC, + [RoleId] ASC +)WITH (PAD_INDEX = OFF, STATISTICS_NORECOMPUTE = OFF, IGNORE_DUP_KEY = OFF, ALLOW_ROW_LOCKS = ON, ALLOW_PAGE_LOCKS = ON) ON [PRIMARY] +) ON [PRIMARY] +GO +/****** Object: Table [dbo].[AuthenticationToken] Script Date: 10/08/2009 18:10:17 ******/ +SET ANSI_NULLS ON +GO +SET QUOTED_IDENTIFIER ON +GO +CREATE TABLE [dbo].[AuthenticationToken]( + [Id] [int] IDENTITY(1,1) NOT NULL, + [UserId] [int] NOT NULL, + [OpenIdClaimedIdentifier] [nvarchar](250) COLLATE SQL_Latin1_General_CP1_CS_AS NOT NULL, -- very important that claimed_id comparisons be case sensitive + [OpenIdFriendlyIdentifier] [nvarchar](250) NULL, + CONSTRAINT [PK_AuthenticationToken] PRIMARY KEY CLUSTERED +( + [Id] ASC +)WITH (PAD_INDEX = OFF, STATISTICS_NORECOMPUTE = OFF, IGNORE_DUP_KEY = OFF, ALLOW_ROW_LOCKS = ON, ALLOW_PAGE_LOCKS = ON) ON [PRIMARY] +) ON [PRIMARY] +GO +/****** Object: StoredProcedure [dbo].[AddUser] Script Date: 10/08/2009 18:10:32 ******/ +SET ANSI_NULLS ON +GO +SET QUOTED_IDENTIFIER ON +GO +CREATE PROCEDURE [dbo].[AddUser] + ( + @firstName nvarchar(50), + @lastName nvarchar(50), + @openid nvarchar(255), + @role nvarchar(255) + ) +AS + DECLARE + @roleid int, + @userid int + + BEGIN TRANSACTION + + INSERT INTO [dbo].[User] (FirstName, LastName) VALUES (@firstName, @lastName) + SET @userid = (SELECT @@IDENTITY) + + IF (SELECT COUNT(*) FROM dbo.Role WHERE [Name] = @role) = 0 + BEGIN + INSERT INTO dbo.Role (Name) VALUES (@role) + SET @roleid = (SELECT @@IDENTITY) + END + ELSE + BEGIN + SET @roleid = (SELECT Id FROM dbo.Role WHERE [Name] = @role) + END + + INSERT INTO dbo.UserRole (UserId, RoleId) VALUES (@userId, @roleid) + + INSERT INTO dbo.AuthenticationToken + (UserId, OpenIdClaimedIdentifier, OpenIdFriendlyIdentifier) + VALUES + (@userid, @openid, @openid) + + COMMIT TRANSACTION + + RETURN @userid +GO +/****** Object: ForeignKey [FK_UserRole_Role] Script Date: 10/08/2009 18:10:17 ******/ +ALTER TABLE [dbo].[UserRole] WITH CHECK ADD CONSTRAINT [FK_UserRole_Role] FOREIGN KEY([RoleId]) +REFERENCES [dbo].[Role] ([Id]) +ON UPDATE CASCADE +ON DELETE CASCADE +GO +ALTER TABLE [dbo].[UserRole] CHECK CONSTRAINT [FK_UserRole_Role] +GO +/****** Object: ForeignKey [FK_UserRole_User] Script Date: 10/08/2009 18:10:17 ******/ +ALTER TABLE [dbo].[UserRole] WITH CHECK ADD CONSTRAINT [FK_UserRole_User] FOREIGN KEY([UserId]) +REFERENCES [dbo].[User] ([Id]) +ON UPDATE CASCADE +ON DELETE CASCADE +GO +ALTER TABLE [dbo].[UserRole] CHECK CONSTRAINT [FK_UserRole_User] +GO +/****** Object: ForeignKey [FK_AuthenticationToken_User] Script Date: 10/08/2009 18:10:17 ******/ +ALTER TABLE [dbo].[AuthenticationToken] WITH CHECK ADD CONSTRAINT [FK_AuthenticationToken_User] FOREIGN KEY([UserId]) +REFERENCES [dbo].[User] ([Id]) +ON UPDATE CASCADE +ON DELETE CASCADE +GO +ALTER TABLE [dbo].[AuthenticationToken] CHECK CONSTRAINT [FK_AuthenticationToken_User] +GO diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx new file mode 100644 index 0000000..7e3a03d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx @@ -0,0 +1,52 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Default.aspx.cs" Inherits="WebFormsRelyingParty.Admin.Default" %> + +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head runat="server"> + <title></title> +</head> +<body> + <form id="form1" runat="server"> + <div> + This is the specially-privileged Admin area. You can only reach here if you are + a member of the Admin role. + </div> + <asp:Repeater runat="server" ID="usersRepeater"> + <HeaderTemplate> + <table border="1"> + <thead> + <tr> + <td> + Email + </td> + <td> + Claimed IDs + </td> + </tr> + </thead> + <tbody> + </HeaderTemplate> + <ItemTemplate> + <tr> + <td> + <%# HttpUtility.HtmlEncode((string)Eval("EmailAddress")) %> + </td> + <td> + <asp:Repeater runat="server" DataSource='<%# Eval("AuthenticationTokens") %>'> + <ItemTemplate> + <%# HttpUtility.HtmlEncode((string)Eval("ClaimedIdentifier")) %> + </ItemTemplate> + <SeparatorTemplate> + <br /> + </SeparatorTemplate> + </asp:Repeater> + </td> + </tr> + </ItemTemplate> + <FooterTemplate> + </tbody> </table> + </FooterTemplate> + </asp:Repeater> + </form> +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.cs b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.cs new file mode 100644 index 0000000..cc9abf1 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.cs @@ -0,0 +1,24 @@ +//----------------------------------------------------------------------- +// <copyright file="Default.aspx.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty.Admin { + using System; + using System.Collections.Generic; + using System.Configuration; + using System.Data.SqlClient; + using System.IO; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + + public partial class Default : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + this.usersRepeater.DataSource = Global.DataContext.User.Include("AuthenticationTokens"); + this.usersRepeater.DataBind(); + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.designer.cs new file mode 100644 index 0000000..aa45ea1 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Default.aspx.designer.cs @@ -0,0 +1,34 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty.Admin { + + + public partial class Default { + + /// <summary> + /// form1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.HtmlControls.HtmlForm form1; + + /// <summary> + /// usersRepeater control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Repeater usersRepeater; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Admin/Web.config b/projecttemplates/WebFormsRelyingParty/Admin/Web.config new file mode 100644 index 0000000..52a5faf --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Admin/Web.config @@ -0,0 +1,9 @@ +<?xml version="1.0"?> +<configuration> + <system.web> + <authorization> + <allow roles="Admin"/> + <deny users="*"/> + </authorization> + </system.web> +</configuration> diff --git a/projecttemplates/WebFormsRelyingParty/Code/DataRoleProvider.cs b/projecttemplates/WebFormsRelyingParty/Code/DataRoleProvider.cs new file mode 100644 index 0000000..8117e4b --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Code/DataRoleProvider.cs @@ -0,0 +1,123 @@ +//----------------------------------------------------------------------- +// <copyright file="DataRoleProvider.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty.Code { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.Security; + + public class DataRoleProvider : RoleProvider { + public override string ApplicationName { + get { throw new NotImplementedException(); } + set { throw new NotImplementedException(); } + } + + public override void AddUsersToRoles(string[] usernames, string[] roleNames) { + var users = from token in Global.DataContext.AuthenticationToken + where usernames.Contains(token.ClaimedIdentifier) + select token.User; + var roles = from role in Global.DataContext.Role + where roleNames.Contains(role.Name, StringComparer.OrdinalIgnoreCase) + select role; + foreach (User user in users) { + foreach (Role role in roles) { + user.Roles.Add(role); + } + } + } + + public override void RemoveUsersFromRoles(string[] usernames, string[] roleNames) { + var users = from token in Global.DataContext.AuthenticationToken + where usernames.Contains(token.ClaimedIdentifier) + select token.User; + var roles = from role in Global.DataContext.Role + where roleNames.Contains(role.Name, StringComparer.OrdinalIgnoreCase) + select role; + foreach (User user in users) { + foreach (Role role in roles) { + user.Roles.Remove(role); + } + } + } + + public override void CreateRole(string roleName) { + Global.DataContext.AddToRole(new Role { Name = roleName }); + } + + /// <summary> + /// Removes a role from the data source for the configured applicationName. + /// </summary> + /// <param name="roleName">The name of the role to delete.</param> + /// <param name="throwOnPopulatedRole">If true, throw an exception if <paramref name="roleName"/> has one or more members and do not delete <paramref name="roleName"/>.</param> + /// <returns> + /// true if the role was successfully deleted; otherwise, false. + /// </returns> + public override bool DeleteRole(string roleName, bool throwOnPopulatedRole) { + Role role = Global.DataContext.Role.SingleOrDefault(r => r.Name == roleName); + if (role == null) { + return false; + } + + if (throwOnPopulatedRole && role.Users.Count > 0) { + throw new InvalidOperationException(); + } + + Global.DataContext.DeleteObject(roleName); + return true; + } + + /// <summary> + /// Gets an array of user names in a role where the user name contains the specified user name to match. + /// </summary> + /// <param name="roleName">The role to search in.</param> + /// <param name="usernameToMatch">The user name to search for.</param> + /// <returns> + /// A string array containing the names of all the users where the user name matches <paramref name="usernameToMatch"/> and the user is a member of the specified role. + /// </returns> + public override string[] FindUsersInRole(string roleName, string usernameToMatch) { + return (from role in Global.DataContext.Role + where role.Name == roleName + from user in role.Users + from authTokens in user.AuthenticationTokens + where authTokens.ClaimedIdentifier == usernameToMatch + select authTokens.ClaimedIdentifier).ToArray(); + } + + public override string[] GetAllRoles() { + return Global.DataContext.Role.Select(role => role.Name).ToArray(); + } + + public override string[] GetRolesForUser(string username) { + return (from authToken in Global.DataContext.AuthenticationToken + where authToken.ClaimedIdentifier == username + from role in authToken.User.Roles + select role.Name).ToArray(); + } + + public override string[] GetUsersInRole(string roleName) { + return (from role in Global.DataContext.Role + where string.Equals(role.Name, roleName, StringComparison.OrdinalIgnoreCase) + from user in role.Users + from token in user.AuthenticationTokens + select token.ClaimedIdentifier).ToArray(); + } + + public override bool IsUserInRole(string username, string roleName) { + Role role = Global.DataContext.Role.SingleOrDefault(r => string.Equals(r.Name, roleName, StringComparison.OrdinalIgnoreCase)); + if (role != null) { + return role.Users.Any(user => user.AuthenticationTokens.Any(token => token.ClaimedIdentifier == username)); + } + + return false; + } + + public override bool RoleExists(string roleName) { + return Global.DataContext.Role.Any(role => string.Equals(role.Name, roleName, StringComparison.OrdinalIgnoreCase)); + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Default.aspx b/projecttemplates/WebFormsRelyingParty/Default.aspx new file mode 100644 index 0000000..e470320 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Default.aspx @@ -0,0 +1,12 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Default.aspx.cs" Inherits="WebFormsRelyingParty._Default" + MasterPageFile="~/Site.Master" %> + +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth" TagPrefix="dnoa" %> +<asp:Content runat="server" ContentPlaceHolderID="head"> + <dnoa:XrdsPublisher runat="server" XrdsUrl="~/xrds.aspx" XrdsAdvertisement="Both" /> +</asp:Content> +<asp:Content runat="server" ContentPlaceHolderID="Body"> + <asp:Label ID="Label1" runat="server" Text="Label"></asp:Label> + <asp:HyperLink ID="HyperLink1" NavigateUrl="~/Members/Default.aspx" Text="Visit the Members Only area" + runat="server" /> +</asp:Content> diff --git a/projecttemplates/WebFormsRelyingParty/Default.aspx.cs b/projecttemplates/WebFormsRelyingParty/Default.aspx.cs new file mode 100644 index 0000000..a72fce1 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Default.aspx.cs @@ -0,0 +1,21 @@ +//----------------------------------------------------------------------- +// <copyright file="Default.aspx.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + + public partial class _Default : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + User user = Global.LoggedInUser; + this.Label1.Text = user != null ? user.FirstName : "<not logged in>"; + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Default.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Default.aspx.designer.cs new file mode 100644 index 0000000..9c12f15 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Default.aspx.designer.cs @@ -0,0 +1,34 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class _Default { + + /// <summary> + /// Label1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Label Label1; + + /// <summary> + /// HyperLink1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.HyperLink HyperLink1; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/GettingStarted.htm b/projecttemplates/WebFormsRelyingParty/GettingStarted.htm new file mode 100644 index 0000000..9a3fbb7 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/GettingStarted.htm @@ -0,0 +1,19 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml" > +<head> + <title>Getting started</title> +</head> +<body> + + <p> + Your OpenID and InfoCard relying party web site is nearly ready to go. You just + need to create your SQL database where user accounts will be stored. <b> + Just build and start your web site </b>and visit Default.aspx. You'll get + further instructions there. + </p> + <p> + Creating your database is almost totally automated, so it should be a piece of + cake.</p> + +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/Global.asax b/projecttemplates/WebFormsRelyingParty/Global.asax new file mode 100644 index 0000000..ff6cdb1 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Global.asax @@ -0,0 +1 @@ +<%@ Application Codebehind="Global.asax.cs" Inherits="WebFormsRelyingParty.Global" Language="C#" %> diff --git a/projecttemplates/WebFormsRelyingParty/Global.asax.cs b/projecttemplates/WebFormsRelyingParty/Global.asax.cs new file mode 100644 index 0000000..15a1047 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Global.asax.cs @@ -0,0 +1,178 @@ +//----------------------------------------------------------------------- +// <copyright file="Global.asax.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty { + using System; + using System.Data; + using System.Data.SqlClient; + using System.Linq; + using System.ServiceModel; + using System.Web; + + public class Global : System.Web.HttpApplication { + private const string DataContextKey = "DataContext"; + + private const string DataContextTransactionKey = "DataContextTransaction"; + + /// <summary> + /// The logger for this sample to use. + /// </summary> + private static log4net.ILog logger = log4net.LogManager.GetLogger("DotNetOpenAuth.ConsumerSample"); + + public static log4net.ILog Logger { + get { return logger; } + } + + public static User LoggedInUser { + get { return Global.DataContext.AuthenticationToken.Where(token => token.ClaimedIdentifier == HttpContext.Current.User.Identity.Name).Select(token => token.User).FirstOrDefault(); } + } + + public static string ApplicationPath { + get { + string path = HttpContext.Current.Request.ApplicationPath; + if (!path.EndsWith("/")) { + path += "/"; + } + + return path; + } + } + + /// <summary> + /// Gets the transaction-protected database connection for the current request. + /// </summary> + public static DatabaseEntities DataContext { + get { + DatabaseEntities dataContext = DataContextSimple; + if (dataContext == null) { + dataContext = new DatabaseEntities(); + try { + dataContext.Connection.Open(); + } catch (EntityException entityEx) { + var sqlEx = entityEx.InnerException as SqlException; + if (sqlEx != null) { + if (sqlEx.Class == 14 && sqlEx.Number == 15350) { + // Most likely the database schema hasn't been created yet. + HttpContext.Current.Response.Redirect("~/Setup.aspx"); + } + } + + throw; + } + + DataContextTransactionSimple = dataContext.Connection.BeginTransaction(); + DataContextSimple = dataContext; + } + + return dataContext; + } + } + + private static DatabaseEntities DataContextSimple { + get { + if (HttpContext.Current != null) { + return HttpContext.Current.Items[DataContextKey] as DatabaseEntities; + } else if (OperationContext.Current != null) { + object data; + if (OperationContext.Current.IncomingMessageProperties.TryGetValue(DataContextKey, out data)) { + return data as DatabaseEntities; + } else { + return null; + } + } else { + throw new InvalidOperationException(); + } + } + + set { + if (HttpContext.Current != null) { + HttpContext.Current.Items[DataContextKey] = value; + } else if (OperationContext.Current != null) { + OperationContext.Current.IncomingMessageProperties[DataContextKey] = value; + } else { + throw new InvalidOperationException(); + } + } + } + + private static IDbTransaction DataContextTransactionSimple { + get { + if (HttpContext.Current != null) { + return HttpContext.Current.Items[DataContextTransactionKey] as IDbTransaction; + } else if (OperationContext.Current != null) { + object data; + if (OperationContext.Current.IncomingMessageProperties.TryGetValue(DataContextTransactionKey, out data)) { + return data as IDbTransaction; + } else { + return null; + } + } else { + throw new InvalidOperationException(); + } + } + + set { + if (HttpContext.Current != null) { + HttpContext.Current.Items[DataContextTransactionKey] = value; + } else if (OperationContext.Current != null) { + OperationContext.Current.IncomingMessageProperties[DataContextTransactionKey] = value; + } else { + throw new InvalidOperationException(); + } + } + } + + protected void Application_Start(object sender, EventArgs e) { + log4net.Config.XmlConfigurator.Configure(); + Logger.Info("Web application starting..."); + } + + protected void Session_Start(object sender, EventArgs e) { + } + + protected void Application_BeginRequest(object sender, EventArgs e) { + } + + protected void Application_EndRequest(object sender, EventArgs e) { + CommitAndCloseDatabaseIfNecessary(); + } + + protected void Application_AuthenticateRequest(object sender, EventArgs e) { + } + + protected void Application_Error(object sender, EventArgs e) { + Logger.Error("An unhandled exception occurred in ASP.NET processing: " + Server.GetLastError(), Server.GetLastError()); + if (DataContextTransactionSimple != null) { + DataContextTransactionSimple.Rollback(); + DataContextTransactionSimple.Dispose(); + } + } + + protected void Session_End(object sender, EventArgs e) { + } + + protected void Application_End(object sender, EventArgs e) { + Logger.Info("Web application shutting down..."); + + // this would be automatic, but in partial trust scenarios it is not. + log4net.LogManager.Shutdown(); + } + + private static void CommitAndCloseDatabaseIfNecessary() { + var dataContext = DataContextSimple; + if (dataContext != null) { + dataContext.SaveChanges(); + if (DataContextTransactionSimple != null) { + DataContextTransactionSimple.Commit(); + DataContextTransactionSimple.Dispose(); + } + + dataContext.Dispose(); + DataContextSimple = null; + } + } + } +}
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/Login.aspx b/projecttemplates/WebFormsRelyingParty/Login.aspx new file mode 100644 index 0000000..ae3599d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Login.aspx @@ -0,0 +1,10 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Login.aspx.cs" Inherits="WebFormsRelyingParty.Login" + MasterPageFile="~/Site.Master" ValidateRequest="false" %> + +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.OpenId.RelyingParty" + TagPrefix="rp" %> +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.InfoCard" TagPrefix="ic" %> +<asp:Content runat="server" ContentPlaceHolderID="Body"> + <h2>Login</h2> + <iframe src="LoginFrame.aspx" frameborder="0" width="355" height="273"></iframe> +</asp:Content> diff --git a/projecttemplates/WebFormsRelyingParty/Login.aspx.cs b/projecttemplates/WebFormsRelyingParty/Login.aspx.cs new file mode 100644 index 0000000..5c57d35 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Login.aspx.cs @@ -0,0 +1,23 @@ +//----------------------------------------------------------------------- +// <copyright file="Login.aspx.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.Security; + using System.Web.UI; + using System.Web.UI.WebControls; + using DotNetOpenAuth.OpenId; + using DotNetOpenAuth.OpenId.Extensions.SimpleRegistration; + using DotNetOpenAuth.OpenId.RelyingParty; + + public partial class Login : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Login.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Login.aspx.designer.cs new file mode 100644 index 0000000..30a38cb --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Login.aspx.designer.cs @@ -0,0 +1,16 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class Login { + } +} diff --git a/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx new file mode 100644 index 0000000..b074076 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx @@ -0,0 +1,65 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="LoginFrame.aspx.cs" Inherits="WebFormsRelyingParty.LoginFrame" + EnableViewState="false" ValidateRequest="false" %> + +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.OpenId.RelyingParty" + TagPrefix="rp" %> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<!-- COPYRIGHT (C) 2009 Andrew Arnott. All rights reserved. --> +<!-- LICENSE: Microsoft Public License available at http://opensource.org/licenses/ms-pl.html --> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head runat="server"> + <link type="text/css" href="theme/ui.all.css" rel="Stylesheet" /> + <link href="styles/loginpopup.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<% if (Request.Url.IsLoopback) { %> + <script type="text/javascript" src="scripts/jquery-1.3.1.js"></script> + <script type="text/javascript" src="scripts/jquery-ui-personalized-1.6rc6.js"></script> +<% } else { %> + <script type="text/javascript" language="javascript" src="http://www.google.com/jsapi"></script> + <script type="text/javascript" language="javascript"> + google.load("jquery", "1.3.2"); + google.load("jqueryui", "1.7.2"); + </script> +<% } %> + + <script type="text/javascript" src="scripts/jquery.cookie.js"></script> + + <form runat="server" id="form1" target="_top"> + <div class="wrapper"> + <p> + Login with an account you already use! + </p> + <rp:OpenIdSelector runat="server" ID="openIdSelector" OnLoggedIn="openIdSelector_LoggedIn" + OnFailed="openIdSelector_Failed" OnCanceled="openIdSelector_Failed" OnReceivedToken="openIdSelector_ReceivedToken" + OnTokenProcessingError="openIdSelector_TokenProcessingError"> + <Buttons> + <rp:SelectorProviderButton OPIdentifier="https://me.yahoo.com/" Image="images/yahoo.gif" /> + <rp:SelectorProviderButton OPIdentifier="https://www.google.com/accounts/o8/id" Image="images/google.gif" /> + <rp:SelectorProviderButton OPIdentifier="https://www.myopenid.com/" Image="images/myopenid.png" /> + <rp:SelectorProviderButton OPIdentifier="https://pip.verisignlabs.com/" Image="images/verisign.gif" SkipBackgroundAuthentication="true" /> + <rp:SelectorOpenIdButton Image="images/openid.gif" /> + <rp:SelectorInfoCardButton /> + </Buttons> + </rp:OpenIdSelector> + <asp:HiddenField runat="server" ID="topWindowUrl" /> + <asp:Panel ID="errorPanel" runat="server" EnableViewState="false" Visible="false" ForeColor="Red"> + Oops. Something went wrong while logging you in. Trying again may work. <a href="#" onclick="$('#errorMessage').show()"> + What went wrong?</a> + <span id="errorMessage" style="display: none"> + <asp:Label ID="errorMessageLabel" runat="server" Text="Login canceled." /> + </span> + </asp:Panel> + <div class="helpDoc"> + <p> + If you have logged in previously, click the same button you did last time. + </p> + <p> + If you don't have an account with any of these services, just pick Google. They'll + help you set up an account. + </p> + </div> + </div> + </form> +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.cs b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.cs new file mode 100644 index 0000000..2528b36 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.cs @@ -0,0 +1,98 @@ +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Globalization; + using System.Linq; + using System.Web; + using System.Web.Security; + using System.Web.UI; + using System.Web.UI.WebControls; + using DotNetOpenAuth.InfoCard; + using DotNetOpenAuth.Messaging; + using DotNetOpenAuth.OpenId.Extensions.SimpleRegistration; + using DotNetOpenAuth.OpenId.RelyingParty; + + public partial class LoginFrame : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + if (!IsPostBack) { + // Because this page can appear as an iframe in a popup of another page, + // we need to record which page the hosting page is in order to redirect back + // to it after login is complete. + this.ClientScript.RegisterOnSubmitStatement( + this.GetType(), + "getTopWindowUrl", + "document.getElementById('topWindowUrl').value = window.parent.location.href;"); + } + } + + protected void openIdSelector_LoggedIn(object sender, OpenIdEventArgs e) { + this.LoginUser(e.ClaimedIdentifier, e.Response.FriendlyIdentifierForDisplay, e.Response.GetExtension<ClaimsResponse>()); + } + + protected void openIdSelector_ReceivedToken(object sender, DotNetOpenAuth.InfoCard.ReceivedTokenEventArgs e) { + this.LoginUser(AuthenticationToken.SynthesizeClaimedIdentifierFromInfoCard(e.Token.UniqueId), e.Token.SiteSpecificId, null); + } + + protected void openIdSelector_Failed(object sender, OpenIdEventArgs e) { + if (e.Response.Exception != null) { + this.errorMessageLabel.Text = e.Response.Exception.Message; + } + this.errorPanel.Visible = true; + } + + protected void openIdSelector_TokenProcessingError(object sender, TokenProcessingErrorEventArgs e) { + this.errorMessageLabel.Text = e.Exception.Message; + this.errorPanel.Visible = true; + } + + private void LoginUser(string claimedIdentifier, string friendlyIdentifier, ClaimsResponse claims) { + // Create an account for this user if we don't already have one. + AuthenticationToken openidToken = Global.DataContext.AuthenticationToken.FirstOrDefault(token => token.ClaimedIdentifier == claimedIdentifier); + if (openidToken == null) { + // this is a user we haven't seen before. + User user = new User(); + openidToken = new AuthenticationToken { + ClaimedIdentifier = claimedIdentifier, + FriendlyIdentifier = friendlyIdentifier, + }; + user.AuthenticationTokens.Add(openidToken); + + // Gather information about the user if it's available. + if (claims != null) { + if (!string.IsNullOrEmpty(claims.Email)) { + user.EmailAddress = claims.Email; + } + if (!string.IsNullOrEmpty(claims.FullName)) { + if (claims.FullName.IndexOf(' ') > 0) { + user.FirstName = claims.FullName.Substring(0, claims.FullName.IndexOf(' ')).Trim(); + user.LastName = claims.FullName.Substring(claims.FullName.IndexOf(' ')).Trim(); + } else { + user.FirstName = claims.FullName; + } + } + } + + Global.DataContext.AddToUser(user); + } + + bool persistentCookie = false; + if (string.IsNullOrEmpty(this.Request.QueryString["ReturnUrl"])) { + FormsAuthentication.SetAuthCookie(openidToken.ClaimedIdentifier, persistentCookie); + if (!string.IsNullOrEmpty(this.topWindowUrl.Value)) { + Uri topWindowUri = new Uri(this.topWindowUrl.Value); + string returnUrl = HttpUtility.ParseQueryString(topWindowUri.Query)["ReturnUrl"]; + if (string.IsNullOrEmpty(returnUrl)) { + Response.Redirect(this.topWindowUrl.Value); + } else { + Response.Redirect(returnUrl); + } + } else { + // This happens for unsolicited assertions. + Response.Redirect("~/"); + } + } else { + FormsAuthentication.RedirectFromLoginPage(openidToken.ClaimedIdentifier, persistentCookie); + } + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.designer.cs new file mode 100644 index 0000000..469b8a6 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/LoginFrame.aspx.designer.cs @@ -0,0 +1,61 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class LoginFrame { + + /// <summary> + /// form1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.HtmlControls.HtmlForm form1; + + /// <summary> + /// openIdSelector control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::DotNetOpenAuth.OpenId.RelyingParty.OpenIdSelector openIdSelector; + + /// <summary> + /// topWindowUrl control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.HiddenField topWindowUrl; + + /// <summary> + /// errorPanel control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Panel errorPanel; + + /// <summary> + /// errorMessageLabel control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Label errorMessageLabel; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Logout.aspx b/projecttemplates/WebFormsRelyingParty/Logout.aspx new file mode 100644 index 0000000..abba0c1 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Logout.aspx @@ -0,0 +1,16 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Logout.aspx.cs" Inherits="WebFormsRelyingParty.Logout" %> + +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> + +<html xmlns="http://www.w3.org/1999/xhtml" > +<head runat="server"> + <title></title> +</head> +<body> + <form id="form1" runat="server"> + <div> + + </div> + </form> +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/Logout.aspx.cs b/projecttemplates/WebFormsRelyingParty/Logout.aspx.cs new file mode 100644 index 0000000..0e53fac --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Logout.aspx.cs @@ -0,0 +1,11 @@ +namespace WebFormsRelyingParty { + using System; + using System.Web.Security; + + public partial class Logout : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + FormsAuthentication.SignOut(); + Response.Redirect("~/"); + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Logout.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Logout.aspx.designer.cs new file mode 100644 index 0000000..19ef79d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Logout.aspx.designer.cs @@ -0,0 +1,25 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class Logout { + + /// <summary> + /// form1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.HtmlControls.HtmlForm form1; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx new file mode 100644 index 0000000..46040ff --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx @@ -0,0 +1,99 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="AccountInfo.aspx.cs" Inherits="WebFormsRelyingParty.Members.AccountInfo" + MasterPageFile="~/Site.Master" ValidateRequest="false" %> + +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.OpenId.RelyingParty" + TagPrefix="rp" %> +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.InfoCard" TagPrefix="ic" %> +<%@ Register Assembly="System.Web.Entity, Version=3.5.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089" + Namespace="System.Web.UI.WebControls" TagPrefix="asp" %> +<asp:Content runat="server" ContentPlaceHolderID="Body"> + <asp:ScriptManager ID="ScriptManager1" runat="server" /> + <h3> + Personal information + </h3> + <asp:UpdatePanel ID="UpdatePanel1" runat="server"> + <ContentTemplate> + <table> + <tr> + <td> + First name + </td> + <td> + <asp:TextBox ID="firstNameBox" runat="server" /> + </td> + </tr> + <tr> + <td> + Last name + </td> + <td> + <asp:TextBox ID="lastNameBox" runat="server" /> + </td> + </tr> + <tr> + <td> + Email + </td> + <td> + <asp:TextBox ID="emailBox" runat="server" Columns="40" ValidationGroup="Profile" /> + <asp:RegularExpressionValidator ID="RegularExpressionValidator1" runat="server" ControlToValidate="emailBox" + ErrorMessage="Invalid email address" ValidationExpression="\w+([-+.']\w+)*@\w+([-.]\w+)*\.\w+([-.]\w+)*" + ValidationGroup="Profile">invalid</asp:RegularExpressionValidator> + </td> + </tr> + <tr> + <td> + </td> + <td> + <asp:Button ID="saveChanges" runat="server" Text="Save profile changes" OnClick="saveChanges_Click" + ValidationGroup="Profile" /> + <asp:UpdateProgress ID="UpdateProgress1" runat="server" AssociatedUpdatePanelID="UpdatePanel1" + DynamicLayout="true"> + <ProgressTemplate> + Saving... + </ProgressTemplate> + </asp:UpdateProgress> + </td> + </tr> + </table> + </ContentTemplate> + <Triggers> + <asp:AsyncPostBackTrigger ControlID="saveChanges" EventName="Click" /> + </Triggers> + </asp:UpdatePanel> + <h3> + OpenIDs & InfoCards + </h3> + <asp:Repeater ID="Repeater1" runat="server"> + <HeaderTemplate> + <ul class="AuthTokens"> + </HeaderTemplate> + <ItemTemplate> + <li class='<%# ((bool)Eval("IsInfoCard")) ? "InfoCard" : "OpenID" %>'> + <asp:Label ID="OpenIdClaimedIdentifierLabel" runat="server" Text='<%# Eval("FriendlyIdentifier") %>' + ToolTip='<%# Eval("ClaimedIdentifier") %>' /> + <asp:Label runat="server" ForeColor="Gray" Text="(current login token)" ToolTip="To delete this token, you must log in using some other token." + Visible='<%# String.Equals((string)Eval("ClaimedIdentifier"), Page.User.Identity.Name, StringComparison.Ordinal) %>' /> + <asp:LinkButton runat="server" Text="remove" CommandName="delete" CommandArgument='<%# Eval("ClaimedIdentifier") %>' + ID="deleteOpenId" OnCommand="deleteOpenId_Command" Visible='<%# !String.Equals((string)Eval("ClaimedIdentifier"), Page.User.Identity.Name, StringComparison.Ordinal) %>' /> + </li> + </ItemTemplate> + <FooterTemplate> + </ul> + </FooterTemplate> + </asp:Repeater> + <asp:Panel ID="Panel1" runat="server"> + <rp:OpenIdAjaxTextBox runat="server" ID="openIdBox" OnLoggedIn="openIdBox_LoggedIn" + AutoPostBack="true" /> + <asp:Label ID="differentAccountLabel" runat="server" EnableViewState="False" ForeColor="Red" + Text="This identifier already belongs to a different user account." Visible="False" /> + <asp:Label ID="alreadyLinkedLabel" runat="server" EnableViewState="False" ForeColor="Red" + Text="This identifier is already linked to your account." Visible="False" /> + </asp:Panel> + <asp:Panel ID="Panel2" runat="server"> + <ic:InfoCardSelector ID="InfoCardSelector1" runat="server" ImageSize="Size92x64" + ToolTip="Log in with your Information Card" OnReceivedToken="InfoCardSelector1_ReceivedToken"> + <ic:ClaimType Name="http://schemas.xmlsoap.org/ws/2005/05/identity/claims/privatepersonalidentifier" /> + </ic:InfoCardSelector> + </asp:Panel> +</asp:Content> diff --git a/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.cs b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.cs new file mode 100644 index 0000000..f35a0ce --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.cs @@ -0,0 +1,82 @@ +//----------------------------------------------------------------------- +// <copyright file="AccountInfo.aspx.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty.Members { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + using DotNetOpenAuth.InfoCard; + using DotNetOpenAuth.OpenId.RelyingParty; + + public partial class AccountInfo : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + Global.LoggedInUser.AuthenticationTokens.Load(); + this.Repeater1.DataSource = Global.LoggedInUser.AuthenticationTokens; + if (!IsPostBack) { + this.Repeater1.DataBind(); + this.emailBox.Text = Global.LoggedInUser.EmailAddress; + this.firstNameBox.Text = Global.LoggedInUser.FirstName; + this.lastNameBox.Text = Global.LoggedInUser.LastName; + } + + this.firstNameBox.Focus(); + } + + protected void openIdBox_LoggedIn(object sender, OpenIdEventArgs e) { + this.AddIdentifier(e.ClaimedIdentifier, e.Response.FriendlyIdentifierForDisplay); + this.openIdBox.Focus(); + } + + protected void deleteOpenId_Command(object sender, CommandEventArgs e) { + string claimedId = (string)e.CommandArgument; + var token = Global.DataContext.AuthenticationToken.First(t => t.ClaimedIdentifier == claimedId && t.User.Id == Global.LoggedInUser.Id); + Global.DataContext.DeleteObject(token); + Global.DataContext.SaveChanges(); + this.Repeater1.DataBind(); + } + + protected void saveChanges_Click(object sender, EventArgs e) { + if (!IsValid) { + return; + } + + Global.LoggedInUser.EmailAddress = this.emailBox.Text; + Global.LoggedInUser.FirstName = this.firstNameBox.Text; + Global.LoggedInUser.LastName = this.lastNameBox.Text; + } + + protected void InfoCardSelector1_ReceivedToken(object sender, ReceivedTokenEventArgs e) { + this.AddIdentifier(AuthenticationToken.SynthesizeClaimedIdentifierFromInfoCard(e.Token.UniqueId), e.Token.SiteSpecificId); + } + + private void AddIdentifier(string claimedId, string friendlyId) { + // Check that this identifier isn't already tied to a user account. + // We do this again here in case the LoggingIn event couldn't verify + // and in case somehow the OP changed it anyway. + var existingToken = Global.DataContext.AuthenticationToken.FirstOrDefault(token => token.ClaimedIdentifier == claimedId); + if (existingToken == null) { + var token = new AuthenticationToken(); + token.ClaimedIdentifier = claimedId; + token.FriendlyIdentifier = friendlyId; + Global.LoggedInUser.AuthenticationTokens.Add(token); + Global.DataContext.SaveChanges(); + this.Repeater1.DataBind(); + + // Clear the box for the next entry + this.openIdBox.Text = string.Empty; + } else { + if (existingToken.User == Global.LoggedInUser) { + this.alreadyLinkedLabel.Visible = true; + } else { + this.differentAccountLabel.Visible = true; + } + } + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.designer.cs new file mode 100644 index 0000000..c3f5b15 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/AccountInfo.aspx.designer.cs @@ -0,0 +1,151 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty.Members { + + + public partial class AccountInfo { + + /// <summary> + /// ScriptManager1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.ScriptManager ScriptManager1; + + /// <summary> + /// UpdatePanel1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.UpdatePanel UpdatePanel1; + + /// <summary> + /// firstNameBox control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.TextBox firstNameBox; + + /// <summary> + /// lastNameBox control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.TextBox lastNameBox; + + /// <summary> + /// emailBox control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.TextBox emailBox; + + /// <summary> + /// RegularExpressionValidator1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.RegularExpressionValidator RegularExpressionValidator1; + + /// <summary> + /// saveChanges control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Button saveChanges; + + /// <summary> + /// UpdateProgress1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.UpdateProgress UpdateProgress1; + + /// <summary> + /// Repeater1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Repeater Repeater1; + + /// <summary> + /// Panel1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Panel Panel1; + + /// <summary> + /// openIdBox control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::DotNetOpenAuth.OpenId.RelyingParty.OpenIdAjaxTextBox openIdBox; + + /// <summary> + /// differentAccountLabel control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Label differentAccountLabel; + + /// <summary> + /// alreadyLinkedLabel control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Label alreadyLinkedLabel; + + /// <summary> + /// Panel2 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Panel Panel2; + + /// <summary> + /// InfoCardSelector1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::DotNetOpenAuth.InfoCard.InfoCardSelector InfoCardSelector1; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Members/Default.aspx b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx new file mode 100644 index 0000000..157237f --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx @@ -0,0 +1,9 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Default.aspx.cs" Inherits="WebFormsRelyingParty.Members.Default" + MasterPageFile="~/Site.Master" %> + +<asp:Content runat="server" ContentPlaceHolderID="Body"> + <h2>Members Only</h2> + <div> + You've made it to the Members Only area. + </div> +</asp:Content> diff --git a/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.cs b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.cs new file mode 100644 index 0000000..8460541 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.cs @@ -0,0 +1,13 @@ +namespace WebFormsRelyingParty.Members { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + + public partial class Default : System.Web.UI.Page { + protected void Page_Load(object sender, EventArgs e) { + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.designer.cs new file mode 100644 index 0000000..2daf037 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/Default.aspx.designer.cs @@ -0,0 +1,16 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty.Members { + + + public partial class Default { + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Members/Web.config b/projecttemplates/WebFormsRelyingParty/Members/Web.config new file mode 100644 index 0000000..aafc323 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Members/Web.config @@ -0,0 +1,18 @@ +<?xml version="1.0"?> +<!-- + Note: As an alternative to hand editing this file you can use the + web admin tool to configure settings for your application. Use + the Website->Asp.Net Configuration option in Visual Studio. + A full list of settings and comments can be found in + machine.config.comments usually located in + \Windows\Microsoft.Net\Framework\v2.x\Config +--> +<configuration> + <appSettings/> + <connectionStrings/> + <system.web> + <authorization> + <deny users="?" /> + </authorization> + </system.web> +</configuration> diff --git a/projecttemplates/WebFormsRelyingParty/Model.Designer.cs b/projecttemplates/WebFormsRelyingParty/Model.Designer.cs new file mode 100644 index 0000000..5c7b138 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Model.Designer.cs @@ -0,0 +1,494 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +[assembly: global::System.Data.Objects.DataClasses.EdmSchemaAttribute()] +[assembly: global::System.Data.Objects.DataClasses.EdmRelationshipAttribute("DatabaseModel", "UserRole", "Role", global::System.Data.Metadata.Edm.RelationshipMultiplicity.Many, typeof(WebFormsRelyingParty.Role), "User", global::System.Data.Metadata.Edm.RelationshipMultiplicity.Many, typeof(WebFormsRelyingParty.User))] +[assembly: global::System.Data.Objects.DataClasses.EdmRelationshipAttribute("DatabaseModel", "UserAuthenticationToken", "User", global::System.Data.Metadata.Edm.RelationshipMultiplicity.One, typeof(WebFormsRelyingParty.User), "AuthenticationToken", global::System.Data.Metadata.Edm.RelationshipMultiplicity.Many, typeof(WebFormsRelyingParty.AuthenticationToken))] + +// Original file name: +// Generation date: 10/10/2009 9:43:51 AM +namespace WebFormsRelyingParty +{ + + /// <summary> + /// There are no comments for DatabaseEntities in the schema. + /// </summary> + public partial class DatabaseEntities : global::System.Data.Objects.ObjectContext + { + /// <summary> + /// Initializes a new DatabaseEntities object using the connection string found in the 'DatabaseEntities' section of the application configuration file. + /// </summary> + public DatabaseEntities() : + base("name=DatabaseEntities", "DatabaseEntities") + { + this.OnContextCreated(); + } + /// <summary> + /// Initialize a new DatabaseEntities object. + /// </summary> + public DatabaseEntities(string connectionString) : + base(connectionString, "DatabaseEntities") + { + this.OnContextCreated(); + } + /// <summary> + /// Initialize a new DatabaseEntities object. + /// </summary> + public DatabaseEntities(global::System.Data.EntityClient.EntityConnection connection) : + base(connection, "DatabaseEntities") + { + this.OnContextCreated(); + } + partial void OnContextCreated(); + /// <summary> + /// There are no comments for Role in the schema. + /// </summary> + public global::System.Data.Objects.ObjectQuery<Role> Role + { + get + { + if ((this._Role == null)) + { + this._Role = base.CreateQuery<Role>("[Role]"); + } + return this._Role; + } + } + private global::System.Data.Objects.ObjectQuery<Role> _Role; + /// <summary> + /// There are no comments for User in the schema. + /// </summary> + public global::System.Data.Objects.ObjectQuery<User> User + { + get + { + if ((this._User == null)) + { + this._User = base.CreateQuery<User>("[User]"); + } + return this._User; + } + } + private global::System.Data.Objects.ObjectQuery<User> _User; + /// <summary> + /// There are no comments for AuthenticationToken in the schema. + /// </summary> + public global::System.Data.Objects.ObjectQuery<AuthenticationToken> AuthenticationToken + { + get + { + if ((this._AuthenticationToken == null)) + { + this._AuthenticationToken = base.CreateQuery<AuthenticationToken>("[AuthenticationToken]"); + } + return this._AuthenticationToken; + } + } + private global::System.Data.Objects.ObjectQuery<AuthenticationToken> _AuthenticationToken; + /// <summary> + /// There are no comments for Role in the schema. + /// </summary> + public void AddToRole(Role role) + { + base.AddObject("Role", role); + } + /// <summary> + /// There are no comments for User in the schema. + /// </summary> + public void AddToUser(User user) + { + base.AddObject("User", user); + } + /// <summary> + /// There are no comments for AuthenticationToken in the schema. + /// </summary> + public void AddToAuthenticationToken(AuthenticationToken authenticationToken) + { + base.AddObject("AuthenticationToken", authenticationToken); + } + } + /// <summary> + /// There are no comments for DatabaseModel.AuthenticationToken in the schema. + /// </summary> + /// <KeyProperties> + /// Id + /// </KeyProperties> + [global::System.Data.Objects.DataClasses.EdmEntityTypeAttribute(NamespaceName="DatabaseModel", Name="AuthenticationToken")] + [global::System.Runtime.Serialization.DataContractAttribute(IsReference=true)] + [global::System.Serializable()] + public partial class AuthenticationToken : global::System.Data.Objects.DataClasses.EntityObject + { + /// <summary> + /// Create a new AuthenticationToken object. + /// </summary> + /// <param name="id">Initial value of Id.</param> + /// <param name="claimedIdentifier">Initial value of ClaimedIdentifier.</param> + public static AuthenticationToken CreateAuthenticationToken(int id, string claimedIdentifier) + { + AuthenticationToken authenticationToken = new AuthenticationToken(); + authenticationToken.Id = id; + authenticationToken.ClaimedIdentifier = claimedIdentifier; + return authenticationToken; + } + /// <summary> + /// There are no comments for Property Id in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute(EntityKeyProperty=true, IsNullable=false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public int Id + { + get + { + return this._Id; + } + set + { + this.OnIdChanging(value); + this.ReportPropertyChanging("Id"); + this._Id = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value); + this.ReportPropertyChanged("Id"); + this.OnIdChanged(); + } + } + private int _Id; + partial void OnIdChanging(int value); + partial void OnIdChanged(); + /// <summary> + /// There are no comments for Property ClaimedIdentifier in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute(IsNullable=false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string ClaimedIdentifier + { + get + { + return this._ClaimedIdentifier; + } + set + { + this.OnClaimedIdentifierChanging(value); + this.ReportPropertyChanging("ClaimedIdentifier"); + this._ClaimedIdentifier = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, false); + this.ReportPropertyChanged("ClaimedIdentifier"); + this.OnClaimedIdentifierChanged(); + } + } + private string _ClaimedIdentifier; + partial void OnClaimedIdentifierChanging(string value); + partial void OnClaimedIdentifierChanged(); + /// <summary> + /// There are no comments for Property FriendlyIdentifier in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string FriendlyIdentifier + { + get + { + return this._FriendlyIdentifier; + } + set + { + this.OnFriendlyIdentifierChanging(value); + this.ReportPropertyChanging("FriendlyIdentifier"); + this._FriendlyIdentifier = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, true); + this.ReportPropertyChanged("FriendlyIdentifier"); + this.OnFriendlyIdentifierChanged(); + } + } + private string _FriendlyIdentifier; + partial void OnFriendlyIdentifierChanging(string value); + partial void OnFriendlyIdentifierChanged(); + /// <summary> + /// There are no comments for User in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmRelationshipNavigationPropertyAttribute("DatabaseModel", "UserAuthenticationToken", "User")] + [global::System.Xml.Serialization.XmlIgnoreAttribute()] + [global::System.Xml.Serialization.SoapIgnoreAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public User User + { + get + { + return ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedReference<User>("DatabaseModel.UserAuthenticationToken", "User").Value; + } + set + { + ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedReference<User>("DatabaseModel.UserAuthenticationToken", "User").Value = value; + } + } + /// <summary> + /// There are no comments for User in the schema. + /// </summary> + [global::System.ComponentModel.BrowsableAttribute(false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public global::System.Data.Objects.DataClasses.EntityReference<User> UserReference + { + get + { + return ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedReference<User>("DatabaseModel.UserAuthenticationToken", "User"); + } + set + { + if ((value != null)) + { + ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.InitializeRelatedReference<User>("DatabaseModel.UserAuthenticationToken", "User", value); + } + } + } + } + /// <summary> + /// There are no comments for DatabaseModel.Role in the schema. + /// </summary> + /// <KeyProperties> + /// Id + /// </KeyProperties> + [global::System.Data.Objects.DataClasses.EdmEntityTypeAttribute(NamespaceName="DatabaseModel", Name="Role")] + [global::System.Runtime.Serialization.DataContractAttribute(IsReference=true)] + [global::System.Serializable()] + public partial class Role : global::System.Data.Objects.DataClasses.EntityObject + { + /// <summary> + /// Create a new Role object. + /// </summary> + /// <param name="id">Initial value of Id.</param> + /// <param name="name">Initial value of Name.</param> + public static Role CreateRole(int id, string name) + { + Role role = new Role(); + role.Id = id; + role.Name = name; + return role; + } + /// <summary> + /// There are no comments for Property Id in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute(EntityKeyProperty=true, IsNullable=false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public int Id + { + get + { + return this._Id; + } + private set + { + this.OnIdChanging(value); + this.ReportPropertyChanging("Id"); + this._Id = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value); + this.ReportPropertyChanged("Id"); + this.OnIdChanged(); + } + } + private int _Id; + partial void OnIdChanging(int value); + partial void OnIdChanged(); + /// <summary> + /// There are no comments for Property Name in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute(IsNullable=false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string Name + { + get + { + return this._Name; + } + set + { + this.OnNameChanging(value); + this.ReportPropertyChanging("Name"); + this._Name = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, false); + this.ReportPropertyChanged("Name"); + this.OnNameChanged(); + } + } + private string _Name; + partial void OnNameChanging(string value); + partial void OnNameChanged(); + /// <summary> + /// There are no comments for Users in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmRelationshipNavigationPropertyAttribute("DatabaseModel", "UserRole", "User")] + [global::System.Xml.Serialization.XmlIgnoreAttribute()] + [global::System.Xml.Serialization.SoapIgnoreAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public global::System.Data.Objects.DataClasses.EntityCollection<User> Users + { + get + { + return ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedCollection<User>("DatabaseModel.UserRole", "User"); + } + set + { + if ((value != null)) + { + ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.InitializeRelatedCollection<User>("DatabaseModel.UserRole", "User", value); + } + } + } + } + /// <summary> + /// There are no comments for DatabaseModel.User in the schema. + /// </summary> + /// <KeyProperties> + /// Id + /// </KeyProperties> + [global::System.Data.Objects.DataClasses.EdmEntityTypeAttribute(NamespaceName="DatabaseModel", Name="User")] + [global::System.Runtime.Serialization.DataContractAttribute(IsReference=true)] + [global::System.Serializable()] + public partial class User : global::System.Data.Objects.DataClasses.EntityObject + { + /// <summary> + /// Create a new User object. + /// </summary> + /// <param name="id">Initial value of Id.</param> + public static User CreateUser(int id) + { + User user = new User(); + user.Id = id; + return user; + } + /// <summary> + /// There are no comments for Property Id in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute(EntityKeyProperty=true, IsNullable=false)] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public int Id + { + get + { + return this._Id; + } + private set + { + this.OnIdChanging(value); + this.ReportPropertyChanging("Id"); + this._Id = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value); + this.ReportPropertyChanged("Id"); + this.OnIdChanged(); + } + } + private int _Id; + partial void OnIdChanging(int value); + partial void OnIdChanged(); + /// <summary> + /// There are no comments for Property FirstName in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string FirstName + { + get + { + return this._FirstName; + } + set + { + this.OnFirstNameChanging(value); + this.ReportPropertyChanging("FirstName"); + this._FirstName = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, true); + this.ReportPropertyChanged("FirstName"); + this.OnFirstNameChanged(); + } + } + private string _FirstName; + partial void OnFirstNameChanging(string value); + partial void OnFirstNameChanged(); + /// <summary> + /// There are no comments for Property LastName in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string LastName + { + get + { + return this._LastName; + } + set + { + this.OnLastNameChanging(value); + this.ReportPropertyChanging("LastName"); + this._LastName = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, true); + this.ReportPropertyChanged("LastName"); + this.OnLastNameChanged(); + } + } + private string _LastName; + partial void OnLastNameChanging(string value); + partial void OnLastNameChanged(); + /// <summary> + /// There are no comments for Property EmailAddress in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmScalarPropertyAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public string EmailAddress + { + get + { + return this._EmailAddress; + } + set + { + this.OnEmailAddressChanging(value); + this.ReportPropertyChanging("EmailAddress"); + this._EmailAddress = global::System.Data.Objects.DataClasses.StructuralObject.SetValidValue(value, true); + this.ReportPropertyChanged("EmailAddress"); + this.OnEmailAddressChanged(); + } + } + private string _EmailAddress; + partial void OnEmailAddressChanging(string value); + partial void OnEmailAddressChanged(); + /// <summary> + /// There are no comments for Roles in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmRelationshipNavigationPropertyAttribute("DatabaseModel", "UserRole", "Role")] + [global::System.Xml.Serialization.XmlIgnoreAttribute()] + [global::System.Xml.Serialization.SoapIgnoreAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public global::System.Data.Objects.DataClasses.EntityCollection<Role> Roles + { + get + { + return ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedCollection<Role>("DatabaseModel.UserRole", "Role"); + } + set + { + if ((value != null)) + { + ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.InitializeRelatedCollection<Role>("DatabaseModel.UserRole", "Role", value); + } + } + } + /// <summary> + /// There are no comments for AuthenticationTokens in the schema. + /// </summary> + [global::System.Data.Objects.DataClasses.EdmRelationshipNavigationPropertyAttribute("DatabaseModel", "UserAuthenticationToken", "AuthenticationToken")] + [global::System.Xml.Serialization.XmlIgnoreAttribute()] + [global::System.Xml.Serialization.SoapIgnoreAttribute()] + [global::System.Runtime.Serialization.DataMemberAttribute()] + public global::System.Data.Objects.DataClasses.EntityCollection<AuthenticationToken> AuthenticationTokens + { + get + { + return ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.GetRelatedCollection<AuthenticationToken>("DatabaseModel.UserAuthenticationToken", "AuthenticationToken"); + } + set + { + if ((value != null)) + { + ((global::System.Data.Objects.DataClasses.IEntityWithRelationships)(this)).RelationshipManager.InitializeRelatedCollection<AuthenticationToken>("DatabaseModel.UserAuthenticationToken", "AuthenticationToken", value); + } + } + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Model.cs b/projecttemplates/WebFormsRelyingParty/Model.cs new file mode 100644 index 0000000..53ca10f --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Model.cs @@ -0,0 +1,21 @@ +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + + public partial class AuthenticationToken { + public bool IsInfoCard { + get { return this.ClaimedIdentifier.StartsWith(UriPrefixForInfoCard); } + } + + private static string UriPrefixForInfoCard { + get { return new Uri(HttpContext.Current.Request.Url, Global.ApplicationPath + "infocard/").AbsoluteUri; } + } + + public static string SynthesizeClaimedIdentifierFromInfoCard(string uniqueId) { + string synthesizedClaimedId = UriPrefixForInfoCard + Uri.EscapeDataString(uniqueId); + return synthesizedClaimedId; + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Model.edmx b/projecttemplates/WebFormsRelyingParty/Model.edmx new file mode 100644 index 0000000..c23b3df --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Model.edmx @@ -0,0 +1,225 @@ +<?xml version="1.0" encoding="utf-8"?> +<edmx:Edmx Version="1.0" xmlns:edmx="http://schemas.microsoft.com/ado/2007/06/edmx"> + <!-- EF Runtime content --> + <edmx:Runtime> + <!-- SSDL content --> + <edmx:StorageModels> + <Schema Namespace="DatabaseModel.Store" Alias="Self" Provider="System.Data.SqlClient" ProviderManifestToken="2005" xmlns:store="http://schemas.microsoft.com/ado/2007/12/edm/EntityStoreSchemaGenerator" xmlns="http://schemas.microsoft.com/ado/2006/04/edm/ssdl"> + <EntityContainer Name="DatabaseModelStoreContainer"> + <EntitySet Name="AuthenticationToken" EntityType="DatabaseModel.Store.AuthenticationToken" store:Type="Tables" Schema="dbo" /> + <EntitySet Name="Role" EntityType="DatabaseModel.Store.Role" store:Type="Tables" Schema="dbo" /> + <EntitySet Name="User" EntityType="DatabaseModel.Store.User" store:Type="Tables" Schema="dbo" /> + <EntitySet Name="UserRole" EntityType="DatabaseModel.Store.UserRole" store:Type="Tables" Schema="dbo" /> + <AssociationSet Name="FK_AuthenticationToken_User" Association="DatabaseModel.Store.FK_AuthenticationToken_User"> + <End Role="User" EntitySet="User" /> + <End Role="AuthenticationToken" EntitySet="AuthenticationToken" /> + </AssociationSet> + <AssociationSet Name="FK_UserRole_Role" Association="DatabaseModel.Store.FK_UserRole_Role"> + <End Role="Role" EntitySet="Role" /> + <End Role="UserRole" EntitySet="UserRole" /> + </AssociationSet> + <AssociationSet Name="FK_UserRole_User" Association="DatabaseModel.Store.FK_UserRole_User"> + <End Role="User" EntitySet="User" /> + <End Role="UserRole" EntitySet="UserRole" /> + </AssociationSet> + </EntityContainer> + <EntityType Name="AuthenticationToken"> + <Key> + <PropertyRef Name="Id" /> + </Key> + <Property Name="Id" Type="int" Nullable="false" StoreGeneratedPattern="Identity" /> + <Property Name="UserId" Type="int" Nullable="false" /> + <Property Name="OpenIdClaimedIdentifier" Type="nvarchar" Nullable="false" MaxLength="250" /> + <Property Name="OpenIdFriendlyIdentifier" Type="nvarchar" MaxLength="250" /> + </EntityType> + <EntityType Name="Role"> + <Key> + <PropertyRef Name="Id" /> + </Key> + <Property Name="Id" Type="int" Nullable="false" StoreGeneratedPattern="Identity" /> + <Property Name="Name" Type="nvarchar" Nullable="false" MaxLength="50" /> + </EntityType> + <EntityType Name="User"> + <Key> + <PropertyRef Name="Id" /> + </Key> + <Property Name="Id" Type="int" Nullable="false" StoreGeneratedPattern="Identity" /> + <Property Name="FirstName" Type="nvarchar" MaxLength="50" /> + <Property Name="LastName" Type="nvarchar" MaxLength="50" /> + <Property Name="EmailAddress" Type="nvarchar" MaxLength="100" /> + </EntityType> + <EntityType Name="UserRole"> + <Key> + <PropertyRef Name="UserId" /> + <PropertyRef Name="RoleId" /> + </Key> + <Property Name="UserId" Type="int" Nullable="false" /> + <Property Name="RoleId" Type="int" Nullable="false" /> + </EntityType> + <Association Name="FK_AuthenticationToken_User"> + <End Role="User" Type="DatabaseModel.Store.User" Multiplicity="1"> + <OnDelete Action="Cascade" /> + </End> + <End Role="AuthenticationToken" Type="DatabaseModel.Store.AuthenticationToken" Multiplicity="*" /> + <ReferentialConstraint> + <Principal Role="User"> + <PropertyRef Name="Id" /> + </Principal> + <Dependent Role="AuthenticationToken"> + <PropertyRef Name="UserId" /> + </Dependent> + </ReferentialConstraint> + </Association> + <Association Name="FK_UserRole_Role"> + <End Role="Role" Type="DatabaseModel.Store.Role" Multiplicity="1"> + <OnDelete Action="Cascade" /> + </End> + <End Role="UserRole" Type="DatabaseModel.Store.UserRole" Multiplicity="*" /> + <ReferentialConstraint> + <Principal Role="Role"> + <PropertyRef Name="Id" /> + </Principal> + <Dependent Role="UserRole"> + <PropertyRef Name="RoleId" /> + </Dependent> + </ReferentialConstraint> + </Association> + <Association Name="FK_UserRole_User"> + <End Role="User" Type="DatabaseModel.Store.User" Multiplicity="1"> + <OnDelete Action="Cascade" /> + </End> + <End Role="UserRole" Type="DatabaseModel.Store.UserRole" Multiplicity="*" /> + <ReferentialConstraint> + <Principal Role="User"> + <PropertyRef Name="Id" /> + </Principal> + <Dependent Role="UserRole"> + <PropertyRef Name="UserId" /> + </Dependent> + </ReferentialConstraint> + </Association> + </Schema></edmx:StorageModels> + <!-- CSDL content --> + <edmx:ConceptualModels> + <Schema Namespace="DatabaseModel" Alias="Self" xmlns="http://schemas.microsoft.com/ado/2006/04/edm"> + <EntityContainer Name="DatabaseEntities"> + <EntitySet Name="Role" EntityType="DatabaseModel.Role" /> + <EntitySet Name="User" EntityType="DatabaseModel.User" /> + <AssociationSet Name="UserRole" Association="DatabaseModel.UserRole"> + <End Role="Role" EntitySet="Role" /> + <End Role="User" EntitySet="User" /> + </AssociationSet> + <EntitySet Name="AuthenticationToken" EntityType="DatabaseModel.AuthenticationToken" /> + <AssociationSet Name="UserAuthenticationToken" Association="DatabaseModel.UserAuthenticationToken"> + <End Role="User" EntitySet="User" /> + <End Role="AuthenticationToken" EntitySet="AuthenticationToken" /></AssociationSet> + </EntityContainer> + <EntityType Name="AuthenticationToken" Abstract="false"> + <Key> + <PropertyRef Name="Id" /></Key> + <Property Name="Id" Type="Int32" Nullable="false" a:SetterAccess="Public" xmlns:a="http://schemas.microsoft.com/ado/2006/04/codegeneration" /> + <NavigationProperty Name="User" Relationship="DatabaseModel.UserAuthenticationToken" FromRole="AuthenticationToken" ToRole="User" /> + <Property Name="ClaimedIdentifier" Type="String" Nullable="false" /> + <Property Name="FriendlyIdentifier" Type="String" Nullable="true" /></EntityType> + <EntityType Name="Role"> + <Key> + <PropertyRef Name="Id" /> + </Key> + <Property Name="Id" Type="Int32" Nullable="false" a:SetterAccess="Private" xmlns:a="http://schemas.microsoft.com/ado/2006/04/codegeneration" /> + <Property Name="Name" Type="String" Nullable="false" MaxLength="50" Unicode="true" FixedLength="false" /> + <NavigationProperty Name="Users" Relationship="DatabaseModel.UserRole" FromRole="Role" ToRole="User" /> + </EntityType> + <EntityType Name="User"> + <Key> + <PropertyRef Name="Id" /> + </Key> + <Property Name="Id" Type="Int32" Nullable="false" a:SetterAccess="Private" xmlns:a="http://schemas.microsoft.com/ado/2006/04/codegeneration" /> + <Property Name="FirstName" Type="String" MaxLength="50" Unicode="true" FixedLength="false" /> + <Property Name="LastName" Type="String" MaxLength="50" Unicode="true" FixedLength="false" /> + <Property Name="EmailAddress" Type="String" MaxLength="100" Unicode="true" FixedLength="false" /> + <NavigationProperty Name="Roles" Relationship="DatabaseModel.UserRole" FromRole="User" ToRole="Role" /> + <NavigationProperty Name="AuthenticationTokens" Relationship="DatabaseModel.UserAuthenticationToken" FromRole="User" ToRole="AuthenticationToken" /></EntityType> + <Association Name="UserRole"> + <End Role="Role" Type="DatabaseModel.Role" Multiplicity="*" /> + <End Role="User" Type="DatabaseModel.User" Multiplicity="*" /> + </Association> + <Association Name="UserAuthenticationToken"> + <End Type="DatabaseModel.User" Role="User" Multiplicity="1" /> + <End Type="DatabaseModel.AuthenticationToken" Role="AuthenticationToken" Multiplicity="*" /></Association></Schema> + </edmx:ConceptualModels> + <!-- C-S mapping content --> + <edmx:Mappings> + <Mapping Space="C-S" xmlns="urn:schemas-microsoft-com:windows:storage:mapping:CS"> + <EntityContainerMapping StorageEntityContainer="DatabaseModelStoreContainer" CdmEntityContainer="DatabaseEntities"> + <EntitySetMapping Name="Role"> + <EntityTypeMapping TypeName="IsTypeOf(DatabaseModel.Role)"> + <MappingFragment StoreEntitySet="Role"> + <ScalarProperty Name="Id" ColumnName="Id" /> + <ScalarProperty Name="Name" ColumnName="Name" /> + </MappingFragment> + </EntityTypeMapping> + </EntitySetMapping> + <EntitySetMapping Name="User"> + <EntityTypeMapping TypeName="IsTypeOf(DatabaseModel.User)"> + <MappingFragment StoreEntitySet="User"> + <ScalarProperty Name="Id" ColumnName="Id" /> + <ScalarProperty Name="FirstName" ColumnName="FirstName" /> + <ScalarProperty Name="LastName" ColumnName="LastName" /> + <ScalarProperty Name="EmailAddress" ColumnName="EmailAddress" /> + </MappingFragment> + </EntityTypeMapping> + </EntitySetMapping> + <AssociationSetMapping Name="UserRole" TypeName="DatabaseModel.UserRole" StoreEntitySet="UserRole"> + <EndProperty Name="Role"> + <ScalarProperty Name="Id" ColumnName="RoleId" /> + </EndProperty> + <EndProperty Name="User"> + <ScalarProperty Name="Id" ColumnName="UserId" /> + </EndProperty> + </AssociationSetMapping> + <EntitySetMapping Name="AuthenticationToken"><EntityTypeMapping TypeName="IsTypeOf(DatabaseModel.AuthenticationToken)"> + <MappingFragment StoreEntitySet="AuthenticationToken"> + <ScalarProperty Name="FriendlyIdentifier" ColumnName="OpenIdFriendlyIdentifier" /> + <ScalarProperty Name="ClaimedIdentifier" ColumnName="OpenIdClaimedIdentifier" /> + <ScalarProperty Name="Id" ColumnName="Id" /> + </MappingFragment> + </EntityTypeMapping> + </EntitySetMapping> + <AssociationSetMapping Name="UserAuthenticationToken" TypeName="DatabaseModel.UserAuthenticationToken" StoreEntitySet="AuthenticationToken"> + <EndProperty Name="AuthenticationToken"> + <ScalarProperty Name="Id" ColumnName="Id" /></EndProperty> + <EndProperty Name="User"> + <ScalarProperty Name="Id" ColumnName="UserId" /></EndProperty></AssociationSetMapping> + </EntityContainerMapping> + </Mapping> + </edmx:Mappings> + </edmx:Runtime> + <!-- EF Designer content (DO NOT EDIT MANUALLY BELOW HERE) --> + <edmx:Designer xmlns="http://schemas.microsoft.com/ado/2007/06/edmx"> + <edmx:Connection> + <DesignerInfoPropertySet> + <DesignerProperty Name="MetadataArtifactProcessing" Value="EmbedInOutputAssembly" /> + </DesignerInfoPropertySet> + </edmx:Connection> + <edmx:Options> + <DesignerInfoPropertySet> + <DesignerProperty Name="ValidateOnBuild" Value="true" /> + </DesignerInfoPropertySet> + </edmx:Options> + <!-- Diagram content (shape and connector positions) --> + <edmx:Diagrams> + <Diagram Name="Model"> + <EntityTypeShape EntityType="DatabaseModel.AuthenticationToken" Width="1.875" PointX="5.25" PointY="1.125" Height="1.4033821614583335" IsExpanded="true" /> + <EntityTypeShape EntityType="DatabaseModel.Role" Width="1.5" PointX="0.75" PointY="1.25" Height="1.5956835937500002" IsExpanded="true" /> + <EntityTypeShape EntityType="DatabaseModel.User" Width="1.75" PointX="2.875" PointY="0.875" Height="2.364889322916667" IsExpanded="true" /> + <AssociationConnector Association="DatabaseModel.UserRole" ManuallyRouted="false"> + <ConnectorPoint PointX="2.25" PointY="2.0478417968750002" /> + <ConnectorPoint PointX="2.875" PointY="2.0478417968750002" /></AssociationConnector> + <InheritanceConnector EntityType="DatabaseModel.AuthenticationToken"> + <ConnectorPoint PointX="6.5625" PointY="3.375" /> + <ConnectorPoint PointX="6.5625" PointY="2.9129850260416665" /></InheritanceConnector> + <AssociationConnector Association="DatabaseModel.UserAuthenticationToken"> + <ConnectorPoint PointX="4.625" PointY="1.8266910807291668" /> + <ConnectorPoint PointX="5.25" PointY="1.8266910807291668" /></AssociationConnector></Diagram></edmx:Diagrams> + </edmx:Designer> +</edmx:Edmx>
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/MyTemplate.vstemplate b/projecttemplates/WebFormsRelyingParty/MyTemplate.vstemplate new file mode 100644 index 0000000..b960809 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/MyTemplate.vstemplate @@ -0,0 +1,132 @@ +<VSTemplate Version="2.0.0" xmlns="http://schemas.microsoft.com/developer/vstemplate/2005" Type="Project"> + <TemplateData> + <Name>ASP.NET OpenID-InfoCard RP</Name> + <RequiredFrameworkVersion>3.5</RequiredFrameworkVersion> + <Description>An ASP.NET web forms web site that accepts OpenID and InfoCard logins</Description> + <ProjectType>CSharp</ProjectType> + <ProjectSubType>Web</ProjectSubType> + <NumberOfParentCategoriesToRollUp>2</NumberOfParentCategoriesToRollUp> + <SortOrder>1000</SortOrder> + <CreateNewFolder>true</CreateNewFolder> + <DefaultName>WebRPApplication</DefaultName> + <ProvideDefaultName>true</ProvideDefaultName> + <LocationField>Enabled</LocationField> + <EnableLocationBrowseButton>true</EnableLocationBrowseButton> + <Icon>__TemplateIcon.ico</Icon> + </TemplateData> + <TemplateContent> + <Project TargetFileName="WebFormsRelyingParty.csproj" File="WebFormsRelyingParty.csproj" ReplaceParameters="true"> + <Folder Name="Admin" TargetFolderName="Admin"> + <ProjectItem ReplaceParameters="true" TargetFileName="Admin.Master">Admin.Master</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Admin.Master.cs">Admin.Master.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Admin.Master.designer.cs">Admin.Master.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="CreateDatabase.sql">CreateDatabase.sql</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx">Default.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.cs">Default.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.designer.cs">Default.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Web.config">Web.config</ProjectItem> + </Folder> + <Folder Name="App_Data" TargetFolderName="App_Data" /> + <Folder Name="bin" TargetFolderName="bin"> + <ProjectItem ReplaceParameters="false" TargetFileName="DotNetOpenAuth.dll">DotNetOpenAuth.dll</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="DotNetOpenAuth.Contracts.dll">DotNetOpenAuth.Contracts.dll</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="DotNetOpenAuth.pdb">DotNetOpenAuth.pdb</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="DotNetOpenAuth.xml">DotNetOpenAuth.xml</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="log4net.dll">log4net.dll</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="log4net.xml">log4net.xml</ProjectItem> + </Folder> + <Folder Name="Code" TargetFolderName="Code"> + <ProjectItem ReplaceParameters="true" TargetFileName="DataRoleProvider.cs">DataRoleProvider.cs</ProjectItem> + </Folder> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx">Default.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.cs">Default.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.designer.cs">Default.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Global.asax">Global.asax</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Global.asax.cs">Global.asax.cs</ProjectItem> + <Folder Name="images" TargetFolderName="images"> + <ProjectItem ReplaceParameters="false" TargetFileName="google.gif">google.gif</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="infocard_23x16.png">infocard_23x16.png</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="openid_login.gif">openid_login.gif</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="yahoo.gif">yahoo.gif</ProjectItem> + <ProjectItem>myopenid.png</ProjectItem> + <ProjectItem>openid.gif</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="yahoo_login.png">yahoo_login.png</ProjectItem> + </Folder> + <ProjectItem ReplaceParameters="true" TargetFileName="Login.aspx">Login.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Login.aspx.cs">Login.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Login.aspx.designer.cs">Login.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="LoginFrame.aspx">LoginFrame.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="LoginFrame.aspx.cs">LoginFrame.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="LoginFrame.aspx.designer.cs">LoginFrame.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Logout.aspx">Logout.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Logout.aspx.cs">Logout.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Logout.aspx.designer.cs">Logout.aspx.designer.cs</ProjectItem> + <Folder Name="Members" TargetFolderName="Members"> + <ProjectItem ReplaceParameters="true" TargetFileName="AccountInfo.aspx">AccountInfo.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="AccountInfo.aspx.cs">AccountInfo.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="AccountInfo.aspx.designer.cs">AccountInfo.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx">Default.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.cs">Default.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Default.aspx.designer.cs">Default.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Web.config">Web.config</ProjectItem> + </Folder> + <ProjectItem ReplaceParameters="true" TargetFileName="Model.cs">Model.cs</ProjectItem> + <ProjectItem ReplaceParameters="false" TargetFileName="Model.edmx">Model.edmx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Model.Designer.cs">Model.Designer.cs</ProjectItem> + <Folder Name="Properties" TargetFolderName="Properties"> + <ProjectItem ReplaceParameters="true" TargetFileName="AssemblyInfo.cs">AssemblyInfo.cs</ProjectItem> + </Folder> + <Folder Name="scripts" TargetFolderName="scripts"> + <ProjectItem>jquery-1.3.1.js</ProjectItem> + <ProjectItem>jquery-ui-personalized-1.6rc6.js</ProjectItem> + <ProjectItem>jquery-ui-personalized-1.6rc6.min.js</ProjectItem> + <ProjectItem>jquery.cookie.js</ProjectItem> + <ProjectItem>LoginLink.js</ProjectItem> + </Folder> + <Folder Name="styles"> + <ProjectItem>loginpopup.css</ProjectItem> + <ProjectItem>Standard.css</ProjectItem> + </Folder> + <Folder Name="theme"> + <Folder Name="images"> + <ProjectItem>ui-bg_flat_55_999999_40x100.png</ProjectItem> + <ProjectItem>ui-bg_flat_75_aaaaaa_40x100.png</ProjectItem> + <ProjectItem>ui-bg_glass_45_0078ae_1x400.png</ProjectItem> + <ProjectItem>ui-bg_glass_55_f8da4e_1x400.png</ProjectItem> + <ProjectItem>ui-bg_glass_75_79c9ec_1x400.png</ProjectItem> + <ProjectItem>ui-bg_gloss-wave_45_e14f1c_500x100.png</ProjectItem> + <ProjectItem>ui-bg_gloss-wave_50_6eac2c_500x100.png</ProjectItem> + <ProjectItem>ui-bg_gloss-wave_75_2191c0_500x100.png</ProjectItem> + <ProjectItem>ui-bg_inset-hard_100_fcfdfd_1x100.png</ProjectItem> + <ProjectItem>ui-icons_0078ae_256x240.png</ProjectItem> + <ProjectItem>ui-icons_056b93_256x240.png</ProjectItem> + <ProjectItem>ui-icons_d8e7f3_256x240.png</ProjectItem> + <ProjectItem>ui-icons_e0fdff_256x240.png</ProjectItem> + <ProjectItem>ui-icons_f5e175_256x240.png</ProjectItem> + <ProjectItem>ui-icons_f7a50d_256x240.png</ProjectItem> + <ProjectItem>ui-icons_fcd113_256x240.png</ProjectItem> + </Folder> + <ProjectItem>ui.accordion.css</ProjectItem> + <ProjectItem>ui.all.css</ProjectItem> + <ProjectItem>ui.base.css</ProjectItem> + <ProjectItem>ui.core.css</ProjectItem> + <ProjectItem>ui.datepicker.css</ProjectItem> + <ProjectItem>ui.dialog.css</ProjectItem> + <ProjectItem>ui.progressbar.css</ProjectItem> + <ProjectItem>ui.resizable.css</ProjectItem> + <ProjectItem>ui.slider.css</ProjectItem> + <ProjectItem>ui.tabs.css</ProjectItem> + <ProjectItem>ui.theme.css</ProjectItem> + </Folder> + <ProjectItem ReplaceParameters="true" TargetFileName="Setup.aspx">Setup.aspx</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Setup.aspx.cs">Setup.aspx.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Setup.aspx.designer.cs">Setup.aspx.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Site.Master">Site.Master</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Site.Master.cs">Site.Master.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Site.Master.designer.cs">Site.Master.designer.cs</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="GettingStarted.htm" OpenInWebBrowser="true">GettingStarted.htm</ProjectItem> + <ProjectItem ReplaceParameters="true" TargetFileName="Web.config">Web.config</ProjectItem> + <ProjectItem>xrds.aspx</ProjectItem> + </Project> + </TemplateContent> +</VSTemplate>
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/Properties/AssemblyInfo.cs b/projecttemplates/WebFormsRelyingParty/Properties/AssemblyInfo.cs new file mode 100644 index 0000000..78ec7de --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Properties/AssemblyInfo.cs @@ -0,0 +1,41 @@ +//----------------------------------------------------------------------- +// <copyright file="AssemblyInfo.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// General Information about an assembly is controlled through the following +// set of attributes. Change these attribute values to modify the information +// associated with an assembly. +[assembly: AssemblyTitle("WebFormsRelyingParty")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("")] +[assembly: AssemblyProduct("WebFormsRelyingParty")] +[assembly: AssemblyCopyright("Copyright © 2009")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Setting ComVisible to false makes the types in this assembly not visible +// to COM components. If you need to access a type in this assembly from +// COM, set the ComVisible attribute to true on that type. +[assembly: ComVisible(false)] + +// The following GUID is for the ID of the typelib if this project is exposed to COM +[assembly: Guid("3d5900ae-111a-45be-96b3-d9e4606ca793")] + +// Version information for an assembly consists of the following four values: +// +// Major Version +// Minor Version +// Build Number +// Revision +// +// You can specify all the values or you can default the Revision and Build Numbers +// by using the '*' as shown below: +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")] diff --git a/projecttemplates/WebFormsRelyingParty/Setup.aspx b/projecttemplates/WebFormsRelyingParty/Setup.aspx new file mode 100644 index 0000000..128bb6d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Setup.aspx @@ -0,0 +1,43 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Setup.aspx.cs" Inherits="WebFormsRelyingParty.Setup" %> + +<%@ Register Assembly="DotNetOpenAuth" Namespace="DotNetOpenAuth.OpenId.RelyingParty" + TagPrefix="rp" %> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head runat="server"> + <title>OpenID RP one-time setup</title> +</head> +<body> + <form id="form1" runat="server"> + <h2> + First steps: + </h2> + <asp:MultiView ID="MultiView1" runat="server" ActiveViewIndex="0"> + <asp:View ID="View1" runat="server"> + <p> + Before you can use this site, you must create your SQL database that will store + your user accounts and add an admin account to that database. + Just tell me what OpenID you will use to administer the site. + </p> + <rp:OpenIdLogin runat="server" ButtonText="Create database" ID="openidLogin" + OnLoggingIn="openidLogin_LoggingIn" + TabIndex="1" LabelText="Administrator's OpenID:" + ButtonToolTip="Clicking this button will create the database and initialize the OpenID you specify as an admin of this web site." + RegisterText="get an OpenID" /> + <asp:Label ID="noOPIdentifierLabel" Visible="false" EnableViewState="false" ForeColor="Red" Font-Bold="true" runat="server" Text="Sorry. To help your admin account remain functional when you push this web site to production, directed identity is disabled on this page. Please use your personal claimed identifier." /> + </asp:View> + <asp:View ID="View2" runat="server"> + <p> + Your database has been successfully initialized. + </p> + <p> + <b>Remember to delete this Setup.aspx page.</b> + </p> + <p> + Visit the <a href="Default.aspx">home page</a>. + </p> + </asp:View> + </asp:MultiView> + </form> +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/Setup.aspx.cs b/projecttemplates/WebFormsRelyingParty/Setup.aspx.cs new file mode 100644 index 0000000..4f73c5f --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Setup.aspx.cs @@ -0,0 +1,64 @@ +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Globalization; + using System.IO; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + using DotNetOpenAuth.OpenId; + using DotNetOpenAuth.OpenId.RelyingParty; + using Microsoft.SqlServer.Management.Common; + using Microsoft.SqlServer.Management.Smo; + + public partial class Setup : System.Web.UI.Page { + private bool databaseCreated; + + protected void Page_Load(object sender, EventArgs e) { + if (!Page.IsPostBack) { + this.openidLogin.Focus(); + } + } + + protected void openidLogin_LoggingIn(object sender, OpenIdEventArgs e) { + // We don't actually want to log in... we just want the claimed identifier. + e.Cancel = true; + if (e.IsDirectedIdentity) { + this.noOPIdentifierLabel.Visible = true; + } else if (!this.databaseCreated) { + this.CreateDatabase(e.ClaimedIdentifier, this.openidLogin.Text); + this.MultiView1.ActiveViewIndex = 1; + + // indicate we have already created the database so that if the + // identifier the user gave has multiple service endpoints, + // we won't try to recreate the database as the next one is considered. + this.databaseCreated = true; + } + } + + private void CreateDatabase(Identifier claimedId, string friendlyId) { + const string SqlFormat = @" +CREATE DATABASE [{0}] ON (NAME='{0}', FILENAME='{0}') +GO +USE ""{0}"" +GO +{1} +EXEC [dbo].[AddUser] 'admin', 'admin', '{2}', '{3}' +GO +"; + string databasePath = HttpContext.Current.Server.MapPath("~/App_Data/Database.mdf"); + string schemaSql = File.ReadAllText(HttpContext.Current.Server.MapPath("~/Admin/CreateDatabase.sql")); + string sql = string.Format(CultureInfo.InvariantCulture, SqlFormat, databasePath, schemaSql, claimedId, "Admin"); + + var serverConnection = new ServerConnection(".\\sqlexpress"); + try { + serverConnection.ExecuteNonQuery(sql); + var server = new Server(serverConnection); + server.DetachDatabase(databasePath, true); + } finally { + serverConnection.Disconnect(); + } + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Setup.aspx.designer.cs b/projecttemplates/WebFormsRelyingParty/Setup.aspx.designer.cs new file mode 100644 index 0000000..a51ceed --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Setup.aspx.designer.cs @@ -0,0 +1,70 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class Setup { + + /// <summary> + /// form1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.HtmlControls.HtmlForm form1; + + /// <summary> + /// MultiView1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.MultiView MultiView1; + + /// <summary> + /// View1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.View View1; + + /// <summary> + /// openidLogin control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::DotNetOpenAuth.OpenId.RelyingParty.OpenIdLogin openidLogin; + + /// <summary> + /// noOPIdentifierLabel control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.Label noOPIdentifierLabel; + + /// <summary> + /// View2 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.View View2; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Site.Master b/projecttemplates/WebFormsRelyingParty/Site.Master new file mode 100644 index 0000000..23241b7 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Site.Master @@ -0,0 +1,49 @@ +<%@ Master Language="C#" AutoEventWireup="true" CodeBehind="Site.master.cs" Inherits="WebFormsRelyingParty.Site" %> + +<%@ Import Namespace="WebFormsRelyingParty" %> +<%@ Import Namespace="System.Linq" %> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head runat="server"> + <title><%=Page.Title %></title> + <link type="text/css" href="theme/ui.all.css" rel="Stylesheet" /> + <link href="styles/Standard.css" rel="stylesheet" type="text/css" /> + <asp:ContentPlaceHolder ID="head" runat="server" /> +</head> +<body> + <form id="form1" runat="server"> + <div style="float: right"> + <asp:LoginView runat="server"> + <LoggedInTemplate> + <%= Global.DataContext.AuthenticationToken.First(token => token.ClaimedIdentifier == Page.User.Identity.Name).FriendlyIdentifier %> + | <asp:HyperLink runat="server" NavigateUrl="~/" Text="Home" /> | <asp:HyperLink + runat="server" NavigateUrl="~/Members/AccountInfo.aspx" Text="Account" /> | + <asp:LoginStatus ID="LoginStatus1" runat="server" /> + </LoggedInTemplate> + <AnonymousTemplate> + <% if (Page.Request.Path != FormsAuthentication.LoginUrl) {%> + <a href="#" class="loginPopupLink">Login</a> + <% } %> + </AnonymousTemplate> + </asp:LoginView> + </div> + <div> + <h1><asp:HyperLink runat="server" NavigateUrl="~/" Text="Adventure Works" /></h1> + <asp:ContentPlaceHolder ID="Body" runat="server"/> + </div> + </form> + +<% if (Request.Url.IsLoopback) { %> + <script type="text/javascript" src="scripts/jquery-1.3.1.js"></script> + <script type="text/javascript" src="scripts/jquery-ui-personalized-1.6rc6.js"></script> +<% } else { %> + <script type="text/javascript" language="javascript" src="http://www.google.com/jsapi"></script> + <script type="text/javascript" language="javascript"> + google.load("jquery", "1.3.2"); + google.load("jqueryui", "1.7.2"); + </script> +<% } %> + + <script type="text/javascript" language="javascript" src="scripts/LoginLink.js"></script> +</body> +</html> diff --git a/projecttemplates/WebFormsRelyingParty/Site.Master.cs b/projecttemplates/WebFormsRelyingParty/Site.Master.cs new file mode 100644 index 0000000..b6a4f1d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Site.Master.cs @@ -0,0 +1,19 @@ +//----------------------------------------------------------------------- +// <copyright file="Site.Master.cs" company="Andrew Arnott"> +// Copyright (c) Andrew Arnott. All rights reserved. +// </copyright> +//----------------------------------------------------------------------- + +namespace WebFormsRelyingParty { + using System; + using System.Collections.Generic; + using System.Linq; + using System.Web; + using System.Web.UI; + using System.Web.UI.WebControls; + + public partial class Site : System.Web.UI.MasterPage { + protected void Page_Load(object sender, EventArgs e) { + } + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Site.Master.designer.cs b/projecttemplates/WebFormsRelyingParty/Site.Master.designer.cs new file mode 100644 index 0000000..f6d2225 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Site.Master.designer.cs @@ -0,0 +1,43 @@ +//------------------------------------------------------------------------------ +// <auto-generated> +// This code was generated by a tool. +// Runtime Version:2.0.50727.4927 +// +// Changes to this file may cause incorrect behavior and will be lost if +// the code is regenerated. +// </auto-generated> +//------------------------------------------------------------------------------ + +namespace WebFormsRelyingParty { + + + public partial class Site { + + /// <summary> + /// head control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.ContentPlaceHolder head; + + /// <summary> + /// form1 control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.HtmlControls.HtmlForm form1; + + /// <summary> + /// Body control. + /// </summary> + /// <remarks> + /// Auto-generated field. + /// To modify move field declaration from designer file to code-behind file. + /// </remarks> + protected global::System.Web.UI.WebControls.ContentPlaceHolder Body; + } +} diff --git a/projecttemplates/WebFormsRelyingParty/Web.config b/projecttemplates/WebFormsRelyingParty/Web.config new file mode 100644 index 0000000..3c7aaae --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/Web.config @@ -0,0 +1,179 @@ +<?xml version="1.0"?> +<configuration> + <configSections> + <section name="uri" type="System.Configuration.UriSection, System, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089" /> + <section name="log4net" type="log4net.Config.Log4NetConfigurationSectionHandler" requirePermission="false" /> + <section name="dotNetOpenAuth" type="DotNetOpenAuth.Configuration.DotNetOpenAuthSection" requirePermission="false" allowLocation="true" /> + <sectionGroup name="system.web.extensions" type="System.Web.Configuration.SystemWebExtensionsSectionGroup, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <sectionGroup name="scripting" type="System.Web.Configuration.ScriptingSectionGroup, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="scriptResourceHandler" type="System.Web.Configuration.ScriptingScriptResourceHandlerSection, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" allowDefinition="MachineToApplication" /> + <sectionGroup name="webServices" type="System.Web.Configuration.ScriptingWebServicesSectionGroup, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="jsonSerialization" type="System.Web.Configuration.ScriptingJsonSerializationSection, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" allowDefinition="Everywhere" /> + <section name="profileService" type="System.Web.Configuration.ScriptingProfileServiceSection, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" allowDefinition="MachineToApplication" /> + <section name="authenticationService" type="System.Web.Configuration.ScriptingAuthenticationServiceSection, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" allowDefinition="MachineToApplication" /> + <section name="roleService" type="System.Web.Configuration.ScriptingRoleServiceSection, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" allowDefinition="MachineToApplication" /> + </sectionGroup> + </sectionGroup> + </sectionGroup> + </configSections> + <!-- The uri section is necessary to turn on .NET 3.5 support for IDN (international domain names), + which is necessary for OpenID urls with unicode characters in the domain/host name. + It is also required to put the Uri class into RFC 3986 escaping mode, which OpenID and OAuth require. --> + <uri> + <idn enabled="All" /> + <iriParsing enabled="true" /> + </uri> + <system.net> + <defaultProxy enabled="true" /> + <settings> + <!-- This setting causes .NET to check certificate revocation lists (CRL) + before trusting HTTPS certificates. But this setting tends to not + be allowed in shared hosting environments. --> + <servicePointManager checkCertificateRevocationList="true" /> + </settings> + </system.net> + <!-- this is an optional configuration section where aspects of dotnetopenauth can be customized --> + <dotNetOpenAuth> + <openid> + <relyingParty> + <behaviors> + <!-- The following OPTIONAL behavior allows RPs to use SREG only, but be compatible + with OPs that use Attribute Exchange (in various formats). --> + <add type="DotNetOpenAuth.OpenId.Behaviors.AXFetchAsSregTransform, DotNetOpenAuth" /> + </behaviors> + </relyingParty> + </openid> + </dotNetOpenAuth> + <!-- log4net is a 3rd party (free) logger library that dotnetopenid will use if present but does not require. --> + <log4net> + <!--<appender name="RollingFileAppender" type="log4net.Appender.RollingFileAppender"> + <file value="RelyingParty.log" /> + <appendToFile value="true" /> + <rollingStyle value="Size" /> + <maxSizeRollBackups value="10" /> + <maximumFileSize value="100KB" /> + <staticLogFileName value="true" /> + <layout type="log4net.Layout.PatternLayout"> + <conversionPattern value="%date (GMT%date{%z}) [%thread] %-5level %logger - %message%newline" /> + </layout> + </appender>--> + <!-- Setup the root category, add the appenders and set the default level --> + <root> + <level value="WARN" /> + <appender-ref ref="RollingFileAppender" /> + </root> + <!-- Specify the level for some specific categories --> + <logger name="DotNetOpenAuth"> + <level value="WARN" /> + </logger> + </log4net> + <appSettings /> + <connectionStrings> + <add name="DatabaseEntities" connectionString="metadata=res://*/Model.csdl|res://*/Model.ssdl|res://*/Model.msl;provider=System.Data.SqlClient;provider connection string="Data Source=.\SQLEXPRESS;AttachDbFilename=|DataDirectory|\Database.mdf;Integrated Security=True;User Instance=True;MultipleActiveResultSets=True"" providerName="System.Data.EntityClient" /> + </connectionStrings> + <system.web> + <!-- + Set compilation debug="true" to insert debugging + symbols into the compiled page. Because this + affects performance, set this value to true only + during development. + --> + <compilation debug="true"> + <assemblies> + <add assembly="System.Core, Version=3.5.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> + <add assembly="System.Data.DataSetExtensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> + <add assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Xml.Linq, Version=3.5.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> + <add assembly="System.Data.Entity, Version=3.5.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089" /> + <add assembly="System.Web.Entity, Version=3.5.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> + </assemblies> + </compilation> + <!-- + The <authentication> section enables configuration + of the security authentication mode used by + ASP.NET to identify an incoming user. + --> + <authentication mode="Forms"> + <forms loginUrl="~/login.aspx" /> + </authentication> + <!-- + The <customErrors> section enables configuration + of what to do if/when an unhandled error occurs + during the execution of a request. Specifically, + it enables developers to configure html error pages + to be displayed in place of a error stack trace. + + <customErrors mode="RemoteOnly" defaultRedirect="GenericErrorPage.htm"> + <error statusCode="403" redirect="NoAccess.htm" /> + <error statusCode="404" redirect="FileNotFound.htm" /> + </customErrors> + --> + <pages> + <controls> + <add tagPrefix="asp" namespace="System.Web.UI" assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add tagPrefix="asp" namespace="System.Web.UI.WebControls" assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + </controls> + </pages> + <httpHandlers> + <remove verb="*" path="*.asmx" /> + <add verb="*" path="*.asmx" validate="false" type="System.Web.Script.Services.ScriptHandlerFactory, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add verb="*" path="*_AppService.axd" validate="false" type="System.Web.Script.Services.ScriptHandlerFactory, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add verb="GET,HEAD" path="ScriptResource.axd" type="System.Web.Handlers.ScriptResourceHandler, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" validate="false" /> + </httpHandlers> + <httpModules> + <add name="ScriptModule" type="System.Web.Handlers.ScriptModule, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + </httpModules> + <roleManager enabled="true" defaultProvider="Database"> + <providers> + <add name="Database" type="WebFormsRelyingParty.Code.DataRoleProvider" /> + </providers> + </roleManager> + </system.web> + <system.codedom> + <compilers> + <compiler language="c#;cs;csharp" extension=".cs" warningLevel="4" type="Microsoft.CSharp.CSharpCodeProvider, System, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089"> + <providerOption name="CompilerVersion" value="v3.5" /> + <providerOption name="WarnAsError" value="false" /> + </compiler> + </compilers> + </system.codedom> + <!-- + The system.webServer section is required for running ASP.NET AJAX under Internet + Information Services 7.0. It is not necessary for previous version of IIS. + --> + <system.webServer> + <validation validateIntegratedModeConfiguration="false" /> + <modules> + <remove name="ScriptModule" /> + <add name="ScriptModule" preCondition="managedHandler" type="System.Web.Handlers.ScriptModule, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + </modules> + <handlers> + <remove name="WebServiceHandlerFactory-Integrated" /> + <remove name="ScriptHandlerFactory" /> + <remove name="ScriptHandlerFactoryAppServices" /> + <remove name="ScriptResource" /> + <add name="ScriptHandlerFactory" verb="*" path="*.asmx" preCondition="integratedMode" type="System.Web.Script.Services.ScriptHandlerFactory, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add name="ScriptHandlerFactoryAppServices" verb="*" path="*_AppService.axd" preCondition="integratedMode" type="System.Web.Script.Services.ScriptHandlerFactory, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add name="ScriptResource" preCondition="integratedMode" verb="GET,HEAD" path="ScriptResource.axd" type="System.Web.Handlers.ScriptResourceHandler, System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + </handlers> + </system.webServer> + <runtime> + <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> + <dependentAssembly> + <assemblyIdentity name="System.Web.Extensions" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-1.1.0.0" newVersion="3.5.0.0" /> + </dependentAssembly> + <dependentAssembly> + <assemblyIdentity name="System.Web.Extensions.Design" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-1.1.0.0" newVersion="3.5.0.0" /> + </dependentAssembly> + </assemblyBinding> + </runtime> + <location path="default.aspx"> + <system.web> + <authorization> + <allow users="*" /> + </authorization> + </system.web> + </location> +</configuration>
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/WebFormsRelyingParty.csproj b/projecttemplates/WebFormsRelyingParty/WebFormsRelyingParty.csproj new file mode 100644 index 0000000..824195a --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/WebFormsRelyingParty.csproj @@ -0,0 +1,281 @@ +<Project ToolsVersion="3.5" DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003"> + <PropertyGroup> + <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> + <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform> + <ProductVersion>9.0.30729</ProductVersion> + <SchemaVersion>2.0</SchemaVersion> + <ProjectGuid>{A78F8FC6-7B03-4230-BE41-761E400D6810}</ProjectGuid> + <ProjectTypeGuids>{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> + <OutputType>Library</OutputType> + <AppDesignerFolder>Properties</AppDesignerFolder> + <RootNamespace>WebFormsRelyingParty</RootNamespace> + <AssemblyName>WebFormsRelyingParty</AssemblyName> + <TargetFrameworkVersion>v3.5</TargetFrameworkVersion> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> + <DebugSymbols>true</DebugSymbols> + <DebugType>full</DebugType> + <Optimize>false</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>DEBUG;TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' "> + <DebugType>pdbonly</DebugType> + <Optimize>true</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <ItemGroup> + <Reference Include="log4net, Version=1.2.10.0, Culture=neutral, PublicKeyToken=1b44e1d426115821, processorArchitecture=MSIL"> + <SpecificVersion>False</SpecificVersion> + <HintPath>..\..\lib\log4net.dll</HintPath> + </Reference> + <Reference Include="Microsoft.SqlServer.ConnectionInfo" /> + <Reference Include="Microsoft.SqlServer.Smo" /> + <Reference Include="Microsoft.SqlServer.Management.Sdk.Sfc" /> + <Reference Include="System" /> + <Reference Include="System.Data" /> + <Reference Include="System.Core"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Data.DataSetExtensions"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Data.Entity"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Data.Linq"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Runtime.Serialization"> + <RequiredTargetFramework>3.0</RequiredTargetFramework> + </Reference> + <Reference Include="System.Security" /> + <Reference Include="System.ServiceModel"> + <RequiredTargetFramework>3.0</RequiredTargetFramework> + </Reference> + <Reference Include="System.Web.Entity, Version=3.5.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089, processorArchitecture=MSIL"> + <SpecificVersion>False</SpecificVersion> + <HintPath>..\..\..\Windows\assembly\GAC_MSIL\System.Web.Entity\3.5.0.0__b77a5c561934e089\System.Web.Entity.dll</HintPath> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Web.Extensions"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Xml.Linq"> + <RequiredTargetFramework>3.5</RequiredTargetFramework> + </Reference> + <Reference Include="System.Drawing" /> + <Reference Include="System.Web" /> + <Reference Include="System.Xml" /> + <Reference Include="System.Configuration" /> + <Reference Include="System.Web.Services" /> + <Reference Include="System.EnterpriseServices" /> + <Reference Include="System.Web.Mobile" /> + </ItemGroup> + <ItemGroup> + <Content Include="Members\AccountInfo.aspx" /> + <Content Include="Default.aspx" /> + <Content Include="Login.aspx" /> + <Content Include="Web.config" /> + </ItemGroup> + <ItemGroup> + <Compile Include="LoginFrame.aspx.cs"> + <DependentUpon>LoginFrame.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="LoginFrame.aspx.designer.cs"> + <DependentUpon>LoginFrame.aspx</DependentUpon> + </Compile> + <Compile Include="Members\AccountInfo.aspx.cs"> + <DependentUpon>AccountInfo.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Members\AccountInfo.aspx.designer.cs"> + <DependentUpon>AccountInfo.aspx</DependentUpon> + </Compile> + <Compile Include="Admin\Admin.Master.cs"> + <DependentUpon>Admin.Master</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Admin\Admin.Master.designer.cs"> + <DependentUpon>Admin.Master</DependentUpon> + </Compile> + <Compile Include="Admin\Default.aspx.cs"> + <DependentUpon>Default.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Admin\Default.aspx.designer.cs"> + <DependentUpon>Default.aspx</DependentUpon> + </Compile> + <Compile Include="Default.aspx.cs"> + <SubType>ASPXCodeBehind</SubType> + <DependentUpon>Default.aspx</DependentUpon> + </Compile> + <Compile Include="Default.aspx.designer.cs"> + <DependentUpon>Default.aspx</DependentUpon> + </Compile> + <Compile Include="Global.asax.cs"> + <DependentUpon>Global.asax</DependentUpon> + </Compile> + <Compile Include="Login.aspx.cs"> + <DependentUpon>Login.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Login.aspx.designer.cs"> + <DependentUpon>Login.aspx</DependentUpon> + </Compile> + <Compile Include="Logout.aspx.cs"> + <DependentUpon>Logout.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Logout.aspx.designer.cs"> + <DependentUpon>Logout.aspx</DependentUpon> + </Compile> + <Compile Include="Members\Default.aspx.cs"> + <DependentUpon>Default.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Members\Default.aspx.designer.cs"> + <DependentUpon>Default.aspx</DependentUpon> + </Compile> + <Compile Include="Model.cs" /> + <Compile Include="Model.Designer.cs"> + <AutoGen>True</AutoGen> + <DesignTime>True</DesignTime> + <DependentUpon>Model.edmx</DependentUpon> + </Compile> + <Compile Include="Properties\AssemblyInfo.cs" /> + <EntityDeploy Include="Model.edmx"> + <Generator>EntityModelCodeGenerator</Generator> + <LastGenOutput>Model.Designer.cs</LastGenOutput> + </EntityDeploy> + <Compile Include="Code\DataRoleProvider.cs"> + </Compile> + <Compile Include="Setup.aspx.cs"> + <DependentUpon>Setup.aspx</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Setup.aspx.designer.cs"> + <DependentUpon>Setup.aspx</DependentUpon> + </Compile> + <Compile Include="Site.Master.cs"> + <DependentUpon>Site.Master</DependentUpon> + <SubType>ASPXCodeBehind</SubType> + </Compile> + <Compile Include="Site.Master.designer.cs"> + <DependentUpon>Site.Master</DependentUpon> + </Compile> + </ItemGroup> + <ItemGroup> + <Service Include="{3259AA49-8AA1-44D3-9025-A0B520596A8C}" /> + </ItemGroup> + <ItemGroup> + <Content Include="Admin\Default.aspx" /> + <Content Include="Admin\Web.config" /> + <Content Include="Global.asax" /> + <Content Include="Site.Master" /> + </ItemGroup> + <ItemGroup> + <Content Include="Admin\Admin.Master" /> + <Content Include="images\google.gif" /> + <Content Include="images\yahoo.gif" /> + <Content Include="styles\Standard.css" /> + </ItemGroup> + <ItemGroup> + <Content Include="bin\DotNetOpenAuth.dll" /> + <Content Include="bin\DotNetOpenAuth.pdb" /> + <Content Include="bin\DotNetOpenAuth.xml" /> + <Content Include="bin\log4net.dll" /> + <Content Include="bin\log4net.xml" /> + <Content Include="GettingStarted.htm" /> + <Content Include="images\infocard_23x16.png" /> + <Content Include="images\myopenid.png" /> + <Content Include="images\openid.gif" /> + <Content Include="images\openid_login.gif" /> + <Content Include="images\yahoo_login.png" /> + <Content Include="LoginFrame.aspx" /> + <Content Include="Logout.aspx" /> + <Content Include="Members\Default.aspx" /> + <Content Include="Members\Web.config" /> + <Content Include="scripts\jquery-1.3.1.js" /> + <Content Include="scripts\jquery-ui-personalized-1.6rc6.js" /> + <Content Include="scripts\jquery-ui-personalized-1.6rc6.min.js" /> + <Content Include="scripts\jquery.cookie.js" /> + <Content Include="scripts\LoginLink.js" /> + <Content Include="Setup.aspx" /> + <Content Include="styles\loginpopup.css" /> + <Content Include="theme\images\ui-bg_flat_55_999999_40x100.png" /> + <Content Include="theme\images\ui-bg_flat_75_aaaaaa_40x100.png" /> + <Content Include="theme\images\ui-bg_glass_45_0078ae_1x400.png" /> + <Content Include="theme\images\ui-bg_glass_55_f8da4e_1x400.png" /> + <Content Include="theme\images\ui-bg_glass_75_79c9ec_1x400.png" /> + <Content Include="theme\images\ui-bg_gloss-wave_45_e14f1c_500x100.png" /> + <Content Include="theme\images\ui-bg_gloss-wave_50_6eac2c_500x100.png" /> + <Content Include="theme\images\ui-bg_gloss-wave_75_2191c0_500x100.png" /> + <Content Include="theme\images\ui-bg_inset-hard_100_fcfdfd_1x100.png" /> + <Content Include="theme\images\ui-icons_0078ae_256x240.png" /> + <Content Include="theme\images\ui-icons_056b93_256x240.png" /> + <Content Include="theme\images\ui-icons_d8e7f3_256x240.png" /> + <Content Include="theme\images\ui-icons_e0fdff_256x240.png" /> + <Content Include="theme\images\ui-icons_f5e175_256x240.png" /> + <Content Include="theme\images\ui-icons_f7a50d_256x240.png" /> + <Content Include="theme\images\ui-icons_fcd113_256x240.png" /> + <Content Include="theme\ui.accordion.css" /> + <Content Include="theme\ui.all.css" /> + <Content Include="theme\ui.base.css" /> + <Content Include="theme\ui.core.css" /> + <Content Include="theme\ui.datepicker.css" /> + <Content Include="theme\ui.dialog.css" /> + <Content Include="theme\ui.progressbar.css" /> + <Content Include="theme\ui.resizable.css" /> + <Content Include="theme\ui.slider.css" /> + <Content Include="theme\ui.tabs.css" /> + <Content Include="theme\ui.theme.css" /> + <Content Include="xrds.aspx" /> + </ItemGroup> + <ItemGroup> + <None Include="Admin\CreateDatabase.sql" /> + </ItemGroup> + <ItemGroup> + <ProjectReference Include="..\..\src\DotNetOpenAuth\DotNetOpenAuth.csproj"> + <Project>{3191B653-F76D-4C1A-9A5A-347BC3AAAAB7}</Project> + <Name>DotNetOpenAuth</Name> + </ProjectReference> + </ItemGroup> + <ItemGroup> + <Folder Include="App_Data\" /> + </ItemGroup> + <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> + <Import Project="$(MSBuildExtensionsPath)\Microsoft\VisualStudio\v9.0\WebApplications\Microsoft.WebApplication.targets" /> + <!-- To modify your build process, add your task inside one of the targets below and uncomment it. + Other similar extension points exist, see Microsoft.Common.targets. + <Target Name="BeforeBuild"> + </Target> + <Target Name="AfterBuild"> + </Target> + --> + <ProjectExtensions> + <VisualStudio> + <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> + <WebProjectProperties> + <UseIIS>False</UseIIS> + <AutoAssignPort>True</AutoAssignPort> + <DevelopmentServerPort>54189</DevelopmentServerPort> + <DevelopmentServerVPath>/</DevelopmentServerVPath> + <IISUrl> + </IISUrl> + <NTLMAuthentication>False</NTLMAuthentication> + <UseCustomServer>False</UseCustomServer> + <CustomServerUrl> + </CustomServerUrl> + <SaveServerSettingsInUserFile>False</SaveServerSettingsInUserFile> + </WebProjectProperties> + </FlavorProperties> + </VisualStudio> + </ProjectExtensions> +</Project>
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/images/google.gif b/projecttemplates/WebFormsRelyingParty/images/google.gif Binary files differnew file mode 100644 index 0000000..1b6cd07 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/google.gif diff --git a/projecttemplates/WebFormsRelyingParty/images/infocard_23x16.png b/projecttemplates/WebFormsRelyingParty/images/infocard_23x16.png Binary files differnew file mode 100644 index 0000000..9dbea9f --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/infocard_23x16.png diff --git a/projecttemplates/WebFormsRelyingParty/images/myopenid.png b/projecttemplates/WebFormsRelyingParty/images/myopenid.png Binary files differnew file mode 100644 index 0000000..204caae --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/myopenid.png diff --git a/projecttemplates/WebFormsRelyingParty/images/openid.gif b/projecttemplates/WebFormsRelyingParty/images/openid.gif Binary files differnew file mode 100644 index 0000000..c718b0e --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/openid.gif diff --git a/projecttemplates/WebFormsRelyingParty/images/openid_login.gif b/projecttemplates/WebFormsRelyingParty/images/openid_login.gif Binary files differnew file mode 100644 index 0000000..cde836c --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/openid_login.gif diff --git a/projecttemplates/WebFormsRelyingParty/images/verisign.gif b/projecttemplates/WebFormsRelyingParty/images/verisign.gif Binary files differnew file mode 100644 index 0000000..faa6aaa --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/verisign.gif diff --git a/projecttemplates/WebFormsRelyingParty/images/yahoo.gif b/projecttemplates/WebFormsRelyingParty/images/yahoo.gif Binary files differnew file mode 100644 index 0000000..42adbfa --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/yahoo.gif diff --git a/projecttemplates/WebFormsRelyingParty/images/yahoo_login.png b/projecttemplates/WebFormsRelyingParty/images/yahoo_login.png Binary files differnew file mode 100644 index 0000000..476fa64 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/images/yahoo_login.png diff --git a/projecttemplates/WebFormsRelyingParty/scripts/LoginLink.js b/projecttemplates/WebFormsRelyingParty/scripts/LoginLink.js new file mode 100644 index 0000000..cf60ff3 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/scripts/LoginLink.js @@ -0,0 +1,53 @@ +$(function() { + var loginContent = 'LoginFrame.aspx'; + var popupWindowName = 'openidlogin'; + var popupWidth = 355; + var popupHeight = 273; // use 205 for 1 row of OP buttons + + { + var div = window.document.createElement('div'); + div.style.padding = 0; + div.id = 'loginDialog'; + + var iframe = window.document.createElement('iframe'); + iframe.src = loginContent; + iframe.frameBorder = 0; + iframe.width = popupWidth; + iframe.height = popupHeight; + div.appendChild(iframe); + + window.document.body.appendChild(div); + } + + $(document).ready(function() { + $("#loginDialog").dialog({ + bgiframe: true, + modal: true, + title: 'Login or register', + resizable: false, + hide: 'clip', + width: popupWidth, + height: popupHeight + 50, + buttons: {}, + closeOnEscape: true, + autoOpen: false, + focus: function(event, ui) { + // var box = $('#openid_identifier')[0]; + // if (box.style.display != 'none') { + // box.focus(); + // } + } + }); + + $('.loginPopupLink').click(function() { + $("#loginDialog").dialog('open'); + }); + $('.loginWindowLink').click(function() { + if (window.showModalDialog) { + window.showModalDialog(loginContent, popupWindowName, 'status:0;resizable:1;scroll:1;center:1;dialogHeight:' + popupHeight + 'px;dialogWidth:' + popupWidth + 'px'); + } else { + window.open(loginContent, popupWindowName, 'modal=yes,status=0,location=1,toolbar=0,menubar=0,resizable=0,scrollbars=0,height=' + popupHeight + 'px,width=' + popupWidth + 'px'); + } + }); + }); +}); diff --git a/projecttemplates/WebFormsRelyingParty/scripts/jquery-1.3.1.js b/projecttemplates/WebFormsRelyingParty/scripts/jquery-1.3.1.js new file mode 100644 index 0000000..3a4badd --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/scripts/jquery-1.3.1.js @@ -0,0 +1,4241 @@ +/*! + * jQuery JavaScript Library v1.3.1 + * http://jquery.com/ + * + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + * + * Date: 2009-01-21 20:42:16 -0500 (Wed, 21 Jan 2009) + * Revision: 6158 + */ +(function(){ + +var + // Will speed up references to window, and allows munging its name. + window = this, + // Will speed up references to undefined, and allows munging its name. + undefined, + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + // Map over the $ in case of overwrite + _$ = window.$, + + jQuery = window.jQuery = window.$ = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/, + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + // Make sure that a selection was provided + selector = selector || document; + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this[0] = selector; + this.length = 1; + this.context = selector; + return this; + } + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + var match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) + selector = jQuery.clean( [ match[1] ], context ); + + // HANDLE: $("#id") + else { + var elem = document.getElementById( match[3] ); + + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem && elem.id != match[3] ) + return jQuery().find( selector ); + + // Otherwise, we inject the element directly into the jQuery object + var ret = jQuery( elem || [] ); + ret.context = document; + ret.selector = selector; + return ret; + } + + // HANDLE: $(expr, [context]) + // (which is just equivalent to: $(content).find(expr) + } else + return jQuery( context ).find( selector ); + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) + return jQuery( document ).ready( selector ); + + // Make sure that old selector state is passed along + if ( selector.selector && selector.context ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return this.setArray(jQuery.makeArray(selector)); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.3.1", + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num === undefined ? + + // Return a 'clean' array + jQuery.makeArray( this ) : + + // Return just the object + this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery( elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) + ret.selector = this.selector + (this.selector ? " " : "") + selector; + else if ( name ) + ret.selector = this.selector + "." + name + "(" + selector + ")"; + + // Return the newly-formed element set + return ret; + }, + + // Force the current matched set of elements to become + // the specified array of elements (destroying the stack in the process) + // You should use pushStack() in order to do this, but maintain the stack + setArray: function( elems ) { + // Resetting the length to 0, then using the native Array push + // is a super-fast way to populate an object with array-like properties + this.length = 0; + Array.prototype.push.apply( this, elems ); + + return this; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem && elem.jquery ? elem[0] : elem + , this ); + }, + + attr: function( name, value, type ) { + var options = name; + + // Look for the case where we're accessing a style value + if ( typeof name === "string" ) + if ( value === undefined ) + return this[0] && jQuery[ type || "attr" ]( this[0], name ); + + else { + options = {}; + options[ name ] = value; + } + + // Check to see if we're setting style values + return this.each(function(i){ + // Set all the styles + for ( name in options ) + jQuery.attr( + type ? + this.style : + this, + name, jQuery.prop( this, options[ name ], type, i, name ) + ); + }); + }, + + css: function( key, value ) { + // ignore negative width and height values + if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 ) + value = undefined; + return this.attr( key, value, "curCSS" ); + }, + + text: function( text ) { + if ( typeof text !== "object" && text != null ) + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + + var ret = ""; + + jQuery.each( text || this, function(){ + jQuery.each( this.childNodes, function(){ + if ( this.nodeType != 8 ) + ret += this.nodeType != 1 ? + this.nodeValue : + jQuery.fn.text( [ this ] ); + }); + }); + + return ret; + }, + + wrapAll: function( html ) { + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).clone(); + + if ( this[0].parentNode ) + wrap.insertBefore( this[0] ); + + wrap.map(function(){ + var elem = this; + + while ( elem.firstChild ) + elem = elem.firstChild; + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + return this.each(function(){ + jQuery( this ).contents().wrapAll( html ); + }); + }, + + wrap: function( html ) { + return this.each(function(){ + jQuery( this ).wrapAll( html ); + }); + }, + + append: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.appendChild( elem ); + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.insertBefore( elem, this.firstChild ); + }); + }, + + before: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this ); + }); + }, + + after: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + }, + + end: function() { + return this.prevObject || jQuery( [] ); + }, + + // For internal use only. + // Behaves like an Array's .push method, not like a jQuery method. + push: [].push, + + find: function( selector ) { + if ( this.length === 1 && !/,/.test(selector) ) { + var ret = this.pushStack( [], "find", selector ); + ret.length = 0; + jQuery.find( selector, this[0], ret ); + return ret; + } else { + var elems = jQuery.map(this, function(elem){ + return jQuery.find( selector, elem ); + }); + + return this.pushStack( /[^+>] [^+>]/.test( selector ) ? + jQuery.unique( elems ) : + elems, "find", selector ); + } + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function(){ + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var clone = this.cloneNode(true), + container = document.createElement("div"); + container.appendChild(clone); + return jQuery.clean([container.innerHTML])[0]; + } else + return this.cloneNode(true); + }); + + // Need to set the expando to null on the cloned set if it exists + // removeData doesn't work here, IE removes it from the original as well + // this is primarily for IE but the data expando shouldn't be copied over in any browser + var clone = ret.find("*").andSelf().each(function(){ + if ( this[ expando ] !== undefined ) + this[ expando ] = null; + }); + + // Copy the events from the original to the clone + if ( events === true ) + this.find("*").andSelf().each(function(i){ + if (this.nodeType == 3) + return; + var events = jQuery.data( this, "events" ); + + for ( var type in events ) + for ( var handler in events[ type ] ) + jQuery.event.add( clone[ i ], type, events[ type ][ handler ], events[ type ][ handler ].data ); + }); + + // Return the cloned set + return ret; + }, + + filter: function( selector ) { + return this.pushStack( + jQuery.isFunction( selector ) && + jQuery.grep(this, function(elem, i){ + return selector.call( elem, i ); + }) || + + jQuery.multiFilter( selector, jQuery.grep(this, function(elem){ + return elem.nodeType === 1; + }) ), "filter", selector ); + }, + + closest: function( selector ) { + var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null; + + return this.map(function(){ + var cur = this; + while ( cur && cur.ownerDocument ) { + if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) + return cur; + cur = cur.parentNode; + } + }); + }, + + not: function( selector ) { + if ( typeof selector === "string" ) + // test special case where just one selector is passed in + if ( isSimple.test( selector ) ) + return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector ); + else + selector = jQuery.multiFilter( selector, this ); + + var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType; + return this.filter(function() { + return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector; + }); + }, + + add: function( selector ) { + return this.pushStack( jQuery.unique( jQuery.merge( + this.get(), + typeof selector === "string" ? + jQuery( selector ) : + jQuery.makeArray( selector ) + ))); + }, + + is: function( selector ) { + return !!selector && jQuery.multiFilter( selector, this ).length > 0; + }, + + hasClass: function( selector ) { + return !!selector && this.is( "." + selector ); + }, + + val: function( value ) { + if ( value === undefined ) { + var elem = this[0]; + + if ( elem ) { + if( jQuery.nodeName( elem, 'option' ) ) + return (elem.attributes.value || {}).specified ? elem.value : elem.text; + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type == "select-one"; + + // Nothing was selected + if ( index < 0 ) + return null; + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + if ( option.selected ) { + // Get the specifc value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) + return value; + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Everything else, we just grab the value + return (elem.value || "").replace(/\r/g, ""); + + } + + return undefined; + } + + if ( typeof value === "number" ) + value += ''; + + return this.each(function(){ + if ( this.nodeType != 1 ) + return; + + if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) ) + this.checked = (jQuery.inArray(this.value, value) >= 0 || + jQuery.inArray(this.name, value) >= 0); + + else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(value); + + jQuery( "option", this ).each(function(){ + this.selected = (jQuery.inArray( this.value, values ) >= 0 || + jQuery.inArray( this.text, values ) >= 0); + }); + + if ( !values.length ) + this.selectedIndex = -1; + + } else + this.value = value; + }); + }, + + html: function( value ) { + return value === undefined ? + (this[0] ? + this[0].innerHTML : + null) : + this.empty().append( value ); + }, + + replaceWith: function( value ) { + return this.after( value ).remove(); + }, + + eq: function( i ) { + return this.slice( i, +i + 1 ); + }, + + slice: function() { + return this.pushStack( Array.prototype.slice.apply( this, arguments ), + "slice", Array.prototype.slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function(elem, i){ + return callback.call( elem, i, elem ); + })); + }, + + andSelf: function() { + return this.add( this.prevObject ); + }, + + domManip: function( args, table, callback ) { + if ( this[0] ) { + var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(), + scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ), + first = fragment.firstChild, + extra = this.length > 1 ? fragment.cloneNode(true) : fragment; + + if ( first ) + for ( var i = 0, l = this.length; i < l; i++ ) + callback.call( root(this[i], first), i > 0 ? extra.cloneNode(true) : fragment ); + + if ( scripts ) + jQuery.each( scripts, evalScript ); + } + + return this; + + function root( elem, cur ) { + return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; + } + } +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +function evalScript( i, elem ) { + if ( elem.src ) + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + + else + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + + if ( elem.parentNode ) + elem.parentNode.removeChild( elem ); +} + +function now(){ + return +new Date; +} + +jQuery.extend = jQuery.fn.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) + target = {}; + + // extend jQuery itself if only one argument is passed + if ( length == i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) + // Extend the base object + for ( var name in options ) { + var src = target[ name ], copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) + continue; + + // Recurse if we're merging object values + if ( deep && copy && typeof copy === "object" && !copy.nodeType ) + target[ name ] = jQuery.extend( deep, + // Never move original objects, clone them + src || ( copy.length != null ? [ ] : { } ) + , copy ); + + // Don't bring in undefined values + else if ( copy !== undefined ) + target[ name ] = copy; + + } + + // Return the modified object + return target; +}; + +// exclude the following css properties to add px +var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i, + // cache defaultView + defaultView = document.defaultView || {}, + toString = Object.prototype.toString; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) + window.jQuery = _jQuery; + + return jQuery; + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return toString.call(obj) === "[object Function]"; + }, + + isArray: function( obj ) { + return toString.call(obj) === "[object Array]"; + }, + + // check if an element is in a (or is an) XML document + isXMLDoc: function( elem ) { + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument ); + }, + + // Evalulates a script in a global context + globalEval: function( data ) { + data = jQuery.trim( data ); + + if ( data ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + if ( jQuery.support.scriptEval ) + script.appendChild( document.createTextNode( data ) ); + else + script.text = data; + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, length = object.length; + + if ( args ) { + if ( length === undefined ) { + for ( name in object ) + if ( callback.apply( object[ name ], args ) === false ) + break; + } else + for ( ; i < length; ) + if ( callback.apply( object[ i++ ], args ) === false ) + break; + + // A special, fast, case for the most common use of each + } else { + if ( length === undefined ) { + for ( name in object ) + if ( callback.call( object[ name ], name, object[ name ] ) === false ) + break; + } else + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ){} + } + + return object; + }, + + prop: function( elem, value, type, i, name ) { + // Handle executable functions + if ( jQuery.isFunction( value ) ) + value = value.call( elem, i ); + + // Handle passing in a number to a CSS property + return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ? + value + "px" : + value; + }, + + className: { + // internal only, use addClass("class") + add: function( elem, classNames ) { + jQuery.each((classNames || "").split(/\s+/), function(i, className){ + if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) ) + elem.className += (elem.className ? " " : "") + className; + }); + }, + + // internal only, use removeClass("class") + remove: function( elem, classNames ) { + if (elem.nodeType == 1) + elem.className = classNames !== undefined ? + jQuery.grep(elem.className.split(/\s+/), function(className){ + return !jQuery.className.has( classNames, className ); + }).join(" ") : + ""; + }, + + // internal only, use hasClass("class") + has: function( elem, className ) { + return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1; + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( var name in options ) + elem.style[ name ] = old[ name ]; + }, + + css: function( elem, name, force ) { + if ( name == "width" || name == "height" ) { + var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ]; + + function getWH() { + val = name == "width" ? elem.offsetWidth : elem.offsetHeight; + var padding = 0, border = 0; + jQuery.each( which, function() { + padding += parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0; + border += parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0; + }); + val -= Math.round(padding + border); + } + + if ( jQuery(elem).is(":visible") ) + getWH(); + else + jQuery.swap( elem, props, getWH ); + + return Math.max(0, val); + } + + return jQuery.curCSS( elem, name, force ); + }, + + curCSS: function( elem, name, force ) { + var ret, style = elem.style; + + // We need to handle opacity special in IE + if ( name == "opacity" && !jQuery.support.opacity ) { + ret = jQuery.attr( style, "opacity" ); + + return ret == "" ? + "1" : + ret; + } + + // Make sure we're using the right name for getting the float value + if ( name.match( /float/i ) ) + name = styleFloat; + + if ( !force && style && style[ name ] ) + ret = style[ name ]; + + else if ( defaultView.getComputedStyle ) { + + // Only "float" is needed here + if ( name.match( /float/i ) ) + name = "float"; + + name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase(); + + var computedStyle = defaultView.getComputedStyle( elem, null ); + + if ( computedStyle ) + ret = computedStyle.getPropertyValue( name ); + + // We should always get a number back from opacity + if ( name == "opacity" && ret == "" ) + ret = "1"; + + } else if ( elem.currentStyle ) { + var camelCase = name.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + + ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ]; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) { + // Remember the original values + var left = style.left, rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = ret || 0; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + } + + return ret; + }, + + clean: function( elems, context, fragment ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) { + var match = /^<(\w+)\s*\/?>$/.exec(elems[0]); + if ( match ) + return [ context.createElement( match[1] ) ]; + } + + var ret = [], scripts = [], div = context.createElement("div"); + + jQuery.each(elems, function(i, elem){ + if ( typeof elem === "number" ) + elem += ''; + + if ( !elem ) + return; + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){ + return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ? + all : + front + "></" + tag + ">"; + }); + + // Trim whitespace, otherwise indexOf won't work as expected + var tags = jQuery.trim( elem ).toLowerCase(); + + var wrap = + // option or optgroup + !tags.indexOf("<opt") && + [ 1, "<select multiple='multiple'>", "</select>" ] || + + !tags.indexOf("<leg") && + [ 1, "<fieldset>", "</fieldset>" ] || + + tags.match(/^<(thead|tbody|tfoot|colg|cap)/) && + [ 1, "<table>", "</table>" ] || + + !tags.indexOf("<tr") && + [ 2, "<table><tbody>", "</tbody></table>" ] || + + // <thead> matched above + (!tags.indexOf("<td") || !tags.indexOf("<th")) && + [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] || + + !tags.indexOf("<col") && + [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] || + + // IE can't serialize <link> and <script> tags normally + !jQuery.support.htmlSerialize && + [ 1, "div<div>", "</div>" ] || + + [ 0, "", "" ]; + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( wrap[0]-- ) + div = div.lastChild; + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var tbody = !tags.indexOf("<table") && tags.indexOf("<tbody") < 0 ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] == "<table>" && tags.indexOf("<tbody") < 0 ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) ) + div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild ); + + elem = jQuery.makeArray( div.childNodes ); + } + + if ( elem.nodeType ) + ret.push( elem ); + else + ret = jQuery.merge( ret, elem ); + + }); + + if ( fragment ) { + for ( var i = 0; ret[i]; i++ ) { + if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + } else { + if ( ret[i].nodeType === 1 ) + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + fragment.appendChild( ret[i] ); + } + } + + return scripts; + } + + return ret; + }, + + attr: function( elem, name, value ) { + // don't set attributes on text and comment nodes + if (!elem || elem.nodeType == 3 || elem.nodeType == 8) + return undefined; + + var notxml = !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // Only do all the following if this is a node (faster for style) + // IE elem.getAttribute passes even for style + if ( elem.tagName ) { + + // These attributes require special treatment + var special = /href|src|style/.test( name ); + + // Safari mis-reports the default selected property of a hidden option + // Accessing the parent's selectedIndex property fixes it + if ( name == "selected" && elem.parentNode ) + elem.parentNode.selectedIndex; + + // If applicable, access the attribute via the DOM 0 way + if ( name in elem && notxml && !special ) { + if ( set ){ + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode ) + throw "type property can't be changed"; + + elem[ name ] = value; + } + + // browsers index elements by id/name on forms, give priority to attributes. + if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) + return elem.getAttributeNode( name ).nodeValue; + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name == "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + return attributeNode && attributeNode.specified + ? attributeNode.value + : elem.nodeName.match(/(button|input|object|select|textarea)/i) + ? 0 + : elem.nodeName.match(/^(a|area)$/i) && elem.href + ? 0 + : undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name == "style" ) + return jQuery.attr( elem.style, "cssText", value ); + + if ( set ) + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + + var attr = !jQuery.support.hrefNormalized && notxml && special + // Some attributes require a special call on IE + ? elem.getAttribute( name, 2 ) + : elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } + + // elem is actually elem.style ... set the style + + // IE uses filters for opacity + if ( !jQuery.support.opacity && name == "opacity" ) { + if ( set ) { + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + elem.zoom = 1; + + // Set the alpha filter to set the opacity + elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) + + (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")"); + } + + return elem.filter && elem.filter.indexOf("opacity=") >= 0 ? + (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '': + ""; + } + + name = name.replace(/-([a-z])/ig, function(all, letter){ + return letter.toUpperCase(); + }); + + if ( set ) + elem[ name ] = value; + + return elem[ name ]; + }, + + trim: function( text ) { + return (text || "").replace( /^\s+|\s+$/g, "" ); + }, + + makeArray: function( array ) { + var ret = []; + + if( array != null ){ + var i = array.length; + // The window, strings (and functions) also have 'length' + if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval ) + ret[0] = array; + else + while( i ) + ret[--i] = array[i]; + } + + return ret; + }, + + inArray: function( elem, array ) { + for ( var i = 0, length = array.length; i < length; i++ ) + // Use === because on IE, window == document + if ( array[ i ] === elem ) + return i; + + return -1; + }, + + merge: function( first, second ) { + // We have to loop this way because IE & Opera overwrite the length + // expando of getElementsByTagName + var i = 0, elem, pos = first.length; + // Also, we need to make sure that the correct elements are being returned + // (IE returns comment nodes in a '*' query) + if ( !jQuery.support.getAll ) { + while ( (elem = second[ i++ ]) != null ) + if ( elem.nodeType != 8 ) + first[ pos++ ] = elem; + + } else + while ( (elem = second[ i++ ]) != null ) + first[ pos++ ] = elem; + + return first; + }, + + unique: function( array ) { + var ret = [], done = {}; + + try { + + for ( var i = 0, length = array.length; i < length; i++ ) { + var id = jQuery.data( array[ i ] ); + + if ( !done[ id ] ) { + done[ id ] = true; + ret.push( array[ i ] ); + } + } + + } catch( e ) { + ret = array; + } + + return ret; + }, + + grep: function( elems, callback, inv ) { + var ret = []; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) + if ( !inv != !callback( elems[ i ], i ) ) + ret.push( elems[ i ] ); + + return ret; + }, + + map: function( elems, callback ) { + var ret = []; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + var value = callback( elems[ i ], i ); + + if ( value != null ) + ret[ ret.length ] = value; + } + + return ret.concat.apply( [], ret ); + } +}); + +// Use of jQuery.browser is deprecated. +// It's included for backwards compatibility and plugins, +// although they should work to migrate away. + +var userAgent = navigator.userAgent.toLowerCase(); + +// Figure out what browser is being used +jQuery.browser = { + version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1], + safari: /webkit/.test( userAgent ), + opera: /opera/.test( userAgent ), + msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ), + mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent ) +}; + +jQuery.each({ + parent: function(elem){return elem.parentNode;}, + parents: function(elem){return jQuery.dir(elem,"parentNode");}, + next: function(elem){return jQuery.nth(elem,2,"nextSibling");}, + prev: function(elem){return jQuery.nth(elem,2,"previousSibling");}, + nextAll: function(elem){return jQuery.dir(elem,"nextSibling");}, + prevAll: function(elem){return jQuery.dir(elem,"previousSibling");}, + siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);}, + children: function(elem){return jQuery.sibling(elem.firstChild);}, + contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);} +}, function(name, fn){ + jQuery.fn[ name ] = function( selector ) { + var ret = jQuery.map( this, fn ); + + if ( selector && typeof selector == "string" ) + ret = jQuery.multiFilter( selector, ret ); + + return this.pushStack( jQuery.unique( ret ), name, selector ); + }; +}); + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function(name, original){ + jQuery.fn[ name ] = function() { + var args = arguments; + + return this.each(function(){ + for ( var i = 0, length = args.length; i < length; i++ ) + jQuery( args[ i ] )[ original ]( this ); + }); + }; +}); + +jQuery.each({ + removeAttr: function( name ) { + jQuery.attr( this, name, "" ); + if (this.nodeType == 1) + this.removeAttribute( name ); + }, + + addClass: function( classNames ) { + jQuery.className.add( this, classNames ); + }, + + removeClass: function( classNames ) { + jQuery.className.remove( this, classNames ); + }, + + toggleClass: function( classNames, state ) { + if( typeof state !== "boolean" ) + state = !jQuery.className.has( this, classNames ); + jQuery.className[ state ? "add" : "remove" ]( this, classNames ); + }, + + remove: function( selector ) { + if ( !selector || jQuery.filter( selector, [ this ] ).length ) { + // Prevent memory leaks + jQuery( "*", this ).add([this]).each(function(){ + jQuery.event.remove(this); + jQuery.removeData(this); + }); + if (this.parentNode) + this.parentNode.removeChild( this ); + } + }, + + empty: function() { + // Remove element nodes and prevent memory leaks + jQuery( ">*", this ).remove(); + + // Remove any remaining nodes + while ( this.firstChild ) + this.removeChild( this.firstChild ); + } +}, function(name, fn){ + jQuery.fn[ name ] = function(){ + return this.each( fn, arguments ); + }; +}); + +// Helper function used by the dimensions and offset modules +function num(elem, prop) { + return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0; +} +var expando = "jQuery" + now(), uuid = 0, windowData = {}; + +jQuery.extend({ + cache: {}, + + data: function( elem, name, data ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // Compute a unique ID for the element + if ( !id ) + id = elem[ expando ] = ++uuid; + + // Only generate the data cache if we're + // trying to access or manipulate it + if ( name && !jQuery.cache[ id ] ) + jQuery.cache[ id ] = {}; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) + jQuery.cache[ id ][ name ] = data; + + // Return the named cache data, or the ID for the element + return name ? + jQuery.cache[ id ][ name ] : + id; + }, + + removeData: function( elem, name ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( jQuery.cache[ id ] ) { + // Remove the section of cache data + delete jQuery.cache[ id ][ name ]; + + // If we've removed all the data, remove the element's cache + name = ""; + + for ( name in jQuery.cache[ id ] ) + break; + + if ( !name ) + jQuery.removeData( elem ); + } + + // Otherwise, we want to remove all of the element's data + } else { + // Clean up the element expando + try { + delete elem[ expando ]; + } catch(e){ + // IE has trouble directly removing the expando + // but it's ok with using removeAttribute + if ( elem.removeAttribute ) + elem.removeAttribute( expando ); + } + + // Completely remove the data cache + delete jQuery.cache[ id ]; + } + }, + queue: function( elem, type, data ) { + if ( elem ){ + + type = (type || "fx") + "queue"; + + var q = jQuery.data( elem, type ); + + if ( !q || jQuery.isArray(data) ) + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + else if( data ) + q.push( data ); + + } + return q; + }, + + dequeue: function( elem, type ){ + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + if( !type || type === "fx" ) + fn = queue[0]; + + if( fn !== undefined ) + fn.call(elem); + } +}); + +jQuery.fn.extend({ + data: function( key, value ){ + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + if ( data === undefined && this.length ) + data = jQuery.data( this[0], key ); + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } else + return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){ + jQuery.data( this, key, value ); + }); + }, + + removeData: function( key ){ + return this.each(function(){ + jQuery.removeData( this, key ); + }); + }, + queue: function(type, data){ + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) + return jQuery.queue( this[0], type ); + + return this.each(function(){ + var queue = jQuery.queue( this, type, data ); + + if( type == "fx" && queue.length == 1 ) + queue[0].call(this); + }); + }, + dequeue: function(type){ + return this.each(function(){ + jQuery.dequeue( this, type ); + }); + } +});/*! + * Sizzle CSS Selector Engine - v0.9.3 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]+['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[]+)+|[>+~])(\s*,\s*)?/g, + done = 0, + toString = Object.prototype.toString; + +var Sizzle = function(selector, context, results, seed) { + results = results || []; + context = context || document; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) + return []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var parts = [], m, set, checkSet, check, mode, extra, prune = true; + + // Reset the position of the chunker regexp (start from head) + chunker.lastIndex = 0; + + while ( (m = chunker.exec(selector)) !== null ) { + parts.push( m[1] ); + + if ( m[2] ) { + extra = RegExp.rightContext; + break; + } + } + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) + selector += parts.shift(); + + set = posProcess( selector, set ); + } + } + } else { + var ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) ); + set = Sizzle.filter( ret.expr, ret.set ); + + if ( parts.length > 0 ) { + checkSet = makeArray(set); + } else { + prune = false; + } + + while ( parts.length ) { + var cur = parts.pop(), pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, isXML(context) ); + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + throw "Syntax error, unrecognized expression: " + (cur || selector); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, context, results, seed ); + } + + return results; +}; + +Sizzle.matches = function(expr, set){ + return Sizzle(expr, null, null, set); +}; + +Sizzle.find = function(expr, context, isXML){ + var set, match; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var type = Expr.order[i], match; + + if ( (match = Expr.match[ type ].exec( expr )) ) { + var left = RegExp.leftContext; + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName("*"); + } + + return {set: set, expr: expr}; +}; + +Sizzle.filter = function(expr, set, inplace, not){ + var old = expr, result = [], curLoop = set, match, anyFound; + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.match[ type ].exec( expr )) != null ) { + var filter = Expr.filter[ type ], found, item; + anyFound = false; + + if ( curLoop == result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not ); + + if ( !match ) { + anyFound = found = true; + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + } else { + curLoop[i] = false; + } + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + expr = expr.replace(/\s*,\s*/, ""); + + // Improper expression + if ( expr == old ) { + if ( anyFound == null ) { + throw "Syntax error, unrecognized expression: " + expr; + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + match: { + ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/ + }, + attrMap: { + "class": "className", + "for": "htmlFor" + }, + attrHandle: { + href: function(elem){ + return elem.getAttribute("href"); + } + }, + relative: { + "+": function(checkSet, part){ + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var cur = elem.previousSibling; + while ( cur && cur.nodeType !== 1 ) { + cur = cur.previousSibling; + } + checkSet[i] = typeof part === "string" ? + cur || false : + cur === part; + } + } + + if ( typeof part === "string" ) { + Sizzle.filter( part, checkSet, true ); + } + }, + ">": function(checkSet, part, isXML){ + if ( typeof part === "string" && !/\W/.test(part) ) { + part = isXML ? part : part.toUpperCase(); + + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName === part ? parent : false; + } + } + } else { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + checkSet[i] = typeof part === "string" ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( typeof part === "string" ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + "": function(checkSet, part, isXML){ + var doneName = "done" + (done++), checkFn = dirCheck; + + if ( !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML); + }, + "~": function(checkSet, part, isXML){ + var doneName = "done" + (done++), checkFn = dirCheck; + + if ( typeof part === "string" && !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML); + } + }, + find: { + ID: function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? [m] : []; + } + }, + NAME: function(match, context, isXML){ + if ( typeof context.getElementsByName !== "undefined" && !isXML ) { + return context.getElementsByName(match[1]); + } + }, + TAG: function(match, context){ + return context.getElementsByTagName(match[1]); + } + }, + preFilter: { + CLASS: function(match, curLoop, inplace, result, not){ + match = " " + match[1].replace(/\\/g, "") + " "; + + var elem; + for ( var i = 0; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (" " + elem.className + " ").indexOf(match) >= 0 ) { + if ( !inplace ) + result.push( elem ); + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + ID: function(match){ + return match[1].replace(/\\/g, ""); + }, + TAG: function(match, curLoop){ + for ( var i = 0; curLoop[i] === false; i++ ){} + return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase(); + }, + CHILD: function(match){ + if ( match[1] == "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = "done" + (done++); + + return match; + }, + ATTR: function(match){ + var name = match[1].replace(/\\/g, ""); + + if ( Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + PSEUDO: function(match, curLoop, inplace, result, not){ + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( match[3].match(chunker).length > 1 ) { + match[3] = Sizzle(match[3], null, null, curLoop); + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + if ( !inplace ) { + result.push.apply( result, ret ); + } + return false; + } + } else if ( Expr.match.POS.test( match[0] ) ) { + return true; + } + + return match; + }, + POS: function(match){ + match.unshift( true ); + return match; + } + }, + filters: { + enabled: function(elem){ + return elem.disabled === false && elem.type !== "hidden"; + }, + disabled: function(elem){ + return elem.disabled === true; + }, + checked: function(elem){ + return elem.checked === true; + }, + selected: function(elem){ + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + return elem.selected === true; + }, + parent: function(elem){ + return !!elem.firstChild; + }, + empty: function(elem){ + return !elem.firstChild; + }, + has: function(elem, i, match){ + return !!Sizzle( match[3], elem ).length; + }, + header: function(elem){ + return /h\d/i.test( elem.nodeName ); + }, + text: function(elem){ + return "text" === elem.type; + }, + radio: function(elem){ + return "radio" === elem.type; + }, + checkbox: function(elem){ + return "checkbox" === elem.type; + }, + file: function(elem){ + return "file" === elem.type; + }, + password: function(elem){ + return "password" === elem.type; + }, + submit: function(elem){ + return "submit" === elem.type; + }, + image: function(elem){ + return "image" === elem.type; + }, + reset: function(elem){ + return "reset" === elem.type; + }, + button: function(elem){ + return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON"; + }, + input: function(elem){ + return /input|select|textarea|button/i.test(elem.nodeName); + } + }, + setFilters: { + first: function(elem, i){ + return i === 0; + }, + last: function(elem, i, match, array){ + return i === array.length - 1; + }, + even: function(elem, i){ + return i % 2 === 0; + }, + odd: function(elem, i){ + return i % 2 === 1; + }, + lt: function(elem, i, match){ + return i < match[3] - 0; + }, + gt: function(elem, i, match){ + return i > match[3] - 0; + }, + nth: function(elem, i, match){ + return match[3] - 0 == i; + }, + eq: function(elem, i, match){ + return match[3] - 0 == i; + } + }, + filter: { + CHILD: function(elem, match){ + var type = match[1], parent = elem.parentNode; + + var doneName = match[0]; + + if ( parent && (!parent[ doneName ] || !elem.nodeIndex) ) { + var count = 1; + + for ( var node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType == 1 ) { + node.nodeIndex = count++; + } + } + + parent[ doneName ] = count - 1; + } + + if ( type == "first" ) { + return elem.nodeIndex == 1; + } else if ( type == "last" ) { + return elem.nodeIndex == parent[ doneName ]; + } else if ( type == "only" ) { + return parent[ doneName ] == 1; + } else if ( type == "nth" ) { + var add = false, first = match[2], last = match[3]; + + if ( first == 1 && last == 0 ) { + return true; + } + + if ( first == 0 ) { + if ( elem.nodeIndex == last ) { + add = true; + } + } else if ( (elem.nodeIndex - last) % first == 0 && (elem.nodeIndex - last) / first >= 0 ) { + add = true; + } + + return add; + } + }, + PSEUDO: function(elem, match, i, array){ + var name = match[1], filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0; + } else if ( name === "not" ) { + var not = match[3]; + + for ( var i = 0, l = not.length; i < l; i++ ) { + if ( not[i] === elem ) { + return false; + } + } + + return true; + } + }, + ID: function(elem, match){ + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + TAG: function(elem, match){ + return (match === "*" && elem.nodeType === 1) || elem.nodeName === match; + }, + CLASS: function(elem, match){ + return match.test( elem.className ); + }, + ATTR: function(elem, match){ + var result = Expr.attrHandle[ match[1] ] ? Expr.attrHandle[ match[1] ]( elem ) : elem[ match[1] ] || elem.getAttribute( match[1] ), value = result + "", type = match[2], check = match[4]; + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !match[4] ? + result : + type === "!=" ? + value != check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + POS: function(elem, match, i, array){ + var name = match[2], filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS; + +for ( var type in Expr.match ) { + Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source ); +} + +var makeArray = function(array, results) { + array = Array.prototype.slice.call( array ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +try { + Array.prototype.slice.call( document.documentElement.childNodes ); + +// Provide a fallback method if it does not work +} catch(e){ + makeArray = function(array, results) { + var ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + } else { + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + } else { + for ( var i = 0; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("form"), + id = "script" + (new Date).getTime(); + form.innerHTML = "<input name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + var root = document.documentElement; + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( !!document.getElementById( id ) ) { + Expr.find.ID = function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : []; + } + }; + + Expr.filter.ID = function(elem, match){ + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function(match, context){ + var results = context.getElementsByTagName(match[1]); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + if ( div.firstChild && div.firstChild.getAttribute("href") !== "#" ) { + Expr.attrHandle.href = function(elem){ + return elem.getAttribute("href", 2); + }; + } +})(); + +if ( document.querySelectorAll ) (function(){ + var oldSizzle = Sizzle, div = document.createElement("div"); + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function(query, context, extra, seed){ + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && context.nodeType === 9 && !isXML(context) ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(e){} + } + + return oldSizzle(query, context, extra, seed); + }; + + Sizzle.find = oldSizzle.find; + Sizzle.filter = oldSizzle.filter; + Sizzle.selectors = oldSizzle.selectors; + Sizzle.matches = oldSizzle.matches; +})(); + +if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) { + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function(match, context) { + return context.getElementsByClassName(match[1]); + }; +} + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + elem = elem[dir]; + var match = false; + + while ( elem && elem.nodeType ) { + var done = elem[doneName]; + if ( done ) { + match = checkSet[ done ]; + break; + } + + if ( elem.nodeType === 1 && !isXML ) + elem[doneName] = i; + + if ( elem.nodeName === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + elem = elem[dir]; + var match = false; + + while ( elem && elem.nodeType ) { + if ( elem[doneName] ) { + match = checkSet[ elem[doneName] ]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) + elem[doneName] = i; + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +var contains = document.compareDocumentPosition ? function(a, b){ + return a.compareDocumentPosition(b) & 16; +} : function(a, b){ + return a !== b && (a.contains ? a.contains(b) : true); +}; + +var isXML = function(elem){ + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && isXML( elem.ownerDocument ); +}; + +var posProcess = function(selector, context){ + var tmpSet = [], later = "", match, + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.filter = Sizzle.filter; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; + +Sizzle.selectors.filters.hidden = function(elem){ + return "hidden" === elem.type || + jQuery.css(elem, "display") === "none" || + jQuery.css(elem, "visibility") === "hidden"; +}; + +Sizzle.selectors.filters.visible = function(elem){ + return "hidden" !== elem.type && + jQuery.css(elem, "display") !== "none" && + jQuery.css(elem, "visibility") !== "hidden"; +}; + +Sizzle.selectors.filters.animated = function(elem){ + return jQuery.grep(jQuery.timers, function(fn){ + return elem === fn.elem; + }).length; +}; + +jQuery.multiFilter = function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return Sizzle.matches(expr, elems); +}; + +jQuery.dir = function( elem, dir ){ + var matched = [], cur = elem[dir]; + while ( cur && cur != document ) { + if ( cur.nodeType == 1 ) + matched.push( cur ); + cur = cur[dir]; + } + return matched; +}; + +jQuery.nth = function(cur, result, dir, elem){ + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) + if ( cur.nodeType == 1 && ++num == result ) + break; + + return cur; +}; + +jQuery.sibling = function(n, elem){ + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType == 1 && n != elem ) + r.push( n ); + } + + return r; +}; + +return; + +window.Sizzle = Sizzle; + +})(); +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function(elem, types, handler, data) { + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( elem.setInterval && elem != window ) + elem = window; + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) + handler.guid = this.guid++; + + // if data is passed, bind to handler + if ( data !== undefined ) { + // Create temporary function pointer to original handler + var fn = handler; + + // Create unique handler function, wrapped around original handler + handler = this.proxy( fn ); + + // Store data in unique handler + handler.data = data; + } + + // Init the element's event structure + var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}), + handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){ + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply(arguments.callee.elem, arguments) : + undefined; + }); + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native + // event in IE. + handle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type) { + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + handler.type = namespaces.slice().sort().join("."); + + // Get the current list of functions bound to this event + var handlers = events[type]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].setup.call(elem, data, namespaces); + + // Init the event handler queue + if (!handlers) { + handlers = events[type] = {}; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) { + // Bind the global event handler to the element + if (elem.addEventListener) + elem.addEventListener(type, handle, false); + else if (elem.attachEvent) + elem.attachEvent("on" + type, handle); + } + } + + // Add the function to the element's handler list + handlers[handler.guid] = handler; + + // Keep track of which events have been used, for global triggering + jQuery.event.global[type] = true; + }); + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + guid: 1, + global: {}, + + // Detach an event or set of events from an element + remove: function(elem, types, handler) { + // don't do events on text and comment nodes + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + var events = jQuery.data(elem, "events"), ret, index; + + if ( events ) { + // Unbind all events for the element + if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") ) + for ( var type in events ) + this.remove( elem, type + (types || "") ); + else { + // types is actually an event object here + if ( types.type ) { + handler = types.handler; + types = types.type; + } + + // Handle multiple events seperated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type){ + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + if ( events[type] ) { + // remove the given handler for the given type + if ( handler ) + delete events[type][handler.guid]; + + // remove all handlers for the given type + else + for ( var handle in events[type] ) + // Handle the removal of namespaced events + if ( namespace.test(events[type][handle].type) ) + delete events[type][handle]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].teardown.call(elem, namespaces); + + // remove generic event handler if no more handlers exist + for ( ret in events[type] ) break; + if ( !ret ) { + if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) { + if (elem.removeEventListener) + elem.removeEventListener(type, jQuery.data(elem, "handle"), false); + else if (elem.detachEvent) + elem.detachEvent("on" + type, jQuery.data(elem, "handle")); + } + ret = null; + delete events[type]; + } + } + }); + } + + // Remove the expando if it's no longer used + for ( ret in events ) break; + if ( !ret ) { + var handle = jQuery.data( elem, "handle" ); + if ( handle ) handle.elem = null; + jQuery.removeData( elem, "events" ); + jQuery.removeData( elem, "handle" ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem, bubbling ) { + // Event object or event type + var type = event.type || event; + + if( !bubbling ){ + event = typeof event === "object" ? + // jQuery.Event object + event[expando] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + // Only trigger if we've ever bound an event for it + if ( this.global[type] ) + jQuery.each( jQuery.cache, function(){ + if ( this.events && this.events[type] ) + jQuery.event.trigger( event, data, this.handle.elem ); + }); + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 ) + return undefined; + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray(data); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = jQuery.data(elem, "handle"); + if ( handle ) + handle.apply( elem, data ); + + // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links) + if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false ) + event.result = false; + + // Trigger the native events (except for clicks on links) + if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) { + this.triggered = true; + try { + elem[ type ](); + // prevent IE from throwing an error for some hidden elements + } catch (e) {} + } + + this.triggered = false; + + if ( !event.isPropagationStopped() ) { + var parent = elem.parentNode || elem.ownerDocument; + if ( parent ) + jQuery.event.trigger(event, data, parent, true); + } + }, + + handle: function(event) { + // returned undefined or false + var all, handlers; + + event = arguments[0] = jQuery.event.fix( event || window.event ); + + // Namespaced event handlers + var namespaces = event.type.split("."); + event.type = namespaces.shift(); + + // Cache this now, all = true means, any handler + all = !namespaces.length && !event.exclusive; + + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + handlers = ( jQuery.data(this, "events") || {} )[event.type]; + + for ( var j in handlers ) { + var handler = handlers[j]; + + // Filter the functions by class + if ( all || namespace.test(handler.type) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handler; + event.data = handler.data; + + var ret = handler.apply(this, arguments); + + if( ret !== undefined ){ + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if( event.isImmediatePropagationStopped() ) + break; + + } + } + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function(event) { + if ( event[expando] ) + return event; + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ){ + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) + event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either + + // check if target is a textnode (safari) + if ( event.target.nodeType == 3 ) + event.target = event.target.parentNode; + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) + event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, body = document.body; + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0); + } + + // Add which for key events + if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) + event.which = event.charCode || event.keyCode; + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) + event.metaKey = event.ctrlKey; + + // Add which for click: 1 == left; 2 == middle; 3 == right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button ) + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + + return event; + }, + + proxy: function( fn, proxy ){ + proxy = proxy || function(){ return fn.apply(this, arguments); }; + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++; + // So proxy can be declared as an argument + return proxy; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: bindReady, + teardown: function() {} + } + }, + + specialAll: { + live: { + setup: function( selector, namespaces ){ + jQuery.event.add( this, namespaces[0], liveHandler ); + }, + teardown: function( namespaces ){ + if ( namespaces.length ) { + var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)"); + + jQuery.each( (jQuery.data(this, "events").live || {}), function(){ + if ( name.test(this.type) ) + remove++; + }); + + if ( remove < 1 ) + jQuery.event.remove( this, namespaces[0], liveHandler ); + } + } + } + } +}; + +jQuery.Event = function( src ){ + // Allow instantiation without the 'new' keyword + if( !this.preventDefault ) + return new jQuery.Event(src); + + // Event object + if( src && src.type ){ + this.originalEvent = src; + this.type = src.type; + // Event type + }else + this.type = src; + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = now(); + + // Mark it as fixed + this[expando] = true; +}; + +function returnFalse(){ + return false; +} +function returnTrue(){ + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if preventDefault exists run it on the original event + if (e.preventDefault) + e.preventDefault(); + // otherwise set the returnValue property of the original event to false (IE) + e.returnValue = false; + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if stopPropagation exists run it on the original event + if (e.stopPropagation) + e.stopPropagation(); + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation:function(){ + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function(event) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + // Traverse up the tree + while ( parent && parent != this ) + try { parent = parent.parentNode; } + catch(e) { parent = this; } + + if( parent != this ){ + // set the correct event type + event.type = event.data; + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } +}; + +jQuery.each({ + mouseover: 'mouseenter', + mouseout: 'mouseleave' +}, function( orig, fix ){ + jQuery.event.special[ fix ] = { + setup: function(){ + jQuery.event.add( this, orig, withinElement, fix ); + }, + teardown: function(){ + jQuery.event.remove( this, orig, withinElement ); + } + }; +}); + +jQuery.fn.extend({ + bind: function( type, data, fn ) { + return type == "unload" ? this.one(type, data, fn) : this.each(function(){ + jQuery.event.add( this, type, fn || data, fn && data ); + }); + }, + + one: function( type, data, fn ) { + var one = jQuery.event.proxy( fn || data, function(event) { + jQuery(this).unbind(event, one); + return (fn || data).apply( this, arguments ); + }); + return this.each(function(){ + jQuery.event.add( this, type, one, fn && data); + }); + }, + + unbind: function( type, fn ) { + return this.each(function(){ + jQuery.event.remove( this, type, fn ); + }); + }, + + trigger: function( type, data ) { + return this.each(function(){ + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if( this[0] ){ + var event = jQuery.Event(type); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, i = 1; + + // link all the functions, so any of them can unbind this click handler + while( i < args.length ) + jQuery.event.proxy( fn, args[i++] ); + + return this.click( jQuery.event.proxy( fn, function(event) { + // Figure out which function to execute + this.lastToggle = ( this.lastToggle || 0 ) % i; + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ this.lastToggle++ ].apply( this, arguments ) || false; + })); + }, + + hover: function(fnOver, fnOut) { + return this.mouseenter(fnOver).mouseleave(fnOut); + }, + + ready: function(fn) { + // Attach the listeners + bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + else + // Add the function to the wait list + jQuery.readyList.push( fn ); + + return this; + }, + + live: function( type, fn ){ + var proxy = jQuery.event.proxy( fn ); + proxy.guid += this.selector + type; + + jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy ); + + return this; + }, + + die: function( type, fn ){ + jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null ); + return this; + } +}); + +function liveHandler( event ){ + var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"), + stop = true, + elems = []; + + jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){ + if ( check.test(fn.type) ) { + var elem = jQuery(event.target).closest(fn.data)[0]; + if ( elem ) + elems.push({ elem: elem, fn: fn }); + } + }); + + jQuery.each(elems, function(){ + if ( this.fn.call(this.elem, event, this.fn.data) === false ) + stop = false; + }); + + return stop; +} + +function liveConvert(type, selector){ + return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join("."); +} + +jQuery.extend({ + isReady: false, + readyList: [], + // Handle when the DOM is ready + ready: function() { + // Make sure that the DOM is not already loaded + if ( !jQuery.isReady ) { + // Remember that the DOM is ready + jQuery.isReady = true; + + // If there are functions bound, to execute + if ( jQuery.readyList ) { + // Execute all of them + jQuery.each( jQuery.readyList, function(){ + this.call( document, jQuery ); + }); + + // Reset the list of functions + jQuery.readyList = null; + } + + // Trigger any bound ready events + jQuery(document).triggerHandler("ready"); + } + } +}); + +var readyBound = false; + +function bindReady(){ + if ( readyBound ) return; + readyBound = true; + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", function(){ + document.removeEventListener( "DOMContentLoaded", arguments.callee, false ); + jQuery.ready(); + }, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", function(){ + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", arguments.callee ); + jQuery.ready(); + } + }); + + // If IE and not an iframe + // continually check to see if the document is ready + if ( document.documentElement.doScroll && typeof window.frameElement === "undefined" ) (function(){ + if ( jQuery.isReady ) return; + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch( error ) { + setTimeout( arguments.callee, 0 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); + })(); + } + + // A fallback to window.onload, that will always work + jQuery.event.add( window, "load", jQuery.ready ); +} + +jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," + + "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," + + "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){ + + // Handle event binding + jQuery.fn[name] = function(fn){ + return fn ? this.bind(name, fn) : this.trigger(name); + }; +}); + +// Prevent memory leaks in IE +// And prevent errors on refresh with events like mouseover in other browsers +// Window isn't included so as not to unbind existing unload events +jQuery( window ).bind( 'unload', function(){ + for ( var id in jQuery.cache ) + // Skip the window + if ( id != 1 && jQuery.cache[ id ].handle ) + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); +}); +(function(){ + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + (new Date).getTime(); + + div.style.display = "none"; + div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>'; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType == 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that you can get all elements in an <object> element + // IE 7 always returns no results + objectAll: !!div.getElementsByTagName("object")[0] + .getElementsByTagName("*").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + opacity: a.style.opacity === "0.5", + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Will be defined later + scriptEval: false, + noCloneEvent: true, + boxModel: null + }; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e){} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function(){ + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", arguments.callee); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function(){ + var div = document.createElement("div"); + div.style.width = "1px"; + div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + document.body.removeChild( div ); + }); +})(); + +var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat"; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + "float": styleFloat, + cssFloat: styleFloat, + styleFloat: styleFloat, + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + tabindex: "tabIndex" +}; +jQuery.fn.extend({ + // Keep a copy of the old load + _load: jQuery.fn.load, + + load: function( url, params, callback ) { + if ( typeof url !== "string" ) + return this._load( url ); + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if( typeof params === "object" ) { + params = jQuery.param( params ); + type = "POST"; + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function(res, status){ + // If successful, inject the HTML into all the matched elements + if ( status == "success" || status == "notmodified" ) + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div/>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + + if( callback ) + self.each( callback, [res.responseText, status, res] ); + } + }); + return this; + }, + + serialize: function() { + return jQuery.param(this.serializeArray()); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + (this.checked || /select|textarea/i.test(this.nodeName) || + /text|hidden|password/i.test(this.type)); + }) + .map(function(i, elem){ + var val = jQuery(this).val(); + return val == null ? null : + jQuery.isArray(val) ? + jQuery.map( val, function(val, i){ + return {name: elem.name, value: val}; + }) : + {name: elem.name, value: val}; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){ + jQuery.fn[o] = function(f){ + return this.bind(o, f); + }; +}); + +var jsc = now(); + +jQuery.extend({ + + get: function( url, data, callback, type ) { + // shift arguments if data argument was ommited + if ( jQuery.isFunction( data ) ) { + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + if ( jQuery.isFunction( data ) ) { + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + */ + // Create the request object; Microsoft failed to properly + // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available + // This function can be overriden by calling jQuery.ajaxSetup + xhr:function(){ + return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + // Last-Modified header cache for next request + lastModified: {}, + + ajax: function( s ) { + // Extend the settings, but re-extend 's' so that it can be + // checked again later (in the test suite, specifically) + s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s)); + + var jsonp, jsre = /=\?(&|$)/g, status, data, + type = s.type.toUpperCase(); + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) + s.data = jQuery.param(s.data); + + // Handle JSONP Parameter Callbacks + if ( s.dataType == "jsonp" ) { + if ( type == "GET" ) { + if ( !s.url.match(jsre) ) + s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } else if ( !s.data || !s.data.match(jsre) ) + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) { + jsonp = "jsonp" + jsc++; + + // Replace the =? sequence both in the query string and the data + if ( s.data ) + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + window[ jsonp ] = function(tmp){ + data = tmp; + success(); + complete(); + // Garbage collect + window[ jsonp ] = undefined; + try{ delete window[ jsonp ]; } catch(e){} + if ( head ) + head.removeChild( script ); + }; + } + + if ( s.dataType == "script" && s.cache == null ) + s.cache = false; + + if ( s.cache === false && type == "GET" ) { + var ts = now(); + // try replacing _= if it is there + var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2"); + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for get requests + if ( s.data && type == "GET" ) { + s.url += (s.url.match(/\?/) ? "&" : "?") + s.data; + + // IE likes to send both get and post data, prevent this + s.data = null; + } + + // Watch for a new set of requests + if ( s.global && ! jQuery.active++ ) + jQuery.event.trigger( "ajaxStart" ); + + // Matches an absolute URL, and saves the domain + var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url ); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType == "script" && type == "GET" && parts + && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){ + + var head = document.getElementsByTagName("head")[0]; + var script = document.createElement("script"); + script.src = s.url; + if (s.scriptCharset) + script.charset = s.scriptCharset; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function(){ + if ( !done && (!this.readyState || + this.readyState == "loaded" || this.readyState == "complete") ) { + done = true; + success(); + complete(); + head.removeChild( script ); + } + }; + } + + head.appendChild(script); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if( s.username ) + xhr.open(type, s.url, s.async, s.username, s.password); + else + xhr.open(type, s.url, s.async); + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set the correct header, if data is being sent + if ( s.data ) + xhr.setRequestHeader("Content-Type", s.contentType); + + // Set the If-Modified-Since header, if ifModified mode. + if ( s.ifModified ) + xhr.setRequestHeader("If-Modified-Since", + jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" ); + + // Set header so the called script knows that it's an XMLHttpRequest + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*" : + s.accepts._default ); + } catch(e){} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend(xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) + jQuery.event.trigger("ajaxSend", [xhr, s]); + + // Wait for a response to come back + var onreadystatechange = function(isTimeout){ + // The request was aborted, clear the interval and decrement jQuery.active + if (xhr.readyState == 0) { + if (ival) { + // clear poll interval + clearInterval(ival); + ival = null; + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) { + requestDone = true; + + // clear poll interval + if (ival) { + clearInterval(ival); + ival = null; + } + + status = isTimeout == "timeout" ? "timeout" : + !jQuery.httpSuccess( xhr ) ? "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" : + "success"; + + if ( status == "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch(e) { + status = "parsererror"; + } + } + + // Make sure that the request was successful or notmodified + if ( status == "success" ) { + // Cache Last-Modified header, if ifModified mode. + var modRes; + try { + modRes = xhr.getResponseHeader("Last-Modified"); + } catch(e) {} // swallow exception thrown by FF if header is not available + + if ( s.ifModified && modRes ) + jQuery.lastModified[s.url] = modRes; + + // JSONP handles its own success callback + if ( !jsonp ) + success(); + } else + jQuery.handleError(s, xhr, status); + + // Fire the complete handlers + complete(); + + if ( isTimeout ) + xhr.abort(); + + // Stop memory leaks + if ( s.async ) + xhr = null; + } + }; + + if ( s.async ) { + // don't attach the handler to the request, just poll it instead + var ival = setInterval(onreadystatechange, 13); + + // Timeout checker + if ( s.timeout > 0 ) + setTimeout(function(){ + // Check to see if the request is still happening + if ( xhr && !requestDone ) + onreadystatechange( "timeout" ); + }, s.timeout); + } + + // Send the data + try { + xhr.send(s.data); + } catch(e) { + jQuery.handleError(s, xhr, null, e); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) + onreadystatechange(); + + function success(){ + // If a local callback was specified, fire it and pass it the data + if ( s.success ) + s.success( data, status ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxSuccess", [xhr, s] ); + } + + function complete(){ + // Process result + if ( s.complete ) + s.complete(xhr, status); + + // The request was completed + if ( s.global ) + jQuery.event.trigger( "ajaxComplete", [xhr, s] ); + + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + handleError: function( s, xhr, status, e ) { + // If a local callback was specified, fire it + if ( s.error ) s.error( xhr, status, e ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxError", [xhr, s, e] ); + }, + + // Counter for holding the number of active queries + active: 0, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol == "file:" || + ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223; + } catch(e){} + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + try { + var xhrRes = xhr.getResponseHeader("Last-Modified"); + + // Firefox always returns 200. check Last-Modified date + return xhr.status == 304 || xhrRes == jQuery.lastModified[url]; + } catch(e){} + return false; + }, + + httpData: function( xhr, type, s ) { + var ct = xhr.getResponseHeader("content-type"), + xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.tagName == "parsererror" ) + throw "parsererror"; + + // Allow a pre-filtering function to sanitize the response + // s != null is checked to keep backwards compatibility + if( s && s.dataFilter ) + data = s.dataFilter( data, type ); + + // The filter can actually parse the response + if( typeof data === "string" ){ + + // If the type is "script", eval it in global context + if ( type == "script" ) + jQuery.globalEval( data ); + + // Get the JavaScript object, if JSON is used. + if ( type == "json" ) + data = window["eval"]("(" + data + ")"); + } + + return data; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a ) { + var s = [ ]; + + function add( key, value ){ + s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value); + }; + + // If an array was passed in, assume that it is an array + // of form elements + if ( jQuery.isArray(a) || a.jquery ) + // Serialize the form elements + jQuery.each( a, function(){ + add( this.name, this.value ); + }); + + // Otherwise, assume that it's an object of key/value pairs + else + // Serialize the key/values + for ( var j in a ) + // If the value is an array then the key names need to be repeated + if ( jQuery.isArray(a[j]) ) + jQuery.each( a[j], function(){ + add( j, this ); + }); + else + add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] ); + + // Return the resulting serialization + return s.join("&").replace(/%20/g, "+"); + } + +}); +var elemdisplay = {}, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +function genFx( type, num ){ + var obj = {}; + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){ + obj[ this ] = type; + }); + return obj; +} + +jQuery.fn.extend({ + show: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("show", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + + this[i].style.display = old || ""; + + if ( jQuery.css(this[i], "display") === "none" ) { + var tagName = this[i].tagName, display; + + if ( elemdisplay[ tagName ] ) { + display = elemdisplay[ tagName ]; + } else { + var elem = jQuery("<" + tagName + " />").appendTo("body"); + + display = elem.css("display"); + if ( display === "none" ) + display = "block"; + + elem.remove(); + + elemdisplay[ tagName ] = display; + } + + this[i].style.display = jQuery.data(this[i], "olddisplay", display); + } + } + + return this; + } + }, + + hide: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("hide", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + if ( !old && old !== "none" ) + jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display")); + this[i].style.display = "none"; + } + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2 ){ + var bool = typeof fn === "boolean"; + + return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ? + this._toggle.apply( this, arguments ) : + fn == null || bool ? + this.each(function(){ + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }) : + this.animate(genFx("toggle", 3), fn, fn2); + }, + + fadeTo: function(speed,to,callback){ + return this.animate({opacity: to}, speed, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + return this[ optall.queue === false ? "each" : "queue" ](function(){ + + var opt = jQuery.extend({}, optall), p, + hidden = this.nodeType == 1 && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden ) + return opt.complete.call(this); + + if ( ( p == "height" || p == "width" ) && this.style ) { + // Store display property + opt.display = jQuery.css(this, "display"); + + // Make sure that nothing sneaks out + opt.overflow = this.style.overflow; + } + } + + if ( opt.overflow != null ) + this.style.overflow = "hidden"; + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function(name, val){ + var e = new jQuery.fx( self, opt, name ); + + if ( /toggle|show|hide/.test(val) ) + e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + else { + var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/), + start = e.cur(true) || 0; + + if ( parts ) { + var end = parseFloat(parts[2]), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit != "px" ) { + self.style[ name ] = (end || 1) + unit; + start = ((end || 1) / e.cur(true)) * start; + self.style[ name ] = start + unit; + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) + end = ((parts[1] == "-=" ? -1 : 1) * end) + start; + + e.custom( start, end, unit ); + } else + e.custom( start, val, "" ); + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function(clearQueue, gotoEnd){ + var timers = jQuery.timers; + + if (clearQueue) + this.queue([]); + + this.each(function(){ + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) + if ( timers[i].elem == this ) { + if (gotoEnd) + // force the next step to be the last + timers[i](true); + timers.splice(i, 1); + } + }); + + // start the next in the queue if the last step wasn't forced + if (!gotoEnd) + this.dequeue(); + + return this; + } + +}); + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" } +}, function( name, props ){ + jQuery.fn[ name ] = function( speed, callback ){ + return this.animate( props, speed, callback ); + }; +}); + +jQuery.extend({ + + speed: function(speed, easing, fn) { + var opt = typeof speed === "object" ? speed : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function(){ + if ( opt.queue !== false ) + jQuery(this).dequeue(); + if ( jQuery.isFunction( opt.old ) ) + opt.old.call( this ); + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ){ + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) + options.orig = {}; + } + +}); + +jQuery.fx.prototype = { + + // Simple function for setting a style value + update: function(){ + if ( this.options.step ) + this.options.step.call( this.elem, this.now, this ); + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + + // Set display property to block for height/width animations + if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style ) + this.elem.style.display = "block"; + }, + + // Get the current size + cur: function(force){ + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) + return this.elem[ this.prop ]; + + var r = parseFloat(jQuery.css(this.elem, this.prop, force)); + return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0; + }, + + // Start an animation from one number to another + custom: function(from, to, unit){ + this.startTime = now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + var self = this; + function t(gotoEnd){ + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) == 1 ) { + timerId = setInterval(function(){ + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) + if ( !timers[i]() ) + timers.splice(i--, 1); + + if ( !timers.length ) { + clearInterval( timerId ); + } + }, 13); + } + }, + + // Simple 'show' function + show: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery(this.elem).show(); + }, + + // Simple 'hide' function + hide: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function(gotoEnd){ + var t = now(); + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + var done = true; + for ( var i in this.options.curAnim ) + if ( this.options.curAnim[i] !== true ) + done = false; + + if ( done ) { + if ( this.options.display != null ) { + // Reset the overflow + this.elem.style.overflow = this.options.overflow; + + // Reset the display + this.elem.style.display = this.options.display; + if ( jQuery.css(this.elem, "display") == "none" ) + this.elem.style.display = "block"; + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) + jQuery(this.elem).hide(); + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) + for ( var p in this.options.curAnim ) + jQuery.attr(this.elem.style, p, this.options.orig[p]); + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } + +}; + +jQuery.extend( jQuery.fx, { + speeds:{ + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + step: { + + opacity: function(fx){ + jQuery.attr(fx.elem.style, "opacity", fx.now); + }, + + _default: function(fx){ + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + else + fx.elem[ fx.prop ] = fx.now; + } + } +}); +if ( document.documentElement["getBoundingClientRect"] ) + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement, + clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0, + top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop, + left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft; + return { top: top, left: left }; + }; +else + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + jQuery.offset.initialized || jQuery.offset.initialize(); + + var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem, + doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement, + body = doc.body, defaultView = doc.defaultView, + prevComputedStyle = defaultView.getComputedStyle(elem, null), + top = elem.offsetTop, left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + computedStyle = defaultView.getComputedStyle(elem, null); + top -= elem.scrollTop, left -= elem.scrollLeft; + if ( elem === offsetParent ) { + top += elem.offsetTop, left += elem.offsetLeft; + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevOffsetParent = offsetParent, offsetParent = elem.offsetParent; + } + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) + top += body.offsetTop, + left += body.offsetLeft; + + if ( prevComputedStyle.position === "fixed" ) + top += Math.max(docElem.scrollTop, body.scrollTop), + left += Math.max(docElem.scrollLeft, body.scrollLeft); + + return { top: top, left: left }; + }; + +jQuery.offset = { + initialize: function() { + if ( this.initialized ) return; + var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop, + html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>'; + + rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' }; + for ( prop in rules ) container.style[prop] = rules[prop]; + + container.innerHTML = html; + body.insertBefore(container, body.firstChild); + innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative'; + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + body.style.marginTop = '1px'; + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0); + body.style.marginTop = bodyMarginTop; + + body.removeChild(container); + this.initialized = true; + }, + + bodyOffset: function(body) { + jQuery.offset.initialized || jQuery.offset.initialize(); + var top = body.offsetTop, left = body.offsetLeft; + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) + top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0, + left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0; + return { top: top, left: left }; + } +}; + + +jQuery.fn.extend({ + position: function() { + var left = 0, top = 0, results; + + if ( this[0] ) { + // Get *real* offsetParent + var offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= num( this, 'marginTop' ); + offset.left -= num( this, 'marginLeft' ); + + // Add offsetParent borders + parentOffset.top += num( offsetParent, 'borderTopWidth' ); + parentOffset.left += num( offsetParent, 'borderLeftWidth' ); + + // Subtract the two offsets + results = { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + } + + return results; + }, + + offsetParent: function() { + var offsetParent = this[0].offsetParent || document.body; + while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') ) + offsetParent = offsetParent.offsetParent; + return jQuery(offsetParent); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ['Left', 'Top'], function(i, name) { + var method = 'scroll' + name; + + jQuery.fn[ method ] = function(val) { + if (!this[0]) return null; + + return val !== undefined ? + + // Set the scroll offset + this.each(function() { + this == window || this == document ? + window.scrollTo( + !i ? val : jQuery(window).scrollLeft(), + i ? val : jQuery(window).scrollTop() + ) : + this[ method ] = val; + }) : + + // Return the scroll offset + this[0] == window || this[0] == document ? + self[ i ? 'pageYOffset' : 'pageXOffset' ] || + jQuery.boxModel && document.documentElement[ method ] || + document.body[ method ] : + this[0][ method ]; + }; +}); +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function(i, name){ + + var tl = i ? "Left" : "Top", // top or left + br = i ? "Right" : "Bottom"; // bottom or right + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function(){ + return this[ name.toLowerCase() ]() + + num(this, "padding" + tl) + + num(this, "padding" + br); + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function(margin) { + return this["inner" + name]() + + num(this, "border" + tl + "Width") + + num(this, "border" + br + "Width") + + (margin ? + num(this, "margin" + tl) + num(this, "margin" + br) : 0); + }; + + var type = name.toLowerCase(); + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + return this[0] == window ? + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] || + document.body[ "client" + name ] : + + // Get document width or height + this[0] == document ? + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + Math.max( + document.documentElement["client" + name], + document.body["scroll" + name], document.documentElement["scroll" + name], + document.body["offset" + name], document.documentElement["offset" + name] + ) : + + // Get or set width or height on the element + size === undefined ? + // Get width or height on the element + (this.length ? jQuery.css( this[0], type ) : null) : + + // Set the width or height on the element (default to pixels if value is unitless) + this.css( type, typeof size === "string" ? size : size + "px" ); + }; + +});})(); diff --git a/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.js b/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.js new file mode 100644 index 0000000..71bea46 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.js @@ -0,0 +1,4126 @@ +/* + * jQuery UI 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +;(function($) { + +var _remove = $.fn.remove, + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); + +//Helper functions and ui object +$.ui = { + version: "1.6rc6", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + cssCache: {}, + css: function(name) { + if ($.ui.cssCache[name]) { return $.ui.cssCache[name]; } + var tmp = $('<div class="ui-gen"></div>').addClass(name).css({position:'absolute', top:'-5000px', left:'-5000px', display:'block'}).appendTo('body'); + + //if (!$.browser.safari) + //tmp.appendTo('body'); + + //Opera and Safari set width and height to 0px instead of auto + //Safari returns rgba(0,0,0,0) when bgcolor is not set + $.ui.cssCache[name] = !!( + (!(/auto|default/).test(tmp.css('cursor')) || (/^[1-9]/).test(tmp.css('height')) || (/^[1-9]/).test(tmp.css('width')) || + !(/none/).test(tmp.css('backgroundImage')) || !(/transparent|rgba\(0, 0, 0, 0\)/).test(tmp.css('backgroundColor'))) + ); + try { $('body').get(0).removeChild(tmp.get(0)); } catch(e){} + return $.ui.cssCache[name]; + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38 + } +}; + +// WAI-ARIA normalization +if (isFF2) { + var attr = $.attr, + removeAttr = $.fn.removeAttr, + ariaNS = "http://www.w3.org/2005/07/aaa", + ariaState = /^aria-/, + ariaRole = /^wairole:/; + + $.attr = function(elem, name, value) { + var set = value !== undefined; + + return (name == 'role' + ? (set + ? attr.call(this, elem, name, "wairole:" + value) + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) + : (ariaState.test(name) + ? (set + ? elem.setAttributeNS(ariaNS, + name.replace(ariaState, "aaa:"), value) + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) + : attr.apply(this, arguments))); + }; + + $.fn.removeAttr = function(name) { + return (ariaState.test(name) + ? this.each(function() { + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); + }) : removeAttr.call(this, name)); + }; +} + +//jQuery plugins +$.fn.extend({ + remove: function() { + // Safari has a native remove event which actually removes DOM elements, + // so we have to use triggerHandler instead of trigger (#3037). + $("*", this).add(this).each(function() { + $(this).triggerHandler("remove"); + }); + return _remove.apply(this, arguments ); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', '') + .unbind('selectstart.ui'); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none') + .bind('selectstart.ui', function() { return false; }); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + + +// $.widget is a factory to create jQuery plugins +// taking some boilerplate code out of the plugin code +function getter(namespace, plugin, method, args) { + function getMethods(type) { + var methods = $[namespace][plugin][type] || []; + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); + } + + var methods = getMethods('getter'); + if (args.length == 1 && typeof args[0] == 'string') { + methods = methods.concat(getMethods('getterSetter')); + } + return ($.inArray(method, methods) != -1); +} + +$.widget = function(name, prototype) { + var namespace = name.split(".")[0]; + name = name.split(".")[1]; + + // create plugin method + $.fn[name] = function(options) { + var isMethodCall = (typeof options == 'string'), + args = Array.prototype.slice.call(arguments, 1); + + // prevent calls to internal methods + if (isMethodCall && options.substring(0, 1) == '_') { + return this; + } + + // handle getter methods + if (isMethodCall && getter(namespace, name, options, args)) { + var instance = $.data(this[0], name); + return (instance ? instance[options].apply(instance, args) + : undefined); + } + + // handle initialization and non-getter methods + return this.each(function() { + var instance = $.data(this, name); + + // constructor + (!instance && !isMethodCall && + $.data(this, name, new $[namespace][name](this, options))._init()); + + // method call + (instance && isMethodCall && $.isFunction(instance[options]) && + instance[options].apply(instance, args)); + }); + }; + + // create widget constructor + $[namespace] = $[namespace] || {}; + $[namespace][name] = function(element, options) { + var self = this; + + this.namespace = namespace; + this.widgetName = name; + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; + this.widgetBaseClass = namespace + '-' + name; + + this.options = $.extend({}, + $.widget.defaults, + $[namespace][name].defaults, + $.metadata && $.metadata.get(element)[name], + options); + + this.element = $(element) + .bind('setData.' + name, function(event, key, value) { + if (event.target == element) { + return self._setData(key, value); + } + }) + .bind('getData.' + name, function(event, key) { + if (event.target == element) { + return self._getData(key); + } + }) + .bind('remove', function() { + return self.destroy(); + }); + }; + + // add widget prototype + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); + + // TODO: merge getter and getterSetter properties from widget prototype + // and plugin prototype + $[namespace][name].getterSetter = 'option'; +}; + +$.widget.prototype = { + _init: function() {}, + destroy: function() { + this.element.removeData(this.widgetName) + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') + .removeAttr('aria-disabled'); + }, + + option: function(key, value) { + var options = key, + self = this; + + if (typeof key == "string") { + if (value === undefined) { + return this._getData(key); + } + options = {}; + options[key] = value; + } + + $.each(options, function(key, value) { + self._setData(key, value); + }); + }, + _getData: function(key) { + return this.options[key]; + }, + _setData: function(key, value) { + this.options[key] = value; + + if (key == 'disabled') { + this.element + [value ? 'addClass' : 'removeClass']( + this.widgetBaseClass + '-disabled' + ' ' + + this.namespace + '-state-disabled') + .attr("aria-disabled", value); + } + }, + + enable: function() { + this._setData('disabled', false); + }, + disable: function() { + this._setData('disabled', true); + }, + + _trigger: function(type, event, data) { + var callback = this.options[type], + eventName = (type == this.widgetEventPrefix + ? type : this.widgetEventPrefix + type); + + event = $.Event(event); + event.type = eventName; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if (event.originalEvent) { + for (var i = $.event.props.length, prop; i;) { + prop = $.event.props[--i]; + event[prop] = event.originalEvent[prop]; + } + } + + this.element.trigger(event, data); + + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false + || event.isDefaultPrevented()); + } +}; + +$.widget.defaults = { + disabled: false +}; + + +/** Mouse Interaction Plugin **/ + +$.ui.mouse = { + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + return false; + } + }); + + // Prevent text selection in IE + if ($.browser.msie) { + this._mouseUnselectable = this.element.attr('unselectable'); + this.element.attr('unselectable', 'on'); + } + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + + // Restore text selection in IE + ($.browser.msie + && this.element.attr('unselectable', this._mouseUnselectable)); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = true; + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}; + +$.ui.mouse.defaults = { + cancel: null, + distance: 1, + delay: 0 +}; + +})(jQuery); +/* + * jQuery UI Draggable 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-draggable")); + (this.options.disabled && this.element.addClass(this.options.cssNamespace+'-draggable-disabled')); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+'-draggable '+this.options.cssNamespace+'-draggable-dragging '+this.options.cssNamespace+'-draggable-disabled'); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.'+this.options.cssNamespace+'-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass(o.cssNamespace+"-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body && $.browser.mozilla) //Ugly FF3 fix + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.6rc6", + eventPrefix: "drag", + defaults: { + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cssNamespace: "ui", + cursor: "default", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + inst.sortables = []; + $(o.connectToSortable).each(function() { + // 'this' points to a string, and should therefore resolved as query, but instead, if the string is assigned to a variable, it loops through the strings properties, + // so we have to append '' to make it anonymous again + $(typeof this == 'string' ? this+'': this).each(function() { + if($.data(this, 'sortable')) { + var sortable = $.data(this, 'sortable'); + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, inst); + } + }); + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, inst); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + if(checkPos.call(inst, this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + this.instance.fromOutside = inst; //Little hack so receive/update callbacks work + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + this.instance.options.revert = false; //No revert here + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.absolutePosition.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.absolutePosition.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Resizable 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + proportionallyResize: o.proportionallyResize ? [o.proportionallyResize] : [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent(); + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + if ($.browser.safari && o.preventDefault) this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this.proportionallyResize.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + if (o.transparent) + this.handles[i].css({ opacity: 0 }); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + if (!o.transparent) + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element); + + if (o.disableSelection) + this._handles.disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + this.wrapper.parent().append( + this.originalElement.css({ + position: this.wrapper.css('position'), + width: this.wrapper.outerWidth(), + height: this.wrapper.outerHeight(), + top: this.wrapper.css('top'), + left: this.wrapper.css('left') + }) + ).end().remove(); + } + + _destroy(this.originalElement); + + }, + + _mouseCapture: function(event) { + + var handle = false; + for(var i in this.handles) { + if($(this.handles[i])[0] == event.target) handle = true; + } + + return this.options.disabled || !!handle; + + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + if (o.preserveCursor) { + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + } + + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this.proportionallyResize.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this.proportionallyResize, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + if (o.preserveCursor) + $('body').css('cursor', 'auto'); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (data.left) this.position.left = data.left; + if (data.top) this.position.top = data.top; + if (data.height) this.size.height = data.height; + if (data.width) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var isNumber = function(value) { + return !isNaN(parseInt(value, 10)) + }; + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this.proportionallyResize.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this.proportionallyResize.length; i++) { + + var prel = this.proportionallyResize[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper.appendTo("body"); + + if (o.disableSelection) + this.helper.disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +})); + +$.extend($.ui.resizable, { + version: "1.6rc6", + eventPrefix: "resize", + defaults: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + cancel: ":input,option", + containment: false, + delay: 0, + disableSelection: true, + distance: 1, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + preserveCursor: true, + preventDefault: true, + proportionallyResize: false, + transparent: false, + zIndex: 1000 + } +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = o.proportionallyResize, ista = pr && (/textarea/i).test(pr.get(0).nodeName), + soffseth = ista && $.ui.hasScroll(pr.get(0), 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr) pr.css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = o._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, pr = o.proportionallyResize, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +})(jQuery); +/* + * jQuery UI Dialog 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" +}; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('<div/>')) + .appendTo(document.body) + .hide() + .addClass( + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ' + + options.dialogClass + ) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"/>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span/>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + (this.shadow && this._destroyShadow()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + if (false === this._trigger('beforeclose', event)) { + return; + } + + (this.overlay && this.overlay.destroy()); + (this.shadow && this._destroyShadow()); + this.uiDialog + .hide(this.options.hide) + .unbind('keypress.ui-dialog'); + + this._trigger('close', event); + $.ui.dialog.overlay.resize(); + + this._isOpen = false; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + var maxZ = this.options.zIndex, options = this.options; + $('.ui-dialog:visible').each(function() { + maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10) || options.zIndex); + }); + (this.overlay && this.overlay.$el.css('z-index', ++maxZ)); + (this.shadow && this.shadow.css('z-index', ++maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function(event) { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true, event); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in: + // - content area + // - button pane + // - title bar + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog.find('.ui-dialog-titlebar :tabbable:first')) + .filter(':first') + .focus(); + + if(options.shadow) + this._createShadow(); + + this._trigger('open', event); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('<button type="button"></button>') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + helper: options.dragHelper, + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide(); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + self._refreshShadow(1); + }, + stop: function() { + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show(); + self._refreshShadow(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + helper: options.resizeHelper, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide(); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + self._refreshShadow(1); + }, + handles: resizeHandles, + stop: function() { + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show(); + self._refreshShadow(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : options.height - nonContentHeight + }); + }, + + _createShadow: function() { + this.shadow = $('<div class="ui-widget-shadow"></div>').css('position', 'absolute').appendTo(document.body); + this._refreshShadow(); + return this.shadow; + }, + + _refreshShadow: function(dragging) { + // IE6 is simply to slow to handle the reflow in a good way, so + // resizing only happens on stop, and the shadow is hidden during drag/resize + if(dragging && $.browser.msie && $.browser.version < 7) return; + + var offset = this.uiDialog.offset(); + this.shadow.css({ + left: offset.left, + top: offset.top, + width: this.uiDialog.outerWidth(), + height: this.uiDialog.outerHeight() + }); + }, + + _destroyShadow: function() { + this.shadow.remove(); + this.shadow = null; + } + +}); + +$.extend($.ui.dialog, { + version: "1.6rc6", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + draggable: true, + height: 'auto', + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + shadow: true, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + $('a, :input').bind($.ui.dialog.overlay.events, function() { + // allow use of the element if inside a dialog and + // - there are no modal dialogs + // - there are modal dialogs, but we are in front of the topmost modal + var allow = false; + var $dialog = $(this).parents('.ui-dialog'); + if ($dialog.length) { + var $overlays = $('.ui-dialog-overlay'); + if ($overlays.length) { + var maxZ = parseInt($overlays.css('z-index'), 10); + $overlays.each(function() { + maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10)); + }); + allow = parseInt($dialog.css('z-index'), 10) > maxZ; + } else { + allow = true; + } + } + return allow; + }); + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('<div></div>').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $('a, :input').add([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); +/* + * jQuery UI Effects 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/ + */ +;(function($) { + +$.effects = $.effects || {}; //Add the 'effects' scope + +$.extend($.effects, { + version: "1.6rc6", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + //if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) + return element.parent(); + + //Cache width,height and float properties of the element, and create a wrapper around it + var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') }; + element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>'); + var wrapper = element.parent(); + + //Transfer the positioning of the element to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative'} ); + } else { + var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto'; + var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto'; + wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show(); + element.css({position: 'relative', top: 0, left: 0 }); + } + + wrapper.css(props); + return wrapper; + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + }, + + //Base function to animate from one class to another in a seamless transition + animateClass: function(value, duration, easing, callback) { + + var cb = (typeof easing == "function" ? easing : (callback ? callback : null)); + var ea = (typeof easing == "string" ? easing : null); + + return this.each(function() { + + var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || ''; + if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */ + if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; } + + //Let's get a style offset + var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove); + var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove); + + // The main function to form the object for animation + for(var n in newStyle) { + if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */ + && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */ + && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */ + && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */ + && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */ + ) offset[n] = newStyle[n]; + } + + that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object + // Change style attribute back to original. For stupid IE, we need to clear the damn object. + if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr); + if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove); + if(cb) cb.apply(this, arguments); + }); + + }); + } +}); + + +function _normalizeArguments(a, m) { + + var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m; + var speed = a[1] && a[1].constructor != Object ? a[1] : o.duration; //either comes from options.duration or the second argument + speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default; + var callback = o.callback || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] ); + + return [a[0], o, speed, callback]; + +} + +//Extend the methods of jQuery +$.fn.extend({ + + //Save old methods + _show: $.fn.show, + _hide: $.fn.hide, + __toggle: $.fn.toggle, + _addClass: $.fn.addClass, + _removeClass: $.fn.removeClass, + _toggleClass: $.fn.toggleClass, + + // New effect methods + effect: function(fx, options, speed, callback) { + return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null; + }, + + show: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._show.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'show')); + } + }, + + hide: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._hide.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'hide')); + } + }, + + toggle: function(){ + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function)) + return this.__toggle.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'toggle')); + } + }, + + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + toggleClass: function(classNames,speed,easing,callback) { + return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed); + }, + morph: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + }, + switchClass: function() { + return this.morph.apply(this, arguments); + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + +/* + * jQuery Color Animations + * Copyright 2007 John Resig + * Released under the MIT and GPL licenses. + */ + +// We override the animation for all of these color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ + $.fx.step[attr] = function(fx) { + if ( fx.state == 0 ) { + fx.start = getColor( fx.elem, attr ); + fx.end = getRGB( fx.end ); + } + + fx.elem.style[attr] = "rgb(" + [ + Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0) + ].join(",") + ")"; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop")) || 0; + offset.left -= parseInt(el.css("marginLeft")) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1]) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.highlight = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['backgroundImage','backgroundColor','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var color = o.options.color || "#ffff99"; // Default highlight color + var oldColor = el.css("backgroundColor"); + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + el.css({backgroundImage: 'none', backgroundColor: color}); // Shift + + // Animation + var animation = {backgroundColor: oldColor }; + if (mode == "hide") animation['opacity'] = 0; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == "hide") el.hide(); + $.effects.restore(el, props); + if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter'); + if(o.callback) o.callback.apply(this, arguments); + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.pulsate = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var times = o.options.times || 5; // Default # of times + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + if (mode == 'hide') times--; + if (el.is(':hidden')) { // Show fadeIn + el.css('opacity', 0); + el.show(); // Show + el.animate({opacity: 1}, duration, o.options.easing); + times = times-2; + } + + // Animate + for (var i = 0; i < times; i++) { // Pulsate + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing); + }; + if (mode == 'hide') { // Last Pulse + el.animate({opacity: 0}, duration, o.options.easing, function(){ + el.hide(); // Hide + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){ + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.puff = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var percent = parseInt(o.options.percent) || 150; // Set default puff percent + options.fade = true; // It's not a puff if it doesn't fade! :) + var original = {height: el.height(), width: el.width()}; // Save original + + // Adjust + var factor = percent / 100; + el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor}; + + // Animation + options.from = el.from; + options.percent = (mode == 'hide') ? percent : 100; + options.mode = mode; + + // Animate + el.effect('scale', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent) || (parseInt(o.options.percent) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.transfer = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var target = $(o.options.to); // Find Target + var position = el.offset(); + var transfer = $('<div class="ui-effects-transfer"></div>').appendTo(document.body); + if(o.options.className) transfer.addClass(o.options.className); + + // Set target css + transfer.addClass(o.options.className); + transfer.css({ + top: position.top, + left: position.left, + height: el.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')), + width: el.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')), + position: 'absolute' + }); + + // Animation + position = target.offset(); + animation = { + top: position.top, + left: position.left, + height: target.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')), + width: target.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')) + }; + + // Animate + transfer.animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); // Remove div + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); diff --git a/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.min.js b/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.min.js new file mode 100644 index 0000000..2d97bb8 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/scripts/jquery-ui-personalized-1.6rc6.min.js @@ -0,0 +1,184 @@ +/*
+ * jQuery UI 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
(function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.6rc6",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n){return}for(var m=0;m<n.length;m++){if(j.options[n[m][0]]){n[m][1].apply(j.element,k)}}}},contains:function(k,j){return document.compareDocumentPosition?k.compareDocumentPosition(j)&16:k!==j&&k.contains(j)},cssCache:{},css:function(j){if(c.ui.cssCache[j]){return c.ui.cssCache[j]}var k=c('<div class="ui-gen"></div>').addClass(j).css({position:"absolute",top:"-5000px",left:"-5000px",display:"block"}).appendTo("body");c.ui.cssCache[j]=!!((!(/auto|default/).test(k.css("cursor"))||(/^[1-9]/).test(k.css("height"))||(/^[1-9]/).test(k.css("width"))||!(/none/).test(k.css("backgroundImage"))||!(/transparent|rgba\(0, 0, 0, 0\)/).test(k.css("backgroundColor"))));try{c("body").get(0).removeChild(k.get(0))}catch(l){}return c.ui.cssCache[j]},hasScroll:function(m,k){if(c(m).css("overflow")=="hidden"){return false}var j=(k&&k=="left")?"scrollLeft":"scrollTop",l=false;if(m[j]>0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=true;this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);;/*
+ * jQuery UI Draggable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
(function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.cssNamespace&&this.element.addClass(this.options.cssNamespace+"-draggable"));(this.options.disabled&&this.element.addClass(this.options.cssNamespace+"-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+"-draggable "+this.options.cssNamespace+"-draggable-dragging "+this.options.cssNamespace+"-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is("."+this.options.cssNamespace+"-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass(c.cssNamespace+"-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body&&a.browser.mozilla)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c)}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop()))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft()))}},_clear:function(){this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(b,c,d){d=d||this._uiHash();a.ui.plugin.call(this,b,[c,d]);if(b=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(b){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs}}}));a.extend(a.ui.draggable,{version:"1.6rc6",eventPrefix:"drag",defaults:{appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cssNamespace:"ui",cursor:"default",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});a.ui.plugin.add("draggable","connectToSortable",{start:function(b,d){var c=a(this).data("draggable"),e=c.options;c.sortables=[];a(e.connectToSortable).each(function(){a(typeof this=="string"?this+"":this).each(function(){if(a.data(this,"sortable")){var f=a.data(this,"sortable");c.sortables.push({instance:f,shouldRevert:f.options.revert});f._refreshItems();f._trigger("activate",b,c)}})})},stop:function(b,d){var c=a(this).data("draggable");a.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(b);this.instance.options.helper=this.instance.options._helper;if(c.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",b,c)}})},drag:function(c,f){var e=a(this).data("draggable"),b=this;var d=function(i){var n=this.offset.click.top,m=this.offset.click.left;var g=this.positionAbs.top,k=this.positionAbs.left;var j=i.height,l=i.width;var p=i.top,h=i.left;return a.ui.isOver(g+n,k+m,p,h,j,l)};a.each(e.sortables,function(g){if(d.call(e,this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(b).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c,true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=e.offset.click.top;this.instance.offset.click.left=e.offset.click.left;this.instance.offset.parent.left-=e.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=e.offset.parent.top-this.instance.offset.parent.top;e._trigger("toSortable",c);e.dropped=this.instance.element;this.instance.fromOutside=e}if(this.instance.currentItem){this.instance._mouseDrag(c)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}e._trigger("fromSortable",c);e.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(c,d){var b=a("body"),e=a(this).data("draggable").options;if(b.css("cursor")){e._cursor=b.css("cursor")}b.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._cursor){a("body").css("cursor",d._cursor)}}});a.ui.plugin.add("draggable","iframeFix",{start:function(b,c){var d=a(this).data("draggable").options;a(d.iframeFix===true?"iframe":d.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop+f.scrollSpeed}else{if(d.pageY-c.overflowOffset.top<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop-f.scrollSpeed}}}if(!f.axis||f.axis!="y"){if((c.overflowOffset.left+c.scrollParent[0].offsetWidth)-d.pageX<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft+f.scrollSpeed}else{if(d.pageX-c.overflowOffset.left<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft-f.scrollSpeed}}}}else{if(!f.axis||f.axis!="x"){if(d.pageY-a(document).scrollTop()<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-f.scrollSpeed)}else{if(a(window).height()-(d.pageY-a(document).scrollTop())<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+f.scrollSpeed)}}}if(!f.axis||f.axis!="y"){if(d.pageX-a(document).scrollLeft()<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-f.scrollSpeed)}else{if(a(window).width()-(d.pageX-a(document).scrollLeft())<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+f.scrollSpeed)}}}}if(b!==false&&a.ui.ddmanager&&!f.dropBehaviour){a.ui.ddmanager.prepareOffsets(c,d)}}});a.ui.plugin.add("draggable","snap",{start:function(c,d){var b=a(this).data("draggable"),e=b.options;b.snapElements=[];a(e.snap.constructor!=String?(e.snap.items||":data(draggable)"):e.snap).each(function(){var g=a(this);var f=g.offset();if(this!=b.element[0]){b.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:f.top,left:f.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.absolutePosition.left,w=x+g.helperProportions.width,f=p.absolutePosition.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(b,c){var e=a(this).data("draggable").options;var d=a.makeArray(a(e.stack.group)).sort(function(g,f){return(parseInt(a(g).css("zIndex"),10)||e.stack.min)-(parseInt(a(f).css("zIndex"),10)||e.stack.min)});a(d).each(function(f){this.style.zIndex=e.stack.min+f});this[0].style.zIndex=e.stack.min+d.length}});a.ui.plugin.add("draggable","zIndex",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("zIndex")){e._zIndex=b.css("zIndex")}b.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._zIndex){a(c.helper).css("zIndex",d._zIndex)}}})})(jQuery);;/*
+ * jQuery UI Resizable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
(function(b){b.widget("ui.resizable",b.extend({},b.ui.mouse,{_init:function(){var d=this,h=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!(h.aspectRatio),aspectRatio:h.aspectRatio,originalElement:this.element,proportionallyResize:h.proportionallyResize?[h.proportionallyResize]:[],_helper:h.helper||h.ghost||h.animate?h.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&b.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent();this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});if(b.browser.safari&&h.preventDefault){this.originalElement.css("resize","none")}this.proportionallyResize.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var j=this.handles.split(",");this.handles={};for(var e=0;e<j.length;e++){var g=b.trim(j[e]),c="ui-resizable-"+g;var f=b('<div class="ui-resizable-handle '+c+'"></div>');if(/sw|se|ne|nw/.test(g)){f.css({zIndex:++h.zIndex})}if("se"==g){f.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[g]=".ui-resizable-"+g;this.element.append(f)}}this._renderAxis=function(o){o=o||this.element;for(var l in this.handles){if(this.handles[l].constructor==String){this.handles[l]=b(this.handles[l],this.element).show()}if(h.transparent){this.handles[l].css({opacity:0})}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var m=b(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?m.outerHeight():m.outerWidth();var k=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");if(!h.transparent){o.css(k,n)}this._proportionallyResize()}if(!b(this.handles[l]).length){continue}}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element);if(h.disableSelection){this._handles.disableSelection()}this._handles.mouseover(function(){if(!d.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}d.axis=i&&i[1]?i[1]:"se"}});if(h.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");d._handles.show()},function(){if(!d.resizing){b(this).addClass("ui-resizable-autohide");d._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var c=function(d){b(d).removeClass("ui-resizable ui-resizable-disabled").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){c(this.element);this.wrapper.parent().append(this.originalElement.css({position:this.wrapper.css("position"),width:this.wrapper.outerWidth(),height:this.wrapper.outerHeight(),top:this.wrapper.css("top"),left:this.wrapper.css("left")})).end().remove()}c(this.originalElement)},_mouseCapture:function(d){var e=false;for(var c in this.handles){if(b(this.handles[c])[0]==d.target){e=true}}return this.options.disabled||!!e},_mouseStart:function(e){var h=this.options,d=this.element.position(),c=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(c.is(".ui-draggable")||(/absolute/).test(c.css("position"))){c.css({position:"absolute",top:d.top,left:d.left})}if(b.browser.opera&&(/relative/).test(c.css("position"))){c.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var i=a(this.helper.css("left")),f=a(this.helper.css("top"));if(h.containment){i+=b(h.containment).scrollLeft()||0;f+=b(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:i,top:f};this.size=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalSize=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalPosition={left:i,top:f};this.sizeDiff={width:c.outerWidth()-c.width(),height:c.outerHeight()-c.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=(typeof h.aspectRatio=="number")?h.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);if(h.preserveCursor){var g=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",g=="auto"?this.axis+"-resize":g)}this._propagate("start",e);return true},_mouseDrag:function(c){var f=this.helper,e=this.options,k={},n=this,h=this.originalMousePosition,l=this.axis;var p=(c.pageX-h.left)||0,m=(c.pageY-h.top)||0;var g=this._change[l];if(!g){return false}var j=g.apply(this,[c,p,m]),i=b.browser.msie&&b.browser.version<7,d=this.sizeDiff;if(this._aspectRatio||c.shiftKey){j=this._updateRatio(j,c)}j=this._respectSize(j,c);this._propagate("resize",c);f.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this.proportionallyResize.length){this._proportionallyResize()}this._updateCache(j);this._trigger("resize",c,this.ui());return false},_mouseStop:function(f){this.resizing=false;var g=this.options,k=this;if(this._helper){var e=this.proportionallyResize,c=e.length&&(/textarea/i).test(e[0].nodeName),d=c&&b.ui.hasScroll(e[0],"left")?0:k.sizeDiff.height,i=c?0:k.sizeDiff.width;var l={width:(k.size.width-i),height:(k.size.height-d)},h=(parseInt(k.element.css("left"),10)+(k.position.left-k.originalPosition.left))||null,j=(parseInt(k.element.css("top"),10)+(k.position.top-k.originalPosition.top))||null;if(!g.animate){this.element.css(b.extend(l,{top:j,left:h}))}if(this._helper&&!g.animate){this._proportionallyResize()}}if(g.preserveCursor){b("body").css("cursor","auto")}this._propagate("stop",f);if(this._helper){this.helper.remove()}return false},_updateCache:function(c){var d=this.options;this.offset=this.helper.offset();if(c.left){this.position.left=c.left}if(c.top){this.position.top=c.top}if(c.height){this.size.height=c.height}if(c.width){this.size.width=c.width}},_updateRatio:function(f,e){var g=this.options,h=this.position,d=this.size,c=this.axis;if(f.height){f.width=(d.height*this.aspectRatio)}else{if(f.width){f.height=(d.width/this.aspectRatio)}}if(c=="sw"){f.left=h.left+(d.width-f.width);f.top=null}if(c=="nw"){f.top=h.top+(d.height-f.height);f.left=h.left+(d.width-f.width)}return f},_respectSize:function(j,e){var r=function(o){return !isNaN(parseInt(o,10))};var h=this.helper,g=this.options,p=this._aspectRatio||e.shiftKey,n=this.axis,s=r(j.width)&&g.maxWidth&&(g.maxWidth<j.width),k=r(j.height)&&g.maxHeight&&(g.maxHeight<j.height),f=r(j.width)&&g.minWidth&&(g.minWidth>j.width),q=r(j.height)&&g.minHeight&&(g.minHeight>j.height);if(f){j.width=g.minWidth}if(q){j.height=g.minHeight}if(s){j.width=g.maxWidth}if(k){j.height=g.maxHeight}var d=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height;var i=/sw|nw|w/.test(n),c=/nw|ne|n/.test(n);if(f&&i){j.left=d-g.minWidth}if(s&&i){j.left=d-g.maxWidth}if(q&&c){j.top=m-g.minHeight}if(k&&c){j.top=m-g.maxHeight}var l=!j.width&&!j.height;if(l&&!j.left&&j.top){j.top=null}else{if(l&&!j.top&&j.left){j.left=null}}return j},_proportionallyResize:function(){var h=this.options;if(!this.proportionallyResize.length){return}var e=this.helper||this.element;for(var d=0;d<this.proportionallyResize.length;d++){var f=this.proportionallyResize[d];if(!this.borderDif){var c=[f.css("borderTopWidth"),f.css("borderRightWidth"),f.css("borderBottomWidth"),f.css("borderLeftWidth")],g=[f.css("paddingTop"),f.css("paddingRight"),f.css("paddingBottom"),f.css("paddingLeft")];this.borderDif=b.map(c,function(j,l){var k=parseInt(j,10)||0,m=parseInt(g[l],10)||0;return k+m})}if(b.browser.msie&&!(!(b(e).is(":hidden")||b(e).parents(":hidden").length))){continue}f.css({height:(e.height()-this.borderDif[0]-this.borderDif[2])||0,width:(e.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var d=this.element,g=this.options;this.elementOffset=d.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var c=b.browser.msie&&b.browser.version<7,e=(c?1:0),f=(c?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++g.zIndex});this.helper.appendTo("body");if(g.disableSelection){this.helper.disableSelection()}}else{this.helper=this.element}},_change:{e:function(e,d,c){return{width:this.originalSize.width+d}},w:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{left:g.left+d,width:e.width-d}},n:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{top:g.top+c,height:e.height-c}},s:function(e,d,c){return{height:this.originalSize.height+c}},se:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},sw:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,d,c]))},ne:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},nw:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,d,c]))}},_propagate:function(d,c){b.ui.plugin.call(this,d,[c,this.ui()]);(d!="resize"&&this._trigger(d,c,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));b.extend(b.ui.resizable,{version:"1.6rc6",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,disableSelection:true,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,preserveCursor:true,preventDefault:true,proportionallyResize:false,transparent:false,zIndex:1000}});b.ui.plugin.add("resizable","alsoResize",{start:function(d,e){var c=b(this).data("resizable"),f=c.options;_store=function(g){b(g).each(function(){b(this).data("resizable-alsoresize",{width:parseInt(b(this).width(),10),height:parseInt(b(this).height(),10),left:parseInt(b(this).css("left"),10),top:parseInt(b(this).css("top"),10)})})};if(typeof(f.alsoResize)=="object"&&!f.alsoResize.parentNode){if(f.alsoResize.length){f.alsoResize=f.alsoResize[0];_store(f.alsoResize)}else{b.each(f.alsoResize,function(g,h){_store(g)})}}else{_store(f.alsoResize)}},resize:function(e,g){var d=b(this).data("resizable"),h=d.options,f=d.originalSize,j=d.originalPosition;var i={height:(d.size.height-f.height)||0,width:(d.size.width-f.width)||0,top:(d.position.top-j.top)||0,left:(d.position.left-j.left)||0},c=function(k,l){b(k).each(function(){var o=b(this),p=b(this).data("resizable-alsoresize"),n={},m=l&&l.length?l:["width","height","top","left"];b.each(m||["width","height","top","left"],function(q,s){var r=(p[s]||0)+(i[s]||0);if(r&&r>=0){n[s]=r||null}});if(/relative/.test(o.css("position"))&&b.browser.opera){d._revertToRelativePosition=true;o.css({position:"absolute",top:"auto",left:"auto"})}o.css(n)})};if(typeof(h.alsoResize)=="object"&&!h.alsoResize.nodeType){b.each(h.alsoResize,function(k,l){c(k,l)})}else{c(h.alsoResize)}},stop:function(d,e){var c=b(this).data("resizable");if(c._revertToRelativePosition&&b.browser.opera){c._revertToRelativePosition=false;el.css({position:"relative"})}b(this).removeData("resizable-alsoresize-start")}});b.ui.plugin.add("resizable","animate",{stop:function(g,l){var m=b(this).data("resizable"),h=m.options;var f=h.proportionallyResize,c=f&&(/textarea/i).test(f.get(0).nodeName),d=c&&b.ui.hasScroll(f.get(0),"left")?0:m.sizeDiff.height,j=c?0:m.sizeDiff.width;var e={width:(m.size.width-j),height:(m.size.height-d)},i=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,k=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;m.element.animate(b.extend(e,k&&i?{top:k,left:i}:{}),{duration:h.animateDuration,easing:h.animateEasing,step:function(){var n={width:parseInt(m.element.css("width"),10),height:parseInt(m.element.css("height"),10),top:parseInt(m.element.css("top"),10),left:parseInt(m.element.css("left"),10)};if(f){f.css({width:n.width,height:n.height})}m._updateCache(n);m._propagate("resize",g)}})}});b.ui.plugin.add("resizable","containment",{start:function(d,n){var r=b(this).data("resizable"),h=r.options,j=r.element;var e=h.containment,i=(e instanceof b)?e.get(0):(/parent/.test(e))?j.parent().get(0):e;if(!i){return}r.containerElement=b(i);if(/document/.test(e)||e==document){r.containerOffset={left:0,top:0};r.containerPosition={left:0,top:0};r.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var l=b(i),g=[];b(["Top","Right","Left","Bottom"]).each(function(p,o){g[p]=a(l.css("padding"+o))});r.containerOffset=l.offset();r.containerPosition=l.position();r.containerSize={height:(l.innerHeight()-g[3]),width:(l.innerWidth()-g[1])};var m=r.containerOffset,c=r.containerSize.height,k=r.containerSize.width,f=(b.ui.hasScroll(i,"left")?i.scrollWidth:k),q=(b.ui.hasScroll(i)?i.scrollHeight:c);r.parentData={element:i,left:m.left,top:m.top,width:f,height:q}}},resize:function(e,l){var p=b(this).data("resizable"),g=p.options,d=p.containerSize,k=p.containerOffset,i=p.size,j=p.position,m=g._aspectRatio||e.shiftKey,c={top:0,left:0},f=p.containerElement;if(f[0]!=document&&(/static/).test(f.css("position"))){c=k}if(j.left<(p._helper?k.left:0)){p.size.width=p.size.width+(p._helper?(p.position.left-k.left):(p.position.left-c.left));if(m){p.size.height=p.size.width/g.aspectRatio}p.position.left=g.helper?k.left:0}if(j.top<(p._helper?k.top:0)){p.size.height=p.size.height+(p._helper?(p.position.top-k.top):p.position.top);if(m){p.size.width=p.size.height*g.aspectRatio}p.position.top=p._helper?k.top:0}var h=Math.abs((p._helper?p.offset.left-c.left:(p.offset.left-c.left))+p.sizeDiff.width),n=Math.abs((p._helper?p.offset.top-c.top:(p.offset.top-k.top))+p.sizeDiff.height);if(h+p.size.width>=p.parentData.width){p.size.width=p.parentData.width-h;if(m){p.size.height=p.size.width/g.aspectRatio}}if(n+p.size.height>=p.parentData.height){p.size.height=p.parentData.height-n;if(m){p.size.width=p.size.height*g.aspectRatio}}},stop:function(d,l){var n=b(this).data("resizable"),e=n.options,j=n.position,k=n.containerOffset,c=n.containerPosition,f=n.containerElement;var g=b(n.helper),p=g.offset(),m=g.outerWidth()-n.sizeDiff.width,i=g.outerHeight()-n.sizeDiff.height;if(n._helper&&!e.animate&&(/relative/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}if(n._helper&&!e.animate&&(/static/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}}});b.ui.plugin.add("resizable","ghost",{start:function(e,f){var c=b(this).data("resizable"),g=c.options,h=g.proportionallyResize,d=c.size;c.ghost=c.originalElement.clone();c.ghost.css({opacity:0.25,display:"block",position:"relative",height:d.height,width:d.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof g.ghost=="string"?g.ghost:"");c.ghost.appendTo(c.helper)},resize:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost){c.ghost.css({position:"relative",height:c.size.height,width:c.size.width})}},stop:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost&&c.helper){c.helper.get(0).removeChild(c.ghost.get(0))}}});b.ui.plugin.add("resizable","grid",{resize:function(c,k){var m=b(this).data("resizable"),f=m.options,i=m.size,g=m.originalSize,h=m.originalPosition,l=m.axis,j=f._aspectRatio||c.shiftKey;f.grid=typeof f.grid=="number"?[f.grid,f.grid]:f.grid;var e=Math.round((i.width-g.width)/(f.grid[0]||1))*(f.grid[0]||1),d=Math.round((i.height-g.height)/(f.grid[1]||1))*(f.grid[1]||1);if(/^(se|s|e)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d}else{if(/^(ne)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d}else{if(/^(sw)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.left=h.left-e}else{m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d;m.position.left=h.left-e}}}}});var a=function(c){return parseInt(c,10)||0}})(jQuery);;/*
+ * jQuery UI Dialog 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
(function(b){var a={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"};b.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");var k=this,l=this.options,i=l.title||this.originalTitle||" ",d=b.ui.dialog.getTitleId(this.element),j=(this.uiDialog=b("<div/>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+l.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:l.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(m){(l.closeOnEscape&&m.keyCode&&m.keyCode==b.ui.keyCode.ESCAPE&&k.close(m))}).attr({role:"dialog","aria-labelledby":d}).mousedown(function(m){k.moveToTop(m)}),f=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j),e=(this.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j),h=b('<a href="#"/>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).mousedown(function(m){m.stopPropagation()}).click(function(m){k.close(m);return false}).appendTo(e),g=(this.uiDialogTitlebarCloseText=b("<span/>")).addClass("ui-icon ui-icon-closethick").text(l.closeText).appendTo(h),c=b("<span/>").addClass("ui-dialog-title").attr("id",d).html(i).prependTo(e);e.find("*").add(e).disableSelection();(l.draggable&&b.fn.draggable&&this._makeDraggable());(l.resizable&&b.fn.resizable&&this._makeResizable());this._createButtons(l.buttons);this._isOpen=false;(l.bgiframe&&b.fn.bgiframe&&j.bgiframe());(l.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(c){if(false===this._trigger("beforeclose",c)){return}(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide(this.options.hide).unbind("keypress.ui-dialog");this._trigger("close",c);b.ui.dialog.overlay.resize();this._isOpen=false},isOpen:function(){return this._isOpen},moveToTop:function(g,f){if((this.options.modal&&!g)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",f)}var e=this.options.zIndex,d=this.options;b(".ui-dialog:visible").each(function(){e=Math.max(e,parseInt(b(this).css("z-index"),10)||d.zIndex)});(this.overlay&&this.overlay.$el.css("z-index",++e));(this.shadow&&this.shadow.css("z-index",++e));var c={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++e);this.element.attr(c);this._trigger("focus",f)},open:function(e){if(this._isOpen){return}var d=this.options,c=this.uiDialog;this.overlay=d.modal?new b.ui.dialog.overlay(this):null;(c.next().length&&c.appendTo("body"));this._size();this._position(d.position);c.show(d.show);this.moveToTop(true,e);(d.modal&&c.bind("keypress.ui-dialog",function(h){if(h.keyCode!=b.ui.keyCode.TAB){return}var g=b(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));b([]).add(c.find(".ui-dialog-content :tabbable:first")).add(c.find(".ui-dialog-buttonpane :tabbable:first")).add(c.find(".ui-dialog-titlebar :tabbable:first")).filter(":first").focus();if(d.shadow){this._createShadow()}this._trigger("open",e);this._isOpen=true},_createButtons:function(f){var e=this,c=false,d=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof f=="object"&&f!==null&&b.each(f,function(){return !(c=true)}));if(c){b.each(f,function(g,h){b('<button type="button"></button>').addClass("ui-state-default ui-corner-all").text(g).click(function(){h.apply(e.element[0],arguments)}).hover(function(){b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){b(this).addClass("ui-state-focus")}).blur(function(){b(this).removeClass("ui-state-focus")}).appendTo(d)});d.appendTo(this.uiDialog)}},_makeDraggable:function(){var c=this,d=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content",helper:d.dragHelper,handle:".ui-dialog-titlebar",containment:"document",start:function(){(d.dragStart&&d.dragStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},drag:function(){(d.drag&&d.drag.apply(c.element[0],arguments));c._refreshShadow(1)},stop:function(){(d.dragStop&&d.dragStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}})},_makeResizable:function(f){f=(f===undefined?this.options.resizable:f);var c=this,e=this.options,d=typeof f=="string"?f:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,helper:e.resizeHelper,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:e.minHeight,start:function(){(e.resizeStart&&e.resizeStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},resize:function(){(e.resize&&e.resize.apply(c.element[0],arguments));c._refreshShadow(1)},handles:d,stop:function(){(e.resizeStop&&e.resizeStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(h){var d=b(window),e=b(document),f=e.scrollTop(),c=e.scrollLeft(),g=f;if(b.inArray(h,["center","top","right","bottom","left"])>=0){h=[h=="right"||h=="left"?h:"center",h=="top"||h=="bottom"?h:"middle"]}if(h.constructor!=Array){h=["center","middle"]}if(h[0].constructor==Number){c+=h[0]}else{switch(h[0]){case"left":c+=0;break;case"right":c+=d.width()-this.uiDialog.outerWidth();break;default:case"center":c+=(d.width()-this.uiDialog.outerWidth())/2}}if(h[1].constructor==Number){f+=h[1]}else{switch(h[1]){case"top":f+=0;break;case"bottom":f+=d.height()-this.uiDialog.outerHeight();break;default:case"middle":f+=(d.height()-this.uiDialog.outerHeight())/2}}f=Math.max(f,g);this.uiDialog.css({top:f,left:c})},_setData:function(d,e){(a[d]&&this.uiDialog.data(a[d],e));switch(d){case"buttons":this._createButtons(e);break;case"closeText":this.uiDialogTitlebarCloseText.text(e);break;case"draggable":(e?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(e);break;case"position":this._position(e);break;case"resizable":var c=this.uiDialog,f=this.uiDialog.is(":data(resizable)");(f&&!e&&c.resizable("destroy"));(f&&typeof e=="string"&&c.resizable("option","handles",e));(f||this._makeResizable(e));break;case"title":b(".ui-dialog-title",this.uiDialogTitlebar).html(e||" ");break;case"width":this.uiDialog.width(e);break}b.widget.prototype._setData.apply(this,arguments)},_size:function(){var d=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var c=this.uiDialog.css({height:"auto",width:d.width}).height();this.element.css({minHeight:Math.max(d.minHeight-c,0),height:d.height=="auto"?"auto":d.height-c})},_createShadow:function(){this.shadow=b('<div class="ui-widget-shadow"></div>').css("position","absolute").appendTo(document.body);this._refreshShadow();return this.shadow},_refreshShadow:function(c){if(c&&b.browser.msie&&b.browser.version<7){return}var d=this.uiDialog.offset();this.shadow.css({left:d.left,top:d.top,width:this.uiDialog.outerWidth(),height:this.uiDialog.outerHeight()})},_destroyShadow:function(){this.shadow.remove();this.shadow=null}});b.extend(b.ui.dialog,{version:"1.6rc6",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",draggable:true,height:"auto",minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,shadow:true,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,getTitleId:function(c){return"ui-dialog-title-"+(c.attr("id")||++this.uuid)},overlay:function(c){this.$el=b.ui.dialog.overlay.create(c)}});b.extend(b.ui.dialog.overlay,{instances:[],events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(c){return c+".dialog-overlay"}).join(" "),create:function(d){if(this.instances.length===0){setTimeout(function(){b("a, :input").bind(b.ui.dialog.overlay.events,function(){var f=false;var h=b(this).parents(".ui-dialog");if(h.length){var e=b(".ui-dialog-overlay");if(e.length){var g=parseInt(e.css("z-index"),10);e.each(function(){g=Math.max(g,parseInt(b(this).css("z-index"),10))});f=parseInt(h.css("z-index"),10)>g}else{f=true}}return f})},1);b(document).bind("keydown.dialog-overlay",function(e){(d.options.closeOnEscape&&e.keyCode&&e.keyCode==b.ui.keyCode.ESCAPE&&d.close(e))});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var c=b("<div></div>").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(d.options.bgiframe&&b.fn.bgiframe&&c.bgiframe());this.instances.push(c);return c},destroy:function(c){this.instances.splice(b.inArray(this.instances,c),1);if(this.instances.length===0){b("a, :input").add([document,window]).unbind(".dialog-overlay")}c.remove()},height:function(){if(b.browser.msie&&b.browser.version<7){var d=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(d<c){return b(window).height()+"px"}else{return d+"px"}}else{return b(document).height()+"px"}},width:function(){if(b.browser.msie&&b.browser.version<7){var c=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var d=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(c<d){return b(window).width()+"px"}else{return c+"px"}}else{return b(document).width()+"px"}},resize:function(){var c=b([]);b.each(b.ui.dialog.overlay.instances,function(){c=c.add(this)});c.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);;/*
+ * jQuery UI Effects 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
(function(d){d.effects=d.effects||{};d.extend(d.effects,{version:"1.6rc6",save:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.data("ec.storage."+h[f],g[0].style[h[f]])}}},restore:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.css(h[f],g.data("ec.storage."+h[f]))}}},setMode:function(f,g){if(g=="toggle"){g=f.is(":hidden")?"show":"hide"}return g},getBaseline:function(g,h){var i,f;switch(g[0]){case"top":i=0;break;case"middle":i=0.5;break;case"bottom":i=1;break;default:i=g[0]/h.height}switch(g[1]){case"left":f=0;break;case"center":f=0.5;break;case"right":f=1;break;default:f=g[1]/h.width}return{x:f,y:i}},createWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent()}var g={width:f.outerWidth(true),height:f.outerHeight(true),"float":f.css("float")};f.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}});function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:i.duration;h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return -(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f},easeOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return h*Math.pow(2,-10*i)*Math.sin((i*l-j)*(2*Math.PI)/k)+m+f},easeInOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l/2)==2){return f+m}if(!k){k=l*(0.3*1.5)}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}if(i<1){return -0.5*(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f}return h*Math.pow(2,-10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k)*0.5+m+f},easeInBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*(h/=j)*h*((i+1)*h-i)+f},easeOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*((h=h/j-1)*h*((i+1)*h+i)+1)+f},easeInOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}if((h/=j/2)<1){return k/2*(h*h*(((i*=(1.525))+1)*h-i))+f}return k/2*((h-=2)*h*(((i*=(1.525))+1)*h+i)+2)+f},easeInBounce:function(g,h,f,j,i){return j-d.easing.easeOutBounce(g,i-h,0,j,i)+f},easeOutBounce:function(g,h,f,j,i){if((h/=i)<(1/2.75)){return j*(7.5625*h*h)+f}else{if(h<(2/2.75)){return j*(7.5625*(h-=(1.5/2.75))*h+0.75)+f}else{if(h<(2.5/2.75)){return j*(7.5625*(h-=(2.25/2.75))*h+0.9375)+f}else{return j*(7.5625*(h-=(2.625/2.75))*h+0.984375)+f}}}},easeInOutBounce:function(g,h,f,j,i){if(h<i/2){return d.easing.easeInBounce(g,h*2,0,j,i)*0.5+f}return d.easing.easeOutBounce(g,h*2-i,0,j,i)*0.5+j*0.5+f}})})(jQuery);;/*
+ * jQuery UI Effects Blind 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.blind=function(b){return this.queue(function(){var d=a(this),c=["position","top","left"];var h=a.effects.setMode(d,b.options.mode||"hide");var g=b.options.direction||"vertical";a.effects.save(d,c);d.show();var j=a.effects.createWrapper(d).css({overflow:"hidden"});var e=(g=="vertical")?"height":"width";var i=(g=="vertical")?j.height():j.width();if(h=="show"){j.css(e,0)}var f={};f[e]=h=="show"?i:0;j.animate(f,b.duration,b.options.easing,function(){if(h=="hide"){d.hide()}a.effects.restore(d,c);a.effects.removeWrapper(d);if(b.callback){b.callback.apply(d[0],arguments)}d.dequeue()})})}})(jQuery);;/*
+ * jQuery UI Effects Bounce 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.bounce=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"up";var c=b.options.distance||20;var d=b.options.times||5;var g=b.duration||250;if(/show|hide/.test(k)){l.push("opacity")}a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var c=b.options.distance||(f=="top"?e.outerHeight({margin:true})/3:e.outerWidth({margin:true})/3);if(k=="show"){e.css("opacity",0).css(f,p=="pos"?-c:c)}if(k=="hide"){c=c/(d*2)}if(k!="hide"){d--}if(k=="show"){var h={opacity:1};h[f]=(p=="pos"?"+=":"-=")+c;e.animate(h,g/2,b.options.easing);c=c/2;d--}for(var j=0;j<d;j++){var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing);c=(k=="hide")?c*2:c/2}if(k=="hide"){var h={opacity:0};h[f]=(p=="pos"?"-=":"+=")+c;e.animate(h,g/2,b.options.easing,function(){e.hide();a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}else{var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Clip 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.clip=function(b){return this.queue(function(){var f=a(this),j=["position","top","left","height","width"];var i=a.effects.setMode(f,b.options.mode||"hide");var k=b.options.direction||"vertical";a.effects.save(f,j);f.show();var c=a.effects.createWrapper(f).css({overflow:"hidden"});var e=f[0].tagName=="IMG"?c:f;var g={size:(k=="vertical")?"height":"width",position:(k=="vertical")?"top":"left"};var d=(k=="vertical")?e.height():e.width();if(i=="show"){e.css(g.size,0);e.css(g.position,d/2)}var h={};h[g.size]=i=="show"?d:0;h[g.position]=i=="show"?0:d/2;e.animate(h,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){f.hide()}a.effects.restore(f,j);a.effects.removeWrapper(f);if(b.callback){b.callback.apply(f[0],arguments)}f.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Drop 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.drop=function(b){return this.queue(function(){var e=a(this),d=["position","top","left","opacity"];var i=a.effects.setMode(e,b.options.mode||"hide");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e);var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true})/2:e.outerWidth({margin:true})/2);if(i=="show"){e.css("opacity",0).css(f,c=="pos"?-j:j)}var g={opacity:i=="show"?1:0};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Explode 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.explode=function(b){return this.queue(function(){var k=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;var e=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):b.options.mode;var h=a(this).show().css("visibility","hidden");var l=h.offset();l.top-=parseInt(h.css("marginTop"))||0;l.left-=parseInt(h.css("marginLeft"))||0;var g=h.outerWidth(true);var c=h.outerHeight(true);for(var f=0;f<k;f++){for(var d=0;d<e;d++){h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*
+ * jQuery UI Effects Fold 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1])/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;/*
+ * jQuery UI Effects Highlight 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Pulsate 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c<f;c++){d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing)}if(g=="hide"){d.animate({opacity:0},e,b.options.easing,function(){d.hide();if(b.callback){b.callback.apply(this,arguments)}})}else{d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing,function(){if(b.callback){b.callback.apply(this,arguments)}})}d.queue("fx",function(){d.dequeue()});d.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Scale 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.puff=function(b){return this.queue(function(){var f=a(this);var c=a.extend(true,{},b.options);var h=a.effects.setMode(f,b.options.mode||"hide");var g=parseInt(b.options.percent)||150;c.fade=true;var e={height:f.height(),width:f.width()};var d=g/100;f.from=(h=="hide")?e:{height:e.height*d,width:e.width*d};c.from=f.from;c.percent=(h=="hide")?g:100;c.mode=h;f.effect("scale",c,b.duration,b.callback);f.dequeue()})};a.effects.scale=function(b){return this.queue(function(){var g=a(this);var d=a.extend(true,{},b.options);var j=a.effects.setMode(g,b.options.mode||"effect");var h=parseInt(b.options.percent)||(parseInt(b.options.percent)==0?0:(j=="hide"?0:100));var i=b.options.direction||"both";var c=b.options.origin;if(j!="effect"){d.origin=c||["middle","center"];d.restore=true}var f={height:g.height(),width:g.width()};g.from=b.options.from||(j=="show"?{height:0,width:0}:f);var e={y:i!="horizontal"?(h/100):1,x:i!="vertical"?(h/100):1};g.to={height:f.height*e.y,width:f.width*e.x};if(b.options.fade){if(j=="show"){g.from.opacity=0;g.to.opacity=1}if(j=="hide"){g.from.opacity=1;g.to.opacity=0}}d.from=g.from;d.to=g.to;d.mode=j;g.effect("size",d,b.duration,b.callback);g.dequeue()})};a.effects.size=function(b){return this.queue(function(){var c=a(this),n=["position","top","left","width","height","overflow","opacity"];var m=["position","top","left","overflow","opacity"];var j=["width","height","overflow"];var p=["fontSize"];var k=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var f=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var g=a.effects.setMode(c,b.options.mode||"effect");var i=b.options.restore||false;var e=b.options.scale||"both";var o=b.options.origin;var d={height:c.height(),width:c.width()};c.from=b.options.from||d;c.to=b.options.to||d;if(o){var h=a.effects.getBaseline(o,d);c.from.top=(d.height-c.from.height)*h.y;c.from.left=(d.width-c.from.width)*h.x;c.to.top=(d.height-c.to.height)*h.y;c.to.left=(d.width-c.to.width)*h.x}var l={from:{y:c.from.height/d.height,x:c.from.width/d.width},to:{y:c.to.height/d.height,x:c.to.width/d.width}};if(e=="box"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(k);c.from=a.effects.setTransition(c,k,l.from.y,c.from);c.to=a.effects.setTransition(c,k,l.to.y,c.to)}if(l.from.x!=l.to.x){n=n.concat(f);c.from=a.effects.setTransition(c,f,l.from.x,c.from);c.to=a.effects.setTransition(c,f,l.to.x,c.to)}}if(e=="content"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(p);c.from=a.effects.setTransition(c,p,l.from.y,c.from);c.to=a.effects.setTransition(c,p,l.to.y,c.to)}}a.effects.save(c,i?n:m);c.show();a.effects.createWrapper(c);c.css("overflow","hidden").css(c.from);if(e=="content"||e=="both"){k=k.concat(["marginTop","marginBottom"]).concat(p);f=f.concat(["marginLeft","marginRight"]);j=n.concat(k).concat(f);c.find("*[width]").each(function(){child=a(this);if(i){a.effects.save(child,j)}var q={height:child.height(),width:child.width()};child.from={height:q.height*l.from.y,width:q.width*l.from.x};child.to={height:q.height*l.to.y,width:q.width*l.to.x};if(l.from.y!=l.to.y){child.from=a.effects.setTransition(child,k,l.from.y,child.from);child.to=a.effects.setTransition(child,k,l.to.y,child.to)}if(l.from.x!=l.to.x){child.from=a.effects.setTransition(child,f,l.from.x,child.from);child.to=a.effects.setTransition(child,f,l.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){if(i){a.effects.restore(child,j)}})})}c.animate(c.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(g=="hide"){c.hide()}a.effects.restore(c,i?n:m);a.effects.removeWrapper(c);if(b.callback){b.callback.apply(this,arguments)}c.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Shake 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.shake=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"left";var c=b.options.distance||20;var d=b.options.times||3;var g=b.duration||b.options.duration||140;a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var h={},o={},m={};h[f]=(p=="pos"?"-=":"+=")+c;o[f]=(p=="pos"?"+=":"-=")+c*2;m[f]=(p=="pos"?"-=":"+=")+c*2;e.animate(h,g,b.options.easing);for(var j=1;j<d;j++){e.animate(o,g,b.options.easing).animate(m,g,b.options.easing)}e.animate(o,g,b.options.easing).animate(h,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}});e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*
+ * jQuery UI Effects Slide 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.slide=function(b){return this.queue(function(){var e=a(this),d=["position","top","left"];var i=a.effects.setMode(e,b.options.mode||"show");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true}):e.outerWidth({margin:true}));if(i=="show"){e.css(f,c=="pos"?-j:j)}var g={};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Transfer 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */
(function(a){a.effects.transfer=function(b){return this.queue(function(){var e=a(this);var g=a.effects.setMode(e,b.options.mode||"effect");var f=a(b.options.to);var c=e.offset();var d=a('<div class="ui-effects-transfer"></div>').appendTo(document.body);if(b.options.className){d.addClass(b.options.className)}d.addClass(b.options.className);d.css({top:c.top,left:c.left,height:e.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:e.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth")),position:"absolute"});c=f.offset();animation={top:c.top,left:c.left,height:f.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:f.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth"))};d.animate(animation,b.duration,b.options.easing,function(){d.remove();if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/scripts/jquery.cookie.js b/projecttemplates/WebFormsRelyingParty/scripts/jquery.cookie.js new file mode 100644 index 0000000..121f723 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/scripts/jquery.cookie.js @@ -0,0 +1,96 @@ +/** +* Cookie plugin +* +* Copyright (c) 2006 Klaus Hartl (stilbuero.de) +* Dual licensed under the MIT and GPL licenses: +* http://www.opensource.org/licenses/mit-license.php +* http://www.gnu.org/licenses/gpl.html +* +*/ + +/** +* Create a cookie with the given name and value and other optional parameters. +* +* @example $.cookie('the_cookie', 'the_value'); +* @desc Set the value of a cookie. +* @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); +* @desc Create a cookie with all available options. +* @example $.cookie('the_cookie', 'the_value'); +* @desc Create a session cookie. +* @example $.cookie('the_cookie', null); +* @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain +* used when the cookie was set. +* +* @param String name The name of the cookie. +* @param String value The value of the cookie. +* @param Object options An object literal containing key/value pairs to provide optional cookie attributes. +* @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. +* If a negative value is specified (e.g. a date in the past), the cookie will be deleted. +* If set to null or omitted, the cookie will be a session cookie and will not be retained +* when the the browser exits. +* @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). +* @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). +* @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will +* require a secure protocol (like HTTPS). +* @type undefined +* +* @name $.cookie +* @cat Plugins/Cookie +* @author Klaus Hartl/klaus.hartl@stilbuero.de +*/ + +/** +* Get the value of a cookie with the given name. +* +* @example $.cookie('the_cookie'); +* @desc Get the value of a cookie. +* +* @param String name The name of the cookie. +* @return The value of the cookie. +* @type String +* +* @name $.cookie +* @cat Plugins/Cookie +* @author Klaus Hartl/klaus.hartl@stilbuero.de +*/ +jQuery.cookie = function(name, value, options) { + if (typeof value != 'undefined') { // name and value given, set cookie + options = options || {}; + if (value === null) { + value = ''; + options.expires = -1; + } + var expires = ''; + if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) { + var date; + if (typeof options.expires == 'number') { + date = new Date(); + date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000)); + } else { + date = options.expires; + } + expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE + } + // CAUTION: Needed to parenthesize options.path and options.domain + // in the following expressions, otherwise they evaluate to undefined + // in the packed version for some reason... + var path = options.path ? '; path=' + (options.path) : ''; + var domain = options.domain ? '; domain=' + (options.domain) : ''; + var secure = options.secure ? '; secure' : ''; + document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join(''); + } else { // only name given, get cookie + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = jQuery.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } +};
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/styles/Standard.css b/projecttemplates/WebFormsRelyingParty/styles/Standard.css new file mode 100644 index 0000000..f0b1d8e --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/styles/Standard.css @@ -0,0 +1,67 @@ +body +{ + font-family: Cambria, Arial, Times New Roman; + font-size: 12pt; +} + +h1 a +{ + text-decoration: none; + color: Black; +} + +div.OpenIdButtons +{ + margin-bottom: 10px; +} + +div.OpenIdButtons span.OpenIdButton +{ + margin-left: 2px; + margin-right: 2px; + display: table; + float: left; + width: 92px; + height: 64px; + border: solid 1px lightgray; + text-align: center; + vertical-align: middle; + cursor: pointer; +} + +div.OpenIdButtons span.OpenIdButton span +{ + margin: 0; + padding: 0; + top: 50%; + display: table-cell; + vertical-align: middle; +} + +div.OpenIdButtons span.OpenIdButton object +{ + height: 0px; +} + +div.OpenIdButtons span.OpenIdButton div +{ + display: inline-block; + margin: 0; + padding: 0; +} + +div.OpenIdBox +{ + margin-top: 10px; + clear: left; +} + +ul.AuthTokens li.OpenID +{ + list-style-image: url(../images/openid_login.gif); +} + +ul.AuthTokens li.InfoCard +{ + list-style-image: url(../images/infocard_23x16.png); +} diff --git a/projecttemplates/WebFormsRelyingParty/styles/loginpopup.css b/projecttemplates/WebFormsRelyingParty/styles/loginpopup.css new file mode 100644 index 0000000..89e1b38 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/styles/loginpopup.css @@ -0,0 +1,23 @@ +body +{ + font-family: Verdana; + font-size: 10pt; + background-color: White; + margin: 10px; +} +/* +body > div.wrapper +{ + width: 355px; + height: 235px; +} +*/ +Div#NotMyComputerDiv +{ + display: none; +} + +.helpDoc +{ + font-size: 80%; +}
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_55_999999_40x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_55_999999_40x100.png Binary files differnew file mode 100644 index 0000000..6b6de7d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_55_999999_40x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_75_aaaaaa_40x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_75_aaaaaa_40x100.png Binary files differnew file mode 100644 index 0000000..5b5dab2 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_flat_75_aaaaaa_40x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_45_0078ae_1x400.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_45_0078ae_1x400.png Binary files differnew file mode 100644 index 0000000..3dac650 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_45_0078ae_1x400.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_55_f8da4e_1x400.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_55_f8da4e_1x400.png Binary files differnew file mode 100644 index 0000000..b383704 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_55_f8da4e_1x400.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_75_79c9ec_1x400.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_75_79c9ec_1x400.png Binary files differnew file mode 100644 index 0000000..d384e42 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_glass_75_79c9ec_1x400.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_45_e14f1c_500x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_45_e14f1c_500x100.png Binary files differnew file mode 100644 index 0000000..b9851ba --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_45_e14f1c_500x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_50_6eac2c_500x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_50_6eac2c_500x100.png Binary files differnew file mode 100644 index 0000000..76dac56 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_50_6eac2c_500x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_75_2191c0_500x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_75_2191c0_500x100.png Binary files differnew file mode 100644 index 0000000..eeacf69 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_gloss-wave_75_2191c0_500x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_inset-hard_100_fcfdfd_1x100.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_inset-hard_100_fcfdfd_1x100.png Binary files differnew file mode 100644 index 0000000..38c3833 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-bg_inset-hard_100_fcfdfd_1x100.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_0078ae_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_0078ae_256x240.png Binary files differnew file mode 100644 index 0000000..58f96f8 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_0078ae_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_056b93_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_056b93_256x240.png Binary files differnew file mode 100644 index 0000000..8e6103d --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_056b93_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_d8e7f3_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_d8e7f3_256x240.png Binary files differnew file mode 100644 index 0000000..2c8aac4 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_d8e7f3_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_e0fdff_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_e0fdff_256x240.png Binary files differnew file mode 100644 index 0000000..d985a26 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_e0fdff_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f5e175_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f5e175_256x240.png Binary files differnew file mode 100644 index 0000000..7862520 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f5e175_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f7a50d_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f7a50d_256x240.png Binary files differnew file mode 100644 index 0000000..c5297f8 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_f7a50d_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_fcd113_256x240.png b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_fcd113_256x240.png Binary files differnew file mode 100644 index 0000000..68dcff5 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/images/ui-icons_fcd113_256x240.png diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.accordion.css b/projecttemplates/WebFormsRelyingParty/theme/ui.accordion.css new file mode 100644 index 0000000..c84ad4e --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.accordion.css @@ -0,0 +1,9 @@ +/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion li {display: inline;} +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.all.css b/projecttemplates/WebFormsRelyingParty/theme/ui.all.css new file mode 100644 index 0000000..543e4c3 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.all.css @@ -0,0 +1,2 @@ +@import "ui.base.css"; +@import "ui.theme.css"; diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.base.css b/projecttemplates/WebFormsRelyingParty/theme/ui.base.css new file mode 100644 index 0000000..dadf378 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.base.css @@ -0,0 +1,9 @@ +@import url("ui.core.css"); + +@import url("ui.accordion.css"); +@import url("ui.datepicker.css"); +@import url("ui.dialog.css"); +@import url("ui.progressbar.css"); +@import url("ui.resizable.css"); +@import url("ui.slider.css"); +@import url("ui.tabs.css"); diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.core.css b/projecttemplates/WebFormsRelyingParty/theme/ui.core.css new file mode 100644 index 0000000..d832ad7 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.core.css @@ -0,0 +1,37 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.datepicker.css b/projecttemplates/WebFormsRelyingParty/theme/ui.datepicker.css new file mode 100644 index 0000000..92986c9 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.datepicker.css @@ -0,0 +1,62 @@ +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:left; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.dialog.css b/projecttemplates/WebFormsRelyingParty/theme/ui.dialog.css new file mode 100644 index 0000000..f10f409 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.dialog.css @@ -0,0 +1,13 @@ +/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.progressbar.css b/projecttemplates/WebFormsRelyingParty/theme/ui.progressbar.css new file mode 100644 index 0000000..bc0939e --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.progressbar.css @@ -0,0 +1,4 @@ +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.resizable.css b/projecttemplates/WebFormsRelyingParty/theme/ui.resizable.css new file mode 100644 index 0000000..44efeb2 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.resizable.css @@ -0,0 +1,13 @@ +/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.slider.css b/projecttemplates/WebFormsRelyingParty/theme/ui.slider.css new file mode 100644 index 0000000..0792a48 --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.slider.css @@ -0,0 +1,17 @@ +/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: 1%; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.tabs.css b/projecttemplates/WebFormsRelyingParty/theme/ui.tabs.css new file mode 100644 index 0000000..70ed3ef --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.tabs.css @@ -0,0 +1,9 @@ +/* Tabs +----------------------------------*/ +.ui-tabs {padding: .2em;} +.ui-tabs .ui-tabs-nav { padding: .2em .2em 0 .2em; position: relative; } +.ui-tabs .ui-tabs-nav li { float: left; border-bottom: 0 !important; margin: 0 .2em -1px 0; padding: 0; list-style: none; } +.ui-tabs .ui-tabs-nav li a { display:block; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: .1em; border-bottom: 0; } +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/theme/ui.theme.css b/projecttemplates/WebFormsRelyingParty/theme/ui.theme.css new file mode 100644 index 0000000..84f7fed --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/theme/ui.theme.css @@ -0,0 +1,243 @@ + + +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://ui.jquery.com/themeroller/?tr=&ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=2191c0&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=75&borderColorHeader=4297d7&fcHeader=eaf5f7&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=0078ae&bgColorDefault=0078ae&bgTextureDefault=02_glass.png&bgImgOpacityDefault=45&borderColorDefault=77d5f7&fcDefault=ffffff&iconColorDefault=e0fdff&bgColorHover=79c9ec&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=448dae&fcHover=026890&iconColorHover=056b93&bgColorActive=6eac2c&bgTextureActive=12_gloss_wave.png&bgImgOpacityActive=50&borderColorActive=acdd4a&fcActive=ffffff&iconColorActive=f5e175&bgColorHighlight=f8da4e&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcd113&fcHighlight=915608&iconColorHighlight=f7a50d&bgColorError=e14f1c&bgTextureError=12_gloss_wave.png&bgImgOpacityError=45&borderColorError=cd0a0a&fcError=ffffff&iconColorError=fcd113&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=75&opacityOverlay=30&bgColorShadow=999999&bgTextureShadow=01_flat.png&bgImgOpacityShadow=55&opacityShadow=45&thicknessShadow=0px&offsetTopShadow=5px&offsetLeftShadow=5px&cornerRadiusShadow=5px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-header { border: 1px solid #4297d7; background: #2191c0 url(images/ui-bg_gloss-wave_75_2191c0_500x100.png) 50% 50% repeat-x; color: #eaf5f7; font-weight: bold; } +.ui-widget-header a { color: #eaf5f7; } +.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #77d5f7; background: #0078ae url(images/ui-bg_glass_45_0078ae_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; } +.ui-state-default a { color: #ffffff; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #448dae; background: #79c9ec url(images/ui-bg_glass_75_79c9ec_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #026890; outline: none; } +.ui-state-hover a { color: #026890; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #acdd4a; background: #6eac2c url(images/ui-bg_gloss-wave_50_6eac2c_500x100.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; } +.ui-state-active a { color: #ffffff; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcd113; background: #f8da4e url(images/ui-bg_glass_55_f8da4e_1x400.png) 50% 50% repeat-x; color: #915608; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #e14f1c url(images/ui-bg_gloss-wave_45_e14f1c_500x100.png) 50% top repeat-x; color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #ffffff; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_0078ae_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_0078ae_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_e0fdff_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_056b93_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_f5e175_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_f7a50d_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_fcd113_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; } +.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; } +.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; } +.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; } +.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; } +.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; } +.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_75_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: 5px 0 0 5px; padding: 0px; background: #999999 url(images/ui-bg_flat_55_999999_40x100.png) 50% 50% repeat-x; opacity: .45;filter:Alpha(Opacity=45); -moz-border-radius: 5px; -webkit-border-radius: 5px; }
\ No newline at end of file diff --git a/projecttemplates/WebFormsRelyingParty/xrds.aspx b/projecttemplates/WebFormsRelyingParty/xrds.aspx new file mode 100644 index 0000000..cb36eee --- /dev/null +++ b/projecttemplates/WebFormsRelyingParty/xrds.aspx @@ -0,0 +1,20 @@ +<%@ Page Language="C#" AutoEventWireup="true" ContentType="application/xrds+xml" %><?xml version="1.0" encoding="UTF-8"?> +<%-- +This page is a required for relying party discovery per OpenID 2.0. +It allows Providers to call back to the relying party site to confirm the +identity that it is claiming in the realm and return_to URLs. +This page should be pointed to by the 'realm' home page, which is default.aspx. +--%> +<xrds:XRDS + xmlns:xrds="xri://$xrds" + xmlns:openid="http://openid.net/xmlns/1.0" + xmlns="xri://$xrd*($v*2.0)"> + <XRD> + <Service priority="1"> + <Type>http://specs.openid.net/auth/2.0/return_to</Type> + <%-- Every page with an OpenID login should be listed here. --%> + <URI priority="1"><%=new Uri(Request.Url, Response.ApplyAppPathModifier("~/LoginFrame.aspx"))%></URI> + <URI priority="2"><%=new Uri(Request.Url, Response.ApplyAppPathModifier("~/Members/AccountInfo.aspx"))%></URI> + </Service> + </XRD> +</xrds:XRDS> |
